diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/flag_mapping smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/flag_mapping
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/flag_mapping 1969-12-31 19:00:00.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/flag_mapping 1970-01-01 04:13:08.000000000 -0500
@@ -0,0 +1,237 @@
+class JpCountryFlags {
+
+$iCountryFlags = array(
+ 'Afghanistan' => 'afgh.gif',
+ 'Republic of Angola' => 'agla.gif',
+ 'Republic of Albania' => 'alba.gif',
+ 'Alderney' => 'alde.gif',
+ 'Democratic and Popular Republic of Algeria' => 'alge.gif',
+ 'Territory of American Samoa' => 'amsa.gif',
+ 'Principality of Andorra' => 'andr.gif',
+ 'British Overseas Territory of Anguilla' => 'angu.gif',
+ 'Antarctica' => 'anta.gif',
+ 'Argentine Republic' => 'arge.gif',
+ 'League of Arab States' => 'arle.gif',
+ 'Republic of Armenia' => 'arme.gif',
+ 'Aruba' => 'arub.gif',
+ 'Commonwealth of Australia' => 'astl.gif',
+ 'Republic of Austria' => 'aust.gif',
+ 'Azerbaijani Republic' => 'azer.gif',
+ 'British Antarctic Territory' => 'bant.gif',
+ 'Kingdom of Belgium' => 'belg.gif',
+ 'British Overseas Territory of Bermuda' => 'berm.gif',
+ 'Commonwealth of the Bahamas' => 'bhms.gif',
+ 'Kingdom of Bahrain' => 'bhrn.gif',
+ 'Republic of Belarus' => 'blru.gif',
+ 'Republic of Bolivia' => 'blva.gif',
+ 'Belize' => 'blze.gif',
+ 'Republic of Benin' => 'bnin.gif',
+ 'Republic of Botswana' => 'bots.gif',
+ 'Federative Republic of Brazil' => 'braz.gif',
+ 'Barbados' => 'brbd.gif',
+ 'British Indian Ocean Territory' => 'brin.gif',
+ 'Brunei Darussalam' => 'brun.gif',
+ 'Republic of Burkina' => 'bufa.gif',
+ 'Republic of Bulgaria' => 'bulg.gif',
+ 'Republic of Burundi' => 'buru.gif',
+ 'Overseas Territory of the British Virgin Islands' => 'bvis.gif',
+ 'Central African Republic' => 'cafr.gif',
+ 'Kingdom of Cambodia' => 'camb.gif',
+ 'Republic of Cameroon' => 'came.gif',
+ 'Dominion of Canada' => 'cana.gif',
+ 'Caribbean Community' => 'cari.gif',
+ 'Republic of Cape Verde' => 'cave.gif',
+ 'Republic of Chad' => 'chad.gif',
+ 'Republic of Chile' => 'chil.gif',
+ 'Territory of Christmas Island' => 'chms.gif',
+ 'Commonwealth of Independent States' => 'cins.gif',
+ 'Cook Islands' => 'ckis.gif',
+ 'Republic of Colombia' => 'clmb.gif',
+ 'Territory of Cocos Islands' => 'cois.gif',
+ 'Commonwealth' => 'comn.gif',
+ 'Union of the Comoros' => 'como.gif',
+ 'Republic of the Congo' => 'cong.gif',
+ 'Republic of Costa Rica' => 'corc.gif',
+ 'Republic of Croatia' => 'croa.gif',
+ 'Republic of Cuba' => 'cuba.gif',
+ 'British Overseas Territory of the Cayman Islands' => 'cyis.gif',
+ 'Republic of Cyprus' => 'cypr.gif',
+ 'The Czech Republic' => 'czec.gif',
+ 'Kingdom of Denmark' => 'denm.gif',
+ 'Republic of Djibouti' => 'djib.gif',
+ 'Commonwealth of Dominica' => 'domn.gif',
+ 'Dominican Republic' => 'dore.gif',
+ 'Republic of Ecuador' => 'ecua.gif',
+ 'Arab Republic of Egypt' => 'egyp.gif',
+ 'Republic of El Salvador' => 'elsa.gif',
+ 'England' => 'engl.gif',
+ 'Republic of Equatorial Guinea' => 'eqgu.gif',
+ 'State of Eritrea' => 'erit.gif',
+ 'Republic of Estonia' => 'estn.gif',
+ 'Ethiopia' => 'ethp.gif',
+ 'European Union' => 'euun.gif',
+ 'British Overseas Territory of the Falkland Islands' => 'fais.gif',
+ 'International Federation of Vexillological Associations' => 'fiav.gif',
+ 'Republic of Fiji' => 'fiji.gif',
+ 'Republic of Finland' => 'finl.gif',
+ 'Territory of French Polynesia' => 'fpol.gif',
+ 'French Republic' => 'fran.gif',
+ 'Overseas Department of French Guiana' => 'frgu.gif',
+ 'Gabonese Republic' => 'gabn.gif',
+ 'Republic of the Gambia' => 'gamb.gif',
+ 'Republic of Georgia' => 'geor.gif',
+ 'Federal Republic of Germany' => 'germ.gif',
+ 'Republic of Ghana' => 'ghan.gif',
+ 'Gibraltar' => 'gibr.gif',
+ 'Hellenic Republic' => 'grec.gif',
+ 'State of Grenada' => 'gren.gif',
+ 'Overseas Department of Guadeloupe' => 'guad.gif',
+ 'Territory of Guam' => 'guam.gif',
+ 'Republic of Guatemala' => 'guat.gif',
+ 'The Bailiwick of Guernsey' => 'guer.gif',
+ 'Republic of Guinea' => 'guin.gif',
+ 'Republic of Haiti' => 'hait.gif',
+ 'Hong Kong Special Administrative Region' => 'hokn.gif',
+ 'Republic of Honduras' => 'hond.gif',
+ 'Republic of Hungary' => 'hung.gif',
+ 'Republic of Iceland' => 'icel.gif',
+ 'International Committee of the Red Cross' => 'icrc.gif',
+ 'Republic of India' => 'inda.gif',
+ 'Republic of Indonesia' => 'indn.gif',
+ 'Republic of Iraq' => 'iraq.gif',
+ 'Republic of Ireland' => 'irel.gif',
+ 'Organization of the Islamic Conference' => 'isco.gif',
+ 'Isle of Man' => 'isma.gif',
+ 'State of Israel' => 'isra.gif',
+ 'Italian Republic' => 'ital.gif',
+ 'Jamaica' => 'jama.gif',
+ 'Japan' => 'japa.gif',
+ 'The Bailiwick of Jersey' => 'jers.gif',
+ 'Hashemite Kingdom of Jordan' => 'jord.gif',
+ 'Republic of Kazakhstan' => 'kazk.gif',
+ 'Republic of Kenya' => 'keny.gif',
+ 'Republic of Kiribati' => 'kirb.gif',
+ 'State of Kuwait' => 'kuwa.gif',
+ 'Kyrgyz Republic' => 'kyrg.gif',
+ 'Republic of Latvia' => 'latv.gif',
+ 'Lebanese Republic' => 'leba.gif',
+ 'Kingdom of Lesotho' => 'lest.gif',
+ 'Republic of Liberia' => 'libe.gif',
+ 'Principality of Liechtenstein' => 'liec.gif',
+ 'Republic of Lithuania' => 'lith.gif',
+ 'Grand Duchy of Luxembourg' => 'luxe.gif',
+ 'Macao Special Administrative Region' => 'maca.gif',
+ 'Republic of Macedonia' => 'mace.gif',
+ 'Republic of Madagascar' => 'mada.gif',
+ 'Republic of the Marshall Islands' => 'mais.gif',
+ 'Republic of Maldives' => 'mald.gif',
+ 'Republic of Mali' => 'mali.gif',
+ 'Federation of Malaysia' => 'mals018.gif',
+ 'Republic of Malta' => 'malt.gif',
+ 'Republic of Malawi' => 'malw.gif',
+ 'Overseas Department of Martinique' => 'mart.gif',
+ 'Islamic Republic of Mauritania' => 'maur.gif',
+ 'Territorial Collectivity of Mayotte' => 'mayt.gif',
+ 'United Mexican States' => 'mexc.gif',
+ 'Federated States of Micronesia' => 'micr.gif',
+ 'Midway Islands' => 'miis.gif',
+ 'Republic of Moldova' => 'mold.gif',
+ 'Principality of Monaco' => 'mona.gif',
+ 'Republic of Mongolia' => 'mong.gif',
+ 'British Overseas Territory of Montserrat' => 'mont.gif',
+ 'Kingdom of Morocco' => 'morc.gif',
+ 'Republic of Mozambique' => 'moza.gif',
+ 'Republic of Mauritius' => 'mrts.gif',
+ 'Union of Myanmar' => 'myan.gif',
+ 'Republic of Namibia' => 'namb.gif',
+ 'North Atlantic Treaty Organization' => 'nato.gif',
+ 'Republic of Nauru' => 'naur.gif',
+ 'Turkish Republic of Northern Cyprus' => 'ncyp.gif',
+ 'Netherlands Antilles' => 'nean.gif',
+ 'Kingdom of Nepal' => 'nepa.gif',
+ 'Kingdom of the Netherlands' => 'neth.gif',
+ 'Territory of Norfolk Island' => 'nfis.gif',
+ 'Federal Republic of Nigeria' => 'ngra.gif',
+ 'Republic of Nicaragua' => 'nica.gif',
+ 'Republic of Niger' => 'nigr.gif',
+ 'Niue' => 'niue.gif',
+ 'Commonwealth of the Northern Mariana Islands' => 'nmar.gif',
+ 'Province of Northern Ireland' => 'noir.gif',
+ 'Nordic Council' => 'nord.gif',
+ 'Kingdom of Norway' => 'norw.gif',
+ 'Territory of New Caledonia and Dependencies' => 'nwca.gif',
+ 'New Zealand' => 'nwze.gif',
+ 'Organization of American States' => 'oast.gif',
+ 'Organization of African Unity' => 'oaun.gif',
+ 'International Olympic Committee' => 'olym.gif',
+ 'Sultanate of Oman' => 'oman.gif',
+ 'Organization of Petroleum Exporting Countries' => 'opec.gif',
+ 'Islamic Republic of Pakistan' => 'paks.gif',
+ 'Republic of Palau' => 'pala.gif',
+ 'Independent State of Papua New Guinea' => 'pang.gif',
+ 'Republic of Paraguay' => 'para.gif',
+ 'Republic of the Philippines' => 'phil.gif',
+ 'British Overseas Territory of the Pitcairn Islands' => 'piis.gif',
+ 'Republic of Poland' => 'pola.gif',
+ 'Republic of Portugal' => 'port.gif',
+ 'Commonwealth of Puerto Rico' => 'purc.gif',
+ 'State of Qatar' => 'qata.gif',
+ 'Russian Federation' => 'russ.gif',
+ 'Republic of Rwanda' => 'rwan.gif',
+ 'Kingdom of Saudi Arabia' => 'saar.gif',
+ 'Republic of San Marino' => 'sama.gif',
+ 'Nordic Sami Conference' => 'sami.gif',
+ 'Sark' => 'sark.gif',
+ 'Scotland' => 'scot.gif',
+ 'Principality of Seborga' => 'sebo.gif',
+ 'Republic of Sierra Leone' => 'sile.gif',
+ 'Republic of Singapore' => 'sing.gif',
+ 'Republic of Korea' => 'skor.gif',
+ 'Republic of Slovenia' => 'slva.gif',
+ 'Somali Republic' => 'smla.gif',
+ 'Republic of Somaliland' => 'smld.gif',
+ 'Republic of South Africa' => 'soaf.gif',
+ 'Solomon Islands' => 'sois.gif',
+ 'Kingdom of Spain' => 'span.gif',
+ 'Secretariat of the Pacific Community' => 'spco.gif',
+ 'Democratic Socialist Republic of Sri Lanka' => 'srla.gif',
+ 'Saint Lucia' => 'stlu.gif',
+ 'Republic of the Sudan' => 'suda.gif',
+ 'Republic of Suriname' => 'surn.gif',
+ 'Slovak Republic' => 'svka.gif',
+ 'Kingdom of Sweden' => 'swdn.gif',
+ 'Swiss Confederation' => 'swit.gif',
+ 'Syrian Arab Republic' => 'syra.gif',
+ 'Kingdom of Swaziland' => 'szld.gif',
+ 'Republic of China' => 'taiw.gif',
+ 'Republic of Tajikistan' => 'tajk.gif',
+ 'United Republic of Tanzania' => 'tanz.gif',
+ 'Kingdom of Thailand' => 'thal.gif',
+ 'Autonomous Region of Tibet' => 'tibe.gif',
+ 'Turkmenistan' => 'tkst.gif',
+ 'Togolese Republic' => 'togo.gif',
+ 'Tokelau' => 'toke.gif',
+ 'Kingdom of Tonga' => 'tong.gif',
+ 'Tristan da Cunha' => 'trdc.gif',
+ 'Tromelin' => 'tris.gif',
+ 'Republic of Tunisia' => 'tuns.gif',
+ 'Republic of Turkey' => 'turk.gif',
+ 'Tuvalu' => 'tuva.gif',
+ 'United Arab Emirates' => 'uaem.gif',
+ 'Republic of Uganda' => 'ugan.gif',
+ 'Ukraine' => 'ukrn.gif',
+ 'United Kingdom of Great Britain' => 'unkg.gif',
+ 'United Nations' => 'unna.gif',
+ 'United States of America' => 'unst.gif',
+ 'Oriental Republic of Uruguay' => 'urgy.gif',
+ 'Virgin Islands of the United States' => 'usvs.gif',
+ 'Republic of Uzbekistan' => 'uzbk.gif',
+ 'State of the Vatican City' => 'vacy.gif',
+ 'Republic of Vanuatu' => 'vant.gif',
+ 'Bolivarian Republic of Venezuela' => 'venz.gif',
+ 'Republic of Yemen' => 'yemn.gif',
+ 'Democratic Republic of Congo' => 'zare.gif',
+ 'Republic of Zimbabwe' => 'zbwe.gif'
+) ;
+
+
Les fichiers binaires smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/flags.dat et smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/flags.dat sont différents.
Les fichiers binaires smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/flags_thumb100x100.dat et smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/flags_thumb100x100.dat sont différents.
Les fichiers binaires smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/flags_thumb35x35.dat et smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/flags_thumb35x35.dat sont différents.
Les fichiers binaires smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/flags_thumb60x60.dat et smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/flags_thumb60x60.dat sont différents.
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/gd_image.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/gd_image.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/gd_image.inc.php 2008-06-13 19:20:44.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/gd_image.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,2005 +1,1650 @@
img = &$aImg;
-
- // Conversion array between color names and RGB
- $this->rgb_table = array(
- "aqua"=> array(0,255,255),
- "lime"=> array(0,255,0),
- "teal"=> array(0,128,128),
- "whitesmoke"=>array(245,245,245),
- "gainsboro"=>array(220,220,220),
- "oldlace"=>array(253,245,230),
- "linen"=>array(250,240,230),
- "antiquewhite"=>array(250,235,215),
- "papayawhip"=>array(255,239,213),
- "blanchedalmond"=>array(255,235,205),
- "bisque"=>array(255,228,196),
- "peachpuff"=>array(255,218,185),
- "navajowhite"=>array(255,222,173),
- "moccasin"=>array(255,228,181),
- "cornsilk"=>array(255,248,220),
- "ivory"=>array(255,255,240),
- "lemonchiffon"=>array(255,250,205),
- "seashell"=>array(255,245,238),
- "mintcream"=>array(245,255,250),
- "azure"=>array(240,255,255),
- "aliceblue"=>array(240,248,255),
- "lavender"=>array(230,230,250),
- "lavenderblush"=>array(255,240,245),
- "mistyrose"=>array(255,228,225),
- "white"=>array(255,255,255),
- "black"=>array(0,0,0),
- "darkslategray"=>array(47,79,79),
- "dimgray"=>array(105,105,105),
- "slategray"=>array(112,128,144),
- "lightslategray"=>array(119,136,153),
- "gray"=>array(190,190,190),
- "lightgray"=>array(211,211,211),
- "midnightblue"=>array(25,25,112),
- "navy"=>array(0,0,128),
- "cornflowerblue"=>array(100,149,237),
- "darkslateblue"=>array(72,61,139),
- "slateblue"=>array(106,90,205),
- "mediumslateblue"=>array(123,104,238),
- "lightslateblue"=>array(132,112,255),
- "mediumblue"=>array(0,0,205),
- "royalblue"=>array(65,105,225),
- "blue"=>array(0,0,255),
- "dodgerblue"=>array(30,144,255),
- "deepskyblue"=>array(0,191,255),
- "skyblue"=>array(135,206,235),
- "lightskyblue"=>array(135,206,250),
- "steelblue"=>array(70,130,180),
- "lightred"=>array(211,167,168),
- "lightsteelblue"=>array(176,196,222),
- "lightblue"=>array(173,216,230),
- "powderblue"=>array(176,224,230),
- "paleturquoise"=>array(175,238,238),
- "darkturquoise"=>array(0,206,209),
- "mediumturquoise"=>array(72,209,204),
- "turquoise"=>array(64,224,208),
- "cyan"=>array(0,255,255),
- "lightcyan"=>array(224,255,255),
- "cadetblue"=>array(95,158,160),
- "mediumaquamarine"=>array(102,205,170),
- "aquamarine"=>array(127,255,212),
- "darkgreen"=>array(0,100,0),
- "darkolivegreen"=>array(85,107,47),
- "darkseagreen"=>array(143,188,143),
- "seagreen"=>array(46,139,87),
- "mediumseagreen"=>array(60,179,113),
- "lightseagreen"=>array(32,178,170),
- "palegreen"=>array(152,251,152),
- "springgreen"=>array(0,255,127),
- "lawngreen"=>array(124,252,0),
- "green"=>array(0,255,0),
- "chartreuse"=>array(127,255,0),
- "mediumspringgreen"=>array(0,250,154),
- "greenyellow"=>array(173,255,47),
- "limegreen"=>array(50,205,50),
- "yellowgreen"=>array(154,205,50),
- "forestgreen"=>array(34,139,34),
- "olivedrab"=>array(107,142,35),
- "darkkhaki"=>array(189,183,107),
- "khaki"=>array(240,230,140),
- "palegoldenrod"=>array(238,232,170),
- "lightgoldenrodyellow"=>array(250,250,210),
- "lightyellow"=>array(255,255,200),
- "yellow"=>array(255,255,0),
- "gold"=>array(255,215,0),
- "lightgoldenrod"=>array(238,221,130),
- "goldenrod"=>array(218,165,32),
- "darkgoldenrod"=>array(184,134,11),
- "rosybrown"=>array(188,143,143),
- "indianred"=>array(205,92,92),
- "saddlebrown"=>array(139,69,19),
- "sienna"=>array(160,82,45),
- "peru"=>array(205,133,63),
- "burlywood"=>array(222,184,135),
- "beige"=>array(245,245,220),
- "wheat"=>array(245,222,179),
- "sandybrown"=>array(244,164,96),
- "tan"=>array(210,180,140),
- "chocolate"=>array(210,105,30),
- "firebrick"=>array(178,34,34),
- "brown"=>array(165,42,42),
- "darksalmon"=>array(233,150,122),
- "salmon"=>array(250,128,114),
- "lightsalmon"=>array(255,160,122),
- "orange"=>array(255,165,0),
- "darkorange"=>array(255,140,0),
- "coral"=>array(255,127,80),
- "lightcoral"=>array(240,128,128),
- "tomato"=>array(255,99,71),
- "orangered"=>array(255,69,0),
- "red"=>array(255,0,0),
- "hotpink"=>array(255,105,180),
- "deeppink"=>array(255,20,147),
- "pink"=>array(255,192,203),
- "lightpink"=>array(255,182,193),
- "palevioletred"=>array(219,112,147),
- "maroon"=>array(176,48,96),
- "mediumvioletred"=>array(199,21,133),
- "violetred"=>array(208,32,144),
- "magenta"=>array(255,0,255),
- "violet"=>array(238,130,238),
- "plum"=>array(221,160,221),
- "orchid"=>array(218,112,214),
- "mediumorchid"=>array(186,85,211),
- "darkorchid"=>array(153,50,204),
- "darkviolet"=>array(148,0,211),
- "blueviolet"=>array(138,43,226),
- "purple"=>array(160,32,240),
- "mediumpurple"=>array(147,112,219),
- "thistle"=>array(216,191,216),
- "snow1"=>array(255,250,250),
- "snow2"=>array(238,233,233),
- "snow3"=>array(205,201,201),
- "snow4"=>array(139,137,137),
- "seashell1"=>array(255,245,238),
- "seashell2"=>array(238,229,222),
- "seashell3"=>array(205,197,191),
- "seashell4"=>array(139,134,130),
- "AntiqueWhite1"=>array(255,239,219),
- "AntiqueWhite2"=>array(238,223,204),
- "AntiqueWhite3"=>array(205,192,176),
- "AntiqueWhite4"=>array(139,131,120),
- "bisque1"=>array(255,228,196),
- "bisque2"=>array(238,213,183),
- "bisque3"=>array(205,183,158),
- "bisque4"=>array(139,125,107),
- "peachPuff1"=>array(255,218,185),
- "peachpuff2"=>array(238,203,173),
- "peachpuff3"=>array(205,175,149),
- "peachpuff4"=>array(139,119,101),
- "navajowhite1"=>array(255,222,173),
- "navajowhite2"=>array(238,207,161),
- "navajowhite3"=>array(205,179,139),
- "navajowhite4"=>array(139,121,94),
- "lemonchiffon1"=>array(255,250,205),
- "lemonchiffon2"=>array(238,233,191),
- "lemonchiffon3"=>array(205,201,165),
- "lemonchiffon4"=>array(139,137,112),
- "ivory1"=>array(255,255,240),
- "ivory2"=>array(238,238,224),
- "ivory3"=>array(205,205,193),
- "ivory4"=>array(139,139,131),
- "honeydew"=>array(193,205,193),
- "lavenderblush1"=>array(255,240,245),
- "lavenderblush2"=>array(238,224,229),
- "lavenderblush3"=>array(205,193,197),
- "lavenderblush4"=>array(139,131,134),
- "mistyrose1"=>array(255,228,225),
- "mistyrose2"=>array(238,213,210),
- "mistyrose3"=>array(205,183,181),
- "mistyrose4"=>array(139,125,123),
- "azure1"=>array(240,255,255),
- "azure2"=>array(224,238,238),
- "azure3"=>array(193,205,205),
- "azure4"=>array(131,139,139),
- "slateblue1"=>array(131,111,255),
- "slateblue2"=>array(122,103,238),
- "slateblue3"=>array(105,89,205),
- "slateblue4"=>array(71,60,139),
- "royalblue1"=>array(72,118,255),
- "royalblue2"=>array(67,110,238),
- "royalblue3"=>array(58,95,205),
- "royalblue4"=>array(39,64,139),
- "dodgerblue1"=>array(30,144,255),
- "dodgerblue2"=>array(28,134,238),
- "dodgerblue3"=>array(24,116,205),
- "dodgerblue4"=>array(16,78,139),
- "steelblue1"=>array(99,184,255),
- "steelblue2"=>array(92,172,238),
- "steelblue3"=>array(79,148,205),
- "steelblue4"=>array(54,100,139),
- "deepskyblue1"=>array(0,191,255),
- "deepskyblue2"=>array(0,178,238),
- "deepskyblue3"=>array(0,154,205),
- "deepskyblue4"=>array(0,104,139),
- "skyblue1"=>array(135,206,255),
- "skyblue2"=>array(126,192,238),
- "skyblue3"=>array(108,166,205),
- "skyblue4"=>array(74,112,139),
- "lightskyblue1"=>array(176,226,255),
- "lightskyblue2"=>array(164,211,238),
- "lightskyblue3"=>array(141,182,205),
- "lightskyblue4"=>array(96,123,139),
- "slategray1"=>array(198,226,255),
- "slategray2"=>array(185,211,238),
- "slategray3"=>array(159,182,205),
- "slategray4"=>array(108,123,139),
- "lightsteelblue1"=>array(202,225,255),
- "lightsteelblue2"=>array(188,210,238),
- "lightsteelblue3"=>array(162,181,205),
- "lightsteelblue4"=>array(110,123,139),
- "lightblue1"=>array(191,239,255),
- "lightblue2"=>array(178,223,238),
- "lightblue3"=>array(154,192,205),
- "lightblue4"=>array(104,131,139),
- "lightcyan1"=>array(224,255,255),
- "lightcyan2"=>array(209,238,238),
- "lightcyan3"=>array(180,205,205),
- "lightcyan4"=>array(122,139,139),
- "paleturquoise1"=>array(187,255,255),
- "paleturquoise2"=>array(174,238,238),
- "paleturquoise3"=>array(150,205,205),
- "paleturquoise4"=>array(102,139,139),
- "cadetblue1"=>array(152,245,255),
- "cadetblue2"=>array(142,229,238),
- "cadetblue3"=>array(122,197,205),
- "cadetblue4"=>array(83,134,139),
- "turquoise1"=>array(0,245,255),
- "turquoise2"=>array(0,229,238),
- "turquoise3"=>array(0,197,205),
- "turquoise4"=>array(0,134,139),
- "cyan1"=>array(0,255,255),
- "cyan2"=>array(0,238,238),
- "cyan3"=>array(0,205,205),
- "cyan4"=>array(0,139,139),
- "darkslategray1"=>array(151,255,255),
- "darkslategray2"=>array(141,238,238),
- "darkslategray3"=>array(121,205,205),
- "darkslategray4"=>array(82,139,139),
- "aquamarine1"=>array(127,255,212),
- "aquamarine2"=>array(118,238,198),
- "aquamarine3"=>array(102,205,170),
- "aquamarine4"=>array(69,139,116),
- "darkseagreen1"=>array(193,255,193),
- "darkseagreen2"=>array(180,238,180),
- "darkseagreen3"=>array(155,205,155),
- "darkseagreen4"=>array(105,139,105),
- "seagreen1"=>array(84,255,159),
- "seagreen2"=>array(78,238,148),
- "seagreen3"=>array(67,205,128),
- "seagreen4"=>array(46,139,87),
- "palegreen1"=>array(154,255,154),
- "palegreen2"=>array(144,238,144),
- "palegreen3"=>array(124,205,124),
- "palegreen4"=>array(84,139,84),
- "springgreen1"=>array(0,255,127),
- "springgreen2"=>array(0,238,118),
- "springgreen3"=>array(0,205,102),
- "springgreen4"=>array(0,139,69),
- "chartreuse1"=>array(127,255,0),
- "chartreuse2"=>array(118,238,0),
- "chartreuse3"=>array(102,205,0),
- "chartreuse4"=>array(69,139,0),
- "olivedrab1"=>array(192,255,62),
- "olivedrab2"=>array(179,238,58),
- "olivedrab3"=>array(154,205,50),
- "olivedrab4"=>array(105,139,34),
- "darkolivegreen1"=>array(202,255,112),
- "darkolivegreen2"=>array(188,238,104),
- "darkolivegreen3"=>array(162,205,90),
- "darkolivegreen4"=>array(110,139,61),
- "khaki1"=>array(255,246,143),
- "khaki2"=>array(238,230,133),
- "khaki3"=>array(205,198,115),
- "khaki4"=>array(139,134,78),
- "lightgoldenrod1"=>array(255,236,139),
- "lightgoldenrod2"=>array(238,220,130),
- "lightgoldenrod3"=>array(205,190,112),
- "lightgoldenrod4"=>array(139,129,76),
- "yellow1"=>array(255,255,0),
- "yellow2"=>array(238,238,0),
- "yellow3"=>array(205,205,0),
- "yellow4"=>array(139,139,0),
- "gold1"=>array(255,215,0),
- "gold2"=>array(238,201,0),
- "gold3"=>array(205,173,0),
- "gold4"=>array(139,117,0),
- "goldenrod1"=>array(255,193,37),
- "goldenrod2"=>array(238,180,34),
- "goldenrod3"=>array(205,155,29),
- "goldenrod4"=>array(139,105,20),
- "darkgoldenrod1"=>array(255,185,15),
- "darkgoldenrod2"=>array(238,173,14),
- "darkgoldenrod3"=>array(205,149,12),
- "darkgoldenrod4"=>array(139,101,8),
- "rosybrown1"=>array(255,193,193),
- "rosybrown2"=>array(238,180,180),
- "rosybrown3"=>array(205,155,155),
- "rosybrown4"=>array(139,105,105),
- "indianred1"=>array(255,106,106),
- "indianred2"=>array(238,99,99),
- "indianred3"=>array(205,85,85),
- "indianred4"=>array(139,58,58),
- "sienna1"=>array(255,130,71),
- "sienna2"=>array(238,121,66),
- "sienna3"=>array(205,104,57),
- "sienna4"=>array(139,71,38),
- "burlywood1"=>array(255,211,155),
- "burlywood2"=>array(238,197,145),
- "burlywood3"=>array(205,170,125),
- "burlywood4"=>array(139,115,85),
- "wheat1"=>array(255,231,186),
- "wheat2"=>array(238,216,174),
- "wheat3"=>array(205,186,150),
- "wheat4"=>array(139,126,102),
- "tan1"=>array(255,165,79),
- "tan2"=>array(238,154,73),
- "tan3"=>array(205,133,63),
- "tan4"=>array(139,90,43),
- "chocolate1"=>array(255,127,36),
- "chocolate2"=>array(238,118,33),
- "chocolate3"=>array(205,102,29),
- "chocolate4"=>array(139,69,19),
- "firebrick1"=>array(255,48,48),
- "firebrick2"=>array(238,44,44),
- "firebrick3"=>array(205,38,38),
- "firebrick4"=>array(139,26,26),
- "brown1"=>array(255,64,64),
- "brown2"=>array(238,59,59),
- "brown3"=>array(205,51,51),
- "brown4"=>array(139,35,35),
- "salmon1"=>array(255,140,105),
- "salmon2"=>array(238,130,98),
- "salmon3"=>array(205,112,84),
- "salmon4"=>array(139,76,57),
- "lightsalmon1"=>array(255,160,122),
- "lightsalmon2"=>array(238,149,114),
- "lightsalmon3"=>array(205,129,98),
- "lightsalmon4"=>array(139,87,66),
- "orange1"=>array(255,165,0),
- "orange2"=>array(238,154,0),
- "orange3"=>array(205,133,0),
- "orange4"=>array(139,90,0),
- "darkorange1"=>array(255,127,0),
- "darkorange2"=>array(238,118,0),
- "darkorange3"=>array(205,102,0),
- "darkorange4"=>array(139,69,0),
- "coral1"=>array(255,114,86),
- "coral2"=>array(238,106,80),
- "coral3"=>array(205,91,69),
- "coral4"=>array(139,62,47),
- "tomato1"=>array(255,99,71),
- "tomato2"=>array(238,92,66),
- "tomato3"=>array(205,79,57),
- "tomato4"=>array(139,54,38),
- "orangered1"=>array(255,69,0),
- "orangered2"=>array(238,64,0),
- "orangered3"=>array(205,55,0),
- "orangered4"=>array(139,37,0),
- "deeppink1"=>array(255,20,147),
- "deeppink2"=>array(238,18,137),
- "deeppink3"=>array(205,16,118),
- "deeppink4"=>array(139,10,80),
- "hotpink1"=>array(255,110,180),
- "hotpink2"=>array(238,106,167),
- "hotpink3"=>array(205,96,144),
- "hotpink4"=>array(139,58,98),
- "pink1"=>array(255,181,197),
- "pink2"=>array(238,169,184),
- "pink3"=>array(205,145,158),
- "pink4"=>array(139,99,108),
- "lightpink1"=>array(255,174,185),
- "lightpink2"=>array(238,162,173),
- "lightpink3"=>array(205,140,149),
- "lightpink4"=>array(139,95,101),
- "palevioletred1"=>array(255,130,171),
- "palevioletred2"=>array(238,121,159),
- "palevioletred3"=>array(205,104,137),
- "palevioletred4"=>array(139,71,93),
- "maroon1"=>array(255,52,179),
- "maroon2"=>array(238,48,167),
- "maroon3"=>array(205,41,144),
- "maroon4"=>array(139,28,98),
- "violetred1"=>array(255,62,150),
- "violetred2"=>array(238,58,140),
- "violetred3"=>array(205,50,120),
- "violetred4"=>array(139,34,82),
- "magenta1"=>array(255,0,255),
- "magenta2"=>array(238,0,238),
- "magenta3"=>array(205,0,205),
- "magenta4"=>array(139,0,139),
- "mediumred"=>array(140,34,34),
- "orchid1"=>array(255,131,250),
- "orchid2"=>array(238,122,233),
- "orchid3"=>array(205,105,201),
- "orchid4"=>array(139,71,137),
- "plum1"=>array(255,187,255),
- "plum2"=>array(238,174,238),
- "plum3"=>array(205,150,205),
- "plum4"=>array(139,102,139),
- "mediumorchid1"=>array(224,102,255),
- "mediumorchid2"=>array(209,95,238),
- "mediumorchid3"=>array(180,82,205),
- "mediumorchid4"=>array(122,55,139),
- "darkorchid1"=>array(191,62,255),
- "darkorchid2"=>array(178,58,238),
- "darkorchid3"=>array(154,50,205),
- "darkorchid4"=>array(104,34,139),
- "purple1"=>array(155,48,255),
- "purple2"=>array(145,44,238),
- "purple3"=>array(125,38,205),
- "purple4"=>array(85,26,139),
- "mediumpurple1"=>array(171,130,255),
- "mediumpurple2"=>array(159,121,238),
- "mediumpurple3"=>array(137,104,205),
- "mediumpurple4"=>array(93,71,139),
- "thistle1"=>array(255,225,255),
- "thistle2"=>array(238,210,238),
- "thistle3"=>array(205,181,205),
- "thistle4"=>array(139,123,139),
- "gray1"=>array(10,10,10),
- "gray2"=>array(40,40,30),
- "gray3"=>array(70,70,70),
- "gray4"=>array(100,100,100),
- "gray5"=>array(130,130,130),
- "gray6"=>array(160,160,160),
- "gray7"=>array(190,190,190),
- "gray8"=>array(210,210,210),
- "gray9"=>array(240,240,240),
- "darkgray"=>array(100,100,100),
- "darkblue"=>array(0,0,139),
- "darkcyan"=>array(0,139,139),
- "darkmagenta"=>array(139,0,139),
- "darkred"=>array(139,0,0),
- "silver"=>array(192, 192, 192),
- "eggplant"=>array(144,176,168),
- "lightgreen"=>array(144,238,144));
- }
-//----------------
-// PUBLIC METHODS
- // Colors can be specified as either
- // 1. #xxxxxx HTML style
- // 2. "colorname" as a named color
- // 3. array(r,g,b) RGB triple
- // This function translates this to a native RGB format and returns an
- // RGB triple.
- function Color($aColor) {
- if (is_string($aColor)) {
- // Strip of any alpha factor
- $pos = strpos($aColor,'@');
- if( $pos === false ) {
- $alpha = 0;
- }
- else {
- $pos2 = strpos($aColor,':');
- if( $pos2===false )
- $pos2 = $pos-1; // Sentinel
- if( $pos > $pos2 ) {
- $alpha = str_replace(',','.',substr($aColor,$pos+1));
- $aColor = substr($aColor,0,$pos);
- }
- else {
- $alpha = substr($aColor,$pos+1,$pos2-$pos-1);
- $aColor = substr($aColor,0,$pos).substr($aColor,$pos2);
- }
- }
-
- // Extract potential adjustment figure at end of color
- // specification
- $pos = strpos($aColor,":");
- if( $pos === false ) {
- $adj = 1.0;
- }
- else {
- $adj = 0.0 + str_replace(',','.',substr($aColor,$pos+1));
- $aColor = substr($aColor,0,$pos);
- }
- if( $adj < 0 )
- JpGraphError::RaiseL(25077);//('Adjustment factor for color must be > 0');
-
- if (substr($aColor, 0, 1) == "#") {
- $r = hexdec(substr($aColor, 1, 2));
- $g = hexdec(substr($aColor, 3, 2));
- $b = hexdec(substr($aColor, 5, 2));
- } else {
- if(!isset($this->rgb_table[$aColor]) )
- JpGraphError::RaiseL(25078,$aColor);//(" Unknown color: $aColor");
- $tmp=$this->rgb_table[$aColor];
- $r = $tmp[0];
- $g = $tmp[1];
- $b = $tmp[2];
- }
- // Scale adj so that an adj=2 always
- // makes the color 100% white (i.e. 255,255,255.
- // and adj=1 neutral and adj=0 black.
- if( $adj > 1 ) {
- $m = ($adj-1.0)*(255-min(255,min($r,min($g,$b))));
- return array(min(255,$r+$m), min(255,$g+$m), min(255,$b+$m),$alpha);
- }
- elseif( $adj < 1 ) {
- $m = ($adj-1.0)*max(255,max($r,max($g,$b)));
- return array(max(0,$r+$m), max(0,$g+$m), max(0,$b+$m),$alpha);
- }
- else {
- return array($r,$g,$b,$alpha);
- }
-
- } elseif( is_array($aColor) ) {
- if( count($aColor)==3 ) {
- $aColor[3]=0;
- return $aColor;
- }
- else
- return $aColor;
- }
- else
- JpGraphError::RaiseL(25079,$aColor,count($aColor));//(" Unknown color specification: $aColor , size=".count($aColor));
- }
-
- // Compare two colors
- // return true if equal
- function Equal($aCol1,$aCol2) {
- $c1 = $this->Color($aCol1);
- $c2 = $this->Color($aCol2);
- if( $c1[0]==$c2[0] && $c1[1]==$c2[1] && $c1[2]==$c2[2] )
- return true;
- else
- return false;
- }
-
- // Allocate a new color in the current image
- // Return new color index, -1 if no more colors could be allocated
- function Allocate($aColor,$aAlpha=0.0) {
- list ($r, $g, $b, $a) = $this->color($aColor);
- // If alpha is specified in the color string then this
- // takes precedence over the second argument
- if( $a > 0 )
- $aAlpha = $a;
- if( $aAlpha < 0 || $aAlpha > 1 ) {
- JpGraphError::RaiseL(25080);//('Alpha parameter for color must be between 0.0 and 1.0');
- }
- return imagecolorresolvealpha($this->img, $r, $g, $b, round($aAlpha * 127));
- }
-} // Class
+require_once 'jpgraph_rgb.inc.php';
+require_once 'jpgraph_ttf.inc.php';
-
-//===================================================
+// Line styles
+define('LINESTYLE_SOLID',1);
+define('LINESTYLE_DOTTED',2);
+define('LINESTYLE_DASHED',3);
+define('LINESTYLE_LONGDASH',4);
+
+// The DEFAULT_GFORMAT sets the default graphic encoding format, i.e.
+// PNG, JPG or GIF depending on what is installed on the target system
+// in that order.
+if( !DEFINED("DEFAULT_GFORMAT") ) {
+ define("DEFAULT_GFORMAT","auto");
+}
+
+//========================================================================
// CLASS Image
-// Description: Wrapper class with some goodies to form the
-// Interface to low level image drawing routines.
-//===================================================
+// Description: The very coor image drawing class that encapsulates all
+// calls to the GD library
+// Note: The class used by the library is the decendant
+// class RotImage which extends the Image class with transparent
+// rotation.
+//=========================================================================
class Image {
- var $img_format;
- var $expired=true;
- var $img=null;
- var $left_margin=30,$right_margin=20,$top_margin=20,$bottom_margin=30;
- var $plotwidth=0,$plotheight=0;
- var $rgb=null;
- var $current_color,$current_color_name;
- var $lastx=0, $lasty=0;
- var $width=0, $height=0;
- var $line_weight=1;
- var $line_style=1; // Default line style is solid
- var $obs_list=array();
- var $font_size=12,$font_family=FF_FONT1, $font_style=FS_NORMAL;
- var $font_file='';
- var $text_halign="left",$text_valign="bottom";
- var $ttf=null;
- var $use_anti_aliasing=false;
- var $quality=null;
- var $colorstack=array(),$colorstackidx=0;
- var $canvascolor = 'white' ;
- var $langconv = null ;
+ public $left_margin=30,$right_margin=30,$top_margin=20,$bottom_margin=30;
+ public $img=null;
+ public $plotwidth=0,$plotheight=0;
+ public $width=0, $height=0;
+ public $rgb=null;
+ public $current_color,$current_color_name;
+ public $line_weight=1, $line_style=LINESTYLE_SOLID;
+ public $img_format;
+ public $ttf=null;
+ protected $expired=true;
+ protected $lastx=0, $lasty=0;
+ protected $obs_list=array();
+ protected $font_size=12,$font_family=FF_FONT1, $font_style=FS_NORMAL;
+ protected $font_file='';
+ protected $text_halign="left",$text_valign="bottom";
+ protected $use_anti_aliasing=false;
+ protected $quality=null;
+ protected $colorstack=array(),$colorstackidx=0;
+ protected $canvascolor = 'white' ;
+ protected $langconv = null ;
+ protected $iInterlace=false;
+ protected $bbox_cache = array(); // STore the last found tetx bounding box
//---------------
// CONSTRUCTOR
- function Image($aWidth,$aHeight,$aFormat=DEFAULT_GFORMAT,$aSetAutoMargin=true) {
- $this->CreateImgCanvas($aWidth,$aHeight);
- if( $aSetAutoMargin )
- $this->SetAutoMargin();
-
- if( !$this->SetImgFormat($aFormat) ) {
- JpGraphError::RaiseL(25081,$aFormat);//("JpGraph: Selected graphic format is either not supported or unknown [$aFormat]");
- }
- $this->ttf = new TTF();
- $this->langconv = new LanguageConv();
+ function __construct($aWidth=0,$aHeight=0,$aFormat=DEFAULT_GFORMAT,$aSetAutoMargin=true) {
+ $this->CreateImgCanvas($aWidth,$aHeight);
+
+ if( $aSetAutoMargin ) {
+ $this->SetAutoMargin();
+ }
+
+ if( !$this->SetImgFormat($aFormat) ) {
+ JpGraphError::RaiseL(25081,$aFormat);//("JpGraph: Selected graphic format is either not supported or unknown [$aFormat]");
+ }
+ $this->ttf = new TTF();
+ $this->langconv = new LanguageConv();
+ }
+
+ // Enable interlacing in images
+ function SetInterlace($aFlg=true) {
+ $this->iInterlace=$aFlg;
}
// Should we use anti-aliasing. Note: This really slows down graphics!
- function SetAntiAliasing() {
- $this->use_anti_aliasing=true;
+ function SetAntiAliasing($aFlg=true) {
+ $this->use_anti_aliasing = $aFlg;
+ if( function_exists('imageantialias') ) {
+ imageantialias($this->img,$aFlg);
+ }
+ else {
+ JpGraphError::RaiseL(25128);//('The function imageantialias() is not available in your PHP installation. Use the GD version that comes with PHP and not the standalone version.')
+ }
+ }
+
+ function GetAntiAliasing() {
+ return $this->use_anti_aliasing ;
}
function CreateRawCanvas($aWidth=0,$aHeight=0) {
- if( $aWidth <= 1 || $aHeight <= 1 ) {
- JpGraphError::RaiseL(25082,$aWidth,$aHeight);//("Illegal sizes specified for width or height when creating an image, (width=$aWidth, height=$aHeight)");
- }
- $this->img = @imagecreatetruecolor($aWidth, $aHeight);
- if( $this->img < 1 ) {
- JpGraphError::RaiseL(25126);
- //die("Can't create truecolor image. Check that you really have GD2 library installed.");
- }
- $this->SetAlphaBlending();
- if( $this->rgb != null )
- $this->rgb->img = $this->img ;
- else
- $this->rgb = new RGB($this->img);
+ if( $aWidth <= 1 || $aHeight <= 1 ) {
+ JpGraphError::RaiseL(25082,$aWidth,$aHeight);//("Illegal sizes specified for width or height when creating an image, (width=$aWidth, height=$aHeight)");
+ }
+
+ $this->img = @imagecreatetruecolor($aWidth, $aHeight);
+ if( $this->img < 1 ) {
+ JpGraphError::RaiseL(25126);
+ //die("Can't create truecolor image. Check that you really have GD2 library installed.");
+ }
+ $this->SetAlphaBlending();
+
+ if( $this->iInterlace ) {
+ imageinterlace($this->img,1);
+ }
+ if( $this->rgb != null ) {
+ $this->rgb->img = $this->img ;
+ }
+ else {
+ $this->rgb = new RGB($this->img);
+ }
}
function CloneCanvasH() {
- $oldimage = $this->img;
- $this->CreateRawCanvas($this->width,$this->height);
- imagecopy($this->img,$oldimage,0,0,0,0,$this->width,$this->height);
- return $oldimage;
+ $oldimage = $this->img;
+ $this->CreateRawCanvas($this->width,$this->height);
+ imagecopy($this->img,$oldimage,0,0,0,0,$this->width,$this->height);
+ return $oldimage;
}
-
+
function CreateImgCanvas($aWidth=0,$aHeight=0) {
- $old = array($this->img,$this->width,$this->height);
-
- $aWidth = round($aWidth);
- $aHeight = round($aHeight);
-
- $this->width=$aWidth;
- $this->height=$aHeight;
-
-
- if( $aWidth==0 || $aHeight==0 ) {
- // We will set the final size later.
- // Note: The size must be specified before any other
- // img routines that stroke anything are called.
- $this->img = null;
- $this->rgb = null;
- return $old;
- }
-
- $this->CreateRawCanvas($aWidth,$aHeight);
-
- // Set canvas color (will also be the background color for a
- // a pallett image
- $this->SetColor($this->canvascolor);
- $this->FilledRectangle(0,0,$aWidth,$aHeight);
+ $old = array($this->img,$this->width,$this->height);
+
+ $aWidth = round($aWidth);
+ $aHeight = round($aHeight);
+
+ $this->width=$aWidth;
+ $this->height=$aHeight;
+
- return $old ;
+ if( $aWidth==0 || $aHeight==0 ) {
+ // We will set the final size later.
+ // Note: The size must be specified before any other
+ // img routines that stroke anything are called.
+ $this->img = null;
+ $this->rgb = null;
+ return $old;
+ }
+
+ $this->CreateRawCanvas($aWidth,$aHeight);
+ // Set canvas color (will also be the background color for a
+ // a pallett image
+ $this->SetColor($this->canvascolor);
+ $this->FilledRectangle(0,0,$aWidth-1,$aHeight-1);
+
+ return $old ;
}
function CopyCanvasH($aToHdl,$aFromHdl,$aToX,$aToY,$aFromX,$aFromY,$aWidth,$aHeight,$aw=-1,$ah=-1) {
- if( $aw === -1 ) {
- $aw = $aWidth;
- $ah = $aHeight;
- $f = 'imagecopyresized';
- }
- else {
- $f = 'imagecopyresampled' ;
- }
- $f($aToHdl,$aFromHdl,
- $aToX,$aToY,$aFromX,$aFromY, $aWidth,$aHeight,$aw,$ah);
+ if( $aw === -1 ) {
+ $aw = $aWidth;
+ $ah = $aHeight;
+ $f = 'imagecopyresized';
+ }
+ else {
+ $f = 'imagecopyresampled';
+ }
+ $f($aToHdl,$aFromHdl,$aToX,$aToY,$aFromX,$aFromY, $aWidth,$aHeight,$aw,$ah);
}
function Copy($fromImg,$toX,$toY,$fromX,$fromY,$toWidth,$toHeight,$fromWidth=-1,$fromHeight=-1) {
- $this->CopyCanvasH($this->img,$fromImg,$toX,$toY,$fromX,$fromY,
- $toWidth,$toHeight,$fromWidth,$fromHeight);
+ $this->CopyCanvasH($this->img,$fromImg,$toX,$toY,$fromX,$fromY,$toWidth,$toHeight,$fromWidth,$fromHeight);
}
function CopyMerge($fromImg,$toX,$toY,$fromX,$fromY,$toWidth,$toHeight,$fromWidth=-1,$fromHeight=-1,$aMix=100) {
- if( $aMix == 100 ) {
- $this->CopyCanvasH($this->img,$fromImg,
- $toX,$toY,$fromX,$fromY,$toWidth,$toHeight,$fromWidth,$fromHeight);
- }
- else {
- if( ($fromWidth != -1 && ($fromWidth != $toWidth)) ||
- ($fromHeight != -1 && ($fromHeight != $fromHeight)) ) {
- // Create a new canvas that will hold the re-scaled original from image
- if( $toWidth <= 1 || $toHeight <= 1 ) {
- JpGraphError::RaiseL(25083);//('Illegal image size when copying image. Size for copied to image is 1 pixel or less.');
- }
- $tmpimg = @imagecreatetruecolor($toWidth, $toHeight);
- if( $tmpimg < 1 ) {
- JpGraphError::RaiseL(25084);//('Failed to create temporary GD canvas. Out of memory ?');
- }
- $this->CopyCanvasH($tmpimg,$fromImg,0,0,0,0,
- $toWidth,$toHeight,$fromWidth,$fromHeight);
- $fromImg = $tmpimg;
- }
- imagecopymerge($this->img,$fromImg,$toX,$toY,$fromX,$fromY,$toWidth,$toHeight,$aMix);
- }
- }
-
- function GetWidth($aImg=null) {
- if( $aImg === null )
- $aImg = $this->img;
- return imagesx($aImg);
- }
-
- function GetHeight($aImg=null) {
- if( $aImg === null )
- $aImg = $this->img;
- return imagesy($aImg);
- }
-
- function CreateFromString($aStr) {
- $img = @imagecreatefromstring($aStr);
- if( $img === false ) {
- JpGraphError::RaiseL(25085);//('An image can not be created from the supplied string. It is either in a format not supported or the string is representing an corrupt image.');
- }
- return $img;
+ if( $aMix == 100 ) {
+ $this->CopyCanvasH($this->img,$fromImg,
+ $toX,$toY,$fromX,$fromY,$toWidth,$toHeight,$fromWidth,$fromHeight);
+ }
+ else {
+ if( ($fromWidth != -1 && ($fromWidth != $toWidth)) || ($fromHeight != -1 && ($fromHeight != $fromHeight)) ) {
+ // Create a new canvas that will hold the re-scaled original from image
+ if( $toWidth <= 1 || $toHeight <= 1 ) {
+ JpGraphError::RaiseL(25083);//('Illegal image size when copying image. Size for copied to image is 1 pixel or less.');
+ }
+
+ $tmpimg = @imagecreatetruecolor($toWidth, $toHeight);
+
+ if( $tmpimg < 1 ) {
+ JpGraphError::RaiseL(25084);//('Failed to create temporary GD canvas. Out of memory ?');
+ }
+ $this->CopyCanvasH($tmpimg,$fromImg,0,0,0,0,
+ $toWidth,$toHeight,$fromWidth,$fromHeight);
+ $fromImg = $tmpimg;
+ }
+ imagecopymerge($this->img,$fromImg,$toX,$toY,$fromX,$fromY,$toWidth,$toHeight,$aMix);
+ }
+ }
+
+ static function GetWidth($aImg=null) {
+ if( $aImg === null ) {
+ $aImg = $this->img;
+ }
+ return imagesx($aImg);
+ }
+
+ static function GetHeight($aImg=null) {
+ if( $aImg === null ) {
+ $aImg = $this->img;
+ }
+ return imagesy($aImg);
+ }
+
+ static function CreateFromString($aStr) {
+ $img = imagecreatefromstring($aStr);
+ if( $img === false ) {
+ JpGraphError::RaiseL(25085);
+ //('An image can not be created from the supplied string. It is either in a format not supported or the string is representing an corrupt image.');
+ }
+ return $img;
}
function SetCanvasH($aHdl) {
- $this->img = $aHdl;
- $this->rgb->img = $aHdl;
+ $this->img = $aHdl;
+ $this->rgb->img = $aHdl;
}
function SetCanvasColor($aColor) {
- $this->canvascolor = $aColor ;
+ $this->canvascolor = $aColor ;
}
function SetAlphaBlending($aFlg=true) {
- ImageAlphaBlending($this->img,$aFlg);
+ ImageAlphaBlending($this->img,$aFlg);
}
-
- function SetAutoMargin() {
- GLOBAL $gJpgBrandTiming;
- $min_bm=5;
- /*
- if( $gJpgBrandTiming )
- $min_bm=15;
- */
- $lm = min(40,$this->width/7);
- $rm = min(20,$this->width/10);
- $tm = max(5,$this->height/7);
- $bm = max($min_bm,$this->height/7);
-
- $this->SetMargin($lm,$rm,$tm,$bm);
+ function SetAutoMargin() {
+ $min_bm=5;
+ $lm = min(40,$this->width/7);
+ $rm = min(20,$this->width/10);
+ $tm = max(5,$this->height/7);
+ $bm = max($min_bm,$this->height/6);
+ $this->SetMargin($lm,$rm,$tm,$bm);
}
-
//---------------
- // PUBLIC METHODS
-
+ // PUBLIC METHODS
+
function SetFont($family,$style=FS_NORMAL,$size=10) {
- $this->font_family=$family;
- $this->font_style=$style;
- $this->font_size=$size;
- $this->font_file='';
- if( ($this->font_family==FF_FONT1 || $this->font_family==FF_FONT2) && $this->font_style==FS_BOLD ){
- ++$this->font_family;
- }
- if( $this->font_family > FF_FONT2+1 ) { // A TTF font so get the font file
-
- // Check that this PHP has support for TTF fonts
- if( !function_exists('imagettfbbox') ) {
- JpGraphError::RaiseL(25087);//('This PHP build has not been configured with TTF support. You need to recompile your PHP installation with FreeType support.');
- }
- $this->font_file = $this->ttf->File($this->font_family,$this->font_style);
- }
+ $this->font_family=$family;
+ $this->font_style=$style;
+ $this->font_size=$size;
+ $this->font_file='';
+ if( ($this->font_family==FF_FONT1 || $this->font_family==FF_FONT2) && $this->font_style==FS_BOLD ){
+ ++$this->font_family;
+ }
+ if( $this->font_family > FF_FONT2+1 ) { // A TTF font so get the font file
+
+ // Check that this PHP has support for TTF fonts
+ if( !function_exists('imagettfbbox') ) {
+ JpGraphError::RaiseL(25087);//('This PHP build has not been configured with TTF support. You need to recompile your PHP installation with FreeType support.');
+ }
+ $this->font_file = $this->ttf->File($this->font_family,$this->font_style);
+ }
}
// Get the specific height for a text string
function GetTextHeight($txt="",$angle=0) {
- $tmp = split("\n",$txt);
- $n = count($tmp);
- $m=0;
- for($i=0; $i< $n; ++$i)
- $m = max($m,strlen($tmp[$i]));
-
- if( $this->font_family <= FF_FONT2+1 ) {
- if( $angle==0 ) {
- $h = imagefontheight($this->font_family);
- if( $h === false ) {
- JpGraphError::RaiseL(25088);//('You have a misconfigured GD font support. The call to imagefontwidth() fails.');
- }
-
- return $n*$h;
- }
- else {
- $w = @imagefontwidth($this->font_family);
- if( $w === false ) {
- JpGraphError::RaiseL(25088);//('You have a misconfigured GD font support. The call to imagefontwidth() fails.');
- }
-
- return $m*$w;
- }
- }
- else {
- $bbox = $this->GetTTFBBox($txt,$angle);
- return $bbox[1]-$bbox[5];
- }
+ $tmp = preg_split('/\n/',$txt);
+ $n = count($tmp);
+ $m=0;
+ for($i=0; $i< $n; ++$i) {
+ $m = max($m,strlen($tmp[$i]));
+ }
+
+ if( $this->font_family <= FF_FONT2+1 ) {
+ if( $angle==0 ) {
+ $h = imagefontheight($this->font_family);
+ if( $h === false ) {
+ JpGraphError::RaiseL(25088);//('You have a misconfigured GD font support. The call to imagefontwidth() fails.');
+ }
+
+ return $n*$h;
+ }
+ else {
+ $w = @imagefontwidth($this->font_family);
+ if( $w === false ) {
+ JpGraphError::RaiseL(25088);//('You have a misconfigured GD font support. The call to imagefontwidth() fails.');
+ }
+
+ return $m*$w;
+ }
+ }
+ else {
+ $bbox = $this->GetTTFBBox($txt,$angle);
+ return $bbox[1]-$bbox[5]+1;
+ }
}
-
+
// Estimate font height
function GetFontHeight($angle=0) {
- $txt = "XOMg";
- return $this->GetTextHeight($txt,$angle);
+ $txt = "XOMg";
+ return $this->GetTextHeight($txt,$angle);
}
-
+
// Approximate font width with width of letter "O"
function GetFontWidth($angle=0) {
- $txt = 'O';
- return $this->GetTextWidth($txt,$angle);
+ $txt = 'O';
+ return $this->GetTextWidth($txt,$angle);
}
-
- // Get actual width of text in absolute pixels
+
+ // Get actual width of text in absolute pixels. Note that the width is the
+ // texts projected with onto the x-axis. Call with angle=0 to get the true
+ // etxt width.
function GetTextWidth($txt,$angle=0) {
- $tmp = split("\n",$txt);
- $n = count($tmp);
- if( $this->font_family <= FF_FONT2+1 ) {
-
- $m=0;
- for($i=0; $i < $n; ++$i) {
- $l=strlen($tmp[$i]);
- if( $l > $m ) {
- $m = $l;
- }
- }
-
- if( $angle==0 ) {
- $w = @imagefontwidth($this->font_family);
- if( $w === false ) {
- JpGraphError::RaiseL(25088);//('You have a misconfigured GD font support. The call to imagefontwidth() fails.');
- }
- return $m*$w;
- }
- else {
- // 90 degrees internal so height becomes width
- $h = @imagefontheight($this->font_family);
- if( $h === false ) {
- JpGraphError::RaiseL(25089);//('You have a misconfigured GD font support. The call to imagefontheight() fails.');
- }
- return $n*$h;
- }
- }
- else {
- // For TTF fonts we must walk through a lines and find the
- // widest one which we use as the width of the multi-line
- // paragraph
- $m=0;
- for( $i=0; $i < $n; ++$i ) {
- $bbox = $this->GetTTFBBox($tmp[$i],$angle);
- $mm = $bbox[2] - $bbox[0];
- if( $mm > $m )
- $m = $mm;
- }
- return $m;
- }
+ $tmp = preg_split('/\n/',$txt);
+ $n = count($tmp);
+ if( $this->font_family <= FF_FONT2+1 ) {
+
+ $m=0;
+ for($i=0; $i < $n; ++$i) {
+ $l=strlen($tmp[$i]);
+ if( $l > $m ) {
+ $m = $l;
+ }
+ }
+
+ if( $angle==0 ) {
+ $w = @imagefontwidth($this->font_family);
+ if( $w === false ) {
+ JpGraphError::RaiseL(25088);//('You have a misconfigured GD font support. The call to imagefontwidth() fails.');
+ }
+ return $m*$w;
+ }
+ else {
+ // 90 degrees internal so height becomes width
+ $h = @imagefontheight($this->font_family);
+ if( $h === false ) {
+ JpGraphError::RaiseL(25089);//('You have a misconfigured GD font support. The call to imagefontheight() fails.');
+ }
+ return $n*$h;
+ }
+ }
+ else {
+ // For TTF fonts we must walk through a lines and find the
+ // widest one which we use as the width of the multi-line
+ // paragraph
+ $m=0;
+ for( $i=0; $i < $n; ++$i ) {
+ $bbox = $this->GetTTFBBox($tmp[$i],$angle);
+ $mm = $bbox[2] - $bbox[0];
+ if( $mm > $m )
+ $m = $mm;
+ }
+ return $m;
+ }
}
-
+
+
// Draw text with a box around it
function StrokeBoxedText($x,$y,$txt,$dir=0,$fcolor="white",$bcolor="black",
- $shadowcolor=false,$paragraph_align="left",
- $xmarg=6,$ymarg=4,$cornerradius=0,$dropwidth=3) {
+ $shadowcolor=false,$paragraph_align="left",
+ $xmarg=6,$ymarg=4,$cornerradius=0,$dropwidth=3) {
+
+ $oldx = $this->lastx;
+ $oldy = $this->lasty;
- if( !is_numeric($dir) ) {
- if( $dir=="h" ) $dir=0;
- elseif( $dir=="v" ) $dir=90;
- else JpGraphError::RaiseL(25090,$dir);//(" Unknown direction specified in call to StrokeBoxedText() [$dir]");
- }
-
- if( $this->font_family >= FF_FONT0 && $this->font_family <= FF_FONT2+1) {
- $width=$this->GetTextWidth($txt,$dir) ;
- $height=$this->GetTextHeight($txt,$dir) ;
- }
- else {
- $width=$this->GetBBoxWidth($txt,$dir) ;
- $height=$this->GetBBoxHeight($txt,$dir) ;
- }
-
- $height += 2*$ymarg;
- $width += 2*$xmarg;
-
- if( $this->text_halign=="right" ) $x -= $width;
- elseif( $this->text_halign=="center" ) $x -= $width/2;
- if( $this->text_valign=="bottom" ) $y -= $height;
- elseif( $this->text_valign=="center" ) $y -= $height/2;
-
- $olda = $this->SetAngle(0);
-
- if( $shadowcolor ) {
- $this->PushColor($shadowcolor);
- $this->FilledRoundedRectangle($x-$xmarg+$dropwidth,$y-$ymarg+$dropwidth,
- $x+$width+$dropwidth,$y+$height-$ymarg+$dropwidth,
- $cornerradius);
- $this->PopColor();
- $this->PushColor($fcolor);
- $this->FilledRoundedRectangle($x-$xmarg,$y-$ymarg,
- $x+$width,$y+$height-$ymarg,
- $cornerradius);
- $this->PopColor();
- $this->PushColor($bcolor);
- $this->RoundedRectangle($x-$xmarg,$y-$ymarg,
- $x+$width,$y+$height-$ymarg,$cornerradius);
- $this->PopColor();
- }
- else {
- if( $fcolor ) {
- $oc=$this->current_color;
- $this->SetColor($fcolor);
- $this->FilledRoundedRectangle($x-$xmarg,$y-$ymarg,$x+$width,$y+$height-$ymarg,$cornerradius);
- $this->current_color=$oc;
- }
- if( $bcolor ) {
- $oc=$this->current_color;
- $this->SetColor($bcolor);
- $this->RoundedRectangle($x-$xmarg,$y-$ymarg,$x+$width,$y+$height-$ymarg,$cornerradius);
- $this->current_color=$oc;
- }
- }
-
- $h=$this->text_halign;
- $v=$this->text_valign;
- $this->SetTextAlign("left","top");
- $this->StrokeText($x, $y, $txt, $dir, $paragraph_align);
- $bb = array($x-$xmarg,$y+$height-$ymarg,$x+$width,$y+$height-$ymarg,
- $x+$width,$y-$ymarg,$x-$xmarg,$y-$ymarg);
- $this->SetTextAlign($h,$v);
+ if( !is_numeric($dir) ) {
+ if( $dir=="h" ) $dir=0;
+ elseif( $dir=="v" ) $dir=90;
+ else JpGraphError::RaiseL(25090,$dir);//(" Unknown direction specified in call to StrokeBoxedText() [$dir]");
+ }
+
+ if( $this->font_family >= FF_FONT0 && $this->font_family <= FF_FONT2+1) {
+ $width=$this->GetTextWidth($txt,$dir) ;
+ $height=$this->GetTextHeight($txt,$dir) ;
+ }
+ else {
+ $width=$this->GetBBoxWidth($txt,$dir) ;
+ $height=$this->GetBBoxHeight($txt,$dir) ;
+ }
+
+ $height += 2*$ymarg;
+ $width += 2*$xmarg;
+
+ if( $this->text_halign=="right" ) $x -= $width;
+ elseif( $this->text_halign=="center" ) $x -= $width/2;
+
+ if( $this->text_valign=="bottom" ) $y -= $height;
+ elseif( $this->text_valign=="center" ) $y -= $height/2;
+
+ $olda = $this->SetAngle(0);
+
+ if( $shadowcolor ) {
+ $this->PushColor($shadowcolor);
+ $this->FilledRoundedRectangle($x-$xmarg+$dropwidth,$y-$ymarg+$dropwidth,
+ $x+$width+$dropwidth,$y+$height-$ymarg+$dropwidth,
+ $cornerradius);
+ $this->PopColor();
+ $this->PushColor($fcolor);
+ $this->FilledRoundedRectangle($x-$xmarg,$y-$ymarg,
+ $x+$width,$y+$height-$ymarg,
+ $cornerradius);
+ $this->PopColor();
+ $this->PushColor($bcolor);
+ $this->RoundedRectangle($x-$xmarg,$y-$ymarg,
+ $x+$width,$y+$height-$ymarg,$cornerradius);
+ $this->PopColor();
+ }
+ else {
+ if( $fcolor ) {
+ $oc=$this->current_color;
+ $this->SetColor($fcolor);
+ $this->FilledRoundedRectangle($x-$xmarg,$y-$ymarg,$x+$width,$y+$height-$ymarg,$cornerradius);
+ $this->current_color=$oc;
+ }
+ if( $bcolor ) {
+ $oc=$this->current_color;
+ $this->SetColor($bcolor);
+ $this->RoundedRectangle($x-$xmarg,$y-$ymarg,$x+$width,$y+$height-$ymarg,$cornerradius);
+ $this->current_color=$oc;
+ }
+ }
+
+ $h=$this->text_halign;
+ $v=$this->text_valign;
+ $this->SetTextAlign("left","top");
+
+ $debug=false;
+ $this->StrokeText($x, $y, $txt, $dir, $paragraph_align,$debug);
- $this->SetAngle($olda);
+ $bb = array($x-$xmarg,$y+$height-$ymarg,$x+$width,$y+$height-$ymarg,
+ $x+$width,$y-$ymarg,$x-$xmarg,$y-$ymarg);
+ $this->SetTextAlign($h,$v);
- return $bb;
+ $this->SetAngle($olda);
+ $this->lastx = $oldx;
+ $this->lasty = $oldy;
+
+ return $bb;
}
- // Set text alignment
+ // Draw text with a box around it. This time the box will be rotated
+ // with the text. The previous method will just make a larger enough non-rotated
+ // box to hold the text inside.
+ function StrokeBoxedText2($x,$y,$txt,$dir=0,$fcolor="white",$bcolor="black",
+ $shadowcolor=false,$paragraph_align="left",
+ $xmarg=6,$ymarg=4,$cornerradius=0,$dropwidth=3) {
+
+ // This version of boxed text will stroke a rotated box round the text
+ // thta will follow the angle of the text.
+ // This has two implications:
+ // 1) This methos will only support TTF fonts
+ // 2) The only two alignment that makes sense are centered or baselined
+
+ if( $this->font_family <= FF_FONT2+1 ) {
+ JpGraphError::RaiseL(25131);//StrokeBoxedText2() Only support TTF fonts and not built in bitmap fonts
+ }
+
+ $oldx = $this->lastx;
+ $oldy = $this->lasty;
+ $dir = $this->NormAngle($dir);
+
+ if( !is_numeric($dir) ) {
+ if( $dir=="h" ) $dir=0;
+ elseif( $dir=="v" ) $dir=90;
+ else JpGraphError::RaiseL(25090,$dir);//(" Unknown direction specified in call to StrokeBoxedText() [$dir]");
+ }
+
+ $width=$this->GetTextWidth($txt,0) + 2*$xmarg;
+ $height=$this->GetTextHeight($txt,0) + 2*$ymarg ;
+ $rect_width=$this->GetBBoxWidth($txt,$dir) ;
+ $rect_height=$this->GetBBoxHeight($txt,$dir) ;
+
+ $baseline_offset = $this->bbox_cache[1]-1;
+
+ if( $this->text_halign=="center" ) {
+ if( $dir >= 0 && $dir <= 90 ) {
+
+ $x -= $rect_width/2;
+ $x += sin($dir*M_PI/180)*$height;
+ $y += $rect_height/2;
+
+ } elseif( $dir >= 270 && $dir <= 360 ) {
+
+ $x -= $rect_width/2;
+ $y -= $rect_height/2;
+ $y += cos($dir*M_PI/180)*$height;
+
+ } elseif( $dir >= 90 && $dir <= 180 ) {
+
+ $x += $rect_width/2;
+ $y += $rect_height/2;
+ $y += cos($dir*M_PI/180)*$height;
+
+ }
+ else {
+ // $dir > 180 && $dir < 270
+ $x += $rect_width/2;
+ $x += sin($dir*M_PI/180)*$height;
+ $y -= $rect_height/2;
+ }
+ }
+
+ // Rotate the box around this point
+ $this->SetCenter($x,$y);
+ $olda = $this->SetAngle(-$dir);
+
+ // We need to use adjusted coordinats for the box to be able
+ // to draw the box below the baseline. This cannot be done before since
+ // the rotating point must be the original x,y since that is arounbf the
+ // point where the text will rotate and we cannot change this since
+ // that is where the GD/GreeType will rotate the text
+
+
+ // For smaller <14pt font we need to do some additional
+ // adjustments to make it look good
+ if( $this->font_size < 14 ) {
+ $x -= 2;
+ $y += 2;
+ }
+ else {
+ // $y += $baseline_offset;
+ }
+
+ if( $shadowcolor ) {
+ $this->PushColor($shadowcolor);
+ $this->FilledRectangle($x-$xmarg+$dropwidth,$y+$ymarg+$dropwidth-$height,
+ $x+$width+$dropwidth,$y+$ymarg+$dropwidth);
+ //$cornerradius);
+ $this->PopColor();
+ $this->PushColor($fcolor);
+ $this->FilledRectangle($x-$xmarg, $y+$ymarg-$height,
+ $x+$width, $y+$ymarg);
+ //$cornerradius);
+ $this->PopColor();
+ $this->PushColor($bcolor);
+ $this->Rectangle($x-$xmarg,$y+$ymarg-$height,
+ $x+$width,$y+$ymarg);
+ //$cornerradius);
+ $this->PopColor();
+ }
+ else {
+ if( $fcolor ) {
+ $oc=$this->current_color;
+ $this->SetColor($fcolor);
+ $this->FilledRectangle($x-$xmarg,$y+$ymarg-$height,$x+$width,$y+$ymarg);//,$cornerradius);
+ $this->current_color=$oc;
+ }
+ if( $bcolor ) {
+ $oc=$this->current_color;
+ $this->SetColor($bcolor);
+ $this->Rectangle($x-$xmarg,$y+$ymarg-$height,$x+$width,$y+$ymarg);//,$cornerradius);
+ $this->current_color=$oc;
+ }
+ }
+
+ if( $this->font_size < 14 ) {
+ $x += 2;
+ $y -= 2;
+ }
+ else {
+
+ // Restore the original y before we stroke the text
+ // $y -= $baseline_offset;
+
+ }
+
+ $this->SetCenter(0,0);
+ $this->SetAngle($olda);
+
+ $h=$this->text_halign;
+ $v=$this->text_valign;
+ if( $this->text_halign == 'center') {
+ $this->SetTextAlign('center','basepoint');
+ }
+ else {
+ $this->SetTextAlign('basepoint','basepoint');
+ }
+
+ $debug=false;
+ $this->StrokeText($x, $y, $txt, $dir, $paragraph_align,$debug);
+
+ $bb = array($x-$xmarg, $y+$height-$ymarg,
+ $x+$width, $y+$height-$ymarg,
+ $x+$width, $y-$ymarg,
+ $x-$xmarg, $y-$ymarg);
+
+ $this->SetTextAlign($h,$v);
+ $this->SetAngle($olda);
+
+ $this->lastx = $oldx;
+ $this->lasty = $oldy;
+
+ return $bb;
+ }
+
+ // Set text alignment
function SetTextAlign($halign,$valign="bottom") {
- $this->text_halign=$halign;
- $this->text_valign=$valign;
+ $this->text_halign=$halign;
+ $this->text_valign=$valign;
}
-
- function _StrokeBuiltinFont($x,$y,$txt,$dir=0,$paragraph_align="left",&$aBoundingBox,$aDebug=false) {
+ function _StrokeBuiltinFont($x,$y,$txt,$dir,$paragraph_align,&$aBoundingBox,$aDebug=false) {
- if( is_numeric($dir) && $dir!=90 && $dir!=0)
- JpGraphError::RaiseL(25091);//(" Internal font does not support drawing text at arbitrary angle. Use TTF fonts instead.");
-
- $h=$this->GetTextHeight($txt);
- $fh=$this->GetFontHeight();
- $w=$this->GetTextWidth($txt);
-
- if( $this->text_halign=="right")
- $x -= $dir==0 ? $w : $h;
- elseif( $this->text_halign=="center" ) {
- // For center we subtract 1 pixel since this makes the middle
- // be prefectly in the middle
- $x -= $dir==0 ? $w/2-1 : $h/2;
- }
- if( $this->text_valign=="top" )
- $y += $dir==0 ? $h : $w;
- elseif( $this->text_valign=="center" )
- $y += $dir==0 ? $h/2 : $w/2;
-
- if( $dir==90 ) {
- imagestringup($this->img,$this->font_family,$x,$y,$txt,$this->current_color);
- $aBoundingBox = array(round($x),round($y),round($x),round($y-$w),round($x+$h),round($y-$w),round($x+$h),round($y));
+ if( is_numeric($dir) && $dir!=90 && $dir!=0)
+ JpGraphError::RaiseL(25091);//(" Internal font does not support drawing text at arbitrary angle. Use TTF fonts instead.");
+
+ $h=$this->GetTextHeight($txt);
+ $fh=$this->GetFontHeight();
+ $w=$this->GetTextWidth($txt);
+
+ if( $this->text_halign=="right") {
+ $x -= $dir==0 ? $w : $h;
+ }
+ elseif( $this->text_halign=="center" ) {
+ // For center we subtract 1 pixel since this makes the middle
+ // be prefectly in the middle
+ $x -= $dir==0 ? $w/2-1 : $h/2;
+ }
+ if( $this->text_valign=="top" ) {
+ $y += $dir==0 ? $h : $w;
+ }
+ elseif( $this->text_valign=="center" ) {
+ $y += $dir==0 ? $h/2 : $w/2;
+ }
+
+ if( $dir==90 ) {
+ imagestringup($this->img,$this->font_family,$x,$y,$txt,$this->current_color);
+ $aBoundingBox = array(round($x),round($y),round($x),round($y-$w),round($x+$h),round($y-$w),round($x+$h),round($y));
if( $aDebug ) {
- // Draw bounding box
- $this->PushColor('green');
- $this->Polygon($aBoundingBox,true);
- $this->PopColor();
- }
- }
- else {
- if( ereg("\n",$txt) ) {
- $tmp = split("\n",$txt);
- for($i=0; $i < count($tmp); ++$i) {
- $w1 = $this->GetTextWidth($tmp[$i]);
- if( $paragraph_align=="left" ) {
- imagestring($this->img,$this->font_family,$x,$y-$h+1+$i*$fh,$tmp[$i],$this->current_color);
- }
- elseif( $paragraph_align=="right" ) {
- imagestring($this->img,$this->font_family,$x+($w-$w1),
- $y-$h+1+$i*$fh,$tmp[$i],$this->current_color);
- }
- else {
- imagestring($this->img,$this->font_family,$x+$w/2-$w1/2,
- $y-$h+1+$i*$fh,$tmp[$i],$this->current_color);
- }
- }
- }
- else {
- //Put the text
- imagestring($this->img,$this->font_family,$x,$y-$h+1,$txt,$this->current_color);
- }
+ // Draw bounding box
+ $this->PushColor('green');
+ $this->Polygon($aBoundingBox,true);
+ $this->PopColor();
+ }
+ }
+ else {
+ if( preg_match('/\n/',$txt) ) {
+ $tmp = preg_split('/\n/',$txt);
+ for($i=0; $i < count($tmp); ++$i) {
+ $w1 = $this->GetTextWidth($tmp[$i]);
+ if( $paragraph_align=="left" ) {
+ imagestring($this->img,$this->font_family,$x,$y-$h+1+$i*$fh,$tmp[$i],$this->current_color);
+ }
+ elseif( $paragraph_align=="right" ) {
+ imagestring($this->img,$this->font_family,$x+($w-$w1),$y-$h+1+$i*$fh,$tmp[$i],$this->current_color);
+ }
+ else {
+ imagestring($this->img,$this->font_family,$x+$w/2-$w1/2,$y-$h+1+$i*$fh,$tmp[$i],$this->current_color);
+ }
+ }
+ }
+ else {
+ //Put the text
+ imagestring($this->img,$this->font_family,$x,$y-$h+1,$txt,$this->current_color);
+ }
if( $aDebug ) {
- // Draw the bounding rectangle and the bounding box
- $p1 = array(round($x),round($y),round($x),round($y-$h),round($x+$w),round($y-$h),round($x+$w),round($y));
-
- // Draw bounding box
- $this->PushColor('green');
- $this->Polygon($p1,true);
- $this->PopColor();
+ // Draw the bounding rectangle and the bounding box
+ $p1 = array(round($x),round($y),round($x),round($y-$h),round($x+$w),round($y-$h),round($x+$w),round($y));
+
+ // Draw bounding box
+ $this->PushColor('green');
+ $this->Polygon($p1,true);
+ $this->PopColor();
}
- $aBoundingBox=array(round($x),round($y),round($x),round($y-$h),round($x+$w),round($y-$h),round($x+$w),round($y));
- }
+ $aBoundingBox=array(round($x),round($y),round($x),round($y-$h),round($x+$w),round($y-$h),round($x+$w),round($y));
+ }
}
function AddTxtCR($aTxt) {
- // If the user has just specified a '\n'
- // instead of '\n\t' we have to add '\r' since
- // the width will be too muchy otherwise since when
- // we print we stroke the individually lines by hand.
- $e = explode("\n",$aTxt);
- $n = count($e);
- for($i=0; $i<$n; ++$i) {
- $e[$i]=str_replace("\r","",$e[$i]);
- }
- return implode("\n\r",$e);
+ // If the user has just specified a '\n'
+ // instead of '\n\t' we have to add '\r' since
+ // the width will be too muchy otherwise since when
+ // we print we stroke the individually lines by hand.
+ $e = explode("\n",$aTxt);
+ $n = count($e);
+ for($i=0; $i<$n; ++$i) {
+ $e[$i]=str_replace("\r","",$e[$i]);
+ }
+ return implode("\n\r",$e);
+ }
+
+ function NormAngle($a) {
+ // Normalize angle in degrees
+ // Normalize angle to be between 0-360
+ while( $a > 360 )
+ $a -= 360;
+ while( $a < -360 )
+ $a += 360;
+ if( $a < 0 )
+ $a = 360 + $a;
+ return $a;
+ }
+
+ function imagettfbbox_fixed($size, $angle, $fontfile, $text) {
+
+
+ if( ! USE_LIBRARY_IMAGETTFBBOX ) {
+
+ $bbox = @imagettfbbox($size, $angle, $fontfile, $text);
+ if( $bbox === false ) {
+ JpGraphError::RaiseL(25092,$this->font_file);
+ //("There is either a configuration problem with TrueType or a problem reading font file (".$this->font_file."). Make sure file exists and is in a readable place for the HTTP process. (If 'basedir' restriction is enabled in PHP then the font file must be located in the document root.). It might also be a wrongly installed FreeType library. Try uppgrading to at least FreeType 2.1.13 and recompile GD with the correct setup so it can find the new FT library.");
+ }
+ $this->bbox_cache = $bbox;
+ return $bbox;
+ }
+
+ // The built in imagettfbbox is buggy for angles != 0 so
+ // we calculate this manually by getting the bounding box at
+ // angle = 0 and then rotate the bounding box manually
+ $bbox = @imagettfbbox($size, 0, $fontfile, $text);
+ if( $bbox === false ) {
+ JpGraphError::RaiseL(25092,$this->font_file);
+ //("There is either a configuration problem with TrueType or a problem reading font file (".$this->font_file."). Make sure file exists and is in a readable place for the HTTP process. (If 'basedir' restriction is enabled in PHP then the font file must be located in the document root.). It might also be a wrongly installed FreeType library. Try uppgrading to at least FreeType 2.1.13 and recompile GD with the correct setup so it can find the new FT library.");
+ }
+
+ $angle = $this->NormAngle($angle);
+
+ $a = $angle*M_PI/180;
+ $ca = cos($a);
+ $sa = sin($a);
+ $ret = array();
+
+ // We always add 1 pixel to the left since the left edge of the bounding
+ // box is sometimes coinciding with the first pixel of the text
+ //$bbox[0] -= 1;
+ //$bbox[6] -= 1;
+
+ // For roatated text we need to add extra width for rotated
+ // text since the kerning and stroking of the TTF is not the same as for
+ // text at a 0 degree angle
+
+ if( $angle > 0.001 && abs($angle-360) > 0.001 ) {
+ $h = abs($bbox[7]-$bbox[1]);
+ $w = abs($bbox[2]-$bbox[0]);
+
+ $bbox[0] -= 2;
+ $bbox[6] -= 2;
+ // The width is underestimated so compensate for that
+ $bbox[2] += round($w*0.06);
+ $bbox[4] += round($w*0.06);
+
+ // and we also need to compensate with increased height
+ $bbox[5] -= round($h*0.1);
+ $bbox[7] -= round($h*0.1);
+
+ if( $angle > 90 ) {
+ // For angles > 90 we also need to extend the height further down
+ // by the baseline since that is also one more problem
+ $bbox[1] += round($h*0.15);
+ $bbox[3] += round($h*0.15);
+
+ // and also make it slighty less height
+ $bbox[7] += round($h*0.05);
+ $bbox[5] += round($h*0.05);
+
+ // And we need to move the box slightly top the rright (from a tetx perspective)
+ $bbox[0] += round($w*0.02);
+ $bbox[6] += round($w*0.02);
+
+ if( $angle > 180 ) {
+ // And we need to move the box slightly to the left (from a text perspective)
+ $bbox[0] -= round($w*0.02);
+ $bbox[6] -= round($w*0.02);
+ $bbox[2] -= round($w*0.02);
+ $bbox[4] -= round($w*0.02);
+
+ }
+
+ }
+ for($i = 0; $i < 7; $i += 2) {
+ $ret[$i] = round($bbox[$i] * $ca + $bbox[$i+1] * $sa);
+ $ret[$i+1] = round($bbox[$i+1] * $ca - $bbox[$i] * $sa);
+ }
+ $this->bbox_cache = $ret;
+ return $ret;
+ }
+ else {
+ $this->bbox_cache = $bbox;
+ return $bbox;
+ }
}
+ // Deprecated
function GetTTFBBox($aTxt,$aAngle=0) {
- $bbox = @ImageTTFBBox($this->font_size,$aAngle,$this->font_file,$aTxt);
- if( $bbox === false ) {
- JpGraphError::RaiseL(25092,$this->font_file);
-//("There is either a configuration problem with TrueType or a problem reading font file (".$this->font_file."). Make sure file exists and is in a readable place for the HTTP process. (If 'basedir' restriction is enabled in PHP then the font file must be located in the document root.). It might also be a wrongly installed FreeType library. Try uppgrading to at least FreeType 2.1.13 and recompile GD with the correct setup so it can find the new FT library.");
- }
- return $bbox;
+ $bbox = $this->imagettfbbox_fixed($this->font_size,$aAngle,$this->font_file,$aTxt);
+ return $bbox;
}
function GetBBoxTTF($aTxt,$aAngle=0) {
- // Normalize the bounding box to become a minimum
- // enscribing rectangle
+ // Normalize the bounding box to become a minimum
+ // enscribing rectangle
- $aTxt = $this->AddTxtCR($aTxt);
+ $aTxt = $this->AddTxtCR($aTxt);
- if( !is_readable($this->font_file) ) {
- JpGraphError::RaiseL(25093,$this->font_file);
-//('Can not read font file ('.$this->font_file.') in call to Image::GetBBoxTTF. Please make sure that you have set a font before calling this method and that the font is installed in the TTF directory.');
- }
- $bbox = $this->GetTTFBBox($aTxt,$aAngle);
-
- if( $aAngle==0 )
- return $bbox;
- if( $aAngle >= 0 ) {
- if( $aAngle <= 90 ) { //<=0
- $bbox = array($bbox[6],$bbox[1],$bbox[2],$bbox[1],
- $bbox[2],$bbox[5],$bbox[6],$bbox[5]);
- }
- elseif( $aAngle <= 180 ) { //<= 2
- $bbox = array($bbox[4],$bbox[7],$bbox[0],$bbox[7],
- $bbox[0],$bbox[3],$bbox[4],$bbox[3]);
- }
- elseif( $aAngle <= 270 ) { //<= 3
- $bbox = array($bbox[2],$bbox[5],$bbox[6],$bbox[5],
- $bbox[6],$bbox[1],$bbox[2],$bbox[1]);
- }
- else {
- $bbox = array($bbox[0],$bbox[3],$bbox[4],$bbox[3],
- $bbox[4],$bbox[7],$bbox[0],$bbox[7]);
- }
- }
- elseif( $aAngle < 0 ) {
- if( $aAngle <= -270 ) { // <= -3
- $bbox = array($bbox[6],$bbox[1],$bbox[2],$bbox[1],
- $bbox[2],$bbox[5],$bbox[6],$bbox[5]);
- }
- elseif( $aAngle <= -180 ) { // <= -2
- $bbox = array($bbox[0],$bbox[3],$bbox[4],$bbox[3],
- $bbox[4],$bbox[7],$bbox[0],$bbox[7]);
- }
- elseif( $aAngle <= -90 ) { // <= -1
- $bbox = array($bbox[2],$bbox[5],$bbox[6],$bbox[5],
- $bbox[6],$bbox[1],$bbox[2],$bbox[1]);
- }
- else {
- $bbox = array($bbox[0],$bbox[3],$bbox[4],$bbox[3],
- $bbox[4],$bbox[7],$bbox[0],$bbox[7]);
- }
- }
- return $bbox;
+ if( !is_readable($this->font_file) ) {
+ JpGraphError::RaiseL(25093,$this->font_file);
+ //('Can not read font file ('.$this->font_file.') in call to Image::GetBBoxTTF. Please make sure that you have set a font before calling this method and that the font is installed in the TTF directory.');
+ }
+ $bbox = $this->imagettfbbox_fixed($this->font_size,$aAngle,$this->font_file,$aTxt);
+
+ if( $aAngle==0 ) return $bbox;
+
+ if( $aAngle >= 0 ) {
+ if( $aAngle <= 90 ) { //<=0
+ $bbox = array($bbox[6],$bbox[1],$bbox[2],$bbox[1],
+ $bbox[2],$bbox[5],$bbox[6],$bbox[5]);
+ }
+ elseif( $aAngle <= 180 ) { //<= 2
+ $bbox = array($bbox[4],$bbox[7],$bbox[0],$bbox[7],
+ $bbox[0],$bbox[3],$bbox[4],$bbox[3]);
+ }
+ elseif( $aAngle <= 270 ) { //<= 3
+ $bbox = array($bbox[2],$bbox[5],$bbox[6],$bbox[5],
+ $bbox[6],$bbox[1],$bbox[2],$bbox[1]);
+ }
+ else {
+ $bbox = array($bbox[0],$bbox[3],$bbox[4],$bbox[3],
+ $bbox[4],$bbox[7],$bbox[0],$bbox[7]);
+ }
+ }
+ elseif( $aAngle < 0 ) {
+ if( $aAngle <= -270 ) { // <= -3
+ $bbox = array($bbox[6],$bbox[1],$bbox[2],$bbox[1],
+ $bbox[2],$bbox[5],$bbox[6],$bbox[5]);
+ }
+ elseif( $aAngle <= -180 ) { // <= -2
+ $bbox = array($bbox[0],$bbox[3],$bbox[4],$bbox[3],
+ $bbox[4],$bbox[7],$bbox[0],$bbox[7]);
+ }
+ elseif( $aAngle <= -90 ) { // <= -1
+ $bbox = array($bbox[2],$bbox[5],$bbox[6],$bbox[5],
+ $bbox[6],$bbox[1],$bbox[2],$bbox[1]);
+ }
+ else {
+ $bbox = array($bbox[0],$bbox[3],$bbox[4],$bbox[3],
+ $bbox[4],$bbox[7],$bbox[0],$bbox[7]);
+ }
+ }
+ return $bbox;
}
function GetBBoxHeight($aTxt,$aAngle=0) {
- $box = $this->GetBBoxTTF($aTxt,$aAngle);
- return $box[1]-$box[7]+1;
+ $box = $this->GetBBoxTTF($aTxt,$aAngle);
+ return abs($box[7]-$box[1]);
}
function GetBBoxWidth($aTxt,$aAngle=0) {
- $box = $this->GetBBoxTTF($aTxt,$aAngle);
- return $box[2]-$box[0]+1;
+ $box = $this->GetBBoxTTF($aTxt,$aAngle);
+ return $box[2]-$box[0]+1;
}
- function _StrokeTTF($x,$y,$txt,$dir=0,$paragraph_align="left",&$aBoundingBox,$debug=false) {
- // Setupo default inter line margin for paragraphs to
- // 25% of the font height.
- $ConstLineSpacing = 0.25 ;
-
- // Remember the anchor point before adjustment
- if( $debug ) {
- $ox=$x;
- $oy=$y;
- }
-
- if( !ereg("\n",$txt) || ($dir>0 && ereg("\n",$txt)) ) {
- // Format a single line
-
- $txt = $this->AddTxtCR($txt);
-
- $bbox=$this->GetBBoxTTF($txt,$dir);
-
- // Align x,y ot lower left corner of bbox
- $x -= $bbox[0];
- $y -= $bbox[1];
-
- // Note to self: "topanchor" is deprecated after we changed the
- // bopunding box stuff.
- if( $this->text_halign=="right" || $this->text_halign=="topanchor" )
- $x -= $bbox[2]-$bbox[0];
- elseif( $this->text_halign=="center" ) $x -= ($bbox[2]-$bbox[0])/2;
-
- if( $this->text_valign=="top" ) $y += abs($bbox[5])+$bbox[1];
- elseif( $this->text_valign=="center" ) $y -= ($bbox[5]-$bbox[1])/2;
-
- ImageTTFText ($this->img, $this->font_size, $dir, $x, $y,
- $this->current_color,$this->font_file,$txt);
-
- // Calculate and return the co-ordinates for the bounding box
- $box=@ImageTTFBBox($this->font_size,$dir,$this->font_file,$txt);
- $p1 = array();
-
-
- for($i=0; $i < 4; ++$i) {
- $p1[] = round($box[$i*2]+$x);
- $p1[] = round($box[$i*2+1]+$y);
- }
- $aBoundingBox = $p1;
-
- // Debugging code to highlight the bonding box and bounding rectangle
- // For text at 0 degrees the bounding box and bounding rectangle are the
- // same
+ function _StrokeTTF($x,$y,$txt,$dir,$paragraph_align,&$aBoundingBox,$debug=false) {
+
+ // Setup default inter line margin for paragraphs to be
+ // 3% of the font height.
+ $ConstLineSpacing = 0.03 ;
+
+ // Remember the anchor point before adjustment
+ if( $debug ) {
+ $ox=$x;
+ $oy=$y;
+ }
+
+ if( !preg_match('/\n/',$txt) || ($dir>0 && preg_match('/\n/',$txt)) ) {
+ // Format a single line
+
+ $txt = $this->AddTxtCR($txt);
+ $bbox=$this->GetBBoxTTF($txt,$dir);
+ $width = $this->GetBBoxWidth($txt,$dir);
+ $height = $this->GetBBoxHeight($txt,$dir);
+
+ // The special alignment "basepoint" is mostly used internally
+ // in the library. This will put the anchor position at the left
+ // basepoint of the tetx. This is the default anchor point for
+ // TTF text.
+
+ if( $this->text_valign != 'basepoint' ) {
+ // Align x,y ot lower left corner of bbox
+
+
+ if( $this->text_halign=='right' ) {
+ $x -= $width;
+ $x -= $bbox[0];
+ }
+ elseif( $this->text_halign=='center' ) {
+ $x -= $width/2;
+ $x -= $bbox[0];
+ }
+ elseif( $this->text_halign=='baseline' ) {
+ // This is only support for text at 90 degree !!
+ // Do nothing the text is drawn at baseline by default
+ }
+
+ if( $this->text_valign=='top' ) {
+ $y -= $bbox[1]; // Adjust to bottom of text
+ $y += $height;
+ }
+ elseif( $this->text_valign=='center' ) {
+ $y -= $bbox[1]; // Adjust to bottom of text
+ $y += $height/2;
+ }
+ elseif( $this->text_valign=='baseline' ) {
+ // This is only support for text at 0 degree !!
+ // Do nothing the text is drawn at baseline by default
+ }
+ }
+ ImageTTFText ($this->img, $this->font_size, $dir, $x, $y,
+ $this->current_color,$this->font_file,$txt);
+
+ // Calculate and return the co-ordinates for the bounding box
+ $box = $this->imagettfbbox_fixed($this->font_size,$dir,$this->font_file,$txt);
+ $p1 = array();
+
+ for($i=0; $i < 4; ++$i) {
+ $p1[] = round($box[$i*2]+$x);
+ $p1[] = round($box[$i*2+1]+$y);
+ }
+ $aBoundingBox = $p1;
+
+ // Debugging code to highlight the bonding box and bounding rectangle
+ // For text at 0 degrees the bounding box and bounding rectangle are the
+ // same
+ if( $debug ) {
+ // Draw the bounding rectangle and the bounding box
+
+ $p = array();
+ $p1 = array();
+
+ for($i=0; $i < 4; ++$i) {
+ $p[] = $bbox[$i*2]+$x ;
+ $p[] = $bbox[$i*2+1]+$y;
+ $p1[] = $box[$i*2]+$x ;
+ $p1[] = $box[$i*2+1]+$y ;
+ }
+
+ // Draw bounding box
+ $this->PushColor('green');
+ $this->Polygon($p1,true);
+ $this->PopColor();
+
+ // Draw bounding rectangle
+ $this->PushColor('darkgreen');
+ $this->Polygon($p,true);
+ $this->PopColor();
+
+ // Draw a cross at the anchor point
+ $this->PushColor('red');
+ $this->Line($ox-15,$oy,$ox+15,$oy);
+ $this->Line($ox,$oy-15,$ox,$oy+15);
+ $this->PopColor();
+ }
+ }
+ else {
+ // Format a text paragraph
+ $fh=$this->GetFontHeight();
+
+ // Line margin is 25% of font height
+ $linemargin=round($fh*$ConstLineSpacing);
+ $fh += $linemargin;
+ $w=$this->GetTextWidth($txt);
+
+ $y -= $linemargin/2;
+ $tmp = preg_split('/\n/',$txt);
+ $nl = count($tmp);
+ $h = $nl * $fh;
+
+ if( $this->text_halign=='right') {
+ $x -= $dir==0 ? $w : $h;
+ }
+ elseif( $this->text_halign=='center' ) {
+ $x -= $dir==0 ? $w/2 : $h/2;
+ }
+
+ if( $this->text_valign=='top' ) {
+ $y += $dir==0 ? $h : $w;
+ }
+ elseif( $this->text_valign=='center' ) {
+ $y += $dir==0 ? $h/2 : $w/2;
+ }
+
+ // Here comes a tricky bit.
+ // Since we have to give the position for the string at the
+ // baseline this means thaht text will move slightly up
+ // and down depending on any of it's character descend below
+ // the baseline, for example a 'g'. To adjust the Y-position
+ // we therefore adjust the text with the baseline Y-offset
+ // as used for the current font and size. This will keep the
+ // baseline at a fixed positoned disregarding the actual
+ // characters in the string.
+ $standardbox = $this->GetTTFBBox('Gg',$dir);
+ $yadj = $standardbox[1];
+ $xadj = $standardbox[0];
+ $aBoundingBox = array();
+ for($i=0; $i < $nl; ++$i) {
+ $wl = $this->GetTextWidth($tmp[$i]);
+ $bbox = $this->GetTTFBBox($tmp[$i],$dir);
+ if( $paragraph_align=='left' ) {
+ $xl = $x;
+ }
+ elseif( $paragraph_align=='right' ) {
+ $xl = $x + ($w-$wl);
+ }
+ else {
+ // Center
+ $xl = $x + $w/2 - $wl/2 ;
+ }
+
+ // In theory we should adjust with full pre-lead to get the lines
+ // lined up but this doesn't look good so therfore we only adjust with
+ // half th pre-lead
+ $xl -= $bbox[0]/2;
+ $yl = $y - $yadj;
+ //$xl = $xl- $xadj;
+ ImageTTFText($this->img, $this->font_size, $dir, $xl, $yl-($h-$fh)+$fh*$i,
+ $this->current_color,$this->font_file,$tmp[$i]);
+
+ // echo "xl=$xl,".$tmp[$i]."
";
+ if( $debug ) {
+ // Draw the bounding rectangle around each line
+ $box=@ImageTTFBBox($this->font_size,$dir,$this->font_file,$tmp[$i]);
+ $p = array();
+ for($j=0; $j < 4; ++$j) {
+ $p[] = $bbox[$j*2]+$xl;
+ $p[] = $bbox[$j*2+1]+$yl-($h-$fh)+$fh*$i;
+ }
+
+ // Draw bounding rectangle
+ $this->PushColor('darkgreen');
+ $this->Polygon($p,true);
+ $this->PopColor();
+ }
+ }
+
+ // Get the bounding box
+ $bbox = $this->GetBBoxTTF($txt,$dir);
+ for($j=0; $j < 4; ++$j) {
+ $bbox[$j*2]+= round($x);
+ $bbox[$j*2+1]+= round($y - ($h-$fh) - $yadj);
+ }
+ $aBoundingBox = $bbox;
+
if( $debug ) {
- // Draw the bounding rectangle and the bounding box
- $box=@ImageTTFBBox($this->font_size,$dir,$this->font_file,$txt);
- $p = array();
- $p1 = array();
- for($i=0; $i < 4; ++$i) {
- $p[] = $bbox[$i*2]+$x;
- $p[] = $bbox[$i*2+1]+$y;
- $p1[] = $box[$i*2]+$x;
- $p1[] = $box[$i*2+1]+$y;
- }
-
- // Draw bounding box
- $this->PushColor('green');
- $this->Polygon($p1,true);
- $this->PopColor();
-
- // Draw bounding rectangle
- $this->PushColor('darkgreen');
- $this->Polygon($p,true);
- $this->PopColor();
-
- // Draw a cross at the anchor point
- $this->PushColor('red');
- $this->Line($ox-15,$oy,$ox+15,$oy);
- $this->Line($ox,$oy-15,$ox,$oy+15);
- $this->PopColor();
- }
- }
- else {
- // Format a text paragraph
- $fh=$this->GetFontHeight();
-
- // Line margin is 25% of font height
- $linemargin=round($fh*$ConstLineSpacing);
- $fh += $linemargin;
- $w=$this->GetTextWidth($txt);
-
- $y -= $linemargin/2;
- $tmp = split("\n",$txt);
- $nl = count($tmp);
- $h = $nl * $fh;
-
- if( $this->text_halign=="right")
- $x -= $dir==0 ? $w : $h;
- elseif( $this->text_halign=="center" ) {
- $x -= $dir==0 ? $w/2 : $h/2;
- }
-
- if( $this->text_valign=="top" )
- $y += $dir==0 ? $h : $w;
- elseif( $this->text_valign=="center" )
- $y += $dir==0 ? $h/2 : $w/2;
-
- // Here comes a tricky bit.
- // Since we have to give the position for the string at the
- // baseline this means thaht text will move slightly up
- // and down depending on any of it's character descend below
- // the baseline, for example a 'g'. To adjust the Y-position
- // we therefore adjust the text with the baseline Y-offset
- // as used for the current font and size. This will keep the
- // baseline at a fixed positoned disregarding the actual
- // characters in the string.
- $standardbox = $this->GetTTFBBox('Gg',$dir);
- $yadj = $standardbox[1];
- $xadj = $standardbox[0];
- $aBoundingBox = array();
- for($i=0; $i < $nl; ++$i) {
- $wl = $this->GetTextWidth($tmp[$i]);
- $bbox = $this->GetTTFBBox($tmp[$i],$dir);
- if( $paragraph_align=="left" ) {
- $xl = $x;
- }
- elseif( $paragraph_align=="right" ) {
- $xl = $x + ($w-$wl);
- }
- else {
- // Center
- $xl = $x + $w/2 - $wl/2 ;
- }
-
- $xl -= $bbox[0];
- $yl = $y - $yadj;
- $xl = $xl - $xadj;
- ImageTTFText ($this->img, $this->font_size, $dir,
- $xl, $yl-($h-$fh)+$fh*$i,
- $this->current_color,$this->font_file,$tmp[$i]);
-
- if( $debug ) {
- // Draw the bounding rectangle around each line
- $box=@ImageTTFBBox($this->font_size,$dir,$this->font_file,$tmp[$i]);
- $p = array();
- for($j=0; $j < 4; ++$j) {
- $p[] = $bbox[$j*2]+$xl;
- $p[] = $bbox[$j*2+1]+$yl-($h-$fh)+$fh*$i;
- }
-
- // Draw bounding rectangle
- $this->PushColor('darkgreen');
- $this->Polygon($p,true);
- $this->PopColor();
- }
- }
-
- // Get the bounding box
- $bbox = $this->GetBBoxTTF($txt,$dir);
- for($j=0; $j < 4; ++$j) {
- $bbox[$j*2]+= round($x);
- $bbox[$j*2+1]+= round($y - ($h-$fh) - $yadj);
- }
- $aBoundingBox = $bbox;
-
- if( $debug ) {
- // Draw a cross at the anchor point
- $this->PushColor('red');
- $this->Line($ox-25,$oy,$ox+25,$oy);
- $this->Line($ox,$oy-25,$ox,$oy+25);
- $this->PopColor();
- }
+ // Draw a cross at the anchor point
+ $this->PushColor('red');
+ $this->Line($ox-25,$oy,$ox+25,$oy);
+ $this->Line($ox,$oy-25,$ox,$oy+25);
+ $this->PopColor();
+ }
- }
+ }
}
-
+
function StrokeText($x,$y,$txt,$dir=0,$paragraph_align="left",$debug=false) {
- $x = round($x);
- $y = round($y);
+ $x = round($x);
+ $y = round($y);
- // Do special language encoding
- $txt = $this->langconv->Convert($txt,$this->font_family);
+ // Do special language encoding
+ $txt = $this->langconv->Convert($txt,$this->font_family);
- if( !is_numeric($dir) )
- JpGraphError::RaiseL(25094);//(" Direction for text most be given as an angle between 0 and 90.");
-
- if( $this->font_family >= FF_FONT0 && $this->font_family <= FF_FONT2+1) {
- $this->_StrokeBuiltinFont($x,$y,$txt,$dir,$paragraph_align,$boundingbox,$debug);
- }
- elseif($this->font_family >= _FF_FIRST && $this->font_family <= _FF_LAST) {
- $this->_StrokeTTF($x,$y,$txt,$dir,$paragraph_align,$boundingbox,$debug);
- }
- else
- JpGraphError::RaiseL(25095);//(" Unknown font font family specification. ");
- return $boundingbox;
+ if( !is_numeric($dir) ) {
+ JpGraphError::RaiseL(25094);//(" Direction for text most be given as an angle between 0 and 90.");
+ }
+
+ if( $this->font_family >= FF_FONT0 && $this->font_family <= FF_FONT2+1) {
+ $this->_StrokeBuiltinFont($x,$y,$txt,$dir,$paragraph_align,$boundingbox,$debug);
+ }
+ elseif( $this->font_family >= _FIRST_FONT && $this->font_family <= _LAST_FONT) {
+ $this->_StrokeTTF($x,$y,$txt,$dir,$paragraph_align,$boundingbox,$debug);
+ }
+ else {
+ JpGraphError::RaiseL(25095);//(" Unknown font font family specification. ");
+ }
+ return $boundingbox;
}
-
+
function SetMargin($lm,$rm,$tm,$bm) {
- $this->left_margin=$lm;
- $this->right_margin=$rm;
- $this->top_margin=$tm;
- $this->bottom_margin=$bm;
- $this->plotwidth=$this->width - $this->left_margin-$this->right_margin ;
- $this->plotheight=$this->height - $this->top_margin-$this->bottom_margin ;
- if( $this->width > 0 && $this->height > 0 ) {
- if( $this->plotwidth < 0 || $this->plotheight < 0 )
- JpGraphError::raise("Too small plot area. ($lm,$rm,$tm,$bm : $this->plotwidth x $this->plotheight). With the given image size and margins there is to little space left for the plot. Increase the plot size or reduce the margins.");
- }
+ $this->left_margin=$lm;
+ $this->right_margin=$rm;
+ $this->top_margin=$tm;
+ $this->bottom_margin=$bm;
+ $this->plotwidth=$this->width - $this->left_margin-$this->right_margin ;
+ $this->plotheight=$this->height - $this->top_margin-$this->bottom_margin ;
+ if( $this->width > 0 && $this->height > 0 ) {
+ if( $this->plotwidth < 0 || $this->plotheight < 0 ) {
+ JpGraphError::RaiseL(25130, $this->plotwidth, $this->plotheight);
+ //JpGraphError::raise("To small plot area. ($lm,$rm,$tm,$bm : $this->plotwidth x $this->plotheight). With the given image size and margins there is to little space left for the plot. Increase the plot size or reduce the margins.");
+ }
+ }
}
function SetTransparent($color) {
- imagecolortransparent ($this->img,$this->rgb->allocate($color));
+ imagecolortransparent ($this->img,$this->rgb->allocate($color));
}
-
+
function SetColor($color,$aAlpha=0) {
- $this->current_color_name = $color;
- $this->current_color=$this->rgb->allocate($color,$aAlpha);
- if( $this->current_color == -1 ) {
- JpGraphError::RaiseL(25096);
-//("Can't allocate any more colors.");
- }
- return $this->current_color;
+ $this->current_color_name = $color;
+ $this->current_color=$this->rgb->allocate($color,$aAlpha);
+ if( $this->current_color == -1 ) {
+ $tc=imagecolorstotal($this->img);
+ JpGraphError::RaiseL(25096);
+ //("Can't allocate any more colors. Image has already allocated maximum of $tc colors. This might happen if you have anti-aliasing turned on together with a background image or perhaps gradient fill since this requires many, many colors. Try to turn off anti-aliasing. If there is still a problem try downgrading the quality of the background image to use a smaller pallete to leave some entries for your graphs. You should try to limit the number of colors in your background image to 64. If there is still problem set the constant DEFINE(\"USE_APPROX_COLORS\",true); in jpgraph.php This will use approximative colors when the palette is full. Unfortunately there is not much JpGraph can do about this since the palette size is a limitation of current graphic format and what the underlying GD library suppports.");
+ }
+ return $this->current_color;
}
-
+
function PushColor($color) {
- if( $color != "" ) {
- $this->colorstack[$this->colorstackidx]=$this->current_color_name;
- $this->colorstack[$this->colorstackidx+1]=$this->current_color;
- $this->colorstackidx+=2;
- $this->SetColor($color);
- }
- else {
- JpGraphError::RaiseL(25097);//("Color specified as empty string in PushColor().");
- }
+ if( $color != "" ) {
+ $this->colorstack[$this->colorstackidx]=$this->current_color_name;
+ $this->colorstack[$this->colorstackidx+1]=$this->current_color;
+ $this->colorstackidx+=2;
+ $this->SetColor($color);
+ }
+ else {
+ JpGraphError::RaiseL(25097);//("Color specified as empty string in PushColor().");
+ }
}
-
+
function PopColor() {
- if($this->colorstackidx<1)
- JpGraphError::RaiseL(25098);//(" Negative Color stack index. Unmatched call to PopColor()");
- $this->current_color=$this->colorstack[--$this->colorstackidx];
- $this->current_color_name=$this->colorstack[--$this->colorstackidx];
+ if( $this->colorstackidx < 1 ) {
+ JpGraphError::RaiseL(25098);//(" Negative Color stack index. Unmatched call to PopColor()");
+ }
+ $this->current_color=$this->colorstack[--$this->colorstackidx];
+ $this->current_color_name=$this->colorstack[--$this->colorstackidx];
}
-
-
+
+
function SetLineWeight($weight) {
- $this->line_weight = $weight;
+ $old = $this->line_weight;
+ imagesetthickness($this->img,$weight);
+ $this->line_weight = $weight;
+ return $old;
}
-
+
function SetStartPoint($x,$y) {
- $this->lastx=round($x);
- $this->lasty=round($y);
+ $this->lastx=round($x);
+ $this->lasty=round($y);
}
-
+
function Arc($cx,$cy,$w,$h,$s,$e) {
- // GD Arc doesn't like negative angles
- while( $s < 0) $s += 360;
- while( $e < 0) $e += 360;
-
- imagearc($this->img,round($cx),round($cy),round($w),round($h),
- $s,$e,$this->current_color);
- }
-
- function FilledArc($xc,$yc,$w,$h,$s,$e,$style="") {
-
- while( $s < 0 ) $s += 360;
- while( $e < 0 ) $e += 360;
- if( $style=="" )
- $style=IMG_ARC_PIE;
-
- // Workaround for bug in 4.4.7 which will not draw a correct 360
- // degree slice with any other angles than 0,360
- if( 360-abs($s-$e) < 0.01 ) {
- $s = 0;
- $e = 360;
- }
- if( abs($s-$e) > 0.001 ) {
- imagefilledarc($this->img,round($xc),round($yc),round($w),round($h),
- round($s),round($e),$this->current_color,$style);
- }
+ // GD Arc doesn't like negative angles
+ while( $s < 0) $s += 360;
+ while( $e < 0) $e += 360;
+ imagearc($this->img,round($cx),round($cy),round($w),round($h),$s,$e,$this->current_color);
+ }
+
+ function FilledArc($xc,$yc,$w,$h,$s,$e,$style='') {
+ $s = round($s);
+ $e = round($e);
+ while( $s < 0 ) $s += 360;
+ while( $e < 0 ) $e += 360;
+ if( $style=='' )
+ $style=IMG_ARC_PIE;
+ if( abs($s-$e) > 0 ) {
+ imagefilledarc($this->img,round($xc),round($yc),round($w),round($h),$s,$e,$this->current_color,$style);
+ }
}
function FilledCakeSlice($cx,$cy,$w,$h,$s,$e) {
- $this->CakeSlice($cx,$cy,$w,$h,$s,$e,$this->current_color_name);
+ $this->CakeSlice($cx,$cy,$w,$h,$s,$e,$this->current_color_name);
}
function CakeSlice($xc,$yc,$w,$h,$s,$e,$fillcolor="",$arccolor="") {
- $s = round($s); $e = round($e);
- $w = round($w); $h = round($h);
- $xc = round($xc); $yc = round($yc);
-
- if( $s==$e ) {
- // A full circle. We draw this a plain circle
- $this->PushColor($fillcolor);
- imagefilledellipse($this->img,$xc,$yc,2*$w,2*$h,$this->current_color);
- $this->PopColor();
- $this->PushColor($arccolor);
- imageellipse($this->img,$xc,$yc,2*$w,2*$h,$this->current_color);
- $this->Line($xc,$yc,cos($s*M_PI/180)*$w+$xc,$yc+sin($s*M_PI/180)*$h);
- $this->PopColor();
- }
- else {
- $this->PushColor($fillcolor);
- $this->FilledArc($xc,$yc,2*$w,2*$h,$s,$e);
- $this->PopColor();
- if( $arccolor != "" ) {
- $this->PushColor($arccolor);
- // We add 2 pixels to make the Arc() better aligned with the filled arc.
- imagefilledarc($this->img,$xc,$yc,2*$w,2*$h,$s,$e,$this->current_color,IMG_ARC_NOFILL | IMG_ARC_EDGED ) ;
-
- // Workaround for bug in 4.4.7 which will not draw a correct 360
- // degree slice with any other angles than 0,360. Unfortunately we cannot just
- // adjust the angles since the interior ar edge is drawn correct but not the surrounding
- // circle. This workaround can only be used with perfect circle shaped arcs
- if( PHP_VERSION==='4.4.7' && (360-abs($s-$e) < 0.01 && $w==$h) ) {
- $this->Circle($xc,$yc,$w);
- }
- $this->PopColor();
- }
- }
+ $s = round($s); $e = round($e);
+ $w = round($w); $h = round($h);
+ $xc = round($xc); $yc = round($yc);
+ if( $s == $e ) {
+ // A full circle. We draw this a plain circle
+ $this->PushColor($fillcolor);
+ imagefilledellipse($this->img,$xc,$yc,2*$w,2*$h,$this->current_color);
+
+ // If antialiasing is used then we often don't have any color no the surrounding
+ // arc. So, we need to check for this special case so we don't send an empty
+ // color to the push function. In this case we use the fill color for the arc as well
+ if( $arccolor != '' ) {
+ $this->PopColor();
+ $this->PushColor($arccolor);
+ }
+ imageellipse($this->img,$xc,$yc,2*$w,2*$h,$this->current_color);
+ $this->Line($xc,$yc,cos($s*M_PI/180)*$w+$xc,$yc+sin($s*M_PI/180)*$h);
+ $this->PopColor();
+ }
+ else {
+ $this->PushColor($fillcolor);
+ $this->FilledArc($xc,$yc,2*$w,2*$h,$s,$e);
+ $this->PopColor();
+ if( $arccolor != "" ) {
+ $this->PushColor($arccolor);
+ // We add 2 pixels to make the Arc() better aligned with
+ // the filled arc.
+ imagefilledarc($this->img,$xc,$yc,2*$w,2*$h,$s,$e,$this->current_color,IMG_ARC_NOFILL | IMG_ARC_EDGED ) ;
+ $this->PopColor();
+ }
+ }
}
function Ellipse($xc,$yc,$w,$h) {
- $this->Arc($xc,$yc,$w,$h,0,360);
- }
-
- // Breseham circle gives visually better result then using GD
- // built in arc(). It takes some more time but gives better
- // accuracy.
- function BresenhamCircle($xc,$yc,$r) {
- $d = 3-2*$r;
- $x = 0;
- $y = $r;
- while($x<=$y) {
- $this->Point($xc+$x,$yc+$y);
- $this->Point($xc+$x,$yc-$y);
- $this->Point($xc-$x,$yc+$y);
- $this->Point($xc-$x,$yc-$y);
-
- $this->Point($xc+$y,$yc+$x);
- $this->Point($xc+$y,$yc-$x);
- $this->Point($xc-$y,$yc+$x);
- $this->Point($xc-$y,$yc-$x);
-
- if( $d<0 ) $d += 4*$x+6;
- else {
- $d += 4*($x-$y)+10;
- --$y;
- }
- ++$x;
- }
+ $this->Arc($xc,$yc,$w,$h,0,360);
}
-
+
function Circle($xc,$yc,$r) {
- if( USE_BRESENHAM )
- $this->BresenhamCircle($xc,$yc,$r);
- else {
-
- /*
- // Some experimental code snippet to see if we can get a decent
- // result doing a trig-circle
- // Create an approximated circle with 0.05 rad resolution
- $end = 2*M_PI;
- $l = $r/10;
- if( $l < 3 ) $l=3;
- $step_size = 2*M_PI/(2*$r*M_PI/$l);
- $pts = array();
- $pts[] = $r + $xc;
- $pts[] = $yc;
- for( $a=$step_size; $a <= $end; $a += $step_size ) {
- $pts[] = round($xc + $r*cos($a));
- $pts[] = round($yc - $r*sin($a));
- }
- imagepolygon($this->img,$pts,count($pts)/2,$this->current_color);
- */
-
- $this->Arc($xc,$yc,$r*2,$r*2,0,360);
-
- // For some reason imageellipse() isn't in GD 2.0.1, PHP 4.1.1
- //imageellipse($this->img,$xc,$yc,$r,$r,$this->current_color);
- }
+ imageellipse($this->img,round($xc),round($yc),$r*2,$r*2,$this->current_color);
}
-
+
function FilledCircle($xc,$yc,$r) {
- imagefilledellipse($this->img,round($xc),round($yc),2*$r,2*$r,$this->current_color);
+ imagefilledellipse($this->img,round($xc),round($yc),2*$r,2*$r,$this->current_color);
}
-
+
// Linear Color InterPolation
function lip($f,$t,$p) {
- $p = round($p,1);
- $r = $f[0] + ($t[0]-$f[0])*$p;
- $g = $f[1] + ($t[1]-$f[1])*$p;
- $b = $f[2] + ($t[2]-$f[2])*$p;
- return array($r,$g,$b);
- }
-
- // Anti-aliased line.
- // Note that this is roughly 8 times slower then a normal line!
- function WuLine($x1,$y1,$x2,$y2) {
- // Get foreground line color
- $lc = imagecolorsforindex($this->img,$this->current_color);
- $lc = array($lc["red"],$lc["green"],$lc["blue"]);
-
- $dx = $x2-$x1;
- $dy = $y2-$y1;
-
- if( abs($dx) > abs($dy) ) {
- if( $dx<0 ) {
- $dx = -$dx;$dy = -$dy;
- $tmp=$x2;$x2=$x1;$x1=$tmp;
- $tmp=$y2;$y2=$y1;$y1=$tmp;
- }
- $x=$x1<<16; $y=$y1<<16;
- $yinc = ($dy*65535)/$dx;
- $first=true;
- while( ($x >> 16) < $x2 ) {
-
- $bc = @imagecolorsforindex($this->img,imagecolorat($this->img,$x>>16,$y>>16));
- if( $bc <= 0 ) {
- JpGraphError::RaiseL(25100);//('Problem with color palette and your GD setup. Please disable anti-aliasing or use GD2 with true-color. If you have GD2 library installed please make sure that you have set the USE_GD2 constant to true and that truecolor is enabled.');
- }
- $bc=array($bc["red"],$bc["green"],$bc["blue"]);
-
- $this->SetColor($this->lip($lc,$bc,($y & 0xFFFF)/65535));
- imagesetpixel($this->img,$x>>16,$y>>16,$this->current_color);
- $this->SetColor($this->lip($lc,$bc,(~$y & 0xFFFF)/65535));
- if( !$first )
- imagesetpixel($this->img,$x>>16,($y>>16)+1,$this->current_color);
- $x += 65536; $y += $yinc;
- $first=false;
- }
- }
- else {
- if( $dy<0 ) {
- $dx = -$dx;$dy = -$dy;
- $tmp=$x2;$x2=$x1;$x1=$tmp;
- $tmp=$y2;$y2=$y1;$y1=$tmp;
- }
- $x=$x1<<16; $y=$y1<<16;
- $xinc = ($dx*65535)/$dy;
- $first = true;
- while( ($y >> 16) < $y2 ) {
-
- $bc = @imagecolorsforindex($this->img,imagecolorat($this->img,$x>>16,$y>>16));
- if( $bc <= 0 ) {
- JpGraphError::RaiseL(25100);//('Problem with color palette and your GD setup. Please disable anti-aliasing or use GD2 with true-color. If you have GD2 library installed please make sure that you have set the USE_GD2 constant to true and truecolor is enabled.');
-
- }
-
- $bc=array($bc["red"],$bc["green"],$bc["blue"]);
-
- $this->SetColor($this->lip($lc,$bc,($x & 0xFFFF)/65535));
- imagesetpixel($this->img,$x>>16,$y>>16,$this->current_color);
- $this->SetColor($this->lip($lc,$bc,(~$x & 0xFFFF)/65535));
- if( !$first )
- imagesetpixel($this->img,($x>>16)+1,$y>>16,$this->current_color);
- $y += 65536; $x += $xinc;
- $first = false;
- }
- }
- $this->SetColor($lc);
- //imagesetpixel($this->img,$x2,$y2,$this->current_color);
- //imagesetpixel($this->img,$x1,$y1,$this->current_color);
+ $p = round($p,1);
+ $r = $f[0] + ($t[0]-$f[0])*$p;
+ $g = $f[1] + ($t[1]-$f[1])*$p;
+ $b = $f[2] + ($t[2]-$f[2])*$p;
+ return array($r,$g,$b);
}
// Set line style dashed, dotted etc
function SetLineStyle($s) {
- if( is_numeric($s) ) {
- if( $s<1 || $s>4 )
- JpGraphError::RaiseL(25101,$s);//(" Illegal numeric argument to SetLineStyle(): ($s)");
- }
- elseif( is_string($s) ) {
- if( $s == "solid" ) $s=1;
- elseif( $s == "dotted" ) $s=2;
- elseif( $s == "dashed" ) $s=3;
- elseif( $s == "longdashed" ) $s=4;
- else JpGraphError::RaiseL(25102,$s);//(" Illegal string argument to SetLineStyle(): $s");
- }
- else {
- JpGraphError::RaiseL(25103,$s);//(" Illegal argument to SetLineStyle $s");
- }
- $old = $this->line_style;
- $this->line_style=$s;
- return $old;
+ if( is_numeric($s) ) {
+ if( $s<1 || $s>4 ) {
+ JpGraphError::RaiseL(25101,$s);//(" Illegal numeric argument to SetLineStyle(): ($s)");
+ }
+ }
+ elseif( is_string($s) ) {
+ if( $s == "solid" ) $s=1;
+ elseif( $s == "dotted" ) $s=2;
+ elseif( $s == "dashed" ) $s=3;
+ elseif( $s == "longdashed" ) $s=4;
+ else {
+ JpGraphError::RaiseL(25102,$s);//(" Illegal string argument to SetLineStyle(): $s");
+ }
+ }
+ else {
+ JpGraphError::RaiseL(25103,$s);//(" Illegal argument to SetLineStyle $s");
+ }
+ $old = $this->line_style;
+ $this->line_style=$s;
+ return $old;
}
-
+
// Same as Line but take the line_style into account
- function StyleLine($x1,$y1,$x2,$y2) {
- switch( $this->line_style ) {
- case 1:// Solid
- $this->Line($x1,$y1,$x2,$y2);
- break;
- case 2: // Dotted
- $this->DashedLine($x1,$y1,$x2,$y2,1,6);
- break;
- case 3: // Dashed
- $this->DashedLine($x1,$y1,$x2,$y2,2,4);
- break;
- case 4: // Longdashes
- $this->DashedLine($x1,$y1,$x2,$y2,8,6);
- break;
- default:
- JpGraphError::RaiseL(25104,$this->line_style);//(" Unknown line style: $this->line_style ");
- break;
- }
+ function StyleLine($x1,$y1,$x2,$y2,$aStyle='') {
+ if( $this->line_weight <= 0 ) return;
+
+ if( $aStyle === '' ) {
+ $aStyle = $this->line_style;
+ }
+
+ // Add error check since dashed line will only work if anti-alias is disabled
+ // this is a limitation in GD
+
+ if( $aStyle == 1 ) {
+ // Solid style. We can handle anti-aliasing for this
+ $this->Line($x1,$y1,$x2,$y2);
+ }
+ else {
+ // Since the GD routines doesn't handle AA for styled line
+ // we have no option than to turn it off to get any lines at
+ // all if the weight > 1
+ $oldaa = $this->GetAntiAliasing();
+ if( $oldaa && $this->line_weight > 1 ) {
+ $this->SetAntiAliasing(false);
+ }
+
+ switch( $aStyle ) {
+ case 2: // Dotted
+ $this->DashedLine($x1,$y1,$x2,$y2,2,6);
+ break;
+ case 3: // Dashed
+ $this->DashedLine($x1,$y1,$x2,$y2,5,9);
+ break;
+ case 4: // Longdashes
+ $this->DashedLine($x1,$y1,$x2,$y2,9,13);
+ break;
+ default:
+ JpGraphError::RaiseL(25104,$this->line_style);//(" Unknown line style: $this->line_style ");
+ break;
+ }
+ if( $oldaa ) {
+ $this->SetAntiAliasing(true);
+ }
+ }
+ }
+
+ function DashedLine($x1,$y1,$x2,$y2,$dash_length=1,$dash_space=4) {
+
+ if( $this->line_weight <= 0 ) return;
+
+ // Add error check to make sure anti-alias is not enabled.
+ // Dashed line does not work with anti-alias enabled. This
+ // is a limitation in GD.
+ if( $this->use_anti_aliasing ) {
+ JpGraphError::RaiseL(25129); // Anti-alias can not be used with dashed lines. Please disable anti-alias or use solid lines.
+ }
+
+
+ $x1 = round($x1);
+ $x2 = round($x2);
+ $y1 = round($y1);
+ $y2 = round($y2);
+
+ $style = array_fill(0,$dash_length,$this->current_color);
+ $style = array_pad($style,$dash_space,IMG_COLOR_TRANSPARENT);
+ imagesetstyle($this->img, $style);
+ imageline($this->img, $x1, $y1, $x2, $y2, IMG_COLOR_STYLED);
+ $this->lastx = $x2;
+ $this->lasty = $y2;
}
function Line($x1,$y1,$x2,$y2) {
- $x1 = round($x1);
- $x2 = round($x2);
- $y1 = round($y1);
- $y2 = round($y2);
-
- if( $this->line_weight==0 ) return;
- if( $this->use_anti_aliasing ) {
- $dx = $x2-$x1;
- $dy = $y2-$y1;
- // Vertical, Horizontal or 45 lines don't need anti-aliasing
- if( $dx!=0 && $dy!=0 && $dx!=$dy ) {
- $this->WuLine($x1,$y1,$x2,$y2);
- return;
- }
- }
- if( $this->line_weight==1 ) {
- imageline($this->img,$x1,$y1,$x2,$y2,$this->current_color);
- }
- elseif( $x1==$x2 ) { // Special case for vertical lines
- imageline($this->img,$x1,$y1,$x2,$y2,$this->current_color);
- $w1=floor($this->line_weight/2);
- $w2=floor(($this->line_weight-1)/2);
- for($i=1; $i<=$w1; ++$i)
- imageline($this->img,$x1+$i,$y1,$x2+$i,$y2,$this->current_color);
- for($i=1; $i<=$w2; ++$i)
- imageline($this->img,$x1-$i,$y1,$x2-$i,$y2,$this->current_color);
- }
- elseif( $y1==$y2 ) { // Special case for horizontal lines
- imageline($this->img,$x1,$y1,$x2,$y2,$this->current_color);
- $w1=floor($this->line_weight/2);
- $w2=floor(($this->line_weight-1)/2);
- for($i=1; $i<=$w1; ++$i)
- imageline($this->img,$x1,$y1+$i,$x2,$y2+$i,$this->current_color);
- for($i=1; $i<=$w2; ++$i)
- imageline($this->img,$x1,$y1-$i,$x2,$y2-$i,$this->current_color);
- }
- else { // General case with a line at an angle
- $a = atan2($y1-$y2,$x2-$x1);
- // Now establish some offsets from the center. This gets a little
- // bit involved since we are dealing with integer functions and we
- // want the apperance to be as smooth as possible and never be thicker
- // then the specified width.
-
- // We do the trig stuff to make sure that the endpoints of the line
- // are perpendicular to the line itself.
- $dx=(sin($a)*$this->line_weight/2);
- $dy=(cos($a)*$this->line_weight/2);
-
- $pnts = array(round($x2+$dx),round($y2+$dy),round($x2-$dx),round($y2-$dy),
- round($x1-$dx),round($y1-$dy),round($x1+$dx),round($y1+$dy));
- imagefilledpolygon($this->img,$pnts,count($pnts)/2,$this->current_color);
- }
- $this->lastx=$x2; $this->lasty=$y2;
+ if( $this->line_weight <= 0 ) return;
+
+ $x1 = round($x1);
+ $x2 = round($x2);
+ $y1 = round($y1);
+ $y2 = round($y2);
+
+ imageline($this->img,$x1,$y1,$x2,$y2,$this->current_color);
+ $this->lastx=$x2;
+ $this->lasty=$y2;
}
function Polygon($p,$closed=FALSE,$fast=FALSE) {
- if( $this->line_weight==0 ) return;
- $n=count($p);
- $oldx = $p[0];
- $oldy = $p[1];
- if( $fast ) {
- for( $i=2; $i < $n; $i+=2 ) {
- imageline($this->img,$oldx,$oldy,$p[$i],$p[$i+1],$this->current_color);
- $oldx = $p[$i];
- $oldy = $p[$i+1];
- }
- if( $closed ) {
- imageline($this->img,$p[$n*2-2],$p[$n*2-1],$p[0],$p[1],$this->current_color);
- }
- }
- else {
- for( $i=2; $i < $n; $i+=2 ) {
- $this->StyleLine($oldx,$oldy,$p[$i],$p[$i+1]);
- $oldx = $p[$i];
- $oldy = $p[$i+1];
- }
- if( $closed )
- $this->Line($oldx,$oldy,$p[0],$p[1]);
- }
+
+ if( $this->line_weight <= 0 ) return;
+
+ $n=count($p);
+ $oldx = $p[0];
+ $oldy = $p[1];
+ if( $fast ) {
+ for( $i=2; $i < $n; $i+=2 ) {
+ imageline($this->img,$oldx,$oldy,$p[$i],$p[$i+1],$this->current_color);
+ $oldx = $p[$i];
+ $oldy = $p[$i+1];
+ }
+ if( $closed ) {
+ imageline($this->img,$p[$n*2-2],$p[$n*2-1],$p[0],$p[1],$this->current_color);
+ }
+ }
+ else {
+ for( $i=2; $i < $n; $i+=2 ) {
+ $this->StyleLine($oldx,$oldy,$p[$i],$p[$i+1]);
+ $oldx = $p[$i];
+ $oldy = $p[$i+1];
+ }
+ if( $closed ) {
+ $this->StyleLine($oldx,$oldy,$p[0],$p[1]);
+ }
+ }
}
-
+
function FilledPolygon($pts) {
- $n=count($pts);
- if( $n == 0 ) {
- JpGraphError::RaiseL(25105);//('NULL data specified for a filled polygon. Check that your data is not NULL.');
- }
- for($i=0; $i < $n; ++$i)
- $pts[$i] = round($pts[$i]);
- imagefilledpolygon($this->img,$pts,count($pts)/2,$this->current_color);
+ $n=count($pts);
+ if( $n == 0 ) {
+ JpGraphError::RaiseL(25105);//('NULL data specified for a filled polygon. Check that your data is not NULL.');
+ }
+ for($i=0; $i < $n; ++$i) {
+ $pts[$i] = round($pts[$i]);
+ }
+ $old = $this->line_weight;
+ imagesetthickness($this->img,1);
+ imagefilledpolygon($this->img,$pts,count($pts)/2,$this->current_color);
+ $this->line_weight = $old;
+ imagesetthickness($this->img,$old);
}
-
+
function Rectangle($xl,$yu,$xr,$yl) {
- $this->Polygon(array($xl,$yu,$xr,$yu,$xr,$yl,$xl,$yl,$xl,$yu));
+ $this->Polygon(array($xl,$yu,$xr,$yu,$xr,$yl,$xl,$yl,$xl,$yu));
}
-
+
function FilledRectangle($xl,$yu,$xr,$yl) {
- $this->FilledPolygon(array($xl,$yu,$xr,$yu,$xr,$yl,$xl,$yl));
+ $this->FilledPolygon(array($xl,$yu,$xr,$yu,$xr,$yl,$xl,$yl));
}
function FilledRectangle2($xl,$yu,$xr,$yl,$color1,$color2,$style=1) {
- // Fill a rectangle with lines of two colors
- if( $style===1 ) {
- // Horizontal stripe
- if( $yl < $yu ) {
- $t = $yl; $yl=$yu; $yu=$t;
- }
- for( $y=$yu; $y <= $yl; ++$y) {
- $this->SetColor($color1);
- $this->Line($xl,$y,$xr,$y);
- ++$y;
- $this->SetColor($color2);
- $this->Line($xl,$y,$xr,$y);
- }
- }
- else {
- if( $xl < $xl ) {
- $t = $xl; $xl=$xr; $xr=$t;
- }
- for( $x=$xl; $x <= $xr; ++$x) {
- $this->SetColor($color1);
- $this->Line($x,$yu,$x,$yl);
- ++$x;
- $this->SetColor($color2);
- $this->Line($x,$yu,$x,$yl);
- }
- }
+ // Fill a rectangle with lines of two colors
+ if( $style===1 ) {
+ // Horizontal stripe
+ if( $yl < $yu ) {
+ $t = $yl; $yl=$yu; $yu=$t;
+ }
+ for( $y=$yu; $y <= $yl; ++$y) {
+ $this->SetColor($color1);
+ $this->Line($xl,$y,$xr,$y);
+ ++$y;
+ $this->SetColor($color2);
+ $this->Line($xl,$y,$xr,$y);
+ }
+ }
+ else {
+ if( $xl < $xl ) {
+ $t = $xl; $xl=$xr; $xr=$t;
+ }
+ for( $x=$xl; $x <= $xr; ++$x) {
+ $this->SetColor($color1);
+ $this->Line($x,$yu,$x,$yl);
+ ++$x;
+ $this->SetColor($color2);
+ $this->Line($x,$yu,$x,$yl);
+ }
+ }
}
- function ShadowRectangle($xl,$yu,$xr,$yl,$fcolor=false,$shadow_width=3,$shadow_color=array(102,102,102)) {
- // This is complicated by the fact that we must also handle the case where
+ function ShadowRectangle($xl,$yu,$xr,$yl,$fcolor=false,$shadow_width=4,$shadow_color='darkgray',$useAlpha=true) {
+ // This is complicated by the fact that we must also handle the case where
// the reactangle has no fill color
- $this->PushColor($shadow_color);
- $this->FilledRectangle($xr-$shadow_width,$yu+$shadow_width,$xr,$yl-$shadow_width-1);
- $this->FilledRectangle($xl+$shadow_width,$yl-$shadow_width,$xr,$yl);
- //$this->FilledRectangle($xl+$shadow_width,$yu+$shadow_width,$xr,$yl);
- $this->PopColor();
- if( $fcolor==false )
- $this->Rectangle($xl,$yu,$xr-$shadow_width-1,$yl-$shadow_width-1);
- else {
- $this->PushColor($fcolor);
- $this->FilledRectangle($xl,$yu,$xr-$shadow_width-1,$yl-$shadow_width-1);
- $this->PopColor();
- $this->Rectangle($xl,$yu,$xr-$shadow_width-1,$yl-$shadow_width-1);
- }
+ $xl = floor($xl);
+ $yu = floor($yu);
+ $xr = floor($xr);
+ $yl = floor($yl);
+ $this->PushColor($shadow_color);
+ $shadowAlpha=0;
+ $this->SetLineWeight(1);
+ $this->SetLineStyle('solid');
+ $basecolor = $this->rgb->Color($shadow_color);
+ $shadow_color = array($basecolor[0],$basecolor[1],$basecolor[2],);
+ for( $i=0; $i < $shadow_width; ++$i ) {
+ $this->SetColor($shadow_color,$shadowAlpha);
+ $this->Line($xr-$shadow_width+$i, $yu+$shadow_width,
+ $xr-$shadow_width+$i, $yl-$shadow_width-1+$i);
+ $this->Line($xl+$shadow_width, $yl-$shadow_width+$i,
+ $xr-$shadow_width+$i, $yl-$shadow_width+$i);
+ if( $useAlpha ) $shadowAlpha += 1.0/$shadow_width;
+ }
+
+ $this->PopColor();
+ if( $fcolor==false ) {
+ $this->Rectangle($xl,$yu,$xr-$shadow_width-1,$yl-$shadow_width-1);
+ }
+ else {
+ $this->PushColor($fcolor);
+ $this->FilledRectangle($xl,$yu,$xr-$shadow_width-1,$yl-$shadow_width-1);
+ $this->PopColor();
+ $this->Rectangle($xl,$yu,$xr-$shadow_width-1,$yl-$shadow_width-1);
+ }
}
function FilledRoundedRectangle($xt,$yt,$xr,$yl,$r=5) {
- if( $r==0 ) {
- $this->FilledRectangle($xt,$yt,$xr,$yl);
- return;
- }
-
- // To avoid overlapping fillings (which will look strange
- // when alphablending is enabled) we have no choice but
- // to fill the five distinct areas one by one.
-
- // Center square
- $this->FilledRectangle($xt+$r,$yt+$r,$xr-$r,$yl-$r);
- // Top band
- $this->FilledRectangle($xt+$r,$yt,$xr-$r,$yt+$r-1);
- // Bottom band
- $this->FilledRectangle($xt+$r,$yl-$r+1,$xr-$r,$yl);
- // Left band
- $this->FilledRectangle($xt,$yt+$r+1,$xt+$r-1,$yl-$r);
- // Right band
- $this->FilledRectangle($xr-$r+1,$yt+$r,$xr,$yl-$r);
-
- // Topleft & Topright arc
- $this->FilledArc($xt+$r,$yt+$r,$r*2,$r*2,180,270);
- $this->FilledArc($xr-$r,$yt+$r,$r*2,$r*2,270,360);
-
- // Bottomleft & Bottom right arc
- $this->FilledArc($xt+$r,$yl-$r,$r*2,$r*2,90,180);
- $this->FilledArc($xr-$r,$yl-$r,$r*2,$r*2,0,90);
+ if( $r==0 ) {
+ $this->FilledRectangle($xt,$yt,$xr,$yl);
+ return;
+ }
+
+ // To avoid overlapping fillings (which will look strange
+ // when alphablending is enabled) we have no choice but
+ // to fill the five distinct areas one by one.
+
+ // Center square
+ $this->FilledRectangle($xt+$r,$yt+$r,$xr-$r,$yl-$r);
+ // Top band
+ $this->FilledRectangle($xt+$r,$yt,$xr-$r,$yt+$r);
+ // Bottom band
+ $this->FilledRectangle($xt+$r,$yl-$r,$xr-$r,$yl);
+ // Left band
+ $this->FilledRectangle($xt,$yt+$r,$xt+$r,$yl-$r);
+ // Right band
+ $this->FilledRectangle($xr-$r,$yt+$r,$xr,$yl-$r);
+
+ // Topleft & Topright arc
+ $this->FilledArc($xt+$r,$yt+$r,$r*2,$r*2,180,270);
+ $this->FilledArc($xr-$r,$yt+$r,$r*2,$r*2,270,360);
+
+ // Bottomleft & Bottom right arc
+ $this->FilledArc($xt+$r,$yl-$r,$r*2,$r*2,90,180);
+ $this->FilledArc($xr-$r,$yl-$r,$r*2,$r*2,0,90);
}
- function RoundedRectangle($xt,$yt,$xr,$yl,$r=5) {
-
- if( $r==0 ) {
- $this->Rectangle($xt,$yt,$xr,$yl);
- return;
- }
-
- // Top & Bottom line
- $this->Line($xt+$r,$yt,$xr-$r,$yt);
- $this->Line($xt+$r,$yl,$xr-$r,$yl);
-
- // Left & Right line
- $this->Line($xt,$yt+$r,$xt,$yl-$r);
- $this->Line($xr,$yt+$r,$xr,$yl-$r);
-
- // Topleft & Topright arc
- $this->Arc($xt+$r,$yt+$r,$r*2,$r*2,180,270);
- $this->Arc($xr-$r,$yt+$r,$r*2,$r*2,270,360);
-
- // Bottomleft & Bottomright arc
- $this->Arc($xt+$r,$yl-$r,$r*2,$r*2,90,180);
- $this->Arc($xr-$r,$yl-$r,$r*2,$r*2,0,90);
+ function RoundedRectangle($xt,$yt,$xr,$yl,$r=5) {
+
+ if( $r==0 ) {
+ $this->Rectangle($xt,$yt,$xr,$yl);
+ return;
+ }
+
+ // Top & Bottom line
+ $this->Line($xt+$r,$yt,$xr-$r,$yt);
+ $this->Line($xt+$r,$yl,$xr-$r,$yl);
+
+ // Left & Right line
+ $this->Line($xt,$yt+$r,$xt,$yl-$r);
+ $this->Line($xr,$yt+$r,$xr,$yl-$r);
+
+ // Topleft & Topright arc
+ $this->Arc($xt+$r,$yt+$r,$r*2,$r*2,180,270);
+ $this->Arc($xr-$r,$yt+$r,$r*2,$r*2,270,360);
+
+ // Bottomleft & Bottomright arc
+ $this->Arc($xt+$r,$yl-$r,$r*2,$r*2,90,180);
+ $this->Arc($xr-$r,$yl-$r,$r*2,$r*2,0,90);
}
function FilledBevel($x1,$y1,$x2,$y2,$depth=2,$color1='white@0.4',$color2='darkgray@0.4') {
- $this->FilledRectangle($x1,$y1,$x2,$y2);
- $this->Bevel($x1,$y1,$x2,$y2,$depth,$color1,$color2);
+ $this->FilledRectangle($x1,$y1,$x2,$y2);
+ $this->Bevel($x1,$y1,$x2,$y2,$depth,$color1,$color2);
}
function Bevel($x1,$y1,$x2,$y2,$depth=2,$color1='white@0.4',$color2='black@0.5') {
- $this->PushColor($color1);
- for( $i=0; $i < $depth; ++$i ) {
- $this->Line($x1+$i,$y1+$i,$x1+$i,$y2-$i);
- $this->Line($x1+$i,$y1+$i,$x2-$i,$y1+$i);
- }
- $this->PopColor();
-
- $this->PushColor($color2);
- for( $i=0; $i < $depth; ++$i ) {
- $this->Line($x1+$i,$y2-$i,$x2-$i,$y2-$i);
- $this->Line($x2-$i,$y1+$i,$x2-$i,$y2-$i-1);
- }
- $this->PopColor();
+ $this->PushColor($color1);
+ for( $i=0; $i < $depth; ++$i ) {
+ $this->Line($x1+$i,$y1+$i,$x1+$i,$y2-$i);
+ $this->Line($x1+$i,$y1+$i,$x2-$i,$y1+$i);
+ }
+ $this->PopColor();
+
+ $this->PushColor($color2);
+ for( $i=0; $i < $depth; ++$i ) {
+ $this->Line($x1+$i,$y2-$i,$x2-$i,$y2-$i);
+ $this->Line($x2-$i,$y1+$i,$x2-$i,$y2-$i-1);
+ }
+ $this->PopColor();
}
function StyleLineTo($x,$y) {
- $this->StyleLine($this->lastx,$this->lasty,$x,$y);
- $this->lastx=$x;
- $this->lasty=$y;
+ $this->StyleLine($this->lastx,$this->lasty,$x,$y);
+ $this->lastx=$x;
+ $this->lasty=$y;
}
-
+
function LineTo($x,$y) {
- $this->Line($this->lastx,$this->lasty,$x,$y);
- $this->lastx=$x;
- $this->lasty=$y;
+ $this->Line($this->lastx,$this->lasty,$x,$y);
+ $this->lastx=$x;
+ $this->lasty=$y;
}
-
+
function Point($x,$y) {
- imagesetpixel($this->img,round($x),round($y),$this->current_color);
+ imagesetpixel($this->img,round($x),round($y),$this->current_color);
}
-
+
function Fill($x,$y) {
- imagefill($this->img,round($x),round($y),$this->current_color);
+ imagefill($this->img,round($x),round($y),$this->current_color);
}
function FillToBorder($x,$y,$aBordColor) {
- $bc = $this->rgb->allocate($aBordColor);
- if( $bc == -1 ) {
- JpGraphError::RaiseL(25106);//('Image::FillToBorder : Can not allocate more colors');
- }
- imagefilltoborder($this->img,round($x),round($y),$bc,$this->current_color);
+ $bc = $this->rgb->allocate($aBordColor);
+ if( $bc == -1 ) {
+ JpGraphError::RaiseL(25106);//('Image::FillToBorder : Can not allocate more colors');
+ }
+ imagefilltoborder($this->img,round($x),round($y),$bc,$this->current_color);
}
-
- function DashedLine($x1,$y1,$x2,$y2,$dash_length=1,$dash_space=4) {
-
- $x1 = round($x1);
- $x2 = round($x2);
- $y1 = round($y1);
- $y2 = round($y2);
-
- // Code based on, but not identical to, work by Ariel Garza and James Pine
- $line_length = ceil (sqrt(pow(($x2 - $x1),2) + pow(($y2 - $y1),2)) );
- $dx = ($line_length) ? ($x2 - $x1) / $line_length : 0;
- $dy = ($line_length) ? ($y2 - $y1) / $line_length : 0;
- $lastx = $x1; $lasty = $y1;
- $xmax = max($x1,$x2);
- $xmin = min($x1,$x2);
- $ymax = max($y1,$y2);
- $ymin = min($y1,$y2);
- for ($i = 0; $i < $line_length; $i += ($dash_length + $dash_space)) {
- $x = ($dash_length * $dx) + $lastx;
- $y = ($dash_length * $dy) + $lasty;
-
- // The last section might overshoot so we must take a computational hit
- // and check this.
- if( $x>$xmax ) $x=$xmax;
- if( $y>$ymax ) $y=$ymax;
-
- if( $x<$xmin ) $x=$xmin;
- if( $y<$ymin ) $y=$ymin;
-
- $this->Line($lastx,$lasty,$x,$y);
- $lastx = $x + ($dash_space * $dx);
- $lasty = $y + ($dash_space * $dy);
- }
- }
function SetExpired($aFlg=true) {
- $this->expired = $aFlg;
+ $this->expired = $aFlg;
}
-
+
// Generate image header
function Headers() {
-
- // In case we are running from the command line with the client version of
- // PHP we can't send any headers.
- $sapi = php_sapi_name();
- if( $sapi == 'cli' )
- return;
-
- // These parameters are set by headers_sent() but they might cause
- // an undefined variable error unless they are initilized
- $file='';
- $lineno='';
- if( headers_sent($file,$lineno) ) {
- $file=basename($file);
- $t = new ErrMsgText();
- $msg = $t->Get(10,$file,$lineno);
- die($msg);
- }
-
- if ($this->expired) {
- header("Expires: Mon, 26 Jul 1997 05:00:00 GMT");
- header("Last-Modified: " . gmdate("D, d M Y H:i:s") . "GMT");
- header("Cache-Control: no-cache, must-revalidate");
- header("Pragma: no-cache");
- }
- header("Content-type: image/$this->img_format");
+
+ // In case we are running from the command line with the client version of
+ // PHP we can't send any headers.
+ $sapi = php_sapi_name();
+ if( $sapi == 'cli' ) return;
+
+ // These parameters are set by headers_sent() but they might cause
+ // an undefined variable error unless they are initilized
+ $file='';
+ $lineno='';
+ if( headers_sent($file,$lineno) ) {
+ $file=basename($file);
+ $t = new ErrMsgText();
+ $msg = $t->Get(10,$file,$lineno);
+ die($msg);
+ }
+
+ if ($this->expired) {
+ header("Expires: Mon, 26 Jul 1997 05:00:00 GMT");
+ header("Last-Modified: " . gmdate("D, d M Y H:i:s") . "GMT");
+ header("Cache-Control: no-cache, must-revalidate");
+ header("Pragma: no-cache");
+ }
+ header("Content-type: image/$this->img_format");
}
// Adjust image quality for formats that allow this
function SetQuality($q) {
- $this->quality = $q;
+ $this->quality = $q;
}
-
+
// Stream image to browser or to file
function Stream($aFile="") {
- $func="image".$this->img_format;
- if( $this->img_format=="jpeg" && $this->quality != null ) {
- $res = @$func($this->img,$aFile,$this->quality);
- }
- else {
- if( $aFile != "" ) {
- $res = @$func($this->img,$aFile);
- if( !$res )
- JpGraphError::RaiseL(25107,$aFile);//("Can't write to file '$aFile'. Check that the process running PHP has enough permission.");
- }
- else {
- $res = @$func($this->img);
- if( !$res )
- JpGraphError::RaiseL(25108);//("Can't stream image. This is most likely due to a faulty PHP/GD setup. Try to recompile PHP and use the built-in GD library that comes with PHP.");
-
- }
- }
+ $func="image".$this->img_format;
+ if( $this->img_format=="jpeg" && $this->quality != null ) {
+ $res = @$func($this->img,$aFile,$this->quality);
+ }
+ else {
+ if( $aFile != "" ) {
+ $res = @$func($this->img,$aFile);
+ if( !$res ) {
+ JpGraphError::RaiseL(25107,$aFile);//("Can't write to file '$aFile'. Check that the process running PHP has enough permission.");
+ }
+ }
+ else {
+ $res = @$func($this->img);
+ if( !$res ) {
+ JpGraphError::RaiseL(25108);//("Can't stream image. This is most likely due to a faulty PHP/GD setup. Try to recompile PHP and use the built-in GD library that comes with PHP.");
+ }
+
+ }
+ }
}
-
- // Clear resource tide up by image
+
+ // Clear resources used by image (this is normally not used since all resources are/should be
+ // returned when the script terminates
function Destroy() {
- imagedestroy($this->img);
+ imagedestroy($this->img);
}
-
+
// Specify image format. Note depending on your installation
// of PHP not all formats may be supported.
- function SetImgFormat($aFormat,$aQuality=75) {
- $this->quality = $aQuality;
- $aFormat = strtolower($aFormat);
- $tst = true;
- $supported = imagetypes();
- if( $aFormat=="auto" ) {
- if( $supported & IMG_PNG )
- $this->img_format="png";
- elseif( $supported & IMG_JPG )
- $this->img_format="jpeg";
- elseif( $supported & IMG_GIF )
- $this->img_format="gif";
- elseif( $supported & IMG_WBMP )
- $this->img_format="wbmp";
- elseif( $supported & IMG_XPM )
- $this->img_format="xpm";
- else
- JpGraphError::RaiseL(25109);//("Your PHP (and GD-lib) installation does not appear to support any known graphic formats. You need to first make sure GD is compiled as a module to PHP. If you also want to use JPEG images you must get the JPEG library. Please see the PHP docs for details.");
-
- return true;
- }
- else {
- if( $aFormat=="jpeg" || $aFormat=="png" || $aFormat=="gif" || $aFormat=="wbmp" || $aFormat=="xpm") {
- if( $aFormat=="jpeg" && !($supported & IMG_JPG) )
- $tst=false;
- elseif( $aFormat=="png" && !($supported & IMG_PNG) )
- $tst=false;
- elseif( $aFormat=="gif" && !($supported & IMG_GIF) )
- $tst=false;
- elseif( $aFormat=="wbmp" && !($supported & IMG_WBMP) )
- $tst=false;
- elseif( $aFormat=="xpm" && !($supported & IMG_XPM) )
- $tst=false;
- else {
- $this->img_format=$aFormat;
- return true;
- }
- }
- else
- $tst=false;
- if( !$tst )
- JpGraphError::RaiseL(25110,$aFormat);//(" Your PHP installation does not support the chosen graphic format: $aFormat");
- }
- }
+ function SetImgFormat($aFormat,$aQuality=75) {
+ $this->quality = $aQuality;
+ $aFormat = strtolower($aFormat);
+ $tst = true;
+ $supported = imagetypes();
+ if( $aFormat=="auto" ) {
+ if( $supported & IMG_PNG ) $this->img_format="png";
+ elseif( $supported & IMG_JPG ) $this->img_format="jpeg";
+ elseif( $supported & IMG_GIF ) $this->img_format="gif";
+ elseif( $supported & IMG_WBMP ) $this->img_format="wbmp";
+ elseif( $supported & IMG_XPM ) $this->img_format="xpm";
+ else {
+ JpGraphError::RaiseL(25109);//("Your PHP (and GD-lib) installation does not appear to support any known graphic formats. You need to first make sure GD is compiled as a module to PHP. If you also want to use JPEG images you must get the JPEG library. Please see the PHP docs for details.");
+ }
+ return true;
+ }
+ else {
+ if( $aFormat=="jpeg" || $aFormat=="png" || $aFormat=="gif" ) {
+ if( $aFormat=="jpeg" && !($supported & IMG_JPG) ) $tst=false;
+ elseif( $aFormat=="png" && !($supported & IMG_PNG) ) $tst=false;
+ elseif( $aFormat=="gif" && !($supported & IMG_GIF) ) $tst=false;
+ elseif( $aFormat=="wbmp" && !($supported & IMG_WBMP) ) $tst=false;
+ elseif( $aFormat=="xpm" && !($supported & IMG_XPM) ) $tst=false;
+ else {
+ $this->img_format=$aFormat;
+ return true;
+ }
+ }
+ else {
+ $tst=false;
+ }
+ if( !$tst ) {
+ JpGraphError::RaiseL(25110,$aFormat);//(" Your PHP installation does not support the chosen graphic format: $aFormat");
+ }
+ }
+ }
} // CLASS
//===================================================
@@ -2008,154 +1653,369 @@
// a specified angle around a specified rotation point.
//===================================================
class RotImage extends Image {
- var $m=array();
- var $a=0;
- var $dx=0,$dy=0,$transx=0,$transy=0;
-
- function RotImage($aWidth,$aHeight,$a=0,$aFormat=DEFAULT_GFORMAT,$aSetAutoMargin=true) {
- $this->Image($aWidth,$aHeight,$aFormat,$aSetAutoMargin);
- $this->dx=$this->left_margin+$this->plotwidth/2;
- $this->dy=$this->top_margin+$this->plotheight/2;
- $this->SetAngle($a);
+ public $a=0;
+ public $dx=0,$dy=0,$transx=0,$transy=0;
+ private $m=array();
+
+ function __construct($aWidth,$aHeight,$a=0,$aFormat=DEFAULT_GFORMAT,$aSetAutoMargin=true) {
+ parent::__construct($aWidth,$aHeight,$aFormat,$aSetAutoMargin);
+ $this->dx=$this->left_margin+$this->plotwidth/2;
+ $this->dy=$this->top_margin+$this->plotheight/2;
+ $this->SetAngle($a);
}
-
+
function SetCenter($dx,$dy) {
- $old_dx = $this->dx;
- $old_dy = $this->dy;
- $this->dx=$dx;
- $this->dy=$dy;
- $this->SetAngle($this->a);
- return array($old_dx,$old_dy);
+ $old_dx = $this->dx;
+ $old_dy = $this->dy;
+ $this->dx=$dx;
+ $this->dy=$dy;
+ $this->SetAngle($this->a);
+ return array($old_dx,$old_dy);
}
-
+
function SetTranslation($dx,$dy) {
- $old = array($this->transx,$this->transy);
- $this->transx = $dx;
- $this->transy = $dy;
- return $old;
+ $old = array($this->transx,$this->transy);
+ $this->transx = $dx;
+ $this->transy = $dy;
+ return $old;
}
function UpdateRotMatrice() {
- $a = $this->a;
- $a *= M_PI/180;
- $sa=sin($a); $ca=cos($a);
- // Create the rotation matrix
- $this->m[0][0] = $ca;
- $this->m[0][1] = -$sa;
- $this->m[0][2] = $this->dx*(1-$ca) + $sa*$this->dy ;
- $this->m[1][0] = $sa;
- $this->m[1][1] = $ca;
- $this->m[1][2] = $this->dy*(1-$ca) - $sa*$this->dx ;
+ $a = $this->a;
+ $a *= M_PI/180;
+ $sa=sin($a); $ca=cos($a);
+ // Create the rotation matrix
+ $this->m[0][0] = $ca;
+ $this->m[0][1] = -$sa;
+ $this->m[0][2] = $this->dx*(1-$ca) + $sa*$this->dy ;
+ $this->m[1][0] = $sa;
+ $this->m[1][1] = $ca;
+ $this->m[1][2] = $this->dy*(1-$ca) - $sa*$this->dx ;
}
function SetAngle($a) {
- $tmp = $this->a;
- $this->a = $a;
- $this->UpdateRotMatrice();
- return $tmp;
+ $tmp = $this->a;
+ $this->a = $a;
+ $this->UpdateRotMatrice();
+ return $tmp;
}
function Circle($xc,$yc,$r) {
- // Circle get's rotated through the Arc() call
- // made in the parent class
- parent::Circle($xc,$yc,$r);
+ list($xc,$yc) = $this->Rotate($xc,$yc);
+ parent::Circle($xc,$yc,$r);
}
function FilledCircle($xc,$yc,$r) {
- list($xc,$yc) = $this->Rotate($xc,$yc);
- parent::FilledCircle($xc,$yc,$r);
+ list($xc,$yc) = $this->Rotate($xc,$yc);
+ parent::FilledCircle($xc,$yc,$r);
}
-
+
+
function Arc($xc,$yc,$w,$h,$s,$e) {
- list($xc,$yc) = $this->Rotate($xc,$yc);
- $s += $this->a;
- $e += $this->a;
- parent::Arc($xc,$yc,$w,$h,$s,$e);
+ list($xc,$yc) = $this->Rotate($xc,$yc);
+ $s += $this->a;
+ $e += $this->a;
+ parent::Arc($xc,$yc,$w,$h,$s,$e);
}
- function FilledArc($xc,$yc,$w,$h,$s,$e) {
- list($xc,$yc) = $this->Rotate($xc,$yc);
- $s += $this->a;
- $e += $this->a;
- parent::FilledArc($xc,$yc,$w,$h,$s,$e);
+ function FilledArc($xc,$yc,$w,$h,$s,$e,$style='') {
+ list($xc,$yc) = $this->Rotate($xc,$yc);
+ $s += $this->a;
+ $e += $this->a;
+ parent::FilledArc($xc,$yc,$w,$h,$s,$e);
}
function SetMargin($lm,$rm,$tm,$bm) {
- parent::SetMargin($lm,$rm,$tm,$bm);
- $this->dx=$this->left_margin+$this->plotwidth/2;
- $this->dy=$this->top_margin+$this->plotheight/2;
- $this->UpdateRotMatrice();
+ parent::SetMargin($lm,$rm,$tm,$bm);
+ $this->dx=$this->left_margin+$this->plotwidth/2;
+ $this->dy=$this->top_margin+$this->plotheight/2;
+ $this->UpdateRotMatrice();
}
-
+
function Rotate($x,$y) {
- // Optimization. Ignore rotation if Angle==0 || ANgle==360
- if( $this->a == 0 || $this->a == 360 ) {
- return array($x + $this->transx, $y + $this->transy );
- }
- else {
- $x1=round($this->m[0][0]*$x + $this->m[0][1]*$y,1) + $this->m[0][2] + $this->transx;
- $y1=round($this->m[1][0]*$x + $this->m[1][1]*$y,1) + $this->m[1][2] + $this->transy;
- return array($x1,$y1);
- }
+ // Optimization. Ignore rotation if Angle==0 || Angle==360
+ if( $this->a == 0 || $this->a == 360 ) {
+ return array($x + $this->transx, $y + $this->transy );
+ }
+ else {
+ $x1=round($this->m[0][0]*$x + $this->m[0][1]*$y,1) + $this->m[0][2] + $this->transx;
+ $y1=round($this->m[1][0]*$x + $this->m[1][1]*$y,1) + $this->m[1][2] + $this->transy;
+ return array($x1,$y1);
+ }
}
function CopyMerge($fromImg,$toX,$toY,$fromX,$fromY,$toWidth,$toHeight,$fromWidth=-1,$fromHeight=-1,$aMix=100) {
- list($toX,$toY) = $this->Rotate($toX,$toY);
- parent::CopyMerge($fromImg,$toX,$toY,$fromX,$fromY,$toWidth,$toHeight,$fromWidth,$fromHeight,$aMix);
+ list($toX,$toY) = $this->Rotate($toX,$toY);
+ parent::CopyMerge($fromImg,$toX,$toY,$fromX,$fromY,$toWidth,$toHeight,$fromWidth,$fromHeight,$aMix);
}
-
+
function ArrRotate($pnts) {
- $n = count($pnts)-1;
- for($i=0; $i < $n; $i+=2) {
- list ($x,$y) = $this->Rotate($pnts[$i],$pnts[$i+1]);
- $pnts[$i] = $x; $pnts[$i+1] = $y;
- }
- return $pnts;
+ $n = count($pnts)-1;
+ for($i=0; $i < $n; $i+=2) {
+ list ($x,$y) = $this->Rotate($pnts[$i],$pnts[$i+1]);
+ $pnts[$i] = $x; $pnts[$i+1] = $y;
+ }
+ return $pnts;
+ }
+
+ function DashedLine($x1,$y1,$x2,$y2,$dash_length=1,$dash_space=4) {
+ list($x1,$y1) = $this->Rotate($x1,$y1);
+ list($x2,$y2) = $this->Rotate($x2,$y2);
+ parent::DashedLine($x1,$y1,$x2,$y2,$dash_length,$dash_space);
}
-
+
function Line($x1,$y1,$x2,$y2) {
- list($x1,$y1) = $this->Rotate($x1,$y1);
- list($x2,$y2) = $this->Rotate($x2,$y2);
- parent::Line($x1,$y1,$x2,$y2);
+ list($x1,$y1) = $this->Rotate($x1,$y1);
+ list($x2,$y2) = $this->Rotate($x2,$y2);
+ parent::Line($x1,$y1,$x2,$y2);
}
function Rectangle($x1,$y1,$x2,$y2) {
- // Rectangle uses Line() so it will be rotated through that call
- parent::Rectangle($x1,$y1,$x2,$y2);
+ // Rectangle uses Line() so it will be rotated through that call
+ parent::Rectangle($x1,$y1,$x2,$y2);
}
-
+
function FilledRectangle($x1,$y1,$x2,$y2) {
- if( $y1==$y2 || $x1==$x2 )
- $this->Line($x1,$y1,$x2,$y2);
- else
- $this->FilledPolygon(array($x1,$y1,$x2,$y1,$x2,$y2,$x1,$y2));
- }
-
- function Polygon($pnts,$closed=FALSE,$fast=false) {
- // Polygon uses Line() so it will be rotated through that call unless
- // fast drawing routines are used in which case a rotate is needed
- if( $fast ) {
- parent::Polygon($this->ArrRotate($pnts));
- }
- else
- parent::Polygon($pnts,$closed,$fast);
+ if( $y1==$y2 || $x1==$x2 )
+ $this->Line($x1,$y1,$x2,$y2);
+ else
+ $this->FilledPolygon(array($x1,$y1,$x2,$y1,$x2,$y2,$x1,$y2));
}
-
+
+ function Polygon($pnts,$closed=FALSE,$fast=FALSE) {
+ // Polygon uses Line() so it will be rotated through that call unless
+ // fast drawing routines are used in which case a rotate is needed
+ if( $fast ) {
+ parent::Polygon($this->ArrRotate($pnts));
+ }
+ else {
+ parent::Polygon($pnts,$closed,$fast);
+ }
+ }
+
function FilledPolygon($pnts) {
- parent::FilledPolygon($this->ArrRotate($pnts));
+ parent::FilledPolygon($this->ArrRotate($pnts));
}
-
+
function Point($x,$y) {
- list($xp,$yp) = $this->Rotate($x,$y);
- parent::Point($xp,$yp);
+ list($xp,$yp) = $this->Rotate($x,$y);
+ parent::Point($xp,$yp);
}
-
+
function StrokeText($x,$y,$txt,$dir=0,$paragraph_align="left",$debug=false) {
- list($xp,$yp) = $this->Rotate($x,$y);
- return parent::StrokeText($xp,$yp,$txt,$dir,$paragraph_align,$debug);
+ list($xp,$yp) = $this->Rotate($x,$y);
+ return parent::StrokeText($xp,$yp,$txt,$dir,$paragraph_align,$debug);
}
}
+//=======================================================================
+// CLASS ImgStreamCache
+// Description: Handle caching of graphs to files. All image output goes
+// through this class
+//=======================================================================
+class ImgStreamCache {
+ private $cache_dir, $timeout=0; // Infinite timeout
+ //---------------
+ // CONSTRUCTOR
+ function __construct($aCacheDir=CACHE_DIR) {
+ $this->cache_dir = $aCacheDir;
+ }
+
+ //---------------
+ // PUBLIC METHODS
+
+ // Specify a timeout (in minutes) for the file. If the file is older then the
+ // timeout value it will be overwritten with a newer version.
+ // If timeout is set to 0 this is the same as infinite large timeout and if
+ // timeout is set to -1 this is the same as infinite small timeout
+ function SetTimeout($aTimeout) {
+ $this->timeout=$aTimeout;
+ }
+
+ // Output image to browser and also write it to the cache
+ function PutAndStream($aImage,$aCacheFileName,$aInline,$aStrokeFileName) {
+
+ // Check if we should always stroke the image to a file
+ if( _FORCE_IMGTOFILE ) {
+ $aStrokeFileName = _FORCE_IMGDIR.GenImgName();
+ }
+
+ if( $aStrokeFileName != '' ) {
+
+ if( $aStrokeFileName == 'auto' ) {
+ $aStrokeFileName = GenImgName();
+ }
+
+ if( file_exists($aStrokeFileName) ) {
+
+ // Wait for lock (to make sure no readers are trying to access the image)
+ $fd = fopen($aStrokeFileName,'w');
+ $lock = flock($fd, LOCK_EX);
+
+ // Since the image write routines only accepts a filename which must not
+ // exist we need to delete the old file first
+ if( !@unlink($aStrokeFileName) ) {
+ $lock = flock($fd, LOCK_UN);
+ JpGraphError::RaiseL(25111,$aStrokeFileName);
+ //(" Can't delete cached image $aStrokeFileName. Permission problem?");
+ }
+ $aImage->Stream($aStrokeFileName);
+ $lock = flock($fd, LOCK_UN);
+ fclose($fd);
+
+ }
+ else {
+ $aImage->Stream($aStrokeFileName);
+ }
+
+ return;
+ }
+
+ if( $aCacheFileName != '' && USE_CACHE) {
+
+ $aCacheFileName = $this->cache_dir . $aCacheFileName;
+ if( file_exists($aCacheFileName) ) {
+ if( !$aInline ) {
+ // If we are generating image off-line (just writing to the cache)
+ // and the file exists and is still valid (no timeout)
+ // then do nothing, just return.
+ $diff=time()-filemtime($aCacheFileName);
+ if( $diff < 0 ) {
+ JpGraphError::RaiseL(25112,$aCacheFileName);
+ //(" Cached imagefile ($aCacheFileName) has file date in the future!!");
+ }
+ if( $this->timeout>0 && ($diff <= $this->timeout*60) ) return;
+ }
+
+ // Wait for lock (to make sure no readers are trying to access the image)
+ $fd = fopen($aCacheFileName,'w');
+ $lock = flock($fd, LOCK_EX);
+
+ if( !@unlink($aCacheFileName) ) {
+ $lock = flock($fd, LOCK_UN);
+ JpGraphError::RaiseL(25113,$aStrokeFileName);
+ //(" Can't delete cached image $aStrokeFileName. Permission problem?");
+ }
+ $aImage->Stream($aCacheFileName);
+ $lock = flock($fd, LOCK_UN);
+ fclose($fd);
+
+ }
+ else {
+ $this->MakeDirs(dirname($aCacheFileName));
+ if( !is_writeable(dirname($aCacheFileName)) ) {
+ JpGraphError::RaiseL(25114,$aCacheFileName);
+ //('PHP has not enough permissions to write to the cache file '.$aCacheFileName.'. Please make sure that the user running PHP has write permission for this file if you wan to use the cache system with JpGraph.');
+ }
+ $aImage->Stream($aCacheFileName);
+ }
+
+ $res=true;
+ // Set group to specified
+ if( CACHE_FILE_GROUP != '' ) {
+ $res = @chgrp($aCacheFileName,CACHE_FILE_GROUP);
+ }
+ if( CACHE_FILE_MOD != '' ) {
+ $res = @chmod($aCacheFileName,CACHE_FILE_MOD);
+ }
+ if( !$res ) {
+ JpGraphError::RaiseL(25115,$aStrokeFileName);
+ //(" Can't set permission for cached image $aStrokeFileName. Permission problem?");
+ }
+
+ $aImage->Destroy();
+ if( $aInline ) {
+ if ($fh = @fopen($aCacheFileName, "rb") ) {
+ $aImage->Headers();
+ fpassthru($fh);
+ return;
+ }
+ else {
+ JpGraphError::RaiseL(25116,$aFile);//(" Cant open file from cache [$aFile]");
+ }
+ }
+ }
+ elseif( $aInline ) {
+ $aImage->Headers();
+ $aImage->Stream();
+ return;
+ }
+ }
+
+ function IsValid($aCacheFileName) {
+ $aCacheFileName = $this->cache_dir.$aCacheFileName;
+ if ( USE_CACHE && file_exists($aCacheFileName) ) {
+ $diff=time()-filemtime($aCacheFileName);
+ if( $this->timeout>0 && ($diff > $this->timeout*60) ) {
+ return false;
+ }
+ else {
+ return true;
+ }
+ }
+ else {
+ return false;
+ }
+ }
+
+ function StreamImgFile($aImage,$aCacheFileName) {
+ $aCacheFileName = $this->cache_dir.$aCacheFileName;
+ if ( $fh = @fopen($aCacheFileName, 'rb') ) {
+ $lock = flock($fh, LOCK_SH);
+ $aImage->Headers();
+ fpassthru($fh);
+ $lock = flock($fh, LOCK_UN);
+ fclose($fh);
+ return true;
+ }
+ else {
+ JpGraphError::RaiseL(25117,$aCacheFileName);//(" Can't open cached image \"$aCacheFileName\" for reading.");
+ }
+ }
+
+ // Check if a given image is in cache and in that case
+ // pass it directly on to web browser. Return false if the
+ // image file doesn't exist or exists but is to old
+ function GetAndStream($aImage,$aCacheFileName) {
+ if( $this->Isvalid($aCacheFileName) ) {
+ $this->StreamImgFile($aImage,$aCacheFileName);
+ }
+ else {
+ return false;
+ }
+ }
+
+ //---------------
+ // PRIVATE METHODS
+ // Create all necessary directories in a path
+ function MakeDirs($aFile) {
+ $dirs = array();
+ // In order to better work when open_basedir is enabled
+ // we do not create directories in the root path
+ while ( $aFile != '/' && !(file_exists($aFile)) ) {
+ $dirs[] = $aFile.'/';
+ $aFile = dirname($aFile);
+ }
+ for ($i = sizeof($dirs)-1; $i>=0; $i--) {
+ if(! @mkdir($dirs[$i],0777) ) {
+ JpGraphError::RaiseL(25118,$aFile);//(" Can't create directory $aFile. Make sure PHP has write permission to this directory.");
+ }
+ // We also specify mode here after we have changed group.
+ // This is necessary if Apache user doesn't belong the
+ // default group and hence can't specify group permission
+ // in the previous mkdir() call
+ if( CACHE_FILE_GROUP != "" ) {
+ $res=true;
+ $res =@chgrp($dirs[$i],CACHE_FILE_GROUP);
+ $res = @chmod($dirs[$i],0777);
+ if( !$res ) {
+ JpGraphError::RaiseL(25119,$aFile);//(" Can't set permissions for $aFile. Permission problems?");
+ }
+ }
+ }
+ return true;
+ }
+} // CLASS Cache
?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_balls.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_balls.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_balls.inc.php 2007-03-23 15:12:08.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_balls.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,1062 +1,1060 @@
'imgdata_large',
- MARK_IMG_MBALL => 'imgdata_small',
- MARK_IMG_SBALL => 'imgdata_xsmall',
- MARK_IMG_BALL => 'imgdata_xsmall');
- var $colors_1 = array('blue','lightblue','brown','darkgreen',
- 'green','purple','red','gray','yellow','silver','gray');
- var $index_1 = array('blue'=>9,'lightblue'=>1,'brown'=>6,'darkgreen'=>7,
- 'green'=>8,'purple'=>4,'red'=>0,'gray'=>5,'silver'=>3,'yellow'=>2);
- var $maxidx_1 = 9 ;
-
- var $colors_2 = array('blue','bluegreen','brown','cyan',
- 'darkgray','greengray','gray','green',
- 'greenblue','lightblue','lightred',
- 'purple','red','white','yellow');
-
-
- var $index_2 = array('blue'=>9,'bluegreen'=>13,'brown'=>8,'cyan'=>12,
- 'darkgray'=>5,'greengray'=>6,'gray'=>2,'green'=>10,
- 'greenblue'=>3,'lightblue'=>1,'lightred'=>14,
- 'purple'=>7,'red'=>0,'white'=>11,'yellow'=>4);
-
- var $maxidx_2 = 14 ;
-
-
- var $colors_3 = array('bluegreen','cyan','darkgray','greengray',
- 'gray','graypurple','green','greenblue','lightblue',
- 'lightred','navy','orange','purple','red','yellow');
-
- var $index_3 = array('bluegreen'=>1,'cyan'=>11,'darkgray'=>14,'greengray'=>10,
- 'gray'=>3,'graypurple'=>4,'green'=>9,'greenblue'=>7,
- 'lightblue'=>13,'lightred'=>0,'navy'=>2,'orange'=>12,
- 'purple'=>8,'red'=>5,'yellow'=>6);
- var $maxidx_3 = 14 ;
-
- var $colors,$index,$maxidx;
- var $imgdata_large ;
- var $imgdata_small ;
- var $imgdata_xsmall ;
+ protected $name = 'Round Balls';
+ protected $an = array(MARK_IMG_LBALL => 'imgdata_large',
+ MARK_IMG_MBALL => 'imgdata_small',
+ MARK_IMG_SBALL => 'imgdata_xsmall',
+ MARK_IMG_BALL => 'imgdata_xsmall');
+ protected $colors,$index,$maxidx;
+ private $colors_1 = array('blue','lightblue','brown','darkgreen',
+ 'green','purple','red','gray','yellow','silver','gray');
+ private $index_1 = array('blue'=>9,'lightblue'=>1,'brown'=>6,'darkgreen'=>7,
+ 'green'=>8,'purple'=>4,'red'=>0,'gray'=>5,'silver'=>3,'yellow'=>2);
+ private $maxidx_1 = 9 ;
+
+ private $colors_2 = array('blue','bluegreen','brown','cyan',
+ 'darkgray','greengray','gray','green',
+ 'greenblue','lightblue','lightred',
+ 'purple','red','white','yellow');
+
+
+ private $index_2 = array('blue'=>9,'bluegreen'=>13,'brown'=>8,'cyan'=>12,
+ 'darkgray'=>5,'greengray'=>6,'gray'=>2,'green'=>10,
+ 'greenblue'=>3,'lightblue'=>1,'lightred'=>14,
+ 'purple'=>7,'red'=>0,'white'=>11,'yellow'=>4);
+
+ private $maxidx_2 = 14 ;
+
+
+ private $colors_3 = array('bluegreen','cyan','darkgray','greengray',
+ 'gray','graypurple','green','greenblue','lightblue',
+ 'lightred','navy','orange','purple','red','yellow');
+
+ private $index_3 = array('bluegreen'=>1,'cyan'=>11,'darkgray'=>14,'greengray'=>10,
+ 'gray'=>3,'graypurple'=>4,'green'=>9,'greenblue'=>7,
+ 'lightblue'=>13,'lightred'=>0,'navy'=>2,'orange'=>12,
+ 'purple'=>8,'red'=>5,'yellow'=>6);
+ private $maxidx_3 = 14 ;
+
+ protected $imgdata_large, $imgdata_small, $imgdata_xsmall ;
function GetImg($aMark,$aIdx) {
- switch( $aMark ) {
- case MARK_IMG_SBALL:
- case MARK_IMG_BALL:
- $this->colors = $this->colors_3;
- $this->index = $this->index_3 ;
- $this->maxidx = $this->maxidx_3 ;
- break;
- case MARK_IMG_MBALL:
- $this->colors = $this->colors_2;
- $this->index = $this->index_2 ;
- $this->maxidx = $this->maxidx_2 ;
- break;
- default:
- $this->colors = $this->colors_1;
- $this->index = $this->index_1 ;
- $this->maxidx = $this->maxidx_1 ;
- break;
- }
- return parent::GetImg($aMark,$aIdx);
+ switch( $aMark ) {
+ case MARK_IMG_SBALL:
+ case MARK_IMG_BALL:
+ $this->colors = $this->colors_3;
+ $this->index = $this->index_3 ;
+ $this->maxidx = $this->maxidx_3 ;
+ break;
+ case MARK_IMG_MBALL:
+ $this->colors = $this->colors_2;
+ $this->index = $this->index_2 ;
+ $this->maxidx = $this->maxidx_2 ;
+ break;
+ default:
+ $this->colors = $this->colors_1;
+ $this->index = $this->index_1 ;
+ $this->maxidx = $this->maxidx_1 ;
+ break;
+ }
+ return parent::GetImg($aMark,$aIdx);
}
- function ImgData_Balls() {
+ function __construct() {
-//==========================================================
-// File: bl_red.png
-//==========================================================
- $this->imgdata_large[0][0]= 1072 ;
- $this->imgdata_large[0][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAAByF'.
- 'BMVEX/////////xsb/vb3/lIz/hIT/e3v/c3P/c2v/a2v/Y2P/'.
- 'UlL/Skr/SkL/Qjn/MTH/MSn/KSn/ISH/IRj/GBj/GBD/EBD/EA'.
- 'j/CAj/CAD/AAD3QkL3MTH3KSn3KSH3GBj3EBD3CAj3AAD1zMzv'.
- 'QkLvISHvIRjvGBjvEBDvEAjvAADnUlLnSkrnMTnnKSnnIRjnGB'.
- 'DnEBDnCAjnAADec3PeSkreISHeGBjeGBDeEAjWhITWa2vWUlLW'.
- 'SkrWISnWGBjWEBDWEAjWCAjWAADOnp7Oa2vOGCHOGBjOGBDOEB'.
- 'DOCAjOAADJrq7Gt7fGGBjGEBDGCAjGAADEpKS/v7+9QkK9GBC9'.
- 'EBC9CAi9AAC1e3u1a2u1Skq1KSm1EBC1CAi1AACtEBCtCBCtCA'.
- 'itAACngYGlCAilAACghIScOTmcCAicAACYgYGUGAiUCAiUAAiU'.
- 'AACMKSmMEACMAACEa2uEGAiEAAB7GBh7CAB7AABzOTlzGBBzCA'.
- 'BzAABrSkprOTlrGBhrAABjOTljAABaQkJaOTlaCABaAABSKSlS'.
- 'GBhSAABKKSlKGBhKAABCGBhCCABCAAA5CAA5AAAxCAAxAAApCA'.
- 'ApAAAhAAAYAACc9eRyAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgF'.
- 'HUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkRFD'.
- 'UHLytKAAAB4UlEQVR4nGNgIAK4mGjrmNq6BmFIWMmISUpKSmk5'.
- 'B8ZEokj4qoiLiQCBgqald3xaBpKMj6y4sLCQkJCIvIaFV0RaUR'.
- 'lCSk5cWEiAn19ASN7QwisuraihHiajKyEixM/NwckjoKrvEACU'.
- 'qumpg7pAUlREiJdNmZmLT9/cMzwps7Smc3I2WEpGUkxYkJuFiY'.
- 'lTxszePzY1v7Shc2oX2D+K4iLCgjzsrOw8embuYUmZeTVtPVOn'.
- 'gqSslYAOF+Ln4ZHWtXMPTcjMrWno7J82rRgoZWOsqaCgrqaqqm'.
- 'fn5peQmlsK1DR52vRaoFSIs5GRoYG5ub27n19CYm5pdVPnxKnT'.
- 'pjWDpLydnZwcHTz8QxMSEnJLgDL9U6dNnQ6Sio4PDAgICA+PTU'.
- 'zNzSkph8hADIxKS46Pj0tKTc3MLSksqWrtmQySAjuDIT8rKy0r'.
- 'Kz+vtLSmur6jb9JUIJgGdjxDQUVRUVFpaUVNQ1NrZ9+kKVOmTZ'.
- 'k6vR0sldJUAwQNTU2dnX0TgOJTQLrSIYFY2dPW1NbW2TNxwtQp'.
- 'U6ZMmjJt2rRGWNB3TO7vnzh5MsgSoB6gy7sREdY7bRrQEDAGOb'.
- 'wXOQW0TJsOEpwClmxBTTbZ7UDVIPkp7dkYaYqhuLa5trYYUxwL'.
- 'AADzm6uekAAcXAAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bl_bluegreen.png
-//==========================================================
- $this->imgdata_large[1][0]= 1368 ;
- $this->imgdata_large[1][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAYAAACpSkzOAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
- 'B3RJTUUH0wMMFi8hE9b2uAAABOVJREFUeNq9lk2sJFUVx3+3qv'.
- 'tW95t57zFvhiFxmCFRUJRoNCQiJARMhiFx/Igxii5goTG6ZDAu'.
- '/EhcSCIrTAgLEiKsJ8ywABNZEMJXEDYCukAmjgjzBkK/j35V1d'.
- '333FtV97io97pfzwxfG86qcu/N+Z3zP+fcW/Apmfk4hx57+R/6'.
- 'Rqmc9ykhsWjlsUngAA1fXIQ7b73pI/186IGHnn9dH/8frC8v4I'.
- 'PiG53uaerR4GmKkv31mB8cyfjd946ZTwR66qVX9OTWIi8UKUv9'.
- 'BOrZXpYZvFeiBvzI0fgSUSFKwbVG+Pl1V3HH0VvNR4KeeukV/f'.
- 'PmMmdHhst76aXD64AbeVQ9bjNHaiGOC2o3wLrAb2/4LL/84ffn'.
- 'fCdzkOdayKpLppBemrBsU5Y1Zdmm9LJdGU6E/t4M24Q26jRDRL'.
- 'j3mdc49cSTekFsMzs5XuTsyLDUNSDQ25NwKOly9YIl22MYhJr/'.
- 'uoDtBBoT0CxBRGYOAhibIaOCe//2MpfM6KHnX9cXipSlbkKWmS'.
- 'nk9iv38J0jixw7vJfrTMYBOvhSoQHJBS09ANELloAGDxW8tfoW'.
- 'J+5/UC8CPS0LU7r3SpYarr7M8rmFjMPLXT6/33L4si7Z2GCrQC'.
- '+0ctlOaNs9DReV8vSLr85ndPLpZ/WNvHW+01kAVFBOGvJx0wYg'.
- 'Sp47RIQ4Emwa8FGJXlDxSCFo5YlVgAo2hwPue/hRndboTV3EW2'.
- 'Wp3k6wBp8q56QiWzecW6vwQfnPRkAWhFgILnq08jQ+R2nlUzzN'.
- 'uES9Q7Vd+9fba7NmWJW61db2247qACmcjxXr45psYphsFGSLBu'.
- 'kIajxqtjNwHkvAjQt0sg3crhPA2+fPz0CuyNFOghsGsr19mnFg'.
- 'DGwrRm8UoAtNmQPQtRXDgdC4HImCFEKcCE0oieUWUYq2LtbiGp'.
- 'mBQmppfIkjw45DK0QNNkvQ0jMBtPL0UnDRM1rN+cxKwzvOo2NP'.
- 'tykR9a1kfpZNDLMG6QDYJqCTBvUe1+uxs+YKyPoGrTwY2HhvC4'.
- 'CDWQd5d4xNApNQEEMgjgLdUCLBQ5cprL/trwNwKG2IUmDqDFd5'.
- 'sr5BWrlxuSdLDFEFlqAzXGc4zFjupqh6uqYihpxJcEgp026l2w'.
- '7wFUv7Z6AvrfRo/n0OYzPwIKE3HUKAJg2otMBiElnsF7wngis9'.
- '3ZDjNnLi7huCWUZfueZKTu/M0V3HvmkOFDVxVKDG04ScejSgW5'.
- 'V0q5JYFEghuDLHlTmToqDeGOCKIVtrW9hsdmXufEcNLPSXuPHa'.
- 'a+bvuh9df5AH/v5PDFmbWQC3Mx+TVvfGVTRB2CodNgT2JBX003'.
- 'aANZAYS/BxCv32TV/l2C03G7jgmfjGiT/qmeEmibEYm7XzAO2k'.
- 'A+pbgHhBgydqu54YO5eRiLCy7yDvPP6Xqf+5Z+Lu277OYuOpiw'.
- 'H15oBmlNOMcmK5RbP+PrEscGU+DSAxdg4CICIkxnLP8aNz63Og'.
- 'H3/rdvOb795GVhuaYo0oBc3GGrEsUPVTwO6a7LYd+X51x3Hu/t'.
- 'lP5tS65FN+6okn9U+n/sqb596dTvhOF+02myXTmkQNrOw7yD3H'.
- 'j14E+UDQjp24/0E9/eKrbA4HH3aMK1b2ccvXvswjv//1J/s5ud'.
- 'Due/hRPfP+OmfOrk7vrn7a48ihA3zh8CH+8Iuffiw/n4r9H1ZZ'.
- '0zz7G56hAAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: bl_yellow.png
-//==========================================================
- $this->imgdata_large[2][0]= 1101 ;
- $this->imgdata_large[2][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAAB2l'.
- 'BMVEX//////////+///+f//9b//8b//73//7X//63//6X//5T/'.
- '/4z//4T//3P//2v//1r//0r//0L//zH//yn//yH//xj//xD//w'.
- 'j//wD/90L/9zn/9zH/9xj/9xD/9wj/9wD39yn37zn37zH37yH3'.
- '7xD37wj37wDv70Lv50rv50Lv5znv5yHv5xjv5wjv5wDn51Ln5x'.
- 'Dn3jHn3iHn3hjn3hDn3gje3oze3nPe3lLe1oze1nPe1lLe1ine'.
- '1iHe1hje1hDe1gje1gDW1qXW1mvWzqXWzkLWzhjWzhDWzgjWzg'.
- 'DOzrXOzq3OzpzOzgDOxkrOxinOxhjOxhDOxgjOxgDGxqXGxnvG'.
- 'xmvGvRjGvRDGvQjGvQDFxbnAvr6/v7+9vaW9vZS9vQi9vQC9tR'.
- 'C9tQi9tQC7u7W1tZS1tXu1tTG1tQi1rRC1rQi1rQCtrYytrSGt'.
- 'rQitrQCtpYStpSGtpQitpQClpYSlpXulpQClnBClnAilnACcnG'.
- 'ucnAicnACclAiclACUlFqUlCmUlAiUlACUjFKUjAiUjACMjFKM'.
- 'jEqMjACMhACEhACEewB7ezF7exB7ewB7cwBzcylzcwBzaxBzaw'.
- 'BraxhrawhrawBrYxBrYwBjYwBjWgBaWgBaUgCXBwRMAAAAAXRS'.
- 'TlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAd'.
- 'LdfvwAAAAHdElNRQfTAwkRFBKiJZ4hAAAB7ElEQVR4nI3S+1vS'.
- 'UBgHcB67WJmIMWAVdDHEDLBC6Go0slj3Ft0m9RRBWQEmFZFDEM'.
- 'Qgt0EMFBY7p/+198hj1kM/9N1+++x73rOd6XT/kStnTx4fPzd9'.
- 'uwfOjFhomj7smAhwj/6Cm2O0xUwy6g7cCL99uCW3jtBmE7lsdr'.
- 'fvejgpzP7uEDFRRoqy2k8xQPnypo2BUMP6waF9Vpf3ciiSzErL'.
- 'XTkPc0zDe3bsHDAcc00yoVgqL3UWN2iENpspff+2vn6D0+NnZ9'.
- '6lC5K6RuSqBTZn1O/a3rd7v/MSez+WyIpVFX8GuuCA9SjD4N6B'.
- 'oRNTfo5PCAVR0fBXoIuOQzab1XjwwNHx00GOj8/nKtV1DdeArk'.
- '24R+0ul9PjmbrHPYl+EipyU0OoQSjg8/m83kl/MMhx0fjCkqio'.
- 'SMOE7t4JMAzDsizH81AqSdW2hroLPg4/CEF4PhKNx98vlevrbY'.
- 'QQXgV6kXwVfjkTiSXmhYVcSa7DIE1DOENe7GM6lUym0l+EXKks'.
- 'K20VAeH2M0JvVgrZfL5Qqkiy0lRVaMBd7H7EZUmsiJJcrTdVja'.
- 'wGpdbTLj3/3qwrUOjAfGgg4LnNA5tdQx14Hm00QFBm65hfNzAm'.
- '+yIFhFtzuj+z2MI/MQn6Uez5pz4Ua41G7VumB/6RX4zMr1TKBr'.
- 'SXAAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: bl_silver.png
-//==========================================================
- $this->imgdata_large[3][0]= 1481 ;
- $this->imgdata_large[3][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAB4AAAAeCAMAAAAM7l6QAAADAF'.
- 'BMVEUAAADOzs7Gxsa9vb21tbXOxsbOzsbGzsb3///O1ta1vb2c'.
- 'paVSWlpKWlpSY2ve5+97hIze7/9aY2vO5/9zhJRaa3tSY3PGzt'.
- 'aMlJxrc3tja3NKUlpCSlK1vcZze4RSWmPW5/+Upb3G3v9zhJxS'.
- 'Y3t7jKVaa4TO3veltc6ElK1re5Rjc4ycpbV7hJRaY3M5QlLn7/'.
- '/Gzt6lrb2EjJzO3v9ja3vG1ve9zu+1xueltdacrc6UpcaMnL1C'.
- 'SlqElLV7jK1zhKVre5zW3u/O1ue1vc6ttcaMlKVze4xrc4RSWm'.
- 'tKUmPG1v+9zve1xu+tveeltd6crdbe5/+9xt6cpb17hJxaY3s5'.
- 'QlrW3vfO1u/Gzue1vdattc6lrcaUnLWMlK2EjKVze5Rrc4xja4'.
- 'RSWnNKUmtCSmO9xuecpcZ7hKVaY4TW3v/O1vfGzu+1vd6ttdal'.
- 'rc69xu+UnL2MlLWEjK1ze5xrc5R7hK1ja4zO1v+1veettd6lrd'.
- 'aMlL3Gzv/39//W1t7Gxs61tb29vcatrbWlpa2cnKWUlJyEhIx7'.
- 'e4TW1ufGxta1tcZSUlqcnK3W1u+UlKW9vda1tc57e4ytrcalpb'.
- '1ra3vOzu9jY3OUlK29vd6MjKWEhJxaWmtSUmNzc4xKSlpjY3tK'.
- 'SmNCQlqUjJzOxs7///8AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
- 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
- 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
- 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
- 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
- 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
- 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
- 'AAAAAAAAAAAAAAAAAAAAAAAAD///9fnkWVAAAAAnRSTlP/AOW3'.
- 'MEoAAAABYktHRP+lB/LFAAAACXBIWXMAAABFAAAARQBP+QatAA'.
- 'AB/klEQVR42mNgxAsYqCdd3+lcb4hLmj8wMMvEu8DCMqYbU9op'.
- 'UEFB2MTb26eyysomFl06XEEhUCHLpAKo2z/fujikEUVaXUFBMB'.
- 'BouLePuV+VVWGRciIXknSEsImCQd3//xwmPr65llaFcSFJHkjS'.
- '3iYmWUDZ//8NfCr989NjNUMSUyTg0jneSiaCINn/gmlVQM12qg'.
- 'lJnp5waTMTE5NAkCyHWZW/lXWNfUlikmdYK0zax7siS4EDKJtd'.
- 'mQeU1XRwLBdLkRGASucWmGVnZ4dnhZvn5lmm29iVOWpnJqcuko'.
- 'JKR1Wm5eTkRKYF5eblp9sU2ZeUJiV7zbfVg0pH56UFBQXNjIqK'.
- 'jgkujItX1koKTVmYajsdKu2qETVhwgSXiUDZ2Bn9xqUeoZ5e0t'.
- 'LzYYZ3B092ndjtOnmKTmycW1s7SHa+l5dtB8zlccE6RlN0dGbM'.
- 'mDVbd5KupNBcL6+F82XgHouLj5vRP2PWLGNdd4+ppnxe8tJec6'.
- 'XnNsKkm0uVQ5RDRHQTPTym68nPlZbvkfYCexsa5rpJ2qXa5Umm'.
- 'ocmec3m8vHjmSs+fgxyhC5JDQ8WSPT2lvbzm8vDIe0nbtiBLN8'.
- '8BigNdu1B6Lsje+fPbUFMLi5TMfGmvHi/puUAv23q2YCTFNqH5'.
- 'MvPnSwPh3HasCbm3XUpv+nS5VtrkEkwAANSTpGHdye9PAAAASn'.
- 'RFWHRzaWduYXR1cmUANGJkODkyYmE4MWZhNTk4MTIyNDJjNjUx'.
- 'NzZhY2UxMDAzOGFhZjdhZWIyNzliNTM2ZGFmZDlkM2RiNDU3Zm'.
- 'NlNT9CliMAAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: bl_purple.png
-//==========================================================
- $this->imgdata_large[4][0]= 1149 ;
- $this->imgdata_large[4][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAACAV'.
- 'BMVEX/////////7///5///1v//xv//rf//pf//lP//jP//hP//'.
- 'c///a///Wv//Wvf/Uv//Sv//Qv//Qvf/Off/Mf//Kf//If//If'.
- 'f/GP//GPf/EP//EPf/CP//CPf/CO//AP//APf3Oe/3Kff3Ke/3'.
- 'Ie/3GO/3EO/3AO/vSu/vSufvOefvMefvIefvGOfvEOfvCOfvAO'.
- 'fnUufnSufnMd7nId7nGN7nGNbnEN7nCN7nAN7ejN7ejNbec97e'.
- 'c9beUtbeQtbeIdbeGNbeENbeCNbeANbWpdbWa9bWQs7WGM7WEM'.
- '7WCM7WAM7Otc7Orc7OnM7OSsbOIb3OGMbOEMbOCMbOAM7OAMbG'.
- 'pcbGnMbGe8bGa8bGKbXGEL3GCL3GAL3FucXBu73AvsC/v7+9pb'.
- '29Ka29GLW9ELW9CLW9AL29ALW5rrm1lLW1e7W1MbW1GKW1EK21'.
- 'CLW1CK21AK2tjK2thKWtMaWtIaWtGJytCK2tCKWtAK2tAKWlhK'.
- 'Wle6WlEJylCJylAKWlAJyca5ycGJScEJScCJScAJycAJSUWpSU'.
- 'UoyUKZSUEIyUCIyUAJSUAIyMUoyMSoyMIYSMEISMCISMAIyMAI'.
- 'SECHuEAISEAHt7MXt7EHt7CHt7AHt7AHNzKXNzEGtzAHNzAGtr'.
- 'GGtrEGNrCGtrAGtrAGNjCFpjAGNjAFpaAFpaAFIpZn4bAAAAAX'.
- 'RSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsS'.
- 'AdLdfvwAAAAHdElNRQfTAwkRFB0ymoOwAAAB9UlEQVR4nGNgIA'.
- 'K42hhqGtm5+WFIWClKycvLK6gbuARGoEj4aMjLSElISUir6Tt7'.
- 'x+aEIWR8leQlwEBSTc/CK7awLguuR0lGQkJMVFRUTFJVzwko1d'.
- 'oFk9OQl5IQE+Dh5hVR0TV3CkkvbJgyASJjDZIR5GBl5eRX0TH1'.
- 'DEqrbJ2ypBEspSgvJSXKw8bMxMavbOLoGZNf1TZlybw4oIyfLN'.
- 'BxotxsLEzsQiaOHkFpBQ2905esrAZK2SpIAaUEuDm5+LTNPAKj'.
- 'C+pbps1evrIDKGWnLictKSkuLKyoZQyUya9o7Z2+YMXKGUApew'.
- 'M9PTVdXR0TEwf3wOjUirruafOXL18xFyjl72Kpb25qaurg4REU'.
- 'EFVe2zJ5zpLlK1aCpbydnZ2dnDwDA6NTopLLeiZNXbB8BcTAyP'.
- 'TQ0JDg4KCY1NS83JKmiVOBepYvX9UPlAovzEiPSU/LLyior2vq'.
- 'mjZr3vLlIF01IC+XVhUWFlZW1Lc290ycOGfxohVATSsXx4Oksn'.
- 'vaWlsb2tq6J0+bM2/RohVA81asbIcEYueU3t7JU6ZNnwNyGkhm'.
- '+cp5CRCppJnzZ8+ZM3/JUogECBbBIixr8Yqly8FCy8F6ltUgoj'.
- 'lz7sqVK2ByK+cVMSCDxoUrwWDVysXt8WhJKqG4Y8bcuTP6qrGk'.
- 'QwwAABiMu7T4HMi4AAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: bl_gray.png
-//==========================================================
- $this->imgdata_large[5][0]= 905 ;
- $this->imgdata_large[5][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAABO1'.
- 'BMVEX////////3///39/fv7+/e5+fW3t7Wzs7WxsbG1tbGzsbG'.
- 'xsbDxMS/v7++wMC+v7+9zsa9xsa9vb29tbW9ra29pa24uLi1xs'.
- 'a1vb21tbWxtrattbWmpqalra2cra2cpaWcnJycjIyUpaWUnJyU'.
- 'lJSUjIyMnJyMnJSMlJSMlIyMjJSMjIyElJSElIyEjIyEhIR7jI'.
- 'x7hIR7hHt7e3t7e3N7e2tzhIRze3tze3Nzc3Nre3trc3Nrc2tr'.
- 'a2tjc3Njc2tja3Nja2tjY2NjWlpaa2taY2taY2NaY1paWlpaUl'.
- 'JSY2NSY1pSWlpSWlJSUlJSUkpKWlpKWlJKUlpKUlJKUkpKSkpK'.
- 'SkJCUlJCUkJCSkpCSkJCQkI5Sko5QkI5Qjk5OUI5OTkxQkIxOT'.
- 'kxMTkxMTEpMTEhMTEhKSkYISEpy7AFAAAAAXRSTlMAQObYZgAA'.
- 'AAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdE'.
- 'lNRQfTAwkRFQfW40uLAAABx0lEQVR4nI3SbXfSMBQA4NV3nce5'.
- 'TecAHUywRMHSgFuBCFsQUqwBS1OsWQh0GTj//y8wZUzdwQ/efM'.
- 'tzcm/uuXdj4z9ic/PR9k4qk1qDnf0X2/uZzKt8GaRvSubg4LVp'.
- 'mkWzCGAT/i3Zsm2XNQHLsm2n2937LaaNnGoJFAEo27B50qN0ay'.
- 'Wg26lXsw8fP8nmzcJb2CbsnF5JmmCE8ncN404KvLfsYwd7/MdV'.
- 'Pdgl/VbKMIzbuwVgVZw2JlSKJTVJ3609vWUY957lgAUd1KNcqr'.
- 'yWnOcOPn8q7d5/8PywAqsOOiVDrn42NFk+HQ7dVuXNYeFdBTpN'.
- 'nY5JdZl8xI5Y+HXYaTVqEDp1hAnRohZM03EUjMdhn5wghOoNnD'.
- 'wSK7KiiDPqEtz+iD4ctdyAifNYzUnScBSxwPd6GLfRURW7Ay5i'.
- 'pS5bmrY8348C5vvUI+TLiIVSJrVA0heK/GDkJxYMRoyfCSmk4s'.
- 'uWc3yic/oBo4yF374LGQs5Xw0GyQljI8bYmEsxVUoKxa6HMpAT'.
- 'vgyhU2mR8uU1pXmsa8ezqb6U4mwWF/5MeY8uLtQ0nmmQ8UWYvb'.
- 'EcJaYWar7QhztrO5Wr4Q4hDbAG/4hfTAF2iCiWrCEAAAAASUVO'.
- 'RK5CYII=' ;
-
-//==========================================================
-// File: bl_brown.png
-//==========================================================
- $this->imgdata_large[6][0]= 1053 ;
- $this->imgdata_large[6][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABkAAAAZCAMAAADzN3VRAAABoV'.
- 'BMVEX////Gzs7GvbXGrZTGpXu9nHO1nHO1nIy9taXGxs7GtaXO'.
- 'nHPGlFrGjEq9hEq1hEqte0Klczmcazmce1KtnIzGxsbGvb3OlF'.
- 'LOlFq9hFKte0qcc0KUYzGEWimMc1K9ta3OnGvOnGPWnGO9jFq9'.
- 'jFKlc0KUazmMYzl7UilzUjGtpZzGxr3GnGPWpWvepXO1hFJ7Wj'.
- 'FrSiFjUjG1ra3GnHPvxpT/5733zpythFKUa0KEYzlzUilaOSF7'.
- 'Wjm9jErvvYz/99b///f/78bnrYS1hFqle0p7UjFrSiljQiFCMR'.
- 'iMhHO9lGvGjFLWnGv/3q3////erXuthEqlc0paQiFKMRhSQin/'.
- '1qX/997//++cc0pjSilaQilKORhCKRiclIy9pYzGlGPntYT33q'.
- '3vvZSEWjlSOSE5KRB7c2O1lHutczmthFqte1JrWkqtjGtCKRBa'.
- 'SjmljGuca0KMYzGMaznOztaclISUYzmEWjFKOSF7a1qEYzFaSi'.
- 'GUjISEa0pKOSm9vb2llIxaQhg5IQiEc2tzY0paORilnJy1raVS'.
- 'OSljUkJjWkKTpvQWAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHU'.
- 'gAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkREiei'.
- 'zP2EAAAB9UlEQVR4nGWS/VfSUBjHL5QluhhBxtwyWcCus5Blpm'.
- 'wDC4ONaWXCyBi7RMZmpQ2Bypm9W/byV3cHHo/W88s95/s5z/d5'.
- 'uwCcCh/4L3zAf+bs0NC588On9QAYGSUuBINk6GI4cmnsBLk8Go'.
- '1SFEGMkzRzZeLq5JE8FvDHouw1lqXiCZJOcnCKnx4AcP0GBqmZ'.
- 'mRgRT9MMB4Wbs7cGSXNRik3dnp9fiMUzNCNKgpzN9bsaWaQo9s'.
- '7dfH7pXiFTZCBU1JK27LmtBO8TDx7mV1eXHqXXyiIUFLWiVzHx'.
- 'BxcJIvV4/cn6wkqmWOOwmVE3UQOAp6HxRKL5bGPj+VwhUhalFq'.
- '8alm5vAt+LlySZTsebzcKrraIIW4JqZC3N3ga+1+EQTZKZta1M'.
- 'pCZCSeDViqVrThsEdsLJZLJYLpZrHVGScrKBvTQNtQHY6XIM02'.
- 'E6Ik7odRW1Dzy3N28n3kGuB3tQagm7UMBFXI/sATAs7L5vdbEs'.
- '8Lycm923NB0j5wMe6KOsKIIyxcuqauxbrmlqyEWfPmPy5assY1'.
- 'U1SvWKZWom9nK/HfQ3+v2HYZSMStayTNN0PYKqg11P1nWsWq7u'.
- '4gJeY8g9PLrddNXRdW8Iryv86I3ja/9s26gvukhDdvUQnIjlKr'.
- 'IdZCNH+3Xw779qbG63f//ZOzb6C4+ofdbzERrSAAAAAElFTkSu'.
- 'QmCC' ;
-
-//==========================================================
-// File: bl_darkgreen.png
-//==========================================================
- $this->imgdata_large[7][0]= 1113 ;
- $this->imgdata_large[7][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAAB2l'.
- 'BMVEX////////3///v///n/+/e99bW/+/W99bO786/v7++vr69'.
- '/96999a7wb24vbu1/9a1zqW1u7itxrWosq6l772l1qWlxrWlxq'.
- '2lva2cxpSU562U3q2UxqWUvaWUpZyM77WM57WMvYyMtZyMrZyM'.
- 'pZSMnJSEvZyEtYyErZSElIx7zpR7xpx7xpR7vZR7jIRz1pRzxp'.
- 'RzjIRrzpRrzoxrxoxrtYRrrYxrrXtrpYRrhHNjzoxjxoxjxoRj'.
- 'vYRjtYRjrXtjpXtjlGNje2tazoxazoRaxoxaxoRavYRatYRatX'.
- 'tarXtapXNanHNajFpae2tSzoRSxoRSvXtStXtSrXtSrXNSpXNS'.
- 'nHNSnGtSlGtSlGNSjGtSjGNKvXtKtXNKrXNKpWtKnGtKlGNKjG'.
- 'NKhGNKhFJKc1pKa1JCrWtCpWtCnGtClGNCjGNCjFpChFpCe1JC'.
- 'a1JCY1I5pWs5nGM5lGM5jFo5hFo5e1o5c0o5WkoxjFoxhFoxhF'.
- 'Ixe1Ixc1Ixc0oxa0ophFIpe0opc0opa0opa0IpY0IpWkIpWjkp'.
- 'UkIpUjkhc0oha0IhY0IhWjkhWjEhUjkhUjEhSjEhSikhQjEhQi'.
- 'kYWjkYSjEYSikYQjEYQikQSikQQikQQiEQOSExf8saAAAAAXRS'.
- 'TlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAd'.
- 'LdfvwAAAAHdElNRQfTAwkRFCaDkWqUAAAB+ElEQVR4nI3S+1vS'.
- 'UBgHcGZlPV0ks/vFrmQWFimJjiwiYUJWjFBWFhClyZCy5hLrwA'.
- 'x2EIwJC1w7zf2vnU0re+iHvs9++7x7zznvORbLf+TA6ct9fYMX'.
- 'jrfAUYefpp+/iM1ykxf/lmuhUZ/PTwXC8dml5Wcd23o5H5Mk6b'.
- '5NUU8icXbhS67rNzn9JDnguOEYGQtEEtwC+Crs3RJ76P5A/znr'.
- 'vsNX7wQnEiwHCtK7TTkW8rvdZ9uJtvZTLkxpHhSrP66bNEj7/P'.
- '3WNoLYeeSWQQCIpe9lQw7RNEU5rDsIYtcJ14Nocg7kRUlBNkxn'.
- 'YmGKcp7cv3vPwR7XOJPmc0VYU3Sv0e9NOBAYG7Hbz/cMjTMveZ'.
- 'CHkqxuTBv0PhYJB4N3XR6PJ5rMAPMnpGUxDX1IxSeMTEaZp1OZ'.
- 'nGAIQiYtsalUIhFlmGTy3sO3AizJCKn6DKYryxzHsWyaneMzr6'.
- 'cWxRVZVlFTe4SpE3zm+U/4+whyiwJcWVMQNr3XONirVWAklxcE'.
- 'EdbqchPhjhVzGpeqhUKhWBQhLElr9fo3pDaQPrw5xOl1CGG1JE'.
- 'k1uYEBIVkrb02+o6RItfq6rBhbw/tuINT96766KhuqYpY3UFPF'.
- 'BbY/19yZ1XF1U0UNBa9T7rZsz80K0jWk6bpWGW55UzbvTHZ+3t'.
- 'vbAv/IT+K1uCmhIrKJAAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: bl_green.png
-//==========================================================
- $this->imgdata_large[8][0]= 1484 ;
- $this->imgdata_large[8][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAYAAACpSkzOAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
- 'B3RJTUUH0wMMFjM4kcoDJQAABVlJREFUeNq9ll2MJFUVx3/11V'.
- 'Vd/TE9vU0v4zLDwJIF16jBqLAPhsRXEiDqg0QTJiQSjcSNvCzw'.
- 'sBEDDxizhvAAxBgf1oR9QF9NiE9ESFZkQyZB5WtddmdnZ3qqqr'.
- 'uqbt367Cofqu3ZZpWVaDzJfbkf53//55z/PVdZXV3l/2H6f7Lp'.
- '5VdOV/4Nb+GmHpUeA7AdBNxc3kafNb73jRPK9Xwon8ToxVefqU'.
- 'b91wibH5EkCQBCizFihTSviHUHR0hWws9xe3wvJ7/7nPKpgX5y'.
- '9oFqt3eOgWniRBoAbUBGGqZUibSYaeoT2B5bnkdaSA6793Cv/S'.
- 'QPPbihXBfo5VdOV+8dfgnvwAU62YH5fCZ12sDujFkwyegCqTrB'.
- 'iUOKTOJKj8jr88jS8zy6cXwBTP048nuHX0I0nDlIp7RpTG7kM0'.
- 'sdyAYsTVukUuWGhlWHMq0ITL92lnUp9R1Obz/GmTNnqn9bDD8/'.
- '+0D1oX0O0zQZZDYCsK2j3Gl9jQqDfHiei8GfiKVLlsZkJaBAN1'.
- '0i6PgwUbB0GxG5/PrtE/xLRr959Znqw9452oVNI+jiJhnr1pe4'.
- 'k29zB1/nFr5Kj7tpt1YYhJ0FJ7nUYbcJQBgahN2MzeCP/OipR6'.
- 'prgN6Qr6ELFQFUWoRpNVjlKwxZB8DCpE+PtfEKqV1cUzxpVudu'.
- 'GTBHA5Y1g99e+dUio9O/P1Vpq+/WE5GGjDSMoAtAQjrf3C52IP'.
- 'QxpY4WK2hpReka9Gfrhqgz0bACRoCWjDh56kQ1z9FeuUUQxVhK'.
- 'B92sD1VahM+bAJgcoJhGjP/6Ln8rAgDiRCVRKiIzxMkkodBJ85'.
- 'im1IlEHbE4k1xyNveL4YP8HarmGJIOpqyjeQmfNHmTvnqZTWBt'.
- 'vIJXpPwlukJSuSTKGK3pEwtJmiX00ZlInTyNscImO6XBITvH1c'.
- '8vVt2OucdKvIyeKRTNCivsEMgcpg6taYs30nfq0Gqg6hOSSFJ4'.
- 'BSnJPht0IqEjWmOGocEI6F0J94F0qaL6BntTF0MtUfweKQKAPU'.
- 'Wwp4OcVnQAmVb0p9DLOzjEhEKnGRmoRc7EzRGlwA6NujAKG4yP'.
- '6Sjwc4aVznZ7DK0xXdkDoJf0kGmFBniFBOBGcZSCCSKd0IwN0k'.
- 'IS+QZWCGVZex4BnUxya3+Zt9iugQbcRFpIAtuHvAZulPUdLhUJ'.
- 'RqegI3WcqaSXddlT3idsWMSRRGkEtNwmyTifAwyBo7LP+11J0e'.
- '7tM7pZOYblHkBLcqZ5LcYtw6Wbd4CM3SpE9foYZsIHoqDKCrbz'.
- 'mLSQtPwmuhXgtBLs0GBdbXOhFGB7WBKO2F8GXt9/VO97Ya3atF'.
- '7nUHnwGjGGQqcPxFEdFqURkEidiZszAERoYIsGju1hq21kWee3'.
- 'bw15+8WpsvAy3K1+i3JkkhZyPpxxjjPOsfOYiZ+TFhLPzQnHOU'.
- 'tpzGB2dgA4tscIkKIx19Cxg/fPL7vQJu47eXt1VvsDK8pwPueZ'.
- 'PuZoQMOqhRoJHSs0kKLBWjvjYinmeQGw1TaX1RFdfZ3LMzYLjA'.
- 'C++dkn6AaH2Nobk6cxEzdnuG0TdC8zvdJkN0hqkFkO/jwL0fxa'.
- 'so8sBcuFzQ+/+MRC+BeAHnpwQzn++ee5KT9Eshuy46dcKAXm32'.
- '0uzPQhS4GttkH2GQID2Wc0Y4LtAbDxhZ/x5A+e/uTG9+jGceXH'.
- '9/ySnnIXnUzOxXe1038mW3ZynNmam4yYWkO+f9cv+Oljz16/lV'.
- '9tDz/9nerc1hm8ZEScSRK7VvtYl1i1dklsOKyvc+zg/bzw1O8+'.
- '/efkajt56kR1ydlEJBc5H46xzbrJ3dY9wrB7hGcff+6/+279L+'.
- '0fHxyiE8XMLl4AAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: bl_blue.png
-//==========================================================
- $this->imgdata_large[9][0]= 1169 ;
- $this->imgdata_large[9][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAACEF'.
- 'BMVEX/////////7//35//v1v/exv/Wvf/Wrf/Wpf/Orf+/v7+9'.
- 'tc69jP+9hP+5ucW1tc6tlP+rq7Wlpdalpcalpb2cnM6cnMacc/'.
- '+cWv+UlLWUjN6UjK2Uc/+Ma/+MUv+EhKWEa/+EQvd7e8Z7e7V7'.
- 'e6V7c957Wv9za9Zza8ZzSv9ra5xrSv9rOf9rMe9jUudjQv9jOe'.
- '9aWpRaUt5aUpRaSu9aSudSUoxSSs5SSoxSMf9KQtZKOfdKMedK'.
- 'Kf9KKe9CKf9CKb1CKa1CIfdCIedCId45MXs5Kfc5If85Iec5Id'.
- 'Y5GP8xMbUxMXsxKc4xKZQxIf8xGP8xGO8xGN4xGNYxGL0xGK0p'.
- 'KXMpIYwpGP8pGO8pGOcpGNYpGM4pEP8pEPcpEOcpEN4pENYpEM'.
- 'YpEL0hGKUhEP8hEPchEO8hEOchEN4hENYhEM4hEMYhELUhCP8h'.
- 'CO8hCN4YGJwYGGsYEL0YEK0YEHMYCN4YCM4YCMYYCL0YCKUYAP'.
- '8QEJQQEIwQEHsQEGsQCM4QCLUQCK0QCKUQCJwQCJQQCIwQCHMQ'.
- 'CGsQAP8QAPcQAO8QAOcQAN4QANYQAM4QAMYQAL0QALUQAKUQAJ'.
- 'QQAIQICGsICGMIAO8IANYIAL0IALUIAK0IAKUIAJwIAJQIAIwI'.
- 'AIQIAHsIAHMIAGsIAGMAAN4AAMYAAK0AAJQAAIwAAIQAAHMAAG'.
- 'sAAGMAAFrR1dDlAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
- 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkRFRPMOZ'.
- '/2AAAB+klEQVR4nGNgIAIIqeqZmBqpi2JISNml5lVXV3d198Yo'.
- 'oUjwm1SnxsbGRsSm5ZfNXO4tjCTjVh0ABhFx6QV9E1Y0S8JkuN'.
- '3yAgLc7W3t/QPi4jPKJ8ye1yoIlTKpjvVy15eVUbN0i4zKLJ8w'.
- 'ae6qcKgLqmMj3PUFWFl5NJ0CExLLJzbNW7BWCyxlXR0ba6/Axs'.
- 'zELmfnkRBT0QiSKgXJCOflxUbYy3KyMHEoOrtEZ1c2TZ6/cMl6'.
- 'eaCUamdsbIC7tjgPr4SBS3BMMVDTwkXr1hsDpYy6UmMj/O0tdX'.
- 'QNbDxjknJLWqYsXLx0vStQynxGflpkZGCgs7Onp29SbtNkoMy6'.
- 'pevCgFJWy3oyMuKjgoKCPWNCvEuqWhcsWrJ06XqQlPnMvrKyrM'.
- 'TomJjkZAfHlNa2qdOWrlu63gcopbG8v7+hvLwip7g4JdSxsLZu'.
- '8dKlS9ettwBKic2eNXHChIkTG5tKqgpr2uo6loLAehWQx0LnzJ'.
- '49p6mpeXLLlNq6RUvqly6dvnR9Bx9ISnnlvLmT582bMr9t4aL2'.
- '+vrp60GaDCGB6Ld6wfwFCxYCJZYsXQ+SmL6+FBryInVrFi1atH'.
- 'jJkqVQsH6pNCzCJNvXrQW6CmQJREYFEc2CYevXrwMLAyXXl0oz'.
- 'IAOt0vVQUGSIkabkDV3DwlzNVDAksAAAfUbNQRCwr88AAAAASU'.
- 'VORK5CYII=' ;
-
-//==========================================================
-// File: bs_red.png
-//==========================================================
- $this->imgdata_small[0][0]= 437 ;
- $this->imgdata_small[0][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAk1'.
- 'BMVEX////////GxsbGra3/xsbOhITWhIT/hIT/e3v/c3P/a2vG'.
- 'UlK1SkrOUlL/Y2PWUlLGSkrnUlLeSkrnSkr/SkqEGBj/KSmlGB'.
- 'jeGBjvGBj3GBj/EBD/CAj/AAD3AADvAADnAADeAADWAADOAADG'.
- 'AAC9AAC1AACtAAClAACcAACUAACMAACEAAB7AABzAABrAABjAA'.
- 'BuukXBAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
- 'cwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGDNEMgOYAAAAm0'.
- 'lEQVR4nI3Q3RKCIBAFYGZMy9RKzX7MVUAUlQTe/+kS0K49d3wD'.
- '7JlFaG+CvIR3FvzPXgpLatxevVVS+Jzv0BDGk/UJwOkQ1ph2g/'.
- 'Ct5ACX4wNT1o/zzUoJUFUGBiGfVnDTYGJgmrWy8iKEtp0Bpd2d'.
- 'jLGu56MB7f4JOOfDJAwoNwslk/jOUi+Jts6RVNrC1hkhPy50Ef'.
- 'u79/ADQMQSGQ8bBywAAAAASUVORK5CYII=' ;
-
-
-//==========================================================
-// File: bs_lightblue.png
-//==========================================================
- $this->imgdata_small[1][0]= 657 ;
- $this->imgdata_small[1][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAABVl'.
- 'BMVEX////////d///AwMC7wcS08P+y+P+xxdCwxM+uws2twMur'.
- 'vsinzNynytylzuKhyN6e5v6d5P+d1fOcwNWcu8ub4f+at8iZ3v'.
- '+ZvdGY2/yW2f+VscGU1vuT1fqTr72Sx+SSxeKR0fWRz/GPz/OP'.
- 'rr+OyeqMy+6Myu2LyeyKxueJudSGw+SGorGDvt+Cvd6CvN2Aud'.
- 'p+uNd+t9Z9tdV8tdR8tNN6sc94r813rct2q8h0qcZ0qMVzp8Rx'.
- 'o8Bwor5tn7ptnrptnrlsnbhqmbRpmbNpi51ol7Flkqtkkqtkka'.
- 'pjj6hijaRhjaZgi6NfiqJfiaFdh55bhJtag5pZgphYgJZYf5VX'.
- 'cn9Ve5FSeI1RdopRdYlQdYlPc4dPcoZPcoVNcINLboBLbH9GZn'.
- 'hGZXdFZHZEY3RDYnJCXW4/W2s/WWg+Wmo7VmU7VGM7U2E6VGM6'.
- 'VGI5UV82T1wGxheQAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHU'.
- 'gAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGTok'.
- '9Yp9AAAAtElEQVR4nGNgIBaw8wkpKghzwvksPAKiUsraprYiLF'.
- 'ARXkE2JiZ1PXMHXzGIAIekOFBE08TGLTCOCyzCLyvDxsZqZOnk'.
- 'E56kAhaRV9NQUjW2tPcMjs9wBYsY6Oobmlk7egRGpxZmgkW0zC'.
- '2s7Jy9giKT8gohaiQcnVzc/UNjkrMLCyHmcHr7BYREJKTlFxbm'.
- 'QOxiEIuKTUzJKgQCaZibpdOzQfwCOZibGRi4dcJyw3S4iQ4HAL'.
- 'qvIlIAMH7YAAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: bs_gray.png
-//==========================================================
- $this->imgdata_small[2][0]= 550 ;
- $this->imgdata_small[2][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAAQCAMAAADH72RtAAABI1'.
- 'BMVEX///8AAAD8EAD8IAD8NAD8RAD8VAAYGBi/v7+goKCCgoJk'.
- 'ZGRGRkb8yAD83AD87AD8/AD4+ADo+ADY+ADI+AC0+ACk+ACU+A'.
- 'CE+AB0/ABk/ABU/ABE/AAw/AAg/AAQ/AAA/AAA+AAA6BAA2CAA'.
- 'yDQAtEQApFQAlGQAhHQAdIgAZJgAVKgARLgAMMgAINwAEOwAAP'.
- 'wAAPgIAPAQAOgYAOAkANgsANA0AMg8AMBEALhMALBUAKhcAKBo'.
- 'AJhwAJB4AIiAAID////4+Pjy8vLs7Ozm5ubg4ODa2trT09PNzc'.
- '3Hx8fBwcG7u7u1tbWurq6oqKiioqKcnJyWlpaQkJCJiYmDg4N9'.
- 'fX13d3dxcXFra2tkZGReXl5YWFhSUlJMTExGRkZAQEA1BLn4AA'.
- 'AAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIA'.
- 'AAsSAdLdfvwAAAAHdElNRQfTAwkUGiIctEHoAAAAfElEQVR4nI'.
- '2N2xKDIAwF+bZ2kAa8cNFosBD//yvKWGh9dN+yk9kjxH28R7ze'.
- 'wzBOYSX6CaNB927Z9qZ66KTSNmBM7UU9Hx2c5qjmJaWCaV5j4t'.
- 'o1ANr40sn5a+x4biElrqHgrXMeac/c1nEpFHG0LSFoo/jO/BeF'.
- 'lJnFbT58ayUf0BpA8wAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bs_greenblue.png
-//==========================================================
- $this->imgdata_small[3][0]= 503 ;
- $this->imgdata_small[3][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAxl'.
- 'BMVEX///////+/v79znJQhSkJ7raU5hHtjraVKnJRCjIRClIyU'.
- '9++E595avbVaxr2/v7+ctbWcvb17nJxrjIx7paUxQkK9//+Mvb'.
- '17ra2Evb17tbVCY2MQGBiU5+ec9/eM5+d71tZanJxjra1rvb1j'.
- 'tbVSnJxara1rzs5jxsZKlJRChIQpUlIhQkJatbVSpaU5c3MxY2'.
- 'MYMTEQISFavb1Sra1KnJxCjIw5e3sxa2spWlpClJQhSkoYOTkp'.
- 'Y2MhUlIQKSkIGBgQMTH+e30mAAAAAXRSTlMAQObYZgAAAAFiS0'.
- 'dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfT'.
- 'AwkUGTIqLgJPAAAAqklEQVR4nI2QVxOCMBCEM6Mi2OiCvSslJB'.
- 'CUoqjn//9TYgCfubf9Zu9uZxFqO+rscO7b6l/LljMZX29J2pNr'.
- 'YjmX4ZaIEs2NeiWO19NNacl8rHAyD4LR6jjw6PMRdTjZE0JOiU'.
- 'dDv2ALTlzRvSdCCfAHGCc7yRPSrAQRQOWxKc3C/IUjBlDdUcM8'.
- '97vFGwBY9QsZGBc/A4DWZNbeXIPWZEZI0c2lqSute/gCO9MXGY'.
- '4/IOkAAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: bs_yellow.png
-//==========================================================
- $this->imgdata_small[4][0]= 507 ;
- $this->imgdata_small[4][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAzF'.
- 'BMVEX///////+/v79zYwCMewDOxoTWzoTezkr/5wj/5wDnzgDe'.
- 'xgC1pQCtnACllACcjACUhABjWgDGvVK1rUrOxlLGvUqEexilnB'.
- 'jv3hj35xj/7wj/7wD35wDv3gDn1gDezgDWxgDOvQDGtQC9rQCE'.
- 'ewB7cwBzawBrYwDWzlLn3lLe1krn3kre1hi9tQC1rQCtpQClnA'.
- 'CclACUjACMhAD/9wC/v7///8bOzoT//4T//3v//3P//2v//2Pn'.
- '50r//0r//yn39xj//xD//wBjYwDO8noaAAAAAXRSTlMAQObYZg'.
- 'AAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAH'.
- 'dElNRQfTAwkUGSDZl3MHAAAAqElEQVR4nI3QWRNDMBAA4My09E'.
- 'IF1SME0VT1okXvM/3//6kEfbZv+81eswA0DfHxRpOV+M+zkDGG'.
- 'rL63zCoJ2ef2RLZDIqNqYexyvFrY9ePkxGWdpvfzC7tEGtIRly'.
- 'nqzboFKMlizAXbNnZyiFUKAy4bZ+B6W0lRaQDLmg4h/k7eFwDL'.
- 'OWIky8qhXUBQ7gKGmsxpC+ah1TdriwByqG8GQNDNr6kLjf/wAx'.
- 'KgEq+FpPbfAAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: bs_darkgray.png
-//==========================================================
- $this->imgdata_small[5][0]= 611 ;
- $this->imgdata_small[5][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAA8AAAAPCAMAAAAMCGV4AAABJl'.
- 'BMVEX////////o8v/f6O7W4OnR3PXL1OTL0evEyLvCzePAwMC/'.
- 'v7a8wsq7t7C1xum1vtS1q6GzopmyxeKsrsOqvNWoq7anvN+nsb'.
- 'qhrcGgqbGfpq6cp7+bqMuVmJKRm7yPlKKMnL6FkKWFipOEkLSE'.
- 'j6qEhoqAiaB+jqd8haF7hZR4iJt4g5l3hZl2gIt2cod1hJVzeY'.
- 'VzboJvhp9sfJJsb41peY1pd5xpdoVod4xndI5lcHxka4BjcYVg'.
- 'Z3BfboFbb4lbZnZbYntaZ4laZYVZV3JYYWpXX3JWWm5VX4RVW2'.
- 'NUYX9SXHxPWn5OVFxNWWtNVXVMVWFKV3xHUGZGU3dGTldFSlxE'.
- 'Sk9ESXBCRlNBS3k/SGs/RU4+R1k9R2U6RFU2PUg0PEQxNU0ECL'.
- 'QWAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAA'.
- 'CxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGQmbJetrAAAAtklEQV'.
- 'R4nGNgwAK4JZTNNOWlYDxhMT4ZDTOzQE1uMF9CiJWVU0LbxDlS'.
- 'G8QVF+FnZ2KRNHAIiPUHaZGSlmZj5lH19A1KjLUA8lXU5MWllF'.
- 'yjo30TYr2BfG19G11b37CEeN84H38gX1HbwTUkOjo+zjfG3hLI'.
- 'l1exCvCNCwnxjfMz0gTyRdXNHXx9fUNCQu2MwU6SN3ZwD42LCH'.
- 'W30IK4T8vUJSAkNMhDiwPqYiktXWN9JZj7UQAAjWEfhlG+kScA'.
- 'AAAASUVORK5CYII=' ;
-
-
-//==========================================================
-// File: bs_darkgreen.png
-//==========================================================
- $this->imgdata_small[6][0]= 666 ;
- $this->imgdata_small[6][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAABX1'.
- 'BMVEX////////l/+nAwMC86r+8wb28wby8wLy78sCzw7SywrSx'.
- 'wLKwvrGuvK+syK+ryq2rx62n36ym3aumxKmk2qij0Keh16ahva'.
- 'Og1aSguKKe06KeuaCetZ+d0KGdtZ+bz6Cay56ZyZ2Zwp2Zr5qZ'.
- 'rpqYwJuXyZuXrJmVw5mUxZiTxJeTw5eTq5WRwJWPtJKOvZKKuI'.
- '6Kt42Kn4yJt42ItIuGsomFsYmEsIiEr4eDr4eBrIR/qoN+qIJ8'.
- 'poB7pH56o356on14nnt2nXl0mndzmnZzmXZymHVwlXNvlHJukn'.
- 'FtiHBqjm1qjW1oi2toiWpniWplh2hlhmdkhWdig2VggGNgf2Je'.
- 'fmFdfGBde19bbl1aeFxXdFpWclhVclhVcVdUcFZTb1VSbVRQal'.
- 'JPaVFKY0xKYkxJYUtIYEpHX0lEWkZCWERCV0NCVkM/U0A+U0A+'.
- 'UUA+UEA9Uj89UT48Tj45TDvewfrHAAAAAXRSTlMAQObYZgAAAA'.
- 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
- 'RQfTAwkUGRjxlcuZAAAAtElEQVR4nGNgIBZw8osqqIpzw/msfI'.
- 'IiUmr6lo6SbFARASEOJiYtQ2uXADmIAJeEGFBE18LBMySBBywi'.
- 'LC/LwcFiZuvmH5WiAxZR0tRW1DC3dfYJS8zyAouYGBibWtm7+o'.
- 'TEpZfkgEX0rG3snNx9Q2NSCksgaqRd3Ty8gyLiU/NKSiDmcPsF'.
- 'BodHJ2UUlZTkQ+xikIlNSE7LLgECZagL2VQyc0H8YnV2uD94jS'.
- 'ILIo14iQ4HALarJBNwbJVNAAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: bs_purple.png
-//==========================================================
- $this->imgdata_small[7][0]= 447 ;
- $this->imgdata_small[7][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAnF'.
- 'BMVEX///////+/v7/Gvca9rb3Grcb/xv+1hLWte629hL21e7XG'.
- 'hMbWhNbOe87We9b/hP//e/97OXv/c///a///Y/+cOZz/Sv/WOd'.
- 'bnOefvOe//Kf9jCGNrCGv/EP//CP/nCOf/AP/3APfvAO/nAOfe'.
- 'AN7WANbOAM7GAMa9AL21ALWtAK2lAKWcAJyUAJSMAIyEAIR7AH'.
- 'tzAHNrAGtjAGPP1sZnAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgF'.
- 'HUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGS'.
- 'o5QpoZAAAAnElEQVR4nI3Q2xJDMBAG4MyQokWrZz3oSkJISJH3'.
- 'f7dK0Gv/Xb7J7vyzCK0NjtPsHuH/2wlhTE7LnTNLCO/TFQjjIp'.
- 'hHAA6bY06LSqppMAY47x+04HXTba2kAFlmQKr+YuVDCGUG2k6/'.
- 'rNwYK8rKwKCnPxHnVS0aA3rag4UQslUGhrlk0Kpv1+sx3tLZ6w'.
- 'dtYemMkOsnz8R3V9/hB87DEu2Wos5+AAAAAElFTkSuQmCC' ;
-
-
-//==========================================================
-// File: bs_brown.png
-//==========================================================
- $this->imgdata_small[8][0]= 677 ;
- $this->imgdata_small[8][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAABaF'.
- 'BMVEX//////////8X/3oD/3nj/1HX/0Gr/xGP/rkv/gBf+iS/2'.
- 'bAL1agDxaQDuZwDrZwLpZQDmZQLlZADjcx7gZATeYQDdZgraXw'.
- 'DZXwHYXgDXiEvXZAvUjlfUXwXTjVfTbR7ShUvRbR7RWwDMWQDL'.
- 'WADKooLKWADJoYLJgkvHWATGoILFn4LFgEvFVgDEZx7EVQDDt6'.
- '/DVQDCt6/CnoLChlfCVADAwMC+hFe+UgC8UgC6UQC4gVe4UAC3'.
- 'gVe3UAC1gFe1eUu1TwC1TgCzTgCwTQKuTACrSgCqSgCpSgCpSQ'.
- 'CodEulSACkRwCiRgCdRACcRACaQwCYQgCWQgKVQQCVQACUQACS'.
- 'UR6RPwCOPgCNPQCLPACKPACJOwCEOQCBOAB+NwB9NgB8NgB7NQ'.
- 'B6NwJ4NAB3RR52MwB0MgBuLwBtLwBsLwBqLgBpLQBkLQJiKgBh'.
- 'KgBgKwRcKABbKQJbJwBaKQRaJwBYKAJVJQDZvdIYAAAAAXRSTl'.
- 'MAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLd'.
- 'fvwAAAAHdElNRQfTAwkUGho0tvl2AAAAtklEQVR4nGNgIBaoSg'.
- 'mLKGpowfkGMty8AqJKpi4mRlAROR5ONg4JFUv3YHOIgDo/HwsT'.
- 'q6yps29EsjZYREFIkJ2ZS9/OMzA20wEsIi8uKSZtaOPmH5WSFw'.
- 'YW0VRW07Vw8vCLSMguLwCL6FlaObp6B0TGZxSXQ9TouHv6+IXG'.
- 'JGYWlpdDzNEKCgmPjkvLKS0vL4LYxWAen5SelV8OBNZQFxrZ5h'.
- 'aC+GX2MDczMBh7pZakehkTHQ4AA0Am/jsB5gkAAAAASUVORK5C'.
- 'YII=' ;
-
-//==========================================================
-// File: bs_blue.png
-//==========================================================
- $this->imgdata_small[9][0]= 436 ;
- $this->imgdata_small[9][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAk1'.
- 'BMVEX///////+/v7+trcbGxv+EhM6EhNaEhP97e/9zc/9ra/9S'.
- 'UsZKSrVSUs5jY/9SUtZKSsZSUudKSt5KSudKSv8YGIQpKf8YGK'.
- 'UYGN4YGO8YGPcQEP8ICP8AAP8AAPcAAO8AAOcAAN4AANYAAM4A'.
- 'AMYAAL0AALUAAK0AAKUAAJwAAJQAAIwAAIQAAHsAAHMAAGsAAG'.
- 'ONFkFbAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
- 'cwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGhNNakHSAAAAmk'.
- 'lEQVR4nI3P2xKCIBAGYGfM6SBWo1nauIqogaDA+z9dK9Lhrv47'.
- 'vtl/2A2CfxNlJRRp9IETYGraJeEb7ocLNKznia8A7Db7umWDUG'.
- 'sxAzhurxRHxok4KQGqCuEhlL45oU1D2w5BztY4KRhj/bCAsetM'.
- '2uObjwvY8/oX50JItYDxSyZSTrO2mNhvGMbaWAevnbFIcpuTr7'.
- 't+5AkyfBIKSJHdSQAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bs_green.png
-//==========================================================
- $this->imgdata_small[10][0]= 452 ;
- $this->imgdata_small[10][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAn1'.
- 'BMVEX///////+/v7+/v7/G/8aUxpSMvYyUzpSMzoyM1oxarVqE'.
- '/4R7/3tavVpKnEpaxlpz/3Nr/2tKtUpj/2Na51pKzkpK1kpK50'.
- 'pK/0oYcxgp/ykYlBgY3hgY7xgY9xgQ/xAI/wgA/wAA9wAA7wAA'.
- '5wAA3gAA1gAAzgAAxgAAvQAAtQAArQAApQAAnAAAlAAAjAAAhA'.
- 'AAewAAcwAAawAAYwA0tyxUAAAAAXRSTlMAQObYZgAAAAFiS0dE'.
- 'AIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAw'.
- 'kUGgW5vvSDAAAAnklEQVR4nI3QSxKCMAwA0M4gqCgoiiJ+kEAL'.
- 'LQUq0PufzX7ENdnlJZNkgtDS2CYZvK6bf+7EoKLA9cH5SQzv6A'.
- 'YloTywsAbYr44FrlgrXCMJwHl3xxVtuuFkJAPIcw2tGB9GcFli'.
- 'oqEf5GTkSUhVMw2TtD0XSlnDOw3SznE5520vNEi7CwW9+Ayjyq'.
- 'U/3+yPuq5gvhkhL0xlGnqL//AFf14UIh4mkEkAAAAASUVORK5C'.
- 'YII=' ;
-
-
-//==========================================================
-// File: bs_white.png
-//==========================================================
- $this->imgdata_small[11][0]= 480 ;
- $this->imgdata_small[11][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAAQCAYAAADwMZRfAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
- 'B3RJTUUH0wMLFTsY/ewvBQAAAW1JREFUeJytkz2u4jAUhT/jic'.
- 'gfBUKiZhE0bIKeVbCWrIKenp6eDiGlCEEEBArIxvzGU4xeZjLk'.
- 'jWb05lRXuvbx+exr4bouX1Xjyw7Atz81F4uFBYjjGIDhcCjq1o'.
- 'k6nN1uZwFerxfP55Msy1itVmRZBsB4PK6YveHkeW5d18XzPIIg'.
- 'wPd9Wq0WnU6HMAxJkoQoiuynOIfDwUopkVIihKAoCgAcx6Hdbm'.
- 'OMIU1T5vN55eBKEikljUYDIX6kFUKU9e8aDAZlmjcca+1b7TgO'.
- '1+uVy+VS9nzfr8e53++VzdZaiqIgz3OMMWitOZ/PaK0JgqDeRC'.
- 'mF53lIKYGfr3O73TDGoJQiTVO01nS73XqT4/FIs9kkCAIej0eZ'.
- 'brPZEMcxSZKgtQZgMpmIWpN+vy+m06n1PK9yTx8Gy+WS/X5Pr9'.
- 'er9GuHLYoiG4YhSilOpxPr9Zrtdlti/JriU5MPjUYjq7UuEWaz'.
- '2d+P/b/qv/zi75oetJcv7QQXAAAAAElFTkSuQmCC' ;
-
-
-//==========================================================
-// File: bs_cyan.png
-//==========================================================
- $this->imgdata_small[12][0]= 633 ;
- $this->imgdata_small[12][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAABPl'.
- 'BMVEX////////F///AwMCvxsaC1NSC0dGCz8+CzMyA//94//91'.
- '//9q//9j//9X4uJX09NXz89Xx8dXxMRL//9L5uZL3d1L2NhLxs'.
- 'ZLt7cv//8e9fUe8fEe7u4e398epqYehoYX//8L+PgK//8F9fUE'.
- '/v4E5+cEb28EZ2cC//8C/v4C/f0CzMwCrq4Cjo4CdXUCaWkCZW'.
- 'UB/PwA//8A/f0A+/sA8/MA7e0A7OwA6+sA5eUA5OQA4uIA4eEA'.
- '3NwA2toA2NgA1dUA09MA0tIA0NAAysoAxsYAxcUAxMQAv78Avr'.
- '4AvLwAtrYAtbUAs7MAsLAAra0Aq6sAqKgApaUApKQAoqIAoKAA'.
- 'n58AmpoAlZUAk5MAkpIAkJAAj48AjIwAiYkAh4cAf38AfX0Ae3'.
- 'sAenoAcnIAcHAAa2sAaWkAaGgAYmIUPEuTAAAAAXRSTlMAQObY'.
- 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAA'.
- 'AHdElNRQfTAwkUGQDi+VPPAAAAtElEQVR4nGNgIBawikipyIiy'.
- 'wfksfJpGRkamNtr8LFARPiMFHmFDcztXfwGoFi0jLiZuZRtnry'.
- 'BddrCIiJEGL6eklYO7X3iCOFhE2thESdHawdUnJDZFDiyiamZh'.
- 'aevk5h0UlZSpBhaRtbN3dPHwDY5MSM+EqBFzc/f0DgiLTkjLzI'.
- 'SYw6bjHxgaEZeckZmpD7GLQSAqJj4xNRMIBGFuFtRLA/ENhGBu'.
- 'ZmDgkJBXl5fgIDocAAKcINaFePT4AAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: bs_bluegreen.png
-//==========================================================
- $this->imgdata_small[13][0]= 493 ;
- $this->imgdata_small[13][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAvV'.
- 'BMVEX///////+/v79j//855/8x3v851v9Spb1C1v8AOUqEtcZK'.
- 'lK1StdYxzv8hxv8AY4QASmNSlK1KpcZKtd4YQlIYnM4YrecIvf'.
- '8AtfcAre8AjL0AhLUAc5wAa5QAWnsAQloAKTkAGCFKhJxKrdYY'.
- 'jL0Ypd4Atf8ArfcApecAnN4AlM4AjMYAe60Ac6UAY4wAUnNSnL'.
- '0AlNYAWoQASmsAOVIAITGEtc4YWnsAUnsAMUqtvcaErcYAKUIA'.
- 'GCkAECHUyVh/AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAA'.
- 'AJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGxNUcXCT'.
- 'AAAAqUlEQVR4nI2Q1xKCMBREM2NHLCCogAGCjd6SqLT8/2cZKT'.
- '6zb3tm987OBWCsXoejp8rC35fi4+l6gXFZlD0Rz6fZ1tdDmKR9'.
- 'RdOmkzmP7DDpilfX3SzvRgQ/Vr1uiZplfsCBiVf03RJd140wgj'.
- 'kmNqMtuYXcxyYmNWJdRoYwzpM9qRvGujuCmSR7q7ARY00/MiWk'.
- 'sCnjkobNEm1+HknDZgAqR0GKU43+wxdu2hYzbsHU6AAAAABJRU'.
- '5ErkJggg==' ;
-
-//==========================================================
-// File: bs_lightred.png
-//==========================================================
- $this->imgdata_small[14][0]= 532 ;
- $this->imgdata_small[14][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAA3l'.
- 'BMVEX///////+/v7/Gvb0hGBj/5///3v//zu//1u//xucpGCG9'.
- 'nK21lKVSQkp7Wms5KTExISlaOUpjQlIhEBj/tdbOhKXnrcbGjK'.
- 'Wla4TetcbGnK2EWmv/rc73pcZ7UmOcY3vOpbW1jJzenLW9e5Rz'.
- 'Slq1c4xrQlJSOULGhJz/pcb3nL2chIzOnK33rcbelK3WjKWMWm'.
- 'vGe5SEUmM5ISnOtb3GrbXerb3vpb2ca3v/rcaUY3POhJxCKTF7'.
- 'SlrWnK21e4ytc4TvnLXnlK2la3taOUK1lJxrSlLGhJRjQkpSMT'.
- 'lw+q2nAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
- 'cwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGjoP2Nm+AAAAr0'.
- 'lEQVR4nGNgIBaYiOk62imYwPnMkiIyso76yhJSzFARMxkRNk49'.
- 'a3t5OW6oFk1LVkYOfWUHKxUXiEYzLS12DnN3VXkjIRtFsIiSk5'.
- '6evqGqhYGKugAfWMRa1FpD2UHeQEXQRlgALCJur+rgbCUNFOAS'.
- 'hqjRkZe3MpBTcwEKCEPMMTGSs3Xz8OQHCnBBHckt6OJpIyAMBD'.
- 'wwN/MYc4H4LK4wNzMwmGrzcvFqmxIdDgDiHRT6VVQkrAAAAABJ'.
- 'RU5ErkJggg==' ;
-
-//==========================================================
-// File: bxs_lightred.png
-//==========================================================
- $this->imgdata_xsmall[0][0]= 432 ;
- $this->imgdata_xsmall[0][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAA3l'.
- 'BMVEX///////+/v7/Gvb0hGBj/5///3v//zu//1u//xucpGCG9'.
- 'nK21lKVSQkp7Wms5KTExISlaOUpjQlIhEBj/tdbOhKXnrcbGjK'.
- 'Wla4TetcbGnK2EWmv/rc73pcZ7UmOcY3vOpbW1jJzenLW9e5Rz'.
- 'Slq1c4xrQlJSOULGhJz/pcb3nL2chIzOnK33rcbelK3WjKWMWm'.
- 'vGe5SEUmM5ISnOtb3GrbXerb3vpb2ca3v/rcaUY3POhJxCKTF7'.
- 'SlrWnK21e4ytc4TvnLXnlK2la3taOUK1lJxrSlLGhJRjQkpSMT'.
- 'lw+q2nAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
- 'cwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUKBOgGhWjAAAAS0'.
- 'lEQVR4nGNgQAEmunYmEJaMCKe1vBxYzJKVQ9lKBSSupKdnaKGi'.
- 'zgdkiqs6WKnYcIGYJnK2HvzCwmCNgi42wsLCECNMeXlNUY0HAL'.
- 'DaB7Du8MiEAAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: bxs_bluegreen.png
-//==========================================================
- $this->imgdata_xsmall[1][0]= 397 ;
- $this->imgdata_xsmall[1][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAvV'.
- 'BMVEX///////+/v79j//855/8x3v851v9Spb1C1v8AOUqEtcZK'.
- 'lK1StdYxzv8hxv8AY4QASmNSlK1KpcZKtd4YQlIYnM4YrecIvf'.
- '8AtfcAre8AjL0AhLUAc5wAa5QAWnsAQloAKTkAGCFKhJxKrdYY'.
- 'jL0Ypd4Atf8ArfcApecAnN4AlM4AjMYAe60Ac6UAY4wAUnNSnL'.
- '0AlNYAWoQASmsAOVIAITGEtc4YWnsAUnsAMUqtvcaErcYAKUIA'.
- 'GCkAECHUyVh/AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAA'.
- 'AJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUKDVyF5Be'.
- 'AAAASUlEQVR4nGNgQAFmYqJcEJaEOJ+UrD5YTJKFTZrfGCQuaq'.
- 'glLWvMaQ5kqujo6hnbKIKYXPr68gp2dmCNJiZAlh3ECGsREWtU'.
- '4wF1kwdpAHfnSwAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bxs_navy.png
-//==========================================================
- $this->imgdata_xsmall[2][0]= 353 ;
- $this->imgdata_xsmall[2][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAk1'.
- 'BMVEX///////+/v7+trcbGxv+EhM6EhNaEhP97e/9zc/9ra/9S'.
- 'UsZKSrVSUs5jY/9SUtZKSsZSUudKSt5KSudKSv8YGIQpKf8YGK'.
- 'UYGN4YGO8YGPcQEP8ICP8AAP8AAPcAAO8AAOcAAN4AANYAAM4A'.
- 'AMYAAL0AALUAAK0AAKUAAJwAAJQAAIwAAIQAAHsAAHMAAGsAAG'.
- 'ONFkFbAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
- 'cwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUJxXO4axZAAAAR0'.
- 'lEQVR4nGNgQAGskhKsEJaslIi8ijpYTJaDU1FVAyQuKSujoKKh'.
- 'LQ5kSigpqWro6oOYrOoaWroGBmCNWiCWAdQwUVFWVOMBOp4GCJ'.
- 's5S60AAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: bxs_gray.png
-//==========================================================
- $this->imgdata_xsmall[3][0]= 492 ;
- $this->imgdata_xsmall[3][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABI1'.
- 'BMVEX///8AAAD8EAD8IAD8NAD8RAD8VAAYGBi/v7+goKCCgoJk'.
- 'ZGRGRkb8yAD83AD87AD8/AD4+ADo+ADY+ADI+AC0+ACk+ACU+A'.
- 'CE+AB0/ABk/ABU/ABE/AAw/AAg/AAQ/AAA/AAA+AAA6BAA2CAA'.
- 'yDQAtEQApFQAlGQAhHQAdIgAZJgAVKgARLgAMMgAINwAEOwAAP'.
- 'wAAPgIAPAQAOgYAOAkANgsANA0AMg8AMBEALhMALBUAKhcAKBo'.
- 'AJhwAJB4AIiAAID////4+Pjy8vLs7Ozm5ubg4ODa2trT09PNzc'.
- '3Hx8fBwcG7u7u1tbWurq6oqKiioqKcnJyWlpaQkJCJiYmDg4N9'.
- 'fX13d3dxcXFra2tkZGReXl5YWFhSUlJMTExGRkZAQEA1BLn4AA'.
- 'AAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxEA'.
- 'AAsRAX9kX5EAAAAHdElNRQfTAwkUKC74clmyAAAAQklEQVR4nG'.
- 'NgQAVBYVCGt5dXYEQ0mOnp5h4QFgVmeri6+4dHxYMVeHoFRUTH'.
- 'gTUFBIZBWAwMkZEx8bFQM2Lj0UwHANc/DV6yq/BiAAAAAElFTk'.
- 'SuQmCC' ;
-
-//==========================================================
-// File: bxs_graypurple.png
-//==========================================================
- $this->imgdata_xsmall[4][0]= 542 ;
- $this->imgdata_xsmall[4][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABSl'.
- 'BMVEX////////11P/MqdvKrNfAwMC+u7+9u7+4rr24lsi3rby3'.
- 'lMe1rLq1o720q7i0oL20ksSzoryyqbaykMGxlb2wkL+vnbiujb'.
- '2sjLuri7qpl7GoirWoibenmK2mla6mjLKmhrSllauki7CjhrCj'.
- 'hLGihLChg6+ggq2fkqadkKOcfqqai6Gag6WYe6WXeqSWeaOTd6'.
- 'CTd5+Rdp6RdZ6RdZ2Qg5eOc5qMcpiLcZeJb5WIbpOHbZKGbJGE'.
- 'a4+CaY2AZ4t/Z4p/Zop/Zol+Zol7ZIZ6Y4V5YoR1ZH11X391Xn'.
- '9zXX1yXXtxXHtvWnluWXhsV3VqVnNpVXJoVHFnU3BmUm9jUGth'.
- 'VGdgTmheTGZcS2RcSmRaSWJYR19XRl5SQllRQlhQQVdPQFZOP1'.
- 'VLPlFJO09IPE5IOk5FOEtEN0lDOEpDOElDNklCNkc/M0XhbrfD'.
- 'AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACx'.
- 'EAAAsRAX9kX5EAAAAHdElNRQfTAwkUKCgREfyHAAAATUlEQVR4'.
- 'nGNgQAEcIko8EBY3M5Ougy+IxSXMwmTsFsAHZMqrSRvZB0W7A5'.
- 'k6FlYugXEZICaPr394Um4uSAFDRFRCbm4uxAihsDAhVOMBHT0L'.
- 'hkeRpo8AAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: bxs_red.png
-//==========================================================
- $this->imgdata_xsmall[5][0]= 357 ;
- $this->imgdata_xsmall[5][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAk1'.
- 'BMVEX////////GxsbGra3/xsbOhITWhIT/hIT/e3v/c3P/a2vG'.
- 'UlK1SkrOUlL/Y2PWUlLGSkrnUlLeSkrnSkr/SkqEGBj/KSmlGB'.
- 'jeGBjvGBj3GBj/EBD/CAj/AAD3AADvAADnAADeAADWAADOAADG'.
- 'AAC9AAC1AACtAAClAACcAACUAACMAACEAAB7AABzAABrAABjAA'.
- 'BuukXBAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
- 'cwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUIyjy5SVMAAAAS0'.
- 'lEQVR4nGNgQAFsUpJsEJastIi8ijpYTJaDU0FVgxXIlJKVUVDR'.
- '0BYHMiUUlVQ1dPVBTDZ1dS1dAwOQAgYtbSDLAGIEq6goK6rxAD'.
- 'yXBg73lwGUAAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: bxs_yellow.png
-//==========================================================
- $this->imgdata_xsmall[6][0]= 414 ;
- $this->imgdata_xsmall[6][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAzF'.
- 'BMVEX///////+/v79zYwCMewDOxoTWzoTezkr/5wj/5wDnzgDe'.
- 'xgC1pQCtnACllACcjACUhABjWgDGvVK1rUrOxlLGvUqEexilnB'.
- 'jv3hj35xj/7wj/7wD35wDv3gDn1gDezgDWxgDOvQDGtQC9rQCE'.
- 'ewB7cwBzawBrYwDWzlLn3lLe1krn3kre1hi9tQC1rQCtpQClnA'.
- 'CclACUjACMhAD/9wC/v7///8bOzoT//4T//3v//3P//2v//2Pn'.
- '50r//0r//yn39xj//xD//wBjYwDO8noaAAAAAXRSTlMAQObYZg'.
- 'AAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAH'.
- 'dElNRQfTAwkUIzoBXFQEAAAAS0lEQVR4nGNgQAFsDhJsEJaTo5'.
- '2skj5YzMnSSk7ZwBzIlOSUklPiMxYHMnW4FXT5VNVBTDZeXiNV'.
- 'QUGQAgYBYyBLEGIEq5gYK6rxAH4kBmHBaMQQAAAAAElFTkSuQm'.
- 'CC' ;
-
-//==========================================================
-// File: bxs_greenblue.png
-//==========================================================
- $this->imgdata_xsmall[7][0]= 410 ;
- $this->imgdata_xsmall[7][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAxl'.
- 'BMVEX///////+/v79znJQhSkJ7raU5hHtjraVKnJRCjIRClIyU'.
- '9++E595avbVaxr2/v7+ctbWcvb17nJxrjIx7paUxQkK9//+Mvb'.
- '17ra2Evb17tbVCY2MQGBiU5+ec9/eM5+d71tZanJxjra1rvb1j'.
- 'tbVSnJxara1rzs5jxsZKlJRChIQpUlIhQkJatbVSpaU5c3MxY2'.
- 'MYMTEQISFavb1Sra1KnJxCjIw5e3sxa2spWlpClJQhSkoYOTkp'.
- 'Y2MhUlIQKSkIGBgQMTH+e30mAAAAAXRSTlMAQObYZgAAAAFiS0'.
- 'dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElNRQfT'.
- 'AwkUJy5/6kV9AAAATUlEQVR4nGNgQAGCyuyCEJaGugKHviVYzF'.
- 'hO3sxCWwDIVNLTM9PXtpEGMhW12Cy0DR1ATEFLSxZ7BweQAgYd'.
- 'HUMHBweIEQKiogKoxgMAo/4H5AfSehsAAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: bxs_purple.png
-//==========================================================
- $this->imgdata_xsmall[8][0]= 364 ;
- $this->imgdata_xsmall[8][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAnF'.
- 'BMVEX///////+/v7/Gvca9rb3Grcb/xv+1hLWte629hL21e7XG'.
- 'hMbWhNbOe87We9b/hP//e/97OXv/c///a///Y/+cOZz/Sv/WOd'.
- 'bnOefvOe//Kf9jCGNrCGv/EP//CP/nCOf/AP/3APfvAO/nAOfe'.
- 'AN7WANbOAM7GAMa9AL21ALWtAK2lAKWcAJyUAJSMAIyEAIR7AH'.
- 'tzAHNrAGtjAGPP1sZnAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgF'.
- 'HUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUIj'.
- 'mBTjT/AAAASUlEQVR4nGNgQAGskhKsEJaCrJiSuhZYTEFASFlD'.
- 'GyQuqSCnrK6tJwpkiquoamgbGIGYrFpaugbGxmCNunpAljHECB'.
- 'ZBQRZU4wFSMAZsXeM71AAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bxs_green.png
-//==========================================================
- $this->imgdata_xsmall[9][0]= 370 ;
- $this->imgdata_xsmall[9][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAn1'.
- 'BMVEX///////+/v7+/v7/G/8aUxpSMvYyUzpSMzoyM1oxarVqE'.
- '/4R7/3tavVpKnEpaxlpz/3Nr/2tKtUpj/2Na51pKzkpK1kpK50'.
- 'pK/0oYcxgp/ykYlBgY3hgY7xgY9xgQ/xAI/wgA/wAA9wAA7wAA'.
- '5wAA3gAA1gAAzgAAxgAAvQAAtQAArQAApQAAnAAAlAAAjAAAhA'.
- 'AAewAAcwAAawAAYwA0tyxUAAAAAXRSTlMAQObYZgAAAAFiS0dE'.
- 'AIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAw'.
- 'kUKBrZxq0HAAAATElEQVR4nGNgQAGccrIcEJaivISyhjaIxa7I'.
- 'I6CiqcMKZMopKqho6OhLA5kyqmqaOobGICartraeoYkJSAGDnj'.
- '6QZQIxgk1Skg3VeABlVgbItqEBUwAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bxs_darkgreen.png
-//==========================================================
- $this->imgdata_xsmall[10][0]= 563 ;
- $this->imgdata_xsmall[10][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABX1'.
- 'BMVEX////////l/+nAwMC86r+8wb28wby8wLy78sCzw7SywrSx'.
- 'wLKwvrGuvK+syK+ryq2rx62n36ym3aumxKmk2qij0Keh16ahva'.
- 'Og1aSguKKe06KeuaCetZ+d0KGdtZ+bz6Cay56ZyZ2Zwp2Zr5qZ'.
- 'rpqYwJuXyZuXrJmVw5mUxZiTxJeTw5eTq5WRwJWPtJKOvZKKuI'.
- '6Kt42Kn4yJt42ItIuGsomFsYmEsIiEr4eDr4eBrIR/qoN+qIJ8'.
- 'poB7pH56o356on14nnt2nXl0mndzmnZzmXZymHVwlXNvlHJukn'.
- 'FtiHBqjm1qjW1oi2toiWpniWplh2hlhmdkhWdig2VggGNgf2Je'.
- 'fmFdfGBde19bbl1aeFxXdFpWclhVclhVcVdUcFZTb1VSbVRQal'.
- 'JPaVFKY0xKYkxJYUtIYEpHX0lEWkZCWERCV0NCVkM/U0A+U0A+'.
- 'UUA+UEA9Uj89UT48Tj45TDvewfrHAAAAAXRSTlMAQObYZgAAAA'.
- 'FiS0dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElN'.
- 'RQfTAwkUKCFozUQjAAAATUlEQVR4nGNgQAGcoqrcEJYQB5OhSw'.
- 'CIxSXGwWThGcIDZCppK5o7hyV6AZl6NnbuoSmFICZ3YHB0RkkJ'.
- 'SAFDbEJaSUkJxAjeyEheVOMBQj4MOEkWew4AAAAASUVORK5CYI'.
- 'I=' ;
-
-//==========================================================
-// File: bxs_cyan.png
-//==========================================================
- $this->imgdata_xsmall[11][0]= 530 ;
- $this->imgdata_xsmall[11][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABPl'.
- 'BMVEX////////F///AwMCvxsaC1NSC0dGCz8+CzMyA//94//91'.
- '//9q//9j//9X4uJX09NXz89Xx8dXxMRL//9L5uZL3d1L2NhLxs'.
- 'ZLt7cv//8e9fUe8fEe7u4e398epqYehoYX//8L+PgK//8F9fUE'.
- '/v4E5+cEb28EZ2cC//8C/v4C/f0CzMwCrq4Cjo4CdXUCaWkCZW'.
- 'UB/PwA//8A/f0A+/sA8/MA7e0A7OwA6+sA5eUA5OQA4uIA4eEA'.
- '3NwA2toA2NgA1dUA09MA0tIA0NAAysoAxsYAxcUAxMQAv78Avr'.
- '4AvLwAtrYAtbUAs7MAsLAAra0Aq6sAqKgApaUApKQAoqIAoKAA'.
- 'n58AmpoAlZUAk5MAkpIAkJAAj48AjIwAiYkAh4cAf38AfX0Ae3'.
- 'sAenoAcnIAcHAAa2sAaWkAaGgAYmIUPEuTAAAAAXRSTlMAQObY'.
- 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAA'.
- 'AHdElNRQfTAwkUKQFKuFWqAAAATUlEQVR4nGNgQAGsUjJsEJaR'.
- 'grC5qz9YzIiL28YriB3IlDZRsnYNiZUDMmXtHT2CE9JBTDb/wI'.
- 'jkzEyQAoaomMTMzEyIERzy8hyoxgMAN2MLVPW0f4gAAAAASUVO'.
- 'RK5CYII=' ;
-
-//==========================================================
-// File: bxs_orange.png
-//==========================================================
- $this->imgdata_xsmall[12][0]= 572 ;
- $this->imgdata_xsmall[12][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABaF'.
- 'BMVEX//////////8X/3oD/3nj/1HX/0Gr/xGP/rkv/gBf+iS/2'.
- 'bAL1agDxaQDuZwDrZwLpZQDmZQLlZADjcx7gZATeYQDdZgraXw'.
- 'DZXwHYXgDXiEvXZAvUjlfUXwXTjVfTbR7ShUvRbR7RWwDMWQDL'.
- 'WADKooLKWADJoYLJgkvHWATGoILFn4LFgEvFVgDEZx7EVQDDt6'.
- '/DVQDCt6/CnoLChlfCVADAwMC+hFe+UgC8UgC6UQC4gVe4UAC3'.
- 'gVe3UAC1gFe1eUu1TwC1TgCzTgCwTQKuTACrSgCqSgCpSgCpSQ'.
- 'CodEulSACkRwCiRgCdRACcRACaQwCYQgCWQgKVQQCVQACUQACS'.
- 'UR6RPwCOPgCNPQCLPACKPACJOwCEOQCBOAB+NwB9NgB8NgB7NQ'.
- 'B6NwJ4NAB3RR52MwB0MgBuLwBtLwBsLwBqLgBpLQBkLQJiKgBh'.
- 'KgBgKwRcKABbKQJbJwBaKQRaJwBYKAJVJQDZvdIYAAAAAXRSTl'.
- 'MAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9k'.
- 'X5EAAAAHdElNRQfTAwkUJBSSy88MAAAATUlEQVR4nGNgQAGqwo'.
- 'paEBYPJ4eKezCIpc7HwmrqG6ENZMpLihm6RaWEAZl6Vo7ekRnF'.
- 'IKZWSHhcTnk5SAFDfFJWeXk5xAjj1FRjVOMBeFwNcWYSLjsAAA'.
- 'AASUVORK5CYII=' ;
-
-//==========================================================
-// File: bxs_lightblue.png
-//==========================================================
- $this->imgdata_xsmall[13][0]= 554 ;
- $this->imgdata_xsmall[13][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABVl'.
- 'BMVEX////////d///AwMC7wcS08P+y+P+xxdCwxM+uws2twMur'.
- 'vsinzNynytylzuKhyN6e5v6d5P+d1fOcwNWcu8ub4f+at8iZ3v'.
- '+ZvdGY2/yW2f+VscGU1vuT1fqTr72Sx+SSxeKR0fWRz/GPz/OP'.
- 'rr+OyeqMy+6Myu2LyeyKxueJudSGw+SGorGDvt+Cvd6CvN2Aud'.
- 'p+uNd+t9Z9tdV8tdR8tNN6sc94r813rct2q8h0qcZ0qMVzp8Rx'.
- 'o8Bwor5tn7ptnrptnrlsnbhqmbRpmbNpi51ol7Flkqtkkqtkka'.
- 'pjj6hijaRhjaZgi6NfiqJfiaFdh55bhJtag5pZgphYgJZYf5VX'.
- 'cn9Ve5FSeI1RdopRdYlQdYlPc4dPcoZPcoVNcINLboBLbH9GZn'.
- 'hGZXdFZHZEY3RDYnJCXW4/W2s/WWg+Wmo7VmU7VGM7U2E6VGM6'.
- 'VGI5UV82T1wGxheQAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHU'.
- 'gAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUJziL'.
- 'PvAsAAAATUlEQVR4nGNgQAHsQgqcEJYgG5Oegy+IxSHOxmTiFs'.
- 'gFZMprKBnbB8e7AplaFlbOQUl5ICanX0BEWmEhSAFDVGxKYWEh'.
- 'xAjusDBuVOMBJO8LrFHRAykAAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: bxs_darkgray.png
-//==========================================================
- $this->imgdata_xsmall[14][0]= 574 ;
- $this->imgdata_xsmall[14][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAYAAACNMs+9AAAABm'.
- 'JLR0QAAAAAAAD5Q7t/AAAACXBIWXMAAAsRAAALEQF/ZF+RAAAB'.
- 'iElEQVR42k3QPU8TYRwA8P//ebkXrgdIColXRAOEkJqbaExMut'.
- 'DBhE1GNjYHPg+DG6ODiU6QOLjVxITBcFKBYCstlAC2Bz17fe76'.
- 'vLD6+wg/1FpTRFR5lpaub/u1eGBGaAT4HneD4OlXx7avtDYUjT'.
- 'HQabd2Ti8e3vVSKzxrtHS32wIpFVldno22Nqvvg2Bhl0gp/aNm'.
- 'vJ3qqXAtLIva+ks1H0wqlSXi4+d6+OFTfRsAfHJx2d1od24rZP'.
- 'xP2HzopINr1mkesX7ccojqif0v9crxWXODZTno3+dNGA7uWLsd'.
- 'mUYU4fHJCViMG9umLBmM4L6fagZGg9QKfjZ+Qfy3C3G/B3mugF'.
- 'IHHNcDf64E3KJALApk2p8CSolUUqLjFkyxOGMsTtFyJ+Wz57NQ'.
- '8DghS4sLB0svioeZZo7nPhFoUKZDIVFbglkTTnl5/rC8snjAkJ'.
- 'Bk/XV5LxHC/v7tR8jzTFPbg8LENK9WX0Vv31T2AEmCSmlKCCoh'.
- 'ROnP1U1tPFYjJBRcbtzSf+GPsFTAQBq1n4AAAABKdEVYdHNpZ2'.
- '5hdHVyZQBiYzYyMDIyNjgwYThjODMyMmUxNjk0NWUzZjljOGFh'.
- 'N2VmZWFhMjA4OTE2ZjkwOTdhZWE1MzYyMjk0MWRkM2I5EqaPDA'.
- 'AAAABJRU5ErkJggg==' ;
+ //==========================================================
+ // File: bl_red.png
+ //==========================================================
+ $this->imgdata_large[0][0]= 1072 ;
+ $this->imgdata_large[0][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAAByF'.
+ 'BMVEX/////////xsb/vb3/lIz/hIT/e3v/c3P/c2v/a2v/Y2P/'.
+ 'UlL/Skr/SkL/Qjn/MTH/MSn/KSn/ISH/IRj/GBj/GBD/EBD/EA'.
+ 'j/CAj/CAD/AAD3QkL3MTH3KSn3KSH3GBj3EBD3CAj3AAD1zMzv'.
+ 'QkLvISHvIRjvGBjvEBDvEAjvAADnUlLnSkrnMTnnKSnnIRjnGB'.
+ 'DnEBDnCAjnAADec3PeSkreISHeGBjeGBDeEAjWhITWa2vWUlLW'.
+ 'SkrWISnWGBjWEBDWEAjWCAjWAADOnp7Oa2vOGCHOGBjOGBDOEB'.
+ 'DOCAjOAADJrq7Gt7fGGBjGEBDGCAjGAADEpKS/v7+9QkK9GBC9'.
+ 'EBC9CAi9AAC1e3u1a2u1Skq1KSm1EBC1CAi1AACtEBCtCBCtCA'.
+ 'itAACngYGlCAilAACghIScOTmcCAicAACYgYGUGAiUCAiUAAiU'.
+ 'AACMKSmMEACMAACEa2uEGAiEAAB7GBh7CAB7AABzOTlzGBBzCA'.
+ 'BzAABrSkprOTlrGBhrAABjOTljAABaQkJaOTlaCABaAABSKSlS'.
+ 'GBhSAABKKSlKGBhKAABCGBhCCABCAAA5CAA5AAAxCAAxAAApCA'.
+ 'ApAAAhAAAYAACc9eRyAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgF'.
+ 'HUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkRFD'.
+ 'UHLytKAAAB4UlEQVR4nGNgIAK4mGjrmNq6BmFIWMmISUpKSmk5'.
+ 'B8ZEokj4qoiLiQCBgqald3xaBpKMj6y4sLCQkJCIvIaFV0RaUR'.
+ 'lCSk5cWEiAn19ASN7QwisuraihHiajKyEixM/NwckjoKrvEACU'.
+ 'qumpg7pAUlREiJdNmZmLT9/cMzwps7Smc3I2WEpGUkxYkJuFiY'.
+ 'lTxszePzY1v7Shc2oX2D+K4iLCgjzsrOw8embuYUmZeTVtPVOn'.
+ 'gqSslYAOF+Ln4ZHWtXMPTcjMrWno7J82rRgoZWOsqaCgrqaqqm'.
+ 'fn5peQmlsK1DR52vRaoFSIs5GRoYG5ub27n19CYm5pdVPnxKnT'.
+ 'pjWDpLydnZwcHTz8QxMSEnJLgDL9U6dNnQ6Sio4PDAgICA+PTU'.
+ 'zNzSkph8hADIxKS46Pj0tKTc3MLSksqWrtmQySAjuDIT8rKy0r'.
+ 'Kz+vtLSmur6jb9JUIJgGdjxDQUVRUVFpaUVNQ1NrZ9+kKVOmTZ'.
+ 'k6vR0sldJUAwQNTU2dnX0TgOJTQLrSIYFY2dPW1NbW2TNxwtQp'.
+ 'U6ZMmjJt2rRGWNB3TO7vnzh5MsgSoB6gy7sREdY7bRrQEDAGOb'.
+ 'wXOQW0TJsOEpwClmxBTTbZ7UDVIPkp7dkYaYqhuLa5trYYUxwL'.
+ 'AADzm6uekAAcXAAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bl_bluegreen.png
+ //==========================================================
+ $this->imgdata_large[1][0]= 1368 ;
+ $this->imgdata_large[1][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAYAAACpSkzOAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
+ 'B3RJTUUH0wMMFi8hE9b2uAAABOVJREFUeNq9lk2sJFUVx3+3qv'.
+ 'tW95t57zFvhiFxmCFRUJRoNCQiJARMhiFx/Igxii5goTG6ZDAu'.
+ '/EhcSCIrTAgLEiKsJ8ywABNZEMJXEDYCukAmjgjzBkK/j35V1d'.
+ '333FtV97io97pfzwxfG86qcu/N+Z3zP+fcW/Apmfk4hx57+R/6'.
+ 'Rqmc9ykhsWjlsUngAA1fXIQ7b73pI/186IGHnn9dH/8frC8v4I'.
+ 'PiG53uaerR4GmKkv31mB8cyfjd946ZTwR66qVX9OTWIi8UKUv9'.
+ 'BOrZXpYZvFeiBvzI0fgSUSFKwbVG+Pl1V3HH0VvNR4KeeukV/f'.
+ 'PmMmdHhst76aXD64AbeVQ9bjNHaiGOC2o3wLrAb2/4LL/84ffn'.
+ 'fCdzkOdayKpLppBemrBsU5Y1Zdmm9LJdGU6E/t4M24Q26jRDRL'.
+ 'j3mdc49cSTekFsMzs5XuTsyLDUNSDQ25NwKOly9YIl22MYhJr/'.
+ 'uoDtBBoT0CxBRGYOAhibIaOCe//2MpfM6KHnX9cXipSlbkKWmS'.
+ 'nk9iv38J0jixw7vJfrTMYBOvhSoQHJBS09ANELloAGDxW8tfoW'.
+ 'J+5/UC8CPS0LU7r3SpYarr7M8rmFjMPLXT6/33L4si7Z2GCrQC'.
+ '+0ctlOaNs9DReV8vSLr85ndPLpZ/WNvHW+01kAVFBOGvJx0wYg'.
+ 'Sp47RIQ4Emwa8FGJXlDxSCFo5YlVgAo2hwPue/hRndboTV3EW2'.
+ 'Wp3k6wBp8q56QiWzecW6vwQfnPRkAWhFgILnq08jQ+R2nlUzzN'.
+ 'uES9Q7Vd+9fba7NmWJW61db2247qACmcjxXr45psYphsFGSLBu'.
+ 'kIajxqtjNwHkvAjQt0sg3crhPA2+fPz0CuyNFOghsGsr19mnFg'.
+ 'DGwrRm8UoAtNmQPQtRXDgdC4HImCFEKcCE0oieUWUYq2LtbiGp'.
+ 'mBQmppfIkjw45DK0QNNkvQ0jMBtPL0UnDRM1rN+cxKwzvOo2NP'.
+ 'tykR9a1kfpZNDLMG6QDYJqCTBvUe1+uxs+YKyPoGrTwY2HhvC4'.
+ 'CDWQd5d4xNApNQEEMgjgLdUCLBQ5cprL/trwNwKG2IUmDqDFd5'.
+ 'sr5BWrlxuSdLDFEFlqAzXGc4zFjupqh6uqYihpxJcEgp026l2w'.
+ '7wFUv7Z6AvrfRo/n0OYzPwIKE3HUKAJg2otMBiElnsF7wngis9'.
+ '3ZDjNnLi7huCWUZfueZKTu/M0V3HvmkOFDVxVKDG04ScejSgW5'.
+ 'V0q5JYFEghuDLHlTmToqDeGOCKIVtrW9hsdmXufEcNLPSXuPHa'.
+ 'a+bvuh9df5AH/v5PDFmbWQC3Mx+TVvfGVTRB2CodNgT2JBX003'.
+ 'aANZAYS/BxCv32TV/l2C03G7jgmfjGiT/qmeEmibEYm7XzAO2k'.
+ 'A+pbgHhBgydqu54YO5eRiLCy7yDvPP6Xqf+5Z+Lu277OYuOpiw'.
+ 'H15oBmlNOMcmK5RbP+PrEscGU+DSAxdg4CICIkxnLP8aNz63Og'.
+ 'H3/rdvOb795GVhuaYo0oBc3GGrEsUPVTwO6a7LYd+X51x3Hu/t'.
+ 'lP5tS65FN+6okn9U+n/sqb596dTvhOF+02myXTmkQNrOw7yD3H'.
+ 'j14E+UDQjp24/0E9/eKrbA4HH3aMK1b2ccvXvswjv//1J/s5ud'.
+ 'Due/hRPfP+OmfOrk7vrn7a48ihA3zh8CH+8Iuffiw/n4r9H1ZZ'.
+ '0zz7G56hAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: bl_yellow.png
+ //==========================================================
+ $this->imgdata_large[2][0]= 1101 ;
+ $this->imgdata_large[2][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAAB2l'.
+ 'BMVEX//////////+///+f//9b//8b//73//7X//63//6X//5T/'.
+ '/4z//4T//3P//2v//1r//0r//0L//zH//yn//yH//xj//xD//w'.
+ 'j//wD/90L/9zn/9zH/9xj/9xD/9wj/9wD39yn37zn37zH37yH3'.
+ '7xD37wj37wDv70Lv50rv50Lv5znv5yHv5xjv5wjv5wDn51Ln5x'.
+ 'Dn3jHn3iHn3hjn3hDn3gje3oze3nPe3lLe1oze1nPe1lLe1ine'.
+ '1iHe1hje1hDe1gje1gDW1qXW1mvWzqXWzkLWzhjWzhDWzgjWzg'.
+ 'DOzrXOzq3OzpzOzgDOxkrOxinOxhjOxhDOxgjOxgDGxqXGxnvG'.
+ 'xmvGvRjGvRDGvQjGvQDFxbnAvr6/v7+9vaW9vZS9vQi9vQC9tR'.
+ 'C9tQi9tQC7u7W1tZS1tXu1tTG1tQi1rRC1rQi1rQCtrYytrSGt'.
+ 'rQitrQCtpYStpSGtpQitpQClpYSlpXulpQClnBClnAilnACcnG'.
+ 'ucnAicnACclAiclACUlFqUlCmUlAiUlACUjFKUjAiUjACMjFKM'.
+ 'jEqMjACMhACEhACEewB7ezF7exB7ewB7cwBzcylzcwBzaxBzaw'.
+ 'BraxhrawhrawBrYxBrYwBjYwBjWgBaWgBaUgCXBwRMAAAAAXRS'.
+ 'TlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAd'.
+ 'LdfvwAAAAHdElNRQfTAwkRFBKiJZ4hAAAB7ElEQVR4nI3S+1vS'.
+ 'UBgHcB67WJmIMWAVdDHEDLBC6Go0slj3Ft0m9RRBWQEmFZFDEM'.
+ 'Qgt0EMFBY7p/+198hj1kM/9N1+++x73rOd6XT/kStnTx4fPzd9'.
+ 'uwfOjFhomj7smAhwj/6Cm2O0xUwy6g7cCL99uCW3jtBmE7lsdr'.
+ 'fvejgpzP7uEDFRRoqy2k8xQPnypo2BUMP6waF9Vpf3ciiSzErL'.
+ 'XTkPc0zDe3bsHDAcc00yoVgqL3UWN2iENpspff+2vn6D0+NnZ9'.
+ '6lC5K6RuSqBTZn1O/a3rd7v/MSez+WyIpVFX8GuuCA9SjD4N6B'.
+ 'oRNTfo5PCAVR0fBXoIuOQzab1XjwwNHx00GOj8/nKtV1DdeArk'.
+ '24R+0ul9PjmbrHPYl+EipyU0OoQSjg8/m83kl/MMhx0fjCkqio'.
+ 'SMOE7t4JMAzDsizH81AqSdW2hroLPg4/CEF4PhKNx98vlevrbY'.
+ 'QQXgV6kXwVfjkTiSXmhYVcSa7DIE1DOENe7GM6lUym0l+EXKks'.
+ 'K20VAeH2M0JvVgrZfL5Qqkiy0lRVaMBd7H7EZUmsiJJcrTdVja'.
+ 'wGpdbTLj3/3qwrUOjAfGgg4LnNA5tdQx14Hm00QFBm65hfNzAm'.
+ '+yIFhFtzuj+z2MI/MQn6Uez5pz4Ua41G7VumB/6RX4zMr1TKBr'.
+ 'SXAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: bl_silver.png
+ //==========================================================
+ $this->imgdata_large[3][0]= 1481 ;
+ $this->imgdata_large[3][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAB4AAAAeCAMAAAAM7l6QAAADAF'.
+ 'BMVEUAAADOzs7Gxsa9vb21tbXOxsbOzsbGzsb3///O1ta1vb2c'.
+ 'paVSWlpKWlpSY2ve5+97hIze7/9aY2vO5/9zhJRaa3tSY3PGzt'.
+ 'aMlJxrc3tja3NKUlpCSlK1vcZze4RSWmPW5/+Upb3G3v9zhJxS'.
+ 'Y3t7jKVaa4TO3veltc6ElK1re5Rjc4ycpbV7hJRaY3M5QlLn7/'.
+ '/Gzt6lrb2EjJzO3v9ja3vG1ve9zu+1xueltdacrc6UpcaMnL1C'.
+ 'SlqElLV7jK1zhKVre5zW3u/O1ue1vc6ttcaMlKVze4xrc4RSWm'.
+ 'tKUmPG1v+9zve1xu+tveeltd6crdbe5/+9xt6cpb17hJxaY3s5'.
+ 'QlrW3vfO1u/Gzue1vdattc6lrcaUnLWMlK2EjKVze5Rrc4xja4'.
+ 'RSWnNKUmtCSmO9xuecpcZ7hKVaY4TW3v/O1vfGzu+1vd6ttdal'.
+ 'rc69xu+UnL2MlLWEjK1ze5xrc5R7hK1ja4zO1v+1veettd6lrd'.
+ 'aMlL3Gzv/39//W1t7Gxs61tb29vcatrbWlpa2cnKWUlJyEhIx7'.
+ 'e4TW1ufGxta1tcZSUlqcnK3W1u+UlKW9vda1tc57e4ytrcalpb'.
+ '1ra3vOzu9jY3OUlK29vd6MjKWEhJxaWmtSUmNzc4xKSlpjY3tK'.
+ 'SmNCQlqUjJzOxs7///8AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
+ 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
+ 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
+ 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
+ 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
+ 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
+ 'AAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA'.
+ 'AAAAAAAAAAAAAAAAAAAAAAAAD///9fnkWVAAAAAnRSTlP/AOW3'.
+ 'MEoAAAABYktHRP+lB/LFAAAACXBIWXMAAABFAAAARQBP+QatAA'.
+ 'AB/klEQVR42mNgxAsYqCdd3+lcb4hLmj8wMMvEu8DCMqYbU9op'.
+ 'UEFB2MTb26eyysomFl06XEEhUCHLpAKo2z/fujikEUVaXUFBMB'.
+ 'BouLePuV+VVWGRciIXknSEsImCQd3//xwmPr65llaFcSFJHkjS'.
+ '3iYmWUDZ//8NfCr989NjNUMSUyTg0jneSiaCINn/gmlVQM12qg'.
+ 'lJnp5waTMTE5NAkCyHWZW/lXWNfUlikmdYK0zax7siS4EDKJtd'.
+ 'mQeU1XRwLBdLkRGASucWmGVnZ4dnhZvn5lmm29iVOWpnJqcuko'.
+ 'JKR1Wm5eTkRKYF5eblp9sU2ZeUJiV7zbfVg0pH56UFBQXNjIqK'.
+ 'jgkujItX1koKTVmYajsdKu2qETVhwgSXiUDZ2Bn9xqUeoZ5e0t'.
+ 'LzYYZ3B092ndjtOnmKTmycW1s7SHa+l5dtB8zlccE6RlN0dGbM'.
+ 'mDVbd5KupNBcL6+F82XgHouLj5vRP2PWLGNdd4+ppnxe8tJec6'.
+ 'XnNsKkm0uVQ5RDRHQTPTym68nPlZbvkfYCexsa5rpJ2qXa5Umm'.
+ 'ocmec3m8vHjmSs+fgxyhC5JDQ8WSPT2lvbzm8vDIe0nbtiBLN8'.
+ '8BigNdu1B6Lsje+fPbUFMLi5TMfGmvHi/puUAv23q2YCTFNqH5'.
+ 'MvPnSwPh3HasCbm3XUpv+nS5VtrkEkwAANSTpGHdye9PAAAASn'.
+ 'RFWHRzaWduYXR1cmUANGJkODkyYmE4MWZhNTk4MTIyNDJjNjUx'.
+ 'NzZhY2UxMDAzOGFhZjdhZWIyNzliNTM2ZGFmZDlkM2RiNDU3Zm'.
+ 'NlNT9CliMAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: bl_purple.png
+ //==========================================================
+ $this->imgdata_large[4][0]= 1149 ;
+ $this->imgdata_large[4][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAACAV'.
+ 'BMVEX/////////7///5///1v//xv//rf//pf//lP//jP//hP//'.
+ 'c///a///Wv//Wvf/Uv//Sv//Qv//Qvf/Off/Mf//Kf//If//If'.
+ 'f/GP//GPf/EP//EPf/CP//CPf/CO//AP//APf3Oe/3Kff3Ke/3'.
+ 'Ie/3GO/3EO/3AO/vSu/vSufvOefvMefvIefvGOfvEOfvCOfvAO'.
+ 'fnUufnSufnMd7nId7nGN7nGNbnEN7nCN7nAN7ejN7ejNbec97e'.
+ 'c9beUtbeQtbeIdbeGNbeENbeCNbeANbWpdbWa9bWQs7WGM7WEM'.
+ '7WCM7WAM7Otc7Orc7OnM7OSsbOIb3OGMbOEMbOCMbOAM7OAMbG'.
+ 'pcbGnMbGe8bGa8bGKbXGEL3GCL3GAL3FucXBu73AvsC/v7+9pb'.
+ '29Ka29GLW9ELW9CLW9AL29ALW5rrm1lLW1e7W1MbW1GKW1EK21'.
+ 'CLW1CK21AK2tjK2thKWtMaWtIaWtGJytCK2tCKWtAK2tAKWlhK'.
+ 'Wle6WlEJylCJylAKWlAJyca5ycGJScEJScCJScAJycAJSUWpSU'.
+ 'UoyUKZSUEIyUCIyUAJSUAIyMUoyMSoyMIYSMEISMCISMAIyMAI'.
+ 'SECHuEAISEAHt7MXt7EHt7CHt7AHt7AHNzKXNzEGtzAHNzAGtr'.
+ 'GGtrEGNrCGtrAGtrAGNjCFpjAGNjAFpaAFpaAFIpZn4bAAAAAX'.
+ 'RSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsS'.
+ 'AdLdfvwAAAAHdElNRQfTAwkRFB0ymoOwAAAB9UlEQVR4nGNgIA'.
+ 'K42hhqGtm5+WFIWClKycvLK6gbuARGoEj4aMjLSElISUir6Tt7'.
+ 'x+aEIWR8leQlwEBSTc/CK7awLguuR0lGQkJMVFRUTFJVzwko1d'.
+ 'oFk9OQl5IQE+Dh5hVR0TV3CkkvbJgyASJjDZIR5GBl5eRX0TH1'.
+ 'DEqrbJ2ypBEspSgvJSXKw8bMxMavbOLoGZNf1TZlybw4oIyfLN'.
+ 'BxotxsLEzsQiaOHkFpBQ2905esrAZK2SpIAaUEuDm5+LTNPAKj'.
+ 'C+pbps1evrIDKGWnLictKSkuLKyoZQyUya9o7Z2+YMXKGUApew'.
+ 'M9PTVdXR0TEwf3wOjUirruafOXL18xFyjl72Kpb25qaurg4REU'.
+ 'EFVe2zJ5zpLlK1aCpbydnZ2dnDwDA6NTopLLeiZNXbB8BcTAyP'.
+ 'TQ0JDg4KCY1NS83JKmiVOBepYvX9UPlAovzEiPSU/LLyior2vq'.
+ 'mjZr3vLlIF01IC+XVhUWFlZW1Lc290ycOGfxohVATSsXx4Oksn'.
+ 'vaWlsb2tq6J0+bM2/RohVA81asbIcEYueU3t7JU6ZNnwNyGkhm'.
+ '+cp5CRCppJnzZ8+ZM3/JUogECBbBIixr8Yqly8FCy8F6ltUgoj'.
+ 'lz7sqVK2ByK+cVMSCDxoUrwWDVysXt8WhJKqG4Y8bcuTP6qrGk'.
+ 'QwwAABiMu7T4HMi4AAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: bl_gray.png
+ //==========================================================
+ $this->imgdata_large[5][0]= 905 ;
+ $this->imgdata_large[5][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAABO1'.
+ 'BMVEX////////3///39/fv7+/e5+fW3t7Wzs7WxsbG1tbGzsbG'.
+ 'xsbDxMS/v7++wMC+v7+9zsa9xsa9vb29tbW9ra29pa24uLi1xs'.
+ 'a1vb21tbWxtrattbWmpqalra2cra2cpaWcnJycjIyUpaWUnJyU'.
+ 'lJSUjIyMnJyMnJSMlJSMlIyMjJSMjIyElJSElIyEjIyEhIR7jI'.
+ 'x7hIR7hHt7e3t7e3N7e2tzhIRze3tze3Nzc3Nre3trc3Nrc2tr'.
+ 'a2tjc3Njc2tja3Nja2tjY2NjWlpaa2taY2taY2NaY1paWlpaUl'.
+ 'JSY2NSY1pSWlpSWlJSUlJSUkpKWlpKWlJKUlpKUlJKUkpKSkpK'.
+ 'SkJCUlJCUkJCSkpCSkJCQkI5Sko5QkI5Qjk5OUI5OTkxQkIxOT'.
+ 'kxMTkxMTEpMTEhMTEhKSkYISEpy7AFAAAAAXRSTlMAQObYZgAA'.
+ 'AAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdE'.
+ 'lNRQfTAwkRFQfW40uLAAABx0lEQVR4nI3SbXfSMBQA4NV3nce5'.
+ 'TecAHUywRMHSgFuBCFsQUqwBS1OsWQh0GTj//y8wZUzdwQ/efM'.
+ 'tzcm/uuXdj4z9ic/PR9k4qk1qDnf0X2/uZzKt8GaRvSubg4LVp'.
+ 'mkWzCGAT/i3Zsm2XNQHLsm2n2937LaaNnGoJFAEo27B50qN0ay'.
+ 'Wg26lXsw8fP8nmzcJb2CbsnF5JmmCE8ncN404KvLfsYwd7/MdV'.
+ 'Pdgl/VbKMIzbuwVgVZw2JlSKJTVJ3609vWUY957lgAUd1KNcqr'.
+ 'yWnOcOPn8q7d5/8PywAqsOOiVDrn42NFk+HQ7dVuXNYeFdBTpN'.
+ 'nY5JdZl8xI5Y+HXYaTVqEDp1hAnRohZM03EUjMdhn5wghOoNnD'.
+ 'wSK7KiiDPqEtz+iD4ctdyAifNYzUnScBSxwPd6GLfRURW7Ay5i'.
+ 'pS5bmrY8348C5vvUI+TLiIVSJrVA0heK/GDkJxYMRoyfCSmk4s'.
+ 'uWc3yic/oBo4yF374LGQs5Xw0GyQljI8bYmEsxVUoKxa6HMpAT'.
+ 'vgyhU2mR8uU1pXmsa8ezqb6U4mwWF/5MeY8uLtQ0nmmQ8UWYvb'.
+ 'EcJaYWar7QhztrO5Wr4Q4hDbAG/4hfTAF2iCiWrCEAAAAASUVO'.
+ 'RK5CYII=' ;
+
+ //==========================================================
+ // File: bl_brown.png
+ //==========================================================
+ $this->imgdata_large[6][0]= 1053 ;
+ $this->imgdata_large[6][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABkAAAAZCAMAAADzN3VRAAABoV'.
+ 'BMVEX////Gzs7GvbXGrZTGpXu9nHO1nHO1nIy9taXGxs7GtaXO'.
+ 'nHPGlFrGjEq9hEq1hEqte0Klczmcazmce1KtnIzGxsbGvb3OlF'.
+ 'LOlFq9hFKte0qcc0KUYzGEWimMc1K9ta3OnGvOnGPWnGO9jFq9'.
+ 'jFKlc0KUazmMYzl7UilzUjGtpZzGxr3GnGPWpWvepXO1hFJ7Wj'.
+ 'FrSiFjUjG1ra3GnHPvxpT/5733zpythFKUa0KEYzlzUilaOSF7'.
+ 'Wjm9jErvvYz/99b///f/78bnrYS1hFqle0p7UjFrSiljQiFCMR'.
+ 'iMhHO9lGvGjFLWnGv/3q3////erXuthEqlc0paQiFKMRhSQin/'.
+ '1qX/997//++cc0pjSilaQilKORhCKRiclIy9pYzGlGPntYT33q'.
+ '3vvZSEWjlSOSE5KRB7c2O1lHutczmthFqte1JrWkqtjGtCKRBa'.
+ 'SjmljGuca0KMYzGMaznOztaclISUYzmEWjFKOSF7a1qEYzFaSi'.
+ 'GUjISEa0pKOSm9vb2llIxaQhg5IQiEc2tzY0paORilnJy1raVS'.
+ 'OSljUkJjWkKTpvQWAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHU'.
+ 'gAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkREiei'.
+ 'zP2EAAAB9UlEQVR4nGWS/VfSUBjHL5QluhhBxtwyWcCus5Blpm'.
+ 'wDC4ONaWXCyBi7RMZmpQ2Bypm9W/byV3cHHo/W88s95/s5z/d5'.
+ 'uwCcCh/4L3zAf+bs0NC588On9QAYGSUuBINk6GI4cmnsBLk8Go'.
+ '1SFEGMkzRzZeLq5JE8FvDHouw1lqXiCZJOcnCKnx4AcP0GBqmZ'.
+ 'mRgRT9MMB4Wbs7cGSXNRik3dnp9fiMUzNCNKgpzN9bsaWaQo9s'.
+ '7dfH7pXiFTZCBU1JK27LmtBO8TDx7mV1eXHqXXyiIUFLWiVzHx'.
+ 'BxcJIvV4/cn6wkqmWOOwmVE3UQOAp6HxRKL5bGPj+VwhUhalFq'.
+ '8alm5vAt+LlySZTsebzcKrraIIW4JqZC3N3ga+1+EQTZKZta1M'.
+ 'pCZCSeDViqVrThsEdsLJZLJYLpZrHVGScrKBvTQNtQHY6XIM02'.
+ 'E6Ik7odRW1Dzy3N28n3kGuB3tQagm7UMBFXI/sATAs7L5vdbEs'.
+ '8Lycm923NB0j5wMe6KOsKIIyxcuqauxbrmlqyEWfPmPy5assY1'.
+ 'U1SvWKZWom9nK/HfQ3+v2HYZSMStayTNN0PYKqg11P1nWsWq7u'.
+ '4gJeY8g9PLrddNXRdW8Iryv86I3ja/9s26gvukhDdvUQnIjlKr'.
+ 'IdZCNH+3Xw779qbG63f//ZOzb6C4+ofdbzERrSAAAAAElFTkSu'.
+ 'QmCC' ;
+
+ //==========================================================
+ // File: bl_darkgreen.png
+ //==========================================================
+ $this->imgdata_large[7][0]= 1113 ;
+ $this->imgdata_large[7][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAAB2l'.
+ 'BMVEX////////3///v///n/+/e99bW/+/W99bO786/v7++vr69'.
+ '/96999a7wb24vbu1/9a1zqW1u7itxrWosq6l772l1qWlxrWlxq'.
+ '2lva2cxpSU562U3q2UxqWUvaWUpZyM77WM57WMvYyMtZyMrZyM'.
+ 'pZSMnJSEvZyEtYyErZSElIx7zpR7xpx7xpR7vZR7jIRz1pRzxp'.
+ 'RzjIRrzpRrzoxrxoxrtYRrrYxrrXtrpYRrhHNjzoxjxoxjxoRj'.
+ 'vYRjtYRjrXtjpXtjlGNje2tazoxazoRaxoxaxoRavYRatYRatX'.
+ 'tarXtapXNanHNajFpae2tSzoRSxoRSvXtStXtSrXtSrXNSpXNS'.
+ 'nHNSnGtSlGtSlGNSjGtSjGNKvXtKtXNKrXNKpWtKnGtKlGNKjG'.
+ 'NKhGNKhFJKc1pKa1JCrWtCpWtCnGtClGNCjGNCjFpChFpCe1JC'.
+ 'a1JCY1I5pWs5nGM5lGM5jFo5hFo5e1o5c0o5WkoxjFoxhFoxhF'.
+ 'Ixe1Ixc1Ixc0oxa0ophFIpe0opc0opa0opa0IpY0IpWkIpWjkp'.
+ 'UkIpUjkhc0oha0IhY0IhWjkhWjEhUjkhUjEhSjEhSikhQjEhQi'.
+ 'kYWjkYSjEYSikYQjEYQikQSikQQikQQiEQOSExf8saAAAAAXRS'.
+ 'TlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAd'.
+ 'LdfvwAAAAHdElNRQfTAwkRFCaDkWqUAAAB+ElEQVR4nI3S+1vS'.
+ 'UBgHcGZlPV0ks/vFrmQWFimJjiwiYUJWjFBWFhClyZCy5hLrwA'.
+ 'x2EIwJC1w7zf2vnU0re+iHvs9++7x7zznvORbLf+TA6ct9fYMX'.
+ 'jrfAUYefpp+/iM1ykxf/lmuhUZ/PTwXC8dml5Wcd23o5H5Mk6b'.
+ '5NUU8icXbhS67rNzn9JDnguOEYGQtEEtwC+Crs3RJ76P5A/znr'.
+ 'vsNX7wQnEiwHCtK7TTkW8rvdZ9uJtvZTLkxpHhSrP66bNEj7/P'.
+ '3WNoLYeeSWQQCIpe9lQw7RNEU5rDsIYtcJ14Nocg7kRUlBNkxn'.
+ 'YmGKcp7cv3vPwR7XOJPmc0VYU3Sv0e9NOBAYG7Hbz/cMjTMveZ'.
+ 'CHkqxuTBv0PhYJB4N3XR6PJ5rMAPMnpGUxDX1IxSeMTEaZp1OZ'.
+ 'nGAIQiYtsalUIhFlmGTy3sO3AizJCKn6DKYryxzHsWyaneMzr6'.
+ 'cWxRVZVlFTe4SpE3zm+U/4+whyiwJcWVMQNr3XONirVWAklxcE'.
+ 'EdbqchPhjhVzGpeqhUKhWBQhLElr9fo3pDaQPrw5xOl1CGG1JE'.
+ 'k1uYEBIVkrb02+o6RItfq6rBhbw/tuINT96766KhuqYpY3UFPF'.
+ 'BbY/19yZ1XF1U0UNBa9T7rZsz80K0jWk6bpWGW55UzbvTHZ+3t'.
+ 'vbAv/IT+K1uCmhIrKJAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: bl_green.png
+ //==========================================================
+ $this->imgdata_large[8][0]= 1484 ;
+ $this->imgdata_large[8][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAYAAACpSkzOAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
+ 'B3RJTUUH0wMMFjM4kcoDJQAABVlJREFUeNq9ll2MJFUVx3/11V'.
+ 'Vd/TE9vU0v4zLDwJIF16jBqLAPhsRXEiDqg0QTJiQSjcSNvCzw'.
+ 'sBEDDxizhvAAxBgf1oR9QF9NiE9ESFZkQyZB5WtddmdnZ3qqqr'.
+ 'uqbt367Cofqu3ZZpWVaDzJfbkf53//55z/PVdZXV3l/2H6f7Lp'.
+ '5VdOV/4Nb+GmHpUeA7AdBNxc3kafNb73jRPK9Xwon8ToxVefqU'.
+ 'b91wibH5EkCQBCizFihTSviHUHR0hWws9xe3wvJ7/7nPKpgX5y'.
+ '9oFqt3eOgWniRBoAbUBGGqZUibSYaeoT2B5bnkdaSA6793Cv/S'.
+ 'QPPbihXBfo5VdOV+8dfgnvwAU62YH5fCZ12sDujFkwyegCqTrB'.
+ 'iUOKTOJKj8jr88jS8zy6cXwBTP048nuHX0I0nDlIp7RpTG7kM0'.
+ 'sdyAYsTVukUuWGhlWHMq0ITL92lnUp9R1Obz/GmTNnqn9bDD8/'.
+ '+0D1oX0O0zQZZDYCsK2j3Gl9jQqDfHiei8GfiKVLlsZkJaBAN1'.
+ '0i6PgwUbB0GxG5/PrtE/xLRr959Znqw9452oVNI+jiJhnr1pe4'.
+ 'k29zB1/nFr5Kj7tpt1YYhJ0FJ7nUYbcJQBgahN2MzeCP/OipR6'.
+ 'prgN6Qr6ELFQFUWoRpNVjlKwxZB8DCpE+PtfEKqV1cUzxpVudu'.
+ 'GTBHA5Y1g99e+dUio9O/P1Vpq+/WE5GGjDSMoAtAQjrf3C52IP'.
+ 'QxpY4WK2hpReka9Gfrhqgz0bACRoCWjDh56kQ1z9FeuUUQxVhK'.
+ 'B92sD1VahM+bAJgcoJhGjP/6Ln8rAgDiRCVRKiIzxMkkodBJ85'.
+ 'im1IlEHbE4k1xyNveL4YP8HarmGJIOpqyjeQmfNHmTvnqZTWBt'.
+ 'vIJXpPwlukJSuSTKGK3pEwtJmiX00ZlInTyNscImO6XBITvH1c'.
+ '8vVt2OucdKvIyeKRTNCivsEMgcpg6taYs30nfq0Gqg6hOSSFJ4'.
+ 'BSnJPht0IqEjWmOGocEI6F0J94F0qaL6BntTF0MtUfweKQKAPU'.
+ 'Wwp4OcVnQAmVb0p9DLOzjEhEKnGRmoRc7EzRGlwA6NujAKG4yP'.
+ '6Sjwc4aVznZ7DK0xXdkDoJf0kGmFBniFBOBGcZSCCSKd0IwN0k'.
+ 'IS+QZWCGVZex4BnUxya3+Zt9iugQbcRFpIAtuHvAZulPUdLhUJ'.
+ 'RqegI3WcqaSXddlT3idsWMSRRGkEtNwmyTifAwyBo7LP+11J0e'.
+ '7tM7pZOYblHkBLcqZ5LcYtw6Wbd4CM3SpE9foYZsIHoqDKCrbz'.
+ 'mLSQtPwmuhXgtBLs0GBdbXOhFGB7WBKO2F8GXt9/VO97Ya3atF'.
+ '7nUHnwGjGGQqcPxFEdFqURkEidiZszAERoYIsGju1hq21kWee3'.
+ 'bw15+8WpsvAy3K1+i3JkkhZyPpxxjjPOsfOYiZ+TFhLPzQnHOU'.
+ 'tpzGB2dgA4tscIkKIx19Cxg/fPL7vQJu47eXt1VvsDK8pwPueZ'.
+ 'PuZoQMOqhRoJHSs0kKLBWjvjYinmeQGw1TaX1RFdfZ3LMzYLjA'.
+ 'C++dkn6AaH2Nobk6cxEzdnuG0TdC8zvdJkN0hqkFkO/jwL0fxa'.
+ 'so8sBcuFzQ+/+MRC+BeAHnpwQzn++ee5KT9Eshuy46dcKAXm32'.
+ '0uzPQhS4GttkH2GQID2Wc0Y4LtAbDxhZ/x5A+e/uTG9+jGceXH'.
+ '9/ySnnIXnUzOxXe1038mW3ZynNmam4yYWkO+f9cv+Oljz16/lV'.
+ '9tDz/9nerc1hm8ZEScSRK7VvtYl1i1dklsOKyvc+zg/bzw1O8+'.
+ '/efkajt56kR1ydlEJBc5H46xzbrJ3dY9wrB7hGcff+6/+279L+'.
+ '0fHxyiE8XMLl4AAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: bl_blue.png
+ //==========================================================
+ $this->imgdata_large[9][0]= 1169 ;
+ $this->imgdata_large[9][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABoAAAAaCAMAAACelLz8AAACEF'.
+ 'BMVEX/////////7//35//v1v/exv/Wvf/Wrf/Wpf/Orf+/v7+9'.
+ 'tc69jP+9hP+5ucW1tc6tlP+rq7Wlpdalpcalpb2cnM6cnMacc/'.
+ '+cWv+UlLWUjN6UjK2Uc/+Ma/+MUv+EhKWEa/+EQvd7e8Z7e7V7'.
+ 'e6V7c957Wv9za9Zza8ZzSv9ra5xrSv9rOf9rMe9jUudjQv9jOe'.
+ '9aWpRaUt5aUpRaSu9aSudSUoxSSs5SSoxSMf9KQtZKOfdKMedK'.
+ 'Kf9KKe9CKf9CKb1CKa1CIfdCIedCId45MXs5Kfc5If85Iec5Id'.
+ 'Y5GP8xMbUxMXsxKc4xKZQxIf8xGP8xGO8xGN4xGNYxGL0xGK0p'.
+ 'KXMpIYwpGP8pGO8pGOcpGNYpGM4pEP8pEPcpEOcpEN4pENYpEM'.
+ 'YpEL0hGKUhEP8hEPchEO8hEOchEN4hENYhEM4hEMYhELUhCP8h'.
+ 'CO8hCN4YGJwYGGsYEL0YEK0YEHMYCN4YCM4YCMYYCL0YCKUYAP'.
+ '8QEJQQEIwQEHsQEGsQCM4QCLUQCK0QCKUQCJwQCJQQCIwQCHMQ'.
+ 'CGsQAP8QAPcQAO8QAOcQAN4QANYQAM4QAMYQAL0QALUQAKUQAJ'.
+ 'QQAIQICGsICGMIAO8IANYIAL0IALUIAK0IAKUIAJwIAJQIAIwI'.
+ 'AIQIAHsIAHMIAGsIAGMAAN4AAMYAAK0AAJQAAIwAAIQAAHMAAG'.
+ 'sAAGMAAFrR1dDlAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
+ 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkRFRPMOZ'.
+ '/2AAAB+klEQVR4nGNgIAIIqeqZmBqpi2JISNml5lVXV3d198Yo'.
+ 'oUjwm1SnxsbGRsSm5ZfNXO4tjCTjVh0ABhFx6QV9E1Y0S8JkuN'.
+ '3yAgLc7W3t/QPi4jPKJ8ye1yoIlTKpjvVy15eVUbN0i4zKLJ8w'.
+ 'ae6qcKgLqmMj3PUFWFl5NJ0CExLLJzbNW7BWCyxlXR0ba6/Axs'.
+ 'zELmfnkRBT0QiSKgXJCOflxUbYy3KyMHEoOrtEZ1c2TZ6/cMl6'.
+ 'eaCUamdsbIC7tjgPr4SBS3BMMVDTwkXr1hsDpYy6UmMj/O0tdX'.
+ 'QNbDxjknJLWqYsXLx0vStQynxGflpkZGCgs7Onp29SbtNkoMy6'.
+ 'pevCgFJWy3oyMuKjgoKCPWNCvEuqWhcsWrJ06XqQlPnMvrKyrM'.
+ 'TomJjkZAfHlNa2qdOWrlu63gcopbG8v7+hvLwip7g4JdSxsLZu'.
+ '8dKlS9ettwBKic2eNXHChIkTG5tKqgpr2uo6loLAehWQx0LnzJ'.
+ '49p6mpeXLLlNq6RUvqly6dvnR9Bx9ISnnlvLmT582bMr9t4aL2'.
+ '+vrp60GaDCGB6Ld6wfwFCxYCJZYsXQ+SmL6+FBryInVrFi1atH'.
+ 'jJkqVQsH6pNCzCJNvXrQW6CmQJREYFEc2CYevXrwMLAyXXl0oz'.
+ 'IAOt0vVQUGSIkabkDV3DwlzNVDAksAAAfUbNQRCwr88AAAAASU'.
+ 'VORK5CYII=' ;
+
+ //==========================================================
+ // File: bs_red.png
+ //==========================================================
+ $this->imgdata_small[0][0]= 437 ;
+ $this->imgdata_small[0][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAk1'.
+ 'BMVEX////////GxsbGra3/xsbOhITWhIT/hIT/e3v/c3P/a2vG'.
+ 'UlK1SkrOUlL/Y2PWUlLGSkrnUlLeSkrnSkr/SkqEGBj/KSmlGB'.
+ 'jeGBjvGBj3GBj/EBD/CAj/AAD3AADvAADnAADeAADWAADOAADG'.
+ 'AAC9AAC1AACtAAClAACcAACUAACMAACEAAB7AABzAABrAABjAA'.
+ 'BuukXBAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
+ 'cwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGDNEMgOYAAAAm0'.
+ 'lEQVR4nI3Q3RKCIBAFYGZMy9RKzX7MVUAUlQTe/+kS0K49d3wD'.
+ '7JlFaG+CvIR3FvzPXgpLatxevVVS+Jzv0BDGk/UJwOkQ1ph2g/'.
+ 'Ct5ACX4wNT1o/zzUoJUFUGBiGfVnDTYGJgmrWy8iKEtp0Bpd2d'.
+ 'jLGu56MB7f4JOOfDJAwoNwslk/jOUi+Jts6RVNrC1hkhPy50Ef'.
+ 'u79/ADQMQSGQ8bBywAAAAASUVORK5CYII=' ;
+
+
+ //==========================================================
+ // File: bs_lightblue.png
+ //==========================================================
+ $this->imgdata_small[1][0]= 657 ;
+ $this->imgdata_small[1][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAABVl'.
+ 'BMVEX////////d///AwMC7wcS08P+y+P+xxdCwxM+uws2twMur'.
+ 'vsinzNynytylzuKhyN6e5v6d5P+d1fOcwNWcu8ub4f+at8iZ3v'.
+ '+ZvdGY2/yW2f+VscGU1vuT1fqTr72Sx+SSxeKR0fWRz/GPz/OP'.
+ 'rr+OyeqMy+6Myu2LyeyKxueJudSGw+SGorGDvt+Cvd6CvN2Aud'.
+ 'p+uNd+t9Z9tdV8tdR8tNN6sc94r813rct2q8h0qcZ0qMVzp8Rx'.
+ 'o8Bwor5tn7ptnrptnrlsnbhqmbRpmbNpi51ol7Flkqtkkqtkka'.
+ 'pjj6hijaRhjaZgi6NfiqJfiaFdh55bhJtag5pZgphYgJZYf5VX'.
+ 'cn9Ve5FSeI1RdopRdYlQdYlPc4dPcoZPcoVNcINLboBLbH9GZn'.
+ 'hGZXdFZHZEY3RDYnJCXW4/W2s/WWg+Wmo7VmU7VGM7U2E6VGM6'.
+ 'VGI5UV82T1wGxheQAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHU'.
+ 'gAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGTok'.
+ '9Yp9AAAAtElEQVR4nGNgIBaw8wkpKghzwvksPAKiUsraprYiLF'.
+ 'ARXkE2JiZ1PXMHXzGIAIekOFBE08TGLTCOCyzCLyvDxsZqZOnk'.
+ 'E56kAhaRV9NQUjW2tPcMjs9wBYsY6Oobmlk7egRGpxZmgkW0zC'.
+ '2s7Jy9giKT8gohaiQcnVzc/UNjkrMLCyHmcHr7BYREJKTlFxbm'.
+ 'QOxiEIuKTUzJKgQCaZibpdOzQfwCOZibGRi4dcJyw3S4iQ4HAL'.
+ 'qvIlIAMH7YAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: bs_gray.png
+ //==========================================================
+ $this->imgdata_small[2][0]= 550 ;
+ $this->imgdata_small[2][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAAQCAMAAADH72RtAAABI1'.
+ 'BMVEX///8AAAD8EAD8IAD8NAD8RAD8VAAYGBi/v7+goKCCgoJk'.
+ 'ZGRGRkb8yAD83AD87AD8/AD4+ADo+ADY+ADI+AC0+ACk+ACU+A'.
+ 'CE+AB0/ABk/ABU/ABE/AAw/AAg/AAQ/AAA/AAA+AAA6BAA2CAA'.
+ 'yDQAtEQApFQAlGQAhHQAdIgAZJgAVKgARLgAMMgAINwAEOwAAP'.
+ 'wAAPgIAPAQAOgYAOAkANgsANA0AMg8AMBEALhMALBUAKhcAKBo'.
+ 'AJhwAJB4AIiAAID////4+Pjy8vLs7Ozm5ubg4ODa2trT09PNzc'.
+ '3Hx8fBwcG7u7u1tbWurq6oqKiioqKcnJyWlpaQkJCJiYmDg4N9'.
+ 'fX13d3dxcXFra2tkZGReXl5YWFhSUlJMTExGRkZAQEA1BLn4AA'.
+ 'AAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIA'.
+ 'AAsSAdLdfvwAAAAHdElNRQfTAwkUGiIctEHoAAAAfElEQVR4nI'.
+ '2N2xKDIAwF+bZ2kAa8cNFosBD//yvKWGh9dN+yk9kjxH28R7ze'.
+ 'wzBOYSX6CaNB927Z9qZ66KTSNmBM7UU9Hx2c5qjmJaWCaV5j4t'.
+ 'o1ANr40sn5a+x4biElrqHgrXMeac/c1nEpFHG0LSFoo/jO/BeF'.
+ 'lJnFbT58ayUf0BpA8wAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bs_greenblue.png
+ //==========================================================
+ $this->imgdata_small[3][0]= 503 ;
+ $this->imgdata_small[3][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAxl'.
+ 'BMVEX///////+/v79znJQhSkJ7raU5hHtjraVKnJRCjIRClIyU'.
+ '9++E595avbVaxr2/v7+ctbWcvb17nJxrjIx7paUxQkK9//+Mvb'.
+ '17ra2Evb17tbVCY2MQGBiU5+ec9/eM5+d71tZanJxjra1rvb1j'.
+ 'tbVSnJxara1rzs5jxsZKlJRChIQpUlIhQkJatbVSpaU5c3MxY2'.
+ 'MYMTEQISFavb1Sra1KnJxCjIw5e3sxa2spWlpClJQhSkoYOTkp'.
+ 'Y2MhUlIQKSkIGBgQMTH+e30mAAAAAXRSTlMAQObYZgAAAAFiS0'.
+ 'dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfT'.
+ 'AwkUGTIqLgJPAAAAqklEQVR4nI2QVxOCMBCEM6Mi2OiCvSslJB'.
+ 'CUoqjn//9TYgCfubf9Zu9uZxFqO+rscO7b6l/LljMZX29J2pNr'.
+ 'YjmX4ZaIEs2NeiWO19NNacl8rHAyD4LR6jjw6PMRdTjZE0JOiU'.
+ 'dDv2ALTlzRvSdCCfAHGCc7yRPSrAQRQOWxKc3C/IUjBlDdUcM8'.
+ '97vFGwBY9QsZGBc/A4DWZNbeXIPWZEZI0c2lqSute/gCO9MXGY'.
+ '4/IOkAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: bs_yellow.png
+ //==========================================================
+ $this->imgdata_small[4][0]= 507 ;
+ $this->imgdata_small[4][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAzF'.
+ 'BMVEX///////+/v79zYwCMewDOxoTWzoTezkr/5wj/5wDnzgDe'.
+ 'xgC1pQCtnACllACcjACUhABjWgDGvVK1rUrOxlLGvUqEexilnB'.
+ 'jv3hj35xj/7wj/7wD35wDv3gDn1gDezgDWxgDOvQDGtQC9rQCE'.
+ 'ewB7cwBzawBrYwDWzlLn3lLe1krn3kre1hi9tQC1rQCtpQClnA'.
+ 'CclACUjACMhAD/9wC/v7///8bOzoT//4T//3v//3P//2v//2Pn'.
+ '50r//0r//yn39xj//xD//wBjYwDO8noaAAAAAXRSTlMAQObYZg'.
+ 'AAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAH'.
+ 'dElNRQfTAwkUGSDZl3MHAAAAqElEQVR4nI3QWRNDMBAA4My09E'.
+ 'IF1SME0VT1okXvM/3//6kEfbZv+81eswA0DfHxRpOV+M+zkDGG'.
+ 'rL63zCoJ2ef2RLZDIqNqYexyvFrY9ePkxGWdpvfzC7tEGtIRly'.
+ 'nqzboFKMlizAXbNnZyiFUKAy4bZ+B6W0lRaQDLmg4h/k7eFwDL'.
+ 'OWIky8qhXUBQ7gKGmsxpC+ah1TdriwByqG8GQNDNr6kLjf/wAx'.
+ 'KgEq+FpPbfAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: bs_darkgray.png
+ //==========================================================
+ $this->imgdata_small[5][0]= 611 ;
+ $this->imgdata_small[5][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAA8AAAAPCAMAAAAMCGV4AAABJl'.
+ 'BMVEX////////o8v/f6O7W4OnR3PXL1OTL0evEyLvCzePAwMC/'.
+ 'v7a8wsq7t7C1xum1vtS1q6GzopmyxeKsrsOqvNWoq7anvN+nsb'.
+ 'qhrcGgqbGfpq6cp7+bqMuVmJKRm7yPlKKMnL6FkKWFipOEkLSE'.
+ 'j6qEhoqAiaB+jqd8haF7hZR4iJt4g5l3hZl2gIt2cod1hJVzeY'.
+ 'VzboJvhp9sfJJsb41peY1pd5xpdoVod4xndI5lcHxka4BjcYVg'.
+ 'Z3BfboFbb4lbZnZbYntaZ4laZYVZV3JYYWpXX3JWWm5VX4RVW2'.
+ 'NUYX9SXHxPWn5OVFxNWWtNVXVMVWFKV3xHUGZGU3dGTldFSlxE'.
+ 'Sk9ESXBCRlNBS3k/SGs/RU4+R1k9R2U6RFU2PUg0PEQxNU0ECL'.
+ 'QWAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAA'.
+ 'CxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGQmbJetrAAAAtklEQV'.
+ 'R4nGNgwAK4JZTNNOWlYDxhMT4ZDTOzQE1uMF9CiJWVU0LbxDlS'.
+ 'G8QVF+FnZ2KRNHAIiPUHaZGSlmZj5lH19A1KjLUA8lXU5MWllF'.
+ 'yjo30TYr2BfG19G11b37CEeN84H38gX1HbwTUkOjo+zjfG3hLI'.
+ 'l1exCvCNCwnxjfMz0gTyRdXNHXx9fUNCQu2MwU6SN3ZwD42LCH'.
+ 'W30IK4T8vUJSAkNMhDiwPqYiktXWN9JZj7UQAAjWEfhlG+kScA'.
+ 'AAAASUVORK5CYII=' ;
+
+
+ //==========================================================
+ // File: bs_darkgreen.png
+ //==========================================================
+ $this->imgdata_small[6][0]= 666 ;
+ $this->imgdata_small[6][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAABX1'.
+ 'BMVEX////////l/+nAwMC86r+8wb28wby8wLy78sCzw7SywrSx'.
+ 'wLKwvrGuvK+syK+ryq2rx62n36ym3aumxKmk2qij0Keh16ahva'.
+ 'Og1aSguKKe06KeuaCetZ+d0KGdtZ+bz6Cay56ZyZ2Zwp2Zr5qZ'.
+ 'rpqYwJuXyZuXrJmVw5mUxZiTxJeTw5eTq5WRwJWPtJKOvZKKuI'.
+ '6Kt42Kn4yJt42ItIuGsomFsYmEsIiEr4eDr4eBrIR/qoN+qIJ8'.
+ 'poB7pH56o356on14nnt2nXl0mndzmnZzmXZymHVwlXNvlHJukn'.
+ 'FtiHBqjm1qjW1oi2toiWpniWplh2hlhmdkhWdig2VggGNgf2Je'.
+ 'fmFdfGBde19bbl1aeFxXdFpWclhVclhVcVdUcFZTb1VSbVRQal'.
+ 'JPaVFKY0xKYkxJYUtIYEpHX0lEWkZCWERCV0NCVkM/U0A+U0A+'.
+ 'UUA+UEA9Uj89UT48Tj45TDvewfrHAAAAAXRSTlMAQObYZgAAAA'.
+ 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
+ 'RQfTAwkUGRjxlcuZAAAAtElEQVR4nGNgIBZw8osqqIpzw/msfI'.
+ 'IiUmr6lo6SbFARASEOJiYtQ2uXADmIAJeEGFBE18LBMySBBywi'.
+ 'LC/LwcFiZuvmH5WiAxZR0tRW1DC3dfYJS8zyAouYGBibWtm7+o'.
+ 'TEpZfkgEX0rG3snNx9Q2NSCksgaqRd3Ty8gyLiU/NKSiDmcPsF'.
+ 'BodHJ2UUlZTkQ+xikIlNSE7LLgECZagL2VQyc0H8YnV2uD94jS'.
+ 'ILIo14iQ4HALarJBNwbJVNAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: bs_purple.png
+ //==========================================================
+ $this->imgdata_small[7][0]= 447 ;
+ $this->imgdata_small[7][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAnF'.
+ 'BMVEX///////+/v7/Gvca9rb3Grcb/xv+1hLWte629hL21e7XG'.
+ 'hMbWhNbOe87We9b/hP//e/97OXv/c///a///Y/+cOZz/Sv/WOd'.
+ 'bnOefvOe//Kf9jCGNrCGv/EP//CP/nCOf/AP/3APfvAO/nAOfe'.
+ 'AN7WANbOAM7GAMa9AL21ALWtAK2lAKWcAJyUAJSMAIyEAIR7AH'.
+ 'tzAHNrAGtjAGPP1sZnAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgF'.
+ 'HUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGS'.
+ 'o5QpoZAAAAnElEQVR4nI3Q2xJDMBAG4MyQokWrZz3oSkJISJH3'.
+ 'f7dK0Gv/Xb7J7vyzCK0NjtPsHuH/2wlhTE7LnTNLCO/TFQjjIp'.
+ 'hHAA6bY06LSqppMAY47x+04HXTba2kAFlmQKr+YuVDCGUG2k6/'.
+ 'rNwYK8rKwKCnPxHnVS0aA3rag4UQslUGhrlk0Kpv1+sx3tLZ6w'.
+ 'dtYemMkOsnz8R3V9/hB87DEu2Wos5+AAAAAElFTkSuQmCC' ;
+
+
+ //==========================================================
+ // File: bs_brown.png
+ //==========================================================
+ $this->imgdata_small[8][0]= 677 ;
+ $this->imgdata_small[8][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAABaF'.
+ 'BMVEX//////////8X/3oD/3nj/1HX/0Gr/xGP/rkv/gBf+iS/2'.
+ 'bAL1agDxaQDuZwDrZwLpZQDmZQLlZADjcx7gZATeYQDdZgraXw'.
+ 'DZXwHYXgDXiEvXZAvUjlfUXwXTjVfTbR7ShUvRbR7RWwDMWQDL'.
+ 'WADKooLKWADJoYLJgkvHWATGoILFn4LFgEvFVgDEZx7EVQDDt6'.
+ '/DVQDCt6/CnoLChlfCVADAwMC+hFe+UgC8UgC6UQC4gVe4UAC3'.
+ 'gVe3UAC1gFe1eUu1TwC1TgCzTgCwTQKuTACrSgCqSgCpSgCpSQ'.
+ 'CodEulSACkRwCiRgCdRACcRACaQwCYQgCWQgKVQQCVQACUQACS'.
+ 'UR6RPwCOPgCNPQCLPACKPACJOwCEOQCBOAB+NwB9NgB8NgB7NQ'.
+ 'B6NwJ4NAB3RR52MwB0MgBuLwBtLwBsLwBqLgBpLQBkLQJiKgBh'.
+ 'KgBgKwRcKABbKQJbJwBaKQRaJwBYKAJVJQDZvdIYAAAAAXRSTl'.
+ 'MAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLd'.
+ 'fvwAAAAHdElNRQfTAwkUGho0tvl2AAAAtklEQVR4nGNgIBaoSg'.
+ 'mLKGpowfkGMty8AqJKpi4mRlAROR5ONg4JFUv3YHOIgDo/HwsT'.
+ 'q6yps29EsjZYREFIkJ2ZS9/OMzA20wEsIi8uKSZtaOPmH5WSFw'.
+ 'YW0VRW07Vw8vCLSMguLwCL6FlaObp6B0TGZxSXQ9TouHv6+IXG'.
+ 'JGYWlpdDzNEKCgmPjkvLKS0vL4LYxWAen5SelV8OBNZQFxrZ5h'.
+ 'aC+GX2MDczMBh7pZakehkTHQ4AA0Am/jsB5gkAAAAASUVORK5C'.
+ 'YII=' ;
+
+ //==========================================================
+ // File: bs_blue.png
+ //==========================================================
+ $this->imgdata_small[9][0]= 436 ;
+ $this->imgdata_small[9][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAk1'.
+ 'BMVEX///////+/v7+trcbGxv+EhM6EhNaEhP97e/9zc/9ra/9S'.
+ 'UsZKSrVSUs5jY/9SUtZKSsZSUudKSt5KSudKSv8YGIQpKf8YGK'.
+ 'UYGN4YGO8YGPcQEP8ICP8AAP8AAPcAAO8AAOcAAN4AANYAAM4A'.
+ 'AMYAAL0AALUAAK0AAKUAAJwAAJQAAIwAAIQAAHsAAHMAAGsAAG'.
+ 'ONFkFbAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
+ 'cwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGhNNakHSAAAAmk'.
+ 'lEQVR4nI3P2xKCIBAGYGfM6SBWo1nauIqogaDA+z9dK9Lhrv47'.
+ 'vtl/2A2CfxNlJRRp9IETYGraJeEb7ocLNKznia8A7Db7umWDUG'.
+ 'sxAzhurxRHxok4KQGqCuEhlL45oU1D2w5BztY4KRhj/bCAsetM'.
+ '2uObjwvY8/oX50JItYDxSyZSTrO2mNhvGMbaWAevnbFIcpuTr7'.
+ 't+5AkyfBIKSJHdSQAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bs_green.png
+ //==========================================================
+ $this->imgdata_small[10][0]= 452 ;
+ $this->imgdata_small[10][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAn1'.
+ 'BMVEX///////+/v7+/v7/G/8aUxpSMvYyUzpSMzoyM1oxarVqE'.
+ '/4R7/3tavVpKnEpaxlpz/3Nr/2tKtUpj/2Na51pKzkpK1kpK50'.
+ 'pK/0oYcxgp/ykYlBgY3hgY7xgY9xgQ/xAI/wgA/wAA9wAA7wAA'.
+ '5wAA3gAA1gAAzgAAxgAAvQAAtQAArQAApQAAnAAAlAAAjAAAhA'.
+ 'AAewAAcwAAawAAYwA0tyxUAAAAAXRSTlMAQObYZgAAAAFiS0dE'.
+ 'AIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAw'.
+ 'kUGgW5vvSDAAAAnklEQVR4nI3QSxKCMAwA0M4gqCgoiiJ+kEAL'.
+ 'LQUq0PufzX7ENdnlJZNkgtDS2CYZvK6bf+7EoKLA9cH5SQzv6A'.
+ 'YloTywsAbYr44FrlgrXCMJwHl3xxVtuuFkJAPIcw2tGB9GcFli'.
+ 'oqEf5GTkSUhVMw2TtD0XSlnDOw3SznE5520vNEi7CwW9+Ayjyq'.
+ 'U/3+yPuq5gvhkhL0xlGnqL//AFf14UIh4mkEkAAAAASUVORK5C'.
+ 'YII=' ;
+
+
+ //==========================================================
+ // File: bs_white.png
+ //==========================================================
+ $this->imgdata_small[11][0]= 480 ;
+ $this->imgdata_small[11][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAAQCAYAAADwMZRfAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
+ 'B3RJTUUH0wMLFTsY/ewvBQAAAW1JREFUeJytkz2u4jAUhT/jic'.
+ 'gfBUKiZhE0bIKeVbCWrIKenp6eDiGlCEEEBArIxvzGU4xeZjLk'.
+ 'jWb05lRXuvbx+exr4bouX1Xjyw7Atz81F4uFBYjjGIDhcCjq1o'.
+ 'k6nN1uZwFerxfP55Msy1itVmRZBsB4PK6YveHkeW5d18XzPIIg'.
+ 'wPd9Wq0WnU6HMAxJkoQoiuynOIfDwUopkVIihKAoCgAcx6Hdbm'.
+ 'OMIU1T5vN55eBKEikljUYDIX6kFUKU9e8aDAZlmjcca+1b7TgO'.
+ '1+uVy+VS9nzfr8e53++VzdZaiqIgz3OMMWitOZ/PaK0JgqDeRC'.
+ 'mF53lIKYGfr3O73TDGoJQiTVO01nS73XqT4/FIs9kkCAIej0eZ'.
+ 'brPZEMcxSZKgtQZgMpmIWpN+vy+m06n1PK9yTx8Gy+WS/X5Pr9'.
+ 'er9GuHLYoiG4YhSilOpxPr9Zrtdlti/JriU5MPjUYjq7UuEWaz'.
+ '2d+P/b/qv/zi75oetJcv7QQXAAAAAElFTkSuQmCC' ;
+
+
+ //==========================================================
+ // File: bs_cyan.png
+ //==========================================================
+ $this->imgdata_small[12][0]= 633 ;
+ $this->imgdata_small[12][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAABPl'.
+ 'BMVEX////////F///AwMCvxsaC1NSC0dGCz8+CzMyA//94//91'.
+ '//9q//9j//9X4uJX09NXz89Xx8dXxMRL//9L5uZL3d1L2NhLxs'.
+ 'ZLt7cv//8e9fUe8fEe7u4e398epqYehoYX//8L+PgK//8F9fUE'.
+ '/v4E5+cEb28EZ2cC//8C/v4C/f0CzMwCrq4Cjo4CdXUCaWkCZW'.
+ 'UB/PwA//8A/f0A+/sA8/MA7e0A7OwA6+sA5eUA5OQA4uIA4eEA'.
+ '3NwA2toA2NgA1dUA09MA0tIA0NAAysoAxsYAxcUAxMQAv78Avr'.
+ '4AvLwAtrYAtbUAs7MAsLAAra0Aq6sAqKgApaUApKQAoqIAoKAA'.
+ 'n58AmpoAlZUAk5MAkpIAkJAAj48AjIwAiYkAh4cAf38AfX0Ae3'.
+ 'sAenoAcnIAcHAAa2sAaWkAaGgAYmIUPEuTAAAAAXRSTlMAQObY'.
+ 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAA'.
+ 'AHdElNRQfTAwkUGQDi+VPPAAAAtElEQVR4nGNgIBawikipyIiy'.
+ 'wfksfJpGRkamNtr8LFARPiMFHmFDcztXfwGoFi0jLiZuZRtnry'.
+ 'BddrCIiJEGL6eklYO7X3iCOFhE2thESdHawdUnJDZFDiyiamZh'.
+ 'aevk5h0UlZSpBhaRtbN3dPHwDY5MSM+EqBFzc/f0DgiLTkjLzI'.
+ 'SYw6bjHxgaEZeckZmpD7GLQSAqJj4xNRMIBGFuFtRLA/ENhGBu'.
+ 'ZmDgkJBXl5fgIDocAAKcINaFePT4AAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: bs_bluegreen.png
+ //==========================================================
+ $this->imgdata_small[13][0]= 493 ;
+ $this->imgdata_small[13][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAvV'.
+ 'BMVEX///////+/v79j//855/8x3v851v9Spb1C1v8AOUqEtcZK'.
+ 'lK1StdYxzv8hxv8AY4QASmNSlK1KpcZKtd4YQlIYnM4YrecIvf'.
+ '8AtfcAre8AjL0AhLUAc5wAa5QAWnsAQloAKTkAGCFKhJxKrdYY'.
+ 'jL0Ypd4Atf8ArfcApecAnN4AlM4AjMYAe60Ac6UAY4wAUnNSnL'.
+ '0AlNYAWoQASmsAOVIAITGEtc4YWnsAUnsAMUqtvcaErcYAKUIA'.
+ 'GCkAECHUyVh/AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAA'.
+ 'AJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGxNUcXCT'.
+ 'AAAAqUlEQVR4nI2Q1xKCMBREM2NHLCCogAGCjd6SqLT8/2cZKT'.
+ '6zb3tm987OBWCsXoejp8rC35fi4+l6gXFZlD0Rz6fZ1tdDmKR9'.
+ 'RdOmkzmP7DDpilfX3SzvRgQ/Vr1uiZplfsCBiVf03RJd140wgj'.
+ 'kmNqMtuYXcxyYmNWJdRoYwzpM9qRvGujuCmSR7q7ARY00/MiWk'.
+ 'sCnjkobNEm1+HknDZgAqR0GKU43+wxdu2hYzbsHU6AAAAABJRU'.
+ '5ErkJggg==' ;
+
+ //==========================================================
+ // File: bs_lightred.png
+ //==========================================================
+ $this->imgdata_small[14][0]= 532 ;
+ $this->imgdata_small[14][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAA3l'.
+ 'BMVEX///////+/v7/Gvb0hGBj/5///3v//zu//1u//xucpGCG9'.
+ 'nK21lKVSQkp7Wms5KTExISlaOUpjQlIhEBj/tdbOhKXnrcbGjK'.
+ 'Wla4TetcbGnK2EWmv/rc73pcZ7UmOcY3vOpbW1jJzenLW9e5Rz'.
+ 'Slq1c4xrQlJSOULGhJz/pcb3nL2chIzOnK33rcbelK3WjKWMWm'.
+ 'vGe5SEUmM5ISnOtb3GrbXerb3vpb2ca3v/rcaUY3POhJxCKTF7'.
+ 'SlrWnK21e4ytc4TvnLXnlK2la3taOUK1lJxrSlLGhJRjQkpSMT'.
+ 'lw+q2nAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
+ 'cwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAwkUGjoP2Nm+AAAAr0'.
+ 'lEQVR4nGNgIBaYiOk62imYwPnMkiIyso76yhJSzFARMxkRNk49'.
+ 'a3t5OW6oFk1LVkYOfWUHKxUXiEYzLS12DnN3VXkjIRtFsIiSk5'.
+ '6evqGqhYGKugAfWMRa1FpD2UHeQEXQRlgALCJur+rgbCUNFOAS'.
+ 'hqjRkZe3MpBTcwEKCEPMMTGSs3Xz8OQHCnBBHckt6OJpIyAMBD'.
+ 'wwN/MYc4H4LK4wNzMwmGrzcvFqmxIdDgDiHRT6VVQkrAAAAABJ'.
+ 'RU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bxs_lightred.png
+ //==========================================================
+ $this->imgdata_xsmall[0][0]= 432 ;
+ $this->imgdata_xsmall[0][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAA3l'.
+ 'BMVEX///////+/v7/Gvb0hGBj/5///3v//zu//1u//xucpGCG9'.
+ 'nK21lKVSQkp7Wms5KTExISlaOUpjQlIhEBj/tdbOhKXnrcbGjK'.
+ 'Wla4TetcbGnK2EWmv/rc73pcZ7UmOcY3vOpbW1jJzenLW9e5Rz'.
+ 'Slq1c4xrQlJSOULGhJz/pcb3nL2chIzOnK33rcbelK3WjKWMWm'.
+ 'vGe5SEUmM5ISnOtb3GrbXerb3vpb2ca3v/rcaUY3POhJxCKTF7'.
+ 'SlrWnK21e4ytc4TvnLXnlK2la3taOUK1lJxrSlLGhJRjQkpSMT'.
+ 'lw+q2nAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
+ 'cwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUKBOgGhWjAAAAS0'.
+ 'lEQVR4nGNgQAEmunYmEJaMCKe1vBxYzJKVQ9lKBSSupKdnaKGi'.
+ 'zgdkiqs6WKnYcIGYJnK2HvzCwmCNgi42wsLCECNMeXlNUY0HAL'.
+ 'DaB7Du8MiEAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: bxs_bluegreen.png
+ //==========================================================
+ $this->imgdata_xsmall[1][0]= 397 ;
+ $this->imgdata_xsmall[1][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAvV'.
+ 'BMVEX///////+/v79j//855/8x3v851v9Spb1C1v8AOUqEtcZK'.
+ 'lK1StdYxzv8hxv8AY4QASmNSlK1KpcZKtd4YQlIYnM4YrecIvf'.
+ '8AtfcAre8AjL0AhLUAc5wAa5QAWnsAQloAKTkAGCFKhJxKrdYY'.
+ 'jL0Ypd4Atf8ArfcApecAnN4AlM4AjMYAe60Ac6UAY4wAUnNSnL'.
+ '0AlNYAWoQASmsAOVIAITGEtc4YWnsAUnsAMUqtvcaErcYAKUIA'.
+ 'GCkAECHUyVh/AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAA'.
+ 'AJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUKDVyF5Be'.
+ 'AAAASUlEQVR4nGNgQAFmYqJcEJaEOJ+UrD5YTJKFTZrfGCQuaq'.
+ 'glLWvMaQ5kqujo6hnbKIKYXPr68gp2dmCNJiZAlh3ECGsREWtU'.
+ '4wF1kwdpAHfnSwAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bxs_navy.png
+ //==========================================================
+ $this->imgdata_xsmall[2][0]= 353 ;
+ $this->imgdata_xsmall[2][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAk1'.
+ 'BMVEX///////+/v7+trcbGxv+EhM6EhNaEhP97e/9zc/9ra/9S'.
+ 'UsZKSrVSUs5jY/9SUtZKSsZSUudKSt5KSudKSv8YGIQpKf8YGK'.
+ 'UYGN4YGO8YGPcQEP8ICP8AAP8AAPcAAO8AAOcAAN4AANYAAM4A'.
+ 'AMYAAL0AALUAAK0AAKUAAJwAAJQAAIwAAIQAAHsAAHMAAGsAAG'.
+ 'ONFkFbAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
+ 'cwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUJxXO4axZAAAAR0'.
+ 'lEQVR4nGNgQAGskhKsEJaslIi8ijpYTJaDU1FVAyQuKSujoKKh'.
+ 'LQ5kSigpqWro6oOYrOoaWroGBmCNWiCWAdQwUVFWVOMBOp4GCJ'.
+ 's5S60AAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: bxs_gray.png
+ //==========================================================
+ $this->imgdata_xsmall[3][0]= 492 ;
+ $this->imgdata_xsmall[3][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABI1'.
+ 'BMVEX///8AAAD8EAD8IAD8NAD8RAD8VAAYGBi/v7+goKCCgoJk'.
+ 'ZGRGRkb8yAD83AD87AD8/AD4+ADo+ADY+ADI+AC0+ACk+ACU+A'.
+ 'CE+AB0/ABk/ABU/ABE/AAw/AAg/AAQ/AAA/AAA+AAA6BAA2CAA'.
+ 'yDQAtEQApFQAlGQAhHQAdIgAZJgAVKgARLgAMMgAINwAEOwAAP'.
+ 'wAAPgIAPAQAOgYAOAkANgsANA0AMg8AMBEALhMALBUAKhcAKBo'.
+ 'AJhwAJB4AIiAAID////4+Pjy8vLs7Ozm5ubg4ODa2trT09PNzc'.
+ '3Hx8fBwcG7u7u1tbWurq6oqKiioqKcnJyWlpaQkJCJiYmDg4N9'.
+ 'fX13d3dxcXFra2tkZGReXl5YWFhSUlJMTExGRkZAQEA1BLn4AA'.
+ 'AAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxEA'.
+ 'AAsRAX9kX5EAAAAHdElNRQfTAwkUKC74clmyAAAAQklEQVR4nG'.
+ 'NgQAVBYVCGt5dXYEQ0mOnp5h4QFgVmeri6+4dHxYMVeHoFRUTH'.
+ 'gTUFBIZBWAwMkZEx8bFQM2Lj0UwHANc/DV6yq/BiAAAAAElFTk'.
+ 'SuQmCC' ;
+
+ //==========================================================
+ // File: bxs_graypurple.png
+ //==========================================================
+ $this->imgdata_xsmall[4][0]= 542 ;
+ $this->imgdata_xsmall[4][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABSl'.
+ 'BMVEX////////11P/MqdvKrNfAwMC+u7+9u7+4rr24lsi3rby3'.
+ 'lMe1rLq1o720q7i0oL20ksSzoryyqbaykMGxlb2wkL+vnbiujb'.
+ '2sjLuri7qpl7GoirWoibenmK2mla6mjLKmhrSllauki7CjhrCj'.
+ 'hLGihLChg6+ggq2fkqadkKOcfqqai6Gag6WYe6WXeqSWeaOTd6'.
+ 'CTd5+Rdp6RdZ6RdZ2Qg5eOc5qMcpiLcZeJb5WIbpOHbZKGbJGE'.
+ 'a4+CaY2AZ4t/Z4p/Zop/Zol+Zol7ZIZ6Y4V5YoR1ZH11X391Xn'.
+ '9zXX1yXXtxXHtvWnluWXhsV3VqVnNpVXJoVHFnU3BmUm9jUGth'.
+ 'VGdgTmheTGZcS2RcSmRaSWJYR19XRl5SQllRQlhQQVdPQFZOP1'.
+ 'VLPlFJO09IPE5IOk5FOEtEN0lDOEpDOElDNklCNkc/M0XhbrfD'.
+ 'AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACx'.
+ 'EAAAsRAX9kX5EAAAAHdElNRQfTAwkUKCgREfyHAAAATUlEQVR4'.
+ 'nGNgQAEcIko8EBY3M5Ougy+IxSXMwmTsFsAHZMqrSRvZB0W7A5'.
+ 'k6FlYugXEZICaPr394Um4uSAFDRFRCbm4uxAihsDAhVOMBHT0L'.
+ 'hkeRpo8AAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: bxs_red.png
+ //==========================================================
+ $this->imgdata_xsmall[5][0]= 357 ;
+ $this->imgdata_xsmall[5][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAk1'.
+ 'BMVEX////////GxsbGra3/xsbOhITWhIT/hIT/e3v/c3P/a2vG'.
+ 'UlK1SkrOUlL/Y2PWUlLGSkrnUlLeSkrnSkr/SkqEGBj/KSmlGB'.
+ 'jeGBjvGBj3GBj/EBD/CAj/AAD3AADvAADnAADeAADWAADOAADG'.
+ 'AAC9AAC1AACtAAClAACcAACUAACMAACEAAB7AABzAABrAABjAA'.
+ 'BuukXBAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZ'.
+ 'cwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUIyjy5SVMAAAAS0'.
+ 'lEQVR4nGNgQAFsUpJsEJastIi8ijpYTJaDU0FVgxXIlJKVUVDR'.
+ '0BYHMiUUlVQ1dPVBTDZ1dS1dAwOQAgYtbSDLAGIEq6goK6rxAD'.
+ 'yXBg73lwGUAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: bxs_yellow.png
+ //==========================================================
+ $this->imgdata_xsmall[6][0]= 414 ;
+ $this->imgdata_xsmall[6][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAzF'.
+ 'BMVEX///////+/v79zYwCMewDOxoTWzoTezkr/5wj/5wDnzgDe'.
+ 'xgC1pQCtnACllACcjACUhABjWgDGvVK1rUrOxlLGvUqEexilnB'.
+ 'jv3hj35xj/7wj/7wD35wDv3gDn1gDezgDWxgDOvQDGtQC9rQCE'.
+ 'ewB7cwBzawBrYwDWzlLn3lLe1krn3kre1hi9tQC1rQCtpQClnA'.
+ 'CclACUjACMhAD/9wC/v7///8bOzoT//4T//3v//3P//2v//2Pn'.
+ '50r//0r//yn39xj//xD//wBjYwDO8noaAAAAAXRSTlMAQObYZg'.
+ 'AAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAH'.
+ 'dElNRQfTAwkUIzoBXFQEAAAAS0lEQVR4nGNgQAFsDhJsEJaTo5'.
+ '2skj5YzMnSSk7ZwBzIlOSUklPiMxYHMnW4FXT5VNVBTDZeXiNV'.
+ 'QUGQAgYBYyBLEGIEq5gYK6rxAH4kBmHBaMQQAAAAAElFTkSuQm'.
+ 'CC' ;
+
+ //==========================================================
+ // File: bxs_greenblue.png
+ //==========================================================
+ $this->imgdata_xsmall[7][0]= 410 ;
+ $this->imgdata_xsmall[7][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAxl'.
+ 'BMVEX///////+/v79znJQhSkJ7raU5hHtjraVKnJRCjIRClIyU'.
+ '9++E595avbVaxr2/v7+ctbWcvb17nJxrjIx7paUxQkK9//+Mvb'.
+ '17ra2Evb17tbVCY2MQGBiU5+ec9/eM5+d71tZanJxjra1rvb1j'.
+ 'tbVSnJxara1rzs5jxsZKlJRChIQpUlIhQkJatbVSpaU5c3MxY2'.
+ 'MYMTEQISFavb1Sra1KnJxCjIw5e3sxa2spWlpClJQhSkoYOTkp'.
+ 'Y2MhUlIQKSkIGBgQMTH+e30mAAAAAXRSTlMAQObYZgAAAAFiS0'.
+ 'dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElNRQfT'.
+ 'AwkUJy5/6kV9AAAATUlEQVR4nGNgQAGCyuyCEJaGugKHviVYzF'.
+ 'hO3sxCWwDIVNLTM9PXtpEGMhW12Cy0DR1ATEFLSxZ7BweQAgYd'.
+ 'HUMHBweIEQKiogKoxgMAo/4H5AfSehsAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: bxs_purple.png
+ //==========================================================
+ $this->imgdata_xsmall[8][0]= 364 ;
+ $this->imgdata_xsmall[8][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAnF'.
+ 'BMVEX///////+/v7/Gvca9rb3Grcb/xv+1hLWte629hL21e7XG'.
+ 'hMbWhNbOe87We9b/hP//e/97OXv/c///a///Y/+cOZz/Sv/WOd'.
+ 'bnOefvOe//Kf9jCGNrCGv/EP//CP/nCOf/AP/3APfvAO/nAOfe'.
+ 'AN7WANbOAM7GAMa9AL21ALWtAK2lAKWcAJyUAJSMAIyEAIR7AH'.
+ 'tzAHNrAGtjAGPP1sZnAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgF'.
+ 'HUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUIj'.
+ 'mBTjT/AAAASUlEQVR4nGNgQAGskhKsEJaCrJiSuhZYTEFASFlD'.
+ 'GyQuqSCnrK6tJwpkiquoamgbGIGYrFpaugbGxmCNunpAljHECB'.
+ 'ZBQRZU4wFSMAZsXeM71AAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bxs_green.png
+ //==========================================================
+ $this->imgdata_xsmall[9][0]= 370 ;
+ $this->imgdata_xsmall[9][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAAAn1'.
+ 'BMVEX///////+/v7+/v7/G/8aUxpSMvYyUzpSMzoyM1oxarVqE'.
+ '/4R7/3tavVpKnEpaxlpz/3Nr/2tKtUpj/2Na51pKzkpK1kpK50'.
+ 'pK/0oYcxgp/ykYlBgY3hgY7xgY9xgQ/xAI/wgA/wAA9wAA7wAA'.
+ '5wAA3gAA1gAAzgAAxgAAvQAAtQAArQAApQAAnAAAlAAAjAAAhA'.
+ 'AAewAAcwAAawAAYwA0tyxUAAAAAXRSTlMAQObYZgAAAAFiS0dE'.
+ 'AIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAw'.
+ 'kUKBrZxq0HAAAATElEQVR4nGNgQAGccrIcEJaivISyhjaIxa7I'.
+ 'I6CiqcMKZMopKqho6OhLA5kyqmqaOobGICartraeoYkJSAGDnj'.
+ '6QZQIxgk1Skg3VeABlVgbItqEBUwAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bxs_darkgreen.png
+ //==========================================================
+ $this->imgdata_xsmall[10][0]= 563 ;
+ $this->imgdata_xsmall[10][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABX1'.
+ 'BMVEX////////l/+nAwMC86r+8wb28wby8wLy78sCzw7SywrSx'.
+ 'wLKwvrGuvK+syK+ryq2rx62n36ym3aumxKmk2qij0Keh16ahva'.
+ 'Og1aSguKKe06KeuaCetZ+d0KGdtZ+bz6Cay56ZyZ2Zwp2Zr5qZ'.
+ 'rpqYwJuXyZuXrJmVw5mUxZiTxJeTw5eTq5WRwJWPtJKOvZKKuI'.
+ '6Kt42Kn4yJt42ItIuGsomFsYmEsIiEr4eDr4eBrIR/qoN+qIJ8'.
+ 'poB7pH56o356on14nnt2nXl0mndzmnZzmXZymHVwlXNvlHJukn'.
+ 'FtiHBqjm1qjW1oi2toiWpniWplh2hlhmdkhWdig2VggGNgf2Je'.
+ 'fmFdfGBde19bbl1aeFxXdFpWclhVclhVcVdUcFZTb1VSbVRQal'.
+ 'JPaVFKY0xKYkxJYUtIYEpHX0lEWkZCWERCV0NCVkM/U0A+U0A+'.
+ 'UUA+UEA9Uj89UT48Tj45TDvewfrHAAAAAXRSTlMAQObYZgAAAA'.
+ 'FiS0dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElN'.
+ 'RQfTAwkUKCFozUQjAAAATUlEQVR4nGNgQAGcoqrcEJYQB5OhSw'.
+ 'CIxSXGwWThGcIDZCppK5o7hyV6AZl6NnbuoSmFICZ3YHB0RkkJ'.
+ 'SAFDbEJaSUkJxAjeyEheVOMBQj4MOEkWew4AAAAASUVORK5CYI'.
+ 'I=' ;
+
+ //==========================================================
+ // File: bxs_cyan.png
+ //==========================================================
+ $this->imgdata_xsmall[11][0]= 530 ;
+ $this->imgdata_xsmall[11][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABPl'.
+ 'BMVEX////////F///AwMCvxsaC1NSC0dGCz8+CzMyA//94//91'.
+ '//9q//9j//9X4uJX09NXz89Xx8dXxMRL//9L5uZL3d1L2NhLxs'.
+ 'ZLt7cv//8e9fUe8fEe7u4e398epqYehoYX//8L+PgK//8F9fUE'.
+ '/v4E5+cEb28EZ2cC//8C/v4C/f0CzMwCrq4Cjo4CdXUCaWkCZW'.
+ 'UB/PwA//8A/f0A+/sA8/MA7e0A7OwA6+sA5eUA5OQA4uIA4eEA'.
+ '3NwA2toA2NgA1dUA09MA0tIA0NAAysoAxsYAxcUAxMQAv78Avr'.
+ '4AvLwAtrYAtbUAs7MAsLAAra0Aq6sAqKgApaUApKQAoqIAoKAA'.
+ 'n58AmpoAlZUAk5MAkpIAkJAAj48AjIwAiYkAh4cAf38AfX0Ae3'.
+ 'sAenoAcnIAcHAAa2sAaWkAaGgAYmIUPEuTAAAAAXRSTlMAQObY'.
+ 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAA'.
+ 'AHdElNRQfTAwkUKQFKuFWqAAAATUlEQVR4nGNgQAGsUjJsEJaR'.
+ 'grC5qz9YzIiL28YriB3IlDZRsnYNiZUDMmXtHT2CE9JBTDb/wI'.
+ 'jkzEyQAoaomMTMzEyIERzy8hyoxgMAN2MLVPW0f4gAAAAASUVO'.
+ 'RK5CYII=' ;
+
+ //==========================================================
+ // File: bxs_orange.png
+ //==========================================================
+ $this->imgdata_xsmall[12][0]= 572 ;
+ $this->imgdata_xsmall[12][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABaF'.
+ 'BMVEX//////////8X/3oD/3nj/1HX/0Gr/xGP/rkv/gBf+iS/2'.
+ 'bAL1agDxaQDuZwDrZwLpZQDmZQLlZADjcx7gZATeYQDdZgraXw'.
+ 'DZXwHYXgDXiEvXZAvUjlfUXwXTjVfTbR7ShUvRbR7RWwDMWQDL'.
+ 'WADKooLKWADJoYLJgkvHWATGoILFn4LFgEvFVgDEZx7EVQDDt6'.
+ '/DVQDCt6/CnoLChlfCVADAwMC+hFe+UgC8UgC6UQC4gVe4UAC3'.
+ 'gVe3UAC1gFe1eUu1TwC1TgCzTgCwTQKuTACrSgCqSgCpSgCpSQ'.
+ 'CodEulSACkRwCiRgCdRACcRACaQwCYQgCWQgKVQQCVQACUQACS'.
+ 'UR6RPwCOPgCNPQCLPACKPACJOwCEOQCBOAB+NwB9NgB8NgB7NQ'.
+ 'B6NwJ4NAB3RR52MwB0MgBuLwBtLwBsLwBqLgBpLQBkLQJiKgBh'.
+ 'KgBgKwRcKABbKQJbJwBaKQRaJwBYKAJVJQDZvdIYAAAAAXRSTl'.
+ 'MAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9k'.
+ 'X5EAAAAHdElNRQfTAwkUJBSSy88MAAAATUlEQVR4nGNgQAGqwo'.
+ 'paEBYPJ4eKezCIpc7HwmrqG6ENZMpLihm6RaWEAZl6Vo7ekRnF'.
+ 'IKZWSHhcTnk5SAFDfFJWeXk5xAjj1FRjVOMBeFwNcWYSLjsAAA'.
+ 'AASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: bxs_lightblue.png
+ //==========================================================
+ $this->imgdata_xsmall[13][0]= 554 ;
+ $this->imgdata_xsmall[13][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAMAAAC67D+PAAABVl'.
+ 'BMVEX////////d///AwMC7wcS08P+y+P+xxdCwxM+uws2twMur'.
+ 'vsinzNynytylzuKhyN6e5v6d5P+d1fOcwNWcu8ub4f+at8iZ3v'.
+ '+ZvdGY2/yW2f+VscGU1vuT1fqTr72Sx+SSxeKR0fWRz/GPz/OP'.
+ 'rr+OyeqMy+6Myu2LyeyKxueJudSGw+SGorGDvt+Cvd6CvN2Aud'.
+ 'p+uNd+t9Z9tdV8tdR8tNN6sc94r813rct2q8h0qcZ0qMVzp8Rx'.
+ 'o8Bwor5tn7ptnrptnrlsnbhqmbRpmbNpi51ol7Flkqtkkqtkka'.
+ 'pjj6hijaRhjaZgi6NfiqJfiaFdh55bhJtag5pZgphYgJZYf5VX'.
+ 'cn9Ve5FSeI1RdopRdYlQdYlPc4dPcoZPcoVNcINLboBLbH9GZn'.
+ 'hGZXdFZHZEY3RDYnJCXW4/W2s/WWg+Wmo7VmU7VGM7U2E6VGM6'.
+ 'VGI5UV82T1wGxheQAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHU'.
+ 'gAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElNRQfTAwkUJziL'.
+ 'PvAsAAAATUlEQVR4nGNgQAHsQgqcEJYgG5Oegy+IxSHOxmTiFs'.
+ 'gFZMprKBnbB8e7AplaFlbOQUl5ICanX0BEWmEhSAFDVGxKYWEh'.
+ 'xAjusDBuVOMBJO8LrFHRAykAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: bxs_darkgray.png
+ //==========================================================
+ $this->imgdata_xsmall[14][0]= 574 ;
+ $this->imgdata_xsmall[14][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAYAAACNMs+9AAAABm'.
+ 'JLR0QAAAAAAAD5Q7t/AAAACXBIWXMAAAsRAAALEQF/ZF+RAAAB'.
+ 'iElEQVR42k3QPU8TYRwA8P//ebkXrgdIColXRAOEkJqbaExMut'.
+ 'DBhE1GNjYHPg+DG6ODiU6QOLjVxITBcFKBYCstlAC2Bz17fe76'.
+ 'vLD6+wg/1FpTRFR5lpaub/u1eGBGaAT4HneD4OlXx7avtDYUjT'.
+ 'HQabd2Ti8e3vVSKzxrtHS32wIpFVldno22Nqvvg2Bhl0gp/aNm'.
+ 'vJ3qqXAtLIva+ks1H0wqlSXi4+d6+OFTfRsAfHJx2d1od24rZP'.
+ 'xP2HzopINr1mkesX7ccojqif0v9crxWXODZTno3+dNGA7uWLsd'.
+ 'mUYU4fHJCViMG9umLBmM4L6fagZGg9QKfjZ+Qfy3C3G/B3mugF'.
+ 'IHHNcDf64E3KJALApk2p8CSolUUqLjFkyxOGMsTtFyJ+Wz57NQ'.
+ '8DghS4sLB0svioeZZo7nPhFoUKZDIVFbglkTTnl5/rC8snjAkJ'.
+ 'Bk/XV5LxHC/v7tR8jzTFPbg8LENK9WX0Vv31T2AEmCSmlKCCoh'.
+ 'ROnP1U1tPFYjJBRcbtzSf+GPsFTAQBq1n4AAAABKdEVYdHNpZ2'.
+ '5hdHVyZQBiYzYyMDIyNjgwYThjODMyMmUxNjk0NWUzZjljOGFh'.
+ 'N2VmZWFhMjA4OTE2ZjkwOTdhZWE1MzYyMjk0MWRkM2I5EqaPDA'.
+ 'AAAABJRU5ErkJggg==' ;
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_bevels.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_bevels.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_bevels.inc.php 2007-03-23 15:12:08.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_bevels.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,101 +1,101 @@
'imgdata');
-
- var $colors = array('green','purple','orange','red','yellow');
- var $index = array('green'=>1,'purple'=>4,'orange'=>2,'red'=>0,'yellow'=>3);
- var $maxidx = 4 ;
-
- var $imgdata ;
-
- function ImgData_Bevels() {
-//==========================================================
-// File: bullets_balls_red_013.png
-//==========================================================
- $this->imgdata[0][0]= 337 ;
- $this->imgdata[0][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAM1'.
- 'BMVEX////////27t/f3+LFwcmNxMuxm62DmqKth1VpZmIWg6fv'.
- 'HCa7K0BwMEytCjFnIyUlEBg9vhQvAAAAAXRSTlMAQObYZgAAAA'.
- 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
- 'RQfTAxcBNhk+pYJVAAAAl0lEQVR4nE2Q2xLDIAgFHUWBKJf//9'.
- 'oekmbafVDZARRbK/pYTKP9WNcNv64zzUdd9BjmrgnsVXRNSzO3'.
- 'CJ5ahdhy0XKQkxld1kxb45j7dp0x2lBNOyVgQpMaoadX7Hs7zr'.
- 'P1yKj47DKBnKaBKiSAkNss7O6PkMx6kIgYXISQJpcZCqdY6KR+'.
- 'J1PkS5Xob/h7MNz8x6D3fz5DKQjpkZOBYAAAAABJRU5ErkJggg'.
- '==' ;
-
-//==========================================================
-// File: bullets_balls_green_013.png
-//==========================================================
- $this->imgdata[1][0]= 344 ;
- $this->imgdata[1][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAM1'.
- 'BMVEX////////27t/e3+K3vriUub/Dm18j4xc3ob10k0ItqQlU'.
- 'e5JBmwpxY1ENaKBgUh0iHgwsSre9AAAAAXRSTlMAQObYZgAAAA'.
- 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
- 'RQfTAxcBNTfJXtxZAAAAnklEQVR4nE2QWY4EMQhDUVhSIRC4/2'.
- 'kbaqLp9p+f2AxAayAzDfiK9znPORuvH0x8Ss9z6I9sHp6tcxE9'.
- 'nLmWmebmt5F5p2AR0+C9AWpLBjXRaZsCAT3SqklVp0YkAWaGtd'.
- 'c5Z41/STYpPzW7BjyiRrwkVmQto/Cw9tNEMvsgcekyCyFPboIu'.
- 'IsuXiKffYB4NK4r/h6d4g9HPPwCR7i8+GscIiiaonUAAAAAASU'.
- 'VORK5CYII=' ;
-
-//==========================================================
-// File: bullets_balls_oy_035.png
-//==========================================================
- $this->imgdata[2][0]= 341 ;
- $this->imgdata[2][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAM1'.
- 'BMVEX////////27t/f3+K5tbqNwcjnkjXjbxR2i5anfEoNkbis'.
- 'PBxpU0sZbZejKgdqIRIlERIwYtkYAAAAAXRSTlMAQObYZgAAAA'.
- 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
- 'RQfTAxcBNgK0wEu5AAAAm0lEQVR4nE3QVxIEIQgEUErAgTHA/U'.
- '+7zbipf9RXgoGo0liMmX6RdSPLPtZM9F4LuuSIaZtZWffiU6Iz'.
- 'Y8SOMF0NogBj30ioGRGLZgiPvce1TbIRz6oBQEbOFGK0rIoxrn'.
- '5hDomMA1cfGRCaRVhjS3gkzheM+4HtnlkXcvdZhWG4qZawewe6'.
- '9Jnz/TKLB/ML6HUepn//QczazuwFO/0Ivpolhi4AAAAASUVORK'.
- '5CYII=' ;
-
-//==========================================================
-// File: bullets_balls_oy_036.png
-//==========================================================
- $this->imgdata[3][0]= 340 ;
- $this->imgdata[3][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAM1'.
- 'BMVEX////////27t/e3+LO3hfYzz65ubiNwci6uQ12ipadgVGa'.
- 'fwsNkbhnVkcaZ5dwSA8lFg7CEepmAAAAAXRSTlMAQObYZgAAAA'.
- 'FiS0dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElN'.
- 'RQfTAxcCBySi1nevAAAAjElEQVR4nFXPWw7EIAgFUNMoCMhj/6'.
- 'staKczc/2RkwjS2glQ+w3YytgXCXCZpRo8gJdGxZadJws13CUP'.
- '4SZI4MYiUxypeiGGw1XShVBTNN9kLXP2GRrZPFvKgd7z/sqGGV'.
- '7C7r7r3l09alYN3iA8Yn+ImdVrNoEeSRqJPAaHfhZzLYwXstdZ'.
- 'rP3n2bvdAI4INwtihiwAAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: bullets_balls_pp_019.png
-//==========================================================
- $this->imgdata[4][0]= 334 ;
- $this->imgdata[4][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAM1'.
- 'BMVEX////+/v7i4eO/w8eHxcvKroNVormtfkjrMN2BeXQrepPc'.
- 'Esy4IL+OFaR7F25LHF8mFRh5XXtUAAAAAXRSTlMAQObYZgAAAA'.
- 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
- 'RQfTAxcBNgkjEpIxAAAAlElEQVR4nE2QAQ7FIAhDDTAVndL7n3'.
- 'ZV/7JfEwMvFIWUlkTMVNInbVv5ZeJqG7Smh2QTBwJBpsdizAZP'.
- '5NyW0awhK8kYodnZxS6ECvPRp2sI+y7PBv1mN02KH7h77QCJ8D'.
- '4VvY5NUgEmCwj6ZMzHtJRgRSXwC1gfcqJJH0GBnSnK1kUQ72DY'.
- 'CPBv+MCS/e0jib77eQAJxwiEWm7hFwAAAABJRU5ErkJggg==' ;
+ protected $name = 'Round Bevels';
+ protected $an = array(MARK_IMG_BEVEL => 'imgdata');
+
+ protected $colors = array('green','purple','orange','red','yellow');
+ protected $index = array('green'=>1,'purple'=>4,'orange'=>2,'red'=>0,'yellow'=>3);
+ protected $maxidx = 4 ;
+
+ protected $imgdata ;
+
+ function __construct() {
+ //==========================================================
+ // File: bullets_balls_red_013.png
+ //==========================================================
+ $this->imgdata[0][0]= 337 ;
+ $this->imgdata[0][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAM1'.
+ 'BMVEX////////27t/f3+LFwcmNxMuxm62DmqKth1VpZmIWg6fv'.
+ 'HCa7K0BwMEytCjFnIyUlEBg9vhQvAAAAAXRSTlMAQObYZgAAAA'.
+ 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
+ 'RQfTAxcBNhk+pYJVAAAAl0lEQVR4nE2Q2xLDIAgFHUWBKJf//9'.
+ 'oekmbafVDZARRbK/pYTKP9WNcNv64zzUdd9BjmrgnsVXRNSzO3'.
+ 'CJ5ahdhy0XKQkxld1kxb45j7dp0x2lBNOyVgQpMaoadX7Hs7zr'.
+ 'P1yKj47DKBnKaBKiSAkNss7O6PkMx6kIgYXISQJpcZCqdY6KR+'.
+ 'J1PkS5Xob/h7MNz8x6D3fz5DKQjpkZOBYAAAAABJRU5ErkJggg'.
+ '==' ;
+
+ //==========================================================
+ // File: bullets_balls_green_013.png
+ //==========================================================
+ $this->imgdata[1][0]= 344 ;
+ $this->imgdata[1][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAM1'.
+ 'BMVEX////////27t/e3+K3vriUub/Dm18j4xc3ob10k0ItqQlU'.
+ 'e5JBmwpxY1ENaKBgUh0iHgwsSre9AAAAAXRSTlMAQObYZgAAAA'.
+ 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
+ 'RQfTAxcBNTfJXtxZAAAAnklEQVR4nE2QWY4EMQhDUVhSIRC4/2'.
+ 'kbaqLp9p+f2AxAayAzDfiK9znPORuvH0x8Ss9z6I9sHp6tcxE9'.
+ 'nLmWmebmt5F5p2AR0+C9AWpLBjXRaZsCAT3SqklVp0YkAWaGtd'.
+ 'c5Z41/STYpPzW7BjyiRrwkVmQto/Cw9tNEMvsgcekyCyFPboIu'.
+ 'IsuXiKffYB4NK4r/h6d4g9HPPwCR7i8+GscIiiaonUAAAAAASU'.
+ 'VORK5CYII=' ;
+
+ //==========================================================
+ // File: bullets_balls_oy_035.png
+ //==========================================================
+ $this->imgdata[2][0]= 341 ;
+ $this->imgdata[2][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAM1'.
+ 'BMVEX////////27t/f3+K5tbqNwcjnkjXjbxR2i5anfEoNkbis'.
+ 'PBxpU0sZbZejKgdqIRIlERIwYtkYAAAAAXRSTlMAQObYZgAAAA'.
+ 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
+ 'RQfTAxcBNgK0wEu5AAAAm0lEQVR4nE3QVxIEIQgEUErAgTHA/U'.
+ '+7zbipf9RXgoGo0liMmX6RdSPLPtZM9F4LuuSIaZtZWffiU6Iz'.
+ 'Y8SOMF0NogBj30ioGRGLZgiPvce1TbIRz6oBQEbOFGK0rIoxrn'.
+ '5hDomMA1cfGRCaRVhjS3gkzheM+4HtnlkXcvdZhWG4qZawewe6'.
+ '9Jnz/TKLB/ML6HUepn//QczazuwFO/0Ivpolhi4AAAAASUVORK'.
+ '5CYII=' ;
+
+ //==========================================================
+ // File: bullets_balls_oy_036.png
+ //==========================================================
+ $this->imgdata[3][0]= 340 ;
+ $this->imgdata[3][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAM1'.
+ 'BMVEX////////27t/e3+LO3hfYzz65ubiNwci6uQ12ipadgVGa'.
+ 'fwsNkbhnVkcaZ5dwSA8lFg7CEepmAAAAAXRSTlMAQObYZgAAAA'.
+ 'FiS0dEAIgFHUgAAAAJcEhZcwAACxEAAAsRAX9kX5EAAAAHdElN'.
+ 'RQfTAxcCBySi1nevAAAAjElEQVR4nFXPWw7EIAgFUNMoCMhj/6'.
+ 'staKczc/2RkwjS2glQ+w3YytgXCXCZpRo8gJdGxZadJws13CUP'.
+ '4SZI4MYiUxypeiGGw1XShVBTNN9kLXP2GRrZPFvKgd7z/sqGGV'.
+ '7C7r7r3l09alYN3iA8Yn+ImdVrNoEeSRqJPAaHfhZzLYwXstdZ'.
+ 'rP3n2bvdAI4INwtihiwAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: bullets_balls_pp_019.png
+ //==========================================================
+ $this->imgdata[4][0]= 334 ;
+ $this->imgdata[4][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABEAAAARCAMAAAAMs7fIAAAAM1'.
+ 'BMVEX////+/v7i4eO/w8eHxcvKroNVormtfkjrMN2BeXQrepPc'.
+ 'Esy4IL+OFaR7F25LHF8mFRh5XXtUAAAAAXRSTlMAQObYZgAAAA'.
+ 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
+ 'RQfTAxcBNgkjEpIxAAAAlElEQVR4nE2QAQ7FIAhDDTAVndL7n3'.
+ 'ZV/7JfEwMvFIWUlkTMVNInbVv5ZeJqG7Smh2QTBwJBpsdizAZP'.
+ '5NyW0awhK8kYodnZxS6ECvPRp2sI+y7PBv1mN02KH7h77QCJ8D'.
+ '4VvY5NUgEmCwj6ZMzHtJRgRSXwC1gfcqJJH0GBnSnK1kUQ72DY'.
+ 'CPBv+MCS/e0jib77eQAJxwiEWm7hFwAAAABJRU5ErkJggg==' ;
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_diamonds.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_diamonds.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_diamonds.inc.php 2007-03-23 15:12:08.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_diamonds.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,176 +1,176 @@
'imgdata');
- var $colors = array('lightblue','darkblue','gray',
- 'blue','pink','purple','red','yellow');
- var $index = array('lightblue' =>7,'darkblue'=>2,'gray'=>6,
- 'blue'=>4,'pink'=>1,'purple'=>5,'red'=>0,'yellow'=>3);
-
- var $maxidx = 7 ;
- var $imgdata ;
-
- function ImgData_Diamonds() {
-//==========================================================
-// File: diam_red.png
-//==========================================================
- $this->imgdata[0][0]= 668 ;
- $this->imgdata[0][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbCAMAAAC6CgRnAAAA/F'.
- 'BMVEX///////+cAAD/AADOAABjAABrAADWGBjOCAj/CAj/GBj/'.
- 'EBCcCAiMOTl7KSl7ISFzGBilGBjOEBBrCAjv5+eMQkK1QkKtMT'.
- 'GtKSnWKSn/KSlzEBCcEBDexsb/tbXOe3ucWlqcUlKUSkr/e3vn'.
- 'a2u9UlL/a2uEMTHeUlLeSkqtOTn/UlL/SkrWOTn/QkL/OTmlIS'.
- 'H/MTH/ISH39/f/9/f35+fezs7/5+fvzs7WtbXOra3nvb3/zs7G'.
- 'nJzvtbXGlJTepaW9jIy1hITWlJS1e3uta2ulY2P/lJTnhITne3'.
- 'vGY2O9Wlr/c3PeY2O1Skr/Y2P/WlreQkLWISGlEBCglEUaAAAA'.
- 'AXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAA'.
- 'sSAdLdfvwAAAAHdElNRQfTAwsWEw5WI4qnAAABGUlEQVR4nHXQ'.
- '1XLDMBAFUKUCM1NiO8zcpIxpp8z0//9SWY7b2LHv6EU6s1qtAN'.
- 'iMBAojLPkigpJvogKC4pxDuQipjanlICXof1RQDkYEF21mKIfg'.
- '/GGKtjAmOKt9oSyuCU7OhyiDCQnjowGfRnooCJIkiWJvv8NxnG'.
- 'nyNAwFcekvZpPP3mu7Vrp8fOq8DYbTyjdnAvBj7Jbd7nP95urs'.
- '+MC2D6unF+Cu0VJULQBAlsOQuueN3Hrp2nGUvqppemBZ0aU7Se'.
- 'SXvYZFMKaLJn7MH3btJmZEMEmGSOreqy0SI/4ffo3uiUOYEACy'.
- 'OFopmNWlP5uZd9uPWmUoxvK9ilO9NtBo6mS7KkZD0fOJYqgGBU'.
- 'S/T7OKCAA9tfsFOicXcbxt29cAAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: diam_pink.png
-//==========================================================
- $this->imgdata[1][0]= 262 ;
- $this->imgdata[1][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbBAMAAAB/+ulmAAAAEl'.
- 'BMVEX///+AgID/M5n/Zpn/zMz/mZn1xELhAAAAAXRSTlMAQObY'.
- 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAA'.
- 'AHdElNRQfTAwsWEi3tX8qUAAAAbUlEQVR4nFXJwQ3AMAhDUdRm'.
- 'kKojuCswABf2X6UEEiC+WF+PyDfoGEuvwXogq3Rk1Y6W0tBSG8'.
- '6Uwpla6CmJnpoYKRsjjb/Y63vo9kIkLcZCCsbGYGwMRqIzEp1R'.
- 'OBmFk9HQGA2N0ZEIz5HX+h/jailYpfz4dAAAAABJRU5ErkJggg'.
- '==' ;
-
-//==========================================================
-// File: diam_blue.png
-//==========================================================
- $this->imgdata[2][0]= 662 ;
- $this->imgdata[2][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbCAMAAAC6CgRnAAAA+V'.
- 'BMVEX///+AgIAAAJwAAP8AAM4AAGMAAGsQEP8YGHMQEHMYGP8Q'.
- 'EKUICJwICM5KSpQxMYQpKXsYGNYQEM4ICGsICP97e85aWpw5OY'.
- 'xSUv85ObVCQt4xMa0pKa0hIaUpKf+9vd6EhLVra+dzc/9SUr1r'.
- 'a/9aWt5SUt5CQrVaWv9KSv8hIXs5Of8xMf8pKdYhIdYYGKUhIf'.
- '/Ozs739//v7/fn5+/v7//n5/fW1ufOzufOzu/W1v+trc69veel'.
- 'pc6trd6UlMa9vf+MjL21tfe1tf+UlNZzc61ra6Wlpf+EhOeMjP'.
- '9ra8ZSUpyEhP9CQoxKSrVCQv85Od4xMdYQENZnJhlWAAAAAXRS'.
- 'TlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAd'.
- 'LdfvwAAAAHdElNRQfTAwsWEx3Snct5AAABFklEQVR4nHXR5XbD'.
- 'IBgGYM6AuHsaqbvOfeuknev9X8xISbplSd5/8JyXwwcA/I0AKm'.
- 'PFchVBdvKNKggKQx2VIoRwMZihMiQE49YUlWBCcPL0hYq4ITh+'.
- 'qKECUoLDZWqoQNA766F/mJHlHXblPJJNiyURhM5eU9cNw5BlmS'.
- 'IrLOLxhzfotF7vwO2j3ez2ap/TmW4AIM7DoN9+tu+vLk6Pdg9O'.
- '6ufXjfXLm6pxPACSJIpRFAa+/26DhuK6qjbiON40k0N3skjOvm'.
- 'NijBmchF5mi+1jhQqDmWyIzPp1hUlrv8On5l+6mMm1tigFNyrt'.
- '5R97g+FKKyGKkTNKesXPJTZXOFIrUoKiypcTQVHjK4g8H2dWEQ'.
- 'B8bvUDLSQXSr41rmEAAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: diam_yellow.png
-//==========================================================
- $this->imgdata[3][0]= 262 ;
- $this->imgdata[3][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbBAMAAAB/+ulmAAAAEl'.
- 'BMVEX///+AgIBmMwCZZgD/zADMmQD/QLMZAAAAAXRSTlMAQObY'.
- 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAA'.
- 'AHdElNRQfTAwsWEwcv/zIDAAAAbUlEQVR4nFXJwQ3AMAhDUdRm'.
- 'kKojuCswABf2X6UEEiC+WF+PyDfoGEuvwXogq3Rk1Y6W0tBSG8'.
- '6Uwpla6CmJnpoYKRsjjb/Y63vo9kIkLcZCCsbGYGwMRqIzEp1R'.
- 'OBmFk9HQGA2N0ZEIz5HX+h/jailYpfz4dAAAAABJRU5ErkJggg'.
- '==' ;
-
-//==========================================================
-// File: diam_lightblue.png
-//==========================================================
- $this->imgdata[4][0]= 671 ;
- $this->imgdata[4][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbCAMAAAC6CgRnAAAA/1'.
- 'BMVEX///+AgIAAnP8A//8Azv8AY/8Aa/8I//8Y1v8Izv8Y//8Q'.
- '//8InP8Qzv8Ypf85jP8he/8Yc/8Ia/8pe/8p//8p1v9Ctf8xrf'.
- '8prf8QnP8Qc/9CjP+1//97//9r//9S//9K//9C//85//8x//8h'.
- '//9r5/9K3v9S3v851v97zv9Svf85rf8hpf/G3v9SnP9anP9KlP'.
- '8xhP/n7//v7+f3///n///O//+U//9z//9j//9a//975/9C3v8h'.
- '1v+E5/+17/9j3v/O7//n9/+95/+l3v9jxv+U1v8Qpf9avf9Ktf'.
- '+Uxv+11v97tf9rrf+cxv+Mvf9jpf+tzv+Etf/O3v/39/8Akkxr'.
- 'AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACx'.
- 'IAAAsSAdLdfvwAAAAHdElNRQfTAwsWEiHk6Ya/AAABGUlEQVR4'.
- 'nHXQ13KDMBAF0J2o0E01GHDvJa7p3em95/+/JQJMYjDc0Yt0Zr'.
- 'VaAaxHgtxwbSGPkGQpOIeQ2ORxJiJmNWYZyAhZR0WcgQGhViU0'.
- 'nEGoedDHGxgRapRPcRpXhOr7XZzCmLjaXk9IIjvkOEmSRLG62+'.
- 'F5XlEElhA5sW21GvXj6mGlDBfnJ51lr9svnvEKwH1hu2QPbwd3'.
- 'N9eXVzuL7/Hn29frdKaamgcgy67L3HFG9gDefV+dm5qme4YRXL'.
- 'oVR374mRqUELZYosf84XAxISFRQuMh4rrH8YxGSP6HX6H97NNQ'.
- 'KEAaR08qCeuSnx2a8zIPWqUowtKHSRK91rAw0elmVYQFVc8mhq'.
- '7p5RD7Ps3IIwA9sfsFxFUX6eZ4Zh4AAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: diam_purple.png
-//==========================================================
- $this->imgdata[5][0]= 657 ;
- $this->imgdata[5][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbCAMAAAC6CgRnAAAA/F'.
- 'BMVEX///////8xAP/OAP+cAP9jAP9rAP+cCP85CP/OEP9SKf/O'.
- 'CP9CEP9zGP9rCP+lGP/WOf/WIf9KIf9jOf+MQv+EMf97If9zEP'.
- '+1Sv+lIf/ne//eUv/na//n5//Oxv/Wzv+chP9zUv97Wv9rQv9a'.
- 'Mf9KGP/v5/+te/97Kf+9Y/+tOf+tKf+lEP/vtf/WMf/WKf/v7+'.
- 'f39/+tnP+9rf9rSv9jQv9CGP+ljP+EY//Gtf+tlP+Ma/9zSv/e'.
- 'zv+UUv+9lP+cWv+lY/+cUv+MOf+EKf+UQv/Opf/OhP/Ga/+1Qv'.
- '/Oe/+9Uv/ntf/eWv/eSv/WGP/3zv/vlP/WEP//9/+pL4oHAAAA'.
- 'AXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAA'.
- 'sSAdLdfvwAAAAHdElNRQfTAwsWEjX+M1LCAAABDklEQVR4nHXQ'.
- '1bLDIBAGYFqIEW+ksbr7cXd3ff93OUCamdOE/Mxw882yywLwPz'.
- '+gNKotlRFUVnNUQlCxTMRFCKEdE+MgpJaEiIOU4DKaoSIygtb3'.
- 'FBUQrm3xjPK4JvXjK0A5hFniYSBtIilQVYUm+X0KTVNiYah+2q'.
- 'ulFb8nUbSovD2+TCavwXQWmnMA6ro+di+uR5cPzfPhVqPV3N1p'.
- 'n3b3+rimAWAYhP3xnXd7P6oc9vadPsa1wYEs00dFQRAFehlX21'.
- '25Sg9NOgwF5jeNTjVL9om0TjDc1lmeCKZ17nFPzhPtSRt6J06R'.
- 'WKUoeG3MoXRa/wjLHGLodwZcotPqjsYngnWslRBZH91hWTbpD2'.
- 'EdF1ECWW1SAAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: diam_gray.png
-//==========================================================
- $this->imgdata[6][0]= 262 ;
- $this->imgdata[6][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbBAMAAAB/+ulmAAAAEl'.
- 'BMVEX//////wAzMzNmZmbMzMyZmZlq4Qo5AAAAAXRSTlMAQObY'.
- 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAA'.
- 'AHdElNRQfTAwsWExZFTxLxAAAAbUlEQVR4nFXJwQ3AMAhDUdRm'.
- 'kKojuCswABf2X6UEEiC+WF+PyDfoGEuvwXogq3Rk1Y6W0tBSG8'.
- '6Uwpla6CmJnpoYKRsjjb/Y63vo9kIkLcZCCsbGYGwMRqIzEp1R'.
- 'OBmFk9HQGA2N0ZEIz5HX+h/jailYpfz4dAAAAABJRU5ErkJggg'.
- '==' ;
-
-//==========================================================
-// File: diam_blgr.png
-//==========================================================
- $this->imgdata[7][0]= 262 ;
- $this->imgdata[7][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbBAMAAAB/+ulmAAAAEl'.
- 'BMVEX///+AgIBmzP9m///M//+Z//8hMmBVAAAAAXRSTlMAQObY'.
- 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAA'.
- 'AHdElNRQfTAwsWEwCxm6egAAAAbUlEQVR4nFXJwQ3AMAhDUdRm'.
- 'kKojuCswABf2X6UEEiC+WF+PyDfoGEuvwXogq3Rk1Y6W0tBSG8'.
- '6Uwpla6CmJnpoYKRsjjb/Y63vo9kIkLcZCCsbGYGwMRqIzEp1R'.
- 'OBmFk9HQGA2N0ZEIz5HX+h/jailYpfz4dAAAAABJRU5ErkJggg'.
- '==' ;
+ protected $name = 'Diamonds';
+ protected $an = array(MARK_IMG_DIAMOND =>'imgdata');
+ protected $colors = array('lightblue','darkblue','gray',
+ 'blue','pink','purple','red','yellow');
+ protected $index = array('lightblue' =>7,'darkblue'=>2,'gray'=>6,
+ 'blue'=>4,'pink'=>1,'purple'=>5,'red'=>0,'yellow'=>3);
+
+ protected $maxidx = 7 ;
+ protected $imgdata ;
+
+ function __construct() {
+ //==========================================================
+ // File: diam_red.png
+ //==========================================================
+ $this->imgdata[0][0]= 668 ;
+ $this->imgdata[0][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbCAMAAAC6CgRnAAAA/F'.
+ 'BMVEX///////+cAAD/AADOAABjAABrAADWGBjOCAj/CAj/GBj/'.
+ 'EBCcCAiMOTl7KSl7ISFzGBilGBjOEBBrCAjv5+eMQkK1QkKtMT'.
+ 'GtKSnWKSn/KSlzEBCcEBDexsb/tbXOe3ucWlqcUlKUSkr/e3vn'.
+ 'a2u9UlL/a2uEMTHeUlLeSkqtOTn/UlL/SkrWOTn/QkL/OTmlIS'.
+ 'H/MTH/ISH39/f/9/f35+fezs7/5+fvzs7WtbXOra3nvb3/zs7G'.
+ 'nJzvtbXGlJTepaW9jIy1hITWlJS1e3uta2ulY2P/lJTnhITne3'.
+ 'vGY2O9Wlr/c3PeY2O1Skr/Y2P/WlreQkLWISGlEBCglEUaAAAA'.
+ 'AXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAA'.
+ 'sSAdLdfvwAAAAHdElNRQfTAwsWEw5WI4qnAAABGUlEQVR4nHXQ'.
+ '1XLDMBAFUKUCM1NiO8zcpIxpp8z0//9SWY7b2LHv6EU6s1qtAN'.
+ 'iMBAojLPkigpJvogKC4pxDuQipjanlICXof1RQDkYEF21mKIfg'.
+ '/GGKtjAmOKt9oSyuCU7OhyiDCQnjowGfRnooCJIkiWJvv8NxnG'.
+ 'nyNAwFcekvZpPP3mu7Vrp8fOq8DYbTyjdnAvBj7Jbd7nP95urs'.
+ '+MC2D6unF+Cu0VJULQBAlsOQuueN3Hrp2nGUvqppemBZ0aU7Se'.
+ 'SXvYZFMKaLJn7MH3btJmZEMEmGSOreqy0SI/4ffo3uiUOYEACy'.
+ 'OFopmNWlP5uZd9uPWmUoxvK9ilO9NtBo6mS7KkZD0fOJYqgGBU'.
+ 'S/T7OKCAA9tfsFOicXcbxt29cAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: diam_pink.png
+ //==========================================================
+ $this->imgdata[1][0]= 262 ;
+ $this->imgdata[1][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbBAMAAAB/+ulmAAAAEl'.
+ 'BMVEX///+AgID/M5n/Zpn/zMz/mZn1xELhAAAAAXRSTlMAQObY'.
+ 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAA'.
+ 'AHdElNRQfTAwsWEi3tX8qUAAAAbUlEQVR4nFXJwQ3AMAhDUdRm'.
+ 'kKojuCswABf2X6UEEiC+WF+PyDfoGEuvwXogq3Rk1Y6W0tBSG8'.
+ '6Uwpla6CmJnpoYKRsjjb/Y63vo9kIkLcZCCsbGYGwMRqIzEp1R'.
+ 'OBmFk9HQGA2N0ZEIz5HX+h/jailYpfz4dAAAAABJRU5ErkJggg'.
+ '==' ;
+
+ //==========================================================
+ // File: diam_blue.png
+ //==========================================================
+ $this->imgdata[2][0]= 662 ;
+ $this->imgdata[2][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbCAMAAAC6CgRnAAAA+V'.
+ 'BMVEX///+AgIAAAJwAAP8AAM4AAGMAAGsQEP8YGHMQEHMYGP8Q'.
+ 'EKUICJwICM5KSpQxMYQpKXsYGNYQEM4ICGsICP97e85aWpw5OY'.
+ 'xSUv85ObVCQt4xMa0pKa0hIaUpKf+9vd6EhLVra+dzc/9SUr1r'.
+ 'a/9aWt5SUt5CQrVaWv9KSv8hIXs5Of8xMf8pKdYhIdYYGKUhIf'.
+ '/Ozs739//v7/fn5+/v7//n5/fW1ufOzufOzu/W1v+trc69veel'.
+ 'pc6trd6UlMa9vf+MjL21tfe1tf+UlNZzc61ra6Wlpf+EhOeMjP'.
+ '9ra8ZSUpyEhP9CQoxKSrVCQv85Od4xMdYQENZnJhlWAAAAAXRS'.
+ 'TlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAd'.
+ 'LdfvwAAAAHdElNRQfTAwsWEx3Snct5AAABFklEQVR4nHXR5XbD'.
+ 'IBgGYM6AuHsaqbvOfeuknev9X8xISbplSd5/8JyXwwcA/I0AKm'.
+ 'PFchVBdvKNKggKQx2VIoRwMZihMiQE49YUlWBCcPL0hYq4ITh+'.
+ 'qKECUoLDZWqoQNA766F/mJHlHXblPJJNiyURhM5eU9cNw5BlmS'.
+ 'IrLOLxhzfotF7vwO2j3ez2ap/TmW4AIM7DoN9+tu+vLk6Pdg9O'.
+ '6ufXjfXLm6pxPACSJIpRFAa+/26DhuK6qjbiON40k0N3skjOvm'.
+ 'NijBmchF5mi+1jhQqDmWyIzPp1hUlrv8On5l+6mMm1tigFNyrt'.
+ '5R97g+FKKyGKkTNKesXPJTZXOFIrUoKiypcTQVHjK4g8H2dWEQ'.
+ 'B8bvUDLSQXSr41rmEAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: diam_yellow.png
+ //==========================================================
+ $this->imgdata[3][0]= 262 ;
+ $this->imgdata[3][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbBAMAAAB/+ulmAAAAEl'.
+ 'BMVEX///+AgIBmMwCZZgD/zADMmQD/QLMZAAAAAXRSTlMAQObY'.
+ 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAA'.
+ 'AHdElNRQfTAwsWEwcv/zIDAAAAbUlEQVR4nFXJwQ3AMAhDUdRm'.
+ 'kKojuCswABf2X6UEEiC+WF+PyDfoGEuvwXogq3Rk1Y6W0tBSG8'.
+ '6Uwpla6CmJnpoYKRsjjb/Y63vo9kIkLcZCCsbGYGwMRqIzEp1R'.
+ 'OBmFk9HQGA2N0ZEIz5HX+h/jailYpfz4dAAAAABJRU5ErkJggg'.
+ '==' ;
+
+ //==========================================================
+ // File: diam_lightblue.png
+ //==========================================================
+ $this->imgdata[4][0]= 671 ;
+ $this->imgdata[4][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbCAMAAAC6CgRnAAAA/1'.
+ 'BMVEX///+AgIAAnP8A//8Azv8AY/8Aa/8I//8Y1v8Izv8Y//8Q'.
+ '//8InP8Qzv8Ypf85jP8he/8Yc/8Ia/8pe/8p//8p1v9Ctf8xrf'.
+ '8prf8QnP8Qc/9CjP+1//97//9r//9S//9K//9C//85//8x//8h'.
+ '//9r5/9K3v9S3v851v97zv9Svf85rf8hpf/G3v9SnP9anP9KlP'.
+ '8xhP/n7//v7+f3///n///O//+U//9z//9j//9a//975/9C3v8h'.
+ '1v+E5/+17/9j3v/O7//n9/+95/+l3v9jxv+U1v8Qpf9avf9Ktf'.
+ '+Uxv+11v97tf9rrf+cxv+Mvf9jpf+tzv+Etf/O3v/39/8Akkxr'.
+ 'AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACx'.
+ 'IAAAsSAdLdfvwAAAAHdElNRQfTAwsWEiHk6Ya/AAABGUlEQVR4'.
+ 'nHXQ13KDMBAF0J2o0E01GHDvJa7p3em95/+/JQJMYjDc0Yt0Zr'.
+ 'VaAaxHgtxwbSGPkGQpOIeQ2ORxJiJmNWYZyAhZR0WcgQGhViU0'.
+ 'nEGoedDHGxgRapRPcRpXhOr7XZzCmLjaXk9IIjvkOEmSRLG62+'.
+ 'F5XlEElhA5sW21GvXj6mGlDBfnJ51lr9svnvEKwH1hu2QPbwd3'.
+ 'N9eXVzuL7/Hn29frdKaamgcgy67L3HFG9gDefV+dm5qme4YRXL'.
+ 'oVR374mRqUELZYosf84XAxISFRQuMh4rrH8YxGSP6HX6H97NNQ'.
+ 'KEAaR08qCeuSnx2a8zIPWqUowtKHSRK91rAw0elmVYQFVc8mhq'.
+ '7p5RD7Ps3IIwA9sfsFxFUX6eZ4Zh4AAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: diam_purple.png
+ //==========================================================
+ $this->imgdata[5][0]= 657 ;
+ $this->imgdata[5][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbCAMAAAC6CgRnAAAA/F'.
+ 'BMVEX///////8xAP/OAP+cAP9jAP9rAP+cCP85CP/OEP9SKf/O'.
+ 'CP9CEP9zGP9rCP+lGP/WOf/WIf9KIf9jOf+MQv+EMf97If9zEP'.
+ '+1Sv+lIf/ne//eUv/na//n5//Oxv/Wzv+chP9zUv97Wv9rQv9a'.
+ 'Mf9KGP/v5/+te/97Kf+9Y/+tOf+tKf+lEP/vtf/WMf/WKf/v7+'.
+ 'f39/+tnP+9rf9rSv9jQv9CGP+ljP+EY//Gtf+tlP+Ma/9zSv/e'.
+ 'zv+UUv+9lP+cWv+lY/+cUv+MOf+EKf+UQv/Opf/OhP/Ga/+1Qv'.
+ '/Oe/+9Uv/ntf/eWv/eSv/WGP/3zv/vlP/WEP//9/+pL4oHAAAA'.
+ 'AXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAA'.
+ 'sSAdLdfvwAAAAHdElNRQfTAwsWEjX+M1LCAAABDklEQVR4nHXQ'.
+ '1bLDIBAGYFqIEW+ksbr7cXd3ff93OUCamdOE/Mxw882yywLwPz'.
+ '+gNKotlRFUVnNUQlCxTMRFCKEdE+MgpJaEiIOU4DKaoSIygtb3'.
+ 'FBUQrm3xjPK4JvXjK0A5hFniYSBtIilQVYUm+X0KTVNiYah+2q'.
+ 'ulFb8nUbSovD2+TCavwXQWmnMA6ro+di+uR5cPzfPhVqPV3N1p'.
+ 'n3b3+rimAWAYhP3xnXd7P6oc9vadPsa1wYEs00dFQRAFehlX21'.
+ '25Sg9NOgwF5jeNTjVL9om0TjDc1lmeCKZ17nFPzhPtSRt6J06R'.
+ 'WKUoeG3MoXRa/wjLHGLodwZcotPqjsYngnWslRBZH91hWTbpD2'.
+ 'EdF1ECWW1SAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: diam_gray.png
+ //==========================================================
+ $this->imgdata[6][0]= 262 ;
+ $this->imgdata[6][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbBAMAAAB/+ulmAAAAEl'.
+ 'BMVEX//////wAzMzNmZmbMzMyZmZlq4Qo5AAAAAXRSTlMAQObY'.
+ 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAA'.
+ 'AHdElNRQfTAwsWExZFTxLxAAAAbUlEQVR4nFXJwQ3AMAhDUdRm'.
+ 'kKojuCswABf2X6UEEiC+WF+PyDfoGEuvwXogq3Rk1Y6W0tBSG8'.
+ '6Uwpla6CmJnpoYKRsjjb/Y63vo9kIkLcZCCsbGYGwMRqIzEp1R'.
+ 'OBmFk9HQGA2N0ZEIz5HX+h/jailYpfz4dAAAAABJRU5ErkJggg'.
+ '==' ;
+
+ //==========================================================
+ // File: diam_blgr.png
+ //==========================================================
+ $this->imgdata[7][0]= 262 ;
+ $this->imgdata[7][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABsAAAAbBAMAAAB/+ulmAAAAEl'.
+ 'BMVEX///+AgIBmzP9m///M//+Z//8hMmBVAAAAAXRSTlMAQObY'.
+ 'ZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAA'.
+ 'AHdElNRQfTAwsWEwCxm6egAAAAbUlEQVR4nFXJwQ3AMAhDUdRm'.
+ 'kKojuCswABf2X6UEEiC+WF+PyDfoGEuvwXogq3Rk1Y6W0tBSG8'.
+ '6Uwpla6CmJnpoYKRsjjb/Y63vo9kIkLcZCCsbGYGwMRqIzEp1R'.
+ 'OBmFk9HQGA2N0ZEIz5HX+h/jailYpfz4dAAAAABJRU5ErkJggg'.
+ '==' ;
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_pushpins.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_pushpins.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_pushpins.inc.php 2007-03-23 15:12:08.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_pushpins.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,516 +1,516 @@
'imgdata_small',
- MARK_IMG_SPUSHPIN => 'imgdata_small',
- MARK_IMG_LPUSHPIN => 'imgdata_large');
-
- var $colors = array('blue','green','orange','pink','red');
- var $index = array('red' => 0, 'orange' => 1, 'pink' => 2, 'blue' => 3, 'green' => 4 ) ;
- var $maxidx = 4 ;
- var $imgdata_large, $imgdata_small ;
-
- function ImgData_PushPins() {
-
- // The anchor should be where the needle "hits" the paper
- // (bottom left corner)
- $this->anchor_x = 0;
- $this->anchor_y = 1;
-
-//==========================================================
-// File: ppl_red.png
-//==========================================================
- $this->imgdata_large[0][0]= 2490 ;
- $this->imgdata_large[0][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAYAAACM/rhtAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
- 'B3RJTUUH0wMKBh4Ryh89CgAACUdJREFUeJy9mNtTFFcexz+/7p'.
- '4Lw1wZJKDGCAwmDAqUySamcCq1ed6k9mn3UfMP7F+1T3nYqn2J'.
- 'lZdoDEjpbq0KG8EBFBFBEJye6Zmenkv32Ydu5GYiUMmeqq6uqT'.
- '6Xz3zP73aOcIKmAQkIFyD3N/jrBPwlKjLQEglVlJKyUjR3u7cc'.
- 'WLoP3/4dvv03LNrQ8I6x1rFbDML9kOmHvh7IRHU9JKmUSG8vpF'.
- 'IoXX/TV0AiEM5A5jT0noFMFMJHXUt/d5f9TUAbhtQ3cPFruDog'.
- '8klHMnmO0dGYe/myOJGINEwTz3F2higFXgy8PpAkOC+h8hoaCt'.
- '4ppHFcQAWSgOQlyI/p+lUjmRxWAwNJd3xca/f34yoFi4tgmjtD'.
- 'NIFkJ4xcgBCgVqEBFJ9DqcZea/gNAAVEg7AOGYnHe9XoaJd3+X'.
- 'LISSSwnz6lsbKCZ9sHh4UVdBkwdA6cPwNnIfJPmC3Ctgft3wwQ'.
- 'QPkvTZJJnbExzfvsM2nMzVG7e5fG48d4lnXwTwEYCjJxuHQBog'.
- 'BHUfKkgAIIhiGk06hTp/Dm5qS1uYlXLvtWd4gPgIiCrAEcVckT'.
- 'Ab5p7TaYJrK1hQaEenrwSiVfQdc91P0kSp7Ii89D5ksY/kAkLy'.
- 'IZXFdXkQjS1YUSEbdcRu168V6+HTUNIKJDRwdE+sBIQmP9Ld59'.
- 'bEBA3of4F/D+uXb7rGaaCSmXI3pPj64PDaHCYfEqFVSjgWo2D2'.
- '73XlJNQTgCyQykIuBWoNKEeh1aLXBPBCggGdBOgxZVSjoajVhH'.
- 'o5HWlIpq4bCQSgm9vXhK4ZZKh5SUYygp4J1EQVUD9xlU18BJQD'.
- 'bUbJ5T5XJStyxN9fSI099P3baxV1dRloW2h2ivx/yakg2ot6F1'.
- 'EkCa4G1D+zVEq5ArKTWM42Q6HUczQV7U66w9e0ZpdRXlOIQ5vF'.
- 'VHUXILKify4jiEzkOqC3peQMoBQymFlMt4Dx6wUSxSsm2UZXEK'.
- 'P30QvOUt8/2Sd78CdWwFDTA+gsw3cOlPcPUD+CQB52oQ21RKXM'.
- 'eRhGXhOg7VoKrx8KuS4ygZhVg3ZI8FGIfwR9BVgAtfwxdXdP3L'.
- '86nUR91dXelNXTeWWy10paQHX602YAP1ADASAL7LJvFtMpOCc0'.
- 'cG3FHuGlz6Gr4YEpnoTCbzsdHRbOzy5RCRiLRMk5rjyOtAimwA'.
- 'U4U3SurBN/0wnAASBCVDIKpB4kiAB5Ub0/UvO9LpPAMDGfn005'.
- 'AxPCzxep3Q6iqPLUseBoufCZRsAE6g5g5kKIDfKUj3wnpAG8QB'.
- '/Z1OIqANQuI65AtwNScyYXR2XlAXL2YZHzcklRKWl5GVFXFtGx'.
- 'MoAiV/EQaAGH6BUQNWgQpwFngv+Ca8KUAQEBcwgTJHyMV7679R'.
- 'XS8YqdSI6u/PMD5ukMtJY3GR2uQkr5aXeWVZOEALmA8WsIAxfL'.
- 'd0goVLAdCOd+/YpgqeVtBv4yiA++q/RKKXixe7GB8PSyoljcVF'.
- 'yg8fyubyMpulEk2lyAIfAAvAC+B+oOQFoAt/+0rAejB/EzjNri'.
- 'vvqNnCd64jxcE39V8spnP+vMbAgDSePKE2NcXm06dslMuUlcID'.
- 'TuFvqwXMBU8N39bGgRR+ki0Dz4L5DSAe9NGD7zq+6kcN1L6H2b'.
- 'ao5WWaQHllRTafPmWrVMJUimoAQrBYJFjQwre7B6A8YAi8LCgD'.
- '5DVo6/hbb/iHK1KggvFeD3hHziQKEMuiNTNDbXGRTdtmw7Iwla'.
- 'KGH0oqwbscLOoG46rAY6AOzRhY74PT6QuUKEN4PegXxd/yEDTT'.
- 'YMWOk+oEaLkuFdNk0zTZwjfkavDUArXWgGXgFb4dEShXhfYqlI'.
- 'ow3w9rg3B6ED60IOOA5oEYQBrcpG+mj9bg0VG8GMJhVDZLyzAo'.
- 'VSq8rFYxXXefcjVgG9+uisDrXUCApoKSBcUHMBmHhfcgNwhtD3'.
- 'q9IG6Lr15b4OUTmPwBJt8JqGuapp05o0mhoHnptLQfPsR+8IBK'.
- 'uYyNH3yr+B77LHheA3tK1Ta+IrMeTL2C6Xl48TOsNWDDgAz7s5'.
- '/r+krP/eddCsbj8fDQ4GBm9MqVvvRXX2VULBayRGRzaYn1SoWa'.
- 'UjgB4PIB5QK4ZgBXBKaAHxQsrED1H7CRgCUPwgHZDqACmhWwXv'.
- '2aDRqGYeRyufS169cvThQKV88PDuYbW1vJ5VRK+5euqxWlPMdX'.
- 'SRqgreHbZGN3ijfKBXBTAeh2Fdwi2MofshP/dvKwCmKhp4m83Y'.
- 'vj8Xg4l8tlCoXC0MTExMTFkZE/1m37wvLGRvKRacoD1209E7Fc'.
- 'pZwYREOQqEJ4z3HskHLsz4AoXykPIBSN0t3dTTQafROoHdumXC'.
- '4fjoMiog0ODiauX7+eLxQKV3O53ETdti88nJnJ3rl505ifmWm3'.
- 'arWSodR8GNbycDoNHy5C5jFold1k8d+DyvELNwg93d18/vnn9P'.
- 'X1oes6nufx/Plz7t+/fxhQKSWJRCI5NjaWHxkZKdj1+sjSwkJm'.
- '+uZN/dZ337VqCwullGUVdZjsgIUC5LqhrUPvCugWuApeApPAzY'.
- 'PKHWyaphGNRunt7WVwcBARwfM8Ojo6sCzrMKBhGLphGFEF2Wq1'.
- '2jc7M5OZ/vHH0MPbt93awkJJmeZsC6ZaMK3DCwvWdNioQUb5B6'.
- 'AdBR+9SzkAz/NwHIeXL18iIui6TjgcJplMMjY2th8wHo+Hh4aG'.
- 'MsPDw6fddru7+Phxx51bt/RbN260qwsLpZhlFZsw9QJ+2Pbrga'.
- 'oJG2FY2oKwuTtVEz9uV34NbqdtbW0xPT1NNBoF4MyZM1y5coWu'.
- 'rq5dQBHRcrlc4tq1a/l8Pj9RMs38ndu3Ez//9JNXLRZNyuXZJk'.
- 'xVYKoExQpsK/+IaAuYb7no8zjC/R+A4zisrq7u+53NZjl16tQ+'.
- 'QIlEIslsNpuPRCJXZ2dnh2/duNFRW1oy07a96MKd575yxRqU1B'.
- '5vPMpF5HHa1tYW9+7do7Ozc/eQpZTSQ6FQt1Lq8pMnT/5w7969'.
- 'nuLcXE1rNufO9fRMhlKpOyvt9qPtVmvb25fFfvvWbrepVCqHwo'.
- 'xaX19vff/996ZhGC8qlkW9Wt1Onz073fXxxz+6MB+9e9dUjuO+'.
- '7ebq9wLdB9hoNCrr6+s/4wf3FCJW3fPmTZhXsNWCprjuW66Dfr'.
- '928KAfBhJAEgiJSLuzs7OSTqctoFkqlZRt26j/I+L/AGjPTN4d'.
- 'Nqn4AAAAAElFTkSuQmCC' ;
-
-//==========================================================
-// File: ppl_orange.png
-//==========================================================
- $this->imgdata_large[1][0]= 2753 ;
- $this->imgdata_large[1][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAYAAACM/rhtAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
- 'B3RJTUUH0wMLFQ0VCkHCzQAACk5JREFUeJytmGtzG0d2hp8zNw'.
- 'AEcRdJ6EJK9FL0CqZUm9jWbkwq3vhDstl8dmLvz8rP2H8Q75ZT'.
- 'pkRfpLgqsS6WIFEKGYkiSBCDO+banQ8DUpRWEkklXQUUqlCDfv'.
- 'rp857pgfAOQ4AMOJdg4R/hX96Hf06bvDc5iT07i8yeg8ksiIAI'.
- '4TBi/ds9/vivD/njapNHvRBfHXMu410AM+BUoVSF05NQsi1sO4'.
- '8402AXwLQTuP31OAZO2aG0MEn14iSlnI1z3LnMk8IZYJyBwjIs'.
- '/TWsVIWPJkvMFS4zMfMhUp5BsoCpAAEBLYKaMFGn00jBxnvu02'.
- '35+JHmSJEnBpQEcPo38MmCxd/nS9Ry71Ga/g1W9a8gn0GsHkgA'.
- '6DGjxkqb5CoO+YxF3A3p+jGjQUzoK+L/V0ADzFMwtSR8eLbAr8'.
- 'uXOTf9NzhTc0geSLUQcYHgYEH786RMg0zWJHV2Aitv4x/HpHVS'.
- 'QA2YBqTTGIUq5qkPMWaWkVwPnPtAA/BevmZcjxaaUtHh8pJJGu'.
- 'DpCB9FvT7A7YT7S3p5vFMNzmWo/O0MSx/Ms3TqI8r59zFTfUQe'.
- 'I7SBODE3tnfoIxYnNHligwik0zAzDdVpyKbA8sff5YAeMEwgkV'.
- 'cufQeTJzZoCsaFLKXPTnNpoUTNsSgJmNoGsuNQjIDwYD2HlnZy'.
- 'k++yxTKXZfKTU8zOpjhneeQYkorSmGERtIlICBKRbLX+y98YN3'.
- 'ADcNIm+bJD4U3pPnmbEaRgYVRTGBkDSSsmxKfY7ZLuDJA4hdjl'.
- 'JEgyBB2SJOvQ9RzTpNKoEwNq0CNFvOXR3/HxMgYVPObaz8kPmh'.
- 'hkEWMatAfRONGGvLizyOE9P8KkpwhPDAgQKJQbELUD0oOIhbbH'.
- 'JeVTmowxjAgZutB5AoOngA+2DdYrcTyOyYZP9+QpBvI29vwEhb'.
- 'It042BVQgDy9KTMfkwQG1A9ACCLlgBBGUwxxoc52WDh2ATyEPp'.
- '1hoaPvrEBh0Dq5an9OUsl/9hylk5b5c+mowLc4E2Jtw4Eoljyf'.
- 'ogA/AGEAagNRjGyUxOmEycyVA5EWDBxrmUp3ytLIv/NJP69Goh'.
- '+9mFydIvS5PZYkvH1oY/RFtKymlwBFQAgQd+kAA6qSQ8pvn2mp'.
- 'SkJkuVFHPHBnQMrEt5Sl+e4/Lvp51PF1PF5Xy6WMvOWZXMom8z'.
- 'OZTQ8+j5sbQiMEwopsCIwRtBGIJSCdzbTGo9NimkDcgdC7Bg49'.
- 'TG5n4/nfr0Si77WdYp1YzyZEkWPdteaEnB7pPqBTxuIf/VgciE'.
- 'SgasCPwh+GNIkaNNag1RiPge5pEhMQVjfoLcF+eoXSvbKxedwn'.
- 'LKzC3KWbOi5/sW5a44/SHFUSgVA7SCzRG0AvA9mPOgFIETgu4n'.
- 'Ww0wNQWFAqRSL6D2ZQYBdDrQ7R7jXiwgRcvIL02makuTmWtpM/'.
- '+BlLMl5vuWzLVEuwH6oYnR1KS8kJINGXMM2YdfRlALoQoQQKeb'.
- 'bDVwoMdxQMaLCwLo96HZTF5HbrEhmOftianfZisfzueKv7ZmrX'.
- 'MsjhxKXZGBjzyeEHmSE3oWiggtyVGmE8DTIXTC5NxgAxOAGUM8'.
- 'fun9mnSSLQ/CxNzOTgJ3LIMgoGwkKBiiMyaVviHVkdCO4FEKNv'.
- 'LQzWBYHfITPa4UBVM0LR/WB7ARJsdDDTjA6deYFIFUOimJ3d0E'.
- 'sNdLavYYgBpthqKcjiiJRO8K6CK0CsJTjfQAGaJtD9vQFAxNNQ'.
- '1FB0yBAfA8gdMAIagLoCVAen0M00zMOTYShNDtoHs9CAIUoI4E'.
- '1IBihCdNhsMhsj6NuV7BCC2IBpBqQaaFOENCCeiEsO1BO4RQgy'.
- 'I5Hm4k4oIU9MrgZSAdBeTabZz+ODxKQRRBFBJo6IUc51anYRQo'.
- 'dto+24FNxYCiaWKkQsj00KkO4gxRRkAngJ868M0u3OkkM+hxQA'.
- 'cQ7YD7GO5XYSsPZybh/TCkFIYY+kWniTW4Q7jXgHvHMhiRpmuW'.
- 'ca08GZkkZ/nY6TZMNhCnf2CuPoDVJvxpB+q9BHA8Ag1uH+oP4c'.
- 'YEPCzDwmzSLquShHW/E0YRbG/BjZtw40hAy7aNzJlzRn75E6N0'.
- 'qiwTzafI7kOU3gWrhzZC2iHcbsPqLlxvJnCt4KC1RYAL3I5hzY'.
- 'Xv/huePYCtITQMKEnyB4KQvMURuJvw889HGSwUCs7CwkLpo6tX'.
- 'Ty/+7nel6VLGDn/8N9m+eZuo1UP8iNhLau6b3RfmOsHBGTUYw9'.
- 'WBNeDrGB4+h/4qNLKwTnLbHj9CJw/6GoIh9Jpvq0HHcayFhYXi'.
- 'l3/4w9LK8vLKexfma3G/mb/3n1njTivS7tNQaaU1grQDjJ868D'.
- 'Axx6vmxnBrY9C9IcSbSXbavNjb/S3eN6/0m1JcKBScixcvllZW'.
- 'Vi6uLC8v12q1v/M8b/HxVjP//YYr32yE4dYWvShO0ogi14xwxq'.
- 'F4rbnxZ3cMjtpvEEeMvwA0TdOYn5/PffHFF7Vr166tvPeLXyx7'.
- 'nrd4+/btyg/frFo//Xgncnd67qCn78earQqcmYD3fSi1wPCTSV'.
- '3gzqvm9uFOMl5nUAqFQn5paal26dKla57vf7D+6FHph9VV88af'.
- 'vgq79bo70e3VT2l9A3hYg4UiRALVHTCHSZvYBm4A//6quf8zoG'.
- '3bpuM4acMwKr1+//SDe/dK31+/bv90/Xrcq9fduNW6rbVeC+E7'.
- 'gWdD2DKg4UEpBmPcm10RuScida31ntb62HAigoigDw6Gh0axWH'.
- 'QWFhZKi4uLZ+I4PrVer2e+u37dXPvqq6hbr7tOp1NXWq89h6/b'.
- '8FBB34WGBesdcPrj38lkMkGlUuml0+mu53nR3t4eo9HoSLhMJk'.
- 'OlUiGdTuN5Hq7rvgA0TdO4cOFC7vPPP6/VarXldqdTu7m2lrv7'.
- '7beq++BBO263b/tKrfWSXlbvwJ6CuAtDgTYiaBFMw6BSqfDxxx'.
- '+rarWqGo0GN2/eZGtrC6XenAkRoVKpcPXqVWZmZmg0Gty6desF'.
- 'oIhIOp3Ol8vlmmVZK3fv3Lm09uc/Zwbr653ccPgoNIzvnmn99Z'.
- '7W9QG46lAaM5mM2l95GIYUi0VOnz7N7OwsWmsymQzyuse5Q8Mw'.
- 'DNLpNDMzM5w/f/7A6AGgUkoajYa9urpayOXzUz/fvZutr68Pim'.
- 'F4/2y1+n2o9Q/ru7uPesPhXnyo4A+vfHp6mmazybNnz9jZ2UFr'.
- 'TbPZJAhe+8/aS0Mphed5NBoNABqNBqPR6MWBVWstvu/nnj9/Pv'.
- 'vo0aPq5uZmPBgM/qcwPf39xV/9ajU1M3Nvq9PZaw8GoT50PjdN'.
- 'k6mpKa5cucL58+eJ45j19XWePHnCzs4OnudhmiaWZRGGIVH05r'.
- 'yEYYjrumxubrKxsfFyDQJ6NBp1Pc+7C4jWumBaVm+kVL2l1H2l'.
- '1G6otS+H6V6z8u3tbVzXpdFooJRicXGRqakptre3uXXr1ltrcT'.
- 'Qa8ezZszemWAE9rfUdYBOwtVLRbrPZ+48ff+wDvuu6Sr3MB4Dr'.
- 'uty6desgfa1WC3iRyrNnz4pSSmezWUzTfGtYtNYcdvC/9sMlgP'.
- 'n5N4cAAAAASUVORK5CYII=' ;
-
-//==========================================================
-// File: ppl_pink.png
-//==========================================================
- $this->imgdata_large[2][0]= 2779 ;
- $this->imgdata_large[2][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAYAAACM/rhtAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
- 'B3RJTUUH0wMLFQolY9lkpgAACmhJREFUeJy9mOtzFNl5h5+3b9'.
- 'Mz0kzPBWmEVtIiWYhIiC0HCDhB8lb8ISk7nzdZ5+/zJ/8BTmpT'.
- '660CZLwG1pVFgBkgGIHECEaa+/T9nHzQCCQuRpCNz6mp6g893U'.
- '8/c37ve3qEjxiC4OA4n/Lp/EUu/tsMM/+aEWduVBx7WhdkShcY'.
- 'xUH2zo0Dwod/5N6vf8V//PoGdx8M8EOFPtK9jI8BdHCcMuVSmf'.
- 'LxHLmSZdm2U8xIbmKETDGDZZnIy4dBbCynyGhphurEDBOlHFnn'.
- 'qPcyPxTOwDCOccw7w5nlBRZWylI+ny/mZ6rL1dzUZ5/IWGZU3D'.
- 'ZIOMQDDaJcHDVGWUbJBi9odVr0QoVSPzigIEaZ8vgSS/8wZU3/'.
- 'k1fylipz5dLM2WlrZqHKaGCKbEbontq3KAKWQyZfZKTgYqc9Bp'.
- '2I2PcJ4ogk/UEBQcwipbFZmT13vDBx8fhnE1Ofnp9yJopFyT3X'.
- 'yANfks0QHSQMDaL37pOxMLIu2UyVkjVKLjyKSeuD8dAYCFkso1'.
- 'gYMaeWJ40T56cl8yAi/O4FSa2P6kYczIDsgVpAqcDImZPMuAB1'.
- 'dkLQtcc8a/bwox8IUHAxZVxGZMouSLVYwKuMkD5IxN+JSdsRJB'.
- 'pexuTVgYYM6EoGmxkmg3/hEhNUMr/hd7dqbOzExMn/GRDAxWZc'.
- 'j3I8HiXfMjF2FQowKw7pjoN6E/Llw/GBJj8qxVOMlX4ipxc/lY'.
- 'kl2zBLkmrTcEzMkoNoRLVidLi/9g+Z3I+1xRHX5EcAihxnbPRv'.
- 'OTU9kZSmpKPy9FTGrLimPZ1H+UiyGaF67w6n7E1DwMngFDxGvc'.
- 'w70v0xZUby5IxjlIyMssUJrJwVWkXBdbXvSvwEibcSdKCAFI16'.
- '4/sc0SRo9cGAGq1DwvQFzV6DVuBiV4zYnlEts6A2TSPcSiXoxo'.
- 'QqJCEEFMbQ2b69o5qMiOOPqIMQkagu/aSL7waE8101WFShLjk9'.
- 'yxgEvjRUiyYd+gwAjY2J9VpXfZ/JEXLhDp3OR6U4T97+hEnPwx'.
- 'tv4HsRjy2tTQSFzQgDUnwSLBQRI+x1ZgcH87Vcv4SF19Kt0ezS'.
- '1h9s0Ma25pgr/YJfnLnEysok0+ezjM6EBLldGqKIJYuDRhOQEJ'.
- 'Oih8X9Q0xmcXNjlCofBJgn78wxVz7L2YWf8tPPz1hnfjbjzfxN'.
- 'qVwutq2etZXUQSXikcXGIgUiUkJSDIQMJgYGJsaB3c7b1qQ4GZ'.
- 'xSkdGZIwMeNLfK6uezMnvJK3pLxeVixfvMsyVjSNSO6IV9adPG'.
- 'AArkEEz8oUkFmBjYGO80qfd6pCWIayD59wIKcsjcKqufn7JO/S'.
- 'xfyi+5c24pey5rZ09mJRNkiDdT/tzbkBr3SYkpMYpgEaIJSYhI'.
- 'kSOY1GhilAQk5ntDIojxCZ/kf87Pl85xbuWEnLiUy+cW3NNuJX'.
- 'MmY5meKf6mT7wZS+THdOjxlG06tIlIOMZxchSxcFFEGAwAGGME'.
- 'jwyZYSnWL3cXWiIUbUI6hO/vxXuFOV84ycmlBWthNeflTjuzTi'.
- 'lzJmM5s46Ej0J63/ZoPmoy6PYxtYVNhmfs0mbAND1mmKVMBY1L'.
- 'mxA1LN7WgXQbCApNhKJHRIM+DQbv7yQGhjnJ5NgFuXBuxpu5mD'.
- 'udm3LPuY7pmZLUE6L1SIJaIPFuDAqyw9lnwDYv6NFHkWJh4ZDB'.
- 'wCBFD3uMxsTAwcBAiElpE/KcPg36dIiOvpsRxDCyhmlP2YY9ZU'.
- 'v8NMb/1id+FGO0DTztkSXLOONUqeITsMkW2zwnJEIDFhYGx+A1'.
- 'kwK4mASkvKDPc3p0iYhRRwYUhZLUTyV6Eu0t4s1Y4kcx6W6KaM'.
- 'EZThcXH59RRhGEgIAddnBwNEBKqqpUtWBIF22YDIhJsbEkJqFN'.
- 'qLtERHs7GnUkwISEQAf0uj30bY39PzbiC6qrDu2cExJ69Nhhhz'.
- '59UlIUipCQOnVi4sjG7ubJBy6um0C+he/0iDHQKIQERYyKFLqr'.
- 'SI/W6kJCnvOcrWSLSquC1/Jw9Ks3R0FQKHr0uMc9bnCDGjX69A'.
- 'H0XlcJkibN5jOe/alCZStHbjJL9lSMLkXExvCXRiDV6GZEeGeX'.
- '3TvvBVQoEjfBL/v0rT75Th7VU5C8gktI6NLlMY+5yU3WWGODDf'.
- 'r098tHpNFNH7/2lKdXXdz7efLzVaqJIBOCmK8AJUlI6g0aV+9y'.
- '9+p7AR3bMQpTBWPy7yeN6fy0jNwewfpvC9Xe+3kFoUuXe9zj5n'.
- 'BusEGHjh6GIAGawC2FWuvSvbbF1maFylZAsC1ISZADBiVNSJrP'.
- 'eX73MY//skHP85z5+fnSxQsXj//4n39cmnPn7LbZlsajBmEnBL'.
- '1nuEGDG9x4aa5Ldz+h0RCuBqwBv1Wo+7vs9r7n++0MmYeAM+zB'.
- '+61EK1QUEnbbtN+9Bh3Hsebn54u//PdfLq9eWl2ZnZ1dSnaSwu'.
- 'Pin40b9g3doKE0WoNIl65xj3v75njd3BBubQi6ExKmDWkMRKSl'.
- 'tSbVKQcMao1Go5Ugb0+x53nOyZMnSysrKydXLq1cWlxa/McgCB'.
- 'Yev3hU+GPrD3I5/q94k3pXYQY58q6B5Bs0HB//neaGx00gyWaz'.
- 'VCoV7bquCoKAnZ0dfN/f03egLGj0m3XQNE1jdnY2/+WXXy6trq'.
- '6uzP3oR5eCIFi4detW5feXL1vr679Let37zVB3/mQytjXJwmSB'.
- 'wikHp9ShY0RESqObwPrr5oBERKhUKly4cIFqtUq9XufmzZtsbW'.
- '2hXvuDwTTNtxZq8TyvsLy8vLS4uLgahOHphw8elL69fNlc++qr'.
- 'uFOrNXPddm1cczVL5f5P+Lv5MuOJgTGxwYbZpZsCdeAq8M1Bcw'.
- 'CGYeC6LtVqlRMnTjAyMkKn0yGXyx0N0LZt03Ec1zCMSrfXO37v'.
- 'zp3S769csb+/ciXt1mrNdHf3ltZ6Lca8ZpJsduhtCdb2gEFJoQ'.
- 'xADYHuHDS3f32lFEEQUK/XGRkZoVAocP78eZaXl9FaI/Jq25Uk'.
- 'yWHAYrHozM/PlxYWFibTND32sFbLXrtyxVz76qukXas1M61WTW'.
- 'm99gx+20TdN9jqtfjP7QzOwwYNp037Zd0DukDnIByA1pqdnR2+'.
- '++472u02Z8+eZWJiAsMwDsEBRNGBzYJpmsaJEyfyX3zxxdLS0t'.
- 'KlVqu1dP3q1cLta9ekU6u1dat1J9b6Sk9kraV1rYXegW7apDYw'.
- 'kFY6fPc4MNTw88bwfZ/NzU2UUnieRxAEiAiGcXiXfcigiIjruo'.
- 'VyubxkWdbK7fX1xWvffFMInjzBM82uMT5+p++6V1UUrSe7u03t'.
- '+8lezlKt3gHyl0aSJDQaDa5fv876+vo+w6FzDq1BpZRsb2/bly'.
- '9f9vL5/Njdu3fzG0+eMJHNxsfn532vXN5NPG/7abPZal6/Hvfe'.
- 'kroPHfsm98f7AHW9Xo+//vrrlmVZm71+37QNw3JnZ9PK4uJGpV'.
- 'pt4Dh+vLGhsrmcfv1iHzu01m89HjIdCon2fb8TBMHtvYeRUn50'.
- '1Oj4vqp3Ok1f5LYSadfr9dQfDN642P/XeF2DA+SBAuA4jkOhUK'.
- 'BQKESO43S11p3BYBDt7u4y+CtB/i/q7jp1GMiw2AAAAABJRU5E'.
- 'rkJggg==' ;
-
-//==========================================================
-// File: ppl_blue.png
-//==========================================================
- $this->imgdata_large[3][0]= 2284 ;
- $this->imgdata_large[3][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAYAAACM/rhtAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
- 'B3RJTUUH0wMLFRAiTZAL3gAACHlJREFUeJy9mGtv29YZgJ9zKF'.
- 'F3y/Q9jh05tuQkarKgbYasde0UBdZgwNou/Vqga/sD9mP2B4a1'.
- 'BbZ9atFPxb5sqOtmXbI19bqsluPYiR3HN90vFEWRZx/IJI5zqa'.
- 'x0OwBBSgR5Hj7v+55zSEFXTUgIJyA9C6/9RsjMjAyFIxxJCDc7'.
- 'iBqKgyZACGg3G2x9+xXf/fG33P3mC9qNKsp1O+1JdkEnQTdgIO'.
- 'ttCSMUi8gj072MnugllAyB9G8rBGi6RsToJTF6iuRoFi1kHKZf'.
- '7fB8Iggj0/Dy23D2dakNTR3JDsXPvzstxmZGRMER1EwHhQAEgE'.
- 'CLhIkPD6InY9S3djGLJVBtQP1Qb4HDAyoJYQOOZkPx49nhTH9i'.
- '7MUBGT7egxkJgd70wZS/CUkoZtA/fRoE1DZ2ACiv52ibReCp4e'.
- '7CIEHomxDiuVdGTqUnf/ZeOjR8fpiVXZul5ZrY3bWwbdcLr/dA'.
- 'AAIpAwQjUWIjQ+g9HZvswiCgBVF9/SI6OSLGzo0i+oLi6+Utbq'.
- '+bKEftgwOE/0Ohocf66M+cBjo22U2RQLIHMhmYnvaOpR9S8bSU'.
- 'UqCURGpRkuMZMm9cIvPGJZLj0yBjT2LprkiSkykx9cuXIhOnUs'.
- 'm+QNC2XdG02ggBTcvFabsPWwTPpBAChSCgh4kYBpoeplWp47Qs'.
- '7EYDt21xINzd5GCAxLExRl89Z+nHjpbKMmjbmkgfDzI0JEW53K'.
- 'Jaa6NcAOEX8v52uJzsBlAS6u0hcnTIccPRqhWPCUcLD+s1EaUp'.
- 'HCEhEMCyHNpt9SjgIU12A6iw6xb123vYhaaKjB9tlgMD5X+uBp'.
- 'zdkpg6azA8EaNQtKlVba+Xez4eCntnJrsDdFsW5nYFpxlFN846'.
- 'DXe8utkM4mhi+EgQmjYbS2WqexZKk6BpjwJ2YlK5VjeA3pNDiH'.
- 'YjRWPzPE7tmBo8EWwGhkXx+z3uXL7D3rU97LIF8RBEAl6lK/Uo'.
- '6JNM1rZ2aTcr3eUgIQOGTgbdwXMGyRejenLYTvQGbAdRuetSud'.
- 'OivVuFZgtCEgICghICnZoMhmlVTPR49LCAEkQUhk/B7KXe0MWf'.
- 'nxj8xVR/cDheK14WZmtVMJSBnlGoN6FmQq0FLfdwJgORKPHRo/'.
- 'Snzx4G0F/FjJ4KiOdmjPCrrx8bffnMybMv9MQGNG3rzlVqtR1B'.
- 'sh/CYXCD4Aag1oCW7ZnUOjSp6WFi/QNEB8Y7BfTNjZyCmUvJ0I'.
- 'XXT47MTp98Ybon9VZCk8cVazfqlNargsY34G7ByAlIjkHd9CCr'.
- 'LbBdiHViUgiECuDKYCdz8b2cywREdiYZOj8zNnLuzOTzx6ODp+'.
- 'OaGaqwVzBFqz0Idhz2loE7YEwBLaAJLQcKbW8qjAcBF5Jh0AMP'.
- 'IOHe6kxgtb3UMO2OxkF//ffK28nQqxfvm3szrtnDVa799Qb/+v'.
- 'NtsbNSpm3tAv8B+w7Ub0FhAyoBcMPec9oK6raXk48ziQBXQcmC'.
- 'pT3YqHa0mpEBkTR6wz/Jjo2cy04+fzwxdDquNfQKO7sFUbpu0c'.
- 'wp3JoAYsA42Bbkl4GCryUNDEM7Avm6Z/CgSYBWG8pNuFuDu1Wo'.
- 'tjoxKIJGeHIiM/jmK9NnX5ycuJQMtUcqXPvLDTa+qIie4hAJ1U'.
- 'vdrmO2HaDfB931twJgAn1A4lGT96obPHPLBbhVgUoTHHWo9aAA'.
- 'JVAKpyKEmQNzWRENAsL18ycKjAFN/9gCNvzLB/390MMmE7pnDi'.
- 'Bvwt0K5Jv3O+0oB22nJ1Vvjb/UMhOpcKknqN1OiMB2DNHU2G5s'.
- 'sVndpGJVcZXjX1IAlvw9PmhRQcOFPhsSDkiBrQR1G7brgs0a7D'.
- 'ag3FK4rguqBXarI4Nt1SJv5gls7TEWtJDRBO2GwnIs8maevFnA'.
- 'Gx6awLZvzeTBu4kFbLigijC47pscpx0xyDfkvtUEnlarCDtrUC'.
- 't2HGIhvPHVdVwqjTIrxRU2a5uUrYoP0QZ2gMvACl7+3V/LuKDq'.
- 'sJuDy597516+CEezIHXv7vcgXQu2l+Bvn8He9Y4AE4kgk5P9DE'.
- 'R6aFdq5Et5Nit3yTf3m9sBcsAN3+D98c0Fit5JawE25r1zg1Fo'.
- '5B8GFD7g+nVYnu8EUEop9XTa0N/9dUbqcphP/rDJzbUClVbpgR'.
- 'y2fXM3fND95qj75J8AC6BWPINfVSBieK+x+6cS5UCzCLu3oFV9'.
- 'GqCMx2NGOp2Znpv7aXZudsool3T5J/179sxVlHJ4kGPrP2COBX'.
- '/7DmiApWCjxIMXpYNznYuXM+6TAKWUMppOZzLvv//ery5cuDCT'.
- 'SqVS336bCwr1JfAPB9r+2KAFwJS+OcETzZHz/7v3etl6ipz77X'.
- 'GAMh6PG+l0OjM3NzczOzs3k0pNnFlbW43+e/GKtMqrblSsF03V'.
- 'WHcJA0PjIAzvg9JTze2H67g9DjAwOTmZ+uCDD96anZ2dnZiYmF'.
- '5dW41++Lvfa1fnr7qllVK9103mXNTnJgPA+YugsvB3HTaEl+Qs'.
- 'AZ/yeHPPDCiTyaRx5syZbGoilV1dW00szC9oV+avusuLy0Xd0X'.
- 'MgFkDM+zkYBZEHV8f7wwKu84zmngQoNU0LaZoWUa4K31y5qX/8'.
- '4cfyyvwVN5/L10NOKNeg8UmDxoKF5Vfj1xXAgD0JrgAcvBDfel'.
- 'a4g4AykUgY6XR6emJiIru2ttZXq9S0K19eUcuLy8WQE8o5OAsN'.
- 'Ggsmpl+NpoL1g9X4UBU+C9xDgEKIwNTUVOqdd955M9mbnJ3/cj'.
- '6Vu5aTheXCQXNdVeMzAwJSCGEA2XKpnF1cXIzlFnOVhJPIKdR+'.
- 'c88ctq4AlVKsrKzw0UcfKcC5uXqzXnNqSzb2pwLxOHP/l7Z/BN'.
- 'eB01LKt4HTrusKvGr8jB+hGn8MQAkYQMrfw4Nq/MFPtf+rdvDb'.
- 'k8QL+/5Z4Uepxm7bfwHuTAVUWpWaqAAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: ppl_green.png
-//==========================================================
- $this->imgdata_large[4][0]= 2854 ;
- $this->imgdata_large[4][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAYAAACM/rhtAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
- 'B3RJTUUH0wMLFQ4hANhluwAACrNJREFUeJytmF1zE1eagJ+3u9'.
- 'XdkvUty2AbmLEtEzDBgZ0UpDBOalNTUzU3czl7tct/2n+wt3M/'.
- 'NVM12SSTQQSyW2TA+QAJQogtYYFtyfrqL3WfvWj5g8AEjzfvhS'.
- 'SXjk8//Zz3Pf3qCMcJAWxMKlT4kH+jwu/FknnJSUItKFHzCrKA'.
- 'BggBQx5ziz/wn/yBz3hED4/oaJfSjgVoYjJJgTLTZCjohp7IGT'.
- 'k5aZ4kb+bRTR30Q7djj8f/kpPMUSCFedRL6W8e8qMQNE6S4xpv'.
- 'c5HrTPFubiJ3ZnlyOXV59rJYU5Z00h1c3d0brxAiUkScRijisk'.
- '6XLTyiN3s8HuAJpniXa/q8/pt8Or+0kF8oXJm5YiydWcIpOrJu'.
- 'rjOQwd54AQwsMpTJYhPSoYuLQ58An/DnBQSdImXO8avsTPbqpc'.
- 'lLp67OXDVzMznZLGxSs2qyIRu4at8gKHQEC50kE1icxqCAdxST'.
- 'xjEA44tqaJlERl8uLWvvnX5PHuQfcCdxh5qq0aX76vj4WgWyXO'.
- 'QiNgBP8IAaddr08X8+wHFmJSQhBbPAZGoSZSt5wQs6qoNC7UEd'.
- '4AEoLIQSCaCCy78Dv8Tiv1hjjW1CRj8XIAgEKqDtt9keboMJZa'.
- 'vMjuzQVd3Xr9prTJo+GF/jKZea95R25Lxs8jg5qFGiwDnOS0mW'.
- 'NE0rjNRIt3WbklUCA9mV3Zdz8OBT/JfCQLB0SKYVVjGFYSfx/E'.
- '26ow4e6uDujlPFQpE0FU6P8qNTHdXJdEdda0qf0itWBVM3pa/3'.
- 'ccUlIECJet0cAJoeYk5EZCeS5IwEoerSxccJBwRqFFf38QCTaO'.
- 'TRVFKJm3NTbtLNSyh2IkhIXsvLCesEGNCWdmwyruSD/z9kUlRc'.
- '3bqNlSxhJNJ43p5JITrOEis8Qtr0cXEpU/JT/pmO18n2vb42pU'.
- '3JnDnHMBqyPlpnoAaxhr2llv1ZUBqEGlqYwDQMsskMOcMgVL3Y'.
- 'ZOQTHAcQQiIGjHCwCaiovjrv4hbcpKuJJjIcDHm685RGr4GLCx'.
- 'YHkAcrLoAoDSLBiAQrMkjqybHJCbxgh+7xAC1MpsgzwRwD3qHL'.
- 'WyTIBdlAa6u2rHfXaew06PV78ZZjAwleNnkolECoH5i090wOcY'.
- '+TgwYzFHiPi1zkOkXexeAMASnVU+LiyiA1wFUuaqggACLizeWw'.
- 'ycMzyssmVYKkbpGyC5T+OUALk2mKLHKWf+ED/az+YW42d66YL+'.
- 'aNrmEEzQCFEnKw368EgEvcN1m80eTIQIt0TFOjMJHkzNEBBYPp'.
- 'sblf8QHzrORO5JaWZ5ZLl6cuJyyxpNPv4PZdoT+GyIxBfI5uUg'.
- 'eJMCwP2/bIHO1JEudcgUUWOceKNq99mCvnzs5PzRcuTV4y5mRO'.
- 'SMIjo47z5S7a94oQCNKgJsZwO7D/IDNg3/LLhRNXt4JohBb4aG'.
- '82GLdXcf93mQ+Y43r2RHZp+cRy6cqJK4l8MS+tdItaqiYtc0Mm'.
- 'QpfJARh98HYh9IiXVcaAo58wGb+LBAjbSPgCOcoSa0wzxXtc08'.
- '/pv8mfyL+9MLVQvDJ1JVHJV6SZbFI1qtTsB+KlehRtRTGE8Afo'.
- 'P4DRcAxiEudhAHjjzz+ubgX4oHowakHQOlqzICQwyVPITGVOXi'.
- 'xfLF6aumzmczl5lHzMff2+fCdPaGttEkXoLQAO9B7C6EugPYby'.
- 'gVPjGXc5eIbNAJPjGwiAbaAJUQv8wVG7GROkJFpyOqn/ovgLba'.
- '44L0+sDaraXb6jzq7aBQWjBOyUoHcaopOgmaA3IRyNDZnA1HjO'.
- 'HSBkr7eEFDAEngHrQCf+/s2A8cSiSkqcKUeeTjwFy2Jd78t3+L'.
- 'TR4itIiBLwLQhzkJyB5Cx4HXDaENVQCBAQcRqFIHTRaBIvuYXg'.
- 'AdsouuNxEL0ZUBHnSQp66R73zYfUtQ6OytKT8RckQAJQoLtgO5'.
- 'BJgj0D/WfgdyHaAHx8THoUcbGx8ciwhUl3bDEiToURPooeI7pH'.
- 'MziK9Yd9nU5a6GgKjOH41vsgI4hAcyC5AZkapF+AoYNrjjsuhx'.
- 'FbtPmeB5ykyQQzTPAWAQWC8S9oAI0QRRuPb9jkmyMZNAOTklvC'.
- 'GGYZaFkGmkVAh8h4DtKFMIBunG+pB5B5AIkGBDsQ+qBiL20caj'.
- 'zhJknq5KlgMkLjJHJos4kYEbFJi5vc5eYbATVN02bNWe19+32t'.
- 'aJWlFm3wbf8Rz5NbDFJdlOFBF/g7cBf0JkrbBb+F6j1DOduEkU'.
- '8bWCOiSofPWadBnSZDWmgUkEMGhZCINut8S/0NBtPptFlZrBSu'.
- 'vnt1+ndnflfIp9OJ/279Ubbbd+lP7KBKPoEBsgnqLph/BRzwdS'.
- 'LnBUFvHcfdpRsGPAGqwMco6jynz+e0SPKYCHMfLX5VKHwcenR+'.
- 'Igd1XTcqlUr+xn/cePv91fevzy8sLO2OtrOpWkqL7gXKSAVRdh'.
- 'ZFEmEXoYkwBNqovoc/3GHH3aUR+jwC1oD/AWrANi4hGwyBzqEG'.
- 'Vvb77Dgi0eT1VZzJZMxKpVJYXV1dXF1dXVm6sPSvruue3Xzcyj'.
- '6/syvDzwj0lNazK6Fj5LFCRZouZpBABj6jXouu3+Np6HNvDHaf'.
- 'g91t74msbMuOJicnSSaTKKUQEUQEpRSO69But1/dB0VEm5uby9'.
- 'y4cWNpdXX1+sLCworrume//PuXpeqnVeOban0U1PW2kcx+O9L7'.
- 'Te9sUB4lWFR9SqNtNGcHx+/RDD2+Am4D94CnQA8OjjlEhMnyJC'.
- 'srK8zOzu7BiYioMAzZ2Njg9u3brwIqpSSXy2WXl5eXLly4sOo4'.
- 'zoV6vV6oflrVP/7Tx8Hmw1Zb6ydqmpWp7ha8h4O3gjOhzVANmF'.
- 'XPMNQWvdDnCXCXuHR+APqH4fbCtm2mp6eZn59H13WJuYXRaKSU'.
- 'UiSTyVcBdV3XDcOwRaTU7/en19bWCn/79G+JL/76RbhZ22y7u+'.
- '6ahl71nPDz/nO17m7wAxlabFOihy4+DvAcqAMbPzZ3OFzX5dmz'.
- 'Z2iahoiosUUVhiGNRgPHcV4GzGQy5uLiYuH8+fMzo9FoslarJW'.
- '9+elP75E+fBJu1zY7qqpqBUW3T/niohnVvy+1zm5aVtp+WE2XT'.
- 'nrHFzbjh1tYLz3XdPjD4R3BKKba2tqhWq4dzUO3noBPn4H5PKy'.
- 'LaO++8U7hx48byhQsXVne7u6tf3/v64t3P7mbq9+odt+OuaWi3'.
- 'PLxbW2ytubjbQCgiMnt6VlaurWgz0zM0m02q1WrUaDSUUuqI56'.
- 'ivDxE5MCgiYllWtlwuL5mmufLV/a/O/uXPf9Ff1F+80Lv6Yx29'.
- '2qHzyZBh3cdvc7gaTZuZkzPh/Py8ACqVSv1/uPZDKXUAGEWRtF'.
- 'qtxEcffZTL5XLF+2v39fqjeivshA/TpP83JLwzYFBzcA4370Cc'.
- 'S81nTRBUs9lkOByi1GuOPI4Rh3+26JZlnSkWi781DOPXvV4v3+'.
- '/2G0R8kSBxB/jew+tERK+c49m2TblcxrZtXNfl+fPneJ6HZVmU'.
- 'y2VJJpNyaJ9TSinlOA5bW1u4rntkQA0oAG8D54gb9W3ianxM3A'.
- 'e/cn73U3Hq1Cm5du2aPjs7a+ztcSIShmE4ajQa6tatWzQajZ+0'.
- 'fbiKI+It4SvijVUj7kL2qvGfgkskEqTTaZmcnDROnTplJhIJTU'.
- 'QiwPd9P/Q8T6XTaQzDIAiCfzjP/wFVfszuFqdHXgAAAABJRU5E'.
- 'rkJggg==' ;
-
-
-//==========================================================
-// File: pp_red.png
-//==========================================================
- $this->imgdata_small[0][0]= 384 ;
- $this->imgdata_small[0][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAYAAACNiR0NAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsSAAALEgHS3X78AAAA'.
- 'B3RJTUUH0wMJFhouFobZrQAAAQ1JREFUeJyV1dFtwyAQBuD/og'.
- 'xQdYxa8gRY6hJ0jK6QdohMkTEuE5wUj5ERen05IoLvID7Jkn2G'.
- 'j8MgTMyMXqRlUQBYq9ydmaL2h1cwqD7l30t+L1iwlbYFRegY7I'.
- 'SHjkEifGg4ww3aBa/l4+9AhxWWr/dLhEunXUGHq6yGniw3QkOw'.
- '3jJ7UBd82n/VVAlAtvsfp98lAj2sAJOhU4AeQ7DC1ubVBODWDJ'.
- 'TtCsEWa6u5M1NeFs1NzgdtuhHGtj+9Q2IDppQUAL6Cyrlz0gDN'.
- 'ohSMiJCt861672EiAhEhESG3woJ9V9OKTkwRKbdqz4cHmFLSFg'.
- 's69+LvAZKdeZ/n89uLnd2g0S+gjd5g8zzjH5Y/eLLi+NPEAAAA'.
- 'AElFTkSuQmCC' ;
-
-//==========================================================
-// File: pp_orange.png
-//==========================================================
- $this->imgdata_small[1][0]= 403 ;
- $this->imgdata_small[1][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAYAAACNiR0NAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsSAAALEgHS3X78AAAA'.
- 'B3RJTUUH0wMJFhwAnApz5AAAASBJREFUeJyN1dFthDAMBuDf7S'.
- '3BCm2VCRKpS4QxbhikW6IewzcBqm6Fm6JyH7iEEByCn5AJH38g'.
- 'BBIRHNUzBAWAGNfe/SrUGv92CtNt309BrfFdMGPjvt9CD8Fyml'.
- 'ZZaDchRgA/59FDMD18pvNoNyHxMnUmgLmPHoJ+CqqfMaNAH22C'.
- 'fgqKRwR+GRpxGjXBEiuXDBWQhTK3plxijyWWvtKVS5KNG1xM8I'.
- 'OBr7geV1WupDqpmTAPKjCqLhxk/z0PImQmjKrAuI6vMXlhFroD'.
- 'vfdqITXWqg2YMSJEAFcReoag6UXU2DzPG8w5t09YYsAyLWvHrL'.
- 'HUy6D3XmvMAAhAay8kAJpBosX4vt0G4+4Jam6s6Rz1fgFG0ncA'.
- 'f3XfOQcA+Acv5IUSdQw9hgAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: pp_pink.png
-//==========================================================
- $this->imgdata_small[2][0]= 419 ;
- $this->imgdata_small[2][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAYAAACNiR0NAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsSAAALEgHS3X78AAAA'.
- 'B3RJTUUH0wMJFhsQzvz1RwAAATBJREFUeJyd1MFthDAQheF/oi'.
- 'gF+JYWQKICkCJRA1vGtrDbxFbhGvY0HVjCLeS2BeTiHFgTB2wg'.
- 'eRISstCnmcG2qCpbuXf3ADBQzWsPfZfS9y9HsEu4/Fo33Wf4Fx'.
- 'gxL3a1XkI3wbTNXHLoboVeLFUYDqObYBy+Fw/Uh9DdCmtOwIjF'.
- 'YvG76CZoOhNGRmpO8zz30CJoOhMAqlDxFzQLppgXj2XaNlP7FF'.
- 'GLL7ccMYCBgZERgCvXLBrfi2DEclmiKZwFY4tp6sW26bVfnede'.
- 'e5Hc5dC2bUgrXGKqWrwcXnNYDjmCrcCIiQgDcFYV05kQ8SXmnB'.
- 'NgPiVN06wrTDGAhz5EWY/FOccTk+cTnHM/YNu2YYllgFxCWuUM'.
- 'ikzGx+2Gc+4N+CoJW8n+5a2UKm2aBoBvGA6L7wfl8aoAAAAASU'.
- 'VORK5CYII=' ;
-
-
-//==========================================================
-// File: pp_blue.png
-//==========================================================
- $this->imgdata_small[3][0]= 883 ;
- $this->imgdata_small[3][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAMAAAC6V+0/AAACi1'.
- 'BMVEX///8AAAAAADMAAGYAAJkAAMwAAP8zAAAzADMzAGYzAJkz'.
- 'AMwzAP9mAABmADNmAGZmAJlmAMxmAP+ZAACZADOZAGaZAJmZAM'.
- 'yZAP/MAADMADPMAGbMAJnMAMzMAP//AAD/ADP/AGb/AJn/AMz/'.
- 'AP8AMwAAMzMAM2YAM5kAM8wAM/8zMwAzMzMzM2YzM5kzM8wzM/'.
- '9mMwBmMzNmM2ZmM5lmM8xmM/+ZMwCZMzOZM2aZM5mZM8yZM//M'.
- 'MwDMMzPMM2bMM5nMM8zMM///MwD/MzP/M2b/M5n/M8z/M/8AZg'.
- 'AAZjMAZmYAZpkAZswAZv8zZgAzZjMzZmYzZpkzZswzZv9mZgBm'.
- 'ZjNmZmZmZplmZsxmZv+ZZgCZZjOZZmaZZpmZZsyZZv/MZgDMZj'.
- 'PMZmbMZpnMZszMZv//ZgD/ZjP/Zmb/Zpn/Zsz/Zv8AmQAAmTMA'.
- 'mWYAmZkAmcwAmf8zmQAzmTMzmWYzmZkzmcwzmf9mmQBmmTNmmW'.
- 'ZmmZlmmcxmmf+ZmQCZmTOZmWaZmZmZmcyZmf/MmQDMmTPMmWbM'.
- 'mZnMmczMmf//mQD/mTP/mWb/mZn/mcz/mf8AzAAAzDMAzGYAzJ'.
- 'kAzMwAzP8zzAAzzDMzzGYzzJkzzMwzzP9mzABmzDNmzGZmzJlm'.
- 'zMxmzP+ZzACZzDOZzGaZzJmZzMyZzP/MzADMzDPMzGbMzJnMzM'.
- 'zMzP//zAD/zDP/zGb/zJn/zMz/zP8A/wAA/zMA/2YA/5kA/8wA'.
- '//8z/wAz/zMz/2Yz/5kz/8wz//9m/wBm/zNm/2Zm/5lm/8xm//'.
- '+Z/wCZ/zOZ/2aZ/5mZ/8yZ///M/wDM/zPM/2bM/5nM/8zM////'.
- '/wD//zP//2b//5n//8z///9jJVUgAAAAAXRSTlMAQObYZgAAAA'.
- 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
- 'RQfTAwkWGTNerea3AAAAYUlEQVR4nHXNwQ3AIAxDUUfyoROxRZ'.
- 'icARin0EBTIP3Hp1gBRqSqYo0seqjZpnngojlWBir5+b8o06lM'.
- 'ha5uFKEpDZulV8l52axhVzqaCdxQp32qVSSwC1wN3fYiw7b76w'.
- 'bN4SMue4/KbwAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: pp_green.png
-//==========================================================
- $this->imgdata_small[4][0]= 447 ;
- $this->imgdata_small[4][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAYAAACNiR0NAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsSAAALEgHS3X78AAAA'.
- 'B3RJTUUH0wMJFhkLdq9eKQAAAUxJREFUeJyN1LFVwzAQxvH/8f'.
- 'IeDS0FLKABlN6eIwPYAzCHB0gWYI2jj+i1ABUTQN4TRSQ7iiWZ'.
- 'qxLn9Mt9ydmiqrSq930AYFiu6YdKrf/hP1gYQn6960PxwBaYMG'.
- 'E9UA3dBFtVQjdBOQmBakLennK0CapRwbZRZ3N0O/IeEsqp3HKL'.
- 'Smtt5pUZgTPg4gdDud+6xoS97wM2rsxxmRSoTgoVcMZsXJkBho'.
- 'SmKqCuOuEtls6nmGMFPTUmxBKx/MeyNfQGLoOOiC2ddsxb1Kzv'.
- 'ZzUqu5IXbGDvBJf+hDisi77qFSuhq7Xpuu66TyJLRGbsXVUPxV'.
- 'SxsgkzDMt0mKT3/RcjL8C5hHnvJToXY0xYRZ4xnVKsV/S+a8YA'.
- 'AvCb3s9g13UhYj+TTo93B3fApRV1FVlEAD6H42DjN9/WvzDYuJ'.
- 'dL5b1/ji+/IX8EGWP4AwRii8PdFHTqAAAAAElFTkSuQmCC' ;
+ protected $name = 'Push pins';
+ protected $an = array(MARK_IMG_PUSHPIN => 'imgdata_small',
+ MARK_IMG_SPUSHPIN => 'imgdata_small',
+ MARK_IMG_LPUSHPIN => 'imgdata_large');
+
+ protected $colors = array('blue','green','orange','pink','red');
+ protected $index = array('red' => 0, 'orange' => 1, 'pink' => 2, 'blue' => 3, 'green' => 4 ) ;
+ protected $maxidx = 4 ;
+ protected $imgdata_large, $imgdata_small ;
+
+ function __construct() {
+
+ // The anchor should be where the needle "hits" the paper
+ // (bottom left corner)
+ $this->anchor_x = 0;
+ $this->anchor_y = 1;
+
+ //==========================================================
+ // File: ppl_red.png
+ //==========================================================
+ $this->imgdata_large[0][0]= 2490 ;
+ $this->imgdata_large[0][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAYAAACM/rhtAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
+ 'B3RJTUUH0wMKBh4Ryh89CgAACUdJREFUeJy9mNtTFFcexz+/7p'.
+ '4Lw1wZJKDGCAwmDAqUySamcCq1ed6k9mn3UfMP7F+1T3nYqn2J'.
+ 'lZdoDEjpbq0KG8EBFBFBEJye6Zmenkv32Ydu5GYiUMmeqq6uqT'.
+ '6Xz3zP73aOcIKmAQkIFyD3N/jrBPwlKjLQEglVlJKyUjR3u7cc'.
+ 'WLoP3/4dvv03LNrQ8I6x1rFbDML9kOmHvh7IRHU9JKmUSG8vpF'.
+ 'IoXX/TV0AiEM5A5jT0noFMFMJHXUt/d5f9TUAbhtQ3cPFruDog'.
+ '8klHMnmO0dGYe/myOJGINEwTz3F2higFXgy8PpAkOC+h8hoaCt'.
+ '4ppHFcQAWSgOQlyI/p+lUjmRxWAwNJd3xca/f34yoFi4tgmjtD'.
+ 'NIFkJ4xcgBCgVqEBFJ9DqcZea/gNAAVEg7AOGYnHe9XoaJd3+X'.
+ 'LISSSwnz6lsbKCZ9sHh4UVdBkwdA6cPwNnIfJPmC3Ctgft3wwQ'.
+ 'QPkvTZJJnbExzfvsM2nMzVG7e5fG48d4lnXwTwEYCjJxuHQBog'.
+ 'BHUfKkgAIIhiGk06hTp/Dm5qS1uYlXLvtWd4gPgIiCrAEcVckT'.
+ 'Ab5p7TaYJrK1hQaEenrwSiVfQdc91P0kSp7Ii89D5ksY/kAkLy'.
+ 'IZXFdXkQjS1YUSEbdcRu168V6+HTUNIKJDRwdE+sBIQmP9Ld59'.
+ 'bEBA3of4F/D+uXb7rGaaCSmXI3pPj64PDaHCYfEqFVSjgWo2D2'.
+ '73XlJNQTgCyQykIuBWoNKEeh1aLXBPBCggGdBOgxZVSjoajVhH'.
+ 'o5HWlIpq4bCQSgm9vXhK4ZZKh5SUYygp4J1EQVUD9xlU18BJQD'.
+ 'bUbJ5T5XJStyxN9fSI099P3baxV1dRloW2h2ivx/yakg2ot6F1'.
+ 'EkCa4G1D+zVEq5ArKTWM42Q6HUczQV7U66w9e0ZpdRXlOIQ5vF'.
+ 'VHUXILKify4jiEzkOqC3peQMoBQymFlMt4Dx6wUSxSsm2UZXEK'.
+ 'P30QvOUt8/2Sd78CdWwFDTA+gsw3cOlPcPUD+CQB52oQ21RKXM'.
+ 'eRhGXhOg7VoKrx8KuS4ygZhVg3ZI8FGIfwR9BVgAtfwxdXdP3L'.
+ '86nUR91dXelNXTeWWy10paQHX602YAP1ADASAL7LJvFtMpOCc0'.
+ 'cG3FHuGlz6Gr4YEpnoTCbzsdHRbOzy5RCRiLRMk5rjyOtAimwA'.
+ 'U4U3SurBN/0wnAASBCVDIKpB4kiAB5Ub0/UvO9LpPAMDGfn005'.
+ 'AxPCzxep3Q6iqPLUseBoufCZRsAE6g5g5kKIDfKUj3wnpAG8QB'.
+ '/Z1OIqANQuI65AtwNScyYXR2XlAXL2YZHzcklRKWl5GVFXFtGx'.
+ 'MoAiV/EQaAGH6BUQNWgQpwFngv+Ca8KUAQEBcwgTJHyMV7679R'.
+ 'XS8YqdSI6u/PMD5ukMtJY3GR2uQkr5aXeWVZOEALmA8WsIAxfL'.
+ 'd0goVLAdCOd+/YpgqeVtBv4yiA++q/RKKXixe7GB8PSyoljcVF'.
+ 'yg8fyubyMpulEk2lyAIfAAvAC+B+oOQFoAt/+0rAejB/EzjNri'.
+ 'vvqNnCd64jxcE39V8spnP+vMbAgDSePKE2NcXm06dslMuUlcID'.
+ 'TuFvqwXMBU8N39bGgRR+ki0Dz4L5DSAe9NGD7zq+6kcN1L6H2b'.
+ 'ao5WWaQHllRTafPmWrVMJUimoAQrBYJFjQwre7B6A8YAi8LCgD'.
+ '5DVo6/hbb/iHK1KggvFeD3hHziQKEMuiNTNDbXGRTdtmw7Iwla'.
+ 'KGH0oqwbscLOoG46rAY6AOzRhY74PT6QuUKEN4PegXxd/yEDTT'.
+ 'YMWOk+oEaLkuFdNk0zTZwjfkavDUArXWgGXgFb4dEShXhfYqlI'.
+ 'ow3w9rg3B6ED60IOOA5oEYQBrcpG+mj9bg0VG8GMJhVDZLyzAo'.
+ 'VSq8rFYxXXefcjVgG9+uisDrXUCApoKSBcUHMBmHhfcgNwhtD3'.
+ 'q9IG6Lr15b4OUTmPwBJt8JqGuapp05o0mhoHnptLQfPsR+8IBK'.
+ 'uYyNH3yr+B77LHheA3tK1Ta+IrMeTL2C6Xl48TOsNWDDgAz7s5'.
+ '/r+krP/eddCsbj8fDQ4GBm9MqVvvRXX2VULBayRGRzaYn1SoWa'.
+ 'UjgB4PIB5QK4ZgBXBKaAHxQsrED1H7CRgCUPwgHZDqACmhWwXv'.
+ '2aDRqGYeRyufS169cvThQKV88PDuYbW1vJ5VRK+5euqxWlPMdX'.
+ 'SRqgreHbZGN3ijfKBXBTAeh2Fdwi2MofshP/dvKwCmKhp4m83Y'.
+ 'vj8Xg4l8tlCoXC0MTExMTFkZE/1m37wvLGRvKRacoD1209E7Fc'.
+ 'pZwYREOQqEJ4z3HskHLsz4AoXykPIBSN0t3dTTQafROoHdumXC'.
+ '4fjoMiog0ODiauX7+eLxQKV3O53ETdti88nJnJ3rl505ifmWm3'.
+ 'arWSodR8GNbycDoNHy5C5jFold1k8d+DyvELNwg93d18/vnn9P'.
+ 'X1oes6nufx/Plz7t+/fxhQKSWJRCI5NjaWHxkZKdj1+sjSwkJm'.
+ '+uZN/dZ337VqCwullGUVdZjsgIUC5LqhrUPvCugWuApeApPAzY'.
+ 'PKHWyaphGNRunt7WVwcBARwfM8Ojo6sCzrMKBhGLphGFEF2Wq1'.
+ '2jc7M5OZ/vHH0MPbt93awkJJmeZsC6ZaMK3DCwvWdNioQUb5B6'.
+ 'AdBR+9SzkAz/NwHIeXL18iIui6TjgcJplMMjY2th8wHo+Hh4aG'.
+ 'MsPDw6fddru7+Phxx51bt/RbN260qwsLpZhlFZsw9QJ+2Pbrga'.
+ 'oJG2FY2oKwuTtVEz9uV34NbqdtbW0xPT1NNBoF4MyZM1y5coWu'.
+ 'rq5dQBHRcrlc4tq1a/l8Pj9RMs38ndu3Ez//9JNXLRZNyuXZJk'.
+ 'xVYKoExQpsK/+IaAuYb7no8zjC/R+A4zisrq7u+53NZjl16tQ+'.
+ 'QIlEIslsNpuPRCJXZ2dnh2/duNFRW1oy07a96MKd575yxRqU1B'.
+ '5vPMpF5HHa1tYW9+7do7Ozc/eQpZTSQ6FQt1Lq8pMnT/5w7969'.
+ 'nuLcXE1rNufO9fRMhlKpOyvt9qPtVmvb25fFfvvWbrepVCqHwo'.
+ 'xaX19vff/996ZhGC8qlkW9Wt1Onz073fXxxz+6MB+9e9dUjuO+'.
+ '7ebq9wLdB9hoNCrr6+s/4wf3FCJW3fPmTZhXsNWCprjuW66Dfr'.
+ '928KAfBhJAEgiJSLuzs7OSTqctoFkqlZRt26j/I+L/AGjPTN4d'.
+ 'Nqn4AAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: ppl_orange.png
+ //==========================================================
+ $this->imgdata_large[1][0]= 2753 ;
+ $this->imgdata_large[1][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAYAAACM/rhtAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
+ 'B3RJTUUH0wMLFQ0VCkHCzQAACk5JREFUeJytmGtzG0d2hp8zNw'.
+ 'AEcRdJ6EJK9FL0CqZUm9jWbkwq3vhDstl8dmLvz8rP2H8Q75ZT'.
+ 'pkRfpLgqsS6WIFEKGYkiSBCDO+banQ8DUpRWEkklXQUUqlCDfv'.
+ 'rp857pgfAOQ4AMOJdg4R/hX96Hf06bvDc5iT07i8yeg8ksiIAI'.
+ '4TBi/ds9/vivD/njapNHvRBfHXMu410AM+BUoVSF05NQsi1sO4'.
+ '8402AXwLQTuP31OAZO2aG0MEn14iSlnI1z3LnMk8IZYJyBwjIs'.
+ '/TWsVIWPJkvMFS4zMfMhUp5BsoCpAAEBLYKaMFGn00jBxnvu02'.
+ '35+JHmSJEnBpQEcPo38MmCxd/nS9Ry71Ga/g1W9a8gn0GsHkgA'.
+ '6DGjxkqb5CoO+YxF3A3p+jGjQUzoK+L/V0ADzFMwtSR8eLbAr8'.
+ 'uXOTf9NzhTc0geSLUQcYHgYEH786RMg0zWJHV2Aitv4x/HpHVS'.
+ 'QA2YBqTTGIUq5qkPMWaWkVwPnPtAA/BevmZcjxaaUtHh8pJJGu'.
+ 'DpCB9FvT7A7YT7S3p5vFMNzmWo/O0MSx/Ms3TqI8r59zFTfUQe'.
+ 'I7SBODE3tnfoIxYnNHligwik0zAzDdVpyKbA8sff5YAeMEwgkV'.
+ 'cufQeTJzZoCsaFLKXPTnNpoUTNsSgJmNoGsuNQjIDwYD2HlnZy'.
+ 'k++yxTKXZfKTU8zOpjhneeQYkorSmGERtIlICBKRbLX+y98YN3'.
+ 'ADcNIm+bJD4U3pPnmbEaRgYVRTGBkDSSsmxKfY7ZLuDJA4hdjl'.
+ 'JEgyBB2SJOvQ9RzTpNKoEwNq0CNFvOXR3/HxMgYVPObaz8kPmh'.
+ 'hkEWMatAfRONGGvLizyOE9P8KkpwhPDAgQKJQbELUD0oOIhbbH'.
+ 'JeVTmowxjAgZutB5AoOngA+2DdYrcTyOyYZP9+QpBvI29vwEhb'.
+ 'It042BVQgDy9KTMfkwQG1A9ACCLlgBBGUwxxoc52WDh2ATyEPp'.
+ '1hoaPvrEBh0Dq5an9OUsl/9hylk5b5c+mowLc4E2Jtw4Eoljyf'.
+ 'ogA/AGEAagNRjGyUxOmEycyVA5EWDBxrmUp3ytLIv/NJP69Goh'.
+ '+9mFydIvS5PZYkvH1oY/RFtKymlwBFQAgQd+kAA6qSQ8pvn2mp'.
+ 'SkJkuVFHPHBnQMrEt5Sl+e4/Lvp51PF1PF5Xy6WMvOWZXMom8z'.
+ 'OZTQ8+j5sbQiMEwopsCIwRtBGIJSCdzbTGo9NimkDcgdC7Bg49'.
+ 'TG5n4/nfr0Si77WdYp1YzyZEkWPdteaEnB7pPqBTxuIf/VgciE'.
+ 'SgasCPwh+GNIkaNNag1RiPge5pEhMQVjfoLcF+eoXSvbKxedwn'.
+ 'LKzC3KWbOi5/sW5a44/SHFUSgVA7SCzRG0AvA9mPOgFIETgu4n'.
+ 'Ww0wNQWFAqRSL6D2ZQYBdDrQ7R7jXiwgRcvIL02makuTmWtpM/'.
+ '+BlLMl5vuWzLVEuwH6oYnR1KS8kJINGXMM2YdfRlALoQoQQKeb'.
+ 'bDVwoMdxQMaLCwLo96HZTF5HbrEhmOftianfZisfzueKv7ZmrX'.
+ 'MsjhxKXZGBjzyeEHmSE3oWiggtyVGmE8DTIXTC5NxgAxOAGUM8'.
+ 'fun9mnSSLQ/CxNzOTgJ3LIMgoGwkKBiiMyaVviHVkdCO4FEKNv'.
+ 'LQzWBYHfITPa4UBVM0LR/WB7ARJsdDDTjA6deYFIFUOimJ3d0E'.
+ 'sNdLavYYgBpthqKcjiiJRO8K6CK0CsJTjfQAGaJtD9vQFAxNNQ'.
+ '1FB0yBAfA8gdMAIagLoCVAen0M00zMOTYShNDtoHs9CAIUoI4E'.
+ '1IBihCdNhsMhsj6NuV7BCC2IBpBqQaaFOENCCeiEsO1BO4RQgy'.
+ 'I5Hm4k4oIU9MrgZSAdBeTabZz+ODxKQRRBFBJo6IUc51anYRQo'.
+ 'dto+24FNxYCiaWKkQsj00KkO4gxRRkAngJ868M0u3OkkM+hxQA'.
+ 'cQ7YD7GO5XYSsPZybh/TCkFIYY+kWniTW4Q7jXgHvHMhiRpmuW'.
+ 'ca08GZkkZ/nY6TZMNhCnf2CuPoDVJvxpB+q9BHA8Ag1uH+oP4c'.
+ 'YEPCzDwmzSLquShHW/E0YRbG/BjZtw40hAy7aNzJlzRn75E6N0'.
+ 'qiwTzafI7kOU3gWrhzZC2iHcbsPqLlxvJnCt4KC1RYAL3I5hzY'.
+ 'Xv/huePYCtITQMKEnyB4KQvMURuJvw889HGSwUCs7CwkLpo6tX'.
+ 'Ty/+7nel6VLGDn/8N9m+eZuo1UP8iNhLau6b3RfmOsHBGTUYw9'.
+ 'WBNeDrGB4+h/4qNLKwTnLbHj9CJw/6GoIh9Jpvq0HHcayFhYXi'.
+ 'l3/4w9LK8vLKexfma3G/mb/3n1njTivS7tNQaaU1grQDjJ868D'.
+ 'Axx6vmxnBrY9C9IcSbSXbavNjb/S3eN6/0m1JcKBScixcvllZW'.
+ 'Vi6uLC8v12q1v/M8b/HxVjP//YYr32yE4dYWvShO0ogi14xwxq'.
+ 'F4rbnxZ3cMjtpvEEeMvwA0TdOYn5/PffHFF7Vr166tvPeLXyx7'.
+ 'nrd4+/btyg/frFo//Xgncnd67qCn78earQqcmYD3fSi1wPCTSV'.
+ '3gzqvm9uFOMl5nUAqFQn5paal26dKla57vf7D+6FHph9VV88af'.
+ 'vgq79bo70e3VT2l9A3hYg4UiRALVHTCHSZvYBm4A//6quf8zoG'.
+ '3bpuM4acMwKr1+//SDe/dK31+/bv90/Xrcq9fduNW6rbVeC+E7'.
+ 'gWdD2DKg4UEpBmPcm10RuScida31ntb62HAigoigDw6Gh0axWH'.
+ 'QWFhZKi4uLZ+I4PrVer2e+u37dXPvqq6hbr7tOp1NXWq89h6/b'.
+ '8FBB34WGBesdcPrj38lkMkGlUuml0+mu53nR3t4eo9HoSLhMJk'.
+ 'OlUiGdTuN5Hq7rvgA0TdO4cOFC7vPPP6/VarXldqdTu7m2lrv7'.
+ '7beq++BBO263b/tKrfWSXlbvwJ6CuAtDgTYiaBFMw6BSqfDxxx'.
+ '+rarWqGo0GN2/eZGtrC6XenAkRoVKpcPXqVWZmZmg0Gty6desF'.
+ 'oIhIOp3Ol8vlmmVZK3fv3Lm09uc/Zwbr653ccPgoNIzvnmn99Z'.
+ '7W9QG46lAaM5mM2l95GIYUi0VOnz7N7OwsWmsymQzyuse5Q8Mw'.
+ 'DNLpNDMzM5w/f/7A6AGgUkoajYa9urpayOXzUz/fvZutr68Pim'.
+ 'F4/2y1+n2o9Q/ru7uPesPhXnyo4A+vfHp6mmazybNnz9jZ2UFr'.
+ 'TbPZJAhe+8/aS0Mphed5NBoNABqNBqPR6MWBVWstvu/nnj9/Pv'.
+ 'vo0aPq5uZmPBgM/qcwPf39xV/9ajU1M3Nvq9PZaw8GoT50PjdN'.
+ 'k6mpKa5cucL58+eJ45j19XWePHnCzs4OnudhmiaWZRGGIVH05r'.
+ 'yEYYjrumxubrKxsfFyDQJ6NBp1Pc+7C4jWumBaVm+kVL2l1H2l'.
+ '1G6otS+H6V6z8u3tbVzXpdFooJRicXGRqakptre3uXXr1ltrcT'.
+ 'Qa8ezZszemWAE9rfUdYBOwtVLRbrPZ+48ff+wDvuu6Sr3MB4Dr'.
+ 'uty6desgfa1WC3iRyrNnz4pSSmezWUzTfGtYtNYcdvC/9sMlgP'.
+ 'n5N4cAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // File: ppl_pink.png
+ //==========================================================
+ $this->imgdata_large[2][0]= 2779 ;
+ $this->imgdata_large[2][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAYAAACM/rhtAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
+ 'B3RJTUUH0wMLFQolY9lkpgAACmhJREFUeJy9mOtzFNl5h5+3b9'.
+ 'Mz0kzPBWmEVtIiWYhIiC0HCDhB8lb8ISk7nzdZ5+/zJ/8BTmpT'.
+ '660CZLwG1pVFgBkgGIHECEaa+/T9nHzQCCQuRpCNz6mp6g893U'.
+ '8/c37ve3qEjxiC4OA4n/Lp/EUu/tsMM/+aEWduVBx7WhdkShcY'.
+ 'xUH2zo0Dwod/5N6vf8V//PoGdx8M8EOFPtK9jI8BdHCcMuVSmf'.
+ 'LxHLmSZdm2U8xIbmKETDGDZZnIy4dBbCynyGhphurEDBOlHFnn'.
+ 'qPcyPxTOwDCOccw7w5nlBRZWylI+ny/mZ6rL1dzUZ5/IWGZU3D'.
+ 'ZIOMQDDaJcHDVGWUbJBi9odVr0QoVSPzigIEaZ8vgSS/8wZU3/'.
+ 'k1fylipz5dLM2WlrZqHKaGCKbEbontq3KAKWQyZfZKTgYqc9Bp'.
+ '2I2PcJ4ogk/UEBQcwipbFZmT13vDBx8fhnE1Ofnp9yJopFyT3X'.
+ 'yANfks0QHSQMDaL37pOxMLIu2UyVkjVKLjyKSeuD8dAYCFkso1'.
+ 'gYMaeWJ40T56cl8yAi/O4FSa2P6kYczIDsgVpAqcDImZPMuAB1'.
+ 'dkLQtcc8a/bwox8IUHAxZVxGZMouSLVYwKuMkD5IxN+JSdsRJB'.
+ 'pexuTVgYYM6EoGmxkmg3/hEhNUMr/hd7dqbOzExMn/GRDAxWZc'.
+ 'j3I8HiXfMjF2FQowKw7pjoN6E/Llw/GBJj8qxVOMlX4ipxc/lY'.
+ 'kl2zBLkmrTcEzMkoNoRLVidLi/9g+Z3I+1xRHX5EcAihxnbPRv'.
+ 'OTU9kZSmpKPy9FTGrLimPZ1H+UiyGaF67w6n7E1DwMngFDxGvc'.
+ 'w70v0xZUby5IxjlIyMssUJrJwVWkXBdbXvSvwEibcSdKCAFI16'.
+ '4/sc0SRo9cGAGq1DwvQFzV6DVuBiV4zYnlEts6A2TSPcSiXoxo'.
+ 'QqJCEEFMbQ2b69o5qMiOOPqIMQkagu/aSL7waE8101WFShLjk9'.
+ 'yxgEvjRUiyYd+gwAjY2J9VpXfZ/JEXLhDp3OR6U4T97+hEnPwx'.
+ 'tv4HsRjy2tTQSFzQgDUnwSLBQRI+x1ZgcH87Vcv4SF19Kt0ezS'.
+ '1h9s0Ma25pgr/YJfnLnEysok0+ezjM6EBLldGqKIJYuDRhOQEJ'.
+ 'Oih8X9Q0xmcXNjlCofBJgn78wxVz7L2YWf8tPPz1hnfjbjzfxN'.
+ 'qVwutq2etZXUQSXikcXGIgUiUkJSDIQMJgYGJsaB3c7b1qQ4GZ'.
+ 'xSkdGZIwMeNLfK6uezMnvJK3pLxeVixfvMsyVjSNSO6IV9adPG'.
+ 'AArkEEz8oUkFmBjYGO80qfd6pCWIayD59wIKcsjcKqufn7JO/S'.
+ 'xfyi+5c24pey5rZ09mJRNkiDdT/tzbkBr3SYkpMYpgEaIJSYhI'.
+ 'kSOY1GhilAQk5ntDIojxCZ/kf87Pl85xbuWEnLiUy+cW3NNuJX'.
+ 'MmY5meKf6mT7wZS+THdOjxlG06tIlIOMZxchSxcFFEGAwAGGME'.
+ 'jwyZYSnWL3cXWiIUbUI6hO/vxXuFOV84ycmlBWthNeflTjuzTi'.
+ 'lzJmM5s46Ej0J63/ZoPmoy6PYxtYVNhmfs0mbAND1mmKVMBY1L'.
+ 'mxA1LN7WgXQbCApNhKJHRIM+DQbv7yQGhjnJ5NgFuXBuxpu5mD'.
+ 'udm3LPuY7pmZLUE6L1SIJaIPFuDAqyw9lnwDYv6NFHkWJh4ZDB'.
+ 'wCBFD3uMxsTAwcBAiElpE/KcPg36dIiOvpsRxDCyhmlP2YY9ZU'.
+ 'v8NMb/1id+FGO0DTztkSXLOONUqeITsMkW2zwnJEIDFhYGx+A1'.
+ 'kwK4mASkvKDPc3p0iYhRRwYUhZLUTyV6Eu0t4s1Y4kcx6W6KaM'.
+ 'EZThcXH59RRhGEgIAddnBwNEBKqqpUtWBIF22YDIhJsbEkJqFN'.
+ 'qLtERHs7GnUkwISEQAf0uj30bY39PzbiC6qrDu2cExJ69Nhhhz'.
+ '59UlIUipCQOnVi4sjG7ubJBy6um0C+he/0iDHQKIQERYyKFLqr'.
+ 'SI/W6kJCnvOcrWSLSquC1/Jw9Ks3R0FQKHr0uMc9bnCDGjX69A'.
+ 'H0XlcJkibN5jOe/alCZStHbjJL9lSMLkXExvCXRiDV6GZEeGeX'.
+ '3TvvBVQoEjfBL/v0rT75Th7VU5C8gktI6NLlMY+5yU3WWGODDf'.
+ 'r098tHpNFNH7/2lKdXXdz7efLzVaqJIBOCmK8AJUlI6g0aV+9y'.
+ '9+p7AR3bMQpTBWPy7yeN6fy0jNwewfpvC9Xe+3kFoUuXe9zj5n'.
+ 'BusEGHjh6GIAGawC2FWuvSvbbF1maFylZAsC1ISZADBiVNSJrP'.
+ 'eX73MY//skHP85z5+fnSxQsXj//4n39cmnPn7LbZlsajBmEnBL'.
+ '1nuEGDG9x4aa5Ldz+h0RCuBqwBv1Wo+7vs9r7n++0MmYeAM+zB'.
+ '+61EK1QUEnbbtN+9Bh3Hsebn54u//PdfLq9eWl2ZnZ1dSnaSwu'.
+ 'Pin40b9g3doKE0WoNIl65xj3v75njd3BBubQi6ExKmDWkMRKSl'.
+ 'tSbVKQcMao1Go5Ugb0+x53nOyZMnSysrKydXLq1cWlxa/McgCB'.
+ 'Yev3hU+GPrD3I5/q94k3pXYQY58q6B5Bs0HB//neaGx00gyWaz'.
+ 'VCoV7bquCoKAnZ0dfN/f03egLGj0m3XQNE1jdnY2/+WXXy6trq'.
+ '6uzP3oR5eCIFi4detW5feXL1vr679Let37zVB3/mQytjXJwmSB'.
+ 'wikHp9ShY0RESqObwPrr5oBERKhUKly4cIFqtUq9XufmzZtsbW'.
+ '2hXvuDwTTNtxZq8TyvsLy8vLS4uLgahOHphw8elL69fNlc++qr'.
+ 'uFOrNXPddm1cczVL5f5P+Lv5MuOJgTGxwYbZpZsCdeAq8M1Bcw'.
+ 'CGYeC6LtVqlRMnTjAyMkKn0yGXyx0N0LZt03Ec1zCMSrfXO37v'.
+ 'zp3S769csb+/ciXt1mrNdHf3ltZ6Lca8ZpJsduhtCdb2gEFJoQ'.
+ 'xADYHuHDS3f32lFEEQUK/XGRkZoVAocP78eZaXl9FaI/Jq25Uk'.
+ 'yWHAYrHozM/PlxYWFibTND32sFbLXrtyxVz76qukXas1M61WTW'.
+ 'm99gx+20TdN9jqtfjP7QzOwwYNp037Zd0DukDnIByA1pqdnR2+'.
+ '++472u02Z8+eZWJiAsMwDsEBRNGBzYJpmsaJEyfyX3zxxdLS0t'.
+ 'KlVqu1dP3q1cLta9ekU6u1dat1J9b6Sk9kraV1rYXegW7apDYw'.
+ 'kFY6fPc4MNTw88bwfZ/NzU2UUnieRxAEiAiGcXiXfcigiIjruo'.
+ 'VyubxkWdbK7fX1xWvffFMInjzBM82uMT5+p++6V1UUrSe7u03t'.
+ '+8lezlKt3gHyl0aSJDQaDa5fv876+vo+w6FzDq1BpZRsb2/bly'.
+ '9f9vL5/Njdu3fzG0+eMJHNxsfn532vXN5NPG/7abPZal6/Hvfe'.
+ 'kroPHfsm98f7AHW9Xo+//vrrlmVZm71+37QNw3JnZ9PK4uJGpV'.
+ 'pt4Dh+vLGhsrmcfv1iHzu01m89HjIdCon2fb8TBMHtvYeRUn50'.
+ '1Oj4vqp3Ok1f5LYSadfr9dQfDN642P/XeF2DA+SBAuA4jkOhUK'.
+ 'BQKESO43S11p3BYBDt7u4y+CtB/i/q7jp1GMiw2AAAAABJRU5E'.
+ 'rkJggg==' ;
+
+ //==========================================================
+ // File: ppl_blue.png
+ //==========================================================
+ $this->imgdata_large[3][0]= 2284 ;
+ $this->imgdata_large[3][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAYAAACM/rhtAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
+ 'B3RJTUUH0wMLFRAiTZAL3gAACHlJREFUeJy9mGtv29YZgJ9zKF'.
+ 'F3y/Q9jh05tuQkarKgbYasde0UBdZgwNou/Vqga/sD9mP2B4a1'.
+ 'BbZ9atFPxb5sqOtmXbI19bqsluPYiR3HN90vFEWRZx/IJI5zqa'.
+ 'x0OwBBSgR5Hj7v+55zSEFXTUgIJyA9C6/9RsjMjAyFIxxJCDc7'.
+ 'iBqKgyZACGg3G2x9+xXf/fG33P3mC9qNKsp1O+1JdkEnQTdgIO'.
+ 'ttCSMUi8gj072MnugllAyB9G8rBGi6RsToJTF6iuRoFi1kHKZf'.
+ '7fB8Iggj0/Dy23D2dakNTR3JDsXPvzstxmZGRMER1EwHhQAEgE'.
+ 'CLhIkPD6InY9S3djGLJVBtQP1Qb4HDAyoJYQOOZkPx49nhTH9i'.
+ '7MUBGT7egxkJgd70wZS/CUkoZtA/fRoE1DZ2ACiv52ibReCp4e'.
+ '7CIEHomxDiuVdGTqUnf/ZeOjR8fpiVXZul5ZrY3bWwbdcLr/dA'.
+ 'AAIpAwQjUWIjQ+g9HZvswiCgBVF9/SI6OSLGzo0i+oLi6+Utbq'.
+ '+bKEftgwOE/0Ohocf66M+cBjo22U2RQLIHMhmYnvaOpR9S8bSU'.
+ 'UqCURGpRkuMZMm9cIvPGJZLj0yBjT2LprkiSkykx9cuXIhOnUs'.
+ 'm+QNC2XdG02ggBTcvFabsPWwTPpBAChSCgh4kYBpoeplWp47Qs'.
+ '7EYDt21xINzd5GCAxLExRl89Z+nHjpbKMmjbmkgfDzI0JEW53K'.
+ 'Jaa6NcAOEX8v52uJzsBlAS6u0hcnTIccPRqhWPCUcLD+s1EaUp'.
+ 'HCEhEMCyHNpt9SjgIU12A6iw6xb123vYhaaKjB9tlgMD5X+uBp'.
+ 'zdkpg6azA8EaNQtKlVba+Xez4eCntnJrsDdFsW5nYFpxlFN846'.
+ 'DXe8utkM4mhi+EgQmjYbS2WqexZKk6BpjwJ2YlK5VjeA3pNDiH'.
+ 'YjRWPzPE7tmBo8EWwGhkXx+z3uXL7D3rU97LIF8RBEAl6lK/Uo'.
+ '6JNM1rZ2aTcr3eUgIQOGTgbdwXMGyRejenLYTvQGbAdRuetSud'.
+ 'OivVuFZgtCEgICghICnZoMhmlVTPR49LCAEkQUhk/B7KXe0MWf'.
+ 'nxj8xVR/cDheK14WZmtVMJSBnlGoN6FmQq0FLfdwJgORKPHRo/'.
+ 'Snzx4G0F/FjJ4KiOdmjPCrrx8bffnMybMv9MQGNG3rzlVqtR1B'.
+ 'sh/CYXCD4Aag1oCW7ZnUOjSp6WFi/QNEB8Y7BfTNjZyCmUvJ0I'.
+ 'XXT47MTp98Ybon9VZCk8cVazfqlNargsY34G7ByAlIjkHd9CCr'.
+ 'LbBdiHViUgiECuDKYCdz8b2cywREdiYZOj8zNnLuzOTzx6ODp+'.
+ 'OaGaqwVzBFqz0Idhz2loE7YEwBLaAJLQcKbW8qjAcBF5Jh0AMP'.
+ 'IOHe6kxgtb3UMO2OxkF//ffK28nQqxfvm3szrtnDVa799Qb/+v'.
+ 'NtsbNSpm3tAv8B+w7Ub0FhAyoBcMPec9oK6raXk48ziQBXQcmC'.
+ 'pT3YqHa0mpEBkTR6wz/Jjo2cy04+fzwxdDquNfQKO7sFUbpu0c'.
+ 'wp3JoAYsA42Bbkl4GCryUNDEM7Avm6Z/CgSYBWG8pNuFuDu1Wo'.
+ 'tjoxKIJGeHIiM/jmK9NnX5ycuJQMtUcqXPvLDTa+qIie4hAJ1U'.
+ 'vdrmO2HaDfB931twJgAn1A4lGT96obPHPLBbhVgUoTHHWo9aAA'.
+ 'JVAKpyKEmQNzWRENAsL18ycKjAFN/9gCNvzLB/390MMmE7pnDi'.
+ 'Bvwt0K5Jv3O+0oB22nJ1Vvjb/UMhOpcKknqN1OiMB2DNHU2G5s'.
+ 'sVndpGJVcZXjX1IAlvw9PmhRQcOFPhsSDkiBrQR1G7brgs0a7D'.
+ 'ag3FK4rguqBXarI4Nt1SJv5gls7TEWtJDRBO2GwnIs8maevFnA'.
+ 'Gx6awLZvzeTBu4kFbLigijC47pscpx0xyDfkvtUEnlarCDtrUC'.
+ 't2HGIhvPHVdVwqjTIrxRU2a5uUrYoP0QZ2gMvACl7+3V/LuKDq'.
+ 'sJuDy597516+CEezIHXv7vcgXQu2l+Bvn8He9Y4AE4kgk5P9DE'.
+ 'R6aFdq5Et5Nit3yTf3m9sBcsAN3+D98c0Fit5JawE25r1zg1Fo'.
+ '5B8GFD7g+nVYnu8EUEop9XTa0N/9dUbqcphP/rDJzbUClVbpgR'.
+ 'y2fXM3fND95qj75J8AC6BWPINfVSBieK+x+6cS5UCzCLu3oFV9'.
+ 'GqCMx2NGOp2Znpv7aXZudsool3T5J/179sxVlHJ4kGPrP2COBX'.
+ '/7DmiApWCjxIMXpYNznYuXM+6TAKWUMppOZzLvv//ery5cuDCT'.
+ 'SqVS336bCwr1JfAPB9r+2KAFwJS+OcETzZHz/7v3etl6ipz77X'.
+ 'GAMh6PG+l0OjM3NzczOzs3k0pNnFlbW43+e/GKtMqrblSsF03V'.
+ 'WHcJA0PjIAzvg9JTze2H67g9DjAwOTmZ+uCDD96anZ2dnZiYmF'.
+ '5dW41++Lvfa1fnr7qllVK9103mXNTnJgPA+YugsvB3HTaEl+Qs'.
+ 'AZ/yeHPPDCiTyaRx5syZbGoilV1dW00szC9oV+avusuLy0Xd0X'.
+ 'MgFkDM+zkYBZEHV8f7wwKu84zmngQoNU0LaZoWUa4K31y5qX/8'.
+ '4cfyyvwVN5/L10NOKNeg8UmDxoKF5Vfj1xXAgD0JrgAcvBDfel'.
+ 'a4g4AykUgY6XR6emJiIru2ttZXq9S0K19eUcuLy8WQE8o5OAsN'.
+ 'Ggsmpl+NpoL1g9X4UBU+C9xDgEKIwNTUVOqdd955M9mbnJ3/cj'.
+ '6Vu5aTheXCQXNdVeMzAwJSCGEA2XKpnF1cXIzlFnOVhJPIKdR+'.
+ 'c88ctq4AlVKsrKzw0UcfKcC5uXqzXnNqSzb2pwLxOHP/l7Z/BN'.
+ 'eB01LKt4HTrusKvGr8jB+hGn8MQAkYQMrfw4Nq/MFPtf+rdvDb'.
+ 'k8QL+/5Z4Uepxm7bfwHuTAVUWpWaqAAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: ppl_green.png
+ //==========================================================
+ $this->imgdata_large[4][0]= 2854 ;
+ $this->imgdata_large[4][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAYAAACM/rhtAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
+ 'B3RJTUUH0wMLFQ4hANhluwAACrNJREFUeJytmF1zE1eagJ+3u9'.
+ 'XdkvUty2AbmLEtEzDBgZ0UpDBOalNTUzU3czl7tct/2n+wt3M/'.
+ 'NVM12SSTQQSyW2TA+QAJQogtYYFtyfrqL3WfvWj5g8AEjzfvhS'.
+ 'SXjk8//Zz3Pf3qCMcJAWxMKlT4kH+jwu/FknnJSUItKFHzCrKA'.
+ 'BggBQx5ziz/wn/yBz3hED4/oaJfSjgVoYjJJgTLTZCjohp7IGT'.
+ 'k5aZ4kb+bRTR30Q7djj8f/kpPMUSCFedRL6W8e8qMQNE6S4xpv'.
+ 'c5HrTPFubiJ3ZnlyOXV59rJYU5Z00h1c3d0brxAiUkScRijisk'.
+ '6XLTyiN3s8HuAJpniXa/q8/pt8Or+0kF8oXJm5YiydWcIpOrJu'.
+ 'rjOQwd54AQwsMpTJYhPSoYuLQ58An/DnBQSdImXO8avsTPbqpc'.
+ 'lLp67OXDVzMznZLGxSs2qyIRu4at8gKHQEC50kE1icxqCAdxST'.
+ 'xjEA44tqaJlERl8uLWvvnX5PHuQfcCdxh5qq0aX76vj4WgWyXO'.
+ 'QiNgBP8IAaddr08X8+wHFmJSQhBbPAZGoSZSt5wQs6qoNC7UEd'.
+ '4AEoLIQSCaCCy78Dv8Tiv1hjjW1CRj8XIAgEKqDtt9keboMJZa'.
+ 'vMjuzQVd3Xr9prTJo+GF/jKZea95R25Lxs8jg5qFGiwDnOS0mW'.
+ 'NE0rjNRIt3WbklUCA9mV3Zdz8OBT/JfCQLB0SKYVVjGFYSfx/E'.
+ '26ow4e6uDujlPFQpE0FU6P8qNTHdXJdEdda0qf0itWBVM3pa/3'.
+ 'ccUlIECJet0cAJoeYk5EZCeS5IwEoerSxccJBwRqFFf38QCTaO'.
+ 'TRVFKJm3NTbtLNSyh2IkhIXsvLCesEGNCWdmwyruSD/z9kUlRc'.
+ '3bqNlSxhJNJ43p5JITrOEis8Qtr0cXEpU/JT/pmO18n2vb42pU'.
+ '3JnDnHMBqyPlpnoAaxhr2llv1ZUBqEGlqYwDQMsskMOcMgVL3Y'.
+ 'ZOQTHAcQQiIGjHCwCaiovjrv4hbcpKuJJjIcDHm685RGr4GLCx'.
+ 'YHkAcrLoAoDSLBiAQrMkjqybHJCbxgh+7xAC1MpsgzwRwD3qHL'.
+ 'WyTIBdlAa6u2rHfXaew06PV78ZZjAwleNnkolECoH5i090wOcY'.
+ '+TgwYzFHiPi1zkOkXexeAMASnVU+LiyiA1wFUuaqggACLizeWw'.
+ 'ycMzyssmVYKkbpGyC5T+OUALk2mKLHKWf+ED/az+YW42d66YL+'.
+ 'aNrmEEzQCFEnKw368EgEvcN1m80eTIQIt0TFOjMJHkzNEBBYPp'.
+ 'sblf8QHzrORO5JaWZ5ZLl6cuJyyxpNPv4PZdoT+GyIxBfI5uUg'.
+ 'eJMCwP2/bIHO1JEudcgUUWOceKNq99mCvnzs5PzRcuTV4y5mRO'.
+ 'SMIjo47z5S7a94oQCNKgJsZwO7D/IDNg3/LLhRNXt4JohBb4aG'.
+ '82GLdXcf93mQ+Y43r2RHZp+cRy6cqJK4l8MS+tdItaqiYtc0Mm'.
+ 'QpfJARh98HYh9IiXVcaAo58wGb+LBAjbSPgCOcoSa0wzxXtc08'.
+ '/pv8mfyL+9MLVQvDJ1JVHJV6SZbFI1qtTsB+KlehRtRTGE8Afo'.
+ 'P4DRcAxiEudhAHjjzz+ubgX4oHowakHQOlqzICQwyVPITGVOXi'.
+ 'xfLF6aumzmczl5lHzMff2+fCdPaGttEkXoLQAO9B7C6EugPYby'.
+ 'gVPjGXc5eIbNAJPjGwiAbaAJUQv8wVG7GROkJFpyOqn/ovgLba'.
+ '44L0+sDaraXb6jzq7aBQWjBOyUoHcaopOgmaA3IRyNDZnA1HjO'.
+ 'HSBkr7eEFDAEngHrQCf+/s2A8cSiSkqcKUeeTjwFy2Jd78t3+L'.
+ 'TR4itIiBLwLQhzkJyB5Cx4HXDaENVQCBAQcRqFIHTRaBIvuYXg'.
+ 'AdsouuNxEL0ZUBHnSQp66R73zYfUtQ6OytKT8RckQAJQoLtgO5'.
+ 'BJgj0D/WfgdyHaAHx8THoUcbGx8ciwhUl3bDEiToURPooeI7pH'.
+ 'MziK9Yd9nU5a6GgKjOH41vsgI4hAcyC5AZkapF+AoYNrjjsuhx'.
+ 'FbtPmeB5ykyQQzTPAWAQWC8S9oAI0QRRuPb9jkmyMZNAOTklvC'.
+ 'GGYZaFkGmkVAh8h4DtKFMIBunG+pB5B5AIkGBDsQ+qBiL20caj'.
+ 'zhJknq5KlgMkLjJHJos4kYEbFJi5vc5eYbATVN02bNWe19+32t'.
+ 'aJWlFm3wbf8Rz5NbDFJdlOFBF/g7cBf0JkrbBb+F6j1DOduEkU'.
+ '8bWCOiSofPWadBnSZDWmgUkEMGhZCINut8S/0NBtPptFlZrBSu'.
+ 'vnt1+ndnflfIp9OJ/279Ubbbd+lP7KBKPoEBsgnqLph/BRzwdS'.
+ 'LnBUFvHcfdpRsGPAGqwMco6jynz+e0SPKYCHMfLX5VKHwcenR+'.
+ 'Igd1XTcqlUr+xn/cePv91fevzy8sLO2OtrOpWkqL7gXKSAVRdh'.
+ 'ZFEmEXoYkwBNqovoc/3GHH3aUR+jwC1oD/AWrANi4hGwyBzqEG'.
+ 'Vvb77Dgi0eT1VZzJZMxKpVJYXV1dXF1dXVm6sPSvruue3Xzcyj'.
+ '6/syvDzwj0lNazK6Fj5LFCRZouZpBABj6jXouu3+Np6HNvDHaf'.
+ 'g91t74msbMuOJicnSSaTKKUQEUQEpRSO69But1/dB0VEm5uby9'.
+ 'y4cWNpdXX1+sLCworrume//PuXpeqnVeOban0U1PW2kcx+O9L7'.
+ 'Te9sUB4lWFR9SqNtNGcHx+/RDD2+Am4D94CnQA8OjjlEhMnyJC'.
+ 'srK8zOzu7BiYioMAzZ2Njg9u3brwIqpSSXy2WXl5eXLly4sOo4'.
+ 'zoV6vV6oflrVP/7Tx8Hmw1Zb6ydqmpWp7ha8h4O3gjOhzVANmF'.
+ 'XPMNQWvdDnCXCXuHR+APqH4fbCtm2mp6eZn59H13WJuYXRaKSU'.
+ 'UiSTyVcBdV3XDcOwRaTU7/en19bWCn/79G+JL/76RbhZ22y7u+'.
+ '6ahl71nPDz/nO17m7wAxlabFOihy4+DvAcqAMbPzZ3OFzX5dmz'.
+ 'Z2iahoiosUUVhiGNRgPHcV4GzGQy5uLiYuH8+fMzo9FoslarJW'.
+ '9+elP75E+fBJu1zY7qqpqBUW3T/niohnVvy+1zm5aVtp+WE2XT'.
+ 'nrHFzbjh1tYLz3XdPjD4R3BKKba2tqhWq4dzUO3noBPn4H5PKy'.
+ 'LaO++8U7hx48byhQsXVne7u6tf3/v64t3P7mbq9+odt+OuaWi3'.
+ 'PLxbW2ytubjbQCgiMnt6VlaurWgz0zM0m02q1WrUaDSUUuqI56'.
+ 'ivDxE5MCgiYllWtlwuL5mmufLV/a/O/uXPf9Ff1F+80Lv6Yx29'.
+ '2qHzyZBh3cdvc7gaTZuZkzPh/Py8ACqVSv1/uPZDKXUAGEWRtF'.
+ 'qtxEcffZTL5XLF+2v39fqjeivshA/TpP83JLwzYFBzcA4370Cc'.
+ 'S81nTRBUs9lkOByi1GuOPI4Rh3+26JZlnSkWi781DOPXvV4v3+'.
+ '/2G0R8kSBxB/jew+tERK+c49m2TblcxrZtXNfl+fPneJ6HZVmU'.
+ 'y2VJJpNyaJ9TSinlOA5bW1u4rntkQA0oAG8D54gb9W3ianxM3A'.
+ 'e/cn73U3Hq1Cm5du2aPjs7a+ztcSIShmE4ajQa6tatWzQajZ+0'.
+ 'fbiKI+It4SvijVUj7kL2qvGfgkskEqTTaZmcnDROnTplJhIJTU'.
+ 'QiwPd9P/Q8T6XTaQzDIAiCfzjP/wFVfszuFqdHXgAAAABJRU5E'.
+ 'rkJggg==' ;
+
+
+ //==========================================================
+ // File: pp_red.png
+ //==========================================================
+ $this->imgdata_small[0][0]= 384 ;
+ $this->imgdata_small[0][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAYAAACNiR0NAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsSAAALEgHS3X78AAAA'.
+ 'B3RJTUUH0wMJFhouFobZrQAAAQ1JREFUeJyV1dFtwyAQBuD/og'.
+ 'xQdYxa8gRY6hJ0jK6QdohMkTEuE5wUj5ERen05IoLvID7Jkn2G'.
+ 'j8MgTMyMXqRlUQBYq9ydmaL2h1cwqD7l30t+L1iwlbYFRegY7I'.
+ 'SHjkEifGg4ww3aBa/l4+9AhxWWr/dLhEunXUGHq6yGniw3QkOw'.
+ '3jJ7UBd82n/VVAlAtvsfp98lAj2sAJOhU4AeQ7DC1ubVBODWDJ'.
+ 'TtCsEWa6u5M1NeFs1NzgdtuhHGtj+9Q2IDppQUAL6Cyrlz0gDN'.
+ 'ohSMiJCt861672EiAhEhESG3woJ9V9OKTkwRKbdqz4cHmFLSFg'.
+ 's69+LvAZKdeZ/n89uLnd2g0S+gjd5g8zzjH5Y/eLLi+NPEAAAA'.
+ 'AElFTkSuQmCC' ;
+
+ //==========================================================
+ // File: pp_orange.png
+ //==========================================================
+ $this->imgdata_small[1][0]= 403 ;
+ $this->imgdata_small[1][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAYAAACNiR0NAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsSAAALEgHS3X78AAAA'.
+ 'B3RJTUUH0wMJFhwAnApz5AAAASBJREFUeJyN1dFthDAMBuDf7S'.
+ '3BCm2VCRKpS4QxbhikW6IewzcBqm6Fm6JyH7iEEByCn5AJH38g'.
+ 'BBIRHNUzBAWAGNfe/SrUGv92CtNt309BrfFdMGPjvt9CD8Fyml'.
+ 'ZZaDchRgA/59FDMD18pvNoNyHxMnUmgLmPHoJ+CqqfMaNAH22C'.
+ 'fgqKRwR+GRpxGjXBEiuXDBWQhTK3plxijyWWvtKVS5KNG1xM8I'.
+ 'OBr7geV1WupDqpmTAPKjCqLhxk/z0PImQmjKrAuI6vMXlhFroD'.
+ 'vfdqITXWqg2YMSJEAFcReoag6UXU2DzPG8w5t09YYsAyLWvHrL'.
+ 'HUy6D3XmvMAAhAay8kAJpBosX4vt0G4+4Jam6s6Rz1fgFG0ncA'.
+ 'f3XfOQcA+Acv5IUSdQw9hgAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: pp_pink.png
+ //==========================================================
+ $this->imgdata_small[2][0]= 419 ;
+ $this->imgdata_small[2][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAYAAACNiR0NAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsSAAALEgHS3X78AAAA'.
+ 'B3RJTUUH0wMJFhsQzvz1RwAAATBJREFUeJyd1MFthDAQheF/oi'.
+ 'gF+JYWQKICkCJRA1vGtrDbxFbhGvY0HVjCLeS2BeTiHFgTB2wg'.
+ 'eRISstCnmcG2qCpbuXf3ADBQzWsPfZfS9y9HsEu4/Fo33Wf4Fx'.
+ 'gxL3a1XkI3wbTNXHLoboVeLFUYDqObYBy+Fw/Uh9DdCmtOwIjF'.
+ 'YvG76CZoOhNGRmpO8zz30CJoOhMAqlDxFzQLppgXj2XaNlP7FF'.
+ 'GLL7ccMYCBgZERgCvXLBrfi2DEclmiKZwFY4tp6sW26bVfnede'.
+ 'e5Hc5dC2bUgrXGKqWrwcXnNYDjmCrcCIiQgDcFYV05kQ8SXmnB'.
+ 'NgPiVN06wrTDGAhz5EWY/FOccTk+cTnHM/YNu2YYllgFxCWuUM'.
+ 'ikzGx+2Gc+4N+CoJW8n+5a2UKm2aBoBvGA6L7wfl8aoAAAAASU'.
+ 'VORK5CYII=' ;
+
+
+ //==========================================================
+ // File: pp_blue.png
+ //==========================================================
+ $this->imgdata_small[3][0]= 883 ;
+ $this->imgdata_small[3][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAMAAAC6V+0/AAACi1'.
+ 'BMVEX///8AAAAAADMAAGYAAJkAAMwAAP8zAAAzADMzAGYzAJkz'.
+ 'AMwzAP9mAABmADNmAGZmAJlmAMxmAP+ZAACZADOZAGaZAJmZAM'.
+ 'yZAP/MAADMADPMAGbMAJnMAMzMAP//AAD/ADP/AGb/AJn/AMz/'.
+ 'AP8AMwAAMzMAM2YAM5kAM8wAM/8zMwAzMzMzM2YzM5kzM8wzM/'.
+ '9mMwBmMzNmM2ZmM5lmM8xmM/+ZMwCZMzOZM2aZM5mZM8yZM//M'.
+ 'MwDMMzPMM2bMM5nMM8zMM///MwD/MzP/M2b/M5n/M8z/M/8AZg'.
+ 'AAZjMAZmYAZpkAZswAZv8zZgAzZjMzZmYzZpkzZswzZv9mZgBm'.
+ 'ZjNmZmZmZplmZsxmZv+ZZgCZZjOZZmaZZpmZZsyZZv/MZgDMZj'.
+ 'PMZmbMZpnMZszMZv//ZgD/ZjP/Zmb/Zpn/Zsz/Zv8AmQAAmTMA'.
+ 'mWYAmZkAmcwAmf8zmQAzmTMzmWYzmZkzmcwzmf9mmQBmmTNmmW'.
+ 'ZmmZlmmcxmmf+ZmQCZmTOZmWaZmZmZmcyZmf/MmQDMmTPMmWbM'.
+ 'mZnMmczMmf//mQD/mTP/mWb/mZn/mcz/mf8AzAAAzDMAzGYAzJ'.
+ 'kAzMwAzP8zzAAzzDMzzGYzzJkzzMwzzP9mzABmzDNmzGZmzJlm'.
+ 'zMxmzP+ZzACZzDOZzGaZzJmZzMyZzP/MzADMzDPMzGbMzJnMzM'.
+ 'zMzP//zAD/zDP/zGb/zJn/zMz/zP8A/wAA/zMA/2YA/5kA/8wA'.
+ '//8z/wAz/zMz/2Yz/5kz/8wz//9m/wBm/zNm/2Zm/5lm/8xm//'.
+ '+Z/wCZ/zOZ/2aZ/5mZ/8yZ///M/wDM/zPM/2bM/5nM/8zM////'.
+ '/wD//zP//2b//5n//8z///9jJVUgAAAAAXRSTlMAQObYZgAAAA'.
+ 'FiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElN'.
+ 'RQfTAwkWGTNerea3AAAAYUlEQVR4nHXNwQ3AIAxDUUfyoROxRZ'.
+ 'icARin0EBTIP3Hp1gBRqSqYo0seqjZpnngojlWBir5+b8o06lM'.
+ 'ha5uFKEpDZulV8l52axhVzqaCdxQp32qVSSwC1wN3fYiw7b76w'.
+ 'bN4SMue4/KbwAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: pp_green.png
+ //==========================================================
+ $this->imgdata_small[4][0]= 447 ;
+ $this->imgdata_small[4][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAAUCAYAAACNiR0NAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsSAAALEgHS3X78AAAA'.
+ 'B3RJTUUH0wMJFhkLdq9eKQAAAUxJREFUeJyN1LFVwzAQxvH/8f'.
+ 'IeDS0FLKABlN6eIwPYAzCHB0gWYI2jj+i1ABUTQN4TRSQ7iiWZ'.
+ 'qxLn9Mt9ydmiqrSq930AYFiu6YdKrf/hP1gYQn6960PxwBaYMG'.
+ 'E9UA3dBFtVQjdBOQmBakLennK0CapRwbZRZ3N0O/IeEsqp3HKL'.
+ 'Smtt5pUZgTPg4gdDud+6xoS97wM2rsxxmRSoTgoVcMZsXJkBho'.
+ 'SmKqCuOuEtls6nmGMFPTUmxBKx/MeyNfQGLoOOiC2ddsxb1Kzv'.
+ 'ZzUqu5IXbGDvBJf+hDisi77qFSuhq7Xpuu66TyJLRGbsXVUPxV'.
+ 'SxsgkzDMt0mKT3/RcjL8C5hHnvJToXY0xYRZ4xnVKsV/S+a8YA'.
+ 'AvCb3s9g13UhYj+TTo93B3fApRV1FVlEAD6H42DjN9/WvzDYuJ'.
+ 'dL5b1/ji+/IX8EGWP4AwRii8PdFHTqAAAAAElFTkSuQmCC' ;
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_squares.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_squares.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_squares.inc.php 2007-03-23 15:12:08.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_squares.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,149 +1,149 @@
'imgdata');
-
- var $colors = array('bluegreen','blue','green',
- 'lightblue','orange','purple','red','yellow');
- var $index = array('bluegreen' =>2,'blue'=>5,'green'=>6,
- 'lightblue'=>0,'orange'=>7,'purple'=>4,'red'=>3,'yellow'=>1);
- var $maxidx = 7 ;
- var $imgdata ;
+ protected $name = 'Squares';
+ protected $an = array(MARK_IMG_SQUARE =>'imgdata');
+
+ protected $colors = array('bluegreen','blue','green',
+ 'lightblue','orange','purple','red','yellow');
+ protected $index = array('bluegreen' =>2,'blue'=>5,'green'=>6,
+ 'lightblue'=>0,'orange'=>7,'purple'=>4,'red'=>3,'yellow'=>1);
+ protected $maxidx = 7 ;
+ protected $imgdata ;
function ImgData_Squares () {
-//==========================================================
-//sq_lblue.png
-//==========================================================
- $this->imgdata[0][0]= 362 ;
- $this->imgdata[0][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAIAAADZrBkAAAAABm'.
- 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
- 'B3RJTUUH0wMLFgojiPx/ygAAAPdJREFUeNpj/P377+kzHx89/c'.
- 'VAHNBQ5VBX52HavPWWjg6nnDQbkXoUFTnnL7zD9PPXrz17HxCj'.
- 'E6Jn6fL7H7/+ZWJgYCBGJ7IeBgYGJogofp1oehDa8OjE1IOiDa'.
- 'tOrHoYGBhY0NwD0enirMDAwMDFxYRVD7ptyDrNTAU0NXix6sGu'.
- 'jYGBgZOT9e/f/0xMjFyczFgVsGAKCfBza2kKzpl3hIuT1c9Xb/'.
- 'PW58/foKchJqx6tmy98vbjj8cvPm/afMnXW1JShA2fNmQ9EBFc'.
- 'Opnw6MGjkwm/Hlw6mQjqwaqTiRg9mDoZv//4M2/+UYJ64EBWgj'.
- 'cm2hwA8l24oNDl+DMAAAAASUVORK5CYII=' ;
-
-//==========================================================
-//sq_yellow.png
-//==========================================================
- $this->imgdata[1][0]= 338 ;
- $this->imgdata[1][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAWl'.
- 'BMVEX////+/+H+/9/9/9v8/8P8/8H8/7v8/7n6/4P5/335/3n5'.
- '/3X4/1f4/1P3/031/w30/wn0/wPt+ADp9ADm8ADk7gDc5gDa5A'.
- 'DL1ADFzgCwuACqsgClrABzeAC9M0MzAAAAAWJLR0QAiAUdSAAA'.
- 'AAlwSFlzAAALEgAACxIB0t1+/AAAAAd0SU1FB9MDCxYEDlOgDj'.
- 'EAAAB+SURBVHjaVcpbCsQgDEDRGERGKopjDa2a/W9zfLWj9/Nw'.
- 'Ac21ZRBOtZlRN9ApzSYFaDUj79KIorRDbJNO9bN/GUSh2ZRJFJ'.
- 'S18iorURBiyksO8buT0zkfYaUqzI91ckfhWhoGXTLzsDjI68Sz'.
- 'pGMjrzPzauA/iXk1AtykmvgBC8UcWUdc9HkAAAAASUVORK5CYI'.
- 'I=' ;
-
-//==========================================================
-//sq_blgr.png
-//==========================================================
- $this->imgdata[2][0]= 347 ;
- $this->imgdata[2][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAZl'.
- 'BMVEX////0+vv0+vrz+fry+frv+Png7e/d7e/a6+zY6+250tSz'.
- '0tSyztCtztGM0NWIz9SDzdNfsLVcrrRZrbJOp61MpqtIr7dHn6'.
- 'RErrZArLQ6q7M2g4kygYcsp68npa4ctr8QZ20JnqepKsl4AAAA'.
- 'AWJLR0QAiAUdSAAAAAlwSFlzAAALEgAACxIB0t1+/AAAAAd0SU'.
- '1FB9MDCxYEByp8tpUAAAB7SURBVHjaVcjRFoIgDADQWZpWJpjY'.
- 'MsnG//9kzIFn3McLzfArDA3MndFjrhvgfDHFBEB9pt0CVzwrY3'.
- 'n2yicjhY4vTSp0nbXtN+hCV53SHDWe61dZY+/9463r2XuifHAM'.
- '0SoH+6xEcovUlCfefeFSIwfTTQ3fB+pi4lV/bTIgvmaA7a0AAA'.
- 'AASUVORK5CYII=' ;
-
-//==========================================================
-//sq_red.png
-//==========================================================
- $this->imgdata[3][0]= 324 ;
- $this->imgdata[3][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAXV'.
- 'BMVEX////++Pn99/j99ff99fb98/X98/T98PL55uj43+P24+bw'.
- 'kKPvjaHviJ3teJHpxMnoL2Pjs73WW3rWNljVWXnUVnbUK1DTJk'.
- '3SUHPOBz/KQmmxPVmuOFasNFOeIkWVka/fAAAAAWJLR0QAiAUd'.
- 'SAAAAAlwSFlzAAALEgAACxIB0t1+/AAAAAd0SU1FB9MDCxYEHd'.
- 'ceT+8AAABtSURBVHjaVchbAkMwEAXQq6i3VrQiQfa/zDYTw8z5'.
- 'PCjGt9JVWFt1XWPh1fWNdfDy+tq6WPfRUPENNKnSnXNWPB4uv2'.
- 'b54nSZ8jHrMtOxvWZZZtpD4KP6xLkO9/AhzhaCOMhJh68cOjzV'.
- '/K/4Ac2cG+nBcaRuAAAAAElFTkSuQmCC' ;
-
-//==========================================================
-//sq_pink.png
-//==========================================================
- $this->imgdata[4][0]= 445 ;
- $this->imgdata[4][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAApV'.
- 'BMVEX////6+Pz69/v49Pr38/r17/jr4+/l3Onj2efh1ua/L+i+'.
- 'q8m+Lue9Lua8qsS8LuW8LeS7pca5LOG4LN+2Y9O2YNW1ZdO1Kt'.
- 'y0atC0aNGzb82zbc6zKtuzKdqycsuwa8qtJtOISZ2GRpuFN6GE'.
- 'NqCDQpmCMZ+BPpd/LJ1/K519S5B9Jpx9Jpt9JZt6RY11BJZ1BJ'.
- 'V0BJV0BJRzBJNvNoRtIoJUEmdZ/XbrAAAAAWJLR0QAiAUdSAAA'.
- 'AAlwSFlzAAALEgAACxIB0t1+/AAAAAd0SU1FB9MDCxYDF3iKMD'.
- 'YAAACeSURBVHjaVczbEoIgGARgCiMtrexoWpaa2FHUgvd/tH4Y'.
- 'BnEvv9ldhNPradPnnGBUTtPDzMRPSIF46SaBoR25dYjz3I20Lb'.
- 'ek6BgQz73Il7KKpSgCO0pTHU0886J1sCe0ZYbALjGhjFnEM2es'.
- 'VhZVI4d+B1QtfnV47ywCEaKeP/p7JdLejSYt0j6NIiOq1wJZIs'.
- 'QTDA0ELHwhPBCwyR/Cni9cOmzJtwAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-//sq_blue.png
-//==========================================================
- $this->imgdata[5][0]= 283 ;
- $this->imgdata[5][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAQl'.
- 'BMVEX////4+fz39/z19vvy8vru7/ni4+7g4fHW1ue8vteXmt6B'.
- 'hdhiZ7FQVaZETcxCSJo1Oq4zNoMjKakhJHcKFaMEC2jRVYdWAA'.
- 'AAAWJLR0QAiAUdSAAAAAlwSFlzAAALEgAACxIB0t1+/AAAAAd0'.
- 'SU1FB9MDCxYDN0PkEP4AAABfSURBVHjaVchHAoAgDATAVcCCIF'.
- 'j4/1elJEjmOFDHKVgDv4iz640gLs+LMF6ZUv/VqcXXplU7Gqpy'.
- 'PFzBT5qml9NzlOX259riWHlS4kOffviHD8PQYZx2EFMPRkw+9Q'.
- 'FSnRPeWEDzKAAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-//sq_green.png
-//==========================================================
- $this->imgdata[6][0]= 325 ;
- $this->imgdata[6][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAXV'.
- 'BMVEX////2+vX1+vX1+fT0+fPz+PPx9/Dv9u7u9e3h7uHe697a'.
- '6dnO2s3I1sa10LOvza2ay5aEwYBWlE9TqE5Tkk1RkEpMrUJMg0'.
- 'hKiUNGpEFBojw8oTcsbScaYBMWlwmMT0NtAAAAAWJLR0QAiAUd'.
- 'SAAAAAlwSFlzAAALEgAACxIB0t1+/AAAAAd0SU1FB9MDCxYEFd'.
- 'nFx90AAABuSURBVHjaVc9HAoAgDADB2HuJWLDx/2cKBITscW4L'.
- '5byzMIWtZobNDZIZtrcCGZsRQ8GwvRSRNxIiMuysODKG3alikl'.
- 'ueOPlpKTLBaRmOZxQxaXlfb5ZWI9om4WntrXiDSJzp7SBkwMQa'.
- 'FEy0VR/NAB2kNuj7rgAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-//sq_orange.png
-//==========================================================
- $this->imgdata[7][0]= 321 ;
- $this->imgdata[7][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAUV'.
- 'BMVEX/////8+n/8uf/8OP/59H/5Mv/zqH/zJ3/ypv/yJf/vYH/'.
- 'u33/uXn/n0n/nUX/m0H/lzn/ljf/lDP/kS3/kCv/iR//hxv/fg'.
- 'n/fAX/eQDYZgDW6ia5AAAAAWJLR0QAiAUdSAAAAAlwSFlzAAAL'.
- 'EgAACxIB0t1+/AAAAAd0SU1FB9MDCxYEJIgbx+cAAAB2SURBVH'.
- 'jaVczRCoQwDETRbLAWLZSGUA35/w/dVI0283i4DODew3YESmWW'.
- 'kg5gWkoQAe6TleUQI/66Sy7i56+kLk7cht2N0+hcnJgQu0SqiC'.
- '1SzSIbzWSi6gavqJ63wSduRi2f+kwyD5rEukwCdZ1kGAMGMfv9'.
- 'AbWuGMOr5COSAAAAAElFTkSuQmCC' ;
+ //==========================================================
+ //sq_lblue.png
+ //==========================================================
+ $this->imgdata[0][0]= 362 ;
+ $this->imgdata[0][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAIAAADZrBkAAAAABm'.
+ 'JLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsRAAALEQF/ZF+RAAAA'.
+ 'B3RJTUUH0wMLFgojiPx/ygAAAPdJREFUeNpj/P377+kzHx89/c'.
+ 'VAHNBQ5VBX52HavPWWjg6nnDQbkXoUFTnnL7zD9PPXrz17HxCj'.
+ 'E6Jn6fL7H7/+ZWJgYCBGJ7IeBgYGJogofp1oehDa8OjE1IOiDa'.
+ 'tOrHoYGBhY0NwD0enirMDAwMDFxYRVD7ptyDrNTAU0NXix6sGu'.
+ 'jYGBgZOT9e/f/0xMjFyczFgVsGAKCfBza2kKzpl3hIuT1c9Xb/'.
+ 'PW58/foKchJqx6tmy98vbjj8cvPm/afMnXW1JShA2fNmQ9EBFc'.
+ 'Opnw6MGjkwm/Hlw6mQjqwaqTiRg9mDoZv//4M2/+UYJ64EBWgj'.
+ 'cm2hwA8l24oNDl+DMAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ //sq_yellow.png
+ //==========================================================
+ $this->imgdata[1][0]= 338 ;
+ $this->imgdata[1][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAWl'.
+ 'BMVEX////+/+H+/9/9/9v8/8P8/8H8/7v8/7n6/4P5/335/3n5'.
+ '/3X4/1f4/1P3/031/w30/wn0/wPt+ADp9ADm8ADk7gDc5gDa5A'.
+ 'DL1ADFzgCwuACqsgClrABzeAC9M0MzAAAAAWJLR0QAiAUdSAAA'.
+ 'AAlwSFlzAAALEgAACxIB0t1+/AAAAAd0SU1FB9MDCxYEDlOgDj'.
+ 'EAAAB+SURBVHjaVcpbCsQgDEDRGERGKopjDa2a/W9zfLWj9/Nw'.
+ 'Ac21ZRBOtZlRN9ApzSYFaDUj79KIorRDbJNO9bN/GUSh2ZRJFJ'.
+ 'S18iorURBiyksO8buT0zkfYaUqzI91ckfhWhoGXTLzsDjI68Sz'.
+ 'pGMjrzPzauA/iXk1AtykmvgBC8UcWUdc9HkAAAAASUVORK5CYI'.
+ 'I=' ;
+
+ //==========================================================
+ //sq_blgr.png
+ //==========================================================
+ $this->imgdata[2][0]= 347 ;
+ $this->imgdata[2][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAZl'.
+ 'BMVEX////0+vv0+vrz+fry+frv+Png7e/d7e/a6+zY6+250tSz'.
+ '0tSyztCtztGM0NWIz9SDzdNfsLVcrrRZrbJOp61MpqtIr7dHn6'.
+ 'RErrZArLQ6q7M2g4kygYcsp68npa4ctr8QZ20JnqepKsl4AAAA'.
+ 'AWJLR0QAiAUdSAAAAAlwSFlzAAALEgAACxIB0t1+/AAAAAd0SU'.
+ '1FB9MDCxYEByp8tpUAAAB7SURBVHjaVcjRFoIgDADQWZpWJpjY'.
+ 'MsnG//9kzIFn3McLzfArDA3MndFjrhvgfDHFBEB9pt0CVzwrY3'.
+ 'n2yicjhY4vTSp0nbXtN+hCV53SHDWe61dZY+/9463r2XuifHAM'.
+ '0SoH+6xEcovUlCfefeFSIwfTTQ3fB+pi4lV/bTIgvmaA7a0AAA'.
+ 'AASUVORK5CYII=' ;
+
+ //==========================================================
+ //sq_red.png
+ //==========================================================
+ $this->imgdata[3][0]= 324 ;
+ $this->imgdata[3][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAXV'.
+ 'BMVEX////++Pn99/j99ff99fb98/X98/T98PL55uj43+P24+bw'.
+ 'kKPvjaHviJ3teJHpxMnoL2Pjs73WW3rWNljVWXnUVnbUK1DTJk'.
+ '3SUHPOBz/KQmmxPVmuOFasNFOeIkWVka/fAAAAAWJLR0QAiAUd'.
+ 'SAAAAAlwSFlzAAALEgAACxIB0t1+/AAAAAd0SU1FB9MDCxYEHd'.
+ 'ceT+8AAABtSURBVHjaVchbAkMwEAXQq6i3VrQiQfa/zDYTw8z5'.
+ 'PCjGt9JVWFt1XWPh1fWNdfDy+tq6WPfRUPENNKnSnXNWPB4uv2'.
+ 'b54nSZ8jHrMtOxvWZZZtpD4KP6xLkO9/AhzhaCOMhJh68cOjzV'.
+ '/K/4Ac2cG+nBcaRuAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ //sq_pink.png
+ //==========================================================
+ $this->imgdata[4][0]= 445 ;
+ $this->imgdata[4][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAApV'.
+ 'BMVEX////6+Pz69/v49Pr38/r17/jr4+/l3Onj2efh1ua/L+i+'.
+ 'q8m+Lue9Lua8qsS8LuW8LeS7pca5LOG4LN+2Y9O2YNW1ZdO1Kt'.
+ 'y0atC0aNGzb82zbc6zKtuzKdqycsuwa8qtJtOISZ2GRpuFN6GE'.
+ 'NqCDQpmCMZ+BPpd/LJ1/K519S5B9Jpx9Jpt9JZt6RY11BJZ1BJ'.
+ 'V0BJV0BJRzBJNvNoRtIoJUEmdZ/XbrAAAAAWJLR0QAiAUdSAAA'.
+ 'AAlwSFlzAAALEgAACxIB0t1+/AAAAAd0SU1FB9MDCxYDF3iKMD'.
+ 'YAAACeSURBVHjaVczbEoIgGARgCiMtrexoWpaa2FHUgvd/tH4Y'.
+ 'BnEvv9ldhNPradPnnGBUTtPDzMRPSIF46SaBoR25dYjz3I20Lb'.
+ 'ek6BgQz73Il7KKpSgCO0pTHU0886J1sCe0ZYbALjGhjFnEM2es'.
+ 'VhZVI4d+B1QtfnV47ywCEaKeP/p7JdLejSYt0j6NIiOq1wJZIs'.
+ 'QTDA0ELHwhPBCwyR/Cni9cOmzJtwAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ //sq_blue.png
+ //==========================================================
+ $this->imgdata[5][0]= 283 ;
+ $this->imgdata[5][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAQl'.
+ 'BMVEX////4+fz39/z19vvy8vru7/ni4+7g4fHW1ue8vteXmt6B'.
+ 'hdhiZ7FQVaZETcxCSJo1Oq4zNoMjKakhJHcKFaMEC2jRVYdWAA'.
+ 'AAAWJLR0QAiAUdSAAAAAlwSFlzAAALEgAACxIB0t1+/AAAAAd0'.
+ 'SU1FB9MDCxYDN0PkEP4AAABfSURBVHjaVchHAoAgDATAVcCCIF'.
+ 'j4/1elJEjmOFDHKVgDv4iz640gLs+LMF6ZUv/VqcXXplU7Gqpy'.
+ 'PFzBT5qml9NzlOX259riWHlS4kOffviHD8PQYZx2EFMPRkw+9Q'.
+ 'FSnRPeWEDzKAAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ //sq_green.png
+ //==========================================================
+ $this->imgdata[6][0]= 325 ;
+ $this->imgdata[6][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAXV'.
+ 'BMVEX////2+vX1+vX1+fT0+fPz+PPx9/Dv9u7u9e3h7uHe697a'.
+ '6dnO2s3I1sa10LOvza2ay5aEwYBWlE9TqE5Tkk1RkEpMrUJMg0'.
+ 'hKiUNGpEFBojw8oTcsbScaYBMWlwmMT0NtAAAAAWJLR0QAiAUd'.
+ 'SAAAAAlwSFlzAAALEgAACxIB0t1+/AAAAAd0SU1FB9MDCxYEFd'.
+ 'nFx90AAABuSURBVHjaVc9HAoAgDADB2HuJWLDx/2cKBITscW4L'.
+ '5byzMIWtZobNDZIZtrcCGZsRQ8GwvRSRNxIiMuysODKG3alikl'.
+ 'ueOPlpKTLBaRmOZxQxaXlfb5ZWI9om4WntrXiDSJzp7SBkwMQa'.
+ 'FEy0VR/NAB2kNuj7rgAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ //sq_orange.png
+ //==========================================================
+ $this->imgdata[7][0]= 321 ;
+ $this->imgdata[7][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAMAAABhEH5lAAAAUV'.
+ 'BMVEX/////8+n/8uf/8OP/59H/5Mv/zqH/zJ3/ypv/yJf/vYH/'.
+ 'u33/uXn/n0n/nUX/m0H/lzn/ljf/lDP/kS3/kCv/iR//hxv/fg'.
+ 'n/fAX/eQDYZgDW6ia5AAAAAWJLR0QAiAUdSAAAAAlwSFlzAAAL'.
+ 'EgAACxIB0t1+/AAAAAd0SU1FB9MDCxYEJIgbx+cAAAB2SURBVH'.
+ 'jaVczRCoQwDETRbLAWLZSGUA35/w/dVI0283i4DODew3YESmWW'.
+ 'kg5gWkoQAe6TleUQI/66Sy7i56+kLk7cht2N0+hcnJgQu0SqiC'.
+ '1SzSIbzWSi6gavqJ63wSduRi2f+kwyD5rEukwCdZ1kGAMGMfv9'.
+ 'AbWuGMOr5COSAAAAAElFTkSuQmCC' ;
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_stars.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_stars.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/imgdata_stars.inc.php 2007-03-23 15:12:08.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/imgdata_stars.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,143 +1,143 @@
'imgdata');
+ protected $name = 'Stars';
+ protected $an = array(MARK_IMG_STAR => 'imgdata');
- var $colors = array('bluegreen','lightblue','purple','blue','green','pink','red','yellow');
- var $index = array('bluegreen'=>3,'lightblue'=>4,'purple'=>1,
- 'blue'=>5,'green'=>0,'pink'=>7,'red'=>2,'yellow'=>6);
- var $maxidx = 7 ;
- var $imgdata ;
-
- function ImgData_Stars() {
-//==========================================================
-// File: bstar_green_001.png
-//==========================================================
- $this->imgdata[0][0]= 329 ;
- $this->imgdata[0][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAAUV'.
- 'BMVEX///////+/v7+83rqcyY2Q/4R7/15y/1tp/05p/0lg/zdX'.
- '/zdX/zVV/zdO/zFJ9TFJvDFD4yg+8Bw+3iU68hwurhYotxYosx'.
- 'YokBoTfwANgQFUp7DWAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgF'.
- 'HUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJj'.
- 'CRyxgTAAAAcUlEQVR4nH3MSw6AIAwEUBL/IKBWwXL/g0pLojUS'.
- 'ZzGLl8ko9Zumhr5iy66/GH0dp49llNPB5sTotDY5PVuLG6tnM9'.
- 'CVKSIe1joSgPsAKSuANNaENFQvTAGzmheSkUpMBWeJZwqBT8wo'.
- 'hmysD4bnnPsC/x8ItUdGPfAAAAAASUVORK5CYII=' ;
-//==========================================================
-// File: bstar_blred.png
-//==========================================================
- $this->imgdata[1][0]= 325 ;
- $this->imgdata[1][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
- 'BMVEX///+/v79uRJ6jWPOSUtKrb+ejWO+gWPaGTruJTr6rZvF2'.
- 'RqC2ocqdVuCeV+egV/GsnLuIXL66rMSpcOyATbipY/OdWOp+VK'.
- 'aTU9WhV+yJKBoLAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
- 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJwynv1'.
- 'XVAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
- 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
- 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
- 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bstar_red_001.png
-//==========================================================
- $this->imgdata[2][0]= 325 ;
- $this->imgdata[2][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
- 'BMVEX///+/v7+eRFHzWG3SUmHnb37vWGr2WHG7Tlm+TljxZneg'.
- 'Rk3KoaXgVmXnV2nxV227nJ++XGzErK3scIS4TVzzY3fqWG2mVF'.
- 'zVU2PsV2rJFw9VAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
- 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJzCI0C'.
- 'lSAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
- 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
- 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
- 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bstar_blgr_001.png
-//==========================================================
- $this->imgdata[3][0]= 325 ;
- $this->imgdata[3][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
- 'BMVEX///+/v79Ehp5Yx/NSq9Jvw+dYwu9YzfZOmbtOmb5myPFG'.
- 'gqChvcpWteBXvedXxvGcsbtcpb6su8RwzOxNmrhjyvNYwupUjK'.
- 'ZTr9VXwOyJhmWNAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
- 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJTC65k'.
- 'vQAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
- 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
- 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
- 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bstar_blgr_002.png
-//==========================================================
- $this->imgdata[4][0]= 325 ;
- $this->imgdata[4][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
- 'BMVEX///+/v79EnpxY8/FS0dJv5+dY7+9Y9vBOubtOur5m8fFG'.
- 'nKChycpW3uBX5+ZX8e2curtcvrqswsRw7OdNuLZj8/BY6udUpK'.
- 'ZT1dRX7OtNkrW5AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
- 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJgXHeN'.
- 'wwAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
- 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
- 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
- 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bstar_blue_001.png
-//==========================================================
- $this->imgdata[5][0]= 325 ;
- $this->imgdata[5][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
- 'BMVEX///+/v79EY55Yi/NSetJvledYiO9YkPZOb7tObr5mkvFG'.
- 'X6ChrcpWgOBXhedXi/Gcpbtcf76sssRwnOxNcbhjk/NYiepUbK'.
- 'ZTfdVXh+ynNEzzAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
- 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJhStyP'.
- 'zCAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
- 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
- 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
- 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bstar_oy_007.png
-//==========================================================
- $this->imgdata[6][0]= 325 ;
- $this->imgdata[6][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
- 'BMVEX///+/v7+ejUTz11jSvVLn02/v1lj21li7q06+r07x2mag'.
- 'lUbKxKHgy1bnz1fx1Ve7t5y+qlzEwqzs03C4pE3z2WPqz1imml'.
- 'TVv1Ps01dGRjeyAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
- 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJjsGGc'.
- 'GbAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
- 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
- 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
- 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
-
-//==========================================================
-// File: bstar_lred.png
-//==========================================================
- $this->imgdata[7][0]= 325 ;
- $this->imgdata[7][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
- 'BMVEX///+/v7+eRJPzWN3SUr7nb9TvWNj2WOS7Tqi+TqnxZtyg'.
- 'Ro/KocPgVsjnV9LxV927nLa+XLTErL7scN24TarzY9/qWNemVJ'.
- 'jVU8LsV9VCwcc9AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
- 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJxi9ZY'.
- 'GoAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
- 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
- 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
- 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
+ protected $colors = array('bluegreen','lightblue','purple','blue','green','pink','red','yellow');
+ protected $index = array('bluegreen'=>3,'lightblue'=>4,'purple'=>1,
+ 'blue'=>5,'green'=>0,'pink'=>7,'red'=>2,'yellow'=>6);
+ protected $maxidx = 7 ;
+ protected $imgdata ;
+
+ function __construct() {
+ //==========================================================
+ // File: bstar_green_001.png
+ //==========================================================
+ $this->imgdata[0][0]= 329 ;
+ $this->imgdata[0][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAAUV'.
+ 'BMVEX///////+/v7+83rqcyY2Q/4R7/15y/1tp/05p/0lg/zdX'.
+ '/zdX/zVV/zdO/zFJ9TFJvDFD4yg+8Bw+3iU68hwurhYotxYosx'.
+ 'YokBoTfwANgQFUp7DWAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgF'.
+ 'HUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJj'.
+ 'CRyxgTAAAAcUlEQVR4nH3MSw6AIAwEUBL/IKBWwXL/g0pLojUS'.
+ 'ZzGLl8ko9Zumhr5iy66/GH0dp49llNPB5sTotDY5PVuLG6tnM9'.
+ 'CVKSIe1joSgPsAKSuANNaENFQvTAGzmheSkUpMBWeJZwqBT8wo'.
+ 'hmysD4bnnPsC/x8ItUdGPfAAAAAASUVORK5CYII=' ;
+ //==========================================================
+ // File: bstar_blred.png
+ //==========================================================
+ $this->imgdata[1][0]= 325 ;
+ $this->imgdata[1][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
+ 'BMVEX///+/v79uRJ6jWPOSUtKrb+ejWO+gWPaGTruJTr6rZvF2'.
+ 'RqC2ocqdVuCeV+egV/GsnLuIXL66rMSpcOyATbipY/OdWOp+VK'.
+ 'aTU9WhV+yJKBoLAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
+ 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJwynv1'.
+ 'XVAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
+ 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
+ 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
+ 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bstar_red_001.png
+ //==========================================================
+ $this->imgdata[2][0]= 325 ;
+ $this->imgdata[2][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
+ 'BMVEX///+/v7+eRFHzWG3SUmHnb37vWGr2WHG7Tlm+TljxZneg'.
+ 'Rk3KoaXgVmXnV2nxV227nJ++XGzErK3scIS4TVzzY3fqWG2mVF'.
+ 'zVU2PsV2rJFw9VAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
+ 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJzCI0C'.
+ 'lSAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
+ 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
+ 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
+ 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bstar_blgr_001.png
+ //==========================================================
+ $this->imgdata[3][0]= 325 ;
+ $this->imgdata[3][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
+ 'BMVEX///+/v79Ehp5Yx/NSq9Jvw+dYwu9YzfZOmbtOmb5myPFG'.
+ 'gqChvcpWteBXvedXxvGcsbtcpb6su8RwzOxNmrhjyvNYwupUjK'.
+ 'ZTr9VXwOyJhmWNAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
+ 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJTC65k'.
+ 'vQAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
+ 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
+ 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
+ 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bstar_blgr_002.png
+ //==========================================================
+ $this->imgdata[4][0]= 325 ;
+ $this->imgdata[4][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
+ 'BMVEX///+/v79EnpxY8/FS0dJv5+dY7+9Y9vBOubtOur5m8fFG'.
+ 'nKChycpW3uBX5+ZX8e2curtcvrqswsRw7OdNuLZj8/BY6udUpK'.
+ 'ZT1dRX7OtNkrW5AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
+ 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJgXHeN'.
+ 'wwAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
+ 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
+ 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
+ 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bstar_blue_001.png
+ //==========================================================
+ $this->imgdata[5][0]= 325 ;
+ $this->imgdata[5][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
+ 'BMVEX///+/v79EY55Yi/NSetJvledYiO9YkPZOb7tObr5mkvFG'.
+ 'X6ChrcpWgOBXhedXi/Gcpbtcf76sssRwnOxNcbhjk/NYiepUbK'.
+ 'ZTfdVXh+ynNEzzAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
+ 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJhStyP'.
+ 'zCAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
+ 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
+ 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
+ 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bstar_oy_007.png
+ //==========================================================
+ $this->imgdata[6][0]= 325 ;
+ $this->imgdata[6][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
+ 'BMVEX///+/v7+ejUTz11jSvVLn02/v1lj21li7q06+r07x2mag'.
+ 'lUbKxKHgy1bnz1fx1Ve7t5y+qlzEwqzs03C4pE3z2WPqz1imml'.
+ 'TVv1Ps01dGRjeyAAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
+ 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJjsGGc'.
+ 'GbAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
+ 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
+ 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
+ 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // File: bstar_lred.png
+ //==========================================================
+ $this->imgdata[7][0]= 325 ;
+ $this->imgdata[7][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABQAAAASCAMAAABsDg4iAAAATl'.
+ 'BMVEX///+/v7+eRJPzWN3SUr7nb9TvWNj2WOS7Tqi+TqnxZtyg'.
+ 'Ro/KocPgVsjnV9LxV927nLa+XLTErL7scN24TarzY9/qWNemVJ'.
+ 'jVU8LsV9VCwcc9AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgA'.
+ 'AAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTAxYTJxi9ZY'.
+ 'GoAAAAcElEQVR4nH3MyQ6AIAwEUFIqiwju2///qLQmWiJxDnN4'.
+ 'mYxSv5lqGCs2nvaLLtZx/VhGOW1MjnPJWp0zsw2wsUY2jd09BY'.
+ 'DFmESC+BwA5UCUxhqAhqrA4CGrLpCMVGK4sZe4B+/5RLdiyMb6'.
+ 'on/PuS9CdQNC7yBXEQAAAABJRU5ErkJggg==' ;
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpg-config.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpg-config.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpg-config.inc.php 2009-04-01 04:04:07.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpg-config.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,17 +1,16 @@
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_antispam-digits.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_antispam-digits.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_antispam-digits.php 2006-10-08 04:09:02.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_antispam-digits.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,203 +1,204 @@
digits['6'][0]= 645 ;
- $this->digits['6'][1]=
- '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
- 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
- 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAEBAAMBAAAAAAAAAAAAAAAABgMEBwX/xAAvEAABAwMC'.
- 'BAQEBwAAAAAAAAABAgMEAAURBiESIjFRBxMUQRUWMmFTYnGRkrHC/8QAFgEBAQEAAAAAAAAAAAAAAAAAAAEC/8QAFhEBAQEAAAAA'.
- 'AAAAAAAAAAAAAAER/9oADAMBAAIRAxEAPwDslwiR3oDku8ONttsAvDiVyMcO/ET7ke5/aoOz6k1Vr5htNjW7a7M1yO3NTQU9JUDu'.
- 'GgrlSn8xyf6p4gXaHJvNps9/mKZtSkGdMjRwpfqAFBLLACRlZUrJONsI2717No1lbZ10kx7XGnRpKWQ/6GVGMfzEJ5VFIVtsOH6e'.
- 'wyKVhYsia0y22pLThSkJK1uniVgdThOM0ol+StIUhpopIyCFq3H8aUVCwnG3PGe4Rp6fLXJtMdyM0ojcIWvIz3HFnAPfrWTXb6GN'.
- 'WaLXDwZjVz8pKEfhuIUFg/bAz9sVJ61nt61mxJFslLtq7e5yPqiBT4UDklKw4MDpt+u+9bFiu9riXNu83R+fcr6tohuQ5HQhmK37'.
- 'paaC8DruScmg6X8KkjZEhbaB9KEyFYSOw26Uqd+e7Qerl5z74DY/1SomP//Z' ;
-
-//==========================================================
-// d2-small.jpg
-//==========================================================
- $this->digits['2'][0]= 606 ;
- $this->digits['2'][1]=
- '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
- 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
- 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEQMBIgACEQEDEQH/xAAYAAEBAQEBAAAAAAAAAAAAAAAFAAQHAv/EACsQAAEDBAEC'.
- 'BAYDAAAAAAAAAAIBAwQABQYRIRIxQVFhcQcTFSJSU5GU0f/EABcBAAMBAAAAAAAAAAAAAAAAAAECAwT/xAAZEQACAwEAAAAAAAAA'.
- 'AAAAAAAAARESUUH/2gAMAwEAAhEDEQA/AOqXm/Q8dxmOL4PPSnCSNFixx6nXnkXgRT3Te17JWbGsveueSyLZdbPItNxOKLzTLjou'.
- 'gYCSoSoY8ISKSbFeUrzkdlnTL1YshskiErkQnFEZaF8kkdBBVdjyi6RNL5+9F486eS/ECVkcBtDt1vZcho5viS8ZCp9C9tAIAm/F'.
- 'VoPRU+HRtJ5JVRP1kP0PfwP+1VKrHBMliXG4Nw8VgE4xGkuqk2S1wTUNEVdIvgpL9iL6KtNxY7WOwo9tt0RCitj0sR2uCbFPPzH1'.
- '7+6rRuSRcljMBMsUy2tky045KOawZk5xtEFBJEROO3hx61kh2rPCIX3MhsyC4QmfTbC6lH8dq5212qwkiG5H6Y/9R2qm+ofxqqsL'.
- 'DLZ6f//Z' ;
-
-//==========================================================
-// d9-small.jpg
-//==========================================================
- $this->digits['9'][0]= 680 ;
- $this->digits['9'][1]=
- '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
- 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
- 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABAUGBwP/xAArEAABAwMD'.
- 'AgYBBQAAAAAAAAABAgMEBQYRABIhE1EUIjEzQUIHMlJhcdH/xAAWAQEBAQAAAAAAAAAAAAAAAAACAQD/xAAYEQEAAwEAAAAAAAAA'.
- 'AAAAAAAAAREhQf/aAAwDAQACEQMRAD8AkK7brF6X7XpMeGoKhFMLEeT4ZUheEhanF4OcZ2pTgDykk92bZpdCsi7aezLjxkIPUZiV'.
- 'RSCy8hah7EkZ27yM7V+iscal5bE22Lon1qNDmSKROd8Sl+Ix1lMOlIS4HGgQpbStoUCnlJz8HmsXtW3Lst2rmBAelLMRRekOwnYz'.
- 'Edls9QKKnOVLyk7UgcbzzrdBthqEJJwZbAI4x1U/7o1TaFa9lG36aXaZTy54VrcXUgrzsGdx+T30aNydweqVw1GS87T6Lb86Q4ha'.
- 'my/IAYjZBx+snKk99oOQMf1AViE65SY348hzFy6hPKnqtKz7DC1lbqyPrvJKUJ7H+M6Wrt3InP7o1brFNp4bCDGhxGAsqz69VSiQ'.
- 'ORwBxrrQ7itm1ac7Hp0WoGTIc3PSn0pccdcP2WorycfA1RaRHjxosZqOyhtDTSAhCf2gDAGjVHTd9sKSCumynFEZK1tIJUe58/ro'.
- '1V1//9k=' ;
-
-//==========================================================
-// d5-small.jpg
-//==========================================================
- $this->digits['5'][0]= 632 ;
- $this->digits['5'][1]=
- '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
- 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
- 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABgIFBwT/xAAoEAABAwME'.
- 'AQQCAwAAAAAAAAABAgMEBQYRABIhIkEUMVFhBxNCgaH/xAAVAQEBAAAAAAAAAAAAAAAAAAAAAv/EABcRAQEBAQAAAAAAAAAAAAAA'.
- 'AAABEUH/2gAMAwEAAhEDEQA/ANGvW4YVOeiRX5b4mv5Sin05IdlupPKdo/j2SO3+6TbPNQvOsTVz33KRT4csR3YUF7Dsh5OSFvug'.
- 'kqG4FPBxnjxpvvi4KZb1pTpU+QwxUi2Y7ZIAefUk5ATxnB9/gbtL/wCH1UpuhPUlZlMVaQ0mS8zJjqZOPfc2TwpIUonI9tw40R1r'.
- 'WNGq/wBdJR1XT3lqHBUnGCfkfWjRWs1ve249erQqQYjOtN1FqPUpCXQ4WIzQSsJwT0UpRwQPG0nzqyuNHobjsl9kBuWqoOoXtT1/'.
- 'WppZcA8lKRj64HxqU+3KpAr6plElRVKef3S4E0K9O8pLXVzKcqSsJAB9wSAca6bSoNXeuA1+5pEV+SGFNU1iKVFqI0Vdx2AJUeoz'.
- '8DGlTDwG3CAf3q/pI0ah6MDhLz6U+EpXwPoaNMU//9k=' ;
-
-//==========================================================
-// d1-small.jpg
-//==========================================================
- $this->digits['1'][0]= 646 ;
- $this->digits['1'][1]=
- '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
- 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
- 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEwMBIgACEQEDEQH/xAAZAAADAAMAAAAAAAAAAAAAAAAABQYCBAf/xAApEAACAQMD'.
- 'AwQBBQAAAAAAAAABAgMEBREABiESMUEHEyJRkSNCYXGB/8QAFgEBAQEAAAAAAAAAAAAAAAAAAAEC/8QAFxEBAQEBAAAAAAAAAAAA'.
- 'AAAAAAEREv/aAAwDAQACEQMRAD8A6jdd4WLbstILnc4Uq0VoWpkJknb6IjXLHJUePOlez923fcW4r1SxWlqC2UbdKirQif3Xw3yA'.
- 'OFAGT09/kO3OmV3a20MFRf6lIYPcpy7yRRAzgxjIy2M8YwcdiBzpX6d22VNvUlTXsFkuwkrKqNSfnK7F8OTzwrAY+l5zoxKskudN'.
- 'EgQPUT9PBkWF3DH+1GPxo1mLnRoAqF2VRgGOFmX/AAgY/GjRUP6hVMFv2FuFqUvUGrpDFJMBnpdyF5bsAQew7Hxzp6LZNT0yQ1DI'.
- 'wp0QCFBhD0jCsfLZHxbx5xxpTuvb1+v9PV7Ztk9roLPLCjmSSN3mX5ZwqjCgZX7PfWxDQb2in96pv9qq46aTE0bW4x9ceAWAYPwS'.
- 'PsYzoixgmheBGjIVcYCnjp/jHjHbRpe1JLn9OnopE/a0ykvjwDx47aNMXqP/2Q==' ;
-
-//==========================================================
-// d8-small.jpg
-//==========================================================
- $this->digits['8'][0]= 694 ;
- $this->digits['8'][1]=
- '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
- 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
- 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AFQMBIgACEQEDEQH/xAAYAAADAQEAAAAAAAAAAAAAAAAABgcEBf/EACsQAAEDAwMD'.
- 'AwMFAAAAAAAAAAECAwQFBhEAEiEUMVEHE0EVYYEiIzJCsf/EABYBAQEBAAAAAAAAAAAAAAAAAAIAAf/EABcRAQEBAQAAAAAAAAAA'.
- 'AAAAAAABERL/2gAMAwEAAhEDEQA/AKL6gVVUa0i1T5QjvTprUJMlxW4R9zgQXe/AH+kaWrntqlWjaq7gpcmotXAw82ht9yY4tch8'.
- 'uAFC0k7VBXPGMY51ruiaue+bThIj+7NbWqS+7HDxajFf6AlB/k44o8ZOABk4xkL0X0tZiojKrlRuGRJjugqldSlKGf6t7BuUQe3J'.
- '44xxxrA1a4KVJipLidri8uLHgqOcfjOPxo0o2hdDvS1CmV2Yl6fS5ioipIQR1CAlKkLKR2UUqAI8g6NRSwuuyHab6s1ufLI/Zai7'.
- 'UBJOxhTS0+6B32pWSFH4CidOdWU0ukLiN1BLr0zG5Sdm3GRvcPhIT858DvjXNrVsSLnm/VIdTXS6tTnFsxZTSN3jchaTwps+O/z9'.
- 'tcBVq3hIX0tYqlIiQHdy5CqRHKHXEjAOMgBKjnvyRk4xrQa7OiGt1K5biYZL8SoVEpjOqkFsONtJCNwASeCQrn7aNUKnQYtLp7EC'.
- 'EylmLHQltptPZKQOBo1FzH//2Q==' ;
-
-//==========================================================
-// d4-small.jpg
-//==========================================================
- $this->digits['4'][0]= 643 ;
- $this->digits['4'][1]=
- '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
- 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
- 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAYAAADAQEAAAAAAAAAAAAAAAAABAYHAv/EAC0QAAIBAwQA'.
- 'BAMJAAAAAAAAAAECAwQFEQAGEiETFDFBUmGBByIjUVNxobHR/8QAFgEBAQEAAAAAAAAAAAAAAAAAAAIB/8QAGBEBAAMBAAAAAAAA'.
- 'AAAAAAAAAAERIVH/2gAMAwEAAhEDEQA/ANjM00Nxmt1xiWW31CZp5uJwoAAaOQ/n7qfcZHqO5my3q5XX7R6ijiqnNut9u4NyJ4yv'.
- 'JJyjYr8Xhrn5g599J7x3ulBNU7Zo7dXXXcLQ8kURYi4epYtkALjOePv1nUvbLvV7P3BZm3DR3eh88Kp7pVzBZI6iUhGWRRGWwE44'.
- 'HX3V+uiL1uHgt+vL/H+aNJQ3CSeCOaFqSaJ1DJKs/TqRkMOvQjvRorHE4pRDLNWLGlRHGUeYIORXs9e5B7OP31E0fmdyb/t0DJ4Q'.
- '27bfx3YZzPUIoAAz7IpOD6cuxq0uNumqLfVNDOqXBoZEjnZcqhIPXH4c46+WkdoWOltu3IDDLLLVVR83UVcuPEmmcZZ2/rHoAANG'.
- 'GI7KIY1ijoLeEQBVCwIoAHpgY6Hy0aZe7mJ2jeHLKcEhusj6aNKgzr//2Q==' ;
-
-//==========================================================
-// d7-small.jpg
-//==========================================================
- $this->digits['7'][0]= 658 ;
- $this->digits['7'][1]=
- '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
- 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
- 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABgEFBwT/xAAuEAABAwIE'.
- 'BAQGAwAAAAAAAAABAgMEBREABiExEhMiQSMyUXEHFBclVJFhk9L/xAAXAQADAQAAAAAAAAAAAAAAAAAAAQID/8QAGREBAQEAAwAA'.
- 'AAAAAAAAAAAAAAEREiFR/9oADAMBAAIRAxEAPwDXq9mCjZeQ05VZ5ZST4bfEpa3VdglCbqUe+g9MZ5Uq7V8415WXoMSdQ6etgSps'.
- '19wpkCMDZKUpv0FZvbi1NzpYasMDLDUbMVXrtQdbeeU23xLWkj5RlLYK0J7anW9gbAjCzkOtsVSUJUdtc6dVZK51UeaFm4LKbhpC'.
- 'l7EhIFkDW974GbRI2XorUVls1OTdKAOqUpR0Hc3198GITQ6k+hLwrEpoODiDenRfW23bBicg78JXxPpD0mgVOW5PAivNNpahsPW5'.
- '8xxQaSVkboQnhsnYm5OHqDGp1IpsalMKjMsMIC3+XZKbJFth62/QOEfMOZqZXp9JcKZTcGmTky3meSi7xQklI81vMR+sXIz/AEgp'.
- 'Q0qPNu6ea8Q2jqtbp8+2w9h/OKORc/cpHjt1dDSHOtLZ4ekHW23bBjj+o9H/AB539aP94MG0+L//2Q==' ;
-
-//==========================================================
-// d3-small.jpg
-//==========================================================
- $this->digits['3'][0]= 662 ;
- $this->digits['3'][1]=
- '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
- 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
- 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABAUGBwL/xAArEAABBAED'.
- 'AwMDBQEAAAAAAAABAgMEBREABhIhMUEiMmETFZEHFkJDUdH/xAAWAQEBAQAAAAAAAAAAAAAAAAABAAL/xAAYEQEBAQEBAAAAAAAA'.
- 'AAAAAAAAEQExQf/aAAwDAQACEQMRAD8A0vclruBdk3VVLLUNssGRJsZSCtqOjlgJAHvcOD6c4HnOdIbcttw1W5P29cFEhuawqTXS'.
- 'VsJjnCMBxKkJJx7goAde+ceJfdNxU0UNlyymyXHi6kxWUNl1S3EnkAEIHX2nv86qtTuZr9Q9+1VhRsOoYpYcgSVyAE/TdewkJxnK'.
- 'sBCjkdPGpnOtFMd3PqsXgfOAgD8Y0aX+11H9rDDjn8lr9yj5J+dGqsqxaw6Cc9cQZU4Sp7zTJsIrKlcUEKwhSin1JABI45GUjqOu'.
- 'lbOvjbc3Ts9ynjGCy445UuFLYRzbWgrT6fhSCQSMDke+pew2zYVly/d7YchNqkMJZnQpgV9J8IzwWFJyUrAJHYgjvpLbu37G5nR7'.
- 'vck5C3YRKYEOEVJZj8kjKypXqWvirjk9h+dB9i4faa89TDZUfKlIyT8k+To10a6KTkpcJ/0vL/7o0TS//9k=' ;
- }
+ public $digits = array();
+ public $iHeight=30, $iWidth=30;
+
+ function __construct() {
+ //==========================================================
+ // d6-small.jpg
+ //==========================================================
+ $this->digits['6'][0]= 645 ;
+ $this->digits['6'][1]=
+ '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
+ 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
+ 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAEBAAMBAAAAAAAAAAAAAAAABgMEBwX/xAAvEAABAwMC'.
+ 'BAQEBwAAAAAAAAABAgMEAAURBiESIjFRBxMUQRUWMmFTYnGRkrHC/8QAFgEBAQEAAAAAAAAAAAAAAAAAAAEC/8QAFhEBAQEAAAAA'.
+ 'AAAAAAAAAAAAAAER/9oADAMBAAIRAxEAPwDslwiR3oDku8ONttsAvDiVyMcO/ET7ke5/aoOz6k1Vr5htNjW7a7M1yO3NTQU9JUDu'.
+ 'GgrlSn8xyf6p4gXaHJvNps9/mKZtSkGdMjRwpfqAFBLLACRlZUrJONsI2717No1lbZ10kx7XGnRpKWQ/6GVGMfzEJ5VFIVtsOH6e'.
+ 'wyKVhYsia0y22pLThSkJK1uniVgdThOM0ol+StIUhpopIyCFq3H8aUVCwnG3PGe4Rp6fLXJtMdyM0ojcIWvIz3HFnAPfrWTXb6GN'.
+ 'WaLXDwZjVz8pKEfhuIUFg/bAz9sVJ61nt61mxJFslLtq7e5yPqiBT4UDklKw4MDpt+u+9bFiu9riXNu83R+fcr6tohuQ5HQhmK37'.
+ 'paaC8DruScmg6X8KkjZEhbaB9KEyFYSOw26Uqd+e7Qerl5z74DY/1SomP//Z' ;
+
+ //==========================================================
+ // d2-small.jpg
+ //==========================================================
+ $this->digits['2'][0]= 606 ;
+ $this->digits['2'][1]=
+ '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
+ 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
+ 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEQMBIgACEQEDEQH/xAAYAAEBAQEBAAAAAAAAAAAAAAAFAAQHAv/EACsQAAEDBAEC'.
+ 'BAYDAAAAAAAAAAIBAwQABQYRIRIxQVFhcQcTFSJSU5GU0f/EABcBAAMBAAAAAAAAAAAAAAAAAAECAwT/xAAZEQACAwEAAAAAAAAA'.
+ 'AAAAAAAAARESUUH/2gAMAwEAAhEDEQA/AOqXm/Q8dxmOL4PPSnCSNFixx6nXnkXgRT3Te17JWbGsveueSyLZdbPItNxOKLzTLjou'.
+ 'gYCSoSoY8ISKSbFeUrzkdlnTL1YshskiErkQnFEZaF8kkdBBVdjyi6RNL5+9F486eS/ECVkcBtDt1vZcho5viS8ZCp9C9tAIAm/F'.
+ 'VoPRU+HRtJ5JVRP1kP0PfwP+1VKrHBMliXG4Nw8VgE4xGkuqk2S1wTUNEVdIvgpL9iL6KtNxY7WOwo9tt0RCitj0sR2uCbFPPzH1'.
+ '7+6rRuSRcljMBMsUy2tky045KOawZk5xtEFBJEROO3hx61kh2rPCIX3MhsyC4QmfTbC6lH8dq5212qwkiG5H6Y/9R2qm+ofxqqsL'.
+ 'DLZ6f//Z' ;
+
+ //==========================================================
+ // d9-small.jpg
+ //==========================================================
+ $this->digits['9'][0]= 680 ;
+ $this->digits['9'][1]=
+ '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
+ 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
+ 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABAUGBwP/xAArEAABAwMD'.
+ 'AgYBBQAAAAAAAAABAgMEBQYRABIhE1EUIjEzQUIHMlJhcdH/xAAWAQEBAQAAAAAAAAAAAAAAAAACAQD/xAAYEQEAAwEAAAAAAAAA'.
+ 'AAAAAAAAAREhQf/aAAwDAQACEQMRAD8AkK7brF6X7XpMeGoKhFMLEeT4ZUheEhanF4OcZ2pTgDykk92bZpdCsi7aezLjxkIPUZiV'.
+ 'RSCy8hah7EkZ27yM7V+iscal5bE22Lon1qNDmSKROd8Sl+Ix1lMOlIS4HGgQpbStoUCnlJz8HmsXtW3Lst2rmBAelLMRRekOwnYz'.
+ 'Edls9QKKnOVLyk7UgcbzzrdBthqEJJwZbAI4x1U/7o1TaFa9lG36aXaZTy54VrcXUgrzsGdx+T30aNydweqVw1GS87T6Lb86Q4ha'.
+ 'my/IAYjZBx+snKk99oOQMf1AViE65SY348hzFy6hPKnqtKz7DC1lbqyPrvJKUJ7H+M6Wrt3InP7o1brFNp4bCDGhxGAsqz69VSiQ'.
+ 'ORwBxrrQ7itm1ac7Hp0WoGTIc3PSn0pccdcP2WorycfA1RaRHjxosZqOyhtDTSAhCf2gDAGjVHTd9sKSCumynFEZK1tIJUe58/ro'.
+ '1V1//9k=' ;
+
+ //==========================================================
+ // d5-small.jpg
+ //==========================================================
+ $this->digits['5'][0]= 632 ;
+ $this->digits['5'][1]=
+ '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
+ 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
+ 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABgIFBwT/xAAoEAABAwME'.
+ 'AQQCAwAAAAAAAAABAgMEBQYRABIhIkEUMVFhBxNCgaH/xAAVAQEBAAAAAAAAAAAAAAAAAAAAAv/EABcRAQEBAQAAAAAAAAAAAAAA'.
+ 'AAABEUH/2gAMAwEAAhEDEQA/ANGvW4YVOeiRX5b4mv5Sin05IdlupPKdo/j2SO3+6TbPNQvOsTVz33KRT4csR3YUF7Dsh5OSFvug'.
+ 'kqG4FPBxnjxpvvi4KZb1pTpU+QwxUi2Y7ZIAefUk5ATxnB9/gbtL/wCH1UpuhPUlZlMVaQ0mS8zJjqZOPfc2TwpIUonI9tw40R1r'.
+ 'WNGq/wBdJR1XT3lqHBUnGCfkfWjRWs1ve249erQqQYjOtN1FqPUpCXQ4WIzQSsJwT0UpRwQPG0nzqyuNHobjsl9kBuWqoOoXtT1/'.
+ 'WppZcA8lKRj64HxqU+3KpAr6plElRVKef3S4E0K9O8pLXVzKcqSsJAB9wSAca6bSoNXeuA1+5pEV+SGFNU1iKVFqI0Vdx2AJUeoz'.
+ '8DGlTDwG3CAf3q/pI0ah6MDhLz6U+EpXwPoaNMU//9k=' ;
+
+ //==========================================================
+ // d1-small.jpg
+ //==========================================================
+ $this->digits['1'][0]= 646 ;
+ $this->digits['1'][1]=
+ '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
+ 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
+ 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEwMBIgACEQEDEQH/xAAZAAADAAMAAAAAAAAAAAAAAAAABQYCBAf/xAApEAACAQMD'.
+ 'AwQBBQAAAAAAAAABAgMEBREABiESMUEHEyJRkSNCYXGB/8QAFgEBAQEAAAAAAAAAAAAAAAAAAAEC/8QAFxEBAQEBAAAAAAAAAAAA'.
+ 'AAAAAAEREv/aAAwDAQACEQMRAD8A6jdd4WLbstILnc4Uq0VoWpkJknb6IjXLHJUePOlez923fcW4r1SxWlqC2UbdKirQif3Xw3yA'.
+ 'OFAGT09/kO3OmV3a20MFRf6lIYPcpy7yRRAzgxjIy2M8YwcdiBzpX6d22VNvUlTXsFkuwkrKqNSfnK7F8OTzwrAY+l5zoxKskudN'.
+ 'EgQPUT9PBkWF3DH+1GPxo1mLnRoAqF2VRgGOFmX/AAgY/GjRUP6hVMFv2FuFqUvUGrpDFJMBnpdyF5bsAQew7Hxzp6LZNT0yQ1DI'.
+ 'wp0QCFBhD0jCsfLZHxbx5xxpTuvb1+v9PV7Ztk9roLPLCjmSSN3mX5ZwqjCgZX7PfWxDQb2in96pv9qq46aTE0bW4x9ceAWAYPwS'.
+ 'PsYzoixgmheBGjIVcYCnjp/jHjHbRpe1JLn9OnopE/a0ykvjwDx47aNMXqP/2Q==' ;
+
+ //==========================================================
+ // d8-small.jpg
+ //==========================================================
+ $this->digits['8'][0]= 694 ;
+ $this->digits['8'][1]=
+ '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
+ 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
+ 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AFQMBIgACEQEDEQH/xAAYAAADAQEAAAAAAAAAAAAAAAAABgcEBf/EACsQAAEDAwMD'.
+ 'AwMFAAAAAAAAAAECAwQFBhEAEiEUMVEHE0EVYYEiIzJCsf/EABYBAQEBAAAAAAAAAAAAAAAAAAIAAf/EABcRAQEBAQAAAAAAAAAA'.
+ 'AAAAAAABERL/2gAMAwEAAhEDEQA/AKL6gVVUa0i1T5QjvTprUJMlxW4R9zgQXe/AH+kaWrntqlWjaq7gpcmotXAw82ht9yY4tch8'.
+ 'uAFC0k7VBXPGMY51ruiaue+bThIj+7NbWqS+7HDxajFf6AlB/k44o8ZOABk4xkL0X0tZiojKrlRuGRJjugqldSlKGf6t7BuUQe3J'.
+ '44xxxrA1a4KVJipLidri8uLHgqOcfjOPxo0o2hdDvS1CmV2Yl6fS5ioipIQR1CAlKkLKR2UUqAI8g6NRSwuuyHab6s1ufLI/Zai7'.
+ 'UBJOxhTS0+6B32pWSFH4CidOdWU0ukLiN1BLr0zG5Sdm3GRvcPhIT858DvjXNrVsSLnm/VIdTXS6tTnFsxZTSN3jchaTwps+O/z9'.
+ 'tcBVq3hIX0tYqlIiQHdy5CqRHKHXEjAOMgBKjnvyRk4xrQa7OiGt1K5biYZL8SoVEpjOqkFsONtJCNwASeCQrn7aNUKnQYtLp7EC'.
+ 'EylmLHQltptPZKQOBo1FzH//2Q==' ;
+
+ //==========================================================
+ // d4-small.jpg
+ //==========================================================
+ $this->digits['4'][0]= 643 ;
+ $this->digits['4'][1]=
+ '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
+ 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
+ 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAYAAADAQEAAAAAAAAAAAAAAAAABAYHAv/EAC0QAAIBAwQA'.
+ 'BAMJAAAAAAAAAAECAwQFEQAGEiETFDFBUmGBByIjUVNxobHR/8QAFgEBAQEAAAAAAAAAAAAAAAAAAAIB/8QAGBEBAAMBAAAAAAAA'.
+ 'AAAAAAAAAAERIVH/2gAMAwEAAhEDEQA/ANjM00Nxmt1xiWW31CZp5uJwoAAaOQ/n7qfcZHqO5my3q5XX7R6ijiqnNut9u4NyJ4yv'.
+ 'JJyjYr8Xhrn5g599J7x3ulBNU7Zo7dXXXcLQ8kURYi4epYtkALjOePv1nUvbLvV7P3BZm3DR3eh88Kp7pVzBZI6iUhGWRRGWwE44'.
+ 'HX3V+uiL1uHgt+vL/H+aNJQ3CSeCOaFqSaJ1DJKs/TqRkMOvQjvRorHE4pRDLNWLGlRHGUeYIORXs9e5B7OP31E0fmdyb/t0DJ4Q'.
+ '27bfx3YZzPUIoAAz7IpOD6cuxq0uNumqLfVNDOqXBoZEjnZcqhIPXH4c46+WkdoWOltu3IDDLLLVVR83UVcuPEmmcZZ2/rHoAANG'.
+ 'GI7KIY1ijoLeEQBVCwIoAHpgY6Hy0aZe7mJ2jeHLKcEhusj6aNKgzr//2Q==' ;
+
+ //==========================================================
+ // d7-small.jpg
+ //==========================================================
+ $this->digits['7'][0]= 658 ;
+ $this->digits['7'][1]=
+ '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
+ 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
+ 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABgEFBwT/xAAuEAABAwIE'.
+ 'BAQGAwAAAAAAAAABAgMEBREABiExEhMiQSMyUXEHFBclVJFhk9L/xAAXAQADAQAAAAAAAAAAAAAAAAAAAQID/8QAGREBAQEAAwAA'.
+ 'AAAAAAAAAAAAAAEREiFR/9oADAMBAAIRAxEAPwDXq9mCjZeQ05VZ5ZST4bfEpa3VdglCbqUe+g9MZ5Uq7V8415WXoMSdQ6etgSps'.
+ '19wpkCMDZKUpv0FZvbi1NzpYasMDLDUbMVXrtQdbeeU23xLWkj5RlLYK0J7anW9gbAjCzkOtsVSUJUdtc6dVZK51UeaFm4LKbhpC'.
+ 'l7EhIFkDW974GbRI2XorUVls1OTdKAOqUpR0Hc3198GITQ6k+hLwrEpoODiDenRfW23bBicg78JXxPpD0mgVOW5PAivNNpahsPW5'.
+ '8xxQaSVkboQnhsnYm5OHqDGp1IpsalMKjMsMIC3+XZKbJFth62/QOEfMOZqZXp9JcKZTcGmTky3meSi7xQklI81vMR+sXIz/AEgp'.
+ 'Q0qPNu6ea8Q2jqtbp8+2w9h/OKORc/cpHjt1dDSHOtLZ4ekHW23bBjj+o9H/AB539aP94MG0+L//2Q==' ;
+
+ //==========================================================
+ // d3-small.jpg
+ //==========================================================
+ $this->digits['3'][0]= 662 ;
+ $this->digits['3'][1]=
+ '/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
+ 'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
+ 'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABAUGBwL/xAArEAABBAED'.
+ 'AwMDBQEAAAAAAAABAgMEBREABhIhMUEiMmETFZEHFkJDUdH/xAAWAQEBAQAAAAAAAAAAAAAAAAABAAL/xAAYEQEBAQEBAAAAAAAA'.
+ 'AAAAAAAAEQExQf/aAAwDAQACEQMRAD8A0vclruBdk3VVLLUNssGRJsZSCtqOjlgJAHvcOD6c4HnOdIbcttw1W5P29cFEhuawqTXS'.
+ 'VsJjnCMBxKkJJx7goAde+ceJfdNxU0UNlyymyXHi6kxWUNl1S3EnkAEIHX2nv86qtTuZr9Q9+1VhRsOoYpYcgSVyAE/TdewkJxnK'.
+ 'sBCjkdPGpnOtFMd3PqsXgfOAgD8Y0aX+11H9rDDjn8lr9yj5J+dGqsqxaw6Cc9cQZU4Sp7zTJsIrKlcUEKwhSin1JABI45GUjqOu'.
+ 'lbOvjbc3Ts9ynjGCy445UuFLYRzbWgrT6fhSCQSMDke+pew2zYVly/d7YchNqkMJZnQpgV9J8IzwWFJyUrAJHYgjvpLbu37G5nR7'.
+ 'vck5C3YRKYEOEVJZj8kjKypXqWvirjk9h+dB9i4faa89TDZUfKlIyT8k+To10a6KTkpcJ/0vL/7o0TS//9k=' ;
+ }
}
class AntiSpam {
var $iNumber='';
- function AntiSpam($aNumber='') {
- $this->iNumber = $aNumber;
+ function __construct($aNumber='') {
+ $this->iNumber = $aNumber;
}
function Rand($aLen) {
- $d='';
- for($i=0; $i < $aLen; ++$i) {
- $d .= rand(1,9);
- }
- $this->iNumber = $d;
- return $d;
+ $d='';
+ for($i=0; $i < $aLen; ++$i) {
+ $d .= rand(1,9);
+ }
+ $this->iNumber = $d;
+ return $d;
}
function Stroke() {
- $n=strlen($this->iNumber);
- for($i=0; $i < $n; ++$i ) {
- if( !is_numeric($this->iNumber[$i]) || $this->iNumber[$i]==0 ) {
- return false;
- }
- }
-
- $dd = new HandDigits();
- $n = strlen($this->iNumber);
- $img = @imagecreatetruecolor($n*$dd->iWidth, $dd->iHeight);
- if( $img < 1 ) {
- return false;
- }
- $start=0;
- for($i=0; $i < $n; ++$i ) {
- $size = $dd->digits[$this->iNumber[$i]][0];
- $dimg = imagecreatefromstring(base64_decode($dd->digits[$this->iNumber[$i]][1]));
- imagecopy($img,$dimg,$start,0,0,0,imagesx($dimg), $dd->iHeight);
- $start += imagesx($dimg);
- }
- $resimg = @imagecreatetruecolor($start+4, $dd->iHeight+4);
- if( $resimg < 1 ) {
- return false;
- }
- imagecopy($resimg,$img,2,2,0,0,$start, $dd->iHeight);
- header("Content-type: image/jpeg");
- imagejpeg($resimg);
- return true;
+ $n=strlen($this->iNumber);
+ for($i=0; $i < $n; ++$i ) {
+ if( !is_numeric($this->iNumber[$i]) || $this->iNumber[$i]==0 ) {
+ return false;
+ }
+ }
+
+ $dd = new HandDigits();
+ $n = strlen($this->iNumber);
+ $img = @imagecreatetruecolor($n*$dd->iWidth, $dd->iHeight);
+ if( $img < 1 ) {
+ return false;
+ }
+ $start=0;
+ for($i=0; $i < $n; ++$i ) {
+ $size = $dd->digits[$this->iNumber[$i]][0];
+ $dimg = imagecreatefromstring(base64_decode($dd->digits[$this->iNumber[$i]][1]));
+ imagecopy($img,$dimg,$start,0,0,0,imagesx($dimg), $dd->iHeight);
+ $start += imagesx($dimg);
+ }
+ $resimg = @imagecreatetruecolor($start+4, $dd->iHeight+4);
+ if( $resimg < 1 ) {
+ return false;
+ }
+ imagecopy($resimg,$img,2,2,0,0,$start, $dd->iHeight);
+ header("Content-type: image/jpeg");
+ imagejpeg($resimg);
+ return true;
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_antispam.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_antispam.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_antispam.php 2006-10-08 04:09:02.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_antispam.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,23 +1,24 @@
chars['j'][0]= 658 ;
-$this->chars['j'][1]=
+ public $chars = array();
+ public $iHeight=30, $iWidth=30;
+
+ function __construct() {
+
+ //==========================================================
+ // lj-small.jpg
+ //==========================================================
+ $this->chars['j'][0]= 658 ;
+ $this->chars['j'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABUDASIAAhEBAxEB/8QAGAAAAwEBAAAAAAAAAAAAAAAAAAUGBAf/xAAsEAACAQMDAwMBCQAAAAAAAAAB'.
@@ -28,11 +29,11 @@
'jEoKiOecXBqh2TDDYIXLKuP6549xk8auI6aJqV45oknWdNswkAIkGMYIxjGO2NR1F0LZY5qkWqkS1xrM0M8lMSJpY+TGrnJiQ577'.
'cEgeNHhi7D3qC3UN69M8tIakRhgrh9o748+eNGtcCiKjjpkQKlMTEg3ZwoxtHHtgfTRpYXArvp//2Q==' ;
-//==========================================================
-// lf-small.jpg
-//==========================================================
-$this->chars['f'][0]= 633 ;
-$this->chars['f'][1]=
+ //==========================================================
+ // lf-small.jpg
+ //==========================================================
+ $this->chars['f'][0]= 633 ;
+ $this->chars['f'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABcDASIAAhEBAxEB/8QAGQAAAgMBAAAAAAAAAAAAAAAAAAQFBgcC/8QAKxAAAgEDAwMCBQUAAAAAAAAA'.
@@ -43,11 +44,11 @@
'aNItzr4usVNdG3S0rmRYAVwEUmyjyQLZ11x7aF4zs9DQOyzml29I2cLa/pixIHi99DFCtU9dFuLIaijo9qiYPmR2mZmB9thgAHOD'.
'4+mjUrURyrUNMZFEkkIOFuFAbsP9d/OjVIQ6Vh4tP//Z' ;
-//==========================================================
-// lb-small.jpg
-//==========================================================
-$this->chars['b'][0]= 645 ;
-$this->chars['b'][1]=
+ //==========================================================
+ // lb-small.jpg
+ //==========================================================
+ $this->chars['b'][0]= 645 ;
+ $this->chars['b'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABUDASIAAhEBAxEB/8QAGQAAAgMBAAAAAAAAAAAAAAAAAAYCAwUH/8QAKxAAAQMDAwMDAwUAAAAAAAAA'.
@@ -58,11 +59,11 @@
'HTG/CWx5wPY8AADx2NYk3SL9wukvUjGobnBkORksIbjdMANozgEqSo8qJPGO/wAVO36IsjUmBIfZfuM7epZk3F9UhSSk5O0K9Kcq'.
'8AcU3UzFuhUSBFud6nRXoz96mqmJZWg7m2dqUNhWBwdqQSP1UU5c/FFCn//Z' ;
-//==========================================================
-// d6-small.jpg
-//==========================================================
-$this->chars['6'][0]= 645 ;
-$this->chars['6'][1]=
+ //==========================================================
+ // d6-small.jpg
+ //==========================================================
+ $this->chars['6'][0]= 645 ;
+ $this->chars['6'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAEBAAMBAAAAAAAAAAAAAAAABgMEBwX/xAAvEAABAwMC'.
@@ -73,11 +74,11 @@
'WaLXDwZjVz8pKEfhuIUFg/bAz9sVJ61nt61mxJFslLtq7e5yPqiBT4UDklKw4MDpt+u+9bFiu9riXNu83R+fcr6tohuQ5HQhmK37'.
'paaC8DruScmg6X8KkjZEhbaB9KEyFYSOw26Uqd+e7Qerl5z74DY/1SomP//Z' ;
-//==========================================================
-// lx-small.jpg
-//==========================================================
-$this->chars['x'][0]= 650 ;
-$this->chars['x'][1]=
+ //==========================================================
+ // lx-small.jpg
+ //==========================================================
+ $this->chars['x'][0]= 650 ;
+ $this->chars['x'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABMDASIAAhEBAxEB/8QAGAAAAwEBAAAAAAAAAAAAAAAAAAUHBgj/xAApEAABAwMDAwQCAwAAAAAAAAAB'.
@@ -88,11 +89,11 @@
'9wQdveOEqBIB425xqhQuk8qo9UKlPrlRblw2ZBeCSVKW6CcoSrI2AGOT41SKzT4dYtmdS5bIXDZhNoWgbZJ94x8AYT/GkM03oNUc'.
'uKgwqtTZDTMOU0FttqRkoHggnPkEEHRrkJ6t1SlSHYUOc6zHaWrsbQrATk5/vRqK/9k=' ;
-//==========================================================
-// d2-small.jpg
-//==========================================================
-$this->chars['2'][0]= 606 ;
-$this->chars['2'][1]=
+ //==========================================================
+ // d2-small.jpg
+ //==========================================================
+ $this->chars['2'][0]= 606 ;
+ $this->chars['2'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEQMBIgACEQEDEQH/xAAYAAEBAQEBAAAAAAAAAAAAAAAFAAQHAv/EACsQAAEDBAEC'.
@@ -103,11 +104,11 @@
'7+6rRuSRcljMBMsUy2tky045KOawZk5xtEFBJEROO3hx61kh2rPCIX3MhsyC4QmfTbC6lH8dq5212qwkiG5H6Y/9R2qm+ofxqqsL'.
'DLZ6f//Z' ;
-//==========================================================
-// lm-small.jpg
-//==========================================================
-$this->chars['m'][0]= 649 ;
-$this->chars['m'][1]=
+ //==========================================================
+ // lm-small.jpg
+ //==========================================================
+ $this->chars['m'][0]= 649 ;
+ $this->chars['m'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABcDASIAAhEBAxEB/8QAGgAAAgMBAQAAAAAAAAAAAAAAAAcDBAUCBv/EAC0QAAICAQMCBAMJAAAAAAAA'.
@@ -118,11 +119,11 @@
'LNjJwM99bm67NB1Ht89KSxNXnr2hNDbiUc47K4KyD2GQMfmMjUnS+7vuIktTqPCaaWCqAMMojPFyw8hyYMQBnAwNJHYGXPTsW9VN'.
'jg2zf50W9zk524GAEihuz+xbIOD82jW5TkjtRPZkTkJ+4VgDhQfuj/f3OjUxl1f/2Q==' ;
-//==========================================================
-// lt-small.jpg
-//==========================================================
-$this->chars['t'][0]= 648 ;
-$this->chars['t'][1]=
+ //==========================================================
+ // lt-small.jpg
+ //==========================================================
+ $this->chars['t'][0]= 648 ;
+ $this->chars['t'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABcDASIAAhEBAxEB/8QAGQAAAgMBAAAAAAAAAAAAAAAAAAQDBQYH/8QAJxAAAQMDAgYDAQEAAAAAAAAA'.
@@ -133,11 +134,11 @@
'+zjtq6mtsyJjclxpKlUhSXEbkgkqWnBx4+J5e/zU0pZemPvJJQzEPDfQOrwwFY9AZ5eeYPLV6FwhoFYZuigxpkJeIjqAeIoAk9wA'.
'D46EnuD+6Nc1smDNrTlRkxqtMo1vzKhIdYgU9YDqVpISrLhHxSSd21I0aYyqP//Z' ;
-//==========================================================
-// li-small.jpg
-//==========================================================
-$this->chars['i'][0]= 639 ;
-$this->chars['i'][1]=
+ //==========================================================
+ // li-small.jpg
+ //==========================================================
+ $this->chars['i'][0]= 639 ;
+ $this->chars['i'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABYDASIAAhEBAxEB/8QAFwABAQEBAAAAAAAAAAAAAAAABwAGBP/EACcQAAEEAQMEAgIDAAAAAAAAAAEC'.
@@ -147,13 +148,13 @@
't2fmEIckqIZaaKuSGG0lQ4gduRoFRHQ9AOgs2lOJbk9aSUlpjGvAWeSVH2VKq/2dFPw3IjyJe8s281ct3I9UoHJXGiQkD2STrSZ7'.
'Yf8AOl7JTdw5eOCz0jw3+LbYCfA9nz71msb8KMxoTGTw+5srjsipAdDqFBQBIuiOl6KrdYyJMyTCshlw2G3Fr/HiNqNNAqJJUoGl'.
'KND+h47km1bZwsvCbYYjycxIyK1qDv2yEi0hQviK8atKDcy9j//Z' ;
-
-//==========================================================
-// lp-small.jpg
-//==========================================================
-$this->chars['p'][0]= 700 ;
-$this->chars['p'][1]=
+
+ //==========================================================
+ // lp-small.jpg
+ //==========================================================
+ $this->chars['p'][0]= 700 ;
+ $this->chars['p'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABcDASIAAhEBAxEB/8QAGgAAAQUBAAAAAAAAAAAAAAAAAAECBAUGB//EAC8QAAEDAwMCBAMJAAAAAAAA'.
@@ -165,11 +166,11 @@
'eQukO3ejUxgENqTcfnE5WbkHiOnJ76N2IqI1DibabptS+zkZhtp90F2Y0S026EkAFK/qL46cXv65NVZDfxHmVCK4DE2/RX/lRFbA'.
'C5LwAyq2EtpHZI7mxPYDRqoctdESimz/2Q==' ;
-//==========================================================
-// le-small.jpg
-//==========================================================
-$this->chars['e'][0]= 700 ;
-$this->chars['e'][1]=
+ //==========================================================
+ // le-small.jpg
+ //==========================================================
+ $this->chars['e'][0]= 700 ;
+ $this->chars['e'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABgDASIAAhEBAxEB/8QAGQAAAgMBAAAAAAAAAAAAAAAAAAYEBQcB/8QAKhAAAQMCBAUEAwEAAAAAAAAA'.
@@ -181,11 +182,11 @@
'TGc1ng6eYs0idczXUZscBBABWgEhEtfKNuUezwPnBhEuj8X2M21z9BR6NUX211Kk/UKKAjuhkPhL7XVf8vtgw7UPJlEyrDWFSYLb'.
'LBNF6qrzG6t0spEu6+fpL7YMXhUndp//2Q==' ;
-//==========================================================
-// la-small.jpg
-//==========================================================
-$this->chars['a'][0]= 730 ;
-$this->chars['a'][1]=
+ //==========================================================
+ // la-small.jpg
+ //==========================================================
+ $this->chars['a'][0]= 730 ;
+ $this->chars['a'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABoDASIAAhEBAxEB/8QAGAABAAMBAAAAAAAAAAAAAAAABgMEBwX/xAAvEAABAwIFAQcCBwAAAAAAAAAB'.
@@ -197,11 +198,11 @@
'UGaD1c9HSR1HFUh9tJU45EBcAtcC9+P9wqbg8IAto9o81yputrVGpiUkgHKkqUTZI32+cKm1z1tIUgPBBAKQ4UBQH3uL3xmXSXep'.
'HVDtXStE5K5jlPU7PF3Q41+okJFkjgC+3OuNSYiSzHaLtRcW4UDMpLYSCbakDW3thhum5p//2Q==' ;
-//==========================================================
-// d9-small.jpg
-//==========================================================
-$this->chars['9'][0]= 680 ;
-$this->chars['9'][1]=
+ //==========================================================
+ // d9-small.jpg
+ //==========================================================
+ $this->chars['9'][0]= 680 ;
+ $this->chars['9'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABAUGBwP/xAArEAABAwMD'.
@@ -213,11 +214,11 @@
'ORwBxrrQ7itm1ac7Hp0WoGTIc3PSn0pccdcP2WorycfA1RaRHjxosZqOyhtDTSAhCf2gDAGjVHTd9sKSCumynFEZK1tIJUe58/ro'.
'1V1//9k=' ;
-//==========================================================
-// d5-small.jpg
-//==========================================================
-$this->chars['5'][0]= 632 ;
-$this->chars['5'][1]=
+ //==========================================================
+ // d5-small.jpg
+ //==========================================================
+ $this->chars['5'][0]= 632 ;
+ $this->chars['5'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABgIFBwT/xAAoEAABAwME'.
@@ -228,11 +229,11 @@
'WppZcA8lKRj64HxqU+3KpAr6plElRVKef3S4E0K9O8pLXVzKcqSsJAB9wSAca6bSoNXeuA1+5pEV+SGFNU1iKVFqI0Vdx2AJUeoz'.
'8DGlTDwG3CAf3q/pI0ah6MDhLz6U+EpXwPoaNMU//9k=' ;
-//==========================================================
-// d1-small.jpg
-//==========================================================
-$this->chars['1'][0]= 646 ;
-$this->chars['1'][1]=
+ //==========================================================
+ // d1-small.jpg
+ //==========================================================
+ $this->chars['1'][0]= 646 ;
+ $this->chars['1'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEwMBIgACEQEDEQH/xAAZAAADAAMAAAAAAAAAAAAAAAAABQYCBAf/xAApEAACAQMD'.
@@ -243,11 +244,11 @@
'wp0QCFBhD0jCsfLZHxbx5xxpTuvb1+v9PV7Ztk9roLPLCjmSSN3mX5ZwqjCgZX7PfWxDQb2in96pv9qq46aTE0bW4x9ceAWAYPwS'.
'PsYzoixgmheBGjIVcYCnjp/jHjHbRpe1JLn9OnopE/a0ykvjwDx47aNMXqP/2Q==' ;
-//==========================================================
-// ll-small.jpg
-//==========================================================
-$this->chars['l'][0]= 626 ;
-$this->chars['l'][1]=
+ //==========================================================
+ // ll-small.jpg
+ //==========================================================
+ $this->chars['l'][0]= 626 ;
+ $this->chars['l'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABcDASIAAhEBAxEB/8QAGAAAAgMAAAAAAAAAAAAAAAAAAAYEBQf/xAArEAACAQIFAwIGAwAAAAAAAAAB'.
@@ -259,11 +260,11 @@
'Ivgw+T0yRRyyxIqNfkLcA8jt7YMKcBWn/9k=' ;
-//==========================================================
-// ls-small.jpg
-//==========================================================
-$this->chars['s'][0]= 701 ;
-$this->chars['s'][1]=
+ //==========================================================
+ // ls-small.jpg
+ //==========================================================
+ $this->chars['s'][0]= 701 ;
+ $this->chars['s'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABQDASIAAhEBAxEB/8QAGgAAAgMBAQAAAAAAAAAAAAAAAAMCBAUGB//EACwQAAEEAQIFAgUFAAAAAAAA'.
@@ -275,11 +276,11 @@
'2k1HvlT3ri2sLOCgtsyJz6XEtBwZPAgJAGQMHUNPWKqWItsqh0UCFVyLeKhyLHQ2TMdHNVj+RKlAnJyfto1FW2ahgjrq6LYTFjjf'.
'lymUOLdWfJyoHA+gA7AAAaNPE3ysJdLT/9k=' ;
-//==========================================================
-// lh-small.jpg
-//==========================================================
-$this->chars['h'][0]= 677 ;
-$this->chars['h'][1]=
+ //==========================================================
+ // lh-small.jpg
+ //==========================================================
+ $this->chars['h'][0]= 677 ;
+ $this->chars['h'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABUDASIAAhEBAxEB/8QAGgAAAQUBAAAAAAAAAAAAAAAAAAIDBAUGB//EACwQAAIBAwMCBQIHAAAAAAAA'.
@@ -292,11 +293,11 @@
'/9k=' ;
-//==========================================================
-// ld-small.jpg
-//==========================================================
-$this->chars['d'][0]= 681 ;
-$this->chars['d'][1]=
+ //==========================================================
+ // ld-small.jpg
+ //==========================================================
+ $this->chars['d'][0]= 681 ;
+ $this->chars['d'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABcDASIAAhEBAxEB/8QAGAAAAwEBAAAAAAAAAAAAAAAAAAQFBgH/xAAsEAABAwMEAAQFBQAAAAAAAAAB'.
@@ -308,11 +309,11 @@
'slsRKo0HwlODkBRzxj2AGoXTtpzIdQ8MbffUChz4NCPRaClAo9Mn6c7T3o13wytmo0K05VIqkiPJbizFiMWs4CTgnIIHOST796NL'.
'Ia1JX//Z' ;
-//==========================================================
-// d8-small.jpg
-//==========================================================
-$this->chars['8'][0]= 694 ;
-$this->chars['8'][1]=
+ //==========================================================
+ // d8-small.jpg
+ //==========================================================
+ $this->chars['8'][0]= 694 ;
+ $this->chars['8'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AFQMBIgACEQEDEQH/xAAYAAADAQEAAAAAAAAAAAAAAAAABgcEBf/EACsQAAEDAwMD'.
@@ -324,11 +325,11 @@
'tcBVq3hIX0tYqlIiQHdy5CqRHKHXEjAOMgBKjnvyRk4xrQa7OiGt1K5biYZL8SoVEpjOqkFsONtJCNwASeCQrn7aNUKnQYtLp7EC'.
'EylmLHQltptPZKQOBo1FzH//2Q==' ;
-//==========================================================
-// lz-small.jpg
-//==========================================================
-$this->chars['z'][0]= 690 ;
-$this->chars['z'][1]=
+ //==========================================================
+ // lz-small.jpg
+ //==========================================================
+ $this->chars['z'][0]= 690 ;
+ $this->chars['z'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABYDASIAAhEBAxEB/8QAFwABAQEBAAAAAAAAAAAAAAAABgAHA//EACsQAAEDAwQBAwIHAAAAAAAAAAEC'.
@@ -340,11 +341,11 @@
'4lLlyJk2cEqW+6V+m0AE9ISLnsj5+O9UhsFK92bZZqb9SRu9p2c4A0OCEqDbYAJSlJwAVZv3fBvbFrg/462btlhuS1RG5nL8pYkq'.
'KrnsKH06I/rVrQKkf//Z' ;
-//==========================================================
-// d4-small.jpg
-//==========================================================
-$this->chars['4'][0]= 643 ;
-$this->chars['4'][1]=
+ //==========================================================
+ // d4-small.jpg
+ //==========================================================
+ $this->chars['4'][0]= 643 ;
+ $this->chars['4'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAYAAADAQEAAAAAAAAAAAAAAAAABAYHAv/EAC0QAAIBAwQA'.
@@ -355,11 +356,11 @@
'27bfx3YZzPUIoAAz7IpOD6cuxq0uNumqLfVNDOqXBoZEjnZcqhIPXH4c46+WkdoWOltu3IDDLLLVVR83UVcuPEmmcZZ2/rHoAANG'.
'GI7KIY1ijoLeEQBVCwIoAHpgY6Hy0aZe7mJ2jeHLKcEhusj6aNKgzr//2Q==' ;
-//==========================================================
-// lv-small.jpg
-//==========================================================
-$this->chars['v'][0]= 648 ;
-$this->chars['v'][1]=
+ //==========================================================
+ // lv-small.jpg
+ //==========================================================
+ $this->chars['v'][0]= 648 ;
+ $this->chars['v'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABQDASIAAhEBAxEB/8QAGQAAAgMBAAAAAAAAAAAAAAAAAAQDBQYH/8QAKBAAAQQBAwMEAgMAAAAAAAAA'.
@@ -370,11 +371,11 @@
'shyW6AocpHNIrv8AvWzk9BUSdPdYS4BcRlomkhIV6KP0VE39V+tU2wdlRMHtZUB8NuTQ+51X27+Kr46ZPIAFV540D8zeLsJ5LMHa'.
'ubmMBCVJdjx0pRyLoWR4I8aNIQ8BvZMNtMTeUcsptKfc4tC1gAkCyFC+K0aJtf/Z' ;
-//==========================================================
-// lk-small.jpg
-//==========================================================
-$this->chars['k'][0]= 680 ;
-$this->chars['k'][1]=
+ //==========================================================
+ // lk-small.jpg
+ //==========================================================
+ $this->chars['k'][0]= 680 ;
+ $this->chars['k'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABUDASIAAhEBAxEB/8QAGQAAAwEBAQAAAAAAAAAAAAAAAAUGBAMH/8QALhAAAQMDAwIEBAcAAAAAAAAA'.
@@ -386,11 +387,11 @@
'hQ5bXb1K9Scuybdxo2OTu92dwSZkWn0Sb8viQWyn8Qq5D6ifSLd0BIv7q0arTBRSKPToMZbi2GWylsvLK148Wue/XRrRjxOpT2R2'.
'k9aP/9k=' ;
-//==========================================================
-// lr-small.jpg
-//==========================================================
-$this->chars['r'][0]= 681 ;
-$this->chars['r'][1]=
+ //==========================================================
+ // lr-small.jpg
+ //==========================================================
+ $this->chars['r'][0]= 681 ;
+ $this->chars['r'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABYDASIAAhEBAxEB/8QAGgAAAgIDAAAAAAAAAAAAAAAAAAYCBQMEB//EAC4QAAICAQIFAgMJAQAAAAAA'.
@@ -402,11 +403,11 @@
'2K2qcnK0Z5S8gPjrgAY8cNEWmq7u23pEos6/Zji+Kd0rLLGWwseA3joeZj/w4OET1g0vlmrWV+ydFnkUxSgsvM4V+YYIwfHz6cHB'.
'ZeKZ1//Z' ;
-//==========================================================
-// lg-small.jpg
-//==========================================================
-$this->chars['g'][0]= 655 ;
-$this->chars['g'][1]=
+ //==========================================================
+ // lg-small.jpg
+ //==========================================================
+ $this->chars['g'][0]= 655 ;
+ $this->chars['g'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABQDASIAAhEBAxEB/8QAGQAAAgMBAAAAAAAAAAAAAAAAAAQCBQYH/8QAJxAAAQQBAwQCAgMAAAAAAAAA'.
@@ -417,11 +418,11 @@
'KvtaSkW4tYNVSqKiTwB+fw5n9sY/cuOXCzDDcluyW3Ckd7V+0n0eNZTH9DdouFalHIOJBUhtDki0pNV3UALo81ehG6IdKjPZ6d47'.
'4ywltanVJvuJI+RQs/sHRqy2r003JhsImEc/CUyhxRZBjKV2oJ8eRXNmufPnRo1WIz3DdNn/2Q==' ;
-//==========================================================
-// lc-small.jpg
-//==========================================================
-$this->chars['c'][0]= 629 ;
-$this->chars['c'][1]=
+ //==========================================================
+ // lc-small.jpg
+ //==========================================================
+ $this->chars['c'][0]= 629 ;
+ $this->chars['c'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABcDASIAAhEBAxEB/8QAGQAAAwEBAQAAAAAAAAAAAAAAAAUGBwID/8QALRAAAgICAQIEBAYDAAAAAAAA'.
@@ -432,11 +433,11 @@
'305xkaEV/GTULMUT1LD/AAGh8gIZS2jv+vpybb8NMIb0dVLWYWgiiU0vmMphOj6V0TvQI3rfsON1E6dYjGtisa0F1mAWR2NhG0WZ'.
'3Ls3TqNs5Hc9h23w49NWL9K+Q/VD5T/zhwPH/9k=' ;
-//==========================================================
-// d7-small.jpg
-//==========================================================
-$this->chars['7'][0]= 658 ;
-$this->chars['7'][1]=
+ //==========================================================
+ // d7-small.jpg
+ //==========================================================
+ $this->chars['7'][0]= 658 ;
+ $this->chars['7'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABgEFBwT/xAAuEAABAwIE'.
@@ -447,11 +448,11 @@
'8xxQaSVkboQnhsnYm5OHqDGp1IpsalMKjMsMIC3+XZKbJFth62/QOEfMOZqZXp9JcKZTcGmTky3meSi7xQklI81vMR+sXIz/AEgp'.
'Q0qPNu6ea8Q2jqtbp8+2w9h/OKORc/cpHjt1dDSHOtLZ4ekHW23bBjj+o9H/AB539aP94MG0+L//2Q==' ;
-//==========================================================
-// ly-small.jpg
-//==========================================================
-$this->chars['y'][0]= 672 ;
-$this->chars['y'][1]=
+ //==========================================================
+ // ly-small.jpg
+ //==========================================================
+ $this->chars['y'][0]= 672 ;
+ $this->chars['y'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABQDASIAAhEBAxEB/8QAGAAAAwEBAAAAAAAAAAAAAAAAAAQGBQf/xAArEAABAwMEAQIFBQAAAAAAAAAB'.
@@ -462,11 +463,11 @@
'DMds24l3HvcNr3Pi9gME6T9WWVsemdYWswwC2lPta4m5WMA3OdUExCmozUJD6g84ntMjrHIFBTdQz5yLDx/WDNytpwW6nAkViqVe'.
'uvmXdlme6n4dCwlRBKEgA2tj99QG7Ilncp5QqpU31PMsJ6x7A32f6SPxo0hPVCD45oVyKf0MtgeT97/nRrO7UOCFla3tn//Z' ;
-//==========================================================
-// d3-small.jpg
-//==========================================================
-$this->chars['3'][0]= 662 ;
-$this->chars['3'][1]=
+ //==========================================================
+ // d3-small.jpg
+ //==========================================================
+ $this->chars['3'][0]= 662 ;
+ $this->chars['3'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD//gAJSnBHcmFwaP/bAEMACAYGBwYFCAcHBwkJCAoMFA0MCwsMGRITDxQdGh8eHRocHCAkLicg'.
'IiwjHBwoNyksMDE0NDQfJzk9ODI8LjM0Mv/bAEMBCQkJDAsMGA0NGDIhHCEyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjIyMjIyMjIyMjIyMv/AABEIAB4AEgMBIgACEQEDEQH/xAAZAAACAwEAAAAAAAAAAAAAAAAABAUGBwL/xAArEAABBAED'.
@@ -477,11 +478,11 @@
'lbOvjbc3Ts9ynjGCy445UuFLYRzbWgrT6fhSCQSMDke+pew2zYVly/d7YchNqkMJZnQpgV9J8IzwWFJyUrAJHYgjvpLbu37G5nR7'.
'vck5C3YRKYEOEVJZj8kjKypXqWvirjk9h+dB9i4faa89TDZUfKlIyT8k+To10a6KTkpcJ/0vL/7o0TS//9k=' ;
-//==========================================================
-// ln-small.jpg
-//==========================================================
-$this->chars['n'][0]= 643 ;
-$this->chars['n'][1]=
+ //==========================================================
+ // ln-small.jpg
+ //==========================================================
+ $this->chars['n'][0]= 643 ;
+ $this->chars['n'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABQDASIAAhEBAxEB/8QAGwAAAgEFAAAAAAAAAAAAAAAAAAYCAQMEBQf/xAAtEAACAQMCBAUCBwAAAAAA'.
@@ -492,11 +493,11 @@
'fB7hj59/XJ08cPWaKj4gvlwSQiG7dCboqvLy9NOmQT9SM7ayJrBa6K5V91hjlWorp4JGUOAglRSiMMDb82/vgaBGTpVvtNUVtyJg'.
'5+WNAh5ZCu/r2+dGrgq0pi0DhmlRsSSAfqMd+b6ZyNu3po1Rk1yNBe3/2Q==' ;
-//==========================================================
-// lu-small.jpg
-//==========================================================
-$this->chars['u'][0]= 671 ;
-$this->chars['u'][1]=
+ //==========================================================
+ // lu-small.jpg
+ //==========================================================
+ $this->chars['u'][0]= 671 ;
+ $this->chars['u'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABcDASIAAhEBAxEB/8QAGQAAAgMBAAAAAAAAAAAAAAAAAAYDBAUH/8QAJRAAAQQBAwQDAQEAAAAAAAAA'.
@@ -507,11 +508,11 @@
'T1KBPdpV2f0pom/1Ws7cmPazu98Ltvcq3VzRHfehz8a4pirFEKRZo8eQT+eCdWYfS/b+WYnxpbuVcDRMdHcyTqg2fiAfiLoi+Rf+'.
'jT7Xc74HtOYnHyUOh8yWUvKeHhy0CiPVUAPoDRrm+OeznTva6lzsyMjCYbbaiNJjJSWElagD5tRpNUSALFeNGoOCH7Bv/9k=' ;
-//==========================================================
-// lw-small.jpg
-//==========================================================
-$this->chars['w'][0]= 673 ;
-$this->chars['w'][1]=
+ //==========================================================
+ // lw-small.jpg
+ //==========================================================
+ $this->chars['w'][0]= 673 ;
+ $this->chars['w'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABcDASIAAhEBAxEB/8QAGAAAAgMAAAAAAAAAAAAAAAAAAAYDBAX/xAAtEAACAQMDAgMHBQAAAAAAAAAB'.
@@ -522,11 +523,11 @@
'7oz/ALqitJulYJKuqvFsppHALLFb3cp9FBaXr+O51bq0q6i38KK5PDVAAxSzU6SIpz3Kjjn8jUFoS7uFmut1gq17xLFQ+DxOccj8'.
'Rsn+tVpiyJnqv09YfOXu5AycgZZQEhBZjgDBOOgwO/po0sttWHdNzqLruioa4UwmdaC3kYp4IwSvJlBHKQ4OSe3po0qxM6P/2Q==' ;
-//==========================================================
-// lq-small.jpg
-//==========================================================
-$this->chars['q'][0]= 671 ;
-$this->chars['q'][1]=
+ //==========================================================
+ // lq-small.jpg
+ //==========================================================
+ $this->chars['q'][0]= 671 ;
+ $this->chars['q'][1]=
'/9j/4AAQSkZJRgABAQEASgBKAAD/2wBDAAgGBgcGBQgHBwcJCQgKDBQNDAsLDBkSEw8UHRofHh0aHBwgJC4nICIsIxwcKDcpLDAx'.
'NDQ0Hyc5PTgyPC4zNDL/2wBDAQkJCQwLDBgNDRgyIRwhMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIyMjIy'.
'MjIyMjIyMjL/wAARCAAeABQDASIAAhEBAxEB/8QAGQAAAgMBAAAAAAAAAAAAAAAAAAcDBAUG/8QAKRAAAQQBBAICAQQDAAAAAAAA'.
@@ -539,85 +540,75 @@
- }
+ }
}
class AntiSpam {
- var $iData='';
- var $iDD=null;
+ private $iData='';
+ private $iDD=null;
- function AntiSpam($aData='') {
- $this->iData = $aData;
- $this->iDD = new HandDigits();
+ function __construct($aData='') {
+ $this->iData = $aData;
+ $this->iDD = new HandDigits();
}
function Set($aData) {
- $this->iData = $aData;
+ $this->iData = $aData;
}
function Rand($aLen) {
- $d='';
- for($i=0; $i < $aLen; ++$i) {
- if( rand(0,9) < 6 ) {
- // Digits
- $d .= chr( ord('1') + rand(0,8) );
- }
- else {
- // Letters
- do {
- $offset = rand(0,25);
- } while ( $offset==14 );
- $d .= chr( ord('a') + $offset );
- }
- }
- $this->iData = $d;
- return $d;
+ $d='';
+ for($i=0; $i < $aLen; ++$i) {
+ if( rand(0,9) < 6 ) {
+ // Digits
+ $d .= chr( ord('1') + rand(0,8) );
+ }
+ else {
+ // Letters
+ do {
+ $offset = rand(0,25);
+ } while ( $offset==14 );
+ $d .= chr( ord('a') + $offset );
+ }
+ }
+ $this->iData = $d;
+ return $d;
}
- function Stroke($aStrokeFileName="") {
+ function Stroke() {
- $n=strlen($this->iData);
- if( $n==0 ) {
- return false;
- }
-
- for($i=0; $i < $n; ++$i ) {
- if( $this->iData[$i]==='0' || strtolower($this->iData[$i])==='o') {
- return false;
- }
- }
-
- $img = @imagecreatetruecolor($n*$this->iDD->iWidth, $this->iDD->iHeight);
- if( $img < 1 ) {
- return false;
- }
-
- $start=0;
- for($i=0; $i < $n; ++$i ) {
- $dimg = imagecreatefromstring(base64_decode($this->iDD->chars[strtolower($this->iData[$i])][1]));
- imagecopy($img,$dimg,$start,0,0,0,imagesx($dimg), $this->iDD->iHeight);
- $start += imagesx($dimg);
- }
- $resimg = @imagecreatetruecolor($start+4, $this->iDD->iHeight+4);
- if( $resimg < 1 ) {
- return false;
- }
-
- imagecopy($resimg,$img,2,2,0,0,$start, $this->iDD->iHeight);
-
- if( $aStrokeFileName!="" ) {
- if( file_exists($aStrokeFileName) ) {
- if( !@unlink($aStrokeFileName) )
- return false;
- }
- imagejpeg($resimg,$aStrokeFileName);
- return;
- }
-
- header("Content-type: image/jpeg");
- $res=imagejpeg($resimg);
- return $res;
+ $n=strlen($this->iData);
+ if( $n==0 ) {
+ return false;
+ }
+
+ for($i=0; $i < $n; ++$i ) {
+ if( $this->iData[$i]==='0' || strtolower($this->iData[$i])==='o') {
+ return false;
+ }
+ }
+
+ $img = @imagecreatetruecolor($n*$this->iDD->iWidth, $this->iDD->iHeight);
+ if( $img < 1 ) {
+ return false;
+ }
+
+ $start=0;
+ for($i=0; $i < $n; ++$i ) {
+ $dimg = imagecreatefromstring(base64_decode($this->iDD->chars[strtolower($this->iData[$i])][1]));
+ imagecopy($img,$dimg,$start,0,0,0,imagesx($dimg), $this->iDD->iHeight);
+ $start += imagesx($dimg);
+ }
+ $resimg = @imagecreatetruecolor($start+4, $this->iDD->iHeight+4);
+ if( $resimg < 1 ) {
+ return false;
+ }
+
+ imagecopy($resimg,$img,2,2,0,0,$start, $this->iDD->iHeight);
+ header("Content-type: image/jpeg");
+ imagejpeg($resimg);
+ return true;
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_bar.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_bar.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_bar.php 2008-06-27 02:33:43.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_bar.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,13 +1,13 @@
Plot($datay,$datax);
- ++$this->numpoints;
- }
-
-//---------------
-// PUBLIC METHODS
-
+ public $fill=false,$fill_color="lightblue"; // Default is to fill with light blue
+ public $iPattern=-1,$iPatternDensity=80,$iPatternColor='black';
+ public $valuepos='top';
+ public $grad=false,$grad_style=1;
+ public $grad_fromcolor=array(50,50,200),$grad_tocolor=array(255,255,255);
+ public $ymin=0;
+ protected $width=0.4; // in percent of major ticks
+ protected $abswidth=-1; // Width in absolute pixels
+ protected $ybase=0; // Bars start at 0
+ protected $align="center";
+ protected $bar_shadow=false;
+ protected $bar_shadow_color="black";
+ protected $bar_shadow_hsize=3,$bar_shadow_vsize=3;
+
+ //---------------
+ // CONSTRUCTOR
+ function __construct($datay,$datax=false) {
+ parent::__construct($datay,$datax);
+ ++$this->numpoints;
+ }
+
+ //---------------
+ // PUBLIC METHODS
+
// Set a drop shadow for the bar (or rather an "up-right" shadow)
- function SetShadow($color="black",$hsize=3,$vsize=3,$show=true) {
- $this->bar_shadow=$show;
- $this->bar_shadow_color=$color;
- $this->bar_shadow_vsize=$vsize;
- $this->bar_shadow_hsize=$hsize;
-
- // Adjust the value margin to compensate for shadow
- $this->value->margin += $vsize;
+ function SetShadow($aColor="black",$aHSize=3,$aVSize=3,$aShow=true) {
+ $this->bar_shadow=$aShow;
+ $this->bar_shadow_color=$aColor;
+ $this->bar_shadow_vsize=$aVSize;
+ $this->bar_shadow_hsize=$aHSize;
+
+ // Adjust the value margin to compensate for shadow
+ $this->value->margin += $aVSize;
}
-
+
// DEPRECATED use SetYBase instead
function SetYMin($aYStartValue) {
- //die("JpGraph Error: Deprecated function SetYMin. Use SetYBase() instead.");
- $this->ybase=$aYStartValue;
+ //die("JpGraph Error: Deprecated function SetYMin. Use SetYBase() instead.");
+ $this->ybase=$aYStartValue;
}
// Specify the base value for the bars
function SetYBase($aYStartValue) {
- $this->ybase=$aYStartValue;
+ $this->ybase=$aYStartValue;
}
-
- function Legend(&$graph) {
- if( $this->grad && $this->legend!="" && !$this->fill ) {
- $color=array($this->grad_fromcolor,$this->grad_tocolor);
- // In order to differentiate between gradients and cooors specified as an RGB triple
- $graph->legend->Add($this->legend,$color,"",-$this->grad_style,
- $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
- }
- elseif( $this->legend!="" && ($this->iPattern > -1 || is_array($this->iPattern)) ) {
- if( is_array($this->iPattern) ) {
- $p1 = $this->iPattern[0];
- $p2 = $this->iPatternColor[0];
- $p3 = $this->iPatternDensity[0];
- }
- else {
- $p1 = $this->iPattern;
- $p2 = $this->iPatternColor;
- $p3 = $this->iPatternDensity;
- }
- $color = array($p1,$p2,$p3,$this->fill_color);
- // A kludge: Too mark that we add a pattern we use a type value of < 100
- $graph->legend->Add($this->legend,$color,"",-101,
- $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
- }
- elseif( $this->fill_color && $this->legend!="" ) {
- if( is_array($this->fill_color) ) {
- $graph->legend->Add($this->legend,$this->fill_color[0],"",0,
- $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
- }
- else {
- $graph->legend->Add($this->legend,$this->fill_color,"",0,
- $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
- }
- }
+
+ // The method will take the specified pattern anre
+ // return a pattern index that corresponds to the original
+ // patterm being rotated 90 degreees. This is needed when plottin
+ // Horizontal bars
+ function RotatePattern($aPat,$aRotate=true) {
+ $rotate = array(1 => 2, 2 => 1, 3 => 3, 4 => 5, 5 => 4, 6 => 6, 7 => 7, 8 => 8);
+ if( $aRotate ) {
+ return $rotate[$aPat];
+ }
+ else {
+ return $aPat;
+ }
+ }
+
+ function Legend($graph) {
+ if( $this->grad && $this->legend!="" && !$this->fill ) {
+ $color=array($this->grad_fromcolor,$this->grad_tocolor);
+ // In order to differentiate between gradients and cooors specified as an RGB triple
+ $graph->legend->Add($this->legend,$color,"",-$this->grad_style,
+ $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ }
+ elseif( $this->legend!="" && ($this->iPattern > -1 || is_array($this->iPattern)) ) {
+ if( is_array($this->iPattern) ) {
+ $p1 = $this->RotatePattern( $this->iPattern[0], $graph->img->a == 90 );
+ $p2 = $this->iPatternColor[0];
+ $p3 = $this->iPatternDensity[0];
+ }
+ else {
+ $p1 = $this->RotatePattern( $this->iPattern, $graph->img->a == 90 );
+ $p2 = $this->iPatternColor;
+ $p3 = $this->iPatternDensity;
+ }
+ if( $p3 < 90 ) $p3 += 5;
+ $color = array($p1,$p2,$p3,$this->fill_color);
+ // A kludge: Too mark that we add a pattern we use a type value of < 100
+ $graph->legend->Add($this->legend,$color,"",-101,
+ $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ }
+ elseif( $this->fill_color && $this->legend!="" ) {
+ if( is_array($this->fill_color) ) {
+ $graph->legend->Add($this->legend,$this->fill_color[0],"",0,
+ $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ }
+ else {
+ $graph->legend->Add($this->legend,$this->fill_color,"",0,
+ $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ }
+ }
}
// Gets called before any axis are stroked
- function PreStrokeAdjust(&$graph) {
- parent::PreStrokeAdjust($graph);
+ function PreStrokeAdjust($graph) {
+ parent::PreStrokeAdjust($graph);
- // If we are using a log Y-scale we want the base to be at the
- // minimum Y-value unless the user have specifically set some other
- // value than the default.
- if( substr($graph->axtype,-3,3)=="log" && $this->ybase==0 )
- $this->ybase = $graph->yaxis->scale->GetMinVal();
-
- // For a "text" X-axis scale we will adjust the
- // display of the bars a little bit.
- if( substr($graph->axtype,0,3)=="tex" ) {
- // Position the ticks between the bars
- $graph->xaxis->scale->ticks->SetXLabelOffset(0.5,0);
-
- // Center the bars
- if( $this->abswidth > -1 ) {
- $graph->SetTextScaleAbsCenterOff($this->abswidth);
- }
- else {
- if( $this->align == "center" )
- $graph->SetTextScaleOff(0.5-$this->width/2);
- elseif( $this->align == "right" )
- $graph->SetTextScaleOff(1-$this->width);
- }
-
- }
- /*
- elseif( is_a($this,'AccBarPlot') || is_a($this,'GroupBarPlot') ) {
- // We only set an absolute width for linear and int scale
- // for text scale the width will be set to a fraction of
- // the majstep width.
- if( $this->abswidth == -1 ) {
+ // If we are using a log Y-scale we want the base to be at the
+ // minimum Y-value unless the user have specifically set some other
+ // value than the default.
+ if( substr($graph->axtype,-3,3)=="log" && $this->ybase==0 )
+ $this->ybase = $graph->yaxis->scale->GetMinVal();
+
+ // For a "text" X-axis scale we will adjust the
+ // display of the bars a little bit.
+ if( substr($graph->axtype,0,3)=="tex" ) {
+ // Position the ticks between the bars
+ $graph->xaxis->scale->ticks->SetXLabelOffset(0.5,0);
+
+ // Center the bars
+ if( $this->abswidth > -1 ) {
+ $graph->SetTextScaleAbsCenterOff($this->abswidth);
+ }
+ else {
+ if( $this->align == "center" )
+ $graph->SetTextScaleOff(0.5-$this->width/2);
+ elseif( $this->align == "right" )
+ $graph->SetTextScaleOff(1-$this->width);
+ }
+ }
+ elseif( ($this instanceof AccBarPlot) || ($this instanceof GroupBarPlot) ) {
+ // We only set an absolute width for linear and int scale
+ // for text scale the width will be set to a fraction of
+ // the majstep width.
+ if( $this->abswidth == -1 ) {
// Not set
- // set width to a visuable sensible default
- $this->abswidth = $graph->img->plotwidth/(2*count($this->coords[0]));
- }
- }
- */
+ // set width to a visuable sensible default
+ $this->abswidth = $graph->img->plotwidth/(2*$this->numpoints);
+ }
+ }
}
function Min() {
- $m = parent::Min();
- if( $m[1] >= $this->ybase )
- $m[1] = $this->ybase;
- return $m;
+ $m = parent::Min();
+ if( $m[1] >= $this->ybase ) $m[1] = $this->ybase;
+ return $m;
}
function Max() {
- $m = parent::Max();
- if( $m[1] <= $this->ybase )
- $m[1] = $this->ybase;
- return $m;
- }
-
+ $m = parent::Max();
+ if( $m[1] <= $this->ybase ) $m[1] = $this->ybase;
+ return $m;
+ }
+
// Specify width as fractions of the major stepo size
function SetWidth($aWidth) {
- if( $aWidth > 1 ) {
- // Interpret this as absolute width
- $this->abswidth=$aWidth;
- }
- else
- $this->width=$aWidth;
+ if( $aWidth > 1 ) {
+ // Interpret this as absolute width
+ $this->abswidth=$aWidth;
+ }
+ else {
+ $this->width=$aWidth;
+ }
}
-
+
// Specify width in absolute pixels. If specified this
// overrides SetWidth()
function SetAbsWidth($aWidth) {
- $this->abswidth=$aWidth;
+ $this->abswidth=$aWidth;
}
-
+
function SetAlign($aAlign) {
- $this->align=$aAlign;
+ $this->align=$aAlign;
}
-
+
function SetNoFill() {
- $this->grad = false;
- $this->fill_color=false;
- $this->fill=false;
+ $this->grad = false;
+ $this->fill_color=false;
+ $this->fill=false;
}
-
+
function SetFillColor($aColor) {
- $this->fill = true ;
- $this->fill_color = $aColor;
+ // Do an extra error check if the color is specified as an RGB array triple
+ // In that case convert it to a hex string since it will otherwise be
+ // interpretated as an array of colors for each individual bar.
+
+ $aColor = RGB::tryHexConversion($aColor);
+ $this->fill = true ;
+ $this->fill_color=$aColor;
+
}
-
+
function SetFillGradient($aFromColor,$aToColor=null,$aStyle=null) {
- $this->grad = true;
- $this->grad_fromcolor = $aFromColor;
- $this->grad_tocolor = $aToColor;
- $this->grad_style = $aStyle;
+ $this->grad = true;
+ $this->grad_fromcolor = $aFromColor;
+ $this->grad_tocolor = $aToColor;
+ $this->grad_style = $aStyle;
}
-
+
function SetValuePos($aPos) {
- $this->valuepos = $aPos;
+ $this->valuepos = $aPos;
}
function SetPattern($aPattern, $aColor='black'){
- if( is_array($aPattern) ) {
- $n = count($aPattern);
- $this->iPattern = array();
- $this->iPatternDensity = array();
- if( is_array($aColor) ) {
- $this->iPatternColor = array();
- if( count($aColor) != $n ) {
- JpGraphError::RaiseL(2001);//('NUmber of colors is not the same as the number of patterns in BarPlot::SetPattern()');
- }
- }
- else
- $this->iPatternColor = $aColor;
- for( $i=0; $i < $n; ++$i ) {
- $this->_SetPatternHelper($aPattern[$i], $this->iPattern[$i], $this->iPatternDensity[$i]);
- if( is_array($aColor) ) {
- $this->iPatternColor[$i] = $aColor[$i];
- }
- }
- }
- else {
- $this->_SetPatternHelper($aPattern, $this->iPattern, $this->iPatternDensity);
- $this->iPatternColor = $aColor;
- }
+ if( is_array($aPattern) ) {
+ $n = count($aPattern);
+ $this->iPattern = array();
+ $this->iPatternDensity = array();
+ if( is_array($aColor) ) {
+ $this->iPatternColor = array();
+ if( count($aColor) != $n ) {
+ JpGraphError::RaiseL(2001);//('NUmber of colors is not the same as the number of patterns in BarPlot::SetPattern()');
+ }
+ }
+ else {
+ $this->iPatternColor = $aColor;
+ }
+ for( $i=0; $i < $n; ++$i ) {
+ $this->_SetPatternHelper($aPattern[$i], $this->iPattern[$i], $this->iPatternDensity[$i]);
+ if( is_array($aColor) ) {
+ $this->iPatternColor[$i] = $aColor[$i];
+ }
+ }
+ }
+ else {
+ $this->_SetPatternHelper($aPattern, $this->iPattern, $this->iPatternDensity);
+ $this->iPatternColor = $aColor;
+ }
}
function _SetPatternHelper($aPattern, &$aPatternValue, &$aDensity){
- switch( $aPattern ) {
- case PATTERN_DIAG1:
- $aPatternValue= 1;
- $aDensity = 90;
- break;
- case PATTERN_DIAG2:
- $aPatternValue= 1;
- $aDensity = 75;
- break;
- case PATTERN_DIAG3:
- $aPatternValue= 2;
- $aDensity = 90;
- break;
- case PATTERN_DIAG4:
- $aPatternValue= 2;
- $aDensity = 75;
- break;
- case PATTERN_CROSS1:
- $aPatternValue= 8;
- $aDensity = 90;
- break;
- case PATTERN_CROSS2:
- $aPatternValue= 8;
- $aDensity = 78;
- break;
- case PATTERN_CROSS3:
- $aPatternValue= 8;
- $aDensity = 65;
- break;
- case PATTERN_CROSS4:
- $aPatternValue= 7;
- $aDensity = 90;
- break;
- case PATTERN_STRIPE1:
- $aPatternValue= 5;
- $aDensity = 95;
- break;
- case PATTERN_STRIPE2:
- $aPatternValue= 5;
- $aDensity = 85;
- break;
- default:
- JpGraphError::RaiseL(2002);//('Unknown pattern specified in call to BarPlot::SetPattern()');
- }
- }
-
- function Stroke(&$img,&$xscale,&$yscale) {
-
- $numpoints = count($this->coords[0]);
- if( isset($this->coords[1]) ) {
- if( count($this->coords[1])!=$numpoints )
- JpGraphError::RaiseL(2003,count($this->coords[1]),$numpoints);
-//("Number of X and Y points are not equal. Number of X-points:".count($this->coords[1])."Number of Y-points:$numpoints");
- else
- $exist_x = true;
- }
- else
- $exist_x = false;
-
-
- $numbars=count($this->coords[0]);
-
- // Use GetMinVal() instead of scale[0] directly since in the case
- // of log scale we get a correct value. Log scales will have negative
- // values for values < 1 while still not representing negative numbers.
- if( $yscale->GetMinVal() >= 0 )
- $zp=$yscale->scale_abs[0];
- else {
- $zp=$yscale->Translate(0);
- }
-
- if( $this->abswidth > -1 ) {
- $abswidth=$this->abswidth;
- }
- else
- $abswidth=round($this->width*$xscale->scale_factor,0);
-
- // Count potential pattern array to avoid doing the count for each iteration
- if( is_array($this->iPattern) ) {
- $np = count($this->iPattern);
- }
-
- $grad = null;
- for($i=0; $i < $numbars; ++$i) {
-
- // If value is NULL, or 0 then don't draw a bar at all
- if ($this->coords[0][$i] === null || $this->coords[0][$i] === '' )
- continue;
-
- if( $exist_x ) $x=$this->coords[1][$i];
- else $x=$i;
-
- $x=$xscale->Translate($x);
-
-// Comment Note: This confuses the positioning when using acc together with
-// grouped bars. Workaround for fixing #191
-/*
- if( !$xscale->textscale ) {
- if($this->align=="center")
- $x -= $abswidth/2;
- elseif($this->align=="right")
- $x -= $abswidth;
- }
-
-*/
- // Stroke fill color and fill gradient
- $pts=array(
- $x,$zp,
- $x,$yscale->Translate($this->coords[0][$i]),
- $x+$abswidth,$yscale->Translate($this->coords[0][$i]),
- $x+$abswidth,$zp);
- if( $this->grad ) {
- if( $grad === null )
- $grad = new Gradient($img);
- if( is_array($this->grad_fromcolor) ) {
- // The first argument (grad_fromcolor) can be either an array or a single color. If it is an array
- // then we have two choices. It can either a) be a single color specified as an RGB triple or it can be
- // an array to specify both (from, to style) for each individual bar. The way to know the difference is
- // to investgate the first element. If this element is an integer [0,255] then we assume it is an RGB
- // triple.
- $ng = count($this->grad_fromcolor);
- if( $ng === 3 ) {
- if( is_numeric($this->grad_fromcolor[0]) && $this->grad_fromcolor[0] > 0 && $this->grad_fromcolor[0] < 256 ) {
- // RGB Triple
- $fromcolor = $this->grad_fromcolor;
- $tocolor = $this->grad_tocolor;
- $style = $this->grad_style;
- }
- }
- else {
- $fromcolor = $this->grad_fromcolor[$i % $ng][0];
- $tocolor = $this->grad_fromcolor[$i % $ng][1];
- $style = $this->grad_fromcolor[$i % $ng][2];
- }
- $grad->FilledRectangle($pts[2],$pts[3],
- $pts[6],$pts[7],
- $fromcolor,$tocolor,$style);
- }
- else {
- $grad->FilledRectangle($pts[2],$pts[3],
- $pts[6],$pts[7],
- $this->grad_fromcolor,$this->grad_tocolor,$this->grad_style);
- }
-
- }
- elseif( !empty($this->fill_color) ) {
- if(is_array($this->fill_color)) {
- $img->PushColor($this->fill_color[$i % count($this->fill_color)]);
- } else {
- $img->PushColor($this->fill_color);
- }
- $img->FilledPolygon($pts);
- $img->PopColor();
- }
-
-
- // Remember value of this bar
- $val=$this->coords[0][$i];
-
- if( !empty($val) && !is_numeric($val) ) {
- JpGraphError::RaiseL(2004,$i,$val);
-//('All values for a barplot must be numeric. You have specified value['.$i.'] == \''.$val.'\'');
- }
-
- // Determine the shadow
- if( $this->bar_shadow && $val != 0) {
-
- $ssh = $this->bar_shadow_hsize;
- $ssv = $this->bar_shadow_vsize;
- // Create points to create a "upper-right" shadow
- if( $val > 0 ) {
- $sp[0]=$pts[6]; $sp[1]=$pts[7];
- $sp[2]=$pts[4]; $sp[3]=$pts[5];
- $sp[4]=$pts[2]; $sp[5]=$pts[3];
- $sp[6]=$pts[2]+$ssh; $sp[7]=$pts[3]-$ssv;
- $sp[8]=$pts[4]+$ssh; $sp[9]=$pts[5]-$ssv;
- $sp[10]=$pts[6]+$ssh; $sp[11]=$pts[7]-$ssv;
- }
- elseif( $val < 0 ) {
- $sp[0]=$pts[4]; $sp[1]=$pts[5];
- $sp[2]=$pts[6]; $sp[3]=$pts[7];
- $sp[4]=$pts[0]; $sp[5]=$pts[1];
- $sp[6]=$pts[0]+$ssh; $sp[7]=$pts[1]-$ssv;
- $sp[8]=$pts[6]+$ssh; $sp[9]=$pts[7]-$ssv;
- $sp[10]=$pts[4]+$ssh; $sp[11]=$pts[5]-$ssv;
- }
- if( is_array($this->bar_shadow_color) ) {
- $numcolors = count($this->bar_shadow_color);
- if( $numcolors == 0 ) {
- JpGraphError::RaiseL(2005);//('You have specified an empty array for shadow colors in the bar plot.');
- }
- $img->PushColor($this->bar_shadow_color[$i % $numcolors]);
- }
- else {
- $img->PushColor($this->bar_shadow_color);
- }
- $img->FilledPolygon($sp);
- $img->PopColor();
- }
-
- // Stroke the pattern
- if( is_array($this->iPattern) ) {
- $f = new RectPatternFactory();
- if( is_array($this->iPatternColor) ) {
- $pcolor = $this->iPatternColor[$i % $np];
- }
- else
- $pcolor = $this->iPatternColor;
- $prect = $f->Create($this->iPattern[$i % $np],$pcolor,1);
- $prect->SetDensity($this->iPatternDensity[$i % $np]);
-
- if( $val < 0 ) {
- $rx = $pts[0];
- $ry = $pts[1];
- }
- else {
- $rx = $pts[2];
- $ry = $pts[3];
- }
- $width = abs($pts[4]-$pts[0])+1;
- $height = abs($pts[1]-$pts[3])+1;
- $prect->SetPos(new Rectangle($rx,$ry,$width,$height));
- $prect->Stroke($img);
- }
- else {
- if( $this->iPattern > -1 ) {
- $f = new RectPatternFactory();
- $prect = $f->Create($this->iPattern,$this->iPatternColor,1);
- $prect->SetDensity($this->iPatternDensity);
- if( $val < 0 ) {
- $rx = $pts[0];
- $ry = $pts[1];
- }
- else {
- $rx = $pts[2];
- $ry = $pts[3];
- }
- $width = abs($pts[4]-$pts[0])+1;
- $height = abs($pts[1]-$pts[3])+1;
- $prect->SetPos(new Rectangle($rx,$ry,$width,$height));
- $prect->Stroke($img);
- }
- }
- // Stroke the outline of the bar
- if( is_array($this->color) )
- $img->SetColor($this->color[$i % count($this->color)]);
- else
- $img->SetColor($this->color);
-
- $pts[] = $pts[0];
- $pts[] = $pts[1];
-
- if( $this->weight > 0 ) {
- $img->SetLineWeight($this->weight);
- $img->Polygon($pts);
- }
-
- // Determine how to best position the values of the individual bars
- $x=$pts[2]+($pts[4]-$pts[2])/2;
- $this->value->SetMargin(5);
-
- if( $this->valuepos=='top' ) {
- $y=$pts[3];
- if( $img->a === 90 ) {
- if( $val < 0 )
- $this->value->SetAlign('right','center');
- else
- $this->value->SetAlign('left','center');
-
- }
- else {
- if( $val < 0 ) {
- $this->value->SetMargin(-5);
- $y=$pts[1];
- $this->value->SetAlign('center','bottom');
- }
- else {
- $this->value->SetAlign('center','bottom');
- }
-
- }
- $this->value->Stroke($img,$val,$x,$y);
- }
- elseif( $this->valuepos=='max' ) {
- $y=$pts[3];
- if( $img->a === 90 ) {
- if( $val < 0 ) {
- $this->value->SetAlign('left','center');
- }
- else {
- $this->value->SetAlign('right','center');
- }
- }
- else {
- if( $val < 0 ) {
- $this->value->SetAlign('center','bottom');
- }
- else {
- $this->value->SetAlign('center','top');
- }
- }
- $this->value->SetMargin(-5);
- $this->value->Stroke($img,$val,$x,$y);
- }
- elseif( $this->valuepos=='center' ) {
- $y = ($pts[3] + $pts[1])/2;
- $this->value->SetAlign('center','center');
- $this->value->SetMargin(0);
- $this->value->Stroke($img,$val,$x,$y);
- }
- elseif( $this->valuepos=='bottom' || $this->valuepos=='min' ) {
- $y=$pts[1];
- if( $img->a === 90 ) {
- if( $val < 0 )
- $this->value->SetAlign('right','center');
- else
- $this->value->SetAlign('left','center');
- }
- $this->value->SetMargin(3);
- $this->value->Stroke($img,$val,$x,$y);
- }
- else {
- JpGraphError::RaiseL(2006,$this->valuepos);
-//('Unknown position for values on bars :'.$this->valuepos);
- }
- if( !empty($this->csimtargets[$i]) ) {
- // Create the client side image map
- $rpts = $img->ArrRotate($pts);
- $csimcoord=round($rpts[0]).", ".round($rpts[1]);
- for( $j=1; $j < 4; ++$j){
- $csimcoord .= ", ".round($rpts[2*$j]).", ".round($rpts[2*$j+1]);
- }
- $this->csimareas .= 'csimareas .= " href=\"".htmlentities($this->csimtargets[$i])."\"";
-
- if( !empty($this->csimwintargets[$i]) ) {
- $this->csimareas .= " target=\"".$this->csimwintargets[$i]."\" ";
- }
-
- $sval='';
- if( !empty($this->csimalts[$i]) ) {
- $sval=sprintf($this->csimalts[$i],$this->coords[0][$i]);
- $this->csimareas .= " title=\"$sval\" alt=\"$sval\" ";
- }
- $this->csimareas .= " />\n";
- }
- }
- return true;
+ switch( $aPattern ) {
+ case PATTERN_DIAG1:
+ $aPatternValue= 1;
+ $aDensity = 92;
+ break;
+ case PATTERN_DIAG2:
+ $aPatternValue= 1;
+ $aDensity = 78;
+ break;
+ case PATTERN_DIAG3:
+ $aPatternValue= 2;
+ $aDensity = 92;
+ break;
+ case PATTERN_DIAG4:
+ $aPatternValue= 2;
+ $aDensity = 78;
+ break;
+ case PATTERN_CROSS1:
+ $aPatternValue= 8;
+ $aDensity = 90;
+ break;
+ case PATTERN_CROSS2:
+ $aPatternValue= 8;
+ $aDensity = 78;
+ break;
+ case PATTERN_CROSS3:
+ $aPatternValue= 8;
+ $aDensity = 65;
+ break;
+ case PATTERN_CROSS4:
+ $aPatternValue= 7;
+ $aDensity = 90;
+ break;
+ case PATTERN_STRIPE1:
+ $aPatternValue= 5;
+ $aDensity = 94;
+ break;
+ case PATTERN_STRIPE2:
+ $aPatternValue= 5;
+ $aDensity = 85;
+ break;
+ default:
+ JpGraphError::RaiseL(2002);
+ //('Unknown pattern specified in call to BarPlot::SetPattern()');
+ }
+ }
+
+ function Stroke($img,$xscale,$yscale) {
+
+ $numpoints = count($this->coords[0]);
+ if( isset($this->coords[1]) ) {
+ if( count($this->coords[1])!=$numpoints ) {
+ JpGraphError::RaiseL(2003,count($this->coords[1]),$numpoints);
+ //"Number of X and Y points are not equal. Number of X-points:".count($this->coords[1])."Number of Y-points:$numpoints");
+ }
+ else {
+ $exist_x = true;
+ }
+ }
+ else {
+ $exist_x = false;
+ }
+
+
+ $numbars=count($this->coords[0]);
+
+ // Use GetMinVal() instead of scale[0] directly since in the case
+ // of log scale we get a correct value. Log scales will have negative
+ // values for values < 1 while still not representing negative numbers.
+ if( $yscale->GetMinVal() >= 0 )
+ $zp=$yscale->scale_abs[0];
+ else {
+ $zp=$yscale->Translate(0);
+ }
+
+ if( $this->abswidth > -1 ) {
+ $abswidth=$this->abswidth;
+ }
+ else {
+ $abswidth=round($this->width*$xscale->scale_factor,0);
+ }
+
+ // Count pontetial pattern array to avoid doing the count for each iteration
+ if( is_array($this->iPattern) ) {
+ $np = count($this->iPattern);
+ }
+
+ $grad = null;
+ for($i=0; $i < $numbars; ++$i) {
+
+ // If value is NULL, or 0 then don't draw a bar at all
+ if ($this->coords[0][$i] === null || $this->coords[0][$i] === '' )
+ continue;
+
+ if( $exist_x ) {
+ $x=$this->coords[1][$i];
+ }
+ else {
+ $x=$i;
+ }
+
+ $x=$xscale->Translate($x);
+
+ // Comment Note: This confuses the positioning when using acc together with
+ // grouped bars. Workaround for fixing #191
+ /*
+ if( !$xscale->textscale ) {
+ if($this->align=="center")
+ $x -= $abswidth/2;
+ elseif($this->align=="right")
+ $x -= $abswidth;
+ }
+ */
+ // Stroke fill color and fill gradient
+ $pts=array(
+ $x,$zp,
+ $x,$yscale->Translate($this->coords[0][$i]),
+ $x+$abswidth,$yscale->Translate($this->coords[0][$i]),
+ $x+$abswidth,$zp);
+ if( $this->grad ) {
+ if( $grad === null ) {
+ $grad = new Gradient($img);
+ }
+ if( is_array($this->grad_fromcolor) ) {
+ // The first argument (grad_fromcolor) can be either an array or a single color. If it is an array
+ // then we have two choices. It can either a) be a single color specified as an RGB triple or it can be
+ // an array to specify both (from, to style) for each individual bar. The way to know the difference is
+ // to investgate the first element. If this element is an integer [0,255] then we assume it is an RGB
+ // triple.
+ $ng = count($this->grad_fromcolor);
+ if( $ng === 3 ) {
+ if( is_numeric($this->grad_fromcolor[0]) && $this->grad_fromcolor[0] > 0 && $this->grad_fromcolor[0] < 256 ) {
+ // RGB Triple
+ $fromcolor = $this->grad_fromcolor;
+ $tocolor = $this->grad_tocolor;
+ $style = $this->grad_style;
+ }
+ else {
+ $fromcolor = $this->grad_fromcolor[$i % $ng][0];
+ $tocolor = $this->grad_fromcolor[$i % $ng][1];
+ $style = $this->grad_fromcolor[$i % $ng][2];
+ }
+ }
+ else {
+ $fromcolor = $this->grad_fromcolor[$i % $ng][0];
+ $tocolor = $this->grad_fromcolor[$i % $ng][1];
+ $style = $this->grad_fromcolor[$i % $ng][2];
+ }
+ $grad->FilledRectangle($pts[2],$pts[3],
+ $pts[6],$pts[7],
+ $fromcolor,$tocolor,$style);
+ }
+ else {
+ $grad->FilledRectangle($pts[2],$pts[3],
+ $pts[6],$pts[7],
+ $this->grad_fromcolor,$this->grad_tocolor,$this->grad_style);
+ }
+ }
+ elseif( !empty($this->fill_color) ) {
+ if(is_array($this->fill_color)) {
+ $img->PushColor($this->fill_color[$i % count($this->fill_color)]);
+ } else {
+ $img->PushColor($this->fill_color);
+ }
+ $img->FilledPolygon($pts);
+ $img->PopColor();
+ }
+
+
+ // Remember value of this bar
+ $val=$this->coords[0][$i];
+
+ if( !empty($val) && !is_numeric($val) ) {
+ JpGraphError::RaiseL(2004,$i,$val);
+ //'All values for a barplot must be numeric. You have specified value['.$i.'] == \''.$val.'\'');
+ }
+
+ // Determine the shadow
+ if( $this->bar_shadow && $val != 0) {
+
+ $ssh = $this->bar_shadow_hsize;
+ $ssv = $this->bar_shadow_vsize;
+ // Create points to create a "upper-right" shadow
+ if( $val > 0 ) {
+ $sp[0]=$pts[6]; $sp[1]=$pts[7];
+ $sp[2]=$pts[4]; $sp[3]=$pts[5];
+ $sp[4]=$pts[2]; $sp[5]=$pts[3];
+ $sp[6]=$pts[2]+$ssh; $sp[7]=$pts[3]-$ssv;
+ $sp[8]=$pts[4]+$ssh; $sp[9]=$pts[5]-$ssv;
+ $sp[10]=$pts[6]+$ssh; $sp[11]=$pts[7]-$ssv;
+ }
+ elseif( $val < 0 ) {
+ $sp[0]=$pts[4]; $sp[1]=$pts[5];
+ $sp[2]=$pts[6]; $sp[3]=$pts[7];
+ $sp[4]=$pts[0]; $sp[5]=$pts[1];
+ $sp[6]=$pts[0]+$ssh; $sp[7]=$pts[1]-$ssv;
+ $sp[8]=$pts[6]+$ssh; $sp[9]=$pts[7]-$ssv;
+ $sp[10]=$pts[4]+$ssh; $sp[11]=$pts[5]-$ssv;
+ }
+ if( is_array($this->bar_shadow_color) ) {
+ $numcolors = count($this->bar_shadow_color);
+ if( $numcolors == 0 ) {
+ JpGraphError::RaiseL(2005);//('You have specified an empty array for shadow colors in the bar plot.');
+ }
+ $img->PushColor($this->bar_shadow_color[$i % $numcolors]);
+ }
+ else {
+ $img->PushColor($this->bar_shadow_color);
+ }
+ $img->FilledPolygon($sp);
+ $img->PopColor();
+ }
+
+ // Stroke the pattern
+ if( is_array($this->iPattern) ) {
+ $f = new RectPatternFactory();
+ if( is_array($this->iPatternColor) ) {
+ $pcolor = $this->iPatternColor[$i % $np];
+ }
+ else {
+ $pcolor = $this->iPatternColor;
+ }
+ $prect = $f->Create($this->iPattern[$i % $np],$pcolor,1);
+ $prect->SetDensity($this->iPatternDensity[$i % $np]);
+
+ if( $val < 0 ) {
+ $rx = $pts[0];
+ $ry = $pts[1];
+ }
+ else {
+ $rx = $pts[2];
+ $ry = $pts[3];
+ }
+ $width = abs($pts[4]-$pts[0])+1;
+ $height = abs($pts[1]-$pts[3])+1;
+ $prect->SetPos(new Rectangle($rx,$ry,$width,$height));
+ $prect->Stroke($img);
+ }
+ else {
+ if( $this->iPattern > -1 ) {
+ $f = new RectPatternFactory();
+ $prect = $f->Create($this->iPattern,$this->iPatternColor,1);
+ $prect->SetDensity($this->iPatternDensity);
+ if( $val < 0 ) {
+ $rx = $pts[0];
+ $ry = $pts[1];
+ }
+ else {
+ $rx = $pts[2];
+ $ry = $pts[3];
+ }
+ $width = abs($pts[4]-$pts[0])+1;
+ $height = abs($pts[1]-$pts[3])+1;
+ $prect->SetPos(new Rectangle($rx,$ry,$width,$height));
+ $prect->Stroke($img);
+ }
+ }
+
+ // Stroke the outline of the bar
+ if( is_array($this->color) ) {
+ $img->SetColor($this->color[$i % count($this->color)]);
+ }
+ else {
+ $img->SetColor($this->color);
+ }
+
+ $pts[] = $pts[0];
+ $pts[] = $pts[1];
+
+ if( $this->weight > 0 ) {
+ $img->SetLineWeight($this->weight);
+ $img->Polygon($pts);
+ }
+
+ // Determine how to best position the values of the individual bars
+ $x=$pts[2]+($pts[4]-$pts[2])/2;
+ $this->value->SetMargin(5);
+
+ if( $this->valuepos=='top' ) {
+ $y=$pts[3];
+ if( $img->a === 90 ) {
+ if( $val < 0 ) {
+ $this->value->SetAlign('right','center');
+ }
+ else {
+ $this->value->SetAlign('left','center');
+ }
+
+ }
+ else {
+ if( $val < 0 ) {
+ $this->value->SetMargin(-5);
+ $y=$pts[1];
+ $this->value->SetAlign('center','bottom');
+ }
+ else {
+ $this->value->SetAlign('center','bottom');
+ }
+
+ }
+ $this->value->Stroke($img,$val,$x,$y);
+ }
+ elseif( $this->valuepos=='max' ) {
+ $y=$pts[3];
+ if( $img->a === 90 ) {
+ if( $val < 0 )
+ $this->value->SetAlign('left','center');
+ else
+ $this->value->SetAlign('right','center');
+ }
+ else {
+ if( $val < 0 ) {
+ $this->value->SetAlign('center','bottom');
+ }
+ else {
+ $this->value->SetAlign('center','top');
+ }
+ }
+ $this->value->SetMargin(-5);
+ $this->value->Stroke($img,$val,$x,$y);
+ }
+ elseif( $this->valuepos=='center' ) {
+ $y = ($pts[3] + $pts[1])/2;
+ $this->value->SetAlign('center','center');
+ $this->value->SetMargin(0);
+ $this->value->Stroke($img,$val,$x,$y);
+ }
+ elseif( $this->valuepos=='bottom' || $this->valuepos=='min' ) {
+ $y=$pts[1];
+ if( $img->a === 90 ) {
+ if( $val < 0 )
+ $this->value->SetAlign('right','center');
+ else
+ $this->value->SetAlign('left','center');
+ }
+ $this->value->SetMargin(3);
+ $this->value->Stroke($img,$val,$x,$y);
+ }
+ else {
+ JpGraphError::RaiseL(2006,$this->valuepos);
+ //'Unknown position for values on bars :'.$this->valuepos);
+ }
+ // Create the client side image map
+ $rpts = $img->ArrRotate($pts);
+ $csimcoord=round($rpts[0]).", ".round($rpts[1]);
+ for( $j=1; $j < 4; ++$j){
+ $csimcoord .= ", ".round($rpts[2*$j]).", ".round($rpts[2*$j+1]);
+ }
+ if( !empty($this->csimtargets[$i]) ) {
+ $this->csimareas .= 'csimareas .= " href=\"".htmlentities($this->csimtargets[$i])."\"";
+
+ if( !empty($this->csimwintargets[$i]) ) {
+ $this->csimareas .= " target=\"".$this->csimwintargets[$i]."\" ";
+ }
+
+ $sval='';
+ if( !empty($this->csimalts[$i]) ) {
+ $sval=sprintf($this->csimalts[$i],$this->coords[0][$i]);
+ $this->csimareas .= " title=\"$sval\" alt=\"$sval\" ";
+ }
+ $this->csimareas .= " />\n";
+ }
+ }
+ return true;
}
} // Class
@@ -589,88 +625,89 @@
// Description: Produce grouped bar plots
//===================================================
class GroupBarPlot extends BarPlot {
- var $plots=array(), $nbrplots=0;
- var $numpoints;
-//---------------
-// CONSTRUCTOR
+ private $plots, $nbrplots=0;
+ //---------------
+ // CONSTRUCTOR
function GroupBarPlot($plots) {
- $this->width=0.5;
- $this->plots = $plots;
- $this->nbrplots = count($plots);
- if( $this->nbrplots < 1 ) {
- JpGraphError::RaiseL(2007);//('Cannot create GroupBarPlot from empty plot array.');
- }
- for($i=0; $i < $this->nbrplots; ++$i ) {
- if( empty($this->plots[$i]) || !isset($this->plots[$i]) ) {
- JpGraphError::RaiseL(2008,$i);//("Group bar plot element nbr $i is undefined or empty.");
- }
- }
- $this->numpoints = $plots[0]->numpoints;
- }
-
-//---------------
-// PUBLIC METHODS
- function Legend(&$graph) {
- $n = count($this->plots);
- for($i=0; $i < $n; ++$i) {
- $c = get_class($this->plots[$i]);
- if( !is_a($this->plots[$i],'BarPlot') ) {
- JpGraphError::RaiseL(2009,$c);//('One of the objects submitted to GroupBar is not a BarPlot. Make sure that you create the Group Bar plot from an array of BarPlot or AccBarPlot objects. (Class = '.$c.')');
- }
- $this->plots[$i]->DoLegend($graph);
- }
+ $this->width=0.7;
+ $this->plots = $plots;
+ $this->nbrplots = count($plots);
+ if( $this->nbrplots < 1 ) {
+ JpGraphError::RaiseL(2007);//('Cannot create GroupBarPlot from empty plot array.');
+ }
+ for($i=0; $i < $this->nbrplots; ++$i ) {
+ if( empty($this->plots[$i]) || !isset($this->plots[$i]) ) {
+ JpGraphError::RaiseL(2008,$i);//("Group bar plot element nbr $i is undefined or empty.");
+ }
+ }
+ $this->numpoints = $plots[0]->numpoints;
+ $this->width=0.7;
+ }
+
+ //---------------
+ // PUBLIC METHODS
+ function Legend($graph) {
+ $n = count($this->plots);
+ for($i=0; $i < $n; ++$i) {
+ $c = get_class($this->plots[$i]);
+ if( !($this->plots[$i] instanceof BarPlot) ) {
+ JpGraphError::RaiseL(2009,$c);
+ //('One of the objects submitted to GroupBar is not a BarPlot. Make sure that you create the Group Bar plot from an array of BarPlot or AccBarPlot objects. (Class = '.$c.')');
+ }
+ $this->plots[$i]->DoLegend($graph);
+ }
}
-
+
function Min() {
- list($xmin,$ymin) = $this->plots[0]->Min();
- $n = count($this->plots);
- for($i=0; $i < $n; ++$i) {
- list($xm,$ym) = $this->plots[$i]->Min();
- $xmin = max($xmin,$xm);
- $ymin = min($ymin,$ym);
- }
- return array($xmin,$ymin);
+ list($xmin,$ymin) = $this->plots[0]->Min();
+ $n = count($this->plots);
+ for($i=0; $i < $n; ++$i) {
+ list($xm,$ym) = $this->plots[$i]->Min();
+ $xmin = max($xmin,$xm);
+ $ymin = min($ymin,$ym);
+ }
+ return array($xmin,$ymin);
}
-
+
function Max() {
- list($xmax,$ymax) = $this->plots[0]->Max();
- $n = count($this->plots);
- for($i=0; $i < $n; ++$i) {
- list($xm,$ym) = $this->plots[$i]->Max();
- $xmax = max($xmax,$xm);
- $ymax = max($ymax,$ym);
- }
- return array($xmax,$ymax);
+ list($xmax,$ymax) = $this->plots[0]->Max();
+ $n = count($this->plots);
+ for($i=0; $i < $n; ++$i) {
+ list($xm,$ym) = $this->plots[$i]->Max();
+ $xmax = max($xmax,$xm);
+ $ymax = max($ymax,$ym);
+ }
+ return array($xmax,$ymax);
}
-
+
function GetCSIMareas() {
- $n = count($this->plots);
- $csimareas='';
- for($i=0; $i < $n; ++$i) {
- $csimareas .= $this->plots[$i]->csimareas;
- }
- return $csimareas;
+ $n = count($this->plots);
+ $csimareas='';
+ for($i=0; $i < $n; ++$i) {
+ $csimareas .= $this->plots[$i]->csimareas;
+ }
+ return $csimareas;
}
-
+
// Stroke all the bars next to each other
- function Stroke(&$img,&$xscale,&$yscale) {
- $tmp=$xscale->off;
- $n = count($this->plots);
- $subwidth = $this->width/$this->nbrplots ;
-
- for( $i=0; $i < $n; ++$i ) {
- $this->plots[$i]->ymin=$this->ybase;
- $this->plots[$i]->SetWidth($subwidth);
-
- // If the client have used SetTextTickInterval() then
- // major_step will be > 1 and the positioning will fail.
- // If we assume it is always one the positioning will work
- // fine with a text scale but this will not work with
- // arbitrary linear scale
- $xscale->off = $tmp+$i*round($xscale->scale_factor* $subwidth);
- $this->plots[$i]->Stroke($img,$xscale,$yscale);
- }
- $xscale->off=$tmp;
+ function Stroke($img,$xscale,$yscale) {
+ $tmp=$xscale->off;
+ $n = count($this->plots);
+ $subwidth = $this->width/$this->nbrplots ;
+
+ for( $i=0; $i < $n; ++$i ) {
+ $this->plots[$i]->ymin=$this->ybase;
+ $this->plots[$i]->SetWidth($subwidth);
+
+ // If the client have used SetTextTickInterval() then
+ // major_step will be > 1 and the positioning will fail.
+ // If we assume it is always one the positioning will work
+ // fine with a text scale but this will not work with
+ // arbitrary linear scale
+ $xscale->off = $tmp+$i*round($xscale->scale_factor* $subwidth);
+ $this->plots[$i]->Stroke($img,$xscale,$yscale);
+ }
+ $xscale->off=$tmp;
}
} // Class
@@ -679,356 +716,419 @@
// Description: Produce accumulated bar plots
//===================================================
class AccBarPlot extends BarPlot {
- var $plots=null,$nbrplots=0,$numpoints=0;
-//---------------
-// CONSTRUCTOR
- function AccBarPlot($plots) {
- $this->plots = $plots;
- $this->nbrplots = count($plots);
- if( $this->nbrplots < 1 ) {
- JpGraphError::RaiseL(2010);//('Cannot create AccBarPlot from empty plot array.');
- }
- for($i=0; $i < $this->nbrplots; ++$i ) {
- if( empty($this->plots[$i]) || !isset($this->plots[$i]) ) {
- JpGraphError::RaiseL(2011,$i);//("Acc bar plot element nbr $i is undefined or empty.");
- }
- }
- $this->numpoints = $plots[0]->numpoints;
- $this->value = new DisplayValue();
- }
-
-//---------------
-// PUBLIC METHODS
- function Legend(&$graph) {
- $n = count($this->plots);
- for( $i=$n-1; $i >= 0; --$i ) {
- $c = get_class($this->plots[$i]);
- if( !is_a($this->plots[$i],'BarPlot') ) {
- JpGraphError::RaiseL(2012,$c);//('One of the objects submitted to AccBar is not a BarPlot. Make sure that you create the AccBar plot from an array of BarPlot objects.(Class='.$c.')');
- }
- $this->plots[$i]->DoLegend($graph);
- }
+ private $plots=null,$nbrplots=0;
+ //---------------
+ // CONSTRUCTOR
+ function __construct($plots) {
+ $this->plots = $plots;
+ $this->nbrplots = count($plots);
+ if( $this->nbrplots < 1 ) {
+ JpGraphError::RaiseL(2010);//('Cannot create AccBarPlot from empty plot array.');
+ }
+ for($i=0; $i < $this->nbrplots; ++$i ) {
+ if( empty($this->plots[$i]) || !isset($this->plots[$i]) ) {
+ JpGraphError::RaiseL(2011,$i);//("Acc bar plot element nbr $i is undefined or empty.");
+ }
+ }
+
+ // We can only allow individual plost which do not have specified X-positions
+ for($i=0; $i < $this->nbrplots; ++$i ) {
+ if( !empty($this->plots[$i]->coords[1]) ) {
+ JpGraphError::RaiseL(2015);
+ //'Individual bar plots in an AccBarPlot or GroupBarPlot can not have specified X-positions.');
+ }
+ }
+
+ // Use 0 weight by default which means that the individual bar
+ // weights will be used per part n the accumulated bar
+ $this->SetWeight(0);
+
+ $this->numpoints = $plots[0]->numpoints;
+ $this->value = new DisplayValue();
+ }
+
+ //---------------
+ // PUBLIC METHODS
+ function Legend($graph) {
+ $n = count($this->plots);
+ for( $i=$n-1; $i >= 0; --$i ) {
+ $c = get_class($this->plots[$i]);
+ if( !($this->plots[$i] instanceof BarPlot) ) {
+ JpGraphError::RaiseL(2012,$c);
+ //('One of the objects submitted to AccBar is not a BarPlot. Make sure that you create the AccBar plot from an array of BarPlot objects.(Class='.$c.')');
+ }
+ $this->plots[$i]->DoLegend($graph);
+ }
}
function Max() {
- list($xmax) = $this->plots[0]->Max();
- $nmax=0;
- for($i=0; $i < count($this->plots); ++$i) {
- $n = count($this->plots[$i]->coords[0]);
- $nmax = max($nmax,$n);
- list($x) = $this->plots[$i]->Max();
- $xmax = max($xmax,$x);
- }
- for( $i = 0; $i < $nmax; $i++ ) {
- // Get y-value for bar $i by adding the
- // individual bars from all the plots added.
- // It would be wrong to just add the
- // individual plots max y-value since that
- // would in most cases give to large y-value.
- $y=0;
- if( !isset($this->plots[0]->coords[0][$i]) ) {
- JpGraphError::RaiseL(2014);
- }
- if( $this->plots[0]->coords[0][$i] > 0 )
- $y=$this->plots[0]->coords[0][$i];
- for( $j = 1; $j < $this->nbrplots; $j++ ) {
- if( !isset($this->plots[$j]->coords[0][$i]) ) {
- JpGraphError::RaiseL(2014);
- }
- if( $this->plots[$j]->coords[0][$i] > 0 )
- $y += $this->plots[$j]->coords[0][$i];
- }
- $ymax[$i] = $y;
- }
- $ymax = max($ymax);
-
- // Bar always start at baseline
- if( $ymax <= $this->ybase )
- $ymax = $this->ybase;
- return array($xmax,$ymax);
+ list($xmax) = $this->plots[0]->Max();
+ $nmax=0;
+ for($i=0; $i < count($this->plots); ++$i) {
+ $n = count($this->plots[$i]->coords[0]);
+ $nmax = max($nmax,$n);
+ list($x) = $this->plots[$i]->Max();
+ $xmax = max($xmax,$x);
+ }
+ for( $i = 0; $i < $nmax; $i++ ) {
+ // Get y-value for bar $i by adding the
+ // individual bars from all the plots added.
+ // It would be wrong to just add the
+ // individual plots max y-value since that
+ // would in most cases give to large y-value.
+ $y=0;
+ if( !isset($this->plots[0]->coords[0][$i]) ) {
+ JpGraphError::RaiseL(2014);
+ }
+ if( $this->plots[0]->coords[0][$i] > 0 )
+ $y=$this->plots[0]->coords[0][$i];
+ for( $j = 1; $j < $this->nbrplots; $j++ ) {
+ if( !isset($this->plots[$j]->coords[0][$i]) ) {
+ JpGraphError::RaiseL(2014);
+ }
+ if( $this->plots[$j]->coords[0][$i] > 0 )
+ $y += $this->plots[$j]->coords[0][$i];
+ }
+ $ymax[$i] = $y;
+ }
+ $ymax = max($ymax);
+
+ // Bar always start at baseline
+ if( $ymax <= $this->ybase )
+ $ymax = $this->ybase;
+ return array($xmax,$ymax);
}
function Min() {
- $nmax=0;
- list($xmin,$ysetmin) = $this->plots[0]->Min();
- for($i=0; $i < count($this->plots); ++$i) {
- $n = count($this->plots[$i]->coords[0]);
- $nmax = max($nmax,$n);
- list($x,$y) = $this->plots[$i]->Min();
- $xmin = Min($xmin,$x);
- $ysetmin = Min($y,$ysetmin);
- }
- for( $i = 0; $i < $nmax; $i++ ) {
- // Get y-value for bar $i by adding the
- // individual bars from all the plots added.
- // It would be wrong to just add the
- // individual plots max y-value since that
- // would in most cases give to large y-value.
- $y=0;
- if( $this->plots[0]->coords[0][$i] < 0 )
- $y=$this->plots[0]->coords[0][$i];
- for( $j = 1; $j < $this->nbrplots; $j++ ) {
- if( $this->plots[$j]->coords[0][$i] < 0 )
- $y += $this->plots[ $j ]->coords[0][$i];
- }
- $ymin[$i] = $y;
- }
- $ymin = Min($ysetmin,Min($ymin));
- // Bar always start at baseline
- if( $ymin >= $this->ybase )
- $ymin = $this->ybase;
- return array($xmin,$ymin);
+ $nmax=0;
+ list($xmin,$ysetmin) = $this->plots[0]->Min();
+ for($i=0; $i < count($this->plots); ++$i) {
+ $n = count($this->plots[$i]->coords[0]);
+ $nmax = max($nmax,$n);
+ list($x,$y) = $this->plots[$i]->Min();
+ $xmin = Min($xmin,$x);
+ $ysetmin = Min($y,$ysetmin);
+ }
+ for( $i = 0; $i < $nmax; $i++ ) {
+ // Get y-value for bar $i by adding the
+ // individual bars from all the plots added.
+ // It would be wrong to just add the
+ // individual plots max y-value since that
+ // would in most cases give to large y-value.
+ $y=0;
+ if( $this->plots[0]->coords[0][$i] < 0 )
+ $y=$this->plots[0]->coords[0][$i];
+ for( $j = 1; $j < $this->nbrplots; $j++ ) {
+ if( $this->plots[$j]->coords[0][$i] < 0 )
+ $y += $this->plots[ $j ]->coords[0][$i];
+ }
+ $ymin[$i] = $y;
+ }
+ $ymin = Min($ysetmin,Min($ymin));
+ // Bar always start at baseline
+ if( $ymin >= $this->ybase )
+ $ymin = $this->ybase;
+ return array($xmin,$ymin);
}
// Stroke acc bar plot
- function Stroke(&$img,&$xscale,&$yscale) {
- $pattern=NULL;
- $img->SetLineWeight($this->weight);
- for($i=0; $i < $this->numpoints-1; $i++) {
- $accy = 0;
- $accy_neg = 0;
- for($j=0; $j < $this->nbrplots; ++$j ) {
- $img->SetColor($this->plots[$j]->color);
-
- if ( $this->plots[$j]->coords[0][$i] >= 0) {
- $yt=$yscale->Translate($this->plots[$j]->coords[0][$i]+$accy);
- $accyt=$yscale->Translate($accy);
- $accy+=$this->plots[$j]->coords[0][$i];
- }
- else {
- //if ( $this->plots[$j]->coords[0][$i] < 0 || $accy_neg < 0 ) {
- $yt=$yscale->Translate($this->plots[$j]->coords[0][$i]+$accy_neg);
- $accyt=$yscale->Translate($accy_neg);
- $accy_neg+=$this->plots[$j]->coords[0][$i];
- }
-
- $xt=$xscale->Translate($i);
-
- if( $this->abswidth > -1 )
- $abswidth=$this->abswidth;
- else
- $abswidth=round($this->width*$xscale->scale_factor,0);
-
- $pts=array($xt,$accyt,$xt,$yt,$xt+$abswidth,$yt,$xt+$abswidth,$accyt);
-
- if( $this->bar_shadow ) {
- $ssh = $this->bar_shadow_hsize;
- $ssv = $this->bar_shadow_vsize;
-
- // We must also differ if we are a positive or negative bar.
- if( $j === 0 ) {
- // This gets extra complicated since we have to
- // see all plots to see if we are negative. It could
- // for example be that all plots are 0 until the very
- // last one. We therefore need to save the initial setup
- // for both the negative and positive case
-
- // In case the final bar is positive
- $sp[0]=$pts[6]+1; $sp[1]=$pts[7];
- $sp[2]=$pts[6]+$ssh; $sp[3]=$pts[7]-$ssv;
-
- // In case the final bar is negative
- $nsp[0]=$pts[0]; $nsp[1]=$pts[1];
- $nsp[2]=$pts[0]+$ssh; $nsp[3]=$pts[1]-$ssv;
- $nsp[4]=$pts[6]+$ssh; $nsp[5]=$pts[7]-$ssv;
- $nsp[10]=$pts[6]+1; $nsp[11]=$pts[7];
- }
-
- if( $j === $this->nbrplots-1 ) {
- // If this is the last plot of the bar and
- // the total value is larger than 0 then we
- // add the shadow.
- if( is_array($this->bar_shadow_color) ) {
- $numcolors = count($this->bar_shadow_color);
- if( $numcolors == 0 ) {
- JpGraphError::RaiseL(2013);//('You have specified an empty array for shadow colors in the bar plot.');
- }
- $img->PushColor($this->bar_shadow_color[$i % $numcolors]);
- }
- else {
- $img->PushColor($this->bar_shadow_color);
- }
-
- if( $accy > 0 ) {
- $sp[4]=$pts[4]+$ssh; $sp[5]=$pts[5]-$ssv;
- $sp[6]=$pts[2]+$ssh; $sp[7]=$pts[3]-$ssv;
- $sp[8]=$pts[2]; $sp[9]=$pts[3]-1;
- $sp[10]=$pts[4]+1; $sp[11]=$pts[5];
- $img->FilledPolygon($sp,4);
- }
- elseif( $accy_neg < 0 ) {
- $nsp[6]=$pts[4]+$ssh; $nsp[7]=$pts[5]-$ssv;
- $nsp[8]=$pts[4]+1; $nsp[9]=$pts[5];
- $img->FilledPolygon($nsp,4);
- }
- $img->PopColor();
- }
- }
-
-
- // If value is NULL or 0, then don't draw a bar at all
- if ($this->plots[$j]->coords[0][$i] == 0 ) continue;
-
- if( $this->plots[$j]->grad ) {
- $grad = new Gradient($img);
- $grad->FilledRectangle(
- $pts[2],$pts[3],
- $pts[6],$pts[7],
- $this->plots[$j]->grad_fromcolor,
- $this->plots[$j]->grad_tocolor,
- $this->plots[$j]->grad_style);
- } else {
- if (is_array($this->plots[$j]->fill_color) ) {
- $numcolors = count($this->plots[$j]->fill_color);
- $fillcolor = $this->plots[$j]->fill_color[$i % $numcolors];
- // If the bar is specified to be non filled then the fill color is false
- if( $fillcolor !== false )
- $img->SetColor($this->plots[$j]->fill_color[$i % $numcolors]);
- }
- else {
- $fillcolor = $this->plots[$j]->fill_color;
- if( $fillcolor !== false )
- $img->SetColor($this->plots[$j]->fill_color);
- }
- if( $fillcolor !== false )
- $img->FilledPolygon($pts);
- $img->SetColor($this->plots[$j]->color);
- }
-
- // Stroke the pattern
- if( $this->plots[$j]->iPattern > -1 ) {
- if( $pattern===NULL )
- $pattern = new RectPatternFactory();
-
- $prect = $pattern->Create($this->plots[$j]->iPattern,$this->plots[$j]->iPatternColor,1);
- $prect->SetDensity($this->plots[$j]->iPatternDensity);
- if( $this->plots[$j]->coords[0][$i] < 0 ) {
- $rx = $pts[0];
- $ry = $pts[1];
- }
- else {
- $rx = $pts[2];
- $ry = $pts[3];
- }
- $width = abs($pts[4]-$pts[0])+1;
- $height = abs($pts[1]-$pts[3])+1;
- $prect->SetPos(new Rectangle($rx,$ry,$width,$height));
- $prect->Stroke($img);
- }
-
-
- // CSIM array
-
- if( $i < count($this->plots[$j]->csimtargets) ) {
- // Create the client side image map
- $rpts = $img->ArrRotate($pts);
- $csimcoord=round($rpts[0]).", ".round($rpts[1]);
- for( $k=1; $k < 4; ++$k){
- $csimcoord .= ", ".round($rpts[2*$k]).", ".round($rpts[2*$k+1]);
- }
- if( ! empty($this->plots[$j]->csimtargets[$i]) ) {
- $this->csimareas.= 'csimareas.= " href=\"".$this->plots[$j]->csimtargets[$i]."\" ";
-
- if( ! empty($this->plots[$j]->csimwintargets[$i]) ) {
- $this->csimareas.= " target=\"".$this->plots[$j]->csimwintargets[$i]."\" ";
- }
-
- $sval='';
- if( !empty($this->plots[$j]->csimalts[$i]) ) {
- $sval=sprintf($this->plots[$j]->csimalts[$i],$this->plots[$j]->coords[0][$i]);
- $this->csimareas .= " title=\"$sval\" ";
- }
- $this->csimareas .= " alt=\"$sval\" />\n";
- }
- }
-
- $pts[] = $pts[0];
- $pts[] = $pts[1];
- $img->SetLineWeight($this->plots[$j]->line_weight);
- $img->Polygon($pts);
- $img->SetLineWeight(1);
- }
-
- // Draw labels for each acc.bar
-
- $x=$pts[2]+($pts[4]-$pts[2])/2;
- if($this->bar_shadow) $x += $ssh;
-
- // First stroke the accumulated value for the entire bar
- // This value is always placed at the top/bottom of the bars
- if( $accy_neg < 0 ) {
- $y=$yscale->Translate($accy_neg);
- $this->value->Stroke($img,$accy_neg,$x,$y);
- }
- else {
- $y=$yscale->Translate($accy);
- $this->value->Stroke($img,$accy,$x,$y);
- }
-
- $accy = 0;
- $accy_neg = 0;
- for($j=0; $j < $this->nbrplots; ++$j ) {
-
- // We don't print 0 values in an accumulated bar plot
- if( $this->plots[$j]->coords[0][$i] == 0 ) continue;
-
- if ($this->plots[$j]->coords[0][$i] > 0) {
- $yt=$yscale->Translate($this->plots[$j]->coords[0][$i]+$accy);
- $accyt=$yscale->Translate($accy);
- if( $this->plots[$j]->valuepos=='center' ) {
- $y = $accyt-($accyt-$yt)/2;
- }
- elseif( $this->plots[$j]->valuepos=='bottom' ) {
- $y = $accyt;
- }
- else { // top or max
- $y = $accyt-($accyt-$yt);
- }
- $accy+=$this->plots[$j]->coords[0][$i];
- if( $this->plots[$j]->valuepos=='center' ) {
- $this->plots[$j]->value->SetAlign("center","center");
- $this->plots[$j]->value->SetMargin(0);
- }
- elseif( $this->plots[$j]->valuepos=='bottom' ) {
- $this->plots[$j]->value->SetAlign('center','bottom');
- $this->plots[$j]->value->SetMargin(2);
- }
- else {
- $this->plots[$j]->value->SetAlign('center','top');
- $this->plots[$j]->value->SetMargin(1);
- }
- } else {
- $yt=$yscale->Translate($this->plots[$j]->coords[0][$i]+$accy_neg);
- $accyt=$yscale->Translate($accy_neg);
- $accy_neg+=$this->plots[$j]->coords[0][$i];
- if( $this->plots[$j]->valuepos=='center' ) {
- $y = $accyt-($accyt-$yt)/2;
- }
- elseif( $this->plots[$j]->valuepos=='bottom' ) {
- $y = $accyt;
- }
- else {
- $y = $accyt-($accyt-$yt);
- }
- if( $this->plots[$j]->valuepos=='center' ) {
- $this->plots[$j]->value->SetAlign("center","center");
- $this->plots[$j]->value->SetMargin(0);
- }
- elseif( $this->plots[$j]->valuepos=='bottom' ) {
- $this->plots[$j]->value->SetAlign('center',$j==0 ? 'bottom':'top');
- $this->plots[$j]->value->SetMargin(-2);
- }
- else {
- $this->plots[$j]->value->SetAlign('center','bottom');
- $this->plots[$j]->value->SetMargin(-1);
- }
- }
- $this->plots[$j]->value->Stroke($img,$this->plots[$j]->coords[0][$i],$x,$y);
- }
+ function Stroke($img,$xscale,$yscale) {
+ $pattern=NULL;
+ $img->SetLineWeight($this->weight);
+ $grad=null;
+ for($i=0; $i < $this->numpoints-1; $i++) {
+ $accy = 0;
+ $accy_neg = 0;
+ for($j=0; $j < $this->nbrplots; ++$j ) {
+ $img->SetColor($this->plots[$j]->color);
+
+ if ( $this->plots[$j]->coords[0][$i] >= 0) {
+ $yt=$yscale->Translate($this->plots[$j]->coords[0][$i]+$accy);
+ $accyt=$yscale->Translate($accy);
+ $accy+=$this->plots[$j]->coords[0][$i];
+ }
+ else {
+ //if ( $this->plots[$j]->coords[0][$i] < 0 || $accy_neg < 0 ) {
+ $yt=$yscale->Translate($this->plots[$j]->coords[0][$i]+$accy_neg);
+ $accyt=$yscale->Translate($accy_neg);
+ $accy_neg+=$this->plots[$j]->coords[0][$i];
+ }
+
+ $xt=$xscale->Translate($i);
+
+ if( $this->abswidth > -1 ) {
+ $abswidth=$this->abswidth;
+ }
+ else {
+ $abswidth=round($this->width*$xscale->scale_factor,0);
+ }
+
+ $pts=array($xt,$accyt,$xt,$yt,$xt+$abswidth,$yt,$xt+$abswidth,$accyt);
+
+ if( $this->bar_shadow ) {
+ $ssh = $this->bar_shadow_hsize;
+ $ssv = $this->bar_shadow_vsize;
+
+ // We must also differ if we are a positive or negative bar.
+ if( $j === 0 ) {
+ // This gets extra complicated since we have to
+ // see all plots to see if we are negative. It could
+ // for example be that all plots are 0 until the very
+ // last one. We therefore need to save the initial setup
+ // for both the negative and positive case
+
+ // In case the final bar is positive
+ $sp[0]=$pts[6]+1; $sp[1]=$pts[7];
+ $sp[2]=$pts[6]+$ssh; $sp[3]=$pts[7]-$ssv;
+
+ // In case the final bar is negative
+ $nsp[0]=$pts[0]; $nsp[1]=$pts[1];
+ $nsp[2]=$pts[0]+$ssh; $nsp[3]=$pts[1]-$ssv;
+ $nsp[4]=$pts[6]+$ssh; $nsp[5]=$pts[7]-$ssv;
+ $nsp[10]=$pts[6]+1; $nsp[11]=$pts[7];
+ }
+
+ if( $j === $this->nbrplots-1 ) {
+ // If this is the last plot of the bar and
+ // the total value is larger than 0 then we
+ // add the shadow.
+ if( is_array($this->bar_shadow_color) ) {
+ $numcolors = count($this->bar_shadow_color);
+ if( $numcolors == 0 ) {
+ JpGraphError::RaiseL(2013);//('You have specified an empty array for shadow colors in the bar plot.');
+ }
+ $img->PushColor($this->bar_shadow_color[$i % $numcolors]);
+ }
+ else {
+ $img->PushColor($this->bar_shadow_color);
+ }
+
+ if( $accy > 0 ) {
+ $sp[4]=$pts[4]+$ssh; $sp[5]=$pts[5]-$ssv;
+ $sp[6]=$pts[2]+$ssh; $sp[7]=$pts[3]-$ssv;
+ $sp[8]=$pts[2]; $sp[9]=$pts[3]-1;
+ $sp[10]=$pts[4]+1; $sp[11]=$pts[5];
+ $img->FilledPolygon($sp,4);
+ }
+ elseif( $accy_neg < 0 ) {
+ $nsp[6]=$pts[4]+$ssh; $nsp[7]=$pts[5]-$ssv;
+ $nsp[8]=$pts[4]+1; $nsp[9]=$pts[5];
+ $img->FilledPolygon($nsp,4);
+ }
+ $img->PopColor();
+ }
+ }
+
+
+ // If value is NULL or 0, then don't draw a bar at all
+ if ($this->plots[$j]->coords[0][$i] == 0 ) continue;
+
+ if( $this->plots[$j]->grad ) {
+ if( $grad === null ) {
+ $grad = new Gradient($img);
+ }
+ if( is_array($this->plots[$j]->grad_fromcolor) ) {
+ // The first argument (grad_fromcolor) can be either an array or a single color. If it is an array
+ // then we have two choices. It can either a) be a single color specified as an RGB triple or it can be
+ // an array to specify both (from, to style) for each individual bar. The way to know the difference is
+ // to investgate the first element. If this element is an integer [0,255] then we assume it is an RGB
+ // triple.
+ $ng = count($this->plots[$j]->grad_fromcolor);
+ if( $ng === 3 ) {
+ if( is_numeric($this->plots[$j]->grad_fromcolor[0]) && $this->plots[$j]->grad_fromcolor[0] > 0 &&
+ $this->plots[$j]->grad_fromcolor[0] < 256 ) {
+ // RGB Triple
+ $fromcolor = $this->plots[$j]->grad_fromcolor;
+ $tocolor = $this->plots[$j]->grad_tocolor;
+ $style = $this->plots[$j]->grad_style;
+ }
+ else {
+ $fromcolor = $this->plots[$j]->grad_fromcolor[$i % $ng][0];
+ $tocolor = $this->plots[$j]->grad_fromcolor[$i % $ng][1];
+ $style = $this->plots[$j]->grad_fromcolor[$i % $ng][2];
+ }
+ }
+ else {
+ $fromcolor = $this->plots[$j]->grad_fromcolor[$i % $ng][0];
+ $tocolor = $this->plots[$j]->grad_fromcolor[$i % $ng][1];
+ $style = $this->plots[$j]->grad_fromcolor[$i % $ng][2];
+ }
+ $grad->FilledRectangle($pts[2],$pts[3],
+ $pts[6],$pts[7],
+ $fromcolor,$tocolor,$style);
+ }
+ else {
+ $grad->FilledRectangle($pts[2],$pts[3],
+ $pts[6],$pts[7],
+ $this->plots[$j]->grad_fromcolor,
+ $this->plots[$j]->grad_tocolor,
+ $this->plots[$j]->grad_style);
+ }
+ } else {
+ if (is_array($this->plots[$j]->fill_color) ) {
+ $numcolors = count($this->plots[$j]->fill_color);
+ $fillcolor = $this->plots[$j]->fill_color[$i % $numcolors];
+ // If the bar is specified to be non filled then the fill color is false
+ if( $fillcolor !== false ) {
+ $img->SetColor($this->plots[$j]->fill_color[$i % $numcolors]);
+ }
+ }
+ else {
+ $fillcolor = $this->plots[$j]->fill_color;
+ if( $fillcolor !== false ) {
+ $img->SetColor($this->plots[$j]->fill_color);
+ }
+ }
+ if( $fillcolor !== false ) {
+ $img->FilledPolygon($pts);
+ }
+ }
+
+ $img->SetColor($this->plots[$j]->color);
+
+ // Stroke the pattern
+ if( $this->plots[$j]->iPattern > -1 ) {
+ if( $pattern===NULL ) {
+ $pattern = new RectPatternFactory();
+ }
+
+ $prect = $pattern->Create($this->plots[$j]->iPattern,$this->plots[$j]->iPatternColor,1);
+ $prect->SetDensity($this->plots[$j]->iPatternDensity);
+ if( $this->plots[$j]->coords[0][$i] < 0 ) {
+ $rx = $pts[0];
+ $ry = $pts[1];
+ }
+ else {
+ $rx = $pts[2];
+ $ry = $pts[3];
+ }
+ $width = abs($pts[4]-$pts[0])+1;
+ $height = abs($pts[1]-$pts[3])+1;
+ $prect->SetPos(new Rectangle($rx,$ry,$width,$height));
+ $prect->Stroke($img);
+ }
+
+
+ // CSIM array
+
+ if( $i < count($this->plots[$j]->csimtargets) ) {
+ // Create the client side image map
+ $rpts = $img->ArrRotate($pts);
+ $csimcoord=round($rpts[0]).", ".round($rpts[1]);
+ for( $k=1; $k < 4; ++$k){
+ $csimcoord .= ", ".round($rpts[2*$k]).", ".round($rpts[2*$k+1]);
+ }
+ if( ! empty($this->plots[$j]->csimtargets[$i]) ) {
+ $this->csimareas.= 'csimareas.= " href=\"".$this->plots[$j]->csimtargets[$i]."\" ";
+
+ if( ! empty($this->plots[$j]->csimwintargets[$i]) ) {
+ $this->csimareas.= " target=\"".$this->plots[$j]->csimwintargets[$i]."\" ";
+ }
+
+ $sval='';
+ if( !empty($this->plots[$j]->csimalts[$i]) ) {
+ $sval=sprintf($this->plots[$j]->csimalts[$i],$this->plots[$j]->coords[0][$i]);
+ $this->csimareas .= " title=\"$sval\" ";
+ }
+ $this->csimareas .= " alt=\"$sval\" />\n";
+ }
+ }
+
+ $pts[] = $pts[0];
+ $pts[] = $pts[1];
+ $img->SetLineWeight($this->plots[$j]->weight);
+ $img->Polygon($pts);
+ $img->SetLineWeight(1);
+ }
+
+ // Daw potential bar around the entire accbar bar
+ if( $this->weight > 0 ) {
+ $y=$yscale->Translate(0);
+ $img->SetColor($this->color);
+ $img->SetLineWeight($this->weight);
+ $img->Rectangle($pts[0],$y,$pts[6],$pts[5]);
+ }
+
+ // Draw labels for each acc.bar
+
+ $x=$pts[2]+($pts[4]-$pts[2])/2;
+ if($this->bar_shadow) $x += $ssh;
+
+ // First stroke the accumulated value for the entire bar
+ // This value is always placed at the top/bottom of the bars
+ if( $accy_neg < 0 ) {
+ $y=$yscale->Translate($accy_neg);
+ $this->value->Stroke($img,$accy_neg,$x,$y);
+ }
+ else {
+ $y=$yscale->Translate($accy);
+ $this->value->Stroke($img,$accy,$x,$y);
+ }
+
+ $accy = 0;
+ $accy_neg = 0;
+ for($j=0; $j < $this->nbrplots; ++$j ) {
+
+ // We don't print 0 values in an accumulated bar plot
+ if( $this->plots[$j]->coords[0][$i] == 0 ) continue;
+
+ if ($this->plots[$j]->coords[0][$i] > 0) {
+ $yt=$yscale->Translate($this->plots[$j]->coords[0][$i]+$accy);
+ $accyt=$yscale->Translate($accy);
+ if( $this->plots[$j]->valuepos=='center' ) {
+ $y = $accyt-($accyt-$yt)/2;
+ }
+ elseif( $this->plots[$j]->valuepos=='bottom' ) {
+ $y = $accyt;
+ }
+ else { // top or max
+ $y = $accyt-($accyt-$yt);
+ }
+ $accy+=$this->plots[$j]->coords[0][$i];
+ if( $this->plots[$j]->valuepos=='center' ) {
+ $this->plots[$j]->value->SetAlign("center","center");
+ $this->plots[$j]->value->SetMargin(0);
+ }
+ elseif( $this->plots[$j]->valuepos=='bottom' ) {
+ $this->plots[$j]->value->SetAlign('center','bottom');
+ $this->plots[$j]->value->SetMargin(2);
+ }
+ else {
+ $this->plots[$j]->value->SetAlign('center','top');
+ $this->plots[$j]->value->SetMargin(1);
+ }
+ } else {
+ $yt=$yscale->Translate($this->plots[$j]->coords[0][$i]+$accy_neg);
+ $accyt=$yscale->Translate($accy_neg);
+ $accy_neg+=$this->plots[$j]->coords[0][$i];
+ if( $this->plots[$j]->valuepos=='center' ) {
+ $y = $accyt-($accyt-$yt)/2;
+ }
+ elseif( $this->plots[$j]->valuepos=='bottom' ) {
+ $y = $accyt;
+ }
+ else {
+ $y = $accyt-($accyt-$yt);
+ }
+ if( $this->plots[$j]->valuepos=='center' ) {
+ $this->plots[$j]->value->SetAlign("center","center");
+ $this->plots[$j]->value->SetMargin(0);
+ }
+ elseif( $this->plots[$j]->valuepos=='bottom' ) {
+ $this->plots[$j]->value->SetAlign('center',$j==0 ? 'bottom':'top');
+ $this->plots[$j]->value->SetMargin(-2);
+ }
+ else {
+ $this->plots[$j]->value->SetAlign('center','bottom');
+ $this->plots[$j]->value->SetMargin(-1);
+ }
+ }
+ $this->plots[$j]->value->Stroke($img,$this->plots[$j]->coords[0][$i],$x,$y);
+ }
- }
- return true;
+ }
+ return true;
}
} // Class
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_canvas.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_canvas.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_canvas.php 2006-10-08 04:09:02.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_canvas.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,13 +1,13 @@
Graph($aWidth,$aHeight,$aCachedName,$timeout,$inline);
+ //---------------
+ // CONSTRUCTOR
+ function __construct($aWidth=300,$aHeight=200,$aCachedName="",$timeout=0,$inline=1) {
+ parent::__construct($aWidth,$aHeight,$aCachedName,$timeout,$inline);
}
-//---------------
-// PUBLIC METHODS
+ //---------------
+ // PUBLIC METHODS
function InitFrame() {
- $this->StrokePlotArea();
+ $this->StrokePlotArea();
}
// Method description
function Stroke($aStrokeFileName="") {
- if( $this->texts != null ) {
- for($i=0; $i < count($this->texts); ++$i) {
- $this->texts[$i]->Stroke($this->img);
- }
- }
- if( $this->iTables !== null ) {
- for($i=0; $i < count($this->iTables); ++$i) {
- $this->iTables[$i]->Stroke($this->img);
- }
- }
- $this->StrokeTitles();
-
- // If the filename is the predefined value = '_csim_special_'
- // we assume that the call to stroke only needs to do enough
- // to correctly generate the CSIM maps.
- // We use this variable to skip things we don't strictly need
- // to do to generate the image map to improve performance
- // a best we can. Therefor you will see a lot of tests !$_csim in the
- // code below.
- $_csim = ($aStrokeFileName===_CSIM_SPECIALFILE);
-
- // We need to know if we have stroked the plot in the
- // GetCSIMareas. Otherwise the CSIM hasn't been generated
- // and in the case of GetCSIM called before stroke to generate
- // CSIM without storing an image to disk GetCSIM must call Stroke.
- $this->iHasStroked = true;
-
- if( !$_csim ) {
-
- // Should we do any final image transformation
- if( $this->iImgTrans ) {
- if( !class_exists('ImgTrans') ) {
- require_once('jpgraph_imgtrans.php');
- }
-
- $tform = new ImgTrans($this->img->img);
- $this->img->img = $tform->Skew3D($this->iImgTransHorizon,$this->iImgTransSkewDist,
- $this->iImgTransDirection,$this->iImgTransHighQ,
- $this->iImgTransMinSize,$this->iImgTransFillColor,
- $this->iImgTransBorder);
- }
-
-
- // If the filename is given as the special _IMG_HANDLER
- // then the image handler is returned and the image is NOT
- // streamed back
- if( $aStrokeFileName == _IMG_HANDLER ) {
- return $this->img->img;
- }
- else {
- // Finally stream the generated picture
- $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,$aStrokeFileName);
- return true;
- }
- }
+ if( $this->texts != null ) {
+ for($i=0; $i < count($this->texts); ++$i) {
+ $this->texts[$i]->Stroke($this->img);
+ }
+ }
+ if( $this->iTables !== null ) {
+ for($i=0; $i < count($this->iTables); ++$i) {
+ $this->iTables[$i]->Stroke($this->img);
+ }
+ }
+ $this->StrokeTitles();
+
+ // If the filename is the predefined value = '_csim_special_'
+ // we assume that the call to stroke only needs to do enough
+ // to correctly generate the CSIM maps.
+ // We use this variable to skip things we don't strictly need
+ // to do to generate the image map to improve performance
+ // a best we can. Therefor you will see a lot of tests !$_csim in the
+ // code below.
+ $_csim = ($aStrokeFileName===_CSIM_SPECIALFILE);
+
+ // We need to know if we have stroked the plot in the
+ // GetCSIMareas. Otherwise the CSIM hasn't been generated
+ // and in the case of GetCSIM called before stroke to generate
+ // CSIM without storing an image to disk GetCSIM must call Stroke.
+ $this->iHasStroked = true;
+
+ if( !$_csim ) {
+
+ // Should we do any final image transformation
+ if( $this->iImgTrans ) {
+ if( !class_exists('ImgTrans',false) ) {
+ require_once('jpgraph_imgtrans.php');
+ }
+
+ $tform = new ImgTrans($this->img->img);
+ $this->img->img = $tform->Skew3D($this->iImgTransHorizon,$this->iImgTransSkewDist,
+ $this->iImgTransDirection,$this->iImgTransHighQ,
+ $this->iImgTransMinSize,$this->iImgTransFillColor,
+ $this->iImgTransBorder);
+ }
+
+
+ // If the filename is given as the special _IMG_HANDLER
+ // then the image handler is returned and the image is NOT
+ // streamed back
+ if( $aStrokeFileName == _IMG_HANDLER ) {
+ return $this->img->img;
+ }
+ else {
+ // Finally stream the generated picture
+ $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,$aStrokeFileName);
+ return true;
+ }
+ }
}
} // Class
+
/* EOF */
?>
\ Pas de fin de ligne à la fin du fichier.
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_canvtools.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_canvtools.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_canvtools.php 2006-10-08 04:09:02.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_canvtools.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,18 +1,18 @@
g = &$graph;
- $this->w = $graph->img->width;
- $this->h = $graph->img->height;
- $this->ixmin = $xmin;
- $this->ixmax = $xmax;
- $this->iymin = $ymin;
- $this->iymax = $ymax;
+ private $g;
+ private $w,$h;
+ private $ixmin=0,$ixmax=10,$iymin=0,$iymax=10;
+
+ function __construct($graph,$xmin=0,$xmax=10,$ymin=0,$ymax=10) {
+ $this->g = $graph;
+ $this->w = $graph->img->width;
+ $this->h = $graph->img->height;
+ $this->ixmin = $xmin;
+ $this->ixmax = $xmax;
+ $this->iymin = $ymin;
+ $this->iymax = $ymax;
}
-
+
function Set($xmin=0,$xmax=10,$ymin=0,$ymax=10) {
- $this->ixmin = $xmin;
- $this->ixmax = $xmax;
- $this->iymin = $ymin;
- $this->iymax = $ymax;
+ $this->ixmin = $xmin;
+ $this->ixmax = $xmax;
+ $this->iymin = $ymin;
+ $this->iymax = $ymax;
+ }
+
+ function Get() {
+ return array($this->ixmin,$this->ixmax,$this->iymin,$this->iymax);
}
function Translate($x,$y) {
- $xp = round(($x-$this->ixmin)/($this->ixmax - $this->ixmin) * $this->w);
- $yp = round(($y-$this->iymin)/($this->iymax - $this->iymin) * $this->h);
- return array($xp,$yp);
+ $xp = round(($x-$this->ixmin)/($this->ixmax - $this->ixmin) * $this->w);
+ $yp = round(($y-$this->iymin)/($this->iymax - $this->iymin) * $this->h);
+ return array($xp,$yp);
}
function TranslateX($x) {
- $xp = round(($x-$this->ixmin)/($this->ixmax - $this->ixmin) * $this->w);
- return $xp;
+ $xp = round(($x-$this->ixmin)/($this->ixmax - $this->ixmin) * $this->w);
+ return $xp;
}
function TranslateY($y) {
- $yp = round(($y-$this->iymin)/($this->iymax - $this->iymin) * $this->h);
- return $yp;
+ $yp = round(($y-$this->iymin)/($this->iymax - $this->iymin) * $this->h);
+ return $yp;
}
}
@@ -67,42 +71,46 @@
// Description: Methods to draw shapes on canvas
//===================================================
class Shape {
- var $img,$scale;
+ private $img,$scale;
- function Shape(&$aGraph,&$scale) {
- $this->img = &$aGraph->img;
- $this->img->SetColor('black');
- $this->scale = &$scale;
+ function __construct($aGraph,$scale) {
+ $this->img = $aGraph->img;
+ $this->img->SetColor('black');
+ $this->scale = $scale;
}
function SetColor($aColor) {
- $this->img->SetColor($aColor);
+ $this->img->SetColor($aColor);
}
function Line($x1,$y1,$x2,$y2) {
- list($x1,$y1) = $this->scale->Translate($x1,$y1);
- list($x2,$y2) = $this->scale->Translate($x2,$y2);
- $this->img->Line($x1,$y1,$x2,$y2);
+ list($x1,$y1) = $this->scale->Translate($x1,$y1);
+ list($x2,$y2) = $this->scale->Translate($x2,$y2);
+ $this->img->Line($x1,$y1,$x2,$y2);
+ }
+
+ function SetLineWeight($aWeight) {
+ $this->img->SetLineWeight($aWeight);
}
function Polygon($p,$aClosed=false) {
- $n=count($p);
- for($i=0; $i < $n; $i+=2 ) {
- $p[$i] = $this->scale->TranslateX($p[$i]);
- $p[$i+1] = $this->scale->TranslateY($p[$i+1]);
- }
- $this->img->Polygon($p,$aClosed);
+ $n=count($p);
+ for($i=0; $i < $n; $i+=2 ) {
+ $p[$i] = $this->scale->TranslateX($p[$i]);
+ $p[$i+1] = $this->scale->TranslateY($p[$i+1]);
+ }
+ $this->img->Polygon($p,$aClosed);
}
function FilledPolygon($p) {
- $n=count($p);
- for($i=0; $i < $n; $i+=2 ) {
- $p[$i] = $this->scale->TranslateX($p[$i]);
- $p[$i+1] = $this->scale->TranslateY($p[$i+1]);
- }
- $this->img->FilledPolygon($p);
+ $n=count($p);
+ for($i=0; $i < $n; $i+=2 ) {
+ $p[$i] = $this->scale->TranslateX($p[$i]);
+ $p[$i+1] = $this->scale->TranslateY($p[$i+1]);
+ }
+ $this->img->FilledPolygon($p);
}
-
+
// Draw a bezier curve with defining points in the $aPnts array
// using $aSteps steps.
@@ -111,401 +119,401 @@
// 4=x2, 5=y2
// 6=x3, 7=y3
function Bezier($p,$aSteps=40) {
- $x0 = $p[0];
- $y0 = $p[1];
- // Calculate coefficients
- $cx = 3*($p[2]-$p[0]);
- $bx = 3*($p[4]-$p[2])-$cx;
- $ax = $p[6]-$p[0]-$cx-$bx;
- $cy = 3*($p[3]-$p[1]);
- $by = 3*($p[5]-$p[3])-$cy;
- $ay = $p[7]-$p[1]-$cy-$by;
-
- // Step size
- $delta = 1.0/$aSteps;
-
- $x_old = $x0;
- $y_old = $y0;
- for($t=$delta; $t<=1.0; $t+=$delta) {
- $tt = $t*$t; $ttt=$tt*$t;
- $x = $ax*$ttt + $bx*$tt + $cx*$t + $x0;
- $y = $ay*$ttt + $by*$tt + $cy*$t + $y0;
- $this->Line($x_old,$y_old,$x,$y);
- $x_old = $x;
- $y_old = $y;
- }
- $this->Line($x_old,$y_old,$p[6],$p[7]);
+ $x0 = $p[0];
+ $y0 = $p[1];
+ // Calculate coefficients
+ $cx = 3*($p[2]-$p[0]);
+ $bx = 3*($p[4]-$p[2])-$cx;
+ $ax = $p[6]-$p[0]-$cx-$bx;
+ $cy = 3*($p[3]-$p[1]);
+ $by = 3*($p[5]-$p[3])-$cy;
+ $ay = $p[7]-$p[1]-$cy-$by;
+
+ // Step size
+ $delta = 1.0/$aSteps;
+
+ $x_old = $x0;
+ $y_old = $y0;
+ for($t=$delta; $t<=1.0; $t+=$delta) {
+ $tt = $t*$t; $ttt=$tt*$t;
+ $x = $ax*$ttt + $bx*$tt + $cx*$t + $x0;
+ $y = $ay*$ttt + $by*$tt + $cy*$t + $y0;
+ $this->Line($x_old,$y_old,$x,$y);
+ $x_old = $x;
+ $y_old = $y;
+ }
+ $this->Line($x_old,$y_old,$p[6],$p[7]);
}
function Rectangle($x1,$y1,$x2,$y2) {
- list($x1,$y1) = $this->scale->Translate($x1,$y1);
- list($x2,$y2) = $this->scale->Translate($x2,$y2);
- $this->img->Rectangle($x1,$y1,$x2,$y2);
+ list($x1,$y1) = $this->scale->Translate($x1,$y1);
+ list($x2,$y2) = $this->scale->Translate($x2,$y2);
+ $this->img->Rectangle($x1,$y1,$x2,$y2);
}
function FilledRectangle($x1,$y1,$x2,$y2) {
- list($x1,$y1) = $this->scale->Translate($x1,$y1);
- list($x2,$y2) = $this->scale->Translate($x2,$y2);
- $this->img->FilledRectangle($x1,$y1,$x2,$y2);
+ list($x1,$y1) = $this->scale->Translate($x1,$y1);
+ list($x2,$y2) = $this->scale->Translate($x2,$y2);
+ $this->img->FilledRectangle($x1,$y1,$x2,$y2);
}
-
+
function Circle($x1,$y1,$r) {
- list($x1,$y1) = $this->scale->Translate($x1,$y1);
- if( $r >= 0 )
- $r = $this->scale->TranslateX($r);
- else
- $r = -$r;
- $this->img->Circle($x1,$y1,$r);
+ list($x1,$y1) = $this->scale->Translate($x1,$y1);
+ if( $r >= 0 )
+ $r = $this->scale->TranslateX($r);
+ else
+ $r = -$r;
+ $this->img->Circle($x1,$y1,$r);
}
function FilledCircle($x1,$y1,$r) {
- list($x1,$y1) = $this->scale->Translate($x1,$y1);
- if( $r >= 0 )
- $r = $this->scale->TranslateX($r);
- else
- $r = -$r;
- $this->img->FilledCircle($x1,$y1,$r);
- }
-
- function RoundedRectangle($x1,$y1,$x2,$y2,$r=null) {
- list($x1,$y1) = $this->scale->Translate($x1,$y1);
- list($x2,$y2) = $this->scale->Translate($x2,$y2);
-
- if( $r == null )
- $r = 5;
- elseif( $r >= 0 )
- $r = $this->scale->TranslateX($r);
- else
- $r = -$r;
- $this->img->RoundedRectangle($x1,$y1,$x2,$y2,$r);
- }
-
- function FilledRoundedRectangle($x1,$y1,$x2,$y2,$r=null) {
- list($x1,$y1) = $this->scale->Translate($x1,$y1);
- list($x2,$y2) = $this->scale->Translate($x2,$y2);
-
- if( $r == null )
- $r = 5;
- elseif( $r > 0 )
- $r = $this->scale->TranslateX($r);
- else
- $r = -$r;
- $this->img->FilledRoundedRectangle($x1,$y1,$x2,$y2,$r);
+ list($x1,$y1) = $this->scale->Translate($x1,$y1);
+ if( $r >= 0 )
+ $r = $this->scale->TranslateX($r);
+ else
+ $r = -$r;
+ $this->img->FilledCircle($x1,$y1,$r);
+ }
+
+ function RoundedRectangle($x1,$y1,$x2,$y2,$r=null) {
+ list($x1,$y1) = $this->scale->Translate($x1,$y1);
+ list($x2,$y2) = $this->scale->Translate($x2,$y2);
+
+ if( $r == null )
+ $r = 5;
+ elseif( $r >= 0 )
+ $r = $this->scale->TranslateX($r);
+ else
+ $r = -$r;
+ $this->img->RoundedRectangle($x1,$y1,$x2,$y2,$r);
+ }
+
+ function FilledRoundedRectangle($x1,$y1,$x2,$y2,$r=null) {
+ list($x1,$y1) = $this->scale->Translate($x1,$y1);
+ list($x2,$y2) = $this->scale->Translate($x2,$y2);
+
+ if( $r == null )
+ $r = 5;
+ elseif( $r > 0 )
+ $r = $this->scale->TranslateX($r);
+ else
+ $r = -$r;
+ $this->img->FilledRoundedRectangle($x1,$y1,$x2,$y2,$r);
}
function ShadowRectangle($x1,$y1,$x2,$y2,$fcolor=false,$shadow_width=null,$shadow_color=array(102,102,102)) {
- list($x1,$y1) = $this->scale->Translate($x1,$y1);
- list($x2,$y2) = $this->scale->Translate($x2,$y2);
- if( $shadow_width == null )
- $shadow_width=4;
- else
- $shadow_width=$this->scale->TranslateX($shadow_width);
- $this->img->ShadowRectangle($x1,$y1,$x2,$y2,$fcolor,$shadow_width,$shadow_color);
+ list($x1,$y1) = $this->scale->Translate($x1,$y1);
+ list($x2,$y2) = $this->scale->Translate($x2,$y2);
+ if( $shadow_width == null )
+ $shadow_width=4;
+ else
+ $shadow_width=$this->scale->TranslateX($shadow_width);
+ $this->img->ShadowRectangle($x1,$y1,$x2,$y2,$fcolor,$shadow_width,$shadow_color);
}
function SetTextAlign($halign,$valign="bottom") {
- $this->img->SetTextAlign($halign,$valign="bottom");
+ $this->img->SetTextAlign($halign,$valign="bottom");
}
function StrokeText($x1,$y1,$txt,$dir=0,$paragraph_align="left") {
- list($x1,$y1) = $this->scale->Translate($x1,$y1);
- $this->img->StrokeText($x1,$y1,$txt,$dir,$paragraph_align);
+ list($x1,$y1) = $this->scale->Translate($x1,$y1);
+ $this->img->StrokeText($x1,$y1,$txt,$dir,$paragraph_align);
}
// A rounded rectangle where one of the corner has been moved "into" the
// rectangle 'iw' width and 'ih' height. Corners:
// 0=Top left, 1=top right, 2=bottom right, 3=bottom left
function IndentedRectangle($xt,$yt,$w,$h,$iw=0,$ih=0,$aCorner=3,$aFillColor="",$r=4) {
-
- list($xt,$yt) = $this->scale->Translate($xt,$yt);
- list($w,$h) = $this->scale->Translate($w,$h);
- list($iw,$ih) = $this->scale->Translate($iw,$ih);
-
- $xr = $xt + $w - 0;
- $yl = $yt + $h - 0;
-
- switch( $aCorner ) {
- case 0: // Upper left
-
- // Bottom line, left & right arc
- $this->img->Line($xt+$r,$yl,$xr-$r,$yl);
- $this->img->Arc($xt+$r,$yl-$r,$r*2,$r*2,90,180);
- $this->img->Arc($xr-$r,$yl-$r,$r*2,$r*2,0,90);
-
- // Right line, Top right arc
- $this->img->Line($xr,$yt+$r,$xr,$yl-$r);
- $this->img->Arc($xr-$r,$yt+$r,$r*2,$r*2,270,360);
-
- // Top line, Top left arc
- $this->img->Line($xt+$iw+$r,$yt,$xr-$r,$yt);
- $this->img->Arc($xt+$iw+$r,$yt+$r,$r*2,$r*2,180,270);
-
- // Left line
- $this->img->Line($xt,$yt+$ih+$r,$xt,$yl-$r);
-
- // Indent horizontal, Lower left arc
- $this->img->Line($xt+$r,$yt+$ih,$xt+$iw-$r,$yt+$ih);
- $this->img->Arc($xt+$r,$yt+$ih+$r,$r*2,$r*2,180,270);
-
- // Indent vertical, Indent arc
- $this->img->Line($xt+$iw,$yt+$r,$xt+$iw,$yt+$ih-$r);
- $this->img->Arc($xt+$iw-$r,$yt+$ih-$r,$r*2,$r*2,0,90);
-
- if( $aFillColor != '' ) {
- $bc = $this->img->current_color_name;
- $this->img->PushColor($aFillColor);
- $this->img->FillToBorder($xr-$r,$yl-$r,$bc);
- $this->img->PopColor();
- }
-
- break;
-
- case 1: // Upper right
-
- // Bottom line, left & right arc
- $this->img->Line($xt+$r,$yl,$xr-$r,$yl);
- $this->img->Arc($xt+$r,$yl-$r,$r*2,$r*2,90,180);
- $this->img->Arc($xr-$r,$yl-$r,$r*2,$r*2,0,90);
-
- // Left line, Top left arc
- $this->img->Line($xt,$yt+$r,$xt,$yl-$r);
- $this->img->Arc($xt+$r,$yt+$r,$r*2,$r*2,180,270);
-
- // Top line, Top right arc
- $this->img->Line($xt+$r,$yt,$xr-$iw-$r,$yt);
- $this->img->Arc($xr-$iw-$r,$yt+$r,$r*2,$r*2,270,360);
-
- // Right line
- $this->img->Line($xr,$yt+$ih+$r,$xr,$yl-$r);
-
- // Indent horizontal, Lower right arc
- $this->img->Line($xr-$iw+$r,$yt+$ih,$xr-$r,$yt+$ih);
- $this->img->Arc($xr-$r,$yt+$ih+$r,$r*2,$r*2,270,360);
-
- // Indent vertical, Indent arc
- $this->img->Line($xr-$iw,$yt+$r,$xr-$iw,$yt+$ih-$r);
- $this->img->Arc($xr-$iw+$r,$yt+$ih-$r,$r*2,$r*2,90,180);
-
- if( $aFillColor != '' ) {
- $bc = $this->img->current_color_name;
- $this->img->PushColor($aFillColor);
- $this->img->FillToBorder($xt+$r,$yl-$r,$bc);
- $this->img->PopColor();
- }
-
- break;
-
- case 2: // Lower right
- // Top line, Top left & Top right arc
- $this->img->Line($xt+$r,$yt,$xr-$r,$yt);
- $this->img->Arc($xt+$r,$yt+$r,$r*2,$r*2,180,270);
- $this->img->Arc($xr-$r,$yt+$r,$r*2,$r*2,270,360);
-
- // Left line, Bottom left arc
- $this->img->Line($xt,$yt+$r,$xt,$yl-$r);
- $this->img->Arc($xt+$r,$yl-$r,$r*2,$r*2,90,180);
-
- // Bottom line, Bottom right arc
- $this->img->Line($xt+$r,$yl,$xr-$iw-$r,$yl);
- $this->img->Arc($xr-$iw-$r,$yl-$r,$r*2,$r*2,0,90);
-
- // Right line
- $this->img->Line($xr,$yt+$r,$xr,$yl-$ih-$r);
-
- // Indent horizontal, Lower right arc
- $this->img->Line($xr-$r,$yl-$ih,$xr-$iw+$r,$yl-$ih);
- $this->img->Arc($xr-$r,$yl-$ih-$r,$r*2,$r*2,0,90);
-
- // Indent vertical, Indent arc
- $this->img->Line($xr-$iw,$yl-$r,$xr-$iw,$yl-$ih+$r);
- $this->img->Arc($xr-$iw+$r,$yl-$ih+$r,$r*2,$r*2,180,270);
-
- if( $aFillColor != '' ) {
- $bc = $this->img->current_color_name;
- $this->img->PushColor($aFillColor);
- $this->img->FillToBorder($xt+$r,$yt+$r,$bc);
- $this->img->PopColor();
- }
-
- break;
-
- case 3: // Lower left
- // Top line, Top left & Top right arc
- $this->img->Line($xt+$r,$yt,$xr-$r,$yt);
- $this->img->Arc($xt+$r,$yt+$r,$r*2,$r*2,180,270);
- $this->img->Arc($xr-$r,$yt+$r,$r*2,$r*2,270,360);
-
- // Right line, Bottom right arc
- $this->img->Line($xr,$yt+$r,$xr,$yl-$r);
- $this->img->Arc($xr-$r,$yl-$r,$r*2,$r*2,0,90);
-
- // Bottom line, Bottom left arc
- $this->img->Line($xt+$iw+$r,$yl,$xr-$r,$yl);
- $this->img->Arc($xt+$iw+$r,$yl-$r,$r*2,$r*2,90,180);
-
- // Left line
- $this->img->Line($xt,$yt+$r,$xt,$yl-$ih-$r);
-
- // Indent horizontal, Lower left arc
- $this->img->Line($xt+$r,$yl-$ih,$xt+$iw-$r,$yl-$ih);
- $this->img->Arc($xt+$r,$yl-$ih-$r,$r*2,$r*2,90,180);
-
- // Indent vertical, Indent arc
- $this->img->Line($xt+$iw,$yl-$ih+$r,$xt+$iw,$yl-$r);
- $this->img->Arc($xt+$iw-$r,$yl-$ih+$r,$r*2,$r*2,270,360);
-
- if( $aFillColor != '' ) {
- $bc = $this->img->current_color_name;
- $this->img->PushColor($aFillColor);
- $this->img->FillToBorder($xr-$r,$yt+$r,$bc);
- $this->img->PopColor();
- }
- break;
- }
+ list($xt,$yt) = $this->scale->Translate($xt,$yt);
+ list($w,$h) = $this->scale->Translate($w,$h);
+ list($iw,$ih) = $this->scale->Translate($iw,$ih);
+
+ $xr = $xt + $w - 0;
+ $yl = $yt + $h - 0;
+
+ switch( $aCorner ) {
+ case 0: // Upper left
+
+ // Bottom line, left & right arc
+ $this->img->Line($xt+$r,$yl,$xr-$r,$yl);
+ $this->img->Arc($xt+$r,$yl-$r,$r*2,$r*2,90,180);
+ $this->img->Arc($xr-$r,$yl-$r,$r*2,$r*2,0,90);
+
+ // Right line, Top right arc
+ $this->img->Line($xr,$yt+$r,$xr,$yl-$r);
+ $this->img->Arc($xr-$r,$yt+$r,$r*2,$r*2,270,360);
+
+ // Top line, Top left arc
+ $this->img->Line($xt+$iw+$r,$yt,$xr-$r,$yt);
+ $this->img->Arc($xt+$iw+$r,$yt+$r,$r*2,$r*2,180,270);
+
+ // Left line
+ $this->img->Line($xt,$yt+$ih+$r,$xt,$yl-$r);
+
+ // Indent horizontal, Lower left arc
+ $this->img->Line($xt+$r,$yt+$ih,$xt+$iw-$r,$yt+$ih);
+ $this->img->Arc($xt+$r,$yt+$ih+$r,$r*2,$r*2,180,270);
+
+ // Indent vertical, Indent arc
+ $this->img->Line($xt+$iw,$yt+$r,$xt+$iw,$yt+$ih-$r);
+ $this->img->Arc($xt+$iw-$r,$yt+$ih-$r,$r*2,$r*2,0,90);
+
+ if( $aFillColor != '' ) {
+ $bc = $this->img->current_color_name;
+ $this->img->PushColor($aFillColor);
+ $this->img->FillToBorder($xr-$r,$yl-$r,$bc);
+ $this->img->PopColor();
+ }
+
+ break;
+
+ case 1: // Upper right
+
+ // Bottom line, left & right arc
+ $this->img->Line($xt+$r,$yl,$xr-$r,$yl);
+ $this->img->Arc($xt+$r,$yl-$r,$r*2,$r*2,90,180);
+ $this->img->Arc($xr-$r,$yl-$r,$r*2,$r*2,0,90);
+
+ // Left line, Top left arc
+ $this->img->Line($xt,$yt+$r,$xt,$yl-$r);
+ $this->img->Arc($xt+$r,$yt+$r,$r*2,$r*2,180,270);
+
+ // Top line, Top right arc
+ $this->img->Line($xt+$r,$yt,$xr-$iw-$r,$yt);
+ $this->img->Arc($xr-$iw-$r,$yt+$r,$r*2,$r*2,270,360);
+
+ // Right line
+ $this->img->Line($xr,$yt+$ih+$r,$xr,$yl-$r);
+
+ // Indent horizontal, Lower right arc
+ $this->img->Line($xr-$iw+$r,$yt+$ih,$xr-$r,$yt+$ih);
+ $this->img->Arc($xr-$r,$yt+$ih+$r,$r*2,$r*2,270,360);
+
+ // Indent vertical, Indent arc
+ $this->img->Line($xr-$iw,$yt+$r,$xr-$iw,$yt+$ih-$r);
+ $this->img->Arc($xr-$iw+$r,$yt+$ih-$r,$r*2,$r*2,90,180);
+
+ if( $aFillColor != '' ) {
+ $bc = $this->img->current_color_name;
+ $this->img->PushColor($aFillColor);
+ $this->img->FillToBorder($xt+$r,$yl-$r,$bc);
+ $this->img->PopColor();
+ }
+
+ break;
+
+ case 2: // Lower right
+ // Top line, Top left & Top right arc
+ $this->img->Line($xt+$r,$yt,$xr-$r,$yt);
+ $this->img->Arc($xt+$r,$yt+$r,$r*2,$r*2,180,270);
+ $this->img->Arc($xr-$r,$yt+$r,$r*2,$r*2,270,360);
+
+ // Left line, Bottom left arc
+ $this->img->Line($xt,$yt+$r,$xt,$yl-$r);
+ $this->img->Arc($xt+$r,$yl-$r,$r*2,$r*2,90,180);
+
+ // Bottom line, Bottom right arc
+ $this->img->Line($xt+$r,$yl,$xr-$iw-$r,$yl);
+ $this->img->Arc($xr-$iw-$r,$yl-$r,$r*2,$r*2,0,90);
+
+ // Right line
+ $this->img->Line($xr,$yt+$r,$xr,$yl-$ih-$r);
+
+ // Indent horizontal, Lower right arc
+ $this->img->Line($xr-$r,$yl-$ih,$xr-$iw+$r,$yl-$ih);
+ $this->img->Arc($xr-$r,$yl-$ih-$r,$r*2,$r*2,0,90);
+
+ // Indent vertical, Indent arc
+ $this->img->Line($xr-$iw,$yl-$r,$xr-$iw,$yl-$ih+$r);
+ $this->img->Arc($xr-$iw+$r,$yl-$ih+$r,$r*2,$r*2,180,270);
+
+ if( $aFillColor != '' ) {
+ $bc = $this->img->current_color_name;
+ $this->img->PushColor($aFillColor);
+ $this->img->FillToBorder($xt+$r,$yt+$r,$bc);
+ $this->img->PopColor();
+ }
+
+ break;
+
+ case 3: // Lower left
+ // Top line, Top left & Top right arc
+ $this->img->Line($xt+$r,$yt,$xr-$r,$yt);
+ $this->img->Arc($xt+$r,$yt+$r,$r*2,$r*2,180,270);
+ $this->img->Arc($xr-$r,$yt+$r,$r*2,$r*2,270,360);
+
+ // Right line, Bottom right arc
+ $this->img->Line($xr,$yt+$r,$xr,$yl-$r);
+ $this->img->Arc($xr-$r,$yl-$r,$r*2,$r*2,0,90);
+
+ // Bottom line, Bottom left arc
+ $this->img->Line($xt+$iw+$r,$yl,$xr-$r,$yl);
+ $this->img->Arc($xt+$iw+$r,$yl-$r,$r*2,$r*2,90,180);
+
+ // Left line
+ $this->img->Line($xt,$yt+$r,$xt,$yl-$ih-$r);
+
+ // Indent horizontal, Lower left arc
+ $this->img->Line($xt+$r,$yl-$ih,$xt+$iw-$r,$yl-$ih);
+ $this->img->Arc($xt+$r,$yl-$ih-$r,$r*2,$r*2,90,180);
+
+ // Indent vertical, Indent arc
+ $this->img->Line($xt+$iw,$yl-$ih+$r,$xt+$iw,$yl-$r);
+ $this->img->Arc($xt+$iw-$r,$yl-$ih+$r,$r*2,$r*2,270,360);
+
+ if( $aFillColor != '' ) {
+ $bc = $this->img->current_color_name;
+ $this->img->PushColor($aFillColor);
+ $this->img->FillToBorder($xr-$r,$yt+$r,$bc);
+ $this->img->PopColor();
+ }
+
+ break;
+ }
}
}
//===================================================
// CLASS RectangleText
-// Description: Draws a text paragraph inside a
+// Description: Draws a text paragraph inside a
// rounded, possible filled, rectangle.
//===================================================
class CanvasRectangleText {
- var $ix,$iy,$iw,$ih,$ir=4;
- var $iTxt,$iColor='black',$iFillColor='',$iFontColor='black';
- var $iParaAlign='center';
- var $iAutoBoxMargin=5;
- var $iShadowWidth=3,$iShadowColor='';
-
- function CanvasRectangleText($aTxt='',$xl=0,$yt=0,$w=0,$h=0) {
- $this->iTxt = new Text($aTxt);
- $this->ix = $xl;
- $this->iy = $yt;
- $this->iw = $w;
- $this->ih = $h;
+ private $ix,$iy,$iw,$ih,$ir=4;
+ private $iTxt,$iColor='black',$iFillColor='',$iFontColor='black';
+ private $iParaAlign='center';
+ private $iAutoBoxMargin=5;
+ private $iShadowWidth=3,$iShadowColor='';
+
+ function __construct($aTxt='',$xl=0,$yt=0,$w=0,$h=0) {
+ $this->iTxt = new Text($aTxt);
+ $this->ix = $xl;
+ $this->iy = $yt;
+ $this->iw = $w;
+ $this->ih = $h;
}
-
+
function SetShadow($aColor='gray',$aWidth=3) {
- $this->iShadowColor = $aColor;
- $this->iShadowWidth = $aWidth;
+ $this->iShadowColor = $aColor;
+ $this->iShadowWidth = $aWidth;
}
function SetFont($FontFam,$aFontStyle,$aFontSize=12) {
- $this->iTxt->SetFont($FontFam,$aFontStyle,$aFontSize);
+ $this->iTxt->SetFont($FontFam,$aFontStyle,$aFontSize);
}
function SetTxt($aTxt) {
- $this->iTxt->Set($aTxt);
+ $this->iTxt->Set($aTxt);
}
function ParagraphAlign($aParaAlign) {
- $this->iParaAlign = $aParaAlign;
+ $this->iParaAlign = $aParaAlign;
}
function SetFillColor($aFillColor) {
- $this->iFillColor = $aFillColor;
+ $this->iFillColor = $aFillColor;
}
function SetAutoMargin($aMargin) {
- $this->iAutoBoxMargin=$aMargin;
+ $this->iAutoBoxMargin=$aMargin;
}
function SetColor($aColor) {
- $this->iColor = $aColor;
+ $this->iColor = $aColor;
}
function SetFontColor($aColor) {
- $this->iFontColor = $aColor;
+ $this->iFontColor = $aColor;
}
function SetPos($xl=0,$yt=0,$w=0,$h=0) {
- $this->ix = $xl;
- $this->iy = $yt;
- $this->iw = $w;
- $this->ih = $h;
+ $this->ix = $xl;
+ $this->iy = $yt;
+ $this->iw = $w;
+ $this->ih = $h;
}
function Pos($xl=0,$yt=0,$w=0,$h=0) {
- $this->ix = $xl;
- $this->iy = $yt;
- $this->iw = $w;
- $this->ih = $h;
+ $this->ix = $xl;
+ $this->iy = $yt;
+ $this->iw = $w;
+ $this->ih = $h;
}
function Set($aTxt,$xl,$yt,$w=0,$h=0) {
- $this->iTxt->Set($aTxt);
- $this->ix = $xl;
- $this->iy = $yt;
- $this->iw = $w;
- $this->ih = $h;
+ $this->iTxt->Set($aTxt);
+ $this->ix = $xl;
+ $this->iy = $yt;
+ $this->iw = $w;
+ $this->ih = $h;
}
function SetCornerRadius($aRad=5) {
- $this->ir = $aRad;
+ $this->ir = $aRad;
}
function Stroke($aImg,$scale) {
-
- // If coordinates are specifed as negative this means we should
- // treat them as abolsute (pixels) coordinates
- if( $this->ix > 0 ) {
- $this->ix = $scale->TranslateX($this->ix) ;
- }
- else {
- $this->ix = -$this->ix;
- }
-
- if( $this->iy > 0 ) {
- $this->iy = $scale->TranslateY($this->iy) ;
- }
- else {
- $this->iy = -$this->iy;
- }
-
- list($this->iw,$this->ih) = $scale->Translate($this->iw,$this->ih) ;
-
- if( $this->iw == 0 )
- $this->iw = round($this->iTxt->GetWidth($aImg) + $this->iAutoBoxMargin);
- if( $this->ih == 0 ) {
- $this->ih = round($this->iTxt->GetTextHeight($aImg) + $this->iAutoBoxMargin);
- }
-
- if( $this->iShadowColor != '' ) {
- $aImg->PushColor($this->iShadowColor);
- $aImg->FilledRoundedRectangle($this->ix+$this->iShadowWidth,
- $this->iy+$this->iShadowWidth,
- $this->ix+$this->iw-1+$this->iShadowWidth,
- $this->iy+$this->ih-1+$this->iShadowWidth,
- $this->ir);
- $aImg->PopColor();
- }
-
- if( $this->iFillColor != '' ) {
- $aImg->PushColor($this->iFillColor);
- $aImg->FilledRoundedRectangle($this->ix,$this->iy,
- $this->ix+$this->iw-1,
- $this->iy+$this->ih-1,
- $this->ir);
- $aImg->PopColor();
- }
-
- if( $this->iColor != '' ) {
- $aImg->PushColor($this->iColor);
- $aImg->RoundedRectangle($this->ix,$this->iy,
- $this->ix+$this->iw-1,
- $this->iy+$this->ih-1,
- $this->ir);
- $aImg->PopColor();
- }
-
- $this->iTxt->Align('center','center');
- $this->iTxt->ParagraphAlign($this->iParaAlign);
- $this->iTxt->SetColor($this->iFontColor);
- $this->iTxt->Stroke($aImg, $this->ix+$this->iw/2, $this->iy+$this->ih/2);
- return array($this->iw, $this->ih);
+ // If coordinates are specifed as negative this means we should
+ // treat them as abolsute (pixels) coordinates
+ if( $this->ix > 0 ) {
+ $this->ix = $scale->TranslateX($this->ix) ;
+ }
+ else {
+ $this->ix = -$this->ix;
+ }
+
+ if( $this->iy > 0 ) {
+ $this->iy = $scale->TranslateY($this->iy) ;
+ }
+ else {
+ $this->iy = -$this->iy;
+ }
+
+ list($this->iw,$this->ih) = $scale->Translate($this->iw,$this->ih) ;
+
+ if( $this->iw == 0 )
+ $this->iw = round($this->iTxt->GetWidth($aImg) + $this->iAutoBoxMargin);
+ if( $this->ih == 0 ) {
+ $this->ih = round($this->iTxt->GetTextHeight($aImg) + $this->iAutoBoxMargin);
+ }
+
+ if( $this->iShadowColor != '' ) {
+ $aImg->PushColor($this->iShadowColor);
+ $aImg->FilledRoundedRectangle($this->ix+$this->iShadowWidth,
+ $this->iy+$this->iShadowWidth,
+ $this->ix+$this->iw-1+$this->iShadowWidth,
+ $this->iy+$this->ih-1+$this->iShadowWidth,
+ $this->ir);
+ $aImg->PopColor();
+ }
+
+ if( $this->iFillColor != '' ) {
+ $aImg->PushColor($this->iFillColor);
+ $aImg->FilledRoundedRectangle($this->ix,$this->iy,
+ $this->ix+$this->iw-1,
+ $this->iy+$this->ih-1,
+ $this->ir);
+ $aImg->PopColor();
+ }
+
+ if( $this->iColor != '' ) {
+ $aImg->PushColor($this->iColor);
+ $aImg->RoundedRectangle($this->ix,$this->iy,
+ $this->ix+$this->iw-1,
+ $this->iy+$this->ih-1,
+ $this->ir);
+ $aImg->PopColor();
+ }
+
+ $this->iTxt->Align('center','center');
+ $this->iTxt->ParagraphAlign($this->iParaAlign);
+ $this->iTxt->SetColor($this->iFontColor);
+ $this->iTxt->Stroke($aImg, $this->ix+$this->iw/2, $this->iy+$this->ih/2);
+
+ return array($this->iw, $this->ih);
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_contour.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_contour.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_contour.php 1969-12-31 19:00:00.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_contour.php 1970-01-01 04:13:08.000000000 -0500
@@ -0,0 +1,587 @@
+nbrRows = count($aMatrix);
+ $this->nbrCols = count($aMatrix[0]);
+ $this->dataPoints = $aMatrix;
+
+ if( is_array($aIsobars) ) {
+ // use the isobar values supplied
+ $this->nbrIsobars = count($aIsobars);
+ $this->isobarValues = $aIsobars;
+ }
+ else {
+ // Determine the isobar values automatically
+ $this->nbrIsobars = $aIsobars;
+ list($min,$max) = $this->getMinMaxVal();
+ $stepSize = ($max-$min) / $aIsobars ;
+ $isobar = $min+$stepSize/2;
+ for ($i = 0; $i < $aIsobars; $i++) {
+ $this->isobarValues[$i] = $isobar;
+ $isobar += $stepSize;
+ }
+ }
+
+ if( $aColors !== null && count($aColors) > 0 ) {
+
+ if( !is_array($aColors) ) {
+ JpGraphError::RaiseL(28001);
+ //'Third argument to Contour must be an array of colors.'
+ }
+
+ if( count($aColors) != count($this->isobarValues) ) {
+ JpGraphError::RaiseL(28002);
+ //'Number of colors must equal the number of isobar lines specified';
+ }
+
+ $this->isobarColors = $aColors;
+ }
+ }
+
+ /**
+ * Flip the plot around the Y-coordinate. This has the same affect as flipping the input
+ * data matrice
+ *
+ * @param $aFlg If true the the vertice in input data matrice position (0,0) corresponds to the top left
+ * corner of teh plot otherwise it will correspond to the bottom left corner (a horizontal flip)
+ */
+ function SetInvert($aFlg=true) {
+ $this->invert = $aFlg;
+ }
+
+ /**
+ * Find the min and max values in the data matrice
+ *
+ * @return array(min_value,max_value)
+ */
+ function getMinMaxVal() {
+ $min = $this->dataPoints[0][0];
+ $max = $this->dataPoints[0][0];
+ for ($i = 0; $i < $this->nbrRows; $i++) {
+ if( ($mi=min($this->dataPoints[$i])) < $min ) $min = $mi;
+ if( ($ma=max($this->dataPoints[$i])) > $max ) $max = $ma;
+ }
+ return array($min,$max);
+ }
+
+ /**
+ * Reset the two matrices that keeps track on where the isobars crosses the
+ * horizontal and vertical edges
+ */
+ function resetEdgeMatrices() {
+ for ($k = 0; $k < 2; $k++) {
+ for ($i = 0; $i <= $this->nbrRows; $i++) {
+ for ($j = 0; $j <= $this->nbrCols; $j++) {
+ $this->edges[$k][$i][$j] = false;
+ }
+ }
+ }
+ }
+
+ /**
+ * Determine if the specified isobar crosses the horizontal edge specified by its row and column
+ *
+ * @param $aRow Row index of edge to be checked
+ * @param $aCol Col index of edge to be checked
+ * @param $aIsobar Isobar value
+ * @return true if the isobar is crossing this edge
+ */
+ function isobarHCrossing($aRow,$aCol,$aIsobar) {
+
+ if( $aCol >= $this->nbrCols-1 ) {
+ JpGraphError::RaiseL(28003,$aCol);
+ //'ContourPlot Internal Error: isobarHCrossing: Coloumn index too large (%d)'
+ }
+ if( $aRow >= $this->nbrRows ) {
+ JpGraphError::RaiseL(28004,$aRow);
+ //'ContourPlot Internal Error: isobarHCrossing: Row index too large (%d)'
+ }
+
+ $v1 = $this->dataPoints[$aRow][$aCol];
+ $v2 = $this->dataPoints[$aRow][$aCol+1];
+
+ return ($aIsobar-$v1)*($aIsobar-$v2) < 0 ;
+
+ }
+
+ /**
+ * Determine if the specified isobar crosses the vertical edge specified by its row and column
+ *
+ * @param $aRow Row index of edge to be checked
+ * @param $aCol Col index of edge to be checked
+ * @param $aIsobar Isobar value
+ * @return true if the isobar is crossing this edge
+ */
+ function isobarVCrossing($aRow,$aCol,$aIsobar) {
+
+ if( $aRow >= $this->nbrRows-1) {
+ JpGraphError::RaiseL(28005,$aRow);
+ //'isobarVCrossing: Row index too large
+ }
+ if( $aCol >= $this->nbrCols ) {
+ JpGraphError::RaiseL(28006,$aCol);
+ //'isobarVCrossing: Col index too large
+ }
+
+ $v1 = $this->dataPoints[$aRow][$aCol];
+ $v2 = $this->dataPoints[$aRow+1][$aCol];
+
+ return ($aIsobar-$v1)*($aIsobar-$v2) < 0 ;
+
+ }
+
+ /**
+ * Determine all edges, horizontal and vertical that the specified isobar crosses. The crossings
+ * are recorded in the two edge matrices.
+ *
+ * @param $aIsobar The value of the isobar to be checked
+ */
+ function determineIsobarEdgeCrossings($aIsobar) {
+
+ $ib = $this->isobarValues[$aIsobar];
+
+ for ($i = 0; $i < $this->nbrRows-1; $i++) {
+ for ($j = 0; $j < $this->nbrCols-1; $j++) {
+ $this->edges[HORIZ_EDGE][$i][$j] = $this->isobarHCrossing($i,$j,$ib);
+ $this->edges[VERT_EDGE][$i][$j] = $this->isobarVCrossing($i,$j,$ib);
+ }
+ }
+
+ // We now have the bottom and rightmost edges unsearched
+ for ($i = 0; $i < $this->nbrRows-1; $i++) {
+ $this->edges[VERT_EDGE][$i][$j] = $this->isobarVCrossing($i,$this->nbrCols-1,$ib);
+ }
+ for ($j = 0; $j < $this->nbrCols-1; $j++) {
+ $this->edges[HORIZ_EDGE][$i][$j] = $this->isobarHCrossing($this->nbrRows-1,$j,$ib);
+ }
+
+ }
+
+ /**
+ * Return the normalized coordinates for the crossing of the specified edge with the specified
+ * isobar- The crossing is simpy detrmined with a linear interpolation between the two vertices
+ * on each side of the edge and the value of the isobar
+ *
+ * @param $aRow Row of edge
+ * @param $aCol Column of edge
+ * @param $aEdgeDir Determine if this is a horizontal or vertical edge
+ * @param $ib The isobar value
+ * @return unknown_type
+ */
+ function getCrossingCoord($aRow,$aCol,$aEdgeDir,$aIsobarVal) {
+
+ // In order to avoid numerical problem when two vertices are very close
+ // we have to check and avoid dividing by close to zero denumerator.
+ if( $aEdgeDir == HORIZ_EDGE ) {
+ $d = abs($this->dataPoints[$aRow][$aCol] - $this->dataPoints[$aRow][$aCol+1]);
+ if( $d > 0.001 ) {
+ $xcoord = $aCol + abs($aIsobarVal - $this->dataPoints[$aRow][$aCol]) / $d;
+ }
+ else {
+ $xcoord = $aCol;
+ }
+ $ycoord = $aRow;
+ }
+ else {
+ $d = abs($this->dataPoints[$aRow][$aCol] - $this->dataPoints[$aRow+1][$aCol]);
+ if( $d > 0.001 ) {
+ $ycoord = $aRow + abs($aIsobarVal - $this->dataPoints[$aRow][$aCol]) / $d;
+ }
+ else {
+ $ycoord = $aRow;
+ }
+ $xcoord = $aCol;
+ }
+ if( $this->invert ) {
+ $ycoord = $this->nbrRows-1 - $ycoord;
+ }
+ return array($xcoord,$ycoord);
+
+ }
+
+ /**
+ * In order to avoid all kinds of unpleasent extra checks and complex boundary
+ * controls for the degenerated case where the contour levels exactly crosses
+ * one of the vertices we add a very small delta (0.1%) to the data point value.
+ * This has no visible affect but it makes the code sooooo much cleaner.
+ *
+ */
+ function adjustDataPointValues() {
+
+ $ni = count($this->isobarValues);
+ for ($k = 0; $k < $ni; $k++) {
+ $ib = $this->isobarValues[$k];
+ for ($row = 0 ; $row < $this->nbrRows-1; ++$row) {
+ for ($col = 0 ; $col < $this->nbrCols-1; ++$col ) {
+ if( abs($this->dataPoints[$row][$col] - $ib) < 0.0001 ) {
+ $this->dataPoints[$row][$col] += $this->dataPoints[$row][$col]*0.001;
+ }
+ }
+ }
+ }
+
+ }
+
+ /**
+ * @param $aFlg
+ * @param $aBW
+ * @return unknown_type
+ */
+ function UseHighContrastColor($aFlg=true,$aBW=false) {
+ $this->highcontrast = $aFlg;
+ $this->highcontrastbw = $aBW;
+ }
+
+ /**
+ * Calculate suitable colors for each defined isobar
+ *
+ */
+ function CalculateColors() {
+ if ( $this->highcontrast ) {
+ if ( $this->highcontrastbw ) {
+ for ($ib = 0; $ib < $this->nbrIsobars; $ib++) {
+ $this->isobarColors[$ib] = 'black';
+ }
+ }
+ else {
+ // Use only blue/red scale
+ $step = round(255/($this->nbrIsobars-1));
+ for ($ib = 0; $ib < $this->nbrIsobars; $ib++) {
+ $this->isobarColors[$ib] = array($ib*$step, 50, 255-$ib*$step);
+ }
+ }
+ }
+ else {
+ $n = $this->nbrIsobars;
+ $v = 0; $step = 1 / ($this->nbrIsobars-1);
+ for ($ib = 0; $ib < $this->nbrIsobars; $ib++) {
+ $this->isobarColors[$ib] = RGB::GetSpectrum($v);
+ $v += $step;
+ }
+ }
+ }
+
+ /**
+ * This is where the main work is done. For each isobar the crossing of the edges are determined
+ * and then each cell is analyzed to find the 0, 2 or 4 crossings. Then the normalized coordinate
+ * for the crossings are determined and pushed on to the isobar stack. When the method is finished
+ * the $isobarCoord will hold one arrayfor each isobar where all the line segments that makes
+ * up the contour plot are stored.
+ *
+ * @return array( $isobarCoord, $isobarValues, $isobarColors )
+ */
+ function getIsobars() {
+
+ $this->adjustDataPointValues();
+
+ for ($isobar = 0; $isobar < $this->nbrIsobars; $isobar++) {
+
+ $ib = $this->isobarValues[$isobar];
+ $this->resetEdgeMatrices();
+ $this->determineIsobarEdgeCrossings($isobar);
+ $this->isobarCoord[$isobar] = array();
+
+ $ncoord = 0;
+
+ for ($row = 0 ; $row < $this->nbrRows-1; ++$row) {
+ for ($col = 0 ; $col < $this->nbrCols-1; ++$col ) {
+
+ // Find out how many crossings around the edges
+ $n = 0;
+ if ( $this->edges[HORIZ_EDGE][$row][$col] ) $neigh[$n++] = array($row, $col, HORIZ_EDGE);
+ if ( $this->edges[HORIZ_EDGE][$row+1][$col] ) $neigh[$n++] = array($row+1,$col, HORIZ_EDGE);
+ if ( $this->edges[VERT_EDGE][$row][$col] ) $neigh[$n++] = array($row, $col, VERT_EDGE);
+ if ( $this->edges[VERT_EDGE][$row][$col+1] ) $neigh[$n++] = array($row, $col+1,VERT_EDGE);
+
+ if ( $n == 2 ) {
+ $n1=0; $n2=1;
+ $this->isobarCoord[$isobar][$ncoord++] = array(
+ $this->getCrossingCoord($neigh[$n1][0],$neigh[$n1][1],$neigh[$n1][2],$ib),
+ $this->getCrossingCoord($neigh[$n2][0],$neigh[$n2][1],$neigh[$n2][2],$ib) );
+ }
+ elseif ( $n == 4 ) {
+ // We must determine how to connect the edges either northwest->southeast or
+ // northeast->southwest. We do that by calculating the imaginary middle value of
+ // the cell by averaging the for corners. This will compared with the value of the
+ // top left corner will help determine the orientation of the ridge/creek
+ $midval = ($this->dataPoints[$row][$col]+$this->dataPoints[$row][$col+1]+$this->dataPoints[$row+1][$col]+$this->dataPoints[$row+1][$col+1])/4;
+ $v = $this->dataPoints[$row][$col];
+ if( $midval == $ib ) {
+ // Orientation "+"
+ $n1=0; $n2=1; $n3=2; $n4=3;
+ } elseif ( ($midval > $ib && $v > $ib) || ($midval < $ib && $v < $ib) ) {
+ // Orientation of ridge/valley = "\"
+ $n1=0; $n2=3; $n3=2; $n4=1;
+ } elseif ( ($midval > $ib && $v < $ib) || ($midval < $ib && $v > $ib) ) {
+ // Orientation of ridge/valley = "/"
+ $n1=0; $n2=2; $n3=3; $n4=1;
+ }
+
+ $this->isobarCoord[$isobar][$ncoord++] = array(
+ $this->getCrossingCoord($neigh[$n1][0],$neigh[$n1][1],$neigh[$n1][2],$ib),
+ $this->getCrossingCoord($neigh[$n2][0],$neigh[$n2][1],$neigh[$n2][2],$ib) );
+
+ $this->isobarCoord[$isobar][$ncoord++] = array(
+ $this->getCrossingCoord($neigh[$n3][0],$neigh[$n3][1],$neigh[$n3][2],$ib),
+ $this->getCrossingCoord($neigh[$n4][0],$neigh[$n4][1],$neigh[$n4][2],$ib) );
+
+ }
+ }
+ }
+ }
+
+ if( count($this->isobarColors) == 0 ) {
+ // No manually specified colors. Calculate them automatically.
+ $this->CalculateColors();
+ }
+ return array( $this->isobarCoord, $this->isobarValues, $this->isobarColors );
+ }
+}
+
+
+/**
+ * This class represent a plotting of a contour outline of data given as a X-Y matrice
+ *
+ */
+class ContourPlot extends Plot {
+
+ private $contour, $contourCoord, $contourVal, $contourColor;
+ private $nbrCountours = 0 ;
+ private $dataMatrix = array();
+ private $invertLegend = false;
+ private $interpFactor = 1;
+ private $flipData = false;
+ private $isobar = 10;
+ private $showLegend = false;
+ private $highcontrast = false, $highcontrastbw = false;
+ private $manualIsobarColors = array();
+
+ /**
+ * Construct a contour plotting algorithm. The end result of the algorithm is a sequence of
+ * line segments for each isobar given as two vertices.
+ *
+ * @param $aDataMatrix The Z-data to be used
+ * @param $aIsobar A mixed variable, if it is an integer then this specified the number of isobars to use.
+ * The values of the isobars are automatically detrmined to be equ-spaced between the min/max value of the
+ * data. If it is an array then it explicetely gives the isobar values
+ * @param $aInvert By default the matrice with row index 0 corresponds to Y-value 0, i.e. in the bottom of
+ * the plot. If this argument is true then the row with the highest index in the matrice corresponds to
+ * Y-value 0. In affect flipping the matrice around an imaginary horizontal axis.
+ * @param $aHighContrast Use high contrast colors (blue/red:ish)
+ * @param $aHighContrastBW Use only black colors for contours
+ * @return an instance of the contour plot algorithm
+ */
+ function __construct($aDataMatrix, $aIsobar=10, $aFactor=1, $aInvert=false, $aIsobarColors=array()) {
+
+ $this->dataMatrix = $aDataMatrix;
+ $this->flipData = $aInvert;
+ $this->isobar = $aIsobar;
+ $this->interpFactor = $aFactor;
+
+ if ( $this->interpFactor > 1 ) {
+
+ if( $this->interpFactor > 5 ) {
+ JpGraphError::RaiseL(28007);// ContourPlot interpolation factor is too large (>5)
+ }
+
+ $ip = new MeshInterpolate();
+ $this->dataMatrix = $ip->Linear($this->dataMatrix, $this->interpFactor);
+ }
+
+ $this->contour = new Contour($this->dataMatrix,$this->isobar,$aIsobarColors);
+
+ if( is_array($aIsobar) )
+ $this->nbrContours = count($aIsobar);
+ else
+ $this->nbrContours = $aIsobar;
+ }
+
+
+ /**
+ * Flipe the data around the center
+ *
+ * @param $aFlg
+ *
+ */
+ function SetInvert($aFlg=true) {
+ $this->flipData = $aFlg;
+ }
+
+ /**
+ * Set the colors for the isobar lines
+ *
+ * @param $aColorArray
+ *
+ */
+ function SetIsobarColors($aColorArray) {
+ $this->manualIsobarColors = $aColorArray;
+ }
+
+ /**
+ * Show the legend
+ *
+ * @param $aFlg true if the legend should be shown
+ *
+ */
+ function ShowLegend($aFlg=true) {
+ $this->showLegend = $aFlg;
+ }
+
+
+ /**
+ * @param $aFlg true if the legend should start with the lowest isobar on top
+ * @return unknown_type
+ */
+ function Invertlegend($aFlg=true) {
+ $this->invertLegend = $aFlg;
+ }
+
+ /* Internal method. Give the min value to be used for the scaling
+ *
+ */
+ function Min() {
+ return array(0,0);
+ }
+
+ /* Internal method. Give the max value to be used for the scaling
+ *
+ */
+ function Max() {
+ return array(count($this->dataMatrix[0])-1,count($this->dataMatrix)-1);
+ }
+
+ /**
+ * Internal ramewrok method to setup the legend to be used for this plot.
+ * @param $aGraph The parent graph class
+ */
+ function Legend($aGraph) {
+
+ if( ! $this->showLegend )
+ return;
+
+ if( $this->invertLegend ) {
+ for ($i = 0; $i < $this->nbrContours; $i++) {
+ $aGraph->legend->Add(sprintf('%.1f',$this->contourVal[$i]), $this->contourColor[$i]);
+ }
+ }
+ else {
+ for ($i = $this->nbrContours-1; $i >= 0 ; $i--) {
+ $aGraph->legend->Add(sprintf('%.1f',$this->contourVal[$i]), $this->contourColor[$i]);
+ }
+ }
+ }
+
+
+ /**
+ * Framework function which gets called before the Stroke() method is called
+ *
+ * @see Plot#PreScaleSetup($aGraph)
+ *
+ */
+ function PreScaleSetup($aGraph) {
+ $xn = count($this->dataMatrix[0])-1;
+ $yn = count($this->dataMatrix)-1;
+
+ $aGraph->xaxis->scale->Update($aGraph->img,0,$xn);
+ $aGraph->yaxis->scale->Update($aGraph->img,0,$yn);
+
+ $this->contour->SetInvert($this->flipData);
+ list($this->contourCoord,$this->contourVal,$this->contourColor) = $this->contour->getIsobars();
+ }
+
+ /**
+ * Use high contrast color schema
+ *
+ * @param $aFlg True, to use high contrast color
+ * @param $aBW True, Use only black and white color schema
+ */
+ function UseHighContrastColor($aFlg=true,$aBW=false) {
+ $this->highcontrast = $aFlg;
+ $this->highcontrastbw = $aBW;
+ $this->contour->UseHighContrastColor($this->highcontrast,$this->highcontrastbw);
+ }
+
+ /**
+ * Internal method. Stroke the contour plot to the graph
+ *
+ * @param $img Image handler
+ * @param $xscale Instance of the xscale to use
+ * @param $yscale Instance of the yscale to use
+ */
+ function Stroke($img,$xscale,$yscale) {
+
+ if( count($this->manualIsobarColors) > 0 ) {
+ $this->contourColor = $this->manualIsobarColors;
+ if( count($this->manualIsobarColors) != $this->nbrContours ) {
+ JpGraphError::RaiseL(28002);
+ }
+ }
+
+ $img->SetLineWeight($this->line_weight);
+
+ for ($c = 0; $c < $this->nbrContours; $c++) {
+
+ $img->SetColor( $this->contourColor[$c] );
+
+ $n = count($this->contourCoord[$c]);
+ $i = 0;
+ while ( $i < $n ) {
+ list($x1,$y1) = $this->contourCoord[$c][$i][0];
+ $x1t = $xscale->Translate($x1);
+ $y1t = $yscale->Translate($y1);
+
+ list($x2,$y2) = $this->contourCoord[$c][$i++][1];
+ $x2t = $xscale->Translate($x2);
+ $y2t = $yscale->Translate($y2);
+
+ $img->Line($x1t,$y1t,$x2t,$y2t);
+ }
+
+ }
+ }
+
+}
+
+// EOF
+?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_date.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_date.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_date.php 2007-09-26 17:00:09.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_date.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,495 +1,497 @@
type=$aType;
- $this->scale=array($aMin,$aMax);
- $this->world_size=$aMax-$aMin;
- $this->ticks = new LinearTicks();
- $this->intscale=true;
+ private $date_format = '';
+ private $iStartAlign = false, $iEndAlign = false;
+ private $iStartTimeAlign = false, $iEndTimeAlign = false;
+
+ //---------------
+ // CONSTRUCTOR
+ function __construct($aMin=0,$aMax=0,$aType='x') {
+ assert($aType=="x");
+ assert($aMin<=$aMax);
+
+ $this->type=$aType;
+ $this->scale=array($aMin,$aMax);
+ $this->world_size=$aMax-$aMin;
+ $this->ticks = new LinearTicks();
+ $this->intscale=true;
}
-//------------------------------------------------------------------------------------------
-// Utility Function AdjDate()
-// Description: Will round a given time stamp to an even year, month or day
-// argument.
-//------------------------------------------------------------------------------------------
+ //------------------------------------------------------------------------------------------
+ // Utility Function AdjDate()
+ // Description: Will round a given time stamp to an even year, month or day
+ // argument.
+ //------------------------------------------------------------------------------------------
function AdjDate($aTime,$aRound=0,$aYearType=false,$aMonthType=false,$aDayType=false) {
- $y = (int)date('Y',$aTime); $m = (int)date('m',$aTime); $d = (int)date('d',$aTime);
- $h=0;$i=0;$s=0;
- if( $aYearType !== false ) {
- $yearAdj = array(0=>1, 1=>2, 2=>5);
- if( $aRound == 0 ) {
- $y = floor($y/$yearAdj[$aYearType])*$yearAdj[$aYearType];
- }
- else {
- ++$y;
- $y = ceil($y/$yearAdj[$aYearType])*$yearAdj[$aYearType];
- }
- $m=1;$d=1;
- }
- elseif( $aMonthType !== false ) {
- $monthAdj = array(0=>1, 1=>6);
- if( $aRound == 0 ) {
- $m = floor($m/$monthAdj[$aMonthType])*$monthAdj[$aMonthType];
- $d=1;
- }
- else {
- ++$m;
- $m = ceil($m/$monthAdj[$aMonthType])*$monthAdj[$aMonthType];
- $d=1;
- }
- }
- elseif( $aDayType !== false ) {
- if( $aDayType == 0 ) {
- if( $aRound == 1 ) {
- //++$d;
- $h=23;$i=59;$s=59;
- }
- }
- else {
- // Adjust to an even week boundary.
- $w = (int)date('w',$aTime); // Day of week 0=Sun, 6=Sat
- if( true ) { // Adjust to start on Mon
- if( $w==0 ) $w=6;
- else --$w;
- }
- if( $aRound == 0 ) {
- $d -= $w;
- }
- else {
- $d += (7-$w);
- $h=23;$i=59;$s=59;
- }
- }
- }
- return mktime($h,$i,$s,$m,$d,$y);
-
- }
-
-//------------------------------------------------------------------------------------------
-// Wrapper for AdjDate that will round a timestamp to an even date rounding
-// it downwards.
-//------------------------------------------------------------------------------------------
+ $y = (int)date('Y',$aTime); $m = (int)date('m',$aTime); $d = (int)date('d',$aTime);
+ $h=0;$i=0;$s=0;
+ if( $aYearType !== false ) {
+ $yearAdj = array(0=>1, 1=>2, 2=>5);
+ if( $aRound == 0 ) {
+ $y = floor($y/$yearAdj[$aYearType])*$yearAdj[$aYearType];
+ }
+ else {
+ ++$y;
+ $y = ceil($y/$yearAdj[$aYearType])*$yearAdj[$aYearType];
+ }
+ $m=1;$d=1;
+ }
+ elseif( $aMonthType !== false ) {
+ $monthAdj = array(0=>1, 1=>6);
+ if( $aRound == 0 ) {
+ $m = floor($m/$monthAdj[$aMonthType])*$monthAdj[$aMonthType];
+ $d=1;
+ }
+ else {
+ ++$m;
+ $m = ceil($m/$monthAdj[$aMonthType])*$monthAdj[$aMonthType];
+ $d=1;
+ }
+ }
+ elseif( $aDayType !== false ) {
+ if( $aDayType == 0 ) {
+ if( $aRound == 1 ) {
+ //++$d;
+ $h=23;$i=59;$s=59;
+ }
+ }
+ else {
+ // Adjust to an even week boundary.
+ $w = (int)date('w',$aTime); // Day of week 0=Sun, 6=Sat
+ if( true ) { // Adjust to start on Mon
+ if( $w==0 ) $w=6;
+ else --$w;
+ }
+ if( $aRound == 0 ) {
+ $d -= $w;
+ }
+ else {
+ $d += (7-$w);
+ $h=23;$i=59;$s=59;
+ }
+ }
+ }
+ return mktime($h,$i,$s,$m,$d,$y);
+
+ }
+
+ //------------------------------------------------------------------------------------------
+ // Wrapper for AdjDate that will round a timestamp to an even date rounding
+ // it downwards.
+ //------------------------------------------------------------------------------------------
function AdjStartDate($aTime,$aYearType=false,$aMonthType=false,$aDayType=false) {
- return $this->AdjDate($aTime,0,$aYearType,$aMonthType,$aDayType);
+ return $this->AdjDate($aTime,0,$aYearType,$aMonthType,$aDayType);
}
-//------------------------------------------------------------------------------------------
-// Wrapper for AdjDate that will round a timestamp to an even date rounding
-// it upwards
-//------------------------------------------------------------------------------------------
+ //------------------------------------------------------------------------------------------
+ // Wrapper for AdjDate that will round a timestamp to an even date rounding
+ // it upwards
+ //------------------------------------------------------------------------------------------
function AdjEndDate($aTime,$aYearType=false,$aMonthType=false,$aDayType=false) {
- return $this->AdjDate($aTime,1,$aYearType,$aMonthType,$aDayType);
+ return $this->AdjDate($aTime,1,$aYearType,$aMonthType,$aDayType);
}
-//------------------------------------------------------------------------------------------
-// Utility Function AdjTime()
-// Description: Will round a given time stamp to an even time according to
-// argument.
-//------------------------------------------------------------------------------------------
+ //------------------------------------------------------------------------------------------
+ // Utility Function AdjTime()
+ // Description: Will round a given time stamp to an even time according to
+ // argument.
+ //------------------------------------------------------------------------------------------
function AdjTime($aTime,$aRound=0,$aHourType=false,$aMinType=false,$aSecType=false) {
- $y = (int)date('Y',$aTime); $m = (int)date('m',$aTime); $d = (int)date('d',$aTime);
- $h = (int)date('H',$aTime); $i = (int)date('i',$aTime); $s = (int)date('s',$aTime);
- if( $aHourType !== false ) {
- $aHourType %= 6;
- $hourAdj = array(0=>1, 1=>2, 2=>3, 3=>4, 4=>6, 5=>12);
- if( $aRound == 0 )
- $h = floor($h/$hourAdj[$aHourType])*$hourAdj[$aHourType];
- else {
- if( ($h % $hourAdj[$aHourType]==0) && ($i > 0 || $s > 0) ) {
- $h++;
- }
- $h = ceil($h/$hourAdj[$aHourType])*$hourAdj[$aHourType];
- if( $h >= 24 ) {
- $aTime += 86400;
- $y = (int)date('Y',$aTime); $m = (int)date('m',$aTime); $d = (int)date('d',$aTime);
- $h -= 24;
- }
- }
- $i=0;$s=0;
- }
- elseif( $aMinType !== false ) {
- $aMinType %= 5;
- $minAdj = array(0=>1, 1=>5, 2=>10, 3=>15, 4=>30);
- if( $aRound == 0 ) {
- $i = floor($i/$minAdj[$aMinType])*$minAdj[$aMinType];
- }
- else {
- if( ($i % $minAdj[$aMinType]==0) && $s > 0 ) {
- $i++;
- }
- $i = ceil($i/$minAdj[$aMinType])*$minAdj[$aMinType];
- if( $i >= 60) {
- $aTime += 3600;
- $y = (int)date('Y',$aTime); $m = (int)date('m',$aTime); $d = (int)date('d',$aTime);
- $h = (int)date('H',$aTime); $i = 0;
- }
- }
- $s=0;
- }
- elseif( $aSecType !== false ) {
- $aSecType %= 5;
- $secAdj = array(0=>1, 1=>5, 2=>10, 3=>15, 4=>30);
- if( $aRound == 0 ) {
- $s = floor($s/$secAdj[$aSecType])*$secAdj[$aSecType];
- }
- else {
- $s = ceil($s/$secAdj[$aSecType]*1.0)*$secAdj[$aSecType];
- if( $s >= 60) {
- $s=0;
- $aTime += 60;
- $y = (int)date('Y',$aTime); $m = (int)date('m',$aTime); $d = (int)date('d',$aTime);
- $h = (int)date('H',$aTime); $i = (int)date('i',$aTime);
- }
- }
- }
- return mktime($h,$i,$s,$m,$d,$y);
- }
-
-//------------------------------------------------------------------------------------------
-// Wrapper for AdjTime that will round a timestamp to an even time rounding
-// it downwards.
-// Example: AdjStartTime(mktime(18,27,13,2,22,2005),false,2) => 18:20
-//------------------------------------------------------------------------------------------
+ $y = (int)date('Y',$aTime); $m = (int)date('m',$aTime); $d = (int)date('d',$aTime);
+ $h = (int)date('H',$aTime); $i = (int)date('i',$aTime); $s = (int)date('s',$aTime);
+ if( $aHourType !== false ) {
+ $aHourType %= 6;
+ $hourAdj = array(0=>1, 1=>2, 2=>3, 3=>4, 4=>6, 5=>12);
+ if( $aRound == 0 )
+ $h = floor($h/$hourAdj[$aHourType])*$hourAdj[$aHourType];
+ else {
+ if( ($h % $hourAdj[$aHourType]==0) && ($i > 0 || $s > 0) ) {
+ $h++;
+ }
+ $h = ceil($h/$hourAdj[$aHourType])*$hourAdj[$aHourType];
+ if( $h >= 24 ) {
+ $aTime += 86400;
+ $y = (int)date('Y',$aTime); $m = (int)date('m',$aTime); $d = (int)date('d',$aTime);
+ $h -= 24;
+ }
+ }
+ $i=0;$s=0;
+ }
+ elseif( $aMinType !== false ) {
+ $aMinType %= 5;
+ $minAdj = array(0=>1, 1=>5, 2=>10, 3=>15, 4=>30);
+ if( $aRound == 0 ) {
+ $i = floor($i/$minAdj[$aMinType])*$minAdj[$aMinType];
+ }
+ else {
+ if( ($i % $minAdj[$aMinType]==0) && $s > 0 ) {
+ $i++;
+ }
+ $i = ceil($i/$minAdj[$aMinType])*$minAdj[$aMinType];
+ if( $i >= 60) {
+ $aTime += 3600;
+ $y = (int)date('Y',$aTime); $m = (int)date('m',$aTime); $d = (int)date('d',$aTime);
+ $h = (int)date('H',$aTime); $i = 0;
+ }
+ }
+ $s=0;
+ }
+ elseif( $aSecType !== false ) {
+ $aSecType %= 5;
+ $secAdj = array(0=>1, 1=>5, 2=>10, 3=>15, 4=>30);
+ if( $aRound == 0 ) {
+ $s = floor($s/$secAdj[$aSecType])*$secAdj[$aSecType];
+ }
+ else {
+ $s = ceil($s/$secAdj[$aSecType]*1.0)*$secAdj[$aSecType];
+ if( $s >= 60) {
+ $s=0;
+ $aTime += 60;
+ $y = (int)date('Y',$aTime); $m = (int)date('m',$aTime); $d = (int)date('d',$aTime);
+ $h = (int)date('H',$aTime); $i = (int)date('i',$aTime);
+ }
+ }
+ }
+ return mktime($h,$i,$s,$m,$d,$y);
+ }
+
+ //------------------------------------------------------------------------------------------
+ // Wrapper for AdjTime that will round a timestamp to an even time rounding
+ // it downwards.
+ // Example: AdjStartTime(mktime(18,27,13,2,22,2005),false,2) => 18:20
+ //------------------------------------------------------------------------------------------
function AdjStartTime($aTime,$aHourType=false,$aMinType=false,$aSecType=false) {
- return $this->AdjTime($aTime,0,$aHourType,$aMinType,$aSecType);
+ return $this->AdjTime($aTime,0,$aHourType,$aMinType,$aSecType);
}
-//------------------------------------------------------------------------------------------
-// Wrapper for AdjTime that will round a timestamp to an even time rounding
-// it upwards
-// Example: AdjEndTime(mktime(18,27,13,2,22,2005),false,2) => 18:30
-//------------------------------------------------------------------------------------------
+ //------------------------------------------------------------------------------------------
+ // Wrapper for AdjTime that will round a timestamp to an even time rounding
+ // it upwards
+ // Example: AdjEndTime(mktime(18,27,13,2,22,2005),false,2) => 18:30
+ //------------------------------------------------------------------------------------------
function AdjEndTime($aTime,$aHourType=false,$aMinType=false,$aSecType=false) {
- return $this->AdjTime($aTime,1,$aHourType,$aMinType,$aSecType);
+ return $this->AdjTime($aTime,1,$aHourType,$aMinType,$aSecType);
}
-//------------------------------------------------------------------------------------------
-// DateAutoScale
-// Autoscale a date axis given start and end time
-// Returns an array ($start,$end,$major,$minor,$format)
-//------------------------------------------------------------------------------------------
+ //------------------------------------------------------------------------------------------
+ // DateAutoScale
+ // Autoscale a date axis given start and end time
+ // Returns an array ($start,$end,$major,$minor,$format)
+ //------------------------------------------------------------------------------------------
function DoDateAutoScale($aStartTime,$aEndTime,$aDensity=0,$aAdjust=true) {
- // Format of array
- // array ( Decision point, array( array( Major-scale-step-array ),
- // array( Minor-scale-step-array ),
- // array( 0=date-adjust, 1=time-adjust, adjustment-alignment) )
- //
- $scalePoints =
- array(
- /* Intervall larger than 10 years */
- SECPERYEAR*10,array(array(SECPERYEAR*5,SECPERYEAR*2),
- array(SECPERYEAR),
- array(0,YEARADJ_1, 0,YEARADJ_1) ),
-
- /* Intervall larger than 2 years */
- SECPERYEAR*2,array(array(SECPERYEAR),array(SECPERYEAR),
- array(0,YEARADJ_1) ),
-
- /* Intervall larger than 90 days (approx 3 month) */
- SECPERDAY*90,array(array(SECPERDAY*30,SECPERDAY*14,SECPERDAY*7,SECPERDAY),
- array(SECPERDAY*5,SECPERDAY*7,SECPERDAY,SECPERDAY),
- array(0,MONTHADJ_1, 0,DAYADJ_WEEK, 0,DAYADJ_1, 0,DAYADJ_1)),
-
- /* Intervall larger than 30 days (approx 1 month) */
- SECPERDAY*30,array(array(SECPERDAY*14,SECPERDAY*7,SECPERDAY*2, SECPERDAY),
- array(SECPERDAY,SECPERDAY,SECPERDAY,SECPERDAY),
- array(0,DAYADJ_WEEK, 0,DAYADJ_1, 0,DAYADJ_1, 0,DAYADJ_1)),
-
- /* Intervall larger than 7 days */
- SECPERDAY*7,array(array(SECPERDAY,SECPERHOUR*12,SECPERHOUR*6,SECPERHOUR*2),
- array(SECPERHOUR*6,SECPERHOUR*3,SECPERHOUR,SECPERHOUR),
- array(0,DAYADJ_1, 1,HOURADJ_12, 1,HOURADJ_6, 1,HOURADJ_1)),
-
- /* Intervall larger than 1 day */
- SECPERDAY,array(array(SECPERDAY,SECPERHOUR*12,SECPERHOUR*6,SECPERHOUR*2,SECPERHOUR),
- array(SECPERHOUR*6,SECPERHOUR*2,SECPERHOUR,SECPERHOUR,SECPERHOUR),
- array(1,HOURADJ_12, 1,HOURADJ_6, 1,HOURADJ_1, 1,HOURADJ_1)),
-
- /* Intervall larger than 12 hours */
- SECPERHOUR*12,array(array(SECPERHOUR*2,SECPERHOUR,SECPERMIN*30,900,600),
- array(1800,1800,900,300,300),
- array(1,HOURADJ_1, 1,MINADJ_30, 1,MINADJ_15, 1,MINADJ_10, 1,MINADJ_5) ),
-
- /* Intervall larger than 2 hours */
- SECPERHOUR*2,array(array(SECPERHOUR,SECPERMIN*30,900,600,300),
- array(1800,900,300,120,60),
- array(1,HOURADJ_1, 1,MINADJ_30, 1,MINADJ_15, 1,MINADJ_10, 1,MINADJ_5) ),
-
- /* Intervall larger than 1 hours */
- SECPERHOUR,array(array(SECPERMIN*30,900,600,300),array(900,300,120,60),
- array(1,MINADJ_30, 1,MINADJ_15, 1,MINADJ_10, 1,MINADJ_5) ),
-
- /* Intervall larger than 30 min */
- SECPERMIN*30,array(array(SECPERMIN*15,SECPERMIN*10,SECPERMIN*5,SECPERMIN),
- array(300,300,60,10),
- array(1,MINADJ_15, 1,MINADJ_10, 1,MINADJ_5, 1,MINADJ_1)),
-
- /* Intervall larger than 1 min */
- SECPERMIN,array(array(SECPERMIN,15,10,5),
- array(15,5,2,1),
- array(1,MINADJ_1, 1,SECADJ_15, 1,SECADJ_10, 1,SECADJ_5)),
-
- /* Intervall larger than 10 sec */
- 10,array(array(5,2),
- array(1,1),
- array(1,SECADJ_5, 1,SECADJ_1)),
-
- /* Intervall larger than 1 sec */
- 1,array(array(1),
- array(1),
- array(1,SECADJ_1)),
- );
-
- $ns = count($scalePoints);
- // Establish major and minor scale units for the date scale
- $diff = $aEndTime - $aStartTime;
- if( $diff < 1 ) return false;
- $done=false;
- $i=0;
- while( ! $done ) {
- if( $diff > $scalePoints[2*$i] ) {
- // Get major and minor scale for this intervall
- $scaleSteps = $scalePoints[2*$i+1];
- $major = $scaleSteps[0][min($aDensity,count($scaleSteps[0])-1)];
- // Try to find out which minor step looks best
- $minor = $scaleSteps[1][min($aDensity,count($scaleSteps[1])-1)];
- if( $aAdjust ) {
- // Find out how we should align the start and end timestamps
- $idx = 2*min($aDensity,floor(count($scaleSteps[2])/2)-1);
- if( $scaleSteps[2][$idx] === 0 ) {
- // Use date adjustment
- $adj = $scaleSteps[2][$idx+1];
- if( $adj >= 30 ) {
- $start = $this->AdjStartDate($aStartTime,$adj-30);
- $end = $this->AdjEndDate($aEndTime,$adj-30);
- }
- elseif( $adj >= 20 ) {
- $start = $this->AdjStartDate($aStartTime,false,$adj-20);
- $end = $this->AdjEndDate($aEndTime,false,$adj-20);
- }
- else {
- $start = $this->AdjStartDate($aStartTime,false,false,$adj);
- $end = $this->AdjEndDate($aEndTime,false,false,$adj);
- // We add 1 second for date adjustment to make sure we end on 00:00 the following day
- // This makes the final major tick be srawn when we step day-by-day instead of ending
- // on xx:59:59 which would not draw the final major tick
- $end++;
- }
- }
- else {
- // Use time adjustment
- $adj = $scaleSteps[2][$idx+1];
- if( $adj >= 30 ) {
- $start = $this->AdjStartTime($aStartTime,$adj-30);
- $end = $this->AdjEndTime($aEndTime,$adj-30);
- }
- elseif( $adj >= 20 ) {
- $start = $this->AdjStartTime($aStartTime,false,$adj-20);
- $end = $this->AdjEndTime($aEndTime,false,$adj-20);
- }
- else {
- $start = $this->AdjStartTime($aStartTime,false,false,$adj);
- $end = $this->AdjEndTime($aEndTime,false,false,$adj);
- }
- }
- }
- // If the overall date span is larger than 1 day ten we show date
- $format = '';
- if( ($end-$start) > SECPERDAY ) {
- $format = 'Y-m-d ';
- }
- // If the major step is less than 1 day we need to whow hours + min
- if( $major < SECPERDAY ) {
- $format .= 'H:i';
- }
- // If the major step is less than 1 min we need to show sec
- if( $major < 60 ) {
- $format .= ':s';
- }
- $done=true;
- }
- ++$i;
- }
- return array($start,$end,$major,$minor,$format);
+ // Format of array
+ // array ( Decision point, array( array( Major-scale-step-array ),
+ // array( Minor-scale-step-array ),
+ // array( 0=date-adjust, 1=time-adjust, adjustment-alignment) )
+ //
+ $scalePoints =
+ array(
+ /* Intervall larger than 10 years */
+ SECPERYEAR*10,array(array(SECPERYEAR*5,SECPERYEAR*2),
+ array(SECPERYEAR),
+ array(0,YEARADJ_1, 0,YEARADJ_1) ),
+
+ /* Intervall larger than 2 years */
+ SECPERYEAR*2,array(array(SECPERYEAR),array(SECPERYEAR),
+ array(0,YEARADJ_1) ),
+
+ /* Intervall larger than 90 days (approx 3 month) */
+ SECPERDAY*90,array(array(SECPERDAY*30,SECPERDAY*14,SECPERDAY*7,SECPERDAY),
+ array(SECPERDAY*5,SECPERDAY*7,SECPERDAY,SECPERDAY),
+ array(0,MONTHADJ_1, 0,DAYADJ_WEEK, 0,DAYADJ_1, 0,DAYADJ_1)),
+
+ /* Intervall larger than 30 days (approx 1 month) */
+ SECPERDAY*30,array(array(SECPERDAY*14,SECPERDAY*7,SECPERDAY*2, SECPERDAY),
+ array(SECPERDAY,SECPERDAY,SECPERDAY,SECPERDAY),
+ array(0,DAYADJ_WEEK, 0,DAYADJ_1, 0,DAYADJ_1, 0,DAYADJ_1)),
+
+ /* Intervall larger than 7 days */
+ SECPERDAY*7,array(array(SECPERDAY,SECPERHOUR*12,SECPERHOUR*6,SECPERHOUR*2),
+ array(SECPERHOUR*6,SECPERHOUR*3,SECPERHOUR,SECPERHOUR),
+ array(0,DAYADJ_1, 1,HOURADJ_12, 1,HOURADJ_6, 1,HOURADJ_1)),
+
+ /* Intervall larger than 1 day */
+ SECPERDAY,array(array(SECPERDAY,SECPERHOUR*12,SECPERHOUR*6,SECPERHOUR*2,SECPERHOUR),
+ array(SECPERHOUR*6,SECPERHOUR*2,SECPERHOUR,SECPERHOUR,SECPERHOUR),
+ array(1,HOURADJ_12, 1,HOURADJ_6, 1,HOURADJ_1, 1,HOURADJ_1)),
+
+ /* Intervall larger than 12 hours */
+ SECPERHOUR*12,array(array(SECPERHOUR*2,SECPERHOUR,SECPERMIN*30,900,600),
+ array(1800,1800,900,300,300),
+ array(1,HOURADJ_1, 1,MINADJ_30, 1,MINADJ_15, 1,MINADJ_10, 1,MINADJ_5) ),
+
+ /* Intervall larger than 2 hours */
+ SECPERHOUR*2,array(array(SECPERHOUR,SECPERMIN*30,900,600,300),
+ array(1800,900,300,120,60),
+ array(1,HOURADJ_1, 1,MINADJ_30, 1,MINADJ_15, 1,MINADJ_10, 1,MINADJ_5) ),
+
+ /* Intervall larger than 1 hours */
+ SECPERHOUR,array(array(SECPERMIN*30,900,600,300),array(900,300,120,60),
+ array(1,MINADJ_30, 1,MINADJ_15, 1,MINADJ_10, 1,MINADJ_5) ),
+
+ /* Intervall larger than 30 min */
+ SECPERMIN*30,array(array(SECPERMIN*15,SECPERMIN*10,SECPERMIN*5,SECPERMIN),
+ array(300,300,60,10),
+ array(1,MINADJ_15, 1,MINADJ_10, 1,MINADJ_5, 1,MINADJ_1)),
+
+ /* Intervall larger than 1 min */
+ SECPERMIN,array(array(SECPERMIN,15,10,5),
+ array(15,5,2,1),
+ array(1,MINADJ_1, 1,SECADJ_15, 1,SECADJ_10, 1,SECADJ_5)),
+
+ /* Intervall larger than 10 sec */
+ 10,array(array(5,2),
+ array(1,1),
+ array(1,SECADJ_5, 1,SECADJ_1)),
+
+ /* Intervall larger than 1 sec */
+ 1,array(array(1),
+ array(1),
+ array(1,SECADJ_1)),
+ );
+
+ $ns = count($scalePoints);
+ // Establish major and minor scale units for the date scale
+ $diff = $aEndTime - $aStartTime;
+ if( $diff < 1 ) return false;
+ $done=false;
+ $i=0;
+ while( ! $done ) {
+ if( $diff > $scalePoints[2*$i] ) {
+ // Get major and minor scale for this intervall
+ $scaleSteps = $scalePoints[2*$i+1];
+ $major = $scaleSteps[0][min($aDensity,count($scaleSteps[0])-1)];
+ // Try to find out which minor step looks best
+ $minor = $scaleSteps[1][min($aDensity,count($scaleSteps[1])-1)];
+ if( $aAdjust ) {
+ // Find out how we should align the start and end timestamps
+ $idx = 2*min($aDensity,floor(count($scaleSteps[2])/2)-1);
+ if( $scaleSteps[2][$idx] === 0 ) {
+ // Use date adjustment
+ $adj = $scaleSteps[2][$idx+1];
+ if( $adj >= 30 ) {
+ $start = $this->AdjStartDate($aStartTime,$adj-30);
+ $end = $this->AdjEndDate($aEndTime,$adj-30);
+ }
+ elseif( $adj >= 20 ) {
+ $start = $this->AdjStartDate($aStartTime,false,$adj-20);
+ $end = $this->AdjEndDate($aEndTime,false,$adj-20);
+ }
+ else {
+ $start = $this->AdjStartDate($aStartTime,false,false,$adj);
+ $end = $this->AdjEndDate($aEndTime,false,false,$adj);
+ // We add 1 second for date adjustment to make sure we end on 00:00 the following day
+ // This makes the final major tick be srawn when we step day-by-day instead of ending
+ // on xx:59:59 which would not draw the final major tick
+ $end++;
+ }
+ }
+ else {
+ // Use time adjustment
+ $adj = $scaleSteps[2][$idx+1];
+ if( $adj >= 30 ) {
+ $start = $this->AdjStartTime($aStartTime,$adj-30);
+ $end = $this->AdjEndTime($aEndTime,$adj-30);
+ }
+ elseif( $adj >= 20 ) {
+ $start = $this->AdjStartTime($aStartTime,false,$adj-20);
+ $end = $this->AdjEndTime($aEndTime,false,$adj-20);
+ }
+ else {
+ $start = $this->AdjStartTime($aStartTime,false,false,$adj);
+ $end = $this->AdjEndTime($aEndTime,false,false,$adj);
+ }
+ }
+ }
+ // If the overall date span is larger than 1 day ten we show date
+ $format = '';
+ if( ($end-$start) > SECPERDAY ) {
+ $format = 'Y-m-d ';
+ }
+ // If the major step is less than 1 day we need to whow hours + min
+ if( $major < SECPERDAY ) {
+ $format .= 'H:i';
+ }
+ // If the major step is less than 1 min we need to show sec
+ if( $major < 60 ) {
+ $format .= ':s';
+ }
+ $done=true;
+ }
+ ++$i;
+ }
+ return array($start,$end,$major,$minor,$format);
}
// Overrides the automatic determined date format. Must be a valid date() format string
function SetDateFormat($aFormat) {
- $this->date_format = $aFormat;
- $this->ticks->SetLabelDateFormat($this->date_format);
+ $this->date_format = $aFormat;
+ $this->ticks->SetLabelDateFormat($this->date_format);
}
function AdjustForDST($aFlg=true) {
- $this->ticks->AdjustForDST($aFlg);
+ $this->ticks->AdjustForDST($aFlg);
}
function SetDateAlign($aStartAlign,$aEndAlign=false) {
- if( $aEndAlign === false ) {
- $aEndAlign=$aStartAlign;
- }
- $this->iStartAlign = $aStartAlign;
- $this->iEndAlign = $aEndAlign;
+ if( $aEndAlign === false ) {
+ $aEndAlign=$aStartAlign;
+ }
+ $this->iStartAlign = $aStartAlign;
+ $this->iEndAlign = $aEndAlign;
}
function SetTimeAlign($aStartAlign,$aEndAlign=false) {
- if( $aEndAlign === false ) {
- $aEndAlign=$aStartAlign;
- }
- $this->iStartTimeAlign = $aStartAlign;
- $this->iEndTimeAlign = $aEndAlign;
- }
-
-
- function AutoScale(&$img,$aStartTime,$aEndTime,$aNumSteps) {
- if( $aStartTime == $aEndTime ) {
- // Special case when we only have one data point.
- // Create a small artifical intervall to do the autoscaling
- $aStartTime -= 10;
- $aEndTime += 10;
- }
- $done=false;
- $i=0;
- while( ! $done && $i < 5) {
- list($adjstart,$adjend,$maj,$min,$format) = $this->DoDateAutoScale($aStartTime,$aEndTime,$i);
- $n = floor(($adjend-$adjstart)/$maj);
- if( $n * 1.7 > $aNumSteps ) {
- $done=true;
- }
- $i++;
- }
-
- /*
- if( 0 ) { // DEBUG
- echo " Start =".date("Y-m-d H:i:s",$aStartTime)."
";
- echo " End =".date("Y-m-d H:i:s",$aEndTime)."
";
- echo "Adj Start =".date("Y-m-d H:i:s",$adjstart)."
";
- echo "Adj End =".date("Y-m-d H:i:s",$adjend)."
";
- echo "Major = $maj s, ".floor($maj/60)."min, ".floor($maj/3600)."h, ".floor($maj/86400)."day
";
- echo "Min = $min s, ".floor($min/60)."min, ".floor($min/3600)."h, ".floor($min/86400)."day
";
- echo "Format=$format
";
- }
- */
-
- if( $this->iStartTimeAlign !== false && $this->iStartAlign !== false ) {
- JpGraphError::RaiseL(3001);
-//('It is only possible to use either SetDateAlign() or SetTimeAlign() but not both');
- }
-
- if( $this->iStartTimeAlign !== false ) {
- if( $this->iStartTimeAlign >= 30 ) {
- $adjstart = $this->AdjStartTime($aStartTime,$this->iStartTimeAlign-30);
- }
- elseif( $this->iStartTimeAlign >= 20 ) {
- $adjstart = $this->AdjStartTime($aStartTime,false,$this->iStartTimeAlign-20);
- }
- else {
- $adjstart = $this->AdjStartTime($aStartTime,false,false,$this->iStartTimeAlign);
- }
- }
- if( $this->iEndTimeAlign !== false ) {
- if( $this->iEndTimeAlign >= 30 ) {
- $adjend = $this->AdjEndTime($aEndTime,$this->iEndTimeAlign-30);
- }
- elseif( $this->iEndTimeAlign >= 20 ) {
- $adjend = $this->AdjEndTime($aEndTime,false,$this->iEndTimeAlign-20);
- }
- else {
- $adjend = $this->AdjEndTime($aEndTime,false,false,$this->iEndTimeAlign);
- }
- }
-
-
-
- if( $this->iStartAlign !== false ) {
- if( $this->iStartAlign >= 30 ) {
- $adjstart = $this->AdjStartDate($aStartTime,$this->iStartAlign-30);
- }
- elseif( $this->iStartAlign >= 20 ) {
- $adjstart = $this->AdjStartDate($aStartTime,false,$this->iStartAlign-20);
- }
- else {
- $adjstart = $this->AdjStartDate($aStartTime,false,false,$this->iStartAlign);
- }
- }
- if( $this->iEndAlign !== false ) {
- if( $this->iEndAlign >= 30 ) {
- $adjend = $this->AdjEndDate($aEndTime,$this->iEndAlign-30);
- }
- elseif( $this->iEndAlign >= 20 ) {
- $adjend = $this->AdjEndDate($aEndTime,false,$this->iEndAlign-20);
- }
- else {
- $adjend = $this->AdjEndDate($aEndTime,false,false,$this->iEndAlign);
- }
- }
- $this->Update($img,$adjstart,$adjend);
- if( ! $this->ticks->IsSpecified() )
- $this->ticks->Set($maj,$min);
- if( $this->date_format == '' )
- $this->ticks->SetLabelDateFormat($format);
- else
- $this->ticks->SetLabelDateFormat($this->date_format);
+ if( $aEndAlign === false ) {
+ $aEndAlign=$aStartAlign;
+ }
+ $this->iStartTimeAlign = $aStartAlign;
+ $this->iEndTimeAlign = $aEndAlign;
+ }
+
+
+ function AutoScale($img,$aStartTime,$aEndTime,$aNumSteps,$_adummy=false) {
+ // We need to have one dummy argument to make the signature of AutoScale()
+ // identical to LinearScale::AutoScale
+ if( $aStartTime == $aEndTime ) {
+ // Special case when we only have one data point.
+ // Create a small artifical intervall to do the autoscaling
+ $aStartTime -= 10;
+ $aEndTime += 10;
+ }
+ $done=false;
+ $i=0;
+ while( ! $done && $i < 5) {
+ list($adjstart,$adjend,$maj,$min,$format) = $this->DoDateAutoScale($aStartTime,$aEndTime,$i);
+ $n = floor(($adjend-$adjstart)/$maj);
+ if( $n * 1.7 > $aNumSteps ) {
+ $done=true;
+ }
+ $i++;
+ }
+
+ /*
+ if( 0 ) { // DEBUG
+ echo " Start =".date("Y-m-d H:i:s",$aStartTime)."
";
+ echo " End =".date("Y-m-d H:i:s",$aEndTime)."
";
+ echo "Adj Start =".date("Y-m-d H:i:s",$adjstart)."
";
+ echo "Adj End =".date("Y-m-d H:i:s",$adjend)."
";
+ echo "Major = $maj s, ".floor($maj/60)."min, ".floor($maj/3600)."h, ".floor($maj/86400)."day
";
+ echo "Min = $min s, ".floor($min/60)."min, ".floor($min/3600)."h, ".floor($min/86400)."day
";
+ echo "Format=$format
";
+ }
+ */
+
+ if( $this->iStartTimeAlign !== false && $this->iStartAlign !== false ) {
+ JpGraphError::RaiseL(3001);
+ //('It is only possible to use either SetDateAlign() or SetTimeAlign() but not both');
+ }
+
+ if( $this->iStartTimeAlign !== false ) {
+ if( $this->iStartTimeAlign >= 30 ) {
+ $adjstart = $this->AdjStartTime($aStartTime,$this->iStartTimeAlign-30);
+ }
+ elseif( $this->iStartTimeAlign >= 20 ) {
+ $adjstart = $this->AdjStartTime($aStartTime,false,$this->iStartTimeAlign-20);
+ }
+ else {
+ $adjstart = $this->AdjStartTime($aStartTime,false,false,$this->iStartTimeAlign);
+ }
+ }
+ if( $this->iEndTimeAlign !== false ) {
+ if( $this->iEndTimeAlign >= 30 ) {
+ $adjend = $this->AdjEndTime($aEndTime,$this->iEndTimeAlign-30);
+ }
+ elseif( $this->iEndTimeAlign >= 20 ) {
+ $adjend = $this->AdjEndTime($aEndTime,false,$this->iEndTimeAlign-20);
+ }
+ else {
+ $adjend = $this->AdjEndTime($aEndTime,false,false,$this->iEndTimeAlign);
+ }
+ }
+
+
+
+ if( $this->iStartAlign !== false ) {
+ if( $this->iStartAlign >= 30 ) {
+ $adjstart = $this->AdjStartDate($aStartTime,$this->iStartAlign-30);
+ }
+ elseif( $this->iStartAlign >= 20 ) {
+ $adjstart = $this->AdjStartDate($aStartTime,false,$this->iStartAlign-20);
+ }
+ else {
+ $adjstart = $this->AdjStartDate($aStartTime,false,false,$this->iStartAlign);
+ }
+ }
+ if( $this->iEndAlign !== false ) {
+ if( $this->iEndAlign >= 30 ) {
+ $adjend = $this->AdjEndDate($aEndTime,$this->iEndAlign-30);
+ }
+ elseif( $this->iEndAlign >= 20 ) {
+ $adjend = $this->AdjEndDate($aEndTime,false,$this->iEndAlign-20);
+ }
+ else {
+ $adjend = $this->AdjEndDate($aEndTime,false,false,$this->iEndAlign);
+ }
+ }
+ $this->Update($img,$adjstart,$adjend);
+ if( ! $this->ticks->IsSpecified() )
+ $this->ticks->Set($maj,$min);
+ if( $this->date_format == '' )
+ $this->ticks->SetLabelDateFormat($format);
+ else
+ $this->ticks->SetLabelDateFormat($this->date_format);
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_errhandler.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_errhandler.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_errhandler.inc.php 2008-03-09 11:30:01.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_errhandler.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,156 +1,242 @@
lt = $_jpg_messages;
+ private $lt=NULL;
+ function __construct() {
+ GLOBAL $__jpg_err_locale;
+ $file = 'lang/'.$__jpg_err_locale.'.inc.php';
+
+ // If the chosen locale doesn't exist try english
+ if( !file_exists(dirname(__FILE__).'/'.$file) ) {
+ $__jpg_err_locale = 'en';
+ }
+
+ $file = 'lang/'.$__jpg_err_locale.'.inc.php';
+ if( !file_exists(dirname(__FILE__).'/'.$file) ) {
+ die('Chosen locale file ("'.$file.'") for error messages does not exist or is not readable for the PHP process. Please make sure that the file exists and that the file permissions are such that the PHP process is allowed to read this file.');
+ }
+ require($file);
+ $this->lt = $_jpg_messages;
}
function Get($errnbr,$a1=null,$a2=null,$a3=null,$a4=null,$a5=null) {
- GLOBAL $__jpg_err_locale;
- if( !isset($this->lt[$errnbr]) ) {
- return 'Internal error: The specified error message ('.$errnbr.') does not exist in the chosen locale ('.$__jpg_err_locale.')';
- }
- $ea = $this->lt[$errnbr];
- $j=0;
- if( $a1 !== null ) {
- $argv[$j++] = $a1;
- if( $a2 !== null ) {
- $argv[$j++] = $a2;
- if( $a3 !== null ) {
- $argv[$j++] = $a3;
- if( $a4 !== null ) {
- $argv[$j++] = $a4;
- if( $a5 !== null ) {
- $argv[$j++] = $a5;
- }
- }
- }
- }
- }
- $numargs = $j;
- if( $ea[1] != $numargs ) {
- // Error message argument count do not match.
- // Just return the error message without arguments.
- return $ea[0];
- }
- switch( $numargs ) {
- case 1:
- $msg = sprintf($ea[0],$argv[0]);
- break;
- case 2:
- $msg = sprintf($ea[0],$argv[0],$argv[1]);
- break;
- case 3:
- $msg = sprintf($ea[0],$argv[0],$argv[1],$argv[2]);
- break;
- case 4:
- $msg = sprintf($ea[0],$argv[0],$argv[1],$argv[2],$argv[3]);
- break;
- case 5:
- $msg = sprintf($ea[0],$argv[0],$argv[1],$argv[2],$argv[3],$argv[4]);
- break;
- case 0:
- default:
- $msg = sprintf($ea[0]);
- break;
- }
- return $msg;
+ GLOBAL $__jpg_err_locale;
+ if( !isset($this->lt[$errnbr]) ) {
+ return 'Internal error: The specified error message ('.$errnbr.') does not exist in the chosen locale ('.$__jpg_err_locale.')';
+ }
+ $ea = $this->lt[$errnbr];
+ $j=0;
+ if( $a1 !== null ) {
+ $argv[$j++] = $a1;
+ if( $a2 !== null ) {
+ $argv[$j++] = $a2;
+ if( $a3 !== null ) {
+ $argv[$j++] = $a3;
+ if( $a4 !== null ) {
+ $argv[$j++] = $a4;
+ if( $a5 !== null ) {
+ $argv[$j++] = $a5;
+ }
+ }
+ }
+ }
+ }
+ $numargs = $j;
+ if( $ea[1] != $numargs ) {
+ // Error message argument count do not match.
+ // Just return the error message without arguments.
+ return $ea[0];
+ }
+ switch( $numargs ) {
+ case 1:
+ $msg = sprintf($ea[0],$argv[0]);
+ break;
+ case 2:
+ $msg = sprintf($ea[0],$argv[0],$argv[1]);
+ break;
+ case 3:
+ $msg = sprintf($ea[0],$argv[0],$argv[1],$argv[2]);
+ break;
+ case 4:
+ $msg = sprintf($ea[0],$argv[0],$argv[1],$argv[2],$argv[3]);
+ break;
+ case 5:
+ $msg = sprintf($ea[0],$argv[0],$argv[1],$argv[2],$argv[3],$argv[4]);
+ break;
+ case 0:
+ default:
+ $msg = sprintf($ea[0]);
+ break;
+ }
+ return $msg;
}
}
-
+
//
// A wrapper class that is used to access the specified error object
// (to hide the global error parameter and avoid having a GLOBAL directive
// in all methods.
//
class JpGraphError {
- function Install($aErrObject) {
- GLOBAL $__jpg_err;
- $__jpg_err = $aErrObject;
- }
- function SetErrLocale($aLoc) {
- GLOBAL $__jpg_err_locale ;
- $__jpg_err_locale = $aLoc;
- }
- function Raise($aMsg,$aHalt=true){
- GLOBAL $__jpg_err;
- $tmp = new $__jpg_err;
- $tmp->Raise($aMsg,$aHalt);
- }
- function RaiseL($errnbr,$a1=null,$a2=null,$a3=null,$a4=null,$a5=null) {
- GLOBAL $__jpg_err;
- $t = new ErrMsgText();
- $msg = $t->Get($errnbr,$a1,$a2,$a3,$a4,$a5);
- $tmp = new $__jpg_err;
- $tmp->Raise($msg);
+ private static $__iImgFlg = true;
+ private static $__iLogFile = '';
+ private static $__iTitle = 'JpGraph Error: ';
+ public static function Raise($aMsg,$aHalt=true){
+ throw new JpGraphException($aMsg);
+ }
+ public static function SetErrLocale($aLoc) {
+ GLOBAL $__jpg_err_locale ;
+ $__jpg_err_locale = $aLoc;
+ }
+ public static function RaiseL($errnbr,$a1=null,$a2=null,$a3=null,$a4=null,$a5=null) {
+ throw new JpGraphExceptionL($errnbr,$a1,$a2,$a3,$a4,$a5);
+ }
+ public static function SetImageFlag($aFlg=true) {
+ self::$__iImgFlg = $aFlg;
+ }
+ public static function GetImageFlag() {
+ return self::$__iImgFlg;
+ }
+ public static function SetLogFile($aFile) {
+ self::$__iLogFile = $aFile;
+ }
+ public static function GetLogFile() {
+ return self::$__iLogFile;
+ }
+ public static function SetTitle($aTitle) {
+ self::$__iTitle = $aTitle;
+ }
+ public static function GetTitle() {
+ return self::$__iTitle;
+ }
+}
+
+class JpGraphException extends Exception {
+ // Redefine the exception so message isn't optional
+ public function __construct($message, $code = 0) {
+ // make sure everything is assigned properly
+ parent::__construct($message, $code);
+ }
+ // custom string representation of object
+ public function _toString() {
+ return __CLASS__ . ": [{$this->code}]: {$this->message} at " . basename($this->getFile()) . ":" . $this->getLine() . "\n" . $this->getTraceAsString() . "\n";
+ }
+ // custom representation of error as an image
+ public function Stroke() {
+ if( JpGraphError::GetImageFlag() ) {
+ $errobj = new JpGraphErrObjectImg();
+ $errobj->SetTitle(JpGraphError::GetTitle());
+ }
+ else {
+ $errobj = new JpGraphErrObject();
+ $errobj->SetTitle(JpGraphError::GetTitle());
+ $errobj->SetStrokeDest(JpGraphError::GetLogFile());
+ }
+ $errobj->Raise($this->getMessage());
+ }
+ static public function defaultHandler(Exception $exception) {
+ global $__jpg_OldHandler;
+ if( $exception instanceof JpGraphException ) {
+ $exception->Stroke();
+ }
+ else {
+ // Restore old handler
+ if( $__jpg_OldHandler !== NULL ) {
+ set_exception_handler($__jpg_OldHandler);
+ }
+ throw $exception;
+ }
}
}
+class JpGraphExceptionL extends JpGraphException {
+ // Redefine the exception so message isn't optional
+ public function __construct($errcode,$a1=null,$a2=null,$a3=null,$a4=null,$a5=null) {
+ // make sure everything is assigned properly
+ $errtxt = new ErrMsgText();
+ JpGraphError::SetTitle('JpGraph Error: '.$errcode);
+ parent::__construct($errtxt->Get($errcode,$a1,$a2,$a3,$a4,$a5), 0);
+ }
+}
+
+// Setup the default handler
+global $__jpg_OldHandler;
+$__jpg_OldHandler = set_exception_handler(array('JpGraphException','defaultHandler'));
+
+//
+// First of all set up a default error handler
+//
+
+//=============================================================
// The default trivial text error handler.
+//=============================================================
class JpGraphErrObject {
- var $iTitle = "JpGraph Error";
- var $iDest = false;
+ protected $iTitle = "JpGraph error: ";
+ protected $iDest = false;
- function JpGraphErrObject() {
- // Empty. Reserved for future use
+
+ function __construct() {
+ // Empty. Reserved for future use
}
function SetTitle($aTitle) {
- $this->iTitle = $aTitle;
+ $this->iTitle = $aTitle;
}
- function SetStrokeDest($aDest) {
- $this->iDest = $aDest;
+ function SetStrokeDest($aDest) {
+ $this->iDest = $aDest;
}
- // If aHalt is true then execution can't continue. Typical used for fatal errors.
- function Raise($aMsg,$aHalt=true) {
- $aMsg = $this->iTitle.' '.$aMsg."\n";
- if ($this->iDest) {
- $f = @fopen($this->iDest,'a');
- if( $f ) {
- @fwrite($f,$aMsg);
- @fclose($f);
- }
- }
- else {
- echo $aMsg;
- }
- if( $aHalt )
- die();
+ // If aHalt is true then execution can't continue. Typical used for fatal errors
+ function Raise($aMsg,$aHalt=false) {
+ if( $this->iDest != '' ) {
+ if( $this->iDest == 'syslog' ) {
+ error_log($this->iTitle.$aMsg);
+ }
+ else {
+ $str = '['.date('r').'] '.$this->iTitle.$aMsg."\n";
+ $f = @fopen($this->iDest,'a');
+ if( $f ) {
+ @fwrite($f,$str);
+ @fclose($f);
+ }
+ }
+ }
+ else {
+ $aMsg = $this->iTitle.$aMsg;
+ // Check SAPI and if we are called from the command line
+ // send the error to STDERR instead
+ if( PHP_SAPI == 'cli' ) {
+ fwrite(STDERR,$aMsg);
+ }
+ else {
+ echo $aMsg;
+ }
+ }
+ if( $aHalt )
+ exit(1);
}
}
@@ -158,120 +244,125 @@
// An image based error handler
//==============================================================
class JpGraphErrObjectImg extends JpGraphErrObject {
+
+ function __construct() {
+ parent::__construct();
+ // Empty. Reserved for future use
+ }
function Raise($aMsg,$aHalt=true) {
- $img_iconerror =
- 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAMAAAC7IEhfAAAAaV'.
- 'BMVEX//////2Xy8mLl5V/Z2VvMzFi/v1WyslKlpU+ZmUyMjEh/'.
- 'f0VyckJlZT9YWDxMTDjAwMDy8sLl5bnY2K/MzKW/v5yyspKlpY'.
- 'iYmH+MjHY/PzV/f2xycmJlZVlZWU9MTEXY2Ms/PzwyMjLFTjea'.
- 'AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACx'.
- 'IAAAsSAdLdfvwAAAAHdElNRQfTBgISOCqusfs5AAABLUlEQVR4'.
- '2tWV3XKCMBBGWfkranCIVClKLd/7P2Q3QsgCxjDTq+6FE2cPH+'.
- 'xJ0Ogn2lQbsT+Wrs+buAZAV4W5T6Bs0YXBBwpKgEuIu+JERAX6'.
- 'wM2rHjmDdEITmsQEEmWADgZm6rAjhXsoMGY9B/NZBwJzBvn+e3'.
- 'wHntCAJdGu9SviwIwoZVDxPB9+Rc0TSEbQr0j3SA1gwdSn6Db0'.
- '6Tm1KfV6yzWGQO7zdpvyKLKBDmRFjzeB3LYgK7r6A/noDAfjtS'.
- 'IXaIzbJSv6WgUebTMV4EoRB8a2mQiQjgtF91HdKDKZ1gtFtQjk'.
- 'YcWaR5OKOhkYt+ZsTFdJRfPAApOpQYJTNHvCRSJR6SJngQadfc'.
- 'vd69OLMddVOPCGVnmrFD8bVYd3JXfxXPtLR/+mtv59/ALWiiMx'.
- 'qL72fwAAAABJRU5ErkJggg==' ;
-
- if( function_exists("imagetypes") )
- $supported = imagetypes();
- else
- $supported = 0;
-
- if( !function_exists('imagecreatefromstring') )
- $supported = 0;
-
- if( ob_get_length() || headers_sent() || !($supported & IMG_PNG) ) {
- // Special case for headers already sent or that the installation doesn't support
- // the PNG format (which the error icon is encoded in).
- // Dont return an image since it can't be displayed
- die($this->iTitle.' '.$aMsg);
- }
-
- $aMsg = wordwrap($aMsg,55);
- $lines = substr_count($aMsg,"\n");
-
- // Create the error icon GD
- $erricon = Image::CreateFromString(base64_decode($img_iconerror));
-
- // Create an image that contains the error text.
- $w=400;
- $h=100 + 15*max(0,$lines-3);
-
- $img = new Image($w,$h);
-
- // Drop shadow
- $img->SetColor("gray");
- $img->FilledRectangle(5,5,$w-1,$h-1,10);
- $img->SetColor("gray:0.7");
- $img->FilledRectangle(5,5,$w-3,$h-3,10);
-
- // Window background
- $img->SetColor("lightblue");
- $img->FilledRectangle(1,1,$w-5,$h-5);
- $img->CopyCanvasH($img->img,$erricon,5,30,0,0,40,40);
-
- // Window border
- $img->SetColor("black");
- $img->Rectangle(1,1,$w-5,$h-5);
- $img->Rectangle(0,0,$w-4,$h-4);
-
- // Window top row
- $img->SetColor("darkred");
- for($y=3; $y < 18; $y += 2 )
- $img->Line(1,$y,$w-6,$y);
-
- // "White shadow"
- $img->SetColor("white");
-
- // Left window edge
- $img->Line(2,2,2,$h-5);
- $img->Line(2,2,$w-6,2);
-
- // "Gray button shadow"
- $img->SetColor("darkgray");
-
- // Gray window shadow
- $img->Line(2,$h-6,$w-5,$h-6);
- $img->Line(3,$h-7,$w-5,$h-7);
-
- // Window title
- $m = floor($w/2-5);
- $l = 100;
- $img->SetColor("lightgray:1.3");
- $img->FilledRectangle($m-$l,2,$m+$l,16);
-
- // Stroke text
- $img->SetColor("darkred");
- $img->SetFont(FF_FONT2,FS_BOLD);
- $img->StrokeText($m-50,15,$this->iTitle);
- $img->SetColor("black");
- $img->SetFont(FF_FONT1,FS_NORMAL);
- $txt = new Text($aMsg,52,25);
- $txt->Align("left","top");
- $txt->Stroke($img);
- if ($this->iDest) {
- $img->Stream($this->iDest);
- } else {
- $img->Headers();
- $img->Stream();
- }
- if( $aHalt )
- die();
+ $img_iconerror =
+ 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAMAAAC7IEhfAAAAaV'.
+ 'BMVEX//////2Xy8mLl5V/Z2VvMzFi/v1WyslKlpU+ZmUyMjEh/'.
+ 'f0VyckJlZT9YWDxMTDjAwMDy8sLl5bnY2K/MzKW/v5yyspKlpY'.
+ 'iYmH+MjHY/PzV/f2xycmJlZVlZWU9MTEXY2Ms/PzwyMjLFTjea'.
+ 'AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACx'.
+ 'IAAAsSAdLdfvwAAAAHdElNRQfTBgISOCqusfs5AAABLUlEQVR4'.
+ '2tWV3XKCMBBGWfkranCIVClKLd/7P2Q3QsgCxjDTq+6FE2cPH+'.
+ 'xJ0Ogn2lQbsT+Wrs+buAZAV4W5T6Bs0YXBBwpKgEuIu+JERAX6'.
+ 'wM2rHjmDdEITmsQEEmWADgZm6rAjhXsoMGY9B/NZBwJzBvn+e3'.
+ 'wHntCAJdGu9SviwIwoZVDxPB9+Rc0TSEbQr0j3SA1gwdSn6Db0'.
+ '6Tm1KfV6yzWGQO7zdpvyKLKBDmRFjzeB3LYgK7r6A/noDAfjtS'.
+ 'IXaIzbJSv6WgUebTMV4EoRB8a2mQiQjgtF91HdKDKZ1gtFtQjk'.
+ 'YcWaR5OKOhkYt+ZsTFdJRfPAApOpQYJTNHvCRSJR6SJngQadfc'.
+ 'vd69OLMddVOPCGVnmrFD8bVYd3JXfxXPtLR/+mtv59/ALWiiMx'.
+ 'qL72fwAAAABJRU5ErkJggg==' ;
+
+
+ if( function_exists("imagetypes") ) {
+ $supported = imagetypes();
+ } else {
+ $supported = 0;
+ }
+
+ if( !function_exists('imagecreatefromstring') ) {
+ $supported = 0;
+ }
+
+ if( ob_get_length() || headers_sent() || !($supported & IMG_PNG) ) {
+ // Special case for headers already sent or that the installation doesn't support
+ // the PNG format (which the error icon is encoded in).
+ // Dont return an image since it can't be displayed
+ die($this->iTitle.' '.$aMsg);
+ }
+
+ $aMsg = wordwrap($aMsg,55);
+ $lines = substr_count($aMsg,"\n");
+
+ // Create the error icon GD
+ $erricon = Image::CreateFromString(base64_decode($img_iconerror));
+
+ // Create an image that contains the error text.
+ $w=400;
+ $h=100 + 15*max(0,$lines-3);
+
+ $img = new Image($w,$h);
+
+
+ // Drop shadow
+ $img->SetColor("gray");
+ $img->FilledRectangle(5,5,$w-1,$h-1,10);
+ $img->SetColor("gray:0.7");
+ $img->FilledRectangle(5,5,$w-3,$h-3,10);
+
+ // Window background
+ $img->SetColor("lightblue");
+ $img->FilledRectangle(1,1,$w-5,$h-5);
+ $img->CopyCanvasH($img->img,$erricon,5,30,0,0,40,40);
+
+ // Window border
+ $img->SetColor("black");
+ $img->Rectangle(1,1,$w-5,$h-5);
+ $img->Rectangle(0,0,$w-4,$h-4);
+
+ // Window top row
+ $img->SetColor("darkred");
+ for($y=3; $y < 18; $y += 2 )
+ $img->Line(1,$y,$w-6,$y);
+
+ // "White shadow"
+ $img->SetColor("white");
+
+ // Left window edge
+ $img->Line(2,2,2,$h-5);
+ $img->Line(2,2,$w-6,2);
+
+ // "Gray button shadow"
+ $img->SetColor("darkgray");
+
+ // Gray window shadow
+ $img->Line(2,$h-6,$w-5,$h-6);
+ $img->Line(3,$h-7,$w-5,$h-7);
+
+ // Window title
+ $m = floor($w/2-5);
+ $l = 110;
+ $img->SetColor("lightgray:1.3");
+ $img->FilledRectangle($m-$l,2,$m+$l,16);
+
+ // Stroke text
+ $img->SetColor("darkred");
+ $img->SetFont(FF_FONT2,FS_BOLD);
+ $img->StrokeText($m-90,15,$this->iTitle);
+ $img->SetColor("black");
+ $img->SetFont(FF_FONT1,FS_NORMAL);
+ $txt = new Text($aMsg,52,25);
+ $txt->Align("left","top");
+ $txt->Stroke($img);
+ if ($this->iDest) {
+ $img->Stream($this->iDest);
+ } else {
+ $img->Headers();
+ $img->Stream();
+ }
+ if( $aHalt )
+ die();
}
}
-// Install the default error handler in a global accessible variable
-if( USE_IMAGE_ERROR_HANDLER ) {
- $__jpg_err = "JpGraphErrObjectImg";
-}
-else {
- $__jpg_err = "JpGraphErrObject";
-}
+if( ! USE_IMAGE_ERROR_HANDLER ) {
+ JpGraphError::SetImageFlag(false);
+}
?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_error.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_error.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_error.php 2006-10-08 04:09:02.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_error.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,78 +1,79 @@
Plot($datay,$datax);
- $this->numpoints /= 2;
- }
-//---------------
-// PUBLIC METHODS
-
+ private $errwidth=2;
+
+ //---------------
+ // CONSTRUCTOR
+ function __construct($datay,$datax=false) {
+ parent::__construct($datay,$datax);
+ $this->numpoints /= 2;
+ }
+ //---------------
+ // PUBLIC METHODS
+
// Gets called before any axis are stroked
- function PreStrokeAdjust(&$graph) {
- if( $this->center ) {
- $a=0.5; $b=0.5;
- ++$this->numpoints;
- } else {
- $a=0; $b=0;
- }
- $graph->xaxis->scale->ticks->SetXLabelOffset($a);
- $graph->SetTextScaleOff($b);
- //$graph->xaxis->scale->ticks->SupressMinorTickMarks();
+ function PreStrokeAdjust($graph) {
+ if( $this->center ) {
+ $a=0.5; $b=0.5;
+ ++$this->numpoints;
+ } else {
+ $a=0; $b=0;
+ }
+ $graph->xaxis->scale->ticks->SetXLabelOffset($a);
+ $graph->SetTextScaleOff($b);
+ //$graph->xaxis->scale->ticks->SupressMinorTickMarks();
}
-
+
// Method description
- function Stroke(&$img,&$xscale,&$yscale) {
- $numpoints=count($this->coords[0])/2;
- $img->SetColor($this->color);
- $img->SetLineWeight($this->weight);
-
- if( isset($this->coords[1]) ) {
- if( count($this->coords[1])!=$numpoints )
- JpGraphError::RaiseL(2003,count($this->coords[1]),$numpoints);
-//("Number of X and Y points are not equal. Number of X-points:".count($this->coords[1])." Number of Y-points:$numpoints");
- else
- $exist_x = true;
- }
- else
- $exist_x = false;
-
- for( $i=0; $i<$numpoints; ++$i) {
- if( $exist_x )
- $x=$this->coords[1][$i];
- else
- $x=$i;
-
- if( !is_numeric($x) ||
- !is_numeric($this->coords[0][$i*2]) || !is_numeric($this->coords[0][$i*2+1]) ) {
- continue;
- }
-
- $xt = $xscale->Translate($x);
- $yt1 = $yscale->Translate($this->coords[0][$i*2]);
- $yt2 = $yscale->Translate($this->coords[0][$i*2+1]);
- $img->Line($xt,$yt1,$xt,$yt2);
- $img->Line($xt-$this->errwidth,$yt1,$xt+$this->errwidth,$yt1);
- $img->Line($xt-$this->errwidth,$yt2,$xt+$this->errwidth,$yt2);
- }
- return true;
+ function Stroke($img,$xscale,$yscale) {
+ $numpoints=count($this->coords[0])/2;
+ $img->SetColor($this->color);
+ $img->SetLineWeight($this->weight);
+
+ if( isset($this->coords[1]) ) {
+ if( count($this->coords[1])!=$numpoints )
+ JpGraphError::RaiseL(2003,count($this->coords[1]),$numpoints);
+ //("Number of X and Y points are not equal. Number of X-points:".count($this->coords[1])." Number of Y-points:$numpoints");
+ else
+ $exist_x = true;
+ }
+ else
+ $exist_x = false;
+
+ for( $i=0; $i<$numpoints; ++$i) {
+ if( $exist_x )
+ $x=$this->coords[1][$i];
+ else
+ $x=$i;
+
+ if( !is_numeric($x) ||
+ !is_numeric($this->coords[0][$i*2]) || !is_numeric($this->coords[0][$i*2+1]) ) {
+ continue;
+ }
+
+ $xt = $xscale->Translate($x);
+ $yt1 = $yscale->Translate($this->coords[0][$i*2]);
+ $yt2 = $yscale->Translate($this->coords[0][$i*2+1]);
+ $img->Line($xt,$yt1,$xt,$yt2);
+ $img->Line($xt-$this->errwidth,$yt1,$xt+$this->errwidth,$yt1);
+ $img->Line($xt-$this->errwidth,$yt2,$xt+$this->errwidth,$yt2);
+ }
+ return true;
}
} // Class
@@ -84,30 +85,30 @@
// BACKWARD COMPATIBILITY
//===================================================
class ErrorLinePlot extends ErrorPlot {
- var $line=null;
-//---------------
-// CONSTRUCTOR
- function ErrorLinePlot(&$datay,$datax=false) {
- $this->ErrorPlot($datay,$datax);
- // Calculate line coordinates as the average of the error limits
- $n = count($datay);
- for($i=0; $i < $n; $i+=2 ) {
- $ly[]=($datay[$i]+$datay[$i+1])/2;
- }
- $this->line=new LinePlot($ly,$datax);
- }
-
-//---------------
-// PUBLIC METHODS
- function Legend(&$graph) {
- if( $this->legend != "" )
- $graph->legend->Add($this->legend,$this->color);
- $this->line->Legend($graph);
- }
-
- function Stroke(&$img,&$xscale,&$yscale) {
- parent::Stroke($img,$xscale,$yscale);
- $this->line->Stroke($img,$xscale,$yscale);
+ public $line=null;
+ //---------------
+ // CONSTRUCTOR
+ function __construct($datay,$datax=false) {
+ parent::__construct($datay,$datax);
+ // Calculate line coordinates as the average of the error limits
+ $n = count($datay);
+ for($i=0; $i < $n; $i+=2 ) {
+ $ly[]=($datay[$i]+$datay[$i+1])/2;
+ }
+ $this->line=new LinePlot($ly,$datax);
+ }
+
+ //---------------
+ // PUBLIC METHODS
+ function Legend($graph) {
+ if( $this->legend != "" )
+ $graph->legend->Add($this->legend,$this->color);
+ $this->line->Legend($graph);
+ }
+
+ function Stroke($img,$xscale,$yscale) {
+ parent::Stroke($img,$xscale,$yscale);
+ $this->line->Stroke($img,$xscale,$yscale);
}
} // Class
@@ -117,37 +118,37 @@
// Description: Combine a line and error plot
//===================================================
class LineErrorPlot extends ErrorPlot {
- var $line=null;
-//---------------
-// CONSTRUCTOR
+ public $line=null;
+ //---------------
+ // CONSTRUCTOR
// Data is (val, errdeltamin, errdeltamax)
- function LineErrorPlot(&$datay,$datax=false) {
- $ly=array(); $ey=array();
- $n = count($datay);
- if( $n % 3 != 0 ) {
- JpGraphError::RaiseL(4002);
-//('Error in input data to LineErrorPlot. Number of data points must be a multiple of 3');
- }
- for($i=0; $i < $n; $i+=3 ) {
- $ly[]=$datay[$i];
- $ey[]=$datay[$i]+$datay[$i+1];
- $ey[]=$datay[$i]+$datay[$i+2];
- }
- $this->ErrorPlot($ey,$datax);
- $this->line=new LinePlot($ly,$datax);
- }
-
-//---------------
-// PUBLIC METHODS
- function Legend(&$graph) {
- if( $this->legend != "" )
- $graph->legend->Add($this->legend,$this->color);
- $this->line->Legend($graph);
- }
-
- function Stroke(&$img,&$xscale,&$yscale) {
- parent::Stroke($img,$xscale,$yscale);
- $this->line->Stroke($img,$xscale,$yscale);
+ function __construct($datay,$datax=false) {
+ $ly=array(); $ey=array();
+ $n = count($datay);
+ if( $n % 3 != 0 ) {
+ JpGraphError::RaiseL(4002);
+ //('Error in input data to LineErrorPlot. Number of data points must be a multiple of 3');
+ }
+ for($i=0; $i < $n; $i+=3 ) {
+ $ly[]=$datay[$i];
+ $ey[]=$datay[$i]+$datay[$i+1];
+ $ey[]=$datay[$i]+$datay[$i+2];
+ }
+ parent::__construct($ey,$datax);
+ $this->line=new LinePlot($ly,$datax);
+ }
+
+ //---------------
+ // PUBLIC METHODS
+ function Legend($graph) {
+ if( $this->legend != "" )
+ $graph->legend->Add($this->legend,$this->color);
+ $this->line->Legend($graph);
+ }
+
+ function Stroke($img,$xscale,$yscale) {
+ parent::Stroke($img,$xscale,$yscale);
+ $this->line->Stroke($img,$xscale,$yscale);
}
} // Class
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_flags.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_flags.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_flags.php 2007-10-13 14:22:39.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_flags.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,9 +1,9 @@
'afgh',
'Republic of Angola' => 'agla',
'Republic of Albania' => 'alba',
@@ -256,117 +256,117 @@
'Republic of Zimbabwe' => 'zbwe' ) ;
- var $iFlagCount = -1;
- var $iFlagSetMap = array(
- FLAGSIZE1 => 'flags_thumb35x35',
- FLAGSIZE2 => 'flags_thumb60x60',
- FLAGSIZE3 => 'flags_thumb100x100',
- FLAGSIZE4 => 'flags'
- );
+ private $iFlagCount = -1;
+ private $iFlagSetMap = array(
+ FLAGSIZE1 => 'flags_thumb35x35',
+ FLAGSIZE2 => 'flags_thumb60x60',
+ FLAGSIZE3 => 'flags_thumb100x100',
+ FLAGSIZE4 => 'flags'
+ );
- var $iFlagData ;
- var $iOrdIdx=array();
+ private $iFlagData ;
+ private $iOrdIdx=array();
function FlagImages($aSize=FLAGSIZE1) {
- switch($aSize) {
- case FLAGSIZE1 :
- case FLAGSIZE2 :
- case FLAGSIZE3 :
- case FLAGSIZE4 :
- $file = dirname(__FILE__).'/'.$this->iFlagSetMap[$aSize].'.dat';
- $fp = fopen($file,'rb');
- $rawdata = fread($fp,filesize($file));
- $this->iFlagData = unserialize($rawdata);
- break;
- default:
- JpGraphError::RaiseL(5001,$aSize);
-//('Unknown flag size. ('.$aSize.')');
- }
- $this->iFlagCount = count($this->iCountryNameMap);
+ switch($aSize) {
+ case FLAGSIZE1 :
+ case FLAGSIZE2 :
+ case FLAGSIZE3 :
+ case FLAGSIZE4 :
+ $file = dirname(__FILE__).'/'.$this->iFlagSetMap[$aSize].'.dat';
+ $fp = fopen($file,'rb');
+ $rawdata = fread($fp,filesize($file));
+ $this->iFlagData = unserialize($rawdata);
+ break;
+ default:
+ JpGraphError::RaiseL(5001,$aSize);
+ //('Unknown flag size. ('.$aSize.')');
+ }
+ $this->iFlagCount = count($this->iCountryNameMap);
}
function GetNum() {
- return $this->iFlagCount;
+ return $this->iFlagCount;
}
function GetImgByName($aName,&$outFullName) {
- $idx = $this->GetIdxByName($aName,$outFullName);
- return $this->GetImgByIdx($idx);
+ $idx = $this->GetIdxByName($aName,$outFullName);
+ return $this->GetImgByIdx($idx);
}
function GetImgByIdx($aIdx) {
- if( array_key_exists($aIdx,$this->iFlagData) ) {
- $d = $this->iFlagData[$aIdx][1];
- return Image::CreateFromString($d);
- }
- else {
- JpGraphError::RaiseL(5002,$aIdx);
-//("Flag index \" $aIdx\" does not exist.");
- }
+ if( array_key_exists($aIdx,$this->iFlagData) ) {
+ $d = $this->iFlagData[$aIdx][1];
+ return Image::CreateFromString($d);
+ }
+ else {
+ JpGraphError::RaiseL(5002,$aIdx);
+ //("Flag index \"�$aIdx\" does not exist.");
+ }
}
function GetIdxByOrdinal($aOrd,&$outFullName) {
- $aOrd--;
- $n = count($this->iOrdIdx);
- if( $n == 0 ) {
- reset($this->iCountryNameMap);
- $this->iOrdIdx=array();
- $i=0;
- while( list($key,$val) = each($this->iCountryNameMap) ) {
- $this->iOrdIdx[$i++] = array($val,$key);
- }
- $tmp=$this->iOrdIdx[$aOrd];
- $outFullName = $tmp[1];
- return $tmp[0];
-
- }
- elseif( $aOrd >= 0 && $aOrd < $n ) {
- $tmp=$this->iOrdIdx[$aOrd];
- $outFullName = $tmp[1];
- return $tmp[0];
- }
- else {
- JpGraphError::RaiseL(5003,$aOrd);
-//('Invalid ordinal number specified for flag index.');
- }
+ $aOrd--;
+ $n = count($this->iOrdIdx);
+ if( $n == 0 ) {
+ reset($this->iCountryNameMap);
+ $this->iOrdIdx=array();
+ $i=0;
+ while( list($key,$val) = each($this->iCountryNameMap) ) {
+ $this->iOrdIdx[$i++] = array($val,$key);
+ }
+ $tmp=$this->iOrdIdx[$aOrd];
+ $outFullName = $tmp[1];
+ return $tmp[0];
+
+ }
+ elseif( $aOrd >= 0 && $aOrd < $n ) {
+ $tmp=$this->iOrdIdx[$aOrd];
+ $outFullName = $tmp[1];
+ return $tmp[0];
+ }
+ else {
+ JpGraphError::RaiseL(5003,$aOrd);
+ //('Invalid ordinal number specified for flag index.');
+ }
}
function GetIdxByName($aName,&$outFullName) {
- if( is_integer($aName) ) {
- $idx = $this->GetIdxByOrdinal($aName,$outFullName);
- return $idx;
- }
-
- $found=false;
- $aName = strtolower($aName);
- $nlen = strlen($aName);
- reset($this->iCountryNameMap);
- // Start by trying to match exact index name
- while( list($key,$val) = each($this->iCountryNameMap) ) {
- if( $nlen == strlen($val) && $val == $aName ) {
- $found=true;
- break;
- }
- }
- if( !$found ) {
- reset($this->iCountryNameMap);
- // If the exact index doesn't work try a (partial) full name
- while( list($key,$val) = each($this->iCountryNameMap) ) {
- if( strpos(strtolower($key), $aName) !== false ) {
- $found=true;
- break;
- }
- }
- }
- if( $found ) {
- $outFullName = $key;
- return $val;
- }
- else {
- JpGraphError::RaiseL(5004,$aName);
-//("The (partial) country name \"$aName\" does not have a cooresponding flag image. The flag may still exist but under another name, e.g. insted of \"usa\" try \"united states\".");
- }
+ if( is_integer($aName) ) {
+ $idx = $this->GetIdxByOrdinal($aName,$outFullName);
+ return $idx;
+ }
+
+ $found=false;
+ $aName = strtolower($aName);
+ $nlen = strlen($aName);
+ reset($this->iCountryNameMap);
+ // Start by trying to match exact index name
+ while( list($key,$val) = each($this->iCountryNameMap) ) {
+ if( $nlen == strlen($val) && $val == $aName ) {
+ $found=true;
+ break;
+ }
+ }
+ if( !$found ) {
+ reset($this->iCountryNameMap);
+ // If the exact index doesn't work try a (partial) full name
+ while( list($key,$val) = each($this->iCountryNameMap) ) {
+ if( strpos(strtolower($key), $aName) !== false ) {
+ $found=true;
+ break;
+ }
+ }
+ }
+ if( $found ) {
+ $outFullName = $key;
+ return $val;
+ }
+ else {
+ JpGraphError::RaiseL(5004,$aName);
+ //("The (partial) country name \"$aName\" does not have a cooresponding flag image. The flag may still exist but under another name, e.g. insted of \"usa\" try \"united states\".");
+ }
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_gantt.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_gantt.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_gantt.php 2007-11-17 06:41:42.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_gantt.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,325 +1,324 @@
vgrid = new LineProperty();
+ function __construct() {
+ $this->vgrid = new LineProperty();
}
function Hide($aF=true) {
- $this->iShow=!$aF;
+ $this->iShow=!$aF;
}
function Show($aF=true) {
- $this->iShow=$aF;
+ $this->iShow=$aF;
}
// Specify font
function SetFont($aFFamily,$aFStyle=FS_NORMAL,$aFSize=10) {
- $this->iFFamily = $aFFamily;
- $this->iFStyle = $aFStyle;
- $this->iFSize = $aFSize;
+ $this->iFFamily = $aFFamily;
+ $this->iFStyle = $aFStyle;
+ $this->iFSize = $aFSize;
}
function SetStyle($aStyle) {
- $this->iStyle = $aStyle;
+ $this->iStyle = $aStyle;
}
function SetColumnMargin($aLeft,$aRight) {
- $this->iLeftColMargin = $aLeft;
- $this->iRightColMargin = $aRight;
+ $this->iLeftColMargin = $aLeft;
+ $this->iRightColMargin = $aRight;
}
function SetFontColor($aFontColor) {
- $this->iFontColor = $aFontColor;
+ $this->iFontColor = $aFontColor;
}
function SetColor($aColor) {
- $this->iColor = $aColor;
+ $this->iColor = $aColor;
}
function SetBackgroundColor($aColor) {
- $this->iBackgroundColor = $aColor;
+ $this->iBackgroundColor = $aColor;
}
function SetColTitles($aTitles,$aWidth=null) {
- $this->iTitles = $aTitles;
- $this->iWidth = $aWidth;
+ $this->iTitles = $aTitles;
+ $this->iWidth = $aWidth;
}
function SetMinColWidth($aWidths) {
- $n = min(count($this->iTitles),count($aWidths));
- for($i=0; $i < $n; ++$i ) {
- if( !empty($aWidths[$i]) ) {
- if( empty($this->iWidth[$i]) ) {
- $this->iWidth[$i] = $aWidths[$i];
- }
- else {
- $this->iWidth[$i] = max($this->iWidth[$i],$aWidths[$i]);
- }
- }
- }
- }
-
- function GetWidth(&$aImg) {
- $txt = new TextProperty();
- $txt->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
- $n = count($this->iTitles) ;
- $rm=$this->iRightColMargin;
- $w = 0;
- for($h=0, $i=0; $i < $n; ++$i ) {
- $w += $this->iLeftColMargin;
- $txt->Set($this->iTitles[$i]);
- if( !empty($this->iWidth[$i]) ) {
- $w1 = max($txt->GetWidth($aImg)+$rm,$this->iWidth[$i]);
- }
- else {
- $w1 = $txt->GetWidth($aImg)+$rm;
- }
- $this->iWidth[$i] = $w1;
- $w += $w1;
- $h = max($h,$txt->GetHeight($aImg));
- }
- $this->iHeight = $h+$this->iTopHeaderMargin;
+ $n = min(count($this->iTitles),count($aWidths));
+ for($i=0; $i < $n; ++$i ) {
+ if( !empty($aWidths[$i]) ) {
+ if( empty($this->iWidth[$i]) ) {
+ $this->iWidth[$i] = $aWidths[$i];
+ }
+ else {
+ $this->iWidth[$i] = max($this->iWidth[$i],$aWidths[$i]);
+ }
+ }
+ }
+ }
+
+ function GetWidth($aImg) {
+ $txt = new TextProperty();
+ $txt->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ $n = count($this->iTitles) ;
+ $rm=$this->iRightColMargin;
+ $w = 0;
+ for($h=0, $i=0; $i < $n; ++$i ) {
+ $w += $this->iLeftColMargin;
+ $txt->Set($this->iTitles[$i]);
+ if( !empty($this->iWidth[$i]) ) {
+ $w1 = max($txt->GetWidth($aImg)+$rm,$this->iWidth[$i]);
+ }
+ else {
+ $w1 = $txt->GetWidth($aImg)+$rm;
+ }
+ $this->iWidth[$i] = $w1;
+ $w += $w1;
+ $h = max($h,$txt->GetHeight($aImg));
+ }
+ $this->iHeight = $h+$this->iTopHeaderMargin;
$txt='';
- return $w;
+ return $w;
}
-
- function GetColStart(&$aImg,&$ioStart,$aAddLeftMargin=false) {
- $n = count($this->iTitles) ;
- $adj = $aAddLeftMargin ? $this->iLeftColMargin : 0;
- $ioStart=array($aImg->left_margin+$adj);
- for( $i=1; $i < $n; ++$i ) {
- $ioStart[$i] = $ioStart[$i-1]+$this->iLeftColMargin+$this->iWidth[$i-1];
- }
+
+ function GetColStart($aImg,&$aStart,$aAddLeftMargin=false) {
+ $n = count($this->iTitles) ;
+ $adj = $aAddLeftMargin ? $this->iLeftColMargin : 0;
+ $aStart=array($aImg->left_margin+$adj);
+ for( $i=1; $i < $n; ++$i ) {
+ $aStart[$i] = $aStart[$i-1]+$this->iLeftColMargin+$this->iWidth[$i-1];
+ }
}
-
+
// Adjust headers left, right or centered
function SetHeaderAlign($aAlign) {
- $this->iHeaderAlign=$aAlign;
+ $this->iHeaderAlign=$aAlign;
}
- function Stroke(&$aImg,$aXLeft,$aYTop,$aXRight,$aYBottom,$aUseTextHeight=false) {
-
- if( !$this->iShow ) return;
-
- $txt = new TextProperty();
- $txt->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
- $txt->SetColor($this->iFontColor);
- $txt->SetAlign($this->iHeaderAlign,'top');
- $n=count($this->iTitles);
-
- if( $n == 0 )
- return;
-
- $x = $aXLeft;
- $h = $this->iHeight;
- $yTop = $aUseTextHeight ? $aYBottom-$h-$this->iTopColMargin-$this->iBottomColMargin : $aYTop ;
-
- if( $h < 0 ) {
- JpGraphError::RaiseL(6001);
-//('Internal error. Height for ActivityTitles is < 0');
- }
-
- $aImg->SetLineWeight(1);
- // Set background color
- $aImg->SetColor($this->iBackgroundColor);
- $aImg->FilledRectangle($aXLeft,$yTop,$aXRight,$aYBottom-1);
-
- if( $this->iStyle == 1 ) {
- // Make a 3D effect
- $aImg->SetColor('white');
- $aImg->Line($aXLeft,$yTop+1,
- $aXRight,$yTop+1);
- }
-
- for($i=0; $i < $n; ++$i ) {
- if( $this->iStyle == 1 ) {
- // Make a 3D effect
- $aImg->SetColor('white');
- $aImg->Line($x+1,$yTop,$x+1,$aYBottom);
- }
- $x += $this->iLeftColMargin;
- $txt->Set($this->iTitles[$i]);
-
- // Adjust the text anchor position according to the choosen alignment
- $xp = $x;
- if( $this->iHeaderAlign == 'center' ) {
- $xp = (($x-$this->iLeftColMargin)+($x+$this->iWidth[$i]))/2;
- }
- elseif( $this->iHeaderAlign == 'right' ) {
- $xp = $x +$this->iWidth[$i]-$this->iRightColMargin;
- }
-
- $txt->Stroke($aImg,$xp,$yTop+$this->iTopHeaderMargin);
- $x += $this->iWidth[$i];
- if( $i < $n-1 ) {
- $aImg->SetColor($this->iColor);
- $aImg->Line($x,$yTop,$x,$aYBottom);
- }
- }
+ function Stroke($aImg,$aXLeft,$aYTop,$aXRight,$aYBottom,$aUseTextHeight=false) {
- $aImg->SetColor($this->iColor);
- $aImg->Line($aXLeft,$yTop, $aXRight,$yTop);
+ if( !$this->iShow ) return;
- // Stroke vertical column dividers
- $cols=array();
- $this->GetColStart($aImg,$cols);
- $n=count($cols);
- for( $i=1; $i < $n; ++$i ) {
- $this->vgrid->Stroke($aImg,$cols[$i],$aYBottom,$cols[$i],
- $aImg->height - $aImg->bottom_margin);
- }
+ $txt = new TextProperty();
+ $txt->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ $txt->SetColor($this->iFontColor);
+ $txt->SetAlign($this->iHeaderAlign,'top');
+ $n=count($this->iTitles);
+
+ if( $n == 0 )
+ return;
+
+ $x = $aXLeft;
+ $h = $this->iHeight;
+ $yTop = $aUseTextHeight ? $aYBottom-$h-$this->iTopColMargin-$this->iBottomColMargin : $aYTop ;
+
+ if( $h < 0 ) {
+ JpGraphError::RaiseL(6001);
+ //('Internal error. Height for ActivityTitles is < 0');
+ }
+
+ $aImg->SetLineWeight(1);
+ // Set background color
+ $aImg->SetColor($this->iBackgroundColor);
+ $aImg->FilledRectangle($aXLeft,$yTop,$aXRight,$aYBottom-1);
+
+ if( $this->iStyle == 1 ) {
+ // Make a 3D effect
+ $aImg->SetColor('white');
+ $aImg->Line($aXLeft,$yTop+1,$aXRight,$yTop+1);
+ }
+
+ for($i=0; $i < $n; ++$i ) {
+ if( $this->iStyle == 1 ) {
+ // Make a 3D effect
+ $aImg->SetColor('white');
+ $aImg->Line($x+1,$yTop,$x+1,$aYBottom);
+ }
+ $x += $this->iLeftColMargin;
+ $txt->Set($this->iTitles[$i]);
+
+ // Adjust the text anchor position according to the choosen alignment
+ $xp = $x;
+ if( $this->iHeaderAlign == 'center' ) {
+ $xp = (($x-$this->iLeftColMargin)+($x+$this->iWidth[$i]))/2;
+ }
+ elseif( $this->iHeaderAlign == 'right' ) {
+ $xp = $x +$this->iWidth[$i]-$this->iRightColMargin;
+ }
+
+ $txt->Stroke($aImg,$xp,$yTop+$this->iTopHeaderMargin);
+ $x += $this->iWidth[$i];
+ if( $i < $n-1 ) {
+ $aImg->SetColor($this->iColor);
+ $aImg->Line($x,$yTop,$x,$aYBottom);
+ }
+ }
+
+ $aImg->SetColor($this->iColor);
+ $aImg->Line($aXLeft,$yTop, $aXRight,$yTop);
+
+ // Stroke vertical column dividers
+ $cols=array();
+ $this->GetColStart($aImg,$cols);
+ $n=count($cols);
+ for( $i=1; $i < $n; ++$i ) {
+ $this->vgrid->Stroke($aImg,$cols[$i],$aYBottom,$cols[$i],
+ $aImg->height - $aImg->bottom_margin);
+ }
}
}
@@ -329,300 +328,328 @@
// Description: Main class to handle gantt graphs
//===================================================
class GanttGraph extends Graph {
- var $scale; // Public accessible
- var $iObj=array(); // Gantt objects
- var $iLabelHMarginFactor=0.2; // 10% margin on each side of the labels
- var $iLabelVMarginFactor=0.4; // 40% margin on top and bottom of label
- var $iLayout=GANTT_FROMTOP; // Could also be GANTT_EVEN
- var $iSimpleFont = FF_FONT1,$iSimpleFontSize=11;
- var $iSimpleStyle=GANTT_RDIAG,$iSimpleColor='yellow',$iSimpleBkgColor='red';
- var $iSimpleProgressBkgColor='gray',$iSimpleProgressColor='darkgreen';
- var $iSimpleProgressStyle=GANTT_SOLID;
- var $hgrid=null;
-//---------------
-// CONSTRUCTOR
+ public $scale; // Public accessible
+ public $hgrid=null;
+ private $iObj=array(); // Gantt objects
+ private $iLabelHMarginFactor=0.2; // 10% margin on each side of the labels
+ private $iLabelVMarginFactor=0.4; // 40% margin on top and bottom of label
+ private $iLayout=GANTT_FROMTOP; // Could also be GANTT_EVEN
+ private $iSimpleFont = FF_FONT1,$iSimpleFontSize=11;
+ private $iSimpleStyle=GANTT_RDIAG,$iSimpleColor='yellow',$iSimpleBkgColor='red';
+ private $iSimpleProgressBkgColor='gray',$iSimpleProgressColor='darkgreen';
+ private $iSimpleProgressStyle=GANTT_SOLID;
+ private $iZoomFactor = 1.0;
+ //---------------
+ // CONSTRUCTOR
// Create a new gantt graph
- function GanttGraph($aWidth=0,$aHeight=0,$aCachedName="",$aTimeOut=0,$aInline=true) {
+ function __construct($aWidth=0,$aHeight=0,$aCachedName="",$aTimeOut=0,$aInline=true) {
- // Backward compatibility
- if( $aWidth == -1 ) $aWidth=0;
- if( $aHeight == -1 ) $aHeight=0;
-
- if( $aWidth< 0 || $aHeight < 0 ) {
- JpgraphError::RaiseL(6002);
-//("You can't specify negative sizes for Gantt graph dimensions. Use 0 to indicate that you want the library to automatically determine a dimension.");
- }
- Graph::Graph($aWidth,$aHeight,$aCachedName,$aTimeOut,$aInline);
- $this->scale = new GanttScale($this->img);
+ // Backward compatibility
+ if( $aWidth == -1 ) $aWidth=0;
+ if( $aHeight == -1 ) $aHeight=0;
+
+ if( $aWidth< 0 || $aHeight < 0 ) {
+ JpgraphError::RaiseL(6002);
+ //("You can't specify negative sizes for Gantt graph dimensions. Use 0 to indicate that you want the library to automatically determine a dimension.");
+ }
+ parent::__construct($aWidth,$aHeight,$aCachedName,$aTimeOut,$aInline);
+ $this->scale = new GanttScale($this->img);
- // Default margins
- $this->img->SetMargin(15,17,25,15);
+ // Default margins
+ $this->img->SetMargin(15,17,25,15);
- $this->hgrid = new HorizontalGridLine();
-
- $this->scale->ShowHeaders(GANTT_HWEEK|GANTT_HDAY);
- $this->SetBox();
- }
-
-//---------------
-// PUBLIC METHODS
+ $this->hgrid = new HorizontalGridLine();
- //
+ $this->scale->ShowHeaders(GANTT_HWEEK|GANTT_HDAY);
+ $this->SetBox();
+ }
+
+ //---------------
+ // PUBLIC METHODS
+
+ //
function SetSimpleFont($aFont,$aSize) {
- $this->iSimpleFont = $aFont;
- $this->iSimpleFontSize = $aSize;
+ $this->iSimpleFont = $aFont;
+ $this->iSimpleFontSize = $aSize;
}
function SetSimpleStyle($aBand,$aColor,$aBkgColor) {
- $this->iSimpleStyle = $aBand;
- $this->iSimpleColor = $aColor;
- $this->iSimpleBkgColor = $aBkgColor;
+ $this->iSimpleStyle = $aBand;
+ $this->iSimpleColor = $aColor;
+ $this->iSimpleBkgColor = $aBkgColor;
}
// A utility function to help create basic Gantt charts
function CreateSimple($data,$constrains=array(),$progress=array()) {
- $num = count($data);
- for( $i=0; $i < $num; ++$i) {
- switch( $data[$i][1] ) {
- case ACTYPE_GROUP:
- // Create a slightly smaller height bar since the
- // "wings" at the end will make it look taller
- $a = new GanttBar($data[$i][0],$data[$i][2],$data[$i][3],$data[$i][4],'',8);
- $a->title->SetFont($this->iSimpleFont,FS_BOLD,$this->iSimpleFontSize);
- $a->rightMark->Show();
- $a->rightMark->SetType(MARK_RIGHTTRIANGLE);
- $a->rightMark->SetWidth(8);
- $a->rightMark->SetColor('black');
- $a->rightMark->SetFillColor('black');
-
- $a->leftMark->Show();
- $a->leftMark->SetType(MARK_LEFTTRIANGLE);
- $a->leftMark->SetWidth(8);
- $a->leftMark->SetColor('black');
- $a->leftMark->SetFillColor('black');
-
- $a->SetPattern(BAND_SOLID,'black');
- $csimpos = 6;
- break;
-
- case ACTYPE_NORMAL:
- $a = new GanttBar($data[$i][0],$data[$i][2],$data[$i][3],$data[$i][4],'',10);
- $a->title->SetFont($this->iSimpleFont,FS_NORMAL,$this->iSimpleFontSize);
- $a->SetPattern($this->iSimpleStyle,$this->iSimpleColor);
- $a->SetFillColor($this->iSimpleBkgColor);
- // Check if this activity should have a constrain line
- $n = count($constrains);
- for( $j=0; $j < $n; ++$j ) {
- if( empty($constrains[$j]) || (count($constrains[$j]) != 3) ) {
- JpGraphError::RaiseL(6003,$j);
-//("Invalid format for Constrain parameter at index=$j in CreateSimple(). Parameter must start with index 0 and contain arrays of (Row,Constrain-To,Constrain-Type)");
- }
- if( $constrains[$j][0]==$data[$i][0] ) {
- $a->SetConstrain($constrains[$j][1],$constrains[$j][2],'black',ARROW_S2,ARROWT_SOLID);
- }
- }
-
- // Check if this activity have a progress bar
- $n = count($progress);
- for( $j=0; $j < $n; ++$j ) {
-
- if( empty($progress[$j]) || (count($progress[$j]) != 2) ) {
- JpGraphError::RaiseL(6004,$j);
-//("Invalid format for Progress parameter at index=$j in CreateSimple(). Parameter must start with index 0 and contain arrays of (Row,Progress)");
- }
- if( $progress[$j][0]==$data[$i][0] ) {
- $a->progress->Set($progress[$j][1]);
- $a->progress->SetHeight(0.5);
- $a->progress->SetPattern($this->iSimpleProgressStyle,
- $this->iSimpleProgressColor);
- $a->progress->SetFillColor($this->iSimpleProgressBkgColor);
- //$a->progress->SetPattern($progress[$j][2],$progress[$j][3]);
- break;
- }
- }
- $csimpos = 6;
- break;
-
- case ACTYPE_MILESTONE:
- $a = new MileStone($data[$i][0],$data[$i][2],$data[$i][3]);
- $a->title->SetFont($this->iSimpleFont,FS_NORMAL,$this->iSimpleFontSize);
- $a->caption->SetFont($this->iSimpleFont,FS_NORMAL,$this->iSimpleFontSize);
- $csimpos = 5;
- break;
- default:
- die('Unknown activity type');
- break;
- }
-
- // Setup caption
- $a->caption->Set($data[$i][$csimpos-1]);
-
- // Check if this activity should have a CSIM target ?
- if( !empty($data[$i][$csimpos]) ) {
- $a->SetCSIMTarget($data[$i][$csimpos]);
- $a->SetCSIMAlt($data[$i][$csimpos+1]);
- }
- if( !empty($data[$i][$csimpos+2]) ) {
- $a->title->SetCSIMTarget($data[$i][$csimpos+2]);
- $a->title->SetCSIMAlt($data[$i][$csimpos+3]);
- }
-
- $this->Add($a);
- }
+ $num = count($data);
+ for( $i=0; $i < $num; ++$i) {
+ switch( $data[$i][1] ) {
+ case ACTYPE_GROUP:
+ // Create a slightly smaller height bar since the
+ // "wings" at the end will make it look taller
+ $a = new GanttBar($data[$i][0],$data[$i][2],$data[$i][3],$data[$i][4],'',8);
+ $a->title->SetFont($this->iSimpleFont,FS_BOLD,$this->iSimpleFontSize);
+ $a->rightMark->Show();
+ $a->rightMark->SetType(MARK_RIGHTTRIANGLE);
+ $a->rightMark->SetWidth(8);
+ $a->rightMark->SetColor('black');
+ $a->rightMark->SetFillColor('black');
+
+ $a->leftMark->Show();
+ $a->leftMark->SetType(MARK_LEFTTRIANGLE);
+ $a->leftMark->SetWidth(8);
+ $a->leftMark->SetColor('black');
+ $a->leftMark->SetFillColor('black');
+
+ $a->SetPattern(BAND_SOLID,'black');
+ $csimpos = 6;
+ break;
+
+ case ACTYPE_NORMAL:
+ $a = new GanttBar($data[$i][0],$data[$i][2],$data[$i][3],$data[$i][4],'',10);
+ $a->title->SetFont($this->iSimpleFont,FS_NORMAL,$this->iSimpleFontSize);
+ $a->SetPattern($this->iSimpleStyle,$this->iSimpleColor);
+ $a->SetFillColor($this->iSimpleBkgColor);
+ // Check if this activity should have a constrain line
+ $n = count($constrains);
+ for( $j=0; $j < $n; ++$j ) {
+ if( empty($constrains[$j]) || (count($constrains[$j]) != 3) ) {
+ JpGraphError::RaiseL(6003,$j);
+ //("Invalid format for Constrain parameter at index=$j in CreateSimple(). Parameter must start with index 0 and contain arrays of (Row,Constrain-To,Constrain-Type)");
+ }
+ if( $constrains[$j][0]==$data[$i][0] ) {
+ $a->SetConstrain($constrains[$j][1],$constrains[$j][2],'black',ARROW_S2,ARROWT_SOLID);
+ }
+ }
+
+ // Check if this activity have a progress bar
+ $n = count($progress);
+ for( $j=0; $j < $n; ++$j ) {
+
+ if( empty($progress[$j]) || (count($progress[$j]) != 2) ) {
+ JpGraphError::RaiseL(6004,$j);
+ //("Invalid format for Progress parameter at index=$j in CreateSimple(). Parameter must start with index 0 and contain arrays of (Row,Progress)");
+ }
+ if( $progress[$j][0]==$data[$i][0] ) {
+ $a->progress->Set($progress[$j][1]);
+ $a->progress->SetPattern($this->iSimpleProgressStyle,
+ $this->iSimpleProgressColor);
+ $a->progress->SetFillColor($this->iSimpleProgressBkgColor);
+ //$a->progress->SetPattern($progress[$j][2],$progress[$j][3]);
+ break;
+ }
+ }
+ $csimpos = 6;
+ break;
+
+ case ACTYPE_MILESTONE:
+ $a = new MileStone($data[$i][0],$data[$i][2],$data[$i][3]);
+ $a->title->SetFont($this->iSimpleFont,FS_NORMAL,$this->iSimpleFontSize);
+ $a->caption->SetFont($this->iSimpleFont,FS_NORMAL,$this->iSimpleFontSize);
+ $csimpos = 5;
+ break;
+ default:
+ die('Unknown activity type');
+ break;
+ }
+
+ // Setup caption
+ $a->caption->Set($data[$i][$csimpos-1]);
+
+ // Check if this activity should have a CSIM target�?
+ if( !empty($data[$i][$csimpos]) ) {
+ $a->SetCSIMTarget($data[$i][$csimpos]);
+ $a->SetCSIMAlt($data[$i][$csimpos+1]);
+ }
+ if( !empty($data[$i][$csimpos+2]) ) {
+ $a->title->SetCSIMTarget($data[$i][$csimpos+2]);
+ $a->title->SetCSIMAlt($data[$i][$csimpos+3]);
+ }
+
+ $this->Add($a);
+ }
+ }
+
+ // Set user specified scale zoom factor when auto sizing is used
+ function SetZoomFactor($aZoom) {
+ $this->iZoomFactor = $aZoom;
}
-
+
// Set what headers should be shown
function ShowHeaders($aFlg) {
- $this->scale->ShowHeaders($aFlg);
+ $this->scale->ShowHeaders($aFlg);
}
-
- // Specify the fraction of the font height that should be added
+
+ // Specify the fraction of the font height that should be added
// as vertical margin
function SetLabelVMarginFactor($aVal) {
- $this->iLabelVMarginFactor = $aVal;
+ $this->iLabelVMarginFactor = $aVal;
}
// Synonym to the method above
function SetVMarginFactor($aVal) {
- $this->iLabelVMarginFactor = $aVal;
+ $this->iLabelVMarginFactor = $aVal;
}
-
-
+
+
// Add a new Gantt object
function Add($aObject) {
- if( is_array($aObject) && count($aObject) > 0 ) {
- $cl = $aObject[0];
- if( is_a($cl,'IconPlot') ) {
- $this->AddIcon($aObject);
- }
- else {
- $n = count($aObject);
- for($i=0; $i < $n; ++$i)
- $this->iObj[] = $aObject[$i];
- }
- }
- else {
- if( is_a($aObject,'IconPlot') ) {
- $this->AddIcon($aObject);
- }
- else {
- $this->iObj[] = $aObject;
- }
+ if( is_array($aObject) && count($aObject) > 0 ) {
+ $cl = $aObject[0];
+ if( class_exists('IconPlot',false) && ($cl instanceof IconPlot) ) {
+ $this->AddIcon($aObject);
+ }
+ elseif( class_exists('Text',false) && ($cl instanceof Text) ) {
+ $this->AddText($aObject);
+ }
+ else {
+ $n = count($aObject);
+ for($i=0; $i < $n; ++$i)
+ $this->iObj[] = $aObject[$i];
+ }
+ }
+ else {
+ if( class_exists('IconPlot',false) && ($aObject instanceof IconPlot) ) {
+ $this->AddIcon($aObject);
+ }
+ elseif( class_exists('Text',false) && ($aObject instanceof Text) ) {
+ $this->AddText($aObject);
+ }
+ else {
+ $this->iObj[] = $aObject;
+ }
+ }
+ }
+
+ function StrokeTexts() {
+ // Stroke any user added text objects
+ if( $this->texts != null ) {
+ $n = count($this->texts);
+ for($i=0; $i < $n; ++$i) {
+ if( $this->texts[$i]->iScalePosX !== null && $this->texts[$i]->iScalePosY !== null ) {
+ $x = $this->scale->TranslateDate($this->texts[$i]->iScalePosX);
+ $y = $this->scale->TranslateVertPos($this->texts[$i]->iScalePosY);
+ $y -= $this->scale->GetVertSpacing()/2;
+ }
+ else {
+ $x = $y = null;
+ }
+ $this->texts[$i]->Stroke($this->img,$x,$y);
+ }
+ }
}
- }
// Override inherit method from Graph and give a warning message
- function SetScale() {
- JpGraphError::RaiseL(6005);
-//("SetScale() is not meaningfull with Gantt charts.");
+ function SetScale($aAxisType,$aYMin=1,$aYMax=1,$aXMin=1,$aXMax=1) {
+ JpGraphError::RaiseL(6005);
+ //("SetScale() is not meaningfull with Gantt charts.");
}
// Specify the date range for Gantt graphs (if this is not set it will be
// automtically determined from the input data)
function SetDateRange($aStart,$aEnd) {
- // Adjust the start and end so that the indicate the
- // begining and end of respective start and end days
- if( strpos($aStart,':') === false )
- $aStart = date('Y-m-d 00:00',strtotime($aStart));
- if( strpos($aEnd,':') === false )
- $aEnd = date('Y-m-d 23:59',strtotime($aEnd));
- $this->scale->SetRange($aStart,$aEnd);
+ // Adjust the start and end so that the indicate the
+ // begining and end of respective start and end days
+ if( strpos($aStart,':') === false )
+ $aStart = date('Y-m-d 00:00',strtotime($aStart));
+ if( strpos($aEnd,':') === false )
+ $aEnd = date('Y-m-d 23:59',strtotime($aEnd));
+ $this->scale->SetRange($aStart,$aEnd);
}
-
+
// Get the maximum width of the activity titles columns for the bars
// The name is lightly misleading since we from now on can have
// multiple columns in the label section. When this was first written
// it only supported a single label, hence the name.
function GetMaxLabelWidth() {
- $m=50;
- if( $this->iObj != null ) {
- $marg = $this->scale->actinfo->iLeftColMargin+$this->scale->actinfo->iRightColMargin;
- $m = $this->iObj[0]->title->GetWidth($this->img)+$marg;
- $n = count($this->iObj);
- for($i=1; $i < $n; ++$i) {
- if( !empty($this->iObj[$i]->title) ) {
- if( $this->iObj[$i]->title->HasTabs() ) {
- list($tot,$w) = $this->iObj[$i]->title->GetWidth($this->img,true);
- $m=max($m,$tot);
- }
- else
- $m=max($m,$this->iObj[$i]->title->GetWidth($this->img));
- }
- }
- }
- return $m;
+ $m=10;
+ if( $this->iObj != null ) {
+ $marg = $this->scale->actinfo->iLeftColMargin+$this->scale->actinfo->iRightColMargin;
+ $n = count($this->iObj);
+ for($i=0; $i < $n; ++$i) {
+ if( !empty($this->iObj[$i]->title) ) {
+ if( $this->iObj[$i]->title->HasTabs() ) {
+ list($tot,$w) = $this->iObj[$i]->title->GetWidth($this->img,true);
+ $m=max($m,$tot);
+ }
+ else
+ $m=max($m,$this->iObj[$i]->title->GetWidth($this->img));
+ }
+ }
+ }
+ return $m;
}
-
+
// Get the maximum height of the titles for the bars
function GetMaxLabelHeight() {
- $m=0;
- if( $this->iObj != null ) {
- $m = $this->iObj[0]->title->GetHeight($this->img);
- $n = count($this->iObj);
- for($i=1; $i < $n; ++$i) {
- if( !empty($this->iObj[$i]->title) ) {
- $m=max($m,$this->iObj[$i]->title->GetHeight($this->img));
- }
- }
- }
- return $m;
+ $m=10;
+ if( $this->iObj != null ) {
+ $n = count($this->iObj);
+ // We can not include the title of GnttVLine since that title is stroked at the bottom
+ // of the Gantt bar and not in the activity title columns
+ for($i=0; $i < $n; ++$i) {
+ if( !empty($this->iObj[$i]->title) && !($this->iObj[$i] instanceof GanttVLine) ) {
+ $m=max($m,$this->iObj[$i]->title->GetHeight($this->img));
+ }
+ }
+ }
+ return $m;
}
function GetMaxBarAbsHeight() {
- $m=0;
- if( $this->iObj != null ) {
- $m = $this->iObj[0]->GetAbsHeight($this->img);
- $n = count($this->iObj);
- for($i=1; $i < $n; ++$i) {
- $m=max($m,$this->iObj[$i]->GetAbsHeight($this->img));
- }
- }
- return $m;
+ $m=0;
+ if( $this->iObj != null ) {
+ $m = $this->iObj[0]->GetAbsHeight($this->img);
+ $n = count($this->iObj);
+ for($i=1; $i < $n; ++$i) {
+ $m=max($m,$this->iObj[$i]->GetAbsHeight($this->img));
+ }
+ }
+ return $m;
}
-
+
// Get the maximum used line number (vertical position) for bars
function GetBarMaxLineNumber() {
- $m=0;
- if( $this->iObj != null ) {
- $m = $this->iObj[0]->GetLineNbr();
- $n = count($this->iObj);
- for($i=1; $i < $n; ++$i) {
- $m=max($m,$this->iObj[$i]->GetLineNbr());
- }
- }
- return $m;
+ $m=1;
+ if( $this->iObj != null ) {
+ $m = $this->iObj[0]->GetLineNbr();
+ $n = count($this->iObj);
+ for($i=1; $i < $n; ++$i) {
+ $m=max($m,$this->iObj[$i]->GetLineNbr());
+ }
+ }
+ return $m;
}
-
+
// Get the minumum and maximum used dates for all bars
function GetBarMinMax() {
- $start = 0 ;
- $n = count($this->iObj);
-
- while( $start < $n && $this->iObj[$start]->GetMaxDate() === false )
- ++$start;
- if( $start >= $n ) {
- JpgraphError::RaiseL(6006);
-//('Cannot autoscale Gantt chart. No dated activities exist. [GetBarMinMax() start >= n]');
- }
-
- $max=$this->scale->NormalizeDate($this->iObj[$start]->GetMaxDate());
- $min=$this->scale->NormalizeDate($this->iObj[$start]->GetMinDate());
-
- for($i=$start+1; $i < $n; ++$i) {
- $rmax = $this->scale->NormalizeDate($this->iObj[$i]->GetMaxDate());
- if( $rmax != false )
- $max=Max($max,$rmax);
- $rmin = $this->scale->NormalizeDate($this->iObj[$i]->GetMinDate());
- if( $rmin != false )
- $min=Min($min,$rmin);
- }
- $minDate = date("Y-m-d",$min);
- $min = strtotime($minDate);
- $maxDate = date("Y-m-d 23:59",$max);
- $max = strtotime($maxDate);
- return array($min,$max);
+ $start = 0 ;
+ $n = count($this->iObj);
+ while( $start < $n && $this->iObj[$start]->GetMaxDate() === false )
+ ++$start;
+ if( $start >= $n ) {
+ JpgraphError::RaiseL(6006);
+ //('Cannot autoscale Gantt chart. No dated activities exist. [GetBarMinMax() start >= n]');
+ }
+
+ $max=$this->scale->NormalizeDate($this->iObj[$start]->GetMaxDate());
+ $min=$this->scale->NormalizeDate($this->iObj[$start]->GetMinDate());
+
+ for($i=$start+1; $i < $n; ++$i) {
+ $rmax = $this->scale->NormalizeDate($this->iObj[$i]->GetMaxDate());
+ if( $rmax != false )
+ $max=Max($max,$rmax);
+ $rmin = $this->scale->NormalizeDate($this->iObj[$i]->GetMinDate());
+ if( $rmin != false )
+ $min=Min($min,$rmin);
+ }
+ $minDate = date("Y-m-d",$min);
+ $min = strtotime($minDate);
+ $maxDate = date("Y-m-d 23:59",$max);
+ $max = strtotime($maxDate);
+ return array($min,$max);
}
// Create a new auto sized canvas if the user hasn't specified a size
@@ -630,255 +657,271 @@
// the minimum width needed to display the headers. Some margins are
// also added to make it better looking.
function AutoSize() {
- if( $this->img->img == null ) {
- // The predefined left, right, top, bottom margins.
- // Note that the top margin might incease depending on
- // the title.
- $lm = $this->img->left_margin;
- $rm = $this->img->right_margin;
- $rm += 2 ;
- $tm = $this->img->top_margin;
- $bm = $this->img->bottom_margin;
- $bm += 1;
- if( BRAND_TIMING ) $bm += 10;
-
- // First find out the height
- $n=$this->GetBarMaxLineNumber()+1;
- $m=max($this->GetMaxLabelHeight(),$this->GetMaxBarAbsHeight());
- $height=$n*((1+$this->iLabelVMarginFactor)*$m);
-
- // Add the height of the scale titles
- $h=$this->scale->GetHeaderHeight();
- $height += $h;
-
- // Calculate the top margin needed for title and subtitle
- if( $this->title->t != "" ) {
- $tm += $this->title->GetFontHeight($this->img);
- }
- if( $this->subtitle->t != "" ) {
- $tm += $this->subtitle->GetFontHeight($this->img);
- }
-
- // ...and then take the bottom and top plot margins into account
- $height += $tm + $bm + $this->scale->iTopPlotMargin + $this->scale->iBottomPlotMargin;
- // Now find the minimum width for the chart required
-
- // If day scale or smaller is shown then we use the day font width
- // as the base size unit.
- // If only weeks or above is displayed we use a modified unit to
- // get a smaller image.
- if( $this->scale->IsDisplayHour() || $this->scale->IsDisplayMinute() ) {
- // Add 2 pixel margin on each side
- $fw=$this->scale->day->GetFontWidth($this->img)+4;
- }
- elseif( $this->scale->IsDisplayWeek() ) {
- $fw = 8;
- }
- elseif( $this->scale->IsDisplayMonth() ) {
- $fw = 4;
- }
- else {
- $fw = 2;
- }
-
- $nd=$this->scale->GetNumberOfDays();
-
- if( $this->scale->IsDisplayDay() ) {
- // If the days are displayed we also need to figure out
- // how much space each day's title will require.
- switch( $this->scale->day->iStyle ) {
- case DAYSTYLE_LONG :
- $txt = "Monday";
- break;
- case DAYSTYLE_LONGDAYDATE1 :
- $txt = "Monday 23 Jun";
- break;
- case DAYSTYLE_LONGDAYDATE2 :
- $txt = "Monday 23 Jun 2003";
- break;
- case DAYSTYLE_SHORT :
- $txt = "Mon";
- break;
- case DAYSTYLE_SHORTDAYDATE1 :
+
+ if( $this->img->img == null ) {
+ // The predefined left, right, top, bottom margins.
+ // Note that the top margin might incease depending on
+ // the title.
+ $hadj = $vadj = 0;
+ if( $this->doshadow ) {
+ $hadj = $this->shadow_width;
+ $vadj = $this->shadow_width+5;
+ }
+
+ $lm = $this->img->left_margin;
+ $rm = $this->img->right_margin +$hadj;
+ $rm += 2 ;
+ $tm = $this->img->top_margin;
+ $bm = $this->img->bottom_margin + $vadj;
+ $bm += 2;
+
+ // If there are any added GanttVLine we must make sure that the
+ // bottom margin is wide enough to hold a title.
+ $n = count($this->iObj);
+ for($i=0; $i < $n; ++$i) {
+ if( $this->iObj[$i] instanceof GanttVLine ) {
+ $bm = max($bm,$this->iObj[$i]->title->GetHeight($this->img)+10);
+ }
+ }
+
+ // First find out the height
+ $n=$this->GetBarMaxLineNumber()+1;
+ $m=max($this->GetMaxLabelHeight(),$this->GetMaxBarAbsHeight());
+ $height=$n*((1+$this->iLabelVMarginFactor)*$m);
+
+ // Add the height of the scale titles
+ $h=$this->scale->GetHeaderHeight();
+ $height += $h;
+
+ // Calculate the top margin needed for title and subtitle
+ if( $this->title->t != "" ) {
+ $tm += $this->title->GetFontHeight($this->img);
+ }
+ if( $this->subtitle->t != "" ) {
+ $tm += $this->subtitle->GetFontHeight($this->img);
+ }
+
+ // ...and then take the bottom and top plot margins into account
+ $height += $tm + $bm + $this->scale->iTopPlotMargin + $this->scale->iBottomPlotMargin;
+ // Now find the minimum width for the chart required
+
+ // If day scale or smaller is shown then we use the day font width
+ // as the base size unit.
+ // If only weeks or above is displayed we use a modified unit to
+ // get a smaller image.
+ if( $this->scale->IsDisplayHour() || $this->scale->IsDisplayMinute() ) {
+ // Add 2 pixel margin on each side
+ $fw=$this->scale->day->GetFontWidth($this->img)+4;
+ }
+ elseif( $this->scale->IsDisplayWeek() ) {
+ $fw = 8;
+ }
+ elseif( $this->scale->IsDisplayMonth() ) {
+ $fw = 4;
+ }
+ else {
+ $fw = 2;
+ }
+
+ $nd=$this->scale->GetNumberOfDays();
+
+ if( $this->scale->IsDisplayDay() ) {
+ // If the days are displayed we also need to figure out
+ // how much space each day's title will require.
+ switch( $this->scale->day->iStyle ) {
+ case DAYSTYLE_LONG :
+ $txt = "Monday";
+ break;
+ case DAYSTYLE_LONGDAYDATE1 :
+ $txt = "Monday 23 Jun";
+ break;
+ case DAYSTYLE_LONGDAYDATE2 :
+ $txt = "Monday 23 Jun 2003";
+ break;
+ case DAYSTYLE_SHORT :
+ $txt = "Mon";
+ break;
+ case DAYSTYLE_SHORTDAYDATE1 :
$txt = "Mon 23/6";
- break;
- case DAYSTYLE_SHORTDAYDATE2 :
- $txt = "Mon 23 Jun";
- break;
- case DAYSTYLE_SHORTDAYDATE3 :
- $txt = "Mon 23";
- break;
- case DAYSTYLE_SHORTDATE1 :
+ break;
+ case DAYSTYLE_SHORTDAYDATE2 :
+ $txt = "Mon 23 Jun";
+ break;
+ case DAYSTYLE_SHORTDAYDATE3 :
+ $txt = "Mon 23";
+ break;
+ case DAYSTYLE_SHORTDATE1 :
$txt = "23/6";
- break;
- case DAYSTYLE_SHORTDATE2 :
- $txt = "23 Jun";
- break;
- case DAYSTYLE_SHORTDATE3 :
- $txt = "Mon 23";
- break;
- case DAYSTYLE_SHORTDATE4 :
- $txt = "88";
- break;
- case DAYSTYLE_CUSTOM :
- $txt = date($this->scale->day->iLabelFormStr,
- strtotime('2003-12-20 18:00'));
- break;
- case DAYSTYLE_ONELETTER :
- default:
- $txt = "M";
- break;
- }
- $fw = $this->scale->day->GetStrWidth($this->img,$txt)+6;
- }
-
- // If we have hours enabled we must make sure that each day has enough
- // space to fit the number of hours to be displayed.
- if( $this->scale->IsDisplayHour() ) {
- // Depending on what format the user has choose we need different amount
- // of space. We therefore create a typical string for the choosen format
- // and determine the length of that string.
- switch( $this->scale->hour->iStyle ) {
- case HOURSTYLE_HMAMPM:
- $txt = '12:00pm';
- break;
- case HOURSTYLE_H24:
- // 13
- $txt = '24';
- break;
- case HOURSTYLE_HAMPM:
- $txt = '12pm';
- break;
- case HOURSTYLE_CUSTOM:
- $txt = date($this->scale->hour->iLabelFormStr,strtotime('2003-12-20 18:00'));
- break;
- case HOURSTYLE_HM24:
- default:
- $txt = '24:00';
- break;
- }
-
- $hfw = $this->scale->hour->GetStrWidth($this->img,$txt)+6;
- $mw = $hfw;
- if( $this->scale->IsDisplayMinute() ) {
- // Depending on what format the user has choose we need different amount
- // of space. We therefore create a typical string for the choosen format
- // and determine the length of that string.
- switch( $this->scale->minute->iStyle ) {
- case HOURSTYLE_CUSTOM:
- $txt2 = date($this->scale->minute->iLabelFormStr,strtotime('2005-05-15 18:55'));
- break;
- case MINUTESTYLE_MM:
- default:
- $txt2 = '15';
- break;
- }
-
- $mfw = $this->scale->minute->GetStrWidth($this->img,$txt2)+6;
- $n2 = ceil(60 / $this->scale->minute->GetIntervall() );
- $mw = $n2 * $mfw;
- }
- $hfw = $hfw < $mw ? $mw : $hfw ;
- $n = ceil(24*60 / $this->scale->TimeToMinutes($this->scale->hour->GetIntervall()) );
- $hw = $n * $hfw;
- $fw = $fw < $hw ? $hw : $fw ;
- }
-
- // We need to repeat this code block here as well.
- // THIS iS NOT A MISTAKE !
- // We really need it since we need to adjust for minutes both in the case
- // where hour scale is shown and when it is not shown.
-
- if( $this->scale->IsDisplayMinute() ) {
- // Depending on what format the user has choose we need different amount
- // of space. We therefore create a typical string for the choosen format
- // and determine the length of that string.
- switch( $this->scale->minute->iStyle ) {
- case HOURSTYLE_CUSTOM:
- $txt = date($this->scale->minute->iLabelFormStr,strtotime('2005-05-15 18:55'));
- break;
- case MINUTESTYLE_MM:
- default:
- $txt = '15';
- break;
- }
-
- $mfw = $this->scale->minute->GetStrWidth($this->img,$txt)+6;
- $n = ceil(60 / $this->scale->TimeToMinutes($this->scale->minute->GetIntervall()) );
- $mw = $n * $mfw;
- $fw = $fw < $mw ? $mw : $fw ;
- }
-
- // If we display week we must make sure that 7*$fw is enough
- // to fit up to 10 characters of the week font (if the week is enabled)
- if( $this->scale->IsDisplayWeek() ) {
- // Depending on what format the user has choose we need different amount
- // of space
- $fsw = strlen($this->scale->week->iLabelFormStr);
- if( $this->scale->week->iStyle==WEEKSTYLE_FIRSTDAY2WNBR ) {
- $fsw += 8;
- }
- elseif( $this->scale->week->iStyle==WEEKSTYLE_FIRSTDAYWNBR ) {
- $fsw += 7;
- }
- else {
- $fsw += 4;
- }
-
- $ww = $fsw*$this->scale->week->GetFontWidth($this->img);
- if( 7*$fw < $ww ) {
- $fw = ceil($ww/7);
- }
- }
-
- if( !$this->scale->IsDisplayDay() && !$this->scale->IsDisplayHour() &&
- !( ($this->scale->week->iStyle==WEEKSTYLE_FIRSTDAYWNBR ||
- $this->scale->week->iStyle==WEEKSTYLE_FIRSTDAY2WNBR) && $this->scale->IsDisplayWeek() ) ) {
- // If we don't display the individual days we can shrink the
- // scale a little bit. This is a little bit pragmatic at the
- // moment and should be re-written to take into account
- // a) What scales exactly are shown and
- // b) what format do they use so we know how wide we need to
- // make each scale text space at minimum.
- $fw /= 2;
- if( !$this->scale->IsDisplayWeek() ) {
- $fw /= 1.8;
- }
- }
-
- $cw = $this->GetMaxActInfoColWidth() ;
- $this->scale->actinfo->SetMinColWidth($cw);
- if( $this->img->width <= 0 ) {
- // Now determine the width for the activity titles column
-
- // Firdst find out the maximum width of each object column
- $titlewidth = max(max($this->GetMaxLabelWidth(),
- $this->scale->tableTitle->GetWidth($this->img)),
- $this->scale->actinfo->GetWidth($this->img));
-
- // Add the width of the vertivcal divider line
- $titlewidth += $this->scale->divider->iWeight*2;
-
-
- // Now get the total width taking
- // titlewidth, left and rigt margin, dayfont size
- // into account
- $width = $titlewidth + $nd*$fw + $lm+$rm;
- }
- else {
- $width = $this->img->width;
- }
-
- $width = round($width);
- $height = round($height);
- if( $width > MAX_GANTTIMG_SIZE_W || $height > MAX_GANTTIMG_SIZE_H ) {
- JpgraphError::RaiseL(6007,$width,$height);
-//("Sanity check for automatic Gantt chart size failed. Either the width (=$width) or height (=$height) is larger than MAX_GANTTIMG_SIZE. This could potentially be caused by a wrong date in one of the activities.");
- }
-
- $this->img->CreateImgCanvas($width,$height);
- $this->img->SetMargin($lm,$rm,$tm,$bm);
- }
+ break;
+ case DAYSTYLE_SHORTDATE2 :
+ $txt = "23 Jun";
+ break;
+ case DAYSTYLE_SHORTDATE3 :
+ $txt = "Mon 23";
+ break;
+ case DAYSTYLE_SHORTDATE4 :
+ $txt = "88";
+ break;
+ case DAYSTYLE_CUSTOM :
+ $txt = date($this->scale->day->iLabelFormStr,strtotime('2003-12-20 18:00'));
+ break;
+ case DAYSTYLE_ONELETTER :
+ default:
+ $txt = "M";
+ break;
+ }
+ $fw = $this->scale->day->GetStrWidth($this->img,$txt)+6;
+ }
+
+ // If we have hours enabled we must make sure that each day has enough
+ // space to fit the number of hours to be displayed.
+ if( $this->scale->IsDisplayHour() ) {
+ // Depending on what format the user has choose we need different amount
+ // of space. We therefore create a typical string for the choosen format
+ // and determine the length of that string.
+ switch( $this->scale->hour->iStyle ) {
+ case HOURSTYLE_HMAMPM:
+ $txt = '12:00pm';
+ break;
+ case HOURSTYLE_H24:
+ // 13
+ $txt = '24';
+ break;
+ case HOURSTYLE_HAMPM:
+ $txt = '12pm';
+ break;
+ case HOURSTYLE_CUSTOM:
+ $txt = date($this->scale->hour->iLabelFormStr,strtotime('2003-12-20 18:00'));
+ break;
+ case HOURSTYLE_HM24:
+ default:
+ $txt = '24:00';
+ break;
+ }
+
+ $hfw = $this->scale->hour->GetStrWidth($this->img,$txt)+6;
+ $mw = $hfw;
+ if( $this->scale->IsDisplayMinute() ) {
+ // Depending on what format the user has choose we need different amount
+ // of space. We therefore create a typical string for the choosen format
+ // and determine the length of that string.
+ switch( $this->scale->minute->iStyle ) {
+ case HOURSTYLE_CUSTOM:
+ $txt2 = date($this->scale->minute->iLabelFormStr,strtotime('2005-05-15 18:55'));
+ break;
+ case MINUTESTYLE_MM:
+ default:
+ $txt2 = '15';
+ break;
+ }
+
+ $mfw = $this->scale->minute->GetStrWidth($this->img,$txt2)+6;
+ $n2 = ceil(60 / $this->scale->minute->GetIntervall() );
+ $mw = $n2 * $mfw;
+ }
+ $hfw = $hfw < $mw ? $mw : $hfw ;
+ $n = ceil(24*60 / $this->scale->TimeToMinutes($this->scale->hour->GetIntervall()) );
+ $hw = $n * $hfw;
+ $fw = $fw < $hw ? $hw : $fw ;
+ }
+
+ // We need to repeat this code block here as well.
+ // THIS iS NOT A MISTAKE !
+ // We really need it since we need to adjust for minutes both in the case
+ // where hour scale is shown and when it is not shown.
+
+ if( $this->scale->IsDisplayMinute() ) {
+ // Depending on what format the user has choose we need different amount
+ // of space. We therefore create a typical string for the choosen format
+ // and determine the length of that string.
+ switch( $this->scale->minute->iStyle ) {
+ case HOURSTYLE_CUSTOM:
+ $txt = date($this->scale->minute->iLabelFormStr,strtotime('2005-05-15 18:55'));
+ break;
+ case MINUTESTYLE_MM:
+ default:
+ $txt = '15';
+ break;
+ }
+
+ $mfw = $this->scale->minute->GetStrWidth($this->img,$txt)+6;
+ $n = ceil(60 / $this->scale->TimeToMinutes($this->scale->minute->GetIntervall()) );
+ $mw = $n * $mfw;
+ $fw = $fw < $mw ? $mw : $fw ;
+ }
+
+ // If we display week we must make sure that 7*$fw is enough
+ // to fit up to 10 characters of the week font (if the week is enabled)
+ if( $this->scale->IsDisplayWeek() ) {
+ // Depending on what format the user has choose we need different amount
+ // of space
+ $fsw = strlen($this->scale->week->iLabelFormStr);
+ if( $this->scale->week->iStyle==WEEKSTYLE_FIRSTDAY2WNBR ) {
+ $fsw += 8;
+ }
+ elseif( $this->scale->week->iStyle==WEEKSTYLE_FIRSTDAYWNBR ) {
+ $fsw += 7;
+ }
+ else {
+ $fsw += 4;
+ }
+
+ $ww = $fsw*$this->scale->week->GetFontWidth($this->img);
+ if( 7*$fw < $ww ) {
+ $fw = ceil($ww/7);
+ }
+ }
+
+ if( !$this->scale->IsDisplayDay() && !$this->scale->IsDisplayHour() &&
+ !( ($this->scale->week->iStyle==WEEKSTYLE_FIRSTDAYWNBR ||
+ $this->scale->week->iStyle==WEEKSTYLE_FIRSTDAY2WNBR) && $this->scale->IsDisplayWeek() ) ) {
+ // If we don't display the individual days we can shrink the
+ // scale a little bit. This is a little bit pragmatic at the
+ // moment and should be re-written to take into account
+ // a) What scales exactly are shown and
+ // b) what format do they use so we know how wide we need to
+ // make each scale text space at minimum.
+ $fw /= 2;
+ if( !$this->scale->IsDisplayWeek() ) {
+ $fw /= 1.8;
+ }
+ }
+
+ $cw = $this->GetMaxActInfoColWidth() ;
+ $this->scale->actinfo->SetMinColWidth($cw);
+ if( $this->img->width <= 0 ) {
+ // Now determine the width for the activity titles column
+
+ // Firdst find out the maximum width of each object column
+ $titlewidth = max(max($this->GetMaxLabelWidth(),
+ $this->scale->tableTitle->GetWidth($this->img)),
+ $this->scale->actinfo->GetWidth($this->img));
+
+ // Add the width of the vertivcal divider line
+ $titlewidth += $this->scale->divider->iWeight*2;
+
+ // Adjust the width by the user specified zoom factor
+ $fw *= $this->iZoomFactor;
+
+ // Now get the total width taking
+ // titlewidth, left and rigt margin, dayfont size
+ // into account
+ $width = $titlewidth + $nd*$fw + $lm+$rm;
+ }
+ else {
+ $width = $this->img->width;
+ }
+
+ $width = round($width);
+ $height = round($height);
+ // Make a sanity check on image size
+ if( $width > MAX_GANTTIMG_SIZE_W || $height > MAX_GANTTIMG_SIZE_H ) {
+ JpgraphError::RaiseL(6007,$width,$height);
+ //("Sanity check for automatic Gantt chart size failed. Either the width (=$width) or height (=$height) is larger than MAX_GANTTIMG_SIZE. This could potentially be caused by a wrong date in one of the activities.");
+ }
+ $this->img->CreateImgCanvas($width,$height);
+ $this->img->SetMargin($lm,$rm,$tm,$bm);
+ }
}
// Return an array width the maximum width for each activity
@@ -886,224 +929,228 @@
// to find out the maximum width of each column. In order to do that we
// must walk through all the objects, sigh...
function GetMaxActInfoColWidth() {
- $n = count($this->iObj);
- if( $n == 0 ) return;
- $w = array();
- $m = $this->scale->actinfo->iLeftColMargin + $this->scale->actinfo->iRightColMargin;
-
- for( $i=0; $i < $n; ++$i ) {
- $tmp = $this->iObj[$i]->title->GetColWidth($this->img,$m);
- $nn = count($tmp);
- for( $j=0; $j < $nn; ++$j ) {
- if( empty($w[$j]) )
- $w[$j] = $tmp[$j];
- else
- $w[$j] = max($w[$j],$tmp[$j]);
- }
- }
- return $w;
+ $n = count($this->iObj);
+ if( $n == 0 ) return;
+ $w = array();
+ $m = $this->scale->actinfo->iLeftColMargin + $this->scale->actinfo->iRightColMargin;
+
+ for( $i=0; $i < $n; ++$i ) {
+ $tmp = $this->iObj[$i]->title->GetColWidth($this->img,$m);
+ $nn = count($tmp);
+ for( $j=0; $j < $nn; ++$j ) {
+ if( empty($w[$j]) )
+ $w[$j] = $tmp[$j];
+ else
+ $w[$j] = max($w[$j],$tmp[$j]);
+ }
+ }
+ return $w;
}
// Stroke the gantt chart
- function Stroke($aStrokeFileName="") {
-
-
- // If the filename is the predefined value = '_csim_special_'
- // we assume that the call to stroke only needs to do enough
- // to correctly generate the CSIM maps.
- // We use this variable to skip things we don't strictly need
- // to do to generate the image map to improve performance
- // a best we can. Therefor you will see a lot of tests !$_csim in the
- // code below.
- $_csim = ($aStrokeFileName===_CSIM_SPECIALFILE);
-
- // Should we autoscale dates?
- if( !$this->scale->IsRangeSet() ) {
- list($min,$max) = $this->GetBarMinMax();
- $this->scale->SetRange($min,$max);
- }
-
- $this->scale->AdjustStartEndDay();
-
- // Check if we should autoscale the image
- $this->AutoSize();
-
- // Should we start from the top or just spread the bars out even over the
- // available height
- $this->scale->SetVertLayout($this->iLayout);
- if( $this->iLayout == GANTT_FROMTOP ) {
- $maxheight=max($this->GetMaxLabelHeight(),$this->GetMaxBarAbsHeight());
- $this->scale->SetVertSpacing($maxheight*(1+$this->iLabelVMarginFactor));
- }
- // If it hasn't been set find out the maximum line number
- if( $this->scale->iVertLines == -1 )
- $this->scale->iVertLines = $this->GetBarMaxLineNumber()+1;
-
- $maxwidth=max($this->scale->actinfo->GetWidth($this->img),
- max($this->GetMaxLabelWidth(),
- $this->scale->tableTitle->GetWidth($this->img)));
-
- $this->scale->SetLabelWidth($maxwidth+$this->scale->divider->iWeight);//*(1+$this->iLabelHMarginFactor));
-
- if( !$_csim ) {
- $this->StrokePlotArea();
- if( $this->iIconDepth == DEPTH_BACK ) {
- $this->StrokeIcons();
- }
- }
-
- $this->scale->Stroke();
-
- if( !$_csim ) {
- // Due to a minor off by 1 bug we need to temporarily adjust the margin
- $this->img->right_margin--;
- $this->StrokePlotBox();
- $this->img->right_margin++;
- }
-
- // Stroke Grid line
- $this->hgrid->Stroke($this->img,$this->scale);
-
- $n = count($this->iObj);
- for($i=0; $i < $n; ++$i) {
- //$this->iObj[$i]->SetLabelLeftMargin(round($maxwidth*$this->iLabelHMarginFactor/2));
- $this->iObj[$i]->Stroke($this->img,$this->scale);
- }
+ function Stroke($aStrokeFileName="") {
- $this->StrokeTitles();
-
- if( !$_csim ) {
- $this->StrokeConstrains();
- $this->footer->Stroke($this->img);
-
- if( $this->iIconDepth == DEPTH_FRONT) {
- $this->StrokeIcons();
- }
-
- // Should we do any final image transformation
- if( $this->iImgTrans ) {
- if( !class_exists('ImgTrans') ) {
- require_once('jpgraph_imgtrans.php');
- }
-
- $tform = new ImgTrans($this->img->img);
- $this->img->img = $tform->Skew3D($this->iImgTransHorizon,$this->iImgTransSkewDist,
- $this->iImgTransDirection,$this->iImgTransHighQ,
- $this->iImgTransMinSize,$this->iImgTransFillColor,
- $this->iImgTransBorder);
- }
-
-
- // If the filename is given as the special "__handle"
- // then the image handler is returned and the image is NOT
- // streamed back
- if( $aStrokeFileName == _IMG_HANDLER ) {
- return $this->img->img;
- }
- else {
- // Finally stream the generated picture
- $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,
- $aStrokeFileName);
- }
- }
+ // If the filename is the predefined value = '_csim_special_'
+ // we assume that the call to stroke only needs to do enough
+ // to correctly generate the CSIM maps.
+ // We use this variable to skip things we don't strictly need
+ // to do to generate the image map to improve performance
+ // a best we can. Therefor you will see a lot of tests !$_csim in the
+ // code below.
+ $_csim = ($aStrokeFileName===_CSIM_SPECIALFILE);
+
+ // Should we autoscale dates?
+
+ if( !$this->scale->IsRangeSet() ) {
+ list($min,$max) = $this->GetBarMinMax();
+ $this->scale->SetRange($min,$max);
+ }
+
+ $this->scale->AdjustStartEndDay();
+
+ // Check if we should autoscale the image
+ $this->AutoSize();
+
+ // Should we start from the top or just spread the bars out even over the
+ // available height
+ $this->scale->SetVertLayout($this->iLayout);
+ if( $this->iLayout == GANTT_FROMTOP ) {
+ $maxheight=max($this->GetMaxLabelHeight(),$this->GetMaxBarAbsHeight());
+ $this->scale->SetVertSpacing($maxheight*(1+$this->iLabelVMarginFactor));
+ }
+ // If it hasn't been set find out the maximum line number
+ if( $this->scale->iVertLines == -1 )
+ $this->scale->iVertLines = $this->GetBarMaxLineNumber()+1;
+
+ $maxwidth=max($this->scale->actinfo->GetWidth($this->img),
+ max($this->GetMaxLabelWidth(),
+ $this->scale->tableTitle->GetWidth($this->img)));
+
+ $this->scale->SetLabelWidth($maxwidth+$this->scale->divider->iWeight);//*(1+$this->iLabelHMarginFactor));
+
+ if( !$_csim ) {
+ $this->StrokePlotArea();
+ if( $this->iIconDepth == DEPTH_BACK ) {
+ $this->StrokeIcons();
+ }
+ }
+
+ $this->scale->Stroke();
+
+ if( !$_csim ) {
+ // Due to a minor off by 1 bug we need to temporarily adjust the margin
+ $this->img->right_margin--;
+ $this->StrokePlotBox();
+ $this->img->right_margin++;
+ }
+
+ // Stroke Grid line
+ $this->hgrid->Stroke($this->img,$this->scale);
+
+ $n = count($this->iObj);
+ for($i=0; $i < $n; ++$i) {
+ //$this->iObj[$i]->SetLabelLeftMargin(round($maxwidth*$this->iLabelHMarginFactor/2));
+ $this->iObj[$i]->Stroke($this->img,$this->scale);
+ }
+
+ $this->StrokeTitles();
+
+ if( !$_csim ) {
+ $this->StrokeConstrains();
+ $this->footer->Stroke($this->img);
+
+
+ if( $this->iIconDepth == DEPTH_FRONT) {
+ $this->StrokeIcons();
+ }
+
+ // Stroke all added user texts
+ $this->StrokeTexts();
+
+ // Should we do any final image transformation
+ if( $this->iImgTrans ) {
+ if( !class_exists('ImgTrans',false) ) {
+ require_once('jpgraph_imgtrans.php');
+ }
+
+ $tform = new ImgTrans($this->img->img);
+ $this->img->img = $tform->Skew3D($this->iImgTransHorizon,$this->iImgTransSkewDist,
+ $this->iImgTransDirection,$this->iImgTransHighQ,
+ $this->iImgTransMinSize,$this->iImgTransFillColor,
+ $this->iImgTransBorder);
+ }
+
+
+ // If the filename is given as the special "__handle"
+ // then the image handler is returned and the image is NOT
+ // streamed back
+ if( $aStrokeFileName == _IMG_HANDLER ) {
+ return $this->img->img;
+ }
+ else {
+ // Finally stream the generated picture
+ $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,
+ $aStrokeFileName);
+ }
+ }
}
function StrokeConstrains() {
- $n = count($this->iObj);
+ $n = count($this->iObj);
- // Stroke all constrains
- for($i=0; $i < $n; ++$i) {
+ // Stroke all constrains
+ for($i=0; $i < $n; ++$i) {
- // Some gantt objects may not have constraints associated with them
- // for example we can add IconPlots which doesn't have this property.
- if( empty($this->iObj[$i]->constraints) ) continue;
-
- $numConstrains = count($this->iObj[$i]->constraints);
-
- for( $k = 0; $k < $numConstrains; $k++ ) {
- $vpos = $this->iObj[$i]->constraints[$k]->iConstrainRow;
- if( $vpos >= 0 ) {
- $c1 = $this->iObj[$i]->iConstrainPos;
-
- // Find out which object is on the target row
- $targetobj = -1;
- for( $j=0; $j < $n && $targetobj == -1; ++$j ) {
- if( $this->iObj[$j]->iVPos == $vpos ) {
- $targetobj = $j;
- }
- }
- if( $targetobj == -1 ) {
- JpGraphError::RaiseL(6008,$this->iObj[$i]->iVPos,$vpos);
-//('You have specifed a constrain from row='.$this->iObj[$i]->iVPos.' to row='.$vpos.' which does not have any activity.');
- }
- $c2 = $this->iObj[$targetobj]->iConstrainPos;
- if( count($c1) == 4 && count($c2 ) == 4) {
- switch( $this->iObj[$i]->constraints[$k]->iConstrainType ) {
- case CONSTRAIN_ENDSTART:
- if( $c1[1] < $c2[1] ) {
- $link = new GanttLink($c1[2],$c1[3],$c2[0],$c2[1]);
- }
- else {
- $link = new GanttLink($c1[2],$c1[1],$c2[0],$c2[3]);
- }
- $link->SetPath(3);
- break;
- case CONSTRAIN_STARTEND:
- if( $c1[1] < $c2[1] ) {
- $link = new GanttLink($c1[0],$c1[3],$c2[2],$c2[1]);
- }
- else {
- $link = new GanttLink($c1[0],$c1[1],$c2[2],$c2[3]);
- }
- $link->SetPath(0);
- break;
- case CONSTRAIN_ENDEND:
- if( $c1[1] < $c2[1] ) {
- $link = new GanttLink($c1[2],$c1[3],$c2[2],$c2[1]);
- }
- else {
- $link = new GanttLink($c1[2],$c1[1],$c2[2],$c2[3]);
- }
- $link->SetPath(1);
- break;
- case CONSTRAIN_STARTSTART:
- if( $c1[1] < $c2[1] ) {
- $link = new GanttLink($c1[0],$c1[3],$c2[0],$c2[1]);
- }
- else {
- $link = new GanttLink($c1[0],$c1[1],$c2[0],$c2[3]);
- }
- $link->SetPath(3);
- break;
- default:
- JpGraphError::RaiseL(6009,$this->iObj[$i]->iVPos,$vpos);
-//('Unknown constrain type specified from row='.$this->iObj[$i]->iVPos.' to row='.$vpos);
- break;
- }
-
- $link->SetColor($this->iObj[$i]->constraints[$k]->iConstrainColor);
- $link->SetArrow($this->iObj[$i]->constraints[$k]->iConstrainArrowSize,
- $this->iObj[$i]->constraints[$k]->iConstrainArrowType);
-
- $link->Stroke($this->img);
- }
- }
- }
- }
+ // Some gantt objects may not have constraints associated with them
+ // for example we can add IconPlots which doesn't have this property.
+ if( empty($this->iObj[$i]->constraints) ) continue;
+
+ $numConstrains = count($this->iObj[$i]->constraints);
+
+ for( $k = 0; $k < $numConstrains; $k++ ) {
+ $vpos = $this->iObj[$i]->constraints[$k]->iConstrainRow;
+ if( $vpos >= 0 ) {
+ $c1 = $this->iObj[$i]->iConstrainPos;
+
+ // Find out which object is on the target row
+ $targetobj = -1;
+ for( $j=0; $j < $n && $targetobj == -1; ++$j ) {
+ if( $this->iObj[$j]->iVPos == $vpos ) {
+ $targetobj = $j;
+ }
+ }
+ if( $targetobj == -1 ) {
+ JpGraphError::RaiseL(6008,$this->iObj[$i]->iVPos,$vpos);
+ //('You have specifed a constrain from row='.$this->iObj[$i]->iVPos.' to row='.$vpos.' which does not have any activity.');
+ }
+ $c2 = $this->iObj[$targetobj]->iConstrainPos;
+ if( count($c1) == 4 && count($c2 ) == 4) {
+ switch( $this->iObj[$i]->constraints[$k]->iConstrainType ) {
+ case CONSTRAIN_ENDSTART:
+ if( $c1[1] < $c2[1] ) {
+ $link = new GanttLink($c1[2],$c1[3],$c2[0],$c2[1]);
+ }
+ else {
+ $link = new GanttLink($c1[2],$c1[1],$c2[0],$c2[3]);
+ }
+ $link->SetPath(3);
+ break;
+ case CONSTRAIN_STARTEND:
+ if( $c1[1] < $c2[1] ) {
+ $link = new GanttLink($c1[0],$c1[3],$c2[2],$c2[1]);
+ }
+ else {
+ $link = new GanttLink($c1[0],$c1[1],$c2[2],$c2[3]);
+ }
+ $link->SetPath(0);
+ break;
+ case CONSTRAIN_ENDEND:
+ if( $c1[1] < $c2[1] ) {
+ $link = new GanttLink($c1[2],$c1[3],$c2[2],$c2[1]);
+ }
+ else {
+ $link = new GanttLink($c1[2],$c1[1],$c2[2],$c2[3]);
+ }
+ $link->SetPath(1);
+ break;
+ case CONSTRAIN_STARTSTART:
+ if( $c1[1] < $c2[1] ) {
+ $link = new GanttLink($c1[0],$c1[3],$c2[0],$c2[1]);
+ }
+ else {
+ $link = new GanttLink($c1[0],$c1[1],$c2[0],$c2[3]);
+ }
+ $link->SetPath(3);
+ break;
+ default:
+ JpGraphError::RaiseL(6009,$this->iObj[$i]->iVPos,$vpos);
+ //('Unknown constrain type specified from row='.$this->iObj[$i]->iVPos.' to row='.$vpos);
+ break;
+ }
+
+ $link->SetColor($this->iObj[$i]->constraints[$k]->iConstrainColor);
+ $link->SetArrow($this->iObj[$i]->constraints[$k]->iConstrainArrowSize,
+ $this->iObj[$i]->constraints[$k]->iConstrainArrowType);
+
+ $link->Stroke($this->img);
+ }
+ }
+ }
+ }
}
function GetCSIMAreas() {
- if( !$this->iHasStroked )
- $this->Stroke(_CSIM_SPECIALFILE);
+ if( !$this->iHasStroked )
+ $this->Stroke(_CSIM_SPECIALFILE);
- $csim = $this->title->GetCSIMAreas();
- $csim .= $this->subtitle->GetCSIMAreas();
- $csim .= $this->subsubtitle->GetCSIMAreas();
-
- $n = count($this->iObj);
- for( $i=$n-1; $i >= 0; --$i )
- $csim .= $this->iObj[$i]->GetCSIMArea();
- return $csim;
+ $csim = $this->title->GetCSIMAreas();
+ $csim .= $this->subtitle->GetCSIMAreas();
+ $csim .= $this->subsubtitle->GetCSIMAreas();
+
+ $n = count($this->iObj);
+ for( $i=$n-1; $i >= 0; --$i )
+ $csim .= $this->iObj[$i]->GetCSIMArea();
+ return $csim;
}
}
@@ -1111,314 +1158,313 @@
// CLASS PredefIcons
// Description: Predefined icons for use with Gantt charts
//===================================================
-DEFINE('GICON_WARNINGRED',0);
-DEFINE('GICON_TEXT',1);
-DEFINE('GICON_ENDCONS',2);
-DEFINE('GICON_MAIL',3);
-DEFINE('GICON_STARTCONS',4);
-DEFINE('GICON_CALC',5);
-DEFINE('GICON_MAGNIFIER',6);
-DEFINE('GICON_LOCK',7);
-DEFINE('GICON_STOP',8);
-DEFINE('GICON_WARNINGYELLOW',9);
-DEFINE('GICON_FOLDEROPEN',10);
-DEFINE('GICON_FOLDER',11);
-DEFINE('GICON_TEXTIMPORTANT',12);
+define('GICON_WARNINGRED',0);
+define('GICON_TEXT',1);
+define('GICON_ENDCONS',2);
+define('GICON_MAIL',3);
+define('GICON_STARTCONS',4);
+define('GICON_CALC',5);
+define('GICON_MAGNIFIER',6);
+define('GICON_LOCK',7);
+define('GICON_STOP',8);
+define('GICON_WARNINGYELLOW',9);
+define('GICON_FOLDEROPEN',10);
+define('GICON_FOLDER',11);
+define('GICON_TEXTIMPORTANT',12);
class PredefIcons {
- var $iBuiltinIcon = null;
- var $iLen = -1 ;
+ private $iBuiltinIcon = null, $iLen = -1 ;
function GetLen() {
- return $this->iLen ;
+ return $this->iLen ;
}
function GetImg($aIdx) {
- if( $aIdx < 0 || $aIdx >= $this->iLen ) {
- JpGraphError::RaiseL(6010,$aIdx);
-//('Illegal icon index for Gantt builtin icon ['.$aIdx.']');
- }
- return Image::CreateFromString(base64_decode($this->iBuiltinIcon[$aIdx][1]));
- }
-
- function PredefIcons() {
- //==========================================================
- // warning.png
- //==========================================================
- $this->iBuiltinIcon[0][0]= 1043 ;
- $this->iBuiltinIcon[0][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAABmJLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsSAAALEgHS3X78AAAA'.
- 'B3RJTUUH0wgKFSgilWPhUQAAA6BJREFUeNrtl91rHFUYh5/3zMx+Z5JNUoOamCZNaqTZ6IWIkqRiQWmi1IDetHfeiCiltgXBP8AL'.
- '0SIUxf/AvfRSBS9EKILFFqyIH9CEmFZtPqrBJLs7c+b1YneT3WTTbNsUFPLCcAbmzPt73o9zzgzs2Z793231UOdv3w9k9Z2uzOdA'.
- '5+2+79yNeL7Hl7hw7oeixRMZ6PJM26W18DNAm/Vh7lR8fqh97NmMF11es1iFpMATqdirwMNA/J4DpIzkr5YsAF1PO6gIMYHRdPwl'.
- 'oO2elmB+qH3sm7XozbkgYvy8SzYnZPtcblyM6I+5z3jQ+0vJfgpEu56BfI9vUkbyi2HZd1QJoeWRiAjBd4SDCW8SSAOy6wBHMzF7'.
- 'YdV2A+ROuvRPLfHoiSU0EMY/cDAIhxJeGngKaN1VgHyPL7NBxI1K9P4QxBzw3K1zJ/zkG8B9uwaQ7/HNsRZv9kohBGD0o7JqMYS/'.
- '/ynPidQw/LrBiPBcS/yFCT95DvB2BWAy4575PaQbQKW+tPd3GCItu2odKI++YxiKu0d26oWmAD7paZU/rLz37VqIijD2YbnzNBBE'.
- 'IBHf8K8qjL7vYhCGErEU8CTg3xXAeMp96GrJEqkyXkm9Bhui1xfsunjdGhcYLq+IzjsGmBt5YH/cmJkFq6gIqlon3u4LxdKGuCIo'.
- 'Qu41g0E41po+2R33Xt5uz9kRIB2UTle7PnfKrROP1HD4sRjZlq0lzhwoZ6rDNeTi3nEg1si/7FT7kYQbXS6E5E65tA5uRF9tutq0'.
- 'K/VwAF+/FbIYWt6+tjQM/AqUms7A4Wy6d7YSfSNxgMmzi0ycWWworio4QJvj4LpuL5BqugTnXzzqJsJwurrlNhJXFaavW67NRw3F'.
- 'q+aJcCQVe9fzvJGmAY7/dPH0gi0f64OveGxa+usCuQMeZ0+kt8BVrX+qPO9Bzx0MgqBvs+a2PfDdYIf+WAjXU1ub4tqNaPPzRs8A'.
- 'blrli+WVn79cXn0cWKl+tGx7HLc7pu3CSmnfitL+l1UihAhwjFkPQev4K/fSABjBM8JCaFuurJU+rgW41SroA8aNMVNAFtgHJCsn'.
- 'XGy/58QVxAC9MccJtZ5kIzNlW440WrJ2ea4YPA9cAooA7i0A/gS+iqLoOpB1HOegqrYB3UBmJrAtQAJwpwPr1Ry92wVlgZsiYlW1'.
- 'uX1gU36dymgqYxJIJJNJT1W9QqHgNwFQBGYqo94OwHZQUuPD7ACglSvc+5n5T9m/wfJJX4U9qzEAAAAASUVORK5CYII=' ;
-
- //==========================================================
- // edit.png
- //==========================================================
- $this->iBuiltinIcon[1][0]= 959 ;
- $this->iBuiltinIcon[1][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAFgAWABY9j+ZuwAAAAlwSFlz'.
- 'AAALEAAACxABrSO9dQAAAAd0SU1FB9AKDAwbIEXOA6AAAAM8SURBVHicpdRPaBxlHMbx76ZvsmOTmm1dsEqQSIIsEmGVBAQjivEQ'.
- 'PAUJngpWsAWlBw8egpQepKwplN4ULEG9CjkEyUFKlSJrWTG0IU51pCsdYW2ncUPjdtp9Z+f3vuNhu8nKbmhaf5cZeGc+PO8zf1Lc'.
- 'm0KhkACICCKCMeaBjiLC0tLSnjNvPmuOHRpH0TZTU1M8zBi9wakzn7OFTs5sw8YYACYmJrre7HkeuVyu69qPF77hlT1XmZ0eQ03O'.
- 'wOLJTvhBx1rLz18VmJ0eY+jVd2FxDkKXnvYLHgb97OgLzE4ON9Hzc1B1QaQzsed5O0Lta3Ec89OnR5h5McfQ+Mw2qgQUnfBOPbZ3'.
- 'bK3l+xOvMT0+3ERLp5FNF6UEjcL32+DdVmGt5WLhDYYPZrbRqreFumXwql0S3w9tnDvLWD5PZigPpdOwuYpSCo3C8wU3UHxQdHbf'.
- 'cZIkNM6dxcnlUM4k1eUFMlUPpUADbpkttFarHe6oYqeOr6yt4RzMQHYUcUsQVtGicHDwKprViuLDkkOtVnsHCHZVRVy/zcj1i5Af'.
- 'h8AjdIts+hUcGcYPK3iBtKM3gD/uAzf/AdY2mmmVgy6X8YNNKmGIvyloPcB8SUin07RQ4EZHFdsdG0wkJEnEaHAJxvKEpSLeaokV'.
- 'r4zWmhUZYLlY4b1D03y5eIEWCtS7vsciAgiIxkQRabWOrlQor66y4pUphoJb1jiO4uO5o0S3q6RSqVbiOmC7VCEgAhLSaDQ48dH7'.
- 'vD46REY0iysegSjKQciRt99ib7qXwX0O+pG4teM6YKHLB9JMq4mTmF9/+AKA4wvLZByH7OgYL7+UY2qvw/7Bfg5kHiXjJFyv3CGO'.
- 'Y1rof+BW4t/XLiPG0DCGr79d4XzRxRnIMn98huXSTYyJ6et1UNYQhRvcinpJq86H3wGPPPM0iBDd+QffD1g4eZjLvuG7S1Wef26E'.
- 'J7L7eSx7gAHVg7V3MSbi6m/r93baBd6qQjerAJg/9Ql/XrvG0ON1+vv7GH3qSfY5fahUnSTpwZgIEQesaVXRPbHRG/xyJSAxMYlp'.
- 'EOm71HUINiY7mGb95l/8jZCyQmJjMDGJjUmsdCROtZ0n/P/Z8v4Fs2MTUUf7vYoAAAAASUVORK5CYII=' ;
-
- //==========================================================
- // endconstrain.png
- //==========================================================
- $this->iBuiltinIcon[2][0]= 666 ;
- $this->iBuiltinIcon[2][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlz'.
- 'AAALDwAACw8BkvkDpQAAAAd0SU1FB9ALEREILkh0+eQAAAIXSURBVHictZU9aFNRFMd/N81HX77aptJUWmp1LHRpIcWhg5sIDlUQ'.
- 'LAXB4t7RRUpwEhy7iQ46CCIoSHcl0CFaoVARU2MFMYktadLXJNok7x2HtCExvuYFmnO4w/3gx+Gc/z1HKRTdMEdXqHbB/sgc/sic'.
- 'nDoYAI8XwDa8o1RMLT+2hAsigtTvbIGVqhX46szUifBGswUeCPgAGB7QeLk0X4Ork+HOxo1VgSqGASjMqkn8W4r4vVtEgI/RRQEL'.
- 'vaoGD85cl5V3nySR/S1mxWxab7f35PnntNyMJeRr9kCMqiHTy09EoeToLwggx6ymiMOD/VwcD7Oa/MHkcIiQx026WGYto5P/U+ZZ'.
- '7gD0QwDuT5z9N3LrVPi0Xs543eQPKkRzaS54eviJIp4tMFQFMllAWN2qcRZHBnixNM8NYD162xq8u7ePSQ+GX2Pjwxc2dB2cLtB8'.
- '7GgamCb0anBYBeChMtl8855CarclxU1gvViiUK4w2OMkNDnGeJ8bt9fH90yOnOkCwLFTwhzykhvtYzOWoBBbY//R3dbaNTYhf2RO'.
- 'QpeuUMzv188MlwuHy0H13HnE48UzMcL0WAtUHX8OxZHoG1URiFw7rnLLCswuSPD1ulze/iWjT2PSf+dBXRFtVVGIvzqph0pQL7VE'.
- 'avXYaXXxPwsnt0imdttCocMmZBdK7YU9D8wuNOW0nXc6QWzPsSa5naZ1beb9BbGB6dxGtMnXAAAAAElFTkSuQmCC' ;
-
- //==========================================================
- // mail.png
- //==========================================================
- $this->iBuiltinIcon[3][0]= 1122 ;
- $this->iBuiltinIcon[3][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlz'.
- 'AAALEAAACxABrSO9dQAAAAd0SU1FB9AJHAMfFvL9OU8AAAPfSURBVHictZRdaBRXFMd/987H7tbNx8aYtGCrEexDsOBDaKHFxirb'.
- 'h0qhsiY0ykppKq1osI99C4H2WSiFFMHWUhXBrjRi0uCmtSEUGgP1QWqhWjGkoW7M1kTX3WRn5p4+TJJNGolQ6IXDnDtz+N0z/3PP'.
- 'UWBIpdpYa23b9g09PZ2kUrOrvmUyGVKp1Ao/mUyi56YnVgWfO/P1CihAd/dJMpmaNROIRq8BkM1m0bH6TasC3j6QXgFdXI+DR6PR'.
- 'JX/Pno8B+KLnMKqlpUU8z8MYs2RBEDzWf9J+0RcRbMdxGBsbw/fmCXwPMUEYID4iAVp8wIRmDIHMo4yHSIBSASKC+CWE0C/PF9jU'.
- '3B6Cp+4M07C5FUtKGNvGwQJctPgIsgD2wRhEIqAMGB+UQYkHJgYYZD7P1HwVlmWhHcfhyk83KeRGUW4t6CgoG5SNUS4KBWgQDUov'.
- '7AGlwYASBVqH0Bk49dXpCviVV3dw/tI1Bvr7kMIIlh0NYUpjlF0BAYvcxSXmEVLKceHSCJm+PnbueBHbtkNwTXUNBzo6aGpq4sSZ'.
- 'GwT5H7BsF6Wdf1GWHQAoM0upeI9PT1yioS7B7tdaSdSuw7KsUGMAy7HYsmUztTW1nMwM0txssX1rlHjjS5jy/Uq2YkK/eJuLl6/z'.
- 'x+1xkslW6mrixGIODx8EFSlEBC0+tmXT0NhA2763iEUjnLv4C8XpUbSbAB1mKkGJ3J83Od77HW5EszvZSqK2iljMIeJaRGNuJePF'.
- '6mspY7BJ1DXwQnCd2fxGRq5OUCz8xt72dyhMZcn++Cu3xu9SKhdp2b4ZHWnAtTSxmIWlhcIjlksR3lNBYzlxZsb7+f7ne+xtSzOd'.
- 'u83szH1OnThOPp/n+a0beeP1l4mvq+PU2Qyd+5PY1RuwlAqLYFaBfbTbyPSdfgaH77A//QF4f1O/vpr6RJyq+C5Kc/M8FbFxXItY'.
- 'xOHDrvfo/fxLDnbsJBp5BowBReVWYAzabeTh5ABDw7cWoNNL3YYYNtSv57lnn6Z+Qx01VeuIuBa2DV1HD3H63BAPZu4u1WGpeLHq'.
- 'Rh7+NcjA0O+0p4+CNwXigwnbWlQQdpuEpli+n+PIkcOc//YKuckJJFh2K2anrjFw+QZt6S6kPImIF/b+cqAJD1LihWAxC61twBTo'.
- 'fPcQF/oGsVW5ovHQlavs2/8+uYnRVSOUgHAmmAClBIOBwKC0gPjhIRgEIX2wg7NnwpZW3d3d4vs+vu8TBMGK51rvPM9b8hdteZxd'.
- 'LBbVR8feJDs0Rlv6GFKeXJ21rNRXESxMPR+CBUl0nN7PjtO+dye7Up/8v1I88bf/ixT/AO1/hZsqW+C6AAAAAElFTkSuQmCC' ;
-
- //==========================================================
- // startconstrain.png
- //==========================================================
- $this->iBuiltinIcon[4][0]= 725 ;
- $this->iBuiltinIcon[4][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlz'.
- 'AAALDgAACw4BQL7hQQAAAAd0SU1FB9ALEREICJp5fBkAAAJSSURBVHic3dS9a1NRGMfx77kxtS+xqS9FG6p1ER3qVJpBQUUc3CRU'.
- 'BwURVLB1EAuKIP0THJQiiNRJBK3iJl18AyeltRZa0bbaJMbUNmlNSm5e7s25j0NqpSSmyag/OMM9POdzDuflwn8djz8gClVRrVEV'.
- 'ur4Bl1FTNSzLrSS6vbml0jUUwSXj8Qfk3PkLtLW2AeBIybmrgz3+gFzpucjlE4f4btuFTuWuCF5XDr3a3UPf6cM8GQvxzbsRAJdh'.
- 'ScfxSywml5j7mVypN0eGEJ0tebIre+zxB6Tv7jPReS2hREpOvpmUXU+H5eC913JnNCSRVE60pUVbWoZjprR39Yq70bdqj4pW7PEH'.
- '5FpvL9e79jOTTHM7ssDL6CJZ08LbvAGnrpZg2mI2Z/MlZfN8IkxuSwu4V9+WIrj7zFlOHfXzKrLIi2SGh5ECKjnNVNxkQEc55vOw'.
- 'rb6O8JLFdHyJ+ayFElUeHvjwkfteL/V7fKTSkFvIQE4DoLI2Mz/muTkTApcBKIwaN8pwIUrKw+ajWwDknAO0d/r4zFaMuRS63sWm'.
- 'RoOdm+vRIriUYjKexrQV+t1o0YEVwfZSVJmD/dIABJuO0LG3lRFx0GOfiAELE9OgCrfU0XnIp5FwGLEy5WEAOxlR5uN+ARhP7GN3'.
- '5w7Gv4bQI2+xpt4jjv2nWBmIlcExE2vDAHYioszBZXw6CPE4ADoWVHmd/tuwlZR9eXYyoszBfpiNQqaAOU5+TXRN+DeeenADPT9b'.
- 'EVgKVsutKPl0TGWGhwofoquaoKK4apsq/tH/e/kFwBMXLgAEKK4AAAAASUVORK5CYII=' ;
-
- //==========================================================
- // calc.png
- //==========================================================
- $this->iBuiltinIcon[5][0]= 589 ;
- $this->iBuiltinIcon[5][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAA4AIwBbgMF12wAAAAlwSFlz'.
- 'AAALEQAACxEBf2RfkQAAAAd0SU1FB9AHBxQeFsqn0wQAAAHKSURBVHicnZWff+RAGIef3U/gcOEgUAgUCgcLhYXCwsHBQeGgUDgs'.
- 'FgMHB4VA/4Bg4XChWFgIFIqBwkJhsRAYeOGF+TQHmWSTTbKd9pU37/x45jvfTDITXEynAbdWKVQB0NazcVm0alcL4rJaRVzm+w/e'.
- '3iwAkzbYRcnnYgI04GCvsxxSPabYaEdt2Ra6D0atcvvvDmyrMWBX1zPq2ircP/Tk98DiJtjV/fim6ziOCL6dDHZNhxQ3arIMsox4'.
- 'vejleL2Ay9+jaw6A+4OSICG2cacGKhsGxg+CxeqAQS0Y7BYJvowq7iGMOhXHEfzpvpQkA9bLKgOgWKt+4Lo1mM9hs9m17QNsJ70P'.
- 'Fjc/O52joogoX8MZKiBiAFxd9Z1vcj9wfSpUlDRNMcYQxzFpmnJ0FPH8nDe1MQaWSz9woQpWSZKEojDkeaWoKAyr1tlu+s48wfVx'.
- 'u7n5i7jthmGIiEGcT+36PP+gFeJrxWLhb0UA/lb4ggGs1T0rZs0zwM/ZjNfilcIY5tutPxgOW3F6dUX464LrKILLiw+A7WErrl+2'.
- 'rABG1EL/BilZP8DjU2uR4U+2E49P1Z8QJmNXUzl24A9GBT0IruCfi86d9x+D12RGzt+pNAAAAABJRU5ErkJggg==' ;
-
- //==========================================================
- // mag.png
- //==========================================================
- $this->iBuiltinIcon[6][0]= 1415 ;
- $this->iBuiltinIcon[6][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlz'.
- 'AAALDAAACwwBP0AiyAAAAAd0SU1FB9ALDxEWDY6Ul+UAAAUESURBVHicdZVrbFRFGIafsyyF0nalV1R6WiggaAptlzsr1OgEogmC'.
- '0IgoBAsBgkIrBAPEhBj/AP6xRTCUFEwRI4jcgsitXMrFCJptJWvBNpXYbbXtbtttt6e7e86ec/yxadlCfZPJZDIz73zzzjfvR2VL'.
- 'F7U+hf0HD2JduIzTFy6SlJRkPtkcDgdCCE65OxFC8NPV6wghyM7OptankJ2dzbSC5QghEEIgCSHog9PpNAF27dlN6miZuPgElB4/'.
- 'nmY3O7ZtByA1NVUCkGWZweD1eklJScESTbqxuIjrd+/x6uIl5M19hSy7nfGOeUxf+g7VjU1sKi7C4/GYsiyz7tAJAD4/cRaA1tZW'.
- 'AHIPnECUVGD1+/3U19ebG4uLeHf1akamjsIwoVnVCOvQEdLoVILYYmMo3PIxSBJflpSaDX5FAmju1QAYv/8k/s8+wLVxOU0jR2LZ'.
- '8sMFAApWrCApbRRDrRZirBYSLBKaoRPQw3SFernf2sav7T0Ubt4KwL4FMwF4Vu8FoHBCKgCzDhwHwLIhZ7y5a89u4m2JhA0wTdDC'.
- 'OrphEjJMNElCHxKDEjaobmvlfo/Krj27CQQCJsCGJW8C0KXqAMxMiosQA8hZWcTFx9OsaniDKh1qmG7VoFsL0x0K06kbeAMhWpRe'.
- '/KpG+gwHAKUnz7Dz3BUMw6DK18nuw99wt0Nh6VdHI8RJicmETQgFg7SFwjSrGv+oKp6ghldV6dZ0ugJBlF6FmCESQ2w2AIqXLsan'.
- 'BrFYLJTnTCBrdBqveeopWZiPFaBHUegJhegMqGgxEkHDwB/UaQ9rdIV06v0+TD2EEQjQFtAY0dsNgNvt5sialQAIIXh7wQKuVf6J'.
- 'gTsSccPDWlQstClBGjr9eHpVWvUQncEwdYEedF8noQ4vmYmpZMTH0nTvDn25vLbrNmu7bvfnsYEbAMnhcPDgwQPzUo2LJusw/mhp'.
- 'QwlHNO0KBAnoIfxtrcQMT2De1Mm891wyUzNlUlJSpIyMDBobGzlzr5rFM/Koq6vrP8ASGxsLwPmKcvIShjPGZiPOakE3VFB8hHwd'.
- 'vJAxhrk5L7Ly+RQuH/sWgPdXrwFg/6HDFBUsIj09nehfbAWwPWOT9n5RYhqGwarNWxkRM5TRCfF4U1PQsDDJFk9uYhwXvzvKjm3b'.
- 'KSsro3DJInNW5RXp7u2bAKSlpeH1esnPz6eqqgqLpmmcr3Fht9ulfaV7mZk1Bs+lM6T1djM9fhg5egDPpTNMy5TZsW07kydPYdWM'.
- 'aXx96ixOp9O8cfUa80srmDpjOgAulytiQqZpMnvObLbt/JTtHxXj9/tRVdU0DGOAufRpevPDTeac0hJyc3NxOOawfv161lVWS6eX'.
- 'z+9/UOCxu1VWVvaTRGv16NFfjB2bNeAQp9NpTpmSM4DcbrdL0WsGDKLRR+52uwe1yP8jb2lpYfikyY9t80n03UCWZeaXVjw1f+zs'.
- 'Oen+/d+pqanhzp2fKSsrw+l0mi6XiyPl5ZGITdN8fAVJwjRNJEmi1qfw1kw7siyTnJxMe3s71dXV3GpoZO64DG41NPJylvxU5D/e'.
- 'qJKsfWQD9IkaZ2RmUvr9aV4aGYcQgjfO3aWoYBF5eXm4ewIsu/CbdPz1aWb0/p1bNoOrQxlUiuiaFo3c3FyEEOx9+C9CCD6paaTW'.
- 'p/TXyYkTJ0Xe59jf7QOyAKDWp/QXxcFQ61P4pT3ShBBcvnUHIQTjxmX19/8BCeVg+/GPpskAAAAASUVORK5CYII=' ;
-
- //==========================================================
- // lock.png
- //==========================================================
- $this->iBuiltinIcon[7][0]= 963 ;
- $this->iBuiltinIcon[7][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAAAAAAAA+UO7fwAAAAlwSFlz'.
- 'AAALCwAACwsBbQSEtwAAAAd0SU1FB9AKAw0XDmwMOwIAAANASURBVHic7ZXfS1t3GMY/3+PprI7aisvo2YU6h6ATA8JW4rrlsF4U'.
- 'qiAsF9mhl0N2cYTRy9G/wptAYWPD9iJtRy5asDe7cYFmyjaXOLaMImOrmkRrjL9yTmIS3120JybWQgfb3R74wuc8Lzw858vLOUpE'.
- 'OK6pqSm2trbY39+nu7tbPHYch7m5OcLhMIA67kWj0aMQEWk6tm17rNm2LSIie3t7ksvlJJ1OSyqVkls3Z8SyLMnlcqTTaVKpFLdu'.
- 'zmBZVj1HeY2VUti2TSQSQSml2bZdi0QirK2tMT09zerqKtlslqGhISYnJ4nHv2N+foFsNquOe9FotLlxOBwmk8lgWRbhcFgymYxY'.
- 'liUi0mqaJoAuIi2macrdO7fFsizx3to0Te7euV1vrXtXEgqFmJmZYWVlhXK5LB4/U9kwDL784kYV0A3DYHd3m4sXRymXywKoRi8U'.
- 'Ch01DgQCJBIJLMsiEAhIIpHw2uLz+eqtYrEYIqKZpimxWEyCwaCMjY01zYPBIJpXqVQqsby8TLVabWKA/v5+RkZGMAyDrq4ulFKH'.
- 'HsfjcWZnZ+ns7KTRqwcnk0mKxSKFQqGJlVKtruuSTCYB6O3trW9UI/v9/iZPB/j8s2HOnX0FgHfeXpeffnzK+fWf+fijvhLs0PtG'.
- 'D/n1OJ9+MsrlSwb3733DwMCAt1EyPj6uACYmJp56168NU6nUqFSE9nZdPE7+WqC/r4NKTagcCJVqDaUUB5VDAA4Pa9x7sMLlSwan'.
- 'WjRmv13D7/erpaWlo604qOp88OF7LC48rPNosMq5Th+Dgxd4/XyA1rbzADi7j8jnf2P++wdcvSr8MJ/i8eomAKlUqn41OsDAQDeD'.
- 'g++yuPCwzm/2vU8+n2a7sMFfj79mp7BBuVzioFSiXHJx3SKuW2Rzy0Up9dxnQVvODALQerqNRn4ZKe0Mvtc6TpzpmqbxalcY9Ato'.
- '2v06t515C73YQftZB9GLnDrt4LoujuPgOA4Ui+C6yOpXJwZrJ7r/gv4P/u+D9W7fLxTz+1ScQxrZ3atRLaVxdjbY2d184R6/sLHe'.
- 'opHP7/Do90Ua+WWUyezzZHObP/7cfX54/dowE1d66s8TV3oE+Mfn+L/zb4XmHPjRG9YjAAAAAElFTkSuQmCC' ;
-
- //==========================================================
- // stop.png
- //==========================================================
- $this->iBuiltinIcon[8][0]= 889 ;
- $this->iBuiltinIcon[8][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAAAAAAAA+UO7fwAAAAlwSFlz'.
- 'AAALDwAACw8BkvkDpQAAAAd0SU1FB9AJDwEvNyD6M/0AAAL2SURBVHic1ZTLaxVnGIefb2bO5OScHJN4oWrFNqcUJYoUEgU3/Qf6'.
- 'F7gwCkIrvdBLUtqqiLhSg9bgBduFSHZdiG5ctkJ3xRDbUFwUmghNzBDanPGMkzOX79LFJGPMOSd204U/+Bbzvd/78F4H/ieJdoad'.
- 'pZKxRFszAI/DcP0HazXY22v+HB01kee1PA/v3zfnjx4xgGnHcNZe7OvuNj+cOEF1ZATv5nUA4jhBSgmADCVWo8Ge2Of9wb18P/G7'.
- 'oUXmYi30zqlTVEdGWLh1g2D6MYlKkXGE0Vl8aa2GEB149+4xXSzyoOIw/mimiZV/DPb25pFOj13A9gOMEChhUEqhVYqWKUk9QAUp'.
- 'sT/P4s8PmKlUmNhQaIJbkDVqBbpw6wZ2zUc4Nm+ePku5p4eOrgpueQOFUoVCVxcD4+N07dpF9+5tVJeWGPBjhvr7WF1zC8ASgtcP'.
- 'H8a7eZ1odh4sh50nzwCw9ZNh3M4Stutiu0X2nB/LyjZ6lcIbVTpdQU/jWVPzLADM8+ZGBRdtC7wrF/O7bR99iu26VL86iU4SAH4b'.
- 'Po5d6AQhstMSvGyI4wS5FJBKSRwnzF8byx/u+PjzzMF1mfryQ1K/jnCahqp1xEopjFLoNEFJSRJHzF799gWHqa+/QKcSUXBI609f'.
- 'Al5W4teQSiHDOipNUKnMI13RvnOXAIEKQixvGWya98SC560MFwPiqEG86JM8q79Q06lvhnOndy5/B6GPCUOMUu3BQgg8z0M3GmBZ'.
- 'iGJn3v2VmsqnfzNx7FDueODuj8ROCFpjtG5TCmOYv32bJ09msP0ISydMfnAUgF8/O45RAA6WTPjlvXcB+Gn7FuRf/zAnNX6x3ARe'.
- 'PSdmqL+P/YHkwMGDOGWDZTlQcNBRhPEComgB/YeHfq2InF1kLlXUOkpMbio1bd7aATRD/X0M1lPeSlM2vt2X1XBZjZnpLG2tmZO6'.
- 'LbQVOIcP+HG2UauH3xgwBqOz9Cc3l1tC24Fz+MvUDroeGNb5if9H/1dM/wLPCYMw9fryKgAAAABJRU5ErkJggg==' ;
-
- //==========================================================
- // error.png
- //==========================================================
- $this->iBuiltinIcon[9][0]= 541 ;
- $this->iBuiltinIcon[9][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAMAAAC7IEhfAAAAaVBMVEX//////2Xy8mLl5V/Z2VvMzFi/v1WyslKlpU+ZmUyMjEh/'.
- 'f0VyckJlZT9YWDxMTDjAwMDy8sLl5bnY2K/MzKW/v5yyspKlpYiYmH+MjHY/PzV/f2xycmJlZVlZWU9MTEXY2Ms/PzwyMjLFTjea'.
- 'AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTCAkUMSj9wWSOAAABLUlEQVR4'.
- '2s2U3ZKCMAxGjfzJanFAXFkUle/9H9JUKA1gKTN7Yy6YMjl+kNPK5rlZVSuxf1ZRnlZxFYAm93NnIKvR+MEHUgqBXx93wZGIUrSe'.
- 'h+ctEgbpiMo3iQ4kioHCGxir/ZYUbr7AgPXs9bX0BCYM8vN/cPe8oQYzom3tVsSBMVHEoOJ5dm5F1RsIe9CtqGgRacCAkUvRtevT'.
- 'e2pd6vOWF+gCuc/brcuhyARakBU9FgK5bUBWdHEH8tHpDsZnRTZQGzdLVvQ3CzyYZiTAmSIODEwzFCAdJopuvbpeZDisJ4pKEcjD'.
- 'ijWPJhU1MjCo9dkYfiUVjQNTDKY6CVbR6A0niUSZjRwFanR0l9i/TyvGnFdqwStq5axMfDbyBksld/FUumvxS/Bd9VyJvQDWiiMx'.
- 'iOsCHgAAAABJRU5ErkJggg==' ;
-
- //==========================================================
- // openfolder.png
- //==========================================================
- $this->iBuiltinIcon[10][0]= 2040 ;
- $this->iBuiltinIcon[10][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEANAAtwClFht71AAAAAlwSFlz'.
- 'AAALEAAACxABrSO9dQAAAAd0SU1FB9AKDQ4RIXMeaLcAAAd1SURBVHicxZd7jBXVHcc/58zcvTNzH8vusqw8FsTsKiCUUh5WBZXG'.
- 'GkOptmqwNWsWLKXFGlEpzZI0AWNKSy0WhDS22gJKtWlTsSRqzYIuLGB2WVvDIwQMZQMsy2OFfdzde+/OnHP6x907vJaFpjb9JZM5'.
- 'c85Mfp/f9/s7Jxn4P4e41gtSyp78WGvtfdEAcqDFYUOH9HS0NhGk9tPb/ilSyp789UUB2AMuqhQy3Uzm7HGkE6W3dTNZMRI3EcWO'.
- 'jf9ClLmWBT3dzW8jUsevWHCG3UpWl+IkHSxnbDh/Mcz12NevBcuWXTmf6TjnXvJ88gDmVB3pw3+nt3UzHa1NqMzBS2zqPLGFjtMN'.
- 'ZNr3XdW+qyqwZcFk76HX/tHWfuQvyO4W7qhaHwL8efkMRlRUpPv7rqD0RrJ+FgAjLy1a20OIxZJEEuNCRfIApj+om4bGM3u2/sYU'.
- '9J41d8973f3Dhg1pISTV1dXXBRNJxPGFCzhou+DCQrScZOkktNaeDZjamgeZ9MgiYmVDccvHhjAzJw0NTh8/alyZMaVJicp0iTHj'.
- 'JpgNv38tjWUhhGROdbUL9W5/MH5XCkjlcibi+KIop5LVHLKEu8A/f4r286doa9pGrGwYAAsfqbbH3b8MgO/Nqgy6WvdbbXHMkEFJ'.
- '4xUOMVEvaTZu3BgmvF4Yk4hz9rO/Ulr5cE9owae/rcGxohSOuiWkC2IjcIqKyPZm+OmCH7GhoZEF077EEzVVweAbJ+riEeO0Ey8y'.
- 'UubqOHn0AOgMwvf59txnBrSp9dgxKmf/+kIP1NY8SFk0jh5ajmNHAWg5b2E5EexojGHjbiVRMoRMNs0LC+Yz46vTuH3enN7BI8fr'.
- 'qFdo0BoVZNC9aVSQ4fNjBzEmQJiARxb+/AqYPMAVB5FsPU5v37g9OxgLhe14ZM5/ju052E6MNZvf5pmHHuLmmWOkEysxUtpGAtme'.
- 'dtHTflJkezqQto3jFRnLssyf1jydxiiM7zNnye/c3ZsqLu2BN5fcMfzrv/hby1tPzmRUoihcTJ87CwQI2yLtDcIqsIjYUf51qBlf'.
- 'OnScOSrdQUOMURkiXsLUzJnvbGhoBGDHH5cGyZLhOpYoNl5hqYnYEXOu5fDl9eYAHntx98n8hFHZcPHUuTSxSASAeK/CGIOxJJ0f'.
- 'bOGNPU280dgkq6Y2yu8vfjCIlwwzr+/ZQ/PHO0gOLuO5qsftDQ2NbN+4OCgqG6WTxWVaq6zpF+DiSHWnicdylp3r6aZTWthIOrNp'.
- 'ktHcvBu0sHX1Sm6ozB3B42d90zZA9bQp7PvgPSzXZfnqX/HS4DKKK2+x69Y/HURs26iBAN5ccsfw7774UcumF37C6f07KSt2OHji'.
- 'DEUJD0tISjyPrrSPlAKvN0JP/U4O1NfjuhG2rvklN1SOpfXwftpbTqAyKRrff5fb7rs9V1R7m4wlz2ihA3HpmXflUWyOH2umpLiY'.
- 'ui3v8M+6bWzfsRNbSgqkxaCkiy0simMuEWEhpcRzIhQWOIAh6tiAwS4owInFiTou5dOnMnl2NR++ujBwXEc9terD6M43nrj6LgAB'.
- 'QnDPA9/irtkP8JRS7Hr/3T6YekDQ1pEiEXOwpUVJzCVlZZFS4mZtkpEo9ChAkDp/jtLMBACy6S4RiQghLyv5cgBRPnKUOX6smUGF'.
- 'hSil0MYw9d77mPy1e5mnFE3batm3czvb6nYgEJztSFGU9LCRlMRdUjIH0+lnEMIwPNXD3NumoVJnrMCJaiciMUZfvQnz4QcBSvV1'.
- 'vjE5GK358t0zmXDnDB79saLpo20c+aSRD+t25JTp7GZQwsEWFiVxl6hlUf/WO9z32CxmL1rOe6u/I2KuwGhzLQCB7/sYY9Bah3el'.
- 'FKbvrrVm4vS7GH/7ncx+chEHGz7myCeNbPtoO0JI2jq78WIRLGkzsqs7V5SfFV5EovXACoiqqsfNpk2vo5VCWtYFBfoU0VoTBAFa'.
- 'a7TRaK2p+MoURk+cxMzq+Rzbv49DDbuo27UTW9h0dedssPxuK+kIfN8XxhgDYPVXf2Fh4XKtFIl4AiklAlBKAYRKKK36wHIweTCt'.
- 'NfHiEkaOn8j0+7/BmDFjaT30GbHywSxcuZkpFfFg+m1jjZ/NmnVvNfRvwd69e8WBA/uNFAIh4JVXXmHsmDHE4vEQQgjQ2lxQIm9N'.
- 'nz35q3BEOZOHzaG2thaA4mRU+L29It+IV21CpbRQfeMFC35gRB/M2rVrubnyZmLxWJhECBEmz/eHyo/7lMlH3LFFujsthNFCCGOu'.
- '+WNyeUgpjSVzMKtWraKyshLPdcPEeYWCIEBdpIxSivr6eta8vI7d6+cGnhdV06pe1QP+F/QXWmuRL+jZZ58LlVmxYgUVFRV4rhtu'.
- '4TzMxXAA6XRaRAtsYUkx8I/JtSJQOlSwpmZpCLN8+fPcdNNoHMfB9/0QJgRoP295TlR7UVv8xxZcHMuWIZ9/Hn35vG3JEGZpzVJG'.
- 'jx5N1IlitKahsZE1L69j69qHgx+urFX/lQL9JYdLlfnZihUhzOLFi8N3Ml1dthOxVH/f/8/CtqSJ2JaJ2JZ59J7RPsC/AViJsQS/'.
- 'dBntAAAAAElFTkSuQmCC' ;
-
- //==========================================================
- // folder.png
- //==========================================================
+ if( $aIdx < 0 || $aIdx >= $this->iLen ) {
+ JpGraphError::RaiseL(6010,$aIdx);
+ //('Illegal icon index for Gantt builtin icon ['.$aIdx.']');
+ }
+ return Image::CreateFromString(base64_decode($this->iBuiltinIcon[$aIdx][1]));
+ }
+
+ function __construct() {
+ //==========================================================
+ // warning.png
+ //==========================================================
+ $this->iBuiltinIcon[0][0]= 1043 ;
+ $this->iBuiltinIcon[0][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAABmJLR0QA/wD/AP+gvaeTAAAACXBIWXMAAAsSAAALEgHS3X78AAAA'.
+ 'B3RJTUUH0wgKFSgilWPhUQAAA6BJREFUeNrtl91rHFUYh5/3zMx+Z5JNUoOamCZNaqTZ6IWIkqRiQWmi1IDetHfeiCiltgXBP8AL'.
+ '0SIUxf/AvfRSBS9EKILFFqyIH9CEmFZtPqrBJLs7c+b1YneT3WTTbNsUFPLCcAbmzPt73o9zzgzs2Z793231UOdv3w9k9Z2uzOdA'.
+ '5+2+79yNeL7Hl7hw7oeixRMZ6PJM26W18DNAm/Vh7lR8fqh97NmMF11es1iFpMATqdirwMNA/J4DpIzkr5YsAF1PO6gIMYHRdPwl'.
+ 'oO2elmB+qH3sm7XozbkgYvy8SzYnZPtcblyM6I+5z3jQ+0vJfgpEu56BfI9vUkbyi2HZd1QJoeWRiAjBd4SDCW8SSAOy6wBHMzF7'.
+ 'YdV2A+ROuvRPLfHoiSU0EMY/cDAIhxJeGngKaN1VgHyPL7NBxI1K9P4QxBzw3K1zJ/zkG8B9uwaQ7/HNsRZv9kohBGD0o7JqMYS/'.
+ '/ynPidQw/LrBiPBcS/yFCT95DvB2BWAy4575PaQbQKW+tPd3GCItu2odKI++YxiKu0d26oWmAD7paZU/rLz37VqIijD2YbnzNBBE'.
+ 'IBHf8K8qjL7vYhCGErEU8CTg3xXAeMp96GrJEqkyXkm9Bhui1xfsunjdGhcYLq+IzjsGmBt5YH/cmJkFq6gIqlon3u4LxdKGuCIo'.
+ 'Qu41g0E41po+2R33Xt5uz9kRIB2UTle7PnfKrROP1HD4sRjZlq0lzhwoZ6rDNeTi3nEg1si/7FT7kYQbXS6E5E65tA5uRF9tutq0'.
+ 'K/VwAF+/FbIYWt6+tjQM/AqUms7A4Wy6d7YSfSNxgMmzi0ycWWworio4QJvj4LpuL5BqugTnXzzqJsJwurrlNhJXFaavW67NRw3F'.
+ 'q+aJcCQVe9fzvJGmAY7/dPH0gi0f64OveGxa+usCuQMeZ0+kt8BVrX+qPO9Bzx0MgqBvs+a2PfDdYIf+WAjXU1ub4tqNaPPzRs8A'.
+ 'blrli+WVn79cXn0cWKl+tGx7HLc7pu3CSmnfitL+l1UihAhwjFkPQev4K/fSABjBM8JCaFuurJU+rgW41SroA8aNMVNAFtgHJCsn'.
+ 'XGy/58QVxAC9MccJtZ5kIzNlW440WrJ2ea4YPA9cAooA7i0A/gS+iqLoOpB1HOegqrYB3UBmJrAtQAJwpwPr1Ry92wVlgZsiYlW1'.
+ 'uX1gU36dymgqYxJIJJNJT1W9QqHgNwFQBGYqo94OwHZQUuPD7ACglSvc+5n5T9m/wfJJX4U9qzEAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // edit.png
+ //==========================================================
+ $this->iBuiltinIcon[1][0]= 959 ;
+ $this->iBuiltinIcon[1][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAFgAWABY9j+ZuwAAAAlwSFlz'.
+ 'AAALEAAACxABrSO9dQAAAAd0SU1FB9AKDAwbIEXOA6AAAAM8SURBVHicpdRPaBxlHMbx76ZvsmOTmm1dsEqQSIIsEmGVBAQjivEQ'.
+ 'PAUJngpWsAWlBw8egpQepKwplN4ULEG9CjkEyUFKlSJrWTG0IU51pCsdYW2ncUPjdtp9Z+f3vuNhu8nKbmhaf5cZeGc+PO8zf1Lc'.
+ 'm0KhkACICCKCMeaBjiLC0tLSnjNvPmuOHRpH0TZTU1M8zBi9wakzn7OFTs5sw8YYACYmJrre7HkeuVyu69qPF77hlT1XmZ0eQ03O'.
+ 'wOLJTvhBx1rLz18VmJ0eY+jVd2FxDkKXnvYLHgb97OgLzE4ON9Hzc1B1QaQzsed5O0Lta3Ec89OnR5h5McfQ+Mw2qgQUnfBOPbZ3'.
+ 'bK3l+xOvMT0+3ERLp5FNF6UEjcL32+DdVmGt5WLhDYYPZrbRqreFumXwql0S3w9tnDvLWD5PZigPpdOwuYpSCo3C8wU3UHxQdHbf'.
+ 'cZIkNM6dxcnlUM4k1eUFMlUPpUADbpkttFarHe6oYqeOr6yt4RzMQHYUcUsQVtGicHDwKprViuLDkkOtVnsHCHZVRVy/zcj1i5Af'.
+ 'h8AjdIts+hUcGcYPK3iBtKM3gD/uAzf/AdY2mmmVgy6X8YNNKmGIvyloPcB8SUin07RQ4EZHFdsdG0wkJEnEaHAJxvKEpSLeaokV'.
+ 'r4zWmhUZYLlY4b1D03y5eIEWCtS7vsciAgiIxkQRabWOrlQor66y4pUphoJb1jiO4uO5o0S3q6RSqVbiOmC7VCEgAhLSaDQ48dH7'.
+ 'vD46REY0iysegSjKQciRt99ib7qXwX0O+pG4teM6YKHLB9JMq4mTmF9/+AKA4wvLZByH7OgYL7+UY2qvw/7Bfg5kHiXjJFyv3CGO'.
+ 'Y1rof+BW4t/XLiPG0DCGr79d4XzRxRnIMn98huXSTYyJ6et1UNYQhRvcinpJq86H3wGPPPM0iBDd+QffD1g4eZjLvuG7S1Wef26E'.
+ 'J7L7eSx7gAHVg7V3MSbi6m/r93baBd6qQjerAJg/9Ql/XrvG0ON1+vv7GH3qSfY5fahUnSTpwZgIEQesaVXRPbHRG/xyJSAxMYlp'.
+ 'EOm71HUINiY7mGb95l/8jZCyQmJjMDGJjUmsdCROtZ0n/P/Z8v4Fs2MTUUf7vYoAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // endconstrain.png
+ //==========================================================
+ $this->iBuiltinIcon[2][0]= 666 ;
+ $this->iBuiltinIcon[2][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlz'.
+ 'AAALDwAACw8BkvkDpQAAAAd0SU1FB9ALEREILkh0+eQAAAIXSURBVHictZU9aFNRFMd/N81HX77aptJUWmp1LHRpIcWhg5sIDlUQ'.
+ 'LAXB4t7RRUpwEhy7iQ46CCIoSHcl0CFaoVARU2MFMYktadLXJNok7x2HtCExvuYFmnO4w/3gx+Gc/z1HKRTdMEdXqHbB/sgc/sic'.
+ 'nDoYAI8XwDa8o1RMLT+2hAsigtTvbIGVqhX46szUifBGswUeCPgAGB7QeLk0X4Ork+HOxo1VgSqGASjMqkn8W4r4vVtEgI/RRQEL'.
+ 'vaoGD85cl5V3nySR/S1mxWxab7f35PnntNyMJeRr9kCMqiHTy09EoeToLwggx6ymiMOD/VwcD7Oa/MHkcIiQx026WGYto5P/U+ZZ'.
+ '7gD0QwDuT5z9N3LrVPi0Xs543eQPKkRzaS54eviJIp4tMFQFMllAWN2qcRZHBnixNM8NYD162xq8u7ePSQ+GX2Pjwxc2dB2cLtB8'.
+ '7GgamCb0anBYBeChMtl8855CarclxU1gvViiUK4w2OMkNDnGeJ8bt9fH90yOnOkCwLFTwhzykhvtYzOWoBBbY//R3dbaNTYhf2RO'.
+ 'QpeuUMzv188MlwuHy0H13HnE48UzMcL0WAtUHX8OxZHoG1URiFw7rnLLCswuSPD1ulze/iWjT2PSf+dBXRFtVVGIvzqph0pQL7VE'.
+ 'avXYaXXxPwsnt0imdttCocMmZBdK7YU9D8wuNOW0nXc6QWzPsSa5naZ1beb9BbGB6dxGtMnXAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // mail.png
+ //==========================================================
+ $this->iBuiltinIcon[3][0]= 1122 ;
+ $this->iBuiltinIcon[3][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlz'.
+ 'AAALEAAACxABrSO9dQAAAAd0SU1FB9AJHAMfFvL9OU8AAAPfSURBVHictZRdaBRXFMd/987H7tbNx8aYtGCrEexDsOBDaKHFxirb'.
+ 'h0qhsiY0ykppKq1osI99C4H2WSiFFMHWUhXBrjRi0uCmtSEUGgP1QWqhWjGkoW7M1kTX3WRn5p4+TJJNGolQ6IXDnDtz+N0z/3PP'.
+ 'UWBIpdpYa23b9g09PZ2kUrOrvmUyGVKp1Ao/mUyi56YnVgWfO/P1CihAd/dJMpmaNROIRq8BkM1m0bH6TasC3j6QXgFdXI+DR6PR'.
+ 'JX/Pno8B+KLnMKqlpUU8z8MYs2RBEDzWf9J+0RcRbMdxGBsbw/fmCXwPMUEYID4iAVp8wIRmDIHMo4yHSIBSASKC+CWE0C/PF9jU'.
+ '3B6Cp+4M07C5FUtKGNvGwQJctPgIsgD2wRhEIqAMGB+UQYkHJgYYZD7P1HwVlmWhHcfhyk83KeRGUW4t6CgoG5SNUS4KBWgQDUov'.
+ '7AGlwYASBVqH0Bk49dXpCviVV3dw/tI1Bvr7kMIIlh0NYUpjlF0BAYvcxSXmEVLKceHSCJm+PnbueBHbtkNwTXUNBzo6aGpq4sSZ'.
+ 'GwT5H7BsF6Wdf1GWHQAoM0upeI9PT1yioS7B7tdaSdSuw7KsUGMAy7HYsmUztTW1nMwM0txssX1rlHjjS5jy/Uq2YkK/eJuLl6/z'.
+ 'x+1xkslW6mrixGIODx8EFSlEBC0+tmXT0NhA2763iEUjnLv4C8XpUbSbAB1mKkGJ3J83Od77HW5EszvZSqK2iljMIeJaRGNuJePF'.
+ '6mspY7BJ1DXwQnCd2fxGRq5OUCz8xt72dyhMZcn++Cu3xu9SKhdp2b4ZHWnAtTSxmIWlhcIjlksR3lNBYzlxZsb7+f7ne+xtSzOd'.
+ 'u83szH1OnThOPp/n+a0beeP1l4mvq+PU2Qyd+5PY1RuwlAqLYFaBfbTbyPSdfgaH77A//QF4f1O/vpr6RJyq+C5Kc/M8FbFxXItY'.
+ 'xOHDrvfo/fxLDnbsJBp5BowBReVWYAzabeTh5ABDw7cWoNNL3YYYNtSv57lnn6Z+Qx01VeuIuBa2DV1HD3H63BAPZu4u1WGpeLHq'.
+ 'Rh7+NcjA0O+0p4+CNwXigwnbWlQQdpuEpli+n+PIkcOc//YKuckJJFh2K2anrjFw+QZt6S6kPImIF/b+cqAJD1LihWAxC61twBTo'.
+ 'fPcQF/oGsVW5ovHQlavs2/8+uYnRVSOUgHAmmAClBIOBwKC0gPjhIRgEIX2wg7NnwpZW3d3d4vs+vu8TBMGK51rvPM9b8hdteZxd'.
+ 'LBbVR8feJDs0Rlv6GFKeXJ21rNRXESxMPR+CBUl0nN7PjtO+dye7Up/8v1I88bf/ixT/AO1/hZsqW+C6AAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // startconstrain.png
+ //==========================================================
+ $this->iBuiltinIcon[4][0]= 725 ;
+ $this->iBuiltinIcon[4][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlz'.
+ 'AAALDgAACw4BQL7hQQAAAAd0SU1FB9ALEREICJp5fBkAAAJSSURBVHic3dS9a1NRGMfx77kxtS+xqS9FG6p1ER3qVJpBQUUc3CRU'.
+ 'BwURVLB1EAuKIP0THJQiiNRJBK3iJl18AyeltRZa0bbaJMbUNmlNSm5e7s25j0NqpSSmyag/OMM9POdzDuflwn8djz8gClVRrVEV'.
+ 'ur4Bl1FTNSzLrSS6vbml0jUUwSXj8Qfk3PkLtLW2AeBIybmrgz3+gFzpucjlE4f4btuFTuWuCF5XDr3a3UPf6cM8GQvxzbsRAJdh'.
+ 'ScfxSywml5j7mVypN0eGEJ0tebIre+zxB6Tv7jPReS2hREpOvpmUXU+H5eC913JnNCSRVE60pUVbWoZjprR39Yq70bdqj4pW7PEH'.
+ '5FpvL9e79jOTTHM7ssDL6CJZ08LbvAGnrpZg2mI2Z/MlZfN8IkxuSwu4V9+WIrj7zFlOHfXzKrLIi2SGh5ECKjnNVNxkQEc55vOw'.
+ 'rb6O8JLFdHyJ+ayFElUeHvjwkfteL/V7fKTSkFvIQE4DoLI2Mz/muTkTApcBKIwaN8pwIUrKw+ajWwDknAO0d/r4zFaMuRS63sWm'.
+ 'RoOdm+vRIriUYjKexrQV+t1o0YEVwfZSVJmD/dIABJuO0LG3lRFx0GOfiAELE9OgCrfU0XnIp5FwGLEy5WEAOxlR5uN+ARhP7GN3'.
+ '5w7Gv4bQI2+xpt4jjv2nWBmIlcExE2vDAHYioszBZXw6CPE4ADoWVHmd/tuwlZR9eXYyoszBfpiNQqaAOU5+TXRN+DeeenADPT9b'.
+ 'EVgKVsutKPl0TGWGhwofoquaoKK4apsq/tH/e/kFwBMXLgAEKK4AAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // calc.png
+ //==========================================================
+ $this->iBuiltinIcon[5][0]= 589 ;
+ $this->iBuiltinIcon[5][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAA4AIwBbgMF12wAAAAlwSFlz'.
+ 'AAALEQAACxEBf2RfkQAAAAd0SU1FB9AHBxQeFsqn0wQAAAHKSURBVHicnZWff+RAGIef3U/gcOEgUAgUCgcLhYXCwsHBQeGgUDgs'.
+ 'FgMHB4VA/4Bg4XChWFgIFIqBwkJhsRAYeOGF+TQHmWSTTbKd9pU37/x45jvfTDITXEynAbdWKVQB0NazcVm0alcL4rJaRVzm+w/e'.
+ '3iwAkzbYRcnnYgI04GCvsxxSPabYaEdt2Ra6D0atcvvvDmyrMWBX1zPq2ircP/Tk98DiJtjV/fim6ziOCL6dDHZNhxQ3arIMsox4'.
+ 'vejleL2Ay9+jaw6A+4OSICG2cacGKhsGxg+CxeqAQS0Y7BYJvowq7iGMOhXHEfzpvpQkA9bLKgOgWKt+4Lo1mM9hs9m17QNsJ70P'.
+ 'Fjc/O52joogoX8MZKiBiAFxd9Z1vcj9wfSpUlDRNMcYQxzFpmnJ0FPH8nDe1MQaWSz9woQpWSZKEojDkeaWoKAyr1tlu+s48wfVx'.
+ 'u7n5i7jthmGIiEGcT+36PP+gFeJrxWLhb0UA/lb4ggGs1T0rZs0zwM/ZjNfilcIY5tutPxgOW3F6dUX464LrKILLiw+A7WErrl+2'.
+ 'rABG1EL/BilZP8DjU2uR4U+2E49P1Z8QJmNXUzl24A9GBT0IruCfi86d9x+D12RGzt+pNAAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // mag.png
+ //==========================================================
+ $this->iBuiltinIcon[6][0]= 1415 ;
+ $this->iBuiltinIcon[6][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlz'.
+ 'AAALDAAACwwBP0AiyAAAAAd0SU1FB9ALDxEWDY6Ul+UAAAUESURBVHicdZVrbFRFGIafsyyF0nalV1R6WiggaAptlzsr1OgEogmC'.
+ '0IgoBAsBgkIrBAPEhBj/AP6xRTCUFEwRI4jcgsitXMrFCJptJWvBNpXYbbXtbtttt6e7e86ec/yxadlCfZPJZDIz73zzzjfvR2VL'.
+ 'F7U+hf0HD2JduIzTFy6SlJRkPtkcDgdCCE65OxFC8NPV6wghyM7OptankJ2dzbSC5QghEEIgCSHog9PpNAF27dlN6miZuPgElB4/'.
+ 'nmY3O7ZtByA1NVUCkGWZweD1eklJScESTbqxuIjrd+/x6uIl5M19hSy7nfGOeUxf+g7VjU1sKi7C4/GYsiyz7tAJAD4/cRaA1tZW'.
+ 'AHIPnECUVGD1+/3U19ebG4uLeHf1akamjsIwoVnVCOvQEdLoVILYYmMo3PIxSBJflpSaDX5FAmju1QAYv/8k/s8+wLVxOU0jR2LZ'.
+ '8sMFAApWrCApbRRDrRZirBYSLBKaoRPQw3SFernf2sav7T0Ubt4KwL4FMwF4Vu8FoHBCKgCzDhwHwLIhZ7y5a89u4m2JhA0wTdDC'.
+ 'OrphEjJMNElCHxKDEjaobmvlfo/Krj27CQQCJsCGJW8C0KXqAMxMiosQA8hZWcTFx9OsaniDKh1qmG7VoFsL0x0K06kbeAMhWpRe'.
+ '/KpG+gwHAKUnz7Dz3BUMw6DK18nuw99wt0Nh6VdHI8RJicmETQgFg7SFwjSrGv+oKp6ghldV6dZ0ugJBlF6FmCESQ2w2AIqXLsan'.
+ 'BrFYLJTnTCBrdBqveeopWZiPFaBHUegJhegMqGgxEkHDwB/UaQ9rdIV06v0+TD2EEQjQFtAY0dsNgNvt5sialQAIIXh7wQKuVf6J'.
+ 'gTsSccPDWlQstClBGjr9eHpVWvUQncEwdYEedF8noQ4vmYmpZMTH0nTvDn25vLbrNmu7bvfnsYEbAMnhcPDgwQPzUo2LJusw/mhp'.
+ 'QwlHNO0KBAnoIfxtrcQMT2De1Mm891wyUzNlUlJSpIyMDBobGzlzr5rFM/Koq6vrP8ASGxsLwPmKcvIShjPGZiPOakE3VFB8hHwd'.
+ 'vJAxhrk5L7Ly+RQuH/sWgPdXrwFg/6HDFBUsIj09nehfbAWwPWOT9n5RYhqGwarNWxkRM5TRCfF4U1PQsDDJFk9uYhwXvzvKjm3b'.
+ 'KSsro3DJInNW5RXp7u2bAKSlpeH1esnPz6eqqgqLpmmcr3Fht9ulfaV7mZk1Bs+lM6T1djM9fhg5egDPpTNMy5TZsW07kydPYdWM'.
+ 'aXx96ixOp9O8cfUa80srmDpjOgAulytiQqZpMnvObLbt/JTtHxXj9/tRVdU0DGOAufRpevPDTeac0hJyc3NxOOawfv161lVWS6eX'.
+ 'z+9/UOCxu1VWVvaTRGv16NFfjB2bNeAQp9NpTpmSM4DcbrdL0WsGDKLRR+52uwe1yP8jb2lpYfikyY9t80n03UCWZeaXVjw1f+zs'.
+ 'Oen+/d+pqanhzp2fKSsrw+l0mi6XiyPl5ZGITdN8fAVJwjRNJEmi1qfw1kw7siyTnJxMe3s71dXV3GpoZO64DG41NPJylvxU5D/e'.
+ 'qJKsfWQD9IkaZ2RmUvr9aV4aGYcQgjfO3aWoYBF5eXm4ewIsu/CbdPz1aWb0/p1bNoOrQxlUiuiaFo3c3FyEEOx9+C9CCD6paaTW'.
+ 'p/TXyYkTJ0Xe59jf7QOyAKDWp/QXxcFQ61P4pT3ShBBcvnUHIQTjxmX19/8BCeVg+/GPpskAAAAASUVORK5CYII=' ;
+
+ //==========================================================
+ // lock.png
+ //==========================================================
+ $this->iBuiltinIcon[7][0]= 963 ;
+ $this->iBuiltinIcon[7][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAAAAAAAA+UO7fwAAAAlwSFlz'.
+ 'AAALCwAACwsBbQSEtwAAAAd0SU1FB9AKAw0XDmwMOwIAAANASURBVHic7ZXfS1t3GMY/3+PprI7aisvo2YU6h6ATA8JW4rrlsF4U'.
+ 'qiAsF9mhl0N2cYTRy9G/wptAYWPD9iJtRy5asDe7cYFmyjaXOLaMImOrmkRrjL9yTmIS3120JybWQgfb3R74wuc8Lzw858vLOUpE'.
+ 'OK6pqSm2trbY39+nu7tbPHYch7m5OcLhMIA67kWj0aMQEWk6tm17rNm2LSIie3t7ksvlJJ1OSyqVkls3Z8SyLMnlcqTTaVKpFLdu'.
+ 'zmBZVj1HeY2VUti2TSQSQSml2bZdi0QirK2tMT09zerqKtlslqGhISYnJ4nHv2N+foFsNquOe9FotLlxOBwmk8lgWRbhcFgymYxY'.
+ 'liUi0mqaJoAuIi2macrdO7fFsizx3to0Te7euV1vrXtXEgqFmJmZYWVlhXK5LB4/U9kwDL784kYV0A3DYHd3m4sXRymXywKoRi8U'.
+ 'Ch01DgQCJBIJLMsiEAhIIpHw2uLz+eqtYrEYIqKZpimxWEyCwaCMjY01zYPBIJpXqVQqsby8TLVabWKA/v5+RkZGMAyDrq4ulFKH'.
+ 'HsfjcWZnZ+ns7KTRqwcnk0mKxSKFQqGJlVKtruuSTCYB6O3trW9UI/v9/iZPB/j8s2HOnX0FgHfeXpeffnzK+fWf+fijvhLs0PtG'.
+ 'D/n1OJ9+MsrlSwb3733DwMCAt1EyPj6uACYmJp56168NU6nUqFSE9nZdPE7+WqC/r4NKTagcCJVqDaUUB5VDAA4Pa9x7sMLlSwan'.
+ 'WjRmv13D7/erpaWlo604qOp88OF7LC48rPNosMq5Th+Dgxd4/XyA1rbzADi7j8jnf2P++wdcvSr8MJ/i8eomAKlUqn41OsDAQDeD'.
+ 'g++yuPCwzm/2vU8+n2a7sMFfj79mp7BBuVzioFSiXHJx3SKuW2Rzy0Up9dxnQVvODALQerqNRn4ZKe0Mvtc6TpzpmqbxalcY9Ato'.
+ '2v06t515C73YQftZB9GLnDrt4LoujuPgOA4Ui+C6yOpXJwZrJ7r/gv4P/u+D9W7fLxTz+1ScQxrZ3atRLaVxdjbY2d184R6/sLHe'.
+ 'opHP7/Do90Ua+WWUyezzZHObP/7cfX54/dowE1d66s8TV3oE+Mfn+L/zb4XmHPjRG9YjAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // stop.png
+ //==========================================================
+ $this->iBuiltinIcon[8][0]= 889 ;
+ $this->iBuiltinIcon[8][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAABYAAAAWCAYAAADEtGw7AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAAAAAAAA+UO7fwAAAAlwSFlz'.
+ 'AAALDwAACw8BkvkDpQAAAAd0SU1FB9AJDwEvNyD6M/0AAAL2SURBVHic1ZTLaxVnGIefb2bO5OScHJN4oWrFNqcUJYoUEgU3/Qf6'.
+ 'F7gwCkIrvdBLUtqqiLhSg9bgBduFSHZdiG5ctkJ3xRDbUFwUmghNzBDanPGMkzOX79LFJGPMOSd204U/+Bbzvd/78F4H/ieJdoad'.
+ 'pZKxRFszAI/DcP0HazXY22v+HB01kee1PA/v3zfnjx4xgGnHcNZe7OvuNj+cOEF1ZATv5nUA4jhBSgmADCVWo8Ge2Of9wb18P/G7'.
+ 'oUXmYi30zqlTVEdGWLh1g2D6MYlKkXGE0Vl8aa2GEB149+4xXSzyoOIw/mimiZV/DPb25pFOj13A9gOMEChhUEqhVYqWKUk9QAUp'.
+ 'sT/P4s8PmKlUmNhQaIJbkDVqBbpw6wZ2zUc4Nm+ePku5p4eOrgpueQOFUoVCVxcD4+N07dpF9+5tVJeWGPBjhvr7WF1zC8ASgtcP'.
+ 'H8a7eZ1odh4sh50nzwCw9ZNh3M4Stutiu0X2nB/LyjZ6lcIbVTpdQU/jWVPzLADM8+ZGBRdtC7wrF/O7bR99iu26VL86iU4SAH4b'.
+ 'Po5d6AQhstMSvGyI4wS5FJBKSRwnzF8byx/u+PjzzMF1mfryQ1K/jnCahqp1xEopjFLoNEFJSRJHzF799gWHqa+/QKcSUXBI609f'.
+ 'Al5W4teQSiHDOipNUKnMI13RvnOXAIEKQixvGWya98SC560MFwPiqEG86JM8q79Q06lvhnOndy5/B6GPCUOMUu3BQgg8z0M3GmBZ'.
+ 'iGJn3v2VmsqnfzNx7FDueODuj8ROCFpjtG5TCmOYv32bJ09msP0ISydMfnAUgF8/O45RAA6WTPjlvXcB+Gn7FuRf/zAnNX6x3ARe'.
+ 'PSdmqL+P/YHkwMGDOGWDZTlQcNBRhPEComgB/YeHfq2InF1kLlXUOkpMbio1bd7aATRD/X0M1lPeSlM2vt2X1XBZjZnpLG2tmZO6'.
+ 'LbQVOIcP+HG2UauH3xgwBqOz9Cc3l1tC24Fz+MvUDroeGNb5if9H/1dM/wLPCYMw9fryKgAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // error.png
+ //==========================================================
+ $this->iBuiltinIcon[9][0]= 541 ;
+ $this->iBuiltinIcon[9][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAACgAAAAoCAMAAAC7IEhfAAAAaVBMVEX//////2Xy8mLl5V/Z2VvMzFi/v1WyslKlpU+ZmUyMjEh/'.
+ 'f0VyckJlZT9YWDxMTDjAwMDy8sLl5bnY2K/MzKW/v5yyspKlpYiYmH+MjHY/PzV/f2xycmJlZVlZWU9MTEXY2Ms/PzwyMjLFTjea'.
+ 'AAAAAXRSTlMAQObYZgAAAAFiS0dEAIgFHUgAAAAJcEhZcwAACxIAAAsSAdLdfvwAAAAHdElNRQfTCAkUMSj9wWSOAAABLUlEQVR4'.
+ '2s2U3ZKCMAxGjfzJanFAXFkUle/9H9JUKA1gKTN7Yy6YMjl+kNPK5rlZVSuxf1ZRnlZxFYAm93NnIKvR+MEHUgqBXx93wZGIUrSe'.
+ 'h+ctEgbpiMo3iQ4kioHCGxir/ZYUbr7AgPXs9bX0BCYM8vN/cPe8oQYzom3tVsSBMVHEoOJ5dm5F1RsIe9CtqGgRacCAkUvRtevT'.
+ 'e2pd6vOWF+gCuc/brcuhyARakBU9FgK5bUBWdHEH8tHpDsZnRTZQGzdLVvQ3CzyYZiTAmSIODEwzFCAdJopuvbpeZDisJ4pKEcjD'.
+ 'ijWPJhU1MjCo9dkYfiUVjQNTDKY6CVbR6A0niUSZjRwFanR0l9i/TyvGnFdqwStq5axMfDbyBksld/FUumvxS/Bd9VyJvQDWiiMx'.
+ 'iOsCHgAAAABJRU5ErkJggg==' ;
+
+ //==========================================================
+ // openfolder.png
+ //==========================================================
+ $this->iBuiltinIcon[10][0]= 2040 ;
+ $this->iBuiltinIcon[10][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAABGdBTUEAALGPC/xhBQAAAAZiS0dEANAAtwClFht71AAAAAlwSFlz'.
+ 'AAALEAAACxABrSO9dQAAAAd0SU1FB9AKDQ4RIXMeaLcAAAd1SURBVHicxZd7jBXVHcc/58zcvTNzH8vusqw8FsTsKiCUUh5WBZXG'.
+ 'GkOptmqwNWsWLKXFGlEpzZI0AWNKSy0WhDS22gJKtWlTsSRqzYIuLGB2WVvDIwQMZQMsy2OFfdzde+/OnHP6x907vJaFpjb9JZM5'.
+ 'c85Mfp/f9/s7Jxn4P4e41gtSyp78WGvtfdEAcqDFYUOH9HS0NhGk9tPb/ilSyp789UUB2AMuqhQy3Uzm7HGkE6W3dTNZMRI3EcWO'.
+ 'jf9ClLmWBT3dzW8jUsevWHCG3UpWl+IkHSxnbDh/Mcz12NevBcuWXTmf6TjnXvJ88gDmVB3pw3+nt3UzHa1NqMzBS2zqPLGFjtMN'.
+ 'ZNr3XdW+qyqwZcFk76HX/tHWfuQvyO4W7qhaHwL8efkMRlRUpPv7rqD0RrJ+FgAjLy1a20OIxZJEEuNCRfIApj+om4bGM3u2/sYU'.
+ '9J41d8973f3Dhg1pISTV1dXXBRNJxPGFCzhou+DCQrScZOkktNaeDZjamgeZ9MgiYmVDccvHhjAzJw0NTh8/alyZMaVJicp0iTHj'.
+ 'JpgNv38tjWUhhGROdbUL9W5/MH5XCkjlcibi+KIop5LVHLKEu8A/f4r286doa9pGrGwYAAsfqbbH3b8MgO/Nqgy6WvdbbXHMkEFJ'.
+ '4xUOMVEvaTZu3BgmvF4Yk4hz9rO/Ulr5cE9owae/rcGxohSOuiWkC2IjcIqKyPZm+OmCH7GhoZEF077EEzVVweAbJ+riEeO0Ey8y'.
+ 'UubqOHn0AOgMwvf59txnBrSp9dgxKmf/+kIP1NY8SFk0jh5ajmNHAWg5b2E5EexojGHjbiVRMoRMNs0LC+Yz46vTuH3enN7BI8fr'.
+ 'qFdo0BoVZNC9aVSQ4fNjBzEmQJiARxb+/AqYPMAVB5FsPU5v37g9OxgLhe14ZM5/ju052E6MNZvf5pmHHuLmmWOkEysxUtpGAtme'.
+ 'dtHTflJkezqQto3jFRnLssyf1jydxiiM7zNnye/c3ZsqLu2BN5fcMfzrv/hby1tPzmRUoihcTJ87CwQI2yLtDcIqsIjYUf51qBlf'.
+ 'OnScOSrdQUOMURkiXsLUzJnvbGhoBGDHH5cGyZLhOpYoNl5hqYnYEXOu5fDl9eYAHntx98n8hFHZcPHUuTSxSASAeK/CGIOxJJ0f'.
+ 'bOGNPU280dgkq6Y2yu8vfjCIlwwzr+/ZQ/PHO0gOLuO5qsftDQ2NbN+4OCgqG6WTxWVaq6zpF+DiSHWnicdylp3r6aZTWthIOrNp'.
+ 'ktHcvBu0sHX1Sm6ozB3B42d90zZA9bQp7PvgPSzXZfnqX/HS4DKKK2+x69Y/HURs26iBAN5ccsfw7774UcumF37C6f07KSt2OHji'.
+ 'DEUJD0tISjyPrrSPlAKvN0JP/U4O1NfjuhG2rvklN1SOpfXwftpbTqAyKRrff5fb7rs9V1R7m4wlz2ihA3HpmXflUWyOH2umpLiY'.
+ 'ui3v8M+6bWzfsRNbSgqkxaCkiy0simMuEWEhpcRzIhQWOIAh6tiAwS4owInFiTou5dOnMnl2NR++ujBwXEc9terD6M43nrj6LgAB'.
+ 'QnDPA9/irtkP8JRS7Hr/3T6YekDQ1pEiEXOwpUVJzCVlZZFS4mZtkpEo9ChAkDp/jtLMBACy6S4RiQghLyv5cgBRPnKUOX6smUGF'.
+ 'hSil0MYw9d77mPy1e5mnFE3batm3czvb6nYgEJztSFGU9LCRlMRdUjIH0+lnEMIwPNXD3NumoVJnrMCJaiciMUZfvQnz4QcBSvV1'.
+ 'vjE5GK358t0zmXDnDB79saLpo20c+aSRD+t25JTp7GZQwsEWFiVxl6hlUf/WO9z32CxmL1rOe6u/I2KuwGhzLQCB7/sYY9Bah3el'.
+ 'FKbvrrVm4vS7GH/7ncx+chEHGz7myCeNbPtoO0JI2jq78WIRLGkzsqs7V5SfFV5EovXACoiqqsfNpk2vo5VCWtYFBfoU0VoTBAFa'.
+ 'a7TRaK2p+MoURk+cxMzq+Rzbv49DDbuo27UTW9h0dedssPxuK+kIfN8XxhgDYPVXf2Fh4XKtFIl4AiklAlBKAYRKKK36wHIweTCt'.
+ 'NfHiEkaOn8j0+7/BmDFjaT30GbHywSxcuZkpFfFg+m1jjZ/NmnVvNfRvwd69e8WBA/uNFAIh4JVXXmHsmDHE4vEQQgjQ2lxQIm9N'.
+ 'nz35q3BEOZOHzaG2thaA4mRU+L29It+IV21CpbRQfeMFC35gRB/M2rVrubnyZmLxWJhECBEmz/eHyo/7lMlH3LFFujsthNFCCGOu'.
+ '+WNyeUgpjSVzMKtWraKyshLPdcPEeYWCIEBdpIxSivr6eta8vI7d6+cGnhdV06pe1QP+F/QXWmuRL+jZZ58LlVmxYgUVFRV4rhtu'.
+ '4TzMxXAA6XRaRAtsYUkx8I/JtSJQOlSwpmZpCLN8+fPcdNNoHMfB9/0QJgRoP295TlR7UVv8xxZcHMuWIZ9/Hn35vG3JEGZpzVJG'.
+ 'jx5N1IlitKahsZE1L69j69qHgx+urFX/lQL9JYdLlfnZihUhzOLFi8N3Ml1dthOxVH/f/8/CtqSJ2JaJ2JZ59J7RPsC/AViJsQS/'.
+ 'dBntAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // folder.png
+ //==========================================================
$this->iBuiltinIcon[11][0]= 1824 ;
- $this->iBuiltinIcon[11][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAACIAAAAiCAYAAAA6RwvCAAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAAAAAAAA+UO7fwAAAAlwSFlz'.
- 'AAALEAAACxABrSO9dQAAAAd0SU1FB9ECAQgFFyd9cRUAAAadSURBVHiczdhvbBP3Hcfx9/2xfefEOA5JoCNNnIT8AdtZmYBETJsI'.
- '6+jQOlQihT1AYgytqzZpD1atfyYqlT1h0lRpT7aRJ4NQpRvZGELVuo5Ua9jEJDIETQsNQyPBsUJMWGPnj//e+e72wNg4xElMR6ed'.
- 'ZNln3933dZ/f93f6yfB/sgmrHdDV1WXlPg8NDZUDScD8LFFFEZZlWYZhWMFg0Orq6sq/gDJAfFy1iiZy9OjrVnj4JzQ1rMWqfxm/'.
- '309jYyNtbW0kEgnu3bvH4cOH88c/jqSKQl4/XGkd+eVtAN46up1LH92ktqYS++ZX8Pv9NDQ0sGnTJlKpFOFwmO7u7vy5IyMjeVRd'.
- 'XV1+WEOh0IrY4pDnq6wXX/sTiCJaMkFZdRNqxefoe7VtCSqXVDqdZnZ2ltraWkzTpKqqijt3JpFlG7dvj7NzZ1f++qFQyA3EClHL'.
- 'Ql743nFkhxPDtJAd5eTaYSVUfX09lZWVlJWVIUnSg7sVQMBCUcu4ceMGe/bsIRQK1QAzOcyykIM9P0KyudAyCWyqG8nhwqa4SkLt'.
- '3r0bVVVxu924XC40TUOWZUQxe97CwgIdHR2LMHIxSCaVInVvFElxE0vMY1Pd2NUKJMWNTXHlUfF//4vETJCelwbpFm3MjP2dt37x'.
- 'AlN+PzU1NViWRSwW4+7du3g8HjweD4qi5EFAJzAExIpCANbooxhplfB0FJvTg6xWIqsVRVF6MopkU3FXPcnkJxGU0VEAdF2noqKC'.
- 'W3/8DpnqLjzep2lubsblcjE8PExHR8fboVDID9xYFpLBDpJF0jDQIncQpWlkm31FlFLtp9PfyuW/vYQj1kPSuRW/38+lj27S2Q7v'.
- '/aWXUBVUffVNtm3blivVCEwsC5Eyc5iiApEpDEAXMqQdldhSiWVQHjJagud+8Fuexck/zv+K82dfoSbSCsDe75/km+4GVPd6+l5t'.
- '4zJHcqVUYN2yEEtZQDCSJCueRAYsPY49HsFIZVG6p25JUumFafT4DKJN4amtT7Nz38sk5+5A70HMtEYyMkFiZhxzjQ/poXrLQrRU'.
- 'DFGEeFpAlkQkm4pRiCpIKodKzk0T/2QMh+piPjxKZPwiSkUtu/b9mNnJEWS7E8nhAmvpM60oJDkXJxqNozxRRUxPIesispBBlsXV'.
- 'UaKEFo8gzoaJhz8s2lOmrpUG+WBhJ9/60g+Z+fDXTAXfxllRjl1VkO0OFATsYhYliiK21ZKKhhHnFveUqSdKgwAEOp7F2v51vvw8'.
- 'XH7/N1wd/BlTweuUV65BdtgfoLTSkipsdD3tRi0VYpommUwGwzDwdT5HYEc3giAwcvH3jLz3BlPB67jWeZBEKYsSBWwpHZtNKo4q'.
- 'aHTDsJeeiGEYWJaFZVmYpommaRiGQdPnv0bb1m8gSRL/vPIOV979aR4lmAJ2p4qCgCxksNuKJ6VNpx4NYhgGpmkuQhmGQTqdxjAM'.
- 'qr2d7HtxEEEQuH1tkKvvvkF44tqDnrIcKJKAPf1g+LAUElq8dIiu60sApmnm93Pfzc7OYhgGrie+wFe++ztcLhcT1wf54PzPCU9c'.
- 'w7XWjWS3IdsdOAUBWZAxrRJnTQ6SG5bce2FCpmkughmGQSqVYm5uDtnj44sH38TtdhP6+Dwf//V4ttHXrkGURZJaic8RgHQ6jWma'.
- 'SJKUL5RLKNfIOczDKF3XSSaTRCIRhLJWntp3nGfWrSMxc5OLf3iNP4+68T9Ub9nF76lTpxgfHycajZJKpdA0LZ9GbjYV7hcDWZaF'.
- 'pmnMz88Ti8UYunSLmu1HFi2aVkxkaGjINTY2ttDb24vX6+XQoUNs3ryZ8vJyIDu1BUFYkkxhgxeiWlpaOHPmDE1NTdTX1xe98eWG'.
- 'JnF/9dQZCoXUYDA4AOD1ejlw4ACtra2Ul5fniwmCkEcUJiUIAoFAgL6+Pnw+H21tbfT39z8SxCS7hHsfWH9/8dL4MKqnp4eWlhac'.
- 'TmcekEvMNE2am5s5ceIEgUCA9vZ2Tp48ic/nY3j4UsmQHCYOjJHtpeBKqL1799Lc3IzT6UTXdRobGxkYGKC9vZ3W1tZ8Ko86NJ8a'.
- 'tXHjRo4dO8bp06fZsmULGzZsoL+/n0AggNfr5ezZs/8VpGTU5OSkc//+/acBfD4f1dXV7Nq1i4aGBs6dO4fP5+Pq1SuPBbIiyjTN'.
- 'RUnV1dUNXLhwAa/Xy44dO4jFYgBEo9FFF1r134BPuYlk16LrAYXsAlmtq6sbKDwoFAp9m+ykuP5ZQVZF3f8tCdwCov8LyHIoAANI'.
- 'AXf/A1TI0XCDh7OWAAAAAElFTkSuQmCC' ;
-
- //==========================================================
- // file_important.png
- //==========================================================
- $this->iBuiltinIcon[12][0]= 1785 ;
- $this->iBuiltinIcon[12][1]=
- 'iVBORw0KGgoAAAANSUhEUgAAACIAAAAiCAYAAAA6RwvCAAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAAAAAAAA+UO7fwAAAAlwSFlz'.
- 'AAALDwAACw8BkvkDpQAAAAd0SU1FB9ECDAcjDeD3lKsAAAZ2SURBVHicrZhPaFzHHcc/897s7lutJCsr2VHsOHWMk0MPbsBUrcnF'.
- 'OFRdSo6FNhdB6SGHlpDmYtJCDyoxyKe6EBxKQkt7KKL0T6ABo0NbciqigtC6PhWKI2NFqqxdSd7V2/dmftPDvPd212t55dCBYfbN'.
- 'zpvfZ77z+/1mdhUjytWrV93Hf/24eD5z9gwiMlDjOKbb7dLtdhER2u02u7u73Lp1CxEZBw4AeZwdNQqkMd9wbziFGINJUt6rRbz5'.
- '1ptUq1XK5TJBEAAUMHt7e+zu7gKwvLzMysoKwAng/uNg9CgQgFKlgg1DUJ67Vqtx6tQpZmdniaIIpRTOOZRSdDoddnZ2aLfbLC8v'.
- 's7S0xJUrV7ZGwQSj1PhhfRodVdDlMrpc5vup5Z2fvMPdu3fZ29vDWjvwztjYGPV6nVqtRqVS4dKlSywtLQFsAdOH2XwsCEApg3jl'.
- 'w98Rak2gvYjNZpNms0mSJDjnHgkDMDc3dySYQ0Ea8w139YUX0OUKulzyg7UmCEO+l1huvHuDra0t9vf3h1TJYSqVypFhHquIrlQI'.
- 'S5qv/uIDAC7/4bcEQYAKvK+0Wq1DVQGIoog7d+4cCeaRII35hrt+8SsEOkRlUaEyR0UpFIrXHxyMVKVUKnHv3r0jwRwaNelBjBjL'.
- 'Sz/7KYuLiwAsLi7y4z/9kY9e+TpkCuSqjI+Po7XuAWeKXLt2DWNMUZMkwRjDhQsXWFtbK6JpCCT3jfQgxomPtPX19YHWicM5x3c2'.
- '73Pj3Ru8/aO3mZqaolKpoHVvyuvXr/Ppnf/Q7uzz380NPtu4y/qnG+ztd1hfX2dtbQ3gIvDnRyqSxl1UoPjyz98D4PTp0wPtq39Z'.
- '4fdzLxegrVaLVqvF5OQkYRgWqpRKJZ77wvNsbW1RG5tgfKLOTH2G7Z1twqBQrgrMDvhInjfSOCY5iIv+hYWFgRZArEWsZWF941Bf'.
- 'SdMUgMnJCWpjVU4cn+HUyePM1Gc4+fRUPkzBI5w1jbukcczLv/5l0XfmzJmBFuCba38r/CRXpT+CrDUoZ0jjB4RYonJAOYRobJKT'.
- 'z5zgqfqxAbsFSH6mpHFM2qdGXh4VnoViD6mSJF2cTQeqDqBaKVHWmonJCWpZjhkC6anR5WsffTgwaHV1FaUUq6urA/2v3f5k4LnV'.
- 'arG9tUn3oI2YBCcWHYAxMVYs1qZEZY2SFB2aYZDGfMN9d7uJiWPSeFiNo5Rclc3NTXZbO6RpF7EJVixYA9agwwDnUiqlEPdQ3imi'.
- 'Jo27BGHIt/7x9yEjc3Nzh27Na7c/4TdffKl4bja3ae5MUIu0T/HOEIaOpJt4gwoSsVTK4SBIY77hFtY3ABBjBiZ90rKwvsH77/+K'.
- 't37wOhO1iPpTk4SBw1mLsz6CnKQ4l3qV+kE+t9XHlNZOk+bUJLVIE1VCcIJWQmJ6qjj30NbcXLkZMt8YPig+Z3n1G5fZ39/j/vY2'.
- '9ckqZT2Ochbn0p4qNkU/dDfUADdXbh4HXgRO4zNdEU0XL1784PLly5w9e7Z4SazFOfGrEotDcOKrcoJPmrYIXf/Zop3QNd1skuGt'.
- 'cUAb2MgAxvHZTgFUq1Wmp6eZnZ0F8JlTjDduDThBnDeECEoJtbGIp6enqEblzCcEZ1PECU4yVRiOGgd0gc+AB0CZvkv1sWPHOHfu'.
- 'HOfPn8da41cpkkltEBEPJhYnBkTQJcdYVKGkgRxCfBsq5xXNgAa2Bn+hjTOgHEKBP8pzRUxykIH4ifLJRTJAl+UMBJzPHQ6bfe/f'.
- 'cWIzPxlUpD+zugzIZtVk1d8znBAqRxgoQuVQgSJQ3h9C5QhDRYgjUILCAzlnEdsHYTKfMTEBcP7F54YUGVmc2GLlIn6ve6v0ahSt'.
- '8X25TzjJ+rIx1grKpQPWR4LkGVVsMgghvS0qjPdvm5OeceOTWA5Evo2mFzkjQfL7hZPUy5yvvF/uPFQL3+nbDmsLCEmT3sTmCTNr'.
- 'rogT6yFsOix3ftw7OwQhkvSU6CuinhCk0+kAkFoBazEEICHaHHiPVmU0gnUp4EAc1mYrF0EBVpwPi34VrBkwPxKk3W5ju/e5/c+d'.
- 'bGUHIAIuydTIE5zfc5Wr4lJcahHnHTP3CVGm78DrgY38N+DEibp7dmYKdAQmBh1hjEFjis+9CTWYGK21H6PxPyOI0DobYwzZF/z7'.
- '7jadTvJtYG0kCD7lfwl49ijgT1gc0AH+dZSJA/xB+Mz/GSIvFoj/B7H1mAd8CO/zAAAAAElFTkSuQmCC' ;
+ $this->iBuiltinIcon[11][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAACIAAAAiCAYAAAA6RwvCAAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAAAAAAAA+UO7fwAAAAlwSFlz'.
+ 'AAALEAAACxABrSO9dQAAAAd0SU1FB9ECAQgFFyd9cRUAAAadSURBVHiczdhvbBP3Hcfx9/2xfefEOA5JoCNNnIT8AdtZmYBETJsI'.
+ '6+jQOlQihT1AYgytqzZpD1atfyYqlT1h0lRpT7aRJ4NQpRvZGELVuo5Ua9jEJDIETQsNQyPBsUJMWGPnj//e+e72wNg4xElMR6ed'.
+ 'ZNln3933dZ/f93f6yfB/sgmrHdDV1WXlPg8NDZUDScD8LFFFEZZlWYZhWMFg0Orq6sq/gDJAfFy1iiZy9OjrVnj4JzQ1rMWqfxm/'.
+ '309jYyNtbW0kEgnu3bvH4cOH88c/jqSKQl4/XGkd+eVtAN46up1LH92ktqYS++ZX8Pv9NDQ0sGnTJlKpFOFwmO7u7vy5IyMjeVRd'.
+ 'XV1+WEOh0IrY4pDnq6wXX/sTiCJaMkFZdRNqxefoe7VtCSqXVDqdZnZ2ltraWkzTpKqqijt3JpFlG7dvj7NzZ1f++qFQyA3EClHL'.
+ 'Ql743nFkhxPDtJAd5eTaYSVUfX09lZWVlJWVIUnSg7sVQMBCUcu4ceMGe/bsIRQK1QAzOcyykIM9P0KyudAyCWyqG8nhwqa4SkLt'.
+ '3r0bVVVxu924XC40TUOWZUQxe97CwgIdHR2LMHIxSCaVInVvFElxE0vMY1Pd2NUKJMWNTXHlUfF//4vETJCelwbpFm3MjP2dt37x'.
+ 'AlN+PzU1NViWRSwW4+7du3g8HjweD4qi5EFAJzAExIpCANbooxhplfB0FJvTg6xWIqsVRVF6MopkU3FXPcnkJxGU0VEAdF2noqKC'.
+ 'W3/8DpnqLjzep2lubsblcjE8PExHR8fboVDID9xYFpLBDpJF0jDQIncQpWlkm31FlFLtp9PfyuW/vYQj1kPSuRW/38+lj27S2Q7v'.
+ '/aWXUBVUffVNtm3blivVCEwsC5Eyc5iiApEpDEAXMqQdldhSiWVQHjJagud+8Fuexck/zv+K82dfoSbSCsDe75/km+4GVPd6+l5t'.
+ '4zJHcqVUYN2yEEtZQDCSJCueRAYsPY49HsFIZVG6p25JUumFafT4DKJN4amtT7Nz38sk5+5A70HMtEYyMkFiZhxzjQ/poXrLQrRU'.
+ 'DFGEeFpAlkQkm4pRiCpIKodKzk0T/2QMh+piPjxKZPwiSkUtu/b9mNnJEWS7E8nhAmvpM60oJDkXJxqNozxRRUxPIesispBBlsXV'.
+ 'UaKEFo8gzoaJhz8s2lOmrpUG+WBhJ9/60g+Z+fDXTAXfxllRjl1VkO0OFATsYhYliiK21ZKKhhHnFveUqSdKgwAEOp7F2v51vvw8'.
+ 'XH7/N1wd/BlTweuUV65BdtgfoLTSkipsdD3tRi0VYpommUwGwzDwdT5HYEc3giAwcvH3jLz3BlPB67jWeZBEKYsSBWwpHZtNKo4q'.
+ 'aHTDsJeeiGEYWJaFZVmYpommaRiGQdPnv0bb1m8gSRL/vPIOV979aR4lmAJ2p4qCgCxksNuKJ6VNpx4NYhgGpmkuQhmGQTqdxjAM'.
+ 'qr2d7HtxEEEQuH1tkKvvvkF44tqDnrIcKJKAPf1g+LAUElq8dIiu60sApmnm93Pfzc7OYhgGrie+wFe++ztcLhcT1wf54PzPCU9c'.
+ 'w7XWjWS3IdsdOAUBWZAxrRJnTQ6SG5bce2FCpmkughmGQSqVYm5uDtnj44sH38TtdhP6+Dwf//V4ttHXrkGURZJaic8RgHQ6jWma'.
+ 'SJKUL5RLKNfIOczDKF3XSSaTRCIRhLJWntp3nGfWrSMxc5OLf3iNP4+68T9Ub9nF76lTpxgfHycajZJKpdA0LZ9GbjYV7hcDWZaF'.
+ 'pmnMz88Ti8UYunSLmu1HFi2aVkxkaGjINTY2ttDb24vX6+XQoUNs3ryZ8vJyIDu1BUFYkkxhgxeiWlpaOHPmDE1NTdTX1xe98eWG'.
+ 'JnF/9dQZCoXUYDA4AOD1ejlw4ACtra2Ul5fniwmCkEcUJiUIAoFAgL6+Pnw+H21tbfT39z8SxCS7hHsfWH9/8dL4MKqnp4eWlhac'.
+ 'TmcekEvMNE2am5s5ceIEgUCA9vZ2Tp48ic/nY3j4UsmQHCYOjJHtpeBKqL1799Lc3IzT6UTXdRobGxkYGKC9vZ3W1tZ8Ko86NJ8a'.
+ 'tXHjRo4dO8bp06fZsmULGzZsoL+/n0AggNfr5ezZs/8VpGTU5OSkc//+/acBfD4f1dXV7Nq1i4aGBs6dO4fP5+Pq1SuPBbIiyjTN'.
+ 'RUnV1dUNXLhwAa/Xy44dO4jFYgBEo9FFF1r134BPuYlk16LrAYXsAlmtq6sbKDwoFAp9m+ykuP5ZQVZF3f8tCdwCov8LyHIoAANI'.
+ 'AXf/A1TI0XCDh7OWAAAAAElFTkSuQmCC' ;
+
+ //==========================================================
+ // file_important.png
+ //==========================================================
+ $this->iBuiltinIcon[12][0]= 1785 ;
+ $this->iBuiltinIcon[12][1]=
+ 'iVBORw0KGgoAAAANSUhEUgAAACIAAAAiCAYAAAA6RwvCAAAABGdBTUEAALGPC/xhBQAAAAZiS0dEAAAAAAAA+UO7fwAAAAlwSFlz'.
+ 'AAALDwAACw8BkvkDpQAAAAd0SU1FB9ECDAcjDeD3lKsAAAZ2SURBVHicrZhPaFzHHcc/897s7lutJCsr2VHsOHWMk0MPbsBUrcnF'.
+ 'OFRdSo6FNhdB6SGHlpDmYtJCDyoxyKe6EBxKQkt7KKL0T6ABo0NbciqigtC6PhWKI2NFqqxdSd7V2/dmftPDvPd212t55dCBYfbN'.
+ 'zpvfZ77z+/1mdhUjytWrV93Hf/24eD5z9gwiMlDjOKbb7dLtdhER2u02u7u73Lp1CxEZBw4AeZwdNQqkMd9wbziFGINJUt6rRbz5'.
+ '1ptUq1XK5TJBEAAUMHt7e+zu7gKwvLzMysoKwAng/uNg9CgQgFKlgg1DUJ67Vqtx6tQpZmdniaIIpRTOOZRSdDoddnZ2aLfbLC8v'.
+ 's7S0xJUrV7ZGwQSj1PhhfRodVdDlMrpc5vup5Z2fvMPdu3fZ29vDWjvwztjYGPV6nVqtRqVS4dKlSywtLQFsAdOH2XwsCEApg3jl'.
+ 'w98Rak2gvYjNZpNms0mSJDjnHgkDMDc3dySYQ0Ea8w139YUX0OUKulzyg7UmCEO+l1huvHuDra0t9vf3h1TJYSqVypFhHquIrlQI'.
+ 'S5qv/uIDAC7/4bcEQYAKvK+0Wq1DVQGIoog7d+4cCeaRII35hrt+8SsEOkRlUaEyR0UpFIrXHxyMVKVUKnHv3r0jwRwaNelBjBjL'.
+ 'Sz/7KYuLiwAsLi7y4z/9kY9e+TpkCuSqjI+Po7XuAWeKXLt2DWNMUZMkwRjDhQsXWFtbK6JpCCT3jfQgxomPtPX19YHWicM5x3c2'.
+ '73Pj3Ru8/aO3mZqaolKpoHVvyuvXr/Ppnf/Q7uzz380NPtu4y/qnG+ztd1hfX2dtbQ3gIvDnRyqSxl1UoPjyz98D4PTp0wPtq39Z'.
+ '4fdzLxegrVaLVqvF5OQkYRgWqpRKJZ77wvNsbW1RG5tgfKLOTH2G7Z1twqBQrgrMDvhInjfSOCY5iIv+hYWFgRZArEWsZWF941Bf'.
+ 'SdMUgMnJCWpjVU4cn+HUyePM1Gc4+fRUPkzBI5w1jbukcczLv/5l0XfmzJmBFuCba38r/CRXpT+CrDUoZ0jjB4RYonJAOYRobJKT'.
+ 'z5zgqfqxAbsFSH6mpHFM2qdGXh4VnoViD6mSJF2cTQeqDqBaKVHWmonJCWpZjhkC6anR5WsffTgwaHV1FaUUq6urA/2v3f5k4LnV'.
+ 'arG9tUn3oI2YBCcWHYAxMVYs1qZEZY2SFB2aYZDGfMN9d7uJiWPSeFiNo5Rclc3NTXZbO6RpF7EJVixYA9agwwDnUiqlEPdQ3imi'.
+ 'Jo27BGHIt/7x9yEjc3Nzh27Na7c/4TdffKl4bja3ae5MUIu0T/HOEIaOpJt4gwoSsVTK4SBIY77hFtY3ABBjBiZ90rKwvsH77/+K'.
+ 't37wOhO1iPpTk4SBw1mLsz6CnKQ4l3qV+kE+t9XHlNZOk+bUJLVIE1VCcIJWQmJ6qjj30NbcXLkZMt8YPig+Z3n1G5fZ39/j/vY2'.
+ '9ckqZT2Ochbn0p4qNkU/dDfUADdXbh4HXgRO4zNdEU0XL1784PLly5w9e7Z4SazFOfGrEotDcOKrcoJPmrYIXf/Zop3QNd1skuGt'.
+ 'cUAb2MgAxvHZTgFUq1Wmp6eZnZ0F8JlTjDduDThBnDeECEoJtbGIp6enqEblzCcEZ1PECU4yVRiOGgd0gc+AB0CZvkv1sWPHOHfu'.
+ 'HOfPn8da41cpkkltEBEPJhYnBkTQJcdYVKGkgRxCfBsq5xXNgAa2Bn+hjTOgHEKBP8pzRUxykIH4ifLJRTJAl+UMBJzPHQ6bfe/f'.
+ 'cWIzPxlUpD+zugzIZtVk1d8znBAqRxgoQuVQgSJQ3h9C5QhDRYgjUILCAzlnEdsHYTKfMTEBcP7F54YUGVmc2GLlIn6ve6v0ahSt'.
+ '8X25TzjJ+rIx1grKpQPWR4LkGVVsMgghvS0qjPdvm5OeceOTWA5Evo2mFzkjQfL7hZPUy5yvvF/uPFQL3+nbDmsLCEmT3sTmCTNr'.
+ 'rogT6yFsOix3ftw7OwQhkvSU6CuinhCk0+kAkFoBazEEICHaHHiPVmU0gnUp4EAc1mYrF0EBVpwPi34VrBkwPxKk3W5ju/e5/c+d'.
+ 'bGUHIAIuydTIE5zfc5Wr4lJcahHnHTP3CVGm78DrgY38N+DEibp7dmYKdAQmBh1hjEFjis+9CTWYGK21H6PxPyOI0DobYwzZF/z7'.
+ '7jadTvJtYG0kCD7lfwl49ijgT1gc0AH+dZSJA/xB+Mz/GSIvFoj/B7H1mAd8CO/zAAAAAElFTkSuQmCC' ;
- $this->iLen = count($this->iBuiltinIcon);
+ $this->iLen = count($this->iBuiltinIcon);
}
}
@@ -1429,67 +1475,65 @@
//===================================================
// CLASS IconImage
-// Description: Holds properties for an icon image
+// Description: Holds properties for an icon image
//===================================================
class IconImage {
- var $iGDImage=null;
- var $iWidth,$iHeight;
- var $ixalign='left',$iyalign='center';
- var $iScale=1.0;
-
- function IconImage($aIcon,$aScale=1) {
- GLOBAL $_gPredefIcons ;
- if( is_string($aIcon) ) {
- $this->iGDImage = Graph::LoadBkgImage('',$aIcon);
- }
- elseif( is_integer($aIcon) ) {
- // Builtin image
- $this->iGDImage = $_gPredefIcons->GetImg($aIcon);
- }
- else {
- JpGraphError::RaiseL(6011);
-//('Argument to IconImage must be string or integer');
- }
- $this->iScale = $aScale;
- $this->iWidth = Image::GetWidth($this->iGDImage);
- $this->iHeight = Image::GetHeight($this->iGDImage);
+ private $iGDImage=null;
+ private $iWidth,$iHeight;
+ private $ixalign='left',$iyalign='center';
+ private $iScale=1.0;
+
+ function __construct($aIcon,$aScale=1) {
+ GLOBAL $_gPredefIcons ;
+ if( is_string($aIcon) ) {
+ $this->iGDImage = Graph::LoadBkgImage('',$aIcon);
+ }
+ elseif( is_integer($aIcon) ) {
+ // Builtin image
+ $this->iGDImage = $_gPredefIcons->GetImg($aIcon);
+ }
+ else {
+ JpGraphError::RaiseL(6011);
+ //('Argument to IconImage must be string or integer');
+ }
+ $this->iScale = $aScale;
+ $this->iWidth = Image::GetWidth($this->iGDImage);
+ $this->iHeight = Image::GetHeight($this->iGDImage);
}
function GetWidth() {
- return round($this->iScale*$this->iWidth);
+ return round($this->iScale*$this->iWidth);
}
function GetHeight() {
- return round($this->iScale*$this->iHeight);
+ return round($this->iScale*$this->iHeight);
}
function SetAlign($aX='left',$aY='center') {
-
- $this->ixalign = $aX;
- $this->iyalign = $aY;
-
+ $this->ixalign = $aX;
+ $this->iyalign = $aY;
}
- function Stroke(&$aImg,$x,$y) {
-
- if( $this->ixalign == 'right' ) {
- $x -= $this->iWidth;
- }
- elseif( $this->ixalign == 'center' ) {
- $x -= round($this->iWidth/2*$this->iScale);
- }
-
- if( $this->iyalign == 'bottom' ) {
- $y -= $this->iHeight;
- }
- elseif( $this->iyalign == 'center' ) {
- $y -= round($this->iHeight/2*$this->iScale);
- }
+ function Stroke($aImg,$x,$y) {
- $aImg->Copy($this->iGDImage,
- $x,$y,0,0,
- round($this->iWidth*$this->iScale),round($this->iHeight*$this->iScale),
- $this->iWidth,$this->iHeight);
+ if( $this->ixalign == 'right' ) {
+ $x -= $this->iWidth;
+ }
+ elseif( $this->ixalign == 'center' ) {
+ $x -= round($this->iWidth/2*$this->iScale);
+ }
+
+ if( $this->iyalign == 'bottom' ) {
+ $y -= $this->iHeight;
+ }
+ elseif( $this->iyalign == 'center' ) {
+ $y -= round($this->iHeight/2*$this->iScale);
+ }
+
+ $aImg->Copy($this->iGDImage,
+ $x,$y,0,0,
+ round($this->iWidth*$this->iScale),round($this->iHeight*$this->iScale),
+ $this->iWidth,$this->iHeight);
}
}
@@ -1499,331 +1543,389 @@
// Description: Holds properties for a text
//===================================================
class TextProperty {
- var $iFFamily=FF_FONT1,$iFStyle=FS_NORMAL,$iFSize=10;
- var $iColor="black";
- var $iShow=true;
- var $iText="";
- var $iHAlign="left",$iVAlign="bottom";
- var $csimtarget='',$csimwintarget='',$csimalt='';
-
-//---------------
-// CONSTRUCTOR
- function TextProperty($aTxt='') {
- $this->iText = $aTxt;
- }
-
-//---------------
-// PUBLIC METHODS
+ public $iShow=true;
+ public $csimtarget='',$csimwintarget='',$csimalt='';
+ private $iFFamily=FF_FONT1,$iFStyle=FS_NORMAL,$iFSize=10;
+ private $iFontArray=array();
+ private $iColor="black";
+ private $iText="";
+ private $iHAlign="left",$iVAlign="bottom";
+
+ //---------------
+ // CONSTRUCTOR
+ function __construct($aTxt='') {
+ $this->iText = $aTxt;
+ }
+
+ //---------------
+ // PUBLIC METHODS
function Set($aTxt) {
- $this->iText = $aTxt;
+ $this->iText = $aTxt;
}
function SetCSIMTarget($aTarget,$aAltText='',$aWinTarget='') {
- if( is_string($aTarget) )
- $aTarget = array($aTarget);
- $this->csimtarget=$aTarget;
-
- if( is_string($aWinTarget) )
- $aWinTarget = array($aWinTarget);
- $this->csimwintarget=$aWinTarget;
+ if( is_string($aTarget) )
+ $aTarget = array($aTarget);
+ $this->csimtarget=$aTarget;
+
+ if( is_string($aWinTarget) )
+ $aWinTarget = array($aWinTarget);
+ $this->csimwintarget=$aWinTarget;
- if( is_string($aAltText) )
- $aAltText = array($aAltText);
+ if( is_string($aAltText) )
+ $aAltText = array($aAltText);
$this->csimalt=$aAltText;
-
+
}
-
+
function SetCSIMAlt($aAltText) {
- if( is_string($aAltText) )
- $aAltText = array($aAltText);
+ if( is_string($aAltText) )
+ $aAltText = array($aAltText);
$this->csimalt=$aAltText;
}
// Set text color
function SetColor($aColor) {
- $this->iColor = $aColor;
+ $this->iColor = $aColor;
}
-
+
function HasTabs() {
- if( is_string($this->iText) ) {
- return substr_count($this->iText,"\t") > 0;
- }
- elseif( is_array($this->iText) ) {
- return false;
- }
+ if( is_string($this->iText) ) {
+ return substr_count($this->iText,"\t") > 0;
+ }
+ elseif( is_array($this->iText) ) {
+ return false;
+ }
}
-
+
// Get number of tabs in string
function GetNbrTabs() {
- if( is_string($this->iText) ) {
- return substr_count($this->iText,"\t") ;
- }
- else{
- return 0;
- }
+ if( is_string($this->iText) ) {
+ return substr_count($this->iText,"\t") ;
+ }
+ else{
+ return 0;
+ }
}
-
+
// Set alignment
function Align($aHAlign,$aVAlign="bottom") {
- $this->iHAlign=$aHAlign;
- $this->iVAlign=$aVAlign;
+ $this->iHAlign=$aHAlign;
+ $this->iVAlign=$aVAlign;
}
-
+
// Synonym
function SetAlign($aHAlign,$aVAlign="bottom") {
- $this->iHAlign=$aHAlign;
- $this->iVAlign=$aVAlign;
+ $this->iHAlign=$aHAlign;
+ $this->iVAlign=$aVAlign;
}
-
+
// Specify font
function SetFont($aFFamily,$aFStyle=FS_NORMAL,$aFSize=10) {
- $this->iFFamily = $aFFamily;
- $this->iFStyle = $aFStyle;
- $this->iFSize = $aFSize;
+ $this->iFFamily = $aFFamily;
+ $this->iFStyle = $aFStyle;
+ $this->iFSize = $aFSize;
+ }
+
+ function SetColumnFonts($aFontArray) {
+ if( !is_array($aFontArray) || count($aFontArray[0]) != 3 ) {
+ JpGraphError::RaiseL(6033);
+ // 'Array of fonts must contain arrays with 3 elements, i.e. (Family, Style, Size)'
+ }
+ $this->iFontArray = $aFontArray;
}
+
function IsColumns() {
- return is_array($this->iText) ;
+ return is_array($this->iText) ;
}
-
+
// Get width of text. If text contains several columns separated by
- // tabs then return both the total width as well as an array with a
+ // tabs then return both the total width as well as an array with a
// width for each column.
- function GetWidth(&$aImg,$aUseTabs=false,$aTabExtraMargin=1.1) {
- $extra_margin=4;
- $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
- if( is_string($this->iText) ) {
- if( strlen($this->iText) == 0 ) return 0;
- $tmp = split("\t",$this->iText);
- if( count($tmp) <= 1 || !$aUseTabs ) {
- $w = $aImg->GetTextWidth($this->iText);
- return $w + 2*$extra_margin;
- }
- else {
- $tot=0;
- $n = count($tmp);
- for($i=0; $i < $n; ++$i) {
- $res[$i] = $aImg->GetTextWidth($tmp[$i]);
- $tot += $res[$i]*$aTabExtraMargin;
- }
- return array(round($tot),$res);
- }
- }
- elseif( is_object($this->iText) ) {
- // A single icon
- return $this->iText->GetWidth()+2*$extra_margin;
- }
- elseif( is_array($this->iText) ) {
- // Must be an array of texts. In this case we return the sum of the
- // length + a fixed margin of 4 pixels on each text string
- $n = count($this->iText);
- for( $i=0, $w=0; $i < $n; ++$i ) {
- $tmp = $this->iText[$i];
- if( is_string($tmp) ) {
- $w += $aImg->GetTextWidth($tmp)+$extra_margin;
- }
- else {
- if( is_object($tmp) === false ) {
- JpGraphError::RaiseL(6012);
- }
- $w += $tmp->GetWidth()+$extra_margin;
- }
- }
- return $w;
- }
- else {
- JpGraphError::RaiseL(6012);
- }
+ function GetWidth($aImg,$aUseTabs=false,$aTabExtraMargin=1.1) {
+ $extra_margin=4;
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ if( is_string($this->iText) ) {
+ if( strlen($this->iText) == 0 ) return 0;
+ $tmp = preg_split('/\t/',$this->iText);
+ if( count($tmp) <= 1 || !$aUseTabs ) {
+ $w = $aImg->GetTextWidth($this->iText);
+ return $w + 2*$extra_margin;
+ }
+ else {
+ $tot=0;
+ $n = count($tmp);
+ for($i=0; $i < $n; ++$i) {
+ $res[$i] = $aImg->GetTextWidth($tmp[$i]);
+ $tot += $res[$i]*$aTabExtraMargin;
+ }
+ return array(round($tot),$res);
+ }
+ }
+ elseif( is_object($this->iText) ) {
+ // A single icon
+ return $this->iText->GetWidth()+2*$extra_margin;
+ }
+ elseif( is_array($this->iText) ) {
+ // Must be an array of texts. In this case we return the sum of the
+ // length + a fixed margin of 4 pixels on each text string
+ $n = count($this->iText);
+ $nf = count($this->iFontArray);
+ for( $i=0, $w=0; $i < $n; ++$i ) {
+ if( $i < $nf ) {
+ $aImg->SetFont($this->iFontArray[$i][0],$this->iFontArray[$i][1],$this->iFontArray[$i][2]);
+ }
+ else {
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ }
+ $tmp = $this->iText[$i];
+ if( is_string($tmp) ) {
+ $w += $aImg->GetTextWidth($tmp)+$extra_margin;
+ }
+ else {
+ if( is_object($tmp) === false ) {
+ JpGraphError::RaiseL(6012);
+ }
+ $w += $tmp->GetWidth()+$extra_margin;
+ }
+ }
+ return $w;
+ }
+ else {
+ JpGraphError::RaiseL(6012);
+ }
}
// for the case where we have multiple columns this function returns the width of each
// column individually. If there is no columns just return the width of the single
// column as an array of one
- function GetColWidth(&$aImg,$aMargin=0) {
- $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
- if( is_array($this->iText) ) {
- $n = count($this->iText);
- for( $i=0, $w=array(); $i < $n; ++$i ) {
- $tmp = $this->iText[$i];
- if( is_string($tmp) ) {
- $w[$i] = $aImg->GetTextWidth($this->iText[$i])+$aMargin;
- }
- else {
- if( is_object($tmp) === false ) {
- JpGraphError::RaiseL(6012);
- }
- $w[$i] = $tmp->GetWidth()+$aMargin;
- }
- }
- return $w;
- }
- else {
- return array($this->GetWidth($aImg));
- }
+ function GetColWidth($aImg,$aMargin=0) {
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ if( is_array($this->iText) ) {
+ $n = count($this->iText);
+ $nf = count($this->iFontArray);
+ for( $i=0, $w=array(); $i < $n; ++$i ) {
+ $tmp = $this->iText[$i];
+ if( is_string($tmp) ) {
+ if( $i < $nf ) {
+ $aImg->SetFont($this->iFontArray[$i][0],$this->iFontArray[$i][1],$this->iFontArray[$i][2]);
+ }
+ else {
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ }
+ $w[$i] = $aImg->GetTextWidth($tmp)+$aMargin;
+ }
+ else {
+ if( is_object($tmp) === false ) {
+ JpGraphError::RaiseL(6012);
+ }
+ $w[$i] = $tmp->GetWidth()+$aMargin;
+ }
+ }
+ return $w;
+ }
+ else {
+ return array($this->GetWidth($aImg));
+ }
}
-
+
// Get total height of text
- function GetHeight(&$aImg) {
- $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
- return $aImg->GetFontHeight();
+ function GetHeight($aImg) {
+ $nf = count($this->iFontArray);
+ $maxheight = -1;
+
+ if( $nf > 0 ) {
+ // We have to find out the largest font and take that one as the
+ // height of the row
+ for($i=0; $i < $nf; ++$i ) {
+ $aImg->SetFont($this->iFontArray[$i][0],$this->iFontArray[$i][1],$this->iFontArray[$i][2]);
+ $height = $aImg->GetFontHeight();
+ $maxheight = max($height,$maxheight);
+ }
+ }
+
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ $height = $aImg->GetFontHeight();
+ $maxheight = max($height,$maxheight);
+ return $maxheight;
}
-
- // Unhide/hide the text
+
+ // Unhide/hide the text
function Show($aShow=true) {
- $this->iShow=$aShow;
+ $this->iShow=$aShow;
}
-
+
// Stroke text at (x,y) coordinates. If the text contains tabs then the
// x parameter should be an array of positions to be used for each successive
// tab mark. If no array is supplied then the tabs will be ignored.
- function Stroke(&$aImg,$aX,$aY) {
- if( $this->iShow ) {
- $aImg->SetColor($this->iColor);
- $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
- $aImg->SetTextAlign($this->iHAlign,$this->iVAlign);
- if( $this->GetNbrTabs() <= 1 ) {
- if( is_string($this->iText) ) {
- // Get rid of any "\t" characters and stroke string
- if( is_array($aX) ) $aX=$aX[0];
- if( is_array($aY) ) $aY=$aY[0];
- $aImg->StrokeText($aX,$aY,str_replace("\t"," ",$this->iText));
- }
- elseif( is_array($this->iText) && ($n = count($this->iText)) > 0 ) {
- $ax = is_array($aX) ;
- $ay = is_array($aY) ;
- if( $ax && $ay ) {
- // Nothing; both are already arrays
- }
- elseif( $ax ) {
- $aY = array_fill(0,$n,$aY);
- }
- elseif( $ay ) {
- $aX = array_fill(0,$n,$aX);
- }
- else {
- $aX = array_fill(0,$n,$aX);
- $aY = array_fill(0,$n,$aY);
- }
- $n = min($n, count($aX) ) ;
- $n = min($n, count($aY) ) ;
- for($i=0; $i < $n; ++$i ) {
- $tmp = $this->iText[$i];
- if( is_object($tmp) ) {
- $tmp->Stroke($aImg,$aX[$i],$aY[$i]);
- }
- else
- $aImg->StrokeText($aX[$i],$aY[$i],str_replace("\t"," ",$tmp));
- }
- }
- }
- else {
- $tmp = split("\t",$this->iText);
- $n = min(count($tmp),count($aX));
- for($i=0; $i < $n; ++$i) {
- $aImg->StrokeText($aX[$i],$aY,$tmp[$i]);
- }
- }
- }
+ function Stroke($aImg,$aX,$aY) {
+ if( $this->iShow ) {
+ $aImg->SetColor($this->iColor);
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ $aImg->SetTextAlign($this->iHAlign,$this->iVAlign);
+ if( $this->GetNbrTabs() < 1 ) {
+ if( is_string($this->iText) ) {
+ if( is_array($aX) ) $aX=$aX[0];
+ if( is_array($aY) ) $aY=$aY[0];
+ $aImg->StrokeText($aX,$aY,$this->iText);
+ }
+ elseif( is_array($this->iText) && ($n = count($this->iText)) > 0 ) {
+ $ax = is_array($aX) ;
+ $ay = is_array($aY) ;
+ if( $ax && $ay ) {
+ // Nothing; both are already arrays
+ }
+ elseif( $ax ) {
+ $aY = array_fill(0,$n,$aY);
+ }
+ elseif( $ay ) {
+ $aX = array_fill(0,$n,$aX);
+ }
+ else {
+ $aX = array_fill(0,$n,$aX);
+ $aY = array_fill(0,$n,$aY);
+ }
+ $n = min($n, count($aX) ) ;
+ $n = min($n, count($aY) ) ;
+ for($i=0; $i < $n; ++$i ) {
+ $tmp = $this->iText[$i];
+ if( is_object($tmp) ) {
+ $tmp->Stroke($aImg,$aX[$i],$aY[$i]);
+ }
+ else {
+ if( $i < count($this->iFontArray) ) {
+ $font = $this->iFontArray[$i];
+ $aImg->SetFont($font[0],$font[1],$font[2]);
+ }
+ else {
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ }
+ $aImg->StrokeText($aX[$i],$aY[$i],str_replace("\t"," ",$tmp));
+ }
+ }
+ }
+ }
+ else {
+ $tmp = preg_split('/\t/',$this->iText);
+ $n = min(count($tmp),count($aX));
+ for($i=0; $i < $n; ++$i) {
+ if( $i < count($this->iFontArray) ) {
+ $font = $this->iFontArray[$i];
+ $aImg->SetFont($font[0],$font[1],$font[2]);
+ }
+ else {
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ }
+ $aImg->StrokeText($aX[$i],$aY,$tmp[$i]);
+ }
+ }
+ }
}
}
//===================================================
// CLASS HeaderProperty
-// Description: Data encapsulating class to hold property
+// Description: Data encapsulating class to hold property
// for each type of the scale headers
//===================================================
class HeaderProperty {
- var $iTitleVertMargin=3,$iFFamily=FF_FONT0,$iFStyle=FS_NORMAL,$iFSize=8;
- var $iFrameColor="black",$iFrameWeight=1;
- var $iShowLabels=true,$iShowGrid=true;
- var $iBackgroundColor="white";
- var $iWeekendBackgroundColor="lightgray",$iSundayTextColor="red"; // these are only used with day scale
- var $iTextColor="black";
- var $iLabelFormStr="%d";
- var $grid,$iStyle=0;
- var $iIntervall = 1;
-
-//---------------
-// CONSTRUCTOR
- function HeaderProperty() {
- $this->grid = new LineProperty();
+ public $grid;
+ public $iShowLabels=true,$iShowGrid=true;
+ public $iTitleVertMargin=3,$iFFamily=FF_FONT0,$iFStyle=FS_NORMAL,$iFSize=8;
+ public $iStyle=0;
+ public $iFrameColor="black",$iFrameWeight=1;
+ public $iBackgroundColor="white";
+ public $iWeekendBackgroundColor="lightgray",$iSundayTextColor="red"; // these are only used with day scale
+ public $iTextColor="black";
+ public $iLabelFormStr="%d";
+ public $iIntervall = 1;
+
+ //---------------
+ // CONSTRUCTOR
+ function __construct() {
+ $this->grid = new LineProperty();
}
-//---------------
-// PUBLIC METHODS
+ //---------------
+ // PUBLIC METHODS
function Show($aShow=true) {
- $this->iShowLabels = $aShow;
+ $this->iShowLabels = $aShow;
}
function SetIntervall($aInt) {
- $this->iIntervall = $aInt;
+ $this->iIntervall = $aInt;
+ }
+
+ function SetInterval($aInt) {
+ $this->iIntervall = $aInt;
}
function GetIntervall() {
- return $this->iIntervall ;
+ return $this->iIntervall ;
}
-
+
function SetFont($aFFamily,$aFStyle=FS_NORMAL,$aFSize=10) {
- $this->iFFamily = $aFFamily;
- $this->iFStyle = $aFStyle;
- $this->iFSize = $aFSize;
+ $this->iFFamily = $aFFamily;
+ $this->iFStyle = $aFStyle;
+ $this->iFSize = $aFSize;
}
function SetFontColor($aColor) {
- $this->iTextColor = $aColor;
+ $this->iTextColor = $aColor;
}
-
- function GetFontHeight(&$aImg) {
- $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
- return $aImg->GetFontHeight();
+
+ function GetFontHeight($aImg) {
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ return $aImg->GetFontHeight();
}
- function GetFontWidth(&$aImg) {
- $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
- return $aImg->GetFontWidth();
+ function GetFontWidth($aImg) {
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ return $aImg->GetFontWidth();
}
- function GetStrWidth(&$aImg,$aStr) {
- $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
- return $aImg->GetTextWidth($aStr);
+ function GetStrWidth($aImg,$aStr) {
+ $aImg->SetFont($this->iFFamily,$this->iFStyle,$this->iFSize);
+ return $aImg->GetTextWidth($aStr);
}
-
+
function SetStyle($aStyle) {
- $this->iStyle = $aStyle;
+ $this->iStyle = $aStyle;
}
-
+
function SetBackgroundColor($aColor) {
- $this->iBackgroundColor=$aColor;
+ $this->iBackgroundColor=$aColor;
}
function SetFrameWeight($aWeight) {
- $this->iFrameWeight=$aWeight;
+ $this->iFrameWeight=$aWeight;
}
function SetFrameColor($aColor) {
- $this->iFrameColor=$aColor;
+ $this->iFrameColor=$aColor;
}
-
+
// Only used by day scale
function SetWeekendColor($aColor) {
- $this->iWeekendBackgroundColor=$aColor;
+ $this->iWeekendBackgroundColor=$aColor;
}
-
+
// Only used by day scale
function SetSundayFontColor($aColor) {
- $this->iSundayTextColor=$aColor;
+ $this->iSundayTextColor=$aColor;
}
-
+
function SetTitleVertMargin($aMargin) {
- $this->iTitleVertMargin=$aMargin;
+ $this->iTitleVertMargin=$aMargin;
}
-
+
function SetLabelFormatString($aStr) {
- $this->iLabelFormStr=$aStr;
+ $this->iLabelFormStr=$aStr;
}
function SetFormatString($aStr) {
- $this->SetLabelFormatString($aStr);
+ $this->SetLabelFormatString($aStr);
}
@@ -1837,181 +1939,182 @@
// date headers (days, week, etc).
//===================================================
class GanttScale {
- var $minute,$hour,$day,$week,$month,$year;
- var $divider,$dividerh,$tableTitle;
- var $iStartDate=-1,$iEndDate=-1;
+ public $minute,$hour,$day,$week,$month,$year;
+ public $divider,$dividerh,$tableTitle;
+ public $iStartDate=-1,$iEndDate=-1;
// Number of gantt bar position (n.b not necessariliy the same as the number of bars)
// we could have on bar in position 1, and one bar in position 5 then there are two
// bars but the number of bar positions is 5
- var $iVertLines=-1;
+ public $actinfo;
+ public $iTopPlotMargin=10,$iBottomPlotMargin=15;
+ public $iVertLines=-1;
+ public $iVertHeaderSize=-1;
// The width of the labels (defaults to the widest of all labels)
- var $iLabelWidth;
+ private $iLabelWidth;
// Out image to stroke the scale to
- var $iImg;
- var $iTableHeaderBackgroundColor="white",$iTableHeaderFrameColor="black";
- var $iTableHeaderFrameWeight=1;
- var $iAvailableHeight=-1,$iVertSpacing=-1,$iVertHeaderSize=-1;
- var $iDateLocale;
- var $iVertLayout=GANTT_EVEN;
- var $iTopPlotMargin=10,$iBottomPlotMargin=15;
- var $iUsePlotWeekendBackground=true;
- var $iWeekStart = 1; // Default to have weekends start on Monday
- var $actinfo;
-
-//---------------
-// CONSTRUCTOR
- function GanttScale(&$aImg) {
- $this->iImg = &$aImg;
- $this->iDateLocale = new DateLocale();
-
- $this->minute = new HeaderProperty();
- $this->minute->SetIntervall(15);
- $this->minute->SetLabelFormatString('i');
- $this->minute->SetFont(FF_FONT0);
- $this->minute->grid->SetColor("gray");
-
- $this->hour = new HeaderProperty();
- $this->hour->SetFont(FF_FONT0);
- $this->hour->SetIntervall(6);
- $this->hour->SetStyle(HOURSTYLE_HM24);
- $this->hour->SetLabelFormatString('H:i');
- $this->hour->grid->SetColor("gray");
-
- $this->day = new HeaderProperty();
- $this->day->grid->SetColor("gray");
- $this->day->SetLabelFormatString('l');
-
- $this->week = new HeaderProperty();
- $this->week->SetLabelFormatString("w%d");
- $this->week->SetFont(FF_FONT1);
-
- $this->month = new HeaderProperty();
- $this->month->SetFont(FF_FONT1,FS_BOLD);
-
- $this->year = new HeaderProperty();
- $this->year->SetFont(FF_FONT1,FS_BOLD);
-
- $this->divider=new LineProperty();
- $this->dividerh=new LineProperty();
- $this->dividerh->SetWeight(2);
- $this->divider->SetWeight(6);
- $this->divider->SetColor('gray');
- $this->divider->SetStyle('fancy');
-
- $this->tableTitle=new TextProperty();
- $this->tableTitle->Show(false);
- $this->actinfo = new GanttActivityInfo();
- }
-
-//---------------
-// PUBLIC METHODS
+ private $iImg;
+ private $iTableHeaderBackgroundColor="white",$iTableHeaderFrameColor="black";
+ private $iTableHeaderFrameWeight=1;
+ private $iAvailableHeight=-1,$iVertSpacing=-1;
+ private $iDateLocale;
+ private $iVertLayout=GANTT_EVEN;
+ private $iUsePlotWeekendBackground=true;
+ private $iWeekStart = 1; // Default to have weekends start on Monday
+
+ //---------------
+ // CONSTRUCTOR
+ function __construct($aImg) {
+ $this->iImg = $aImg;
+ $this->iDateLocale = new DateLocale();
+
+ $this->minute = new HeaderProperty();
+ $this->minute->SetIntervall(15);
+ $this->minute->SetLabelFormatString('i');
+ $this->minute->SetFont(FF_FONT0);
+ $this->minute->grid->SetColor("gray");
+
+ $this->hour = new HeaderProperty();
+ $this->hour->SetFont(FF_FONT0);
+ $this->hour->SetIntervall(6);
+ $this->hour->SetStyle(HOURSTYLE_HM24);
+ $this->hour->SetLabelFormatString('H:i');
+ $this->hour->grid->SetColor("gray");
+
+ $this->day = new HeaderProperty();
+ $this->day->grid->SetColor("gray");
+ $this->day->SetLabelFormatString('l');
+
+ $this->week = new HeaderProperty();
+ $this->week->SetLabelFormatString("w%d");
+ $this->week->SetFont(FF_FONT1);
+
+ $this->month = new HeaderProperty();
+ $this->month->SetFont(FF_FONT1,FS_BOLD);
+
+ $this->year = new HeaderProperty();
+ $this->year->SetFont(FF_FONT1,FS_BOLD);
+
+ $this->divider=new LineProperty();
+ $this->dividerh=new LineProperty();
+ $this->dividerh->SetWeight(2);
+ $this->divider->SetWeight(6);
+ $this->divider->SetColor('gray');
+ $this->divider->SetStyle('fancy');
+
+ $this->tableTitle=new TextProperty();
+ $this->tableTitle->Show(false);
+ $this->actinfo = new GanttActivityInfo();
+ }
+
+ //---------------
+ // PUBLIC METHODS
// Specify what headers should be visible
function ShowHeaders($aFlg) {
- $this->day->Show($aFlg & GANTT_HDAY);
- $this->week->Show($aFlg & GANTT_HWEEK);
- $this->month->Show($aFlg & GANTT_HMONTH);
- $this->year->Show($aFlg & GANTT_HYEAR);
- $this->hour->Show($aFlg & GANTT_HHOUR);
- $this->minute->Show($aFlg & GANTT_HMIN);
-
- // Make some default settings of gridlines whihc makes sense
- if( $aFlg & GANTT_HWEEK ) {
- $this->month->grid->Show(false);
- $this->year->grid->Show(false);
- }
- if( $aFlg & GANTT_HHOUR ) {
- $this->day->grid->SetColor("black");
- }
+ $this->day->Show($aFlg & GANTT_HDAY);
+ $this->week->Show($aFlg & GANTT_HWEEK);
+ $this->month->Show($aFlg & GANTT_HMONTH);
+ $this->year->Show($aFlg & GANTT_HYEAR);
+ $this->hour->Show($aFlg & GANTT_HHOUR);
+ $this->minute->Show($aFlg & GANTT_HMIN);
+
+ // Make some default settings of gridlines whihc makes sense
+ if( $aFlg & GANTT_HWEEK ) {
+ $this->month->grid->Show(false);
+ $this->year->grid->Show(false);
+ }
+ if( $aFlg & GANTT_HHOUR ) {
+ $this->day->grid->SetColor("black");
+ }
}
-
+
// Should the weekend background stretch all the way down in the plotarea
function UseWeekendBackground($aShow) {
- $this->iUsePlotWeekendBackground = $aShow;
+ $this->iUsePlotWeekendBackground = $aShow;
}
-
+
// Have a range been specified?
function IsRangeSet() {
- return $this->iStartDate!=-1 && $this->iEndDate!=-1;
+ return $this->iStartDate!=-1 && $this->iEndDate!=-1;
}
-
+
// Should the layout be from top or even?
function SetVertLayout($aLayout) {
- $this->iVertLayout = $aLayout;
+ $this->iVertLayout = $aLayout;
}
-
+
// Which locale should be used?
function SetDateLocale($aLocale) {
- $this->iDateLocale->Set($aLocale);
+ $this->iDateLocale->Set($aLocale);
}
-
+
// Number of days we are showing
function GetNumberOfDays() {
- return round(($this->iEndDate-$this->iStartDate)/SECPERDAY);
+ return round(($this->iEndDate-$this->iStartDate)/SECPERDAY);
}
-
+
// The width of the actual plot area
function GetPlotWidth() {
- $img=$this->iImg;
- return $img->width - $img->left_margin - $img->right_margin;
+ $img=$this->iImg;
+ return $img->width - $img->left_margin - $img->right_margin;
}
// Specify the width of the titles(labels) for the activities
// (This is by default set to the minimum width enought for the
// widest title)
function SetLabelWidth($aLabelWidth) {
- $this->iLabelWidth=$aLabelWidth;
+ $this->iLabelWidth=$aLabelWidth;
}
- // Which day should the week start?
- // 0==Sun, 1==Monday, 2==Tuesday etc
+ // Which day should the week start?
+ // 0==Sun, 1==Monday, 2==Tuesday etc
function SetWeekStart($aStartDay) {
- $this->iWeekStart = $aStartDay % 7;
-
- //Recalculate the startday since this will change the week start
- $this->SetRange($this->iStartDate,$this->iEndDate);
+ $this->iWeekStart = $aStartDay % 7;
+
+ //Recalculate the startday since this will change the week start
+ $this->SetRange($this->iStartDate,$this->iEndDate);
}
// Do we show min scale?
function IsDisplayMinute() {
- return $this->minute->iShowLabels;
+ return $this->minute->iShowLabels;
}
// Do we show day scale?
function IsDisplayHour() {
- return $this->hour->iShowLabels;
+ return $this->hour->iShowLabels;
}
-
+
// Do we show day scale?
function IsDisplayDay() {
- return $this->day->iShowLabels;
+ return $this->day->iShowLabels;
}
-
+
// Do we show week scale?
function IsDisplayWeek() {
- return $this->week->iShowLabels;
+ return $this->week->iShowLabels;
}
-
+
// Do we show month scale?
function IsDisplayMonth() {
- return $this->month->iShowLabels;
+ return $this->month->iShowLabels;
}
-
+
// Do we show year scale?
function IsDisplayYear() {
- return $this->year->iShowLabels;
+ return $this->year->iShowLabels;
}
// Specify spacing (in percent of bar height) between activity bars
function SetVertSpacing($aSpacing) {
- $this->iVertSpacing = $aSpacing;
+ $this->iVertSpacing = $aSpacing;
}
// Specify scale min and max date either as timestamp or as date strings
// Always round to the nearest week boundary
function SetRange($aMin,$aMax) {
- $this->iStartDate = $this->NormalizeDate($aMin);
- $this->iEndDate = $this->NormalizeDate($aMax);
+ $this->iStartDate = $this->NormalizeDate($aMin);
+ $this->iEndDate = $this->NormalizeDate($aMax);
}
@@ -2019,890 +2122,895 @@
// of the week taking the specified week start day into account.
function AdjustStartEndDay() {
- if( !($this->IsDisplayYear() ||$this->IsDisplayMonth() || $this->IsDisplayWeek()) ) {
- // Don't adjust
- return;
- }
-
- // Get day in week for start and ending date (Sun==0)
- $ds=strftime("%w",$this->iStartDate);
- $de=strftime("%w",$this->iEndDate);
-
- // We want to start on iWeekStart day. But first we subtract a week
- // if the startdate is "behind" the day the week start at.
- // This way we ensure that the given start date is always included
- // in the range. If we don't do this the nearest correct weekday in the week
- // to start at might be later than the start date.
- if( $ds < $this->iWeekStart )
- $d = strtotime('-7 day',$this->iStartDate);
- else
- $d = $this->iStartDate;
- $adjdate = strtotime(($this->iWeekStart-$ds).' day',$d /*$this->iStartDate*/ );
- $this->iStartDate = $adjdate;
-
- // We want to end on the last day of the week
- $preferredEndDay = ($this->iWeekStart+6)%7;
- if( $preferredEndDay != $de ) {
- // Solve equivalence eq: $de + x ~ $preferredDay (mod 7)
- $adj = (7+($preferredEndDay - $de)) % 7;
- $adjdate = strtotime("+$adj day",$this->iEndDate);
- $this->iEndDate = $adjdate;
- }
+ if( !($this->IsDisplayYear() ||$this->IsDisplayMonth() || $this->IsDisplayWeek()) ) {
+ // Don't adjust
+ return;
+ }
+
+ // Get day in week for start and ending date (Sun==0)
+ $ds=strftime("%w",$this->iStartDate);
+ $de=strftime("%w",$this->iEndDate);
+
+ // We want to start on iWeekStart day. But first we subtract a week
+ // if the startdate is "behind" the day the week start at.
+ // This way we ensure that the given start date is always included
+ // in the range. If we don't do this the nearest correct weekday in the week
+ // to start at might be later than the start date.
+ if( $ds < $this->iWeekStart )
+ $d = strtotime('-7 day',$this->iStartDate);
+ else
+ $d = $this->iStartDate;
+ $adjdate = strtotime(($this->iWeekStart-$ds).' day',$d /*$this->iStartDate*/ );
+ $this->iStartDate = $adjdate;
+
+ // We want to end on the last day of the week
+ $preferredEndDay = ($this->iWeekStart+6)%7;
+ if( $preferredEndDay != $de ) {
+ // Solve equivalence eq: $de + x ~ $preferredDay (mod 7)
+ $adj = (7+($preferredEndDay - $de)) % 7;
+ $adjdate = strtotime("+$adj day",$this->iEndDate);
+ $this->iEndDate = $adjdate;
+ }
}
- // Specify background for the table title area (upper left corner of the table)
+ // Specify background for the table title area (upper left corner of the table)
function SetTableTitleBackground($aColor) {
- $this->iTableHeaderBackgroundColor = $aColor;
+ $this->iTableHeaderBackgroundColor = $aColor;
}
-///////////////////////////////////////
-// PRIVATE Methods
-
+ ///////////////////////////////////////
+ // PRIVATE Methods
+
// Determine the height of all the scale headers combined
function GetHeaderHeight() {
- $img=$this->iImg;
- $height=1;
- if( $this->minute->iShowLabels ) {
- $height += $this->minute->GetFontHeight($img);
- $height += $this->minute->iTitleVertMargin;
- }
- if( $this->hour->iShowLabels ) {
- $height += $this->hour->GetFontHeight($img);
- $height += $this->hour->iTitleVertMargin;
- }
- if( $this->day->iShowLabels ) {
- $height += $this->day->GetFontHeight($img);
- $height += $this->day->iTitleVertMargin;
- }
- if( $this->week->iShowLabels ) {
- $height += $this->week->GetFontHeight($img);
- $height += $this->week->iTitleVertMargin;
- }
- if( $this->month->iShowLabels ) {
- $height += $this->month->GetFontHeight($img);
- $height += $this->month->iTitleVertMargin;
- }
- if( $this->year->iShowLabels ) {
- $height += $this->year->GetFontHeight($img);
- $height += $this->year->iTitleVertMargin;
- }
- return $height;
+ $img=$this->iImg;
+ $height=1;
+ if( $this->minute->iShowLabels ) {
+ $height += $this->minute->GetFontHeight($img);
+ $height += $this->minute->iTitleVertMargin;
+ }
+ if( $this->hour->iShowLabels ) {
+ $height += $this->hour->GetFontHeight($img);
+ $height += $this->hour->iTitleVertMargin;
+ }
+ if( $this->day->iShowLabels ) {
+ $height += $this->day->GetFontHeight($img);
+ $height += $this->day->iTitleVertMargin;
+ }
+ if( $this->week->iShowLabels ) {
+ $height += $this->week->GetFontHeight($img);
+ $height += $this->week->iTitleVertMargin;
+ }
+ if( $this->month->iShowLabels ) {
+ $height += $this->month->GetFontHeight($img);
+ $height += $this->month->iTitleVertMargin;
+ }
+ if( $this->year->iShowLabels ) {
+ $height += $this->year->GetFontHeight($img);
+ $height += $this->year->iTitleVertMargin;
+ }
+ return $height;
}
-
+
// Get width (in pixels) for a single day
function GetDayWidth() {
- return ($this->GetPlotWidth()-$this->iLabelWidth+1)/$this->GetNumberOfDays();
+ return ($this->GetPlotWidth()-$this->iLabelWidth+1)/$this->GetNumberOfDays();
}
// Get width (in pixels) for a single hour
function GetHourWidth() {
- return $this->GetDayWidth() / 24 ;
+ return $this->GetDayWidth() / 24 ;
}
function GetMinuteWidth() {
- return $this->GetHourWidth() / 60 ;
+ return $this->GetHourWidth() / 60 ;
}
// Nuber of days in a year
function GetNumDaysInYear($aYear) {
- if( $this->IsLeap($aYear) )
- return 366;
- else
- return 365;
+ if( $this->IsLeap($aYear) )
+ return 366;
+ else
+ return 365;
}
-
- // Get week number
+
+ // Get week number
function GetWeekNbr($aDate,$aSunStart=true) {
- // We can't use the internal strftime() since it gets the weeknumber
- // wrong since it doesn't follow ISO on all systems since this is
- // system linrary dependent.
- // Even worse is that this works differently if we are on a Windows
- // or UNIX box (it even differs between UNIX boxes how strftime()
- // is natively implemented)
- //
- // Credit to Nicolas Hoizey Most likely you have some text in your script before the call to Graph::Stroke(). If this texts gets sent back to the browser the browser will assume that all data is plain text. Look for any text, even spaces and newlines, that might have been sent back to the browser. For example it is a common mistake to leave a blank line before the opening \"<?php\". Wahrscheinlich steht Text im Skript bevor Graph::Stroke() aufgerufen wird. Wenn dieser Text zum Browser gesendet wird, nimmt dieser an, dass die gesamten Daten aus Text bestehen. Such nach irgendwelchem Text, auch nach Leerzeichen und Zeilenumbrüchen, die eventuell bereits zum Browser gesendet wurden. Zum Beispiel ist ein oft auftretender Fehler, eine Leerzeile am Anfang der Datei oder vor Graph::Stroke() zu lassen."<?php". Wahrscheinlich steht Text im Skript bevor Graph::Stroke() aufgerufen wird. Wenn dieser Text zum Browser gesendet wird, nimmt dieser an, dass die gesamten Daten aus Text bestehen. Such nach irgendwelchem Text, auch nach Leerzeichen und Zeilenumbrüchen, die eventuell bereits zum Browser gesendet wurden. Zum Beispiel ist ein oft auftretender Fehler, eine Leerzeile am Anfang der Datei oder vor Graph::Stroke() zu lassen."<?php". Most likely you have some text in your script before the call to Graph::Stroke(). If this texts gets sent back to the browser the browser will assume that all data is plain text. Look for any text, even spaces and newlines, that might have been sent back to the browser. For example it is a common mistake to leave a blank line before the opening "<?php". Most likely you have some text in your script before the call to Graph::Stroke(). If this texts gets sent back to the browser the browser will assume that all data is plain text. Look for any text, even spaces and newlines, that might have been sent back to the browser. For example it is a common mistake to leave a blank line before the opening "<?php".
";
+ if( $i % $numcolumns == 0 ) {
+ $rows++;
+ $rowheight[$rows-1] = 0;
+ }
+ $rowheight[$rows-1] = max($rowheight[$rows-1],$h);
+ }
+
+ $abs_height = 0;
+ for( $i=0; $i < $rows; ++$i ) {
+ $abs_height += $rowheight[$i] ;
+ }
+
+ // Make sure that the height is at least as high as mark size + ymargin
+ $abs_height = max($abs_height,$this->mark_abs_vsize);
+ $abs_height += $this->ybottom_margin;
+
+ // Find out the maximum width in each column
+ for( $i=$numcolumns; $i < $n; ++$i ) {
+ $colwidth[$i % $numcolumns] = max(
+ $aImg->GetTextWidth($this->txtcol[$i][0])+2*$this->xmargin+2*$this->mark_abs_hsize,
+ $colwidth[$i % $numcolumns]);
+ }
+
+ // Get the total width
+ $mtw = 0;
+ for( $i=0; $i < $numcolumns; ++$i ) {
+ $mtw += $colwidth[$i] ;
+ }
+
+ // remove the last rows interpace margin (since there is no next row)
+ $abs_height -= $this->ylinespacing;
+
+
+ // Find out maximum width we need for legend box
+ $abs_width = $mtw+$this->xlmargin+($numcolumns-1)*$this->mark_abs_hsize;
+
+ if( $this->xabspos === -1 && $this->yabspos === -1 ) {
+ $this->xabspos = $this->xpos*$aImg->width ;
+ $this->yabspos = $this->ypos*$aImg->height ;
+ }
+
+ // Positioning of the legend box
+ if( $this->halign == 'left' ) {
+ $xp = $this->xabspos;
+ }
+ elseif( $this->halign == 'center' ) {
+ $xp = $this->xabspos - $abs_width/2;
+ }
+ else {
+ $xp = $aImg->width - $this->xabspos - $abs_width;
+ }
+
+ $yp=$this->yabspos;
+ if( $this->valign == 'center' ) {
+ $yp-=$abs_height/2;
+ }
+ elseif( $this->valign == 'bottom' ) {
+ $yp-=$abs_height;
+ }
+
+ // Stroke legend box
+ $aImg->SetColor($this->color);
+ $aImg->SetLineWeight($this->frameweight);
+ $aImg->SetLineStyle('solid');
+
+ if( $this->shadow ) {
+ $aImg->ShadowRectangle($xp,$yp,
+ $xp+$abs_width+$this->shadow_width+2,
+ $yp+$abs_height+$this->shadow_width+2,
+ $this->fill_color,$this->shadow_width+2,$this->shadow_color);
+ }
+ else {
+ $aImg->SetColor($this->fill_color);
+ $aImg->FilledRectangle($xp,$yp,$xp+$abs_width,$yp+$abs_height);
+ $aImg->SetColor($this->color);
+ $aImg->Rectangle($xp,$yp,$xp+$abs_width,$yp+$abs_height);
+ }
+
+ if( $this->bkg_gradtype >= 0 ) {
+ $grad = new Gradient($aImg);
+ $grad->FilledRectangle($xp+1, $yp+1,
+ $xp+$abs_width-3, $yp+$abs_height-3,
+ $this->bkg_gradfrom, $this->bkg_gradto,
+ $this->bkg_gradtype);
+ }
+
+ // x1,y1 is the position for the legend marker + text
+ // The vertical position is the baseline position for the text
+ // and every marker is adjusted acording to that.
+
+ // For multiline texts this get more complicated.
+
+ $x1 = $xp + $this->xlmargin;
+ $y1 = $yp + $rowheight[0] - $this->ylinespacing + 2 ; // The ymargin is included in rowheight
+
+ // Now, y1 is the bottom vertical position of the first legend, i.e if
+ // the legend has multiple lines it is the bottom line.
+
+ $grad = new Gradient($aImg);
+ $patternFactory = null;
+
+ // Now stroke each legend in turn
+ // Each plot has added the following information to the legend
+ // p[0] = Legend text
+ // p[1] = Color,
+ // p[2] = For markers a reference to the PlotMark object
+ // p[3] = For lines the line style, for gradient the negative gradient style
+ // p[4] = CSIM target
+ // p[5] = CSIM Alt text
+ $i = 1 ; $row = 0;
+ foreach($this->txtcol as $p) {
+
+ // STROKE DEBUG BOX
+ if( _JPG_DEBUG ) {
+ $aImg->SetLineWeight(1);
+ $aImg->SetColor('red');
+ $aImg->SetLineStyle('solid');
+ $aImg->Rectangle($x1,$y1,$xp+$abs_width-1,$y1-$rowheight[$row]);
+ }
+
+ $aImg->SetLineWeight($this->weight);
+ $x1 = round($x1)+1; // We add one to not collide with the border
+ $y1=round($y1);
+
+ // This is the center offset up from the baseline which is
+ // considered the "center" of the marks. This gets slightly complicated since
+ // we need to consider if the text is a multiline paragraph or if it is only
+ // a single line. The reason is that for single line the y1 corresponds to the baseline
+ // and that is fine. However for a multiline paragraph there is no single baseline
+ // and in that case the y1 corresponds to the lowest y for the bounding box. In that
+ // case we center the mark in the middle of the paragraph
+ if( !preg_match('/\n/',$p[0]) ) {
+ // Single line
+ $marky = ceil($y1-$this->mark_abs_vsize/2)-1;
+ } else {
+ // Paragraph
+ $marky = $y1 - $aImg->GetTextHeight($p[0])/2;
+
+ // echo "y1=$y1, p[o]={$p[0]}, marky=$marky
";
+ }
+
+ //echo "
Mark #$i: marky=$marky
";
+
+ $x1 += $this->mark_abs_hsize;
+
+ if ( !empty($p[2]) && $p[2]->GetType() > -1 ) {
+
+
+ // Make a plot mark legend. This is constructed with a mark which
+ // is run through with a line
+
+ // First construct a bit of the line that looks exactly like the
+ // line in the plot
+ $aImg->SetColor($p[1]);
+ if( is_string($p[3]) || $p[3]>0 ) {
+ $aImg->SetLineStyle($p[3]);
+ $aImg->StyleLine($x1-$this->mark_abs_hsize,$marky,$x1+$this->mark_abs_hsize,$marky);
+ }
+
+ // Stroke a mark with the standard size
+ // (As long as it is not an image mark )
+ if( $p[2]->GetType() != MARK_IMG ) {
+
+ // Clear any user callbacks since we ont want them called for
+ // the legend marks
+ $p[2]->iFormatCallback = '';
+ $p[2]->iFormatCallback2 = '';
+
+ // Since size for circles is specified as the radius
+ // this means that we must half the size to make the total
+ // width behave as the other marks
+ if( $p[2]->GetType() == MARK_FILLEDCIRCLE || $p[2]->GetType() == MARK_CIRCLE ) {
+ $p[2]->SetSize(min($this->mark_abs_vsize,$this->mark_abs_hsize)/2);
+ $p[2]->Stroke($aImg,$x1,$marky);
+ }
+ else {
+ $p[2]->SetSize(min($this->mark_abs_vsize,$this->mark_abs_hsize));
+ $p[2]->Stroke($aImg,$x1,$marky);
+ }
+ }
+ }
+ elseif ( !empty($p[2]) && (is_string($p[3]) || $p[3]>0 ) ) {
+ // Draw a styled line
+ $aImg->SetColor($p[1]);
+ $aImg->SetLineStyle($p[3]);
+ $aImg->StyleLine($x1-$this->mark_abs_hsize,$marky,$x1+$this->mark_abs_hsize,$marky);
+ $aImg->StyleLine($x1-$this->mark_abs_hsize,$marky+1,$x1+$this->mark_abs_hsize,$marky+1);
+ }
+ else {
+ // Draw a colored box
+ $color = $p[1] ;
+
+ // We make boxes slightly larger to better show
+ $boxsize = max($this->mark_abs_vsize,$this->mark_abs_hsize) + 2 ;
+
+ $ym = $marky-ceil($boxsize/2) ; // Marker y-coordinate
+
+ // We either need to plot a gradient or a
+ // pattern. To differentiate we use a kludge.
+ // Patterns have a p[3] value of < -100
+ if( $p[3] < -100 ) {
+ // p[1][0] == iPattern, p[1][1] == iPatternColor, p[1][2] == iPatternDensity
+ if( $patternFactory == null ) {
+ $patternFactory = new RectPatternFactory();
+ }
+ $prect = $patternFactory->Create($p[1][0],$p[1][1],1);
+ $prect->SetBackground($p[1][3]);
+ $prect->SetDensity($p[1][2]+1);
+ $prect->SetPos(new Rectangle($x1,$ym,$boxsize,$boxsize));
+ $prect->Stroke($aImg);
+ $prect=null;
+ }
+ else {
+ if( is_array($color) && count($color)==2 ) {
+ // The client want a gradient color
+ $grad->FilledRectangle($x1-$boxsize/2,$ym,
+ $x1+$boxsize/2,$ym+$boxsize,
+ $color[0],$color[1],-$p[3]);
+ }
+ else {
+ $aImg->SetColor($p[1]);
+ $aImg->FilledRectangle($x1-$boxsize/2,$ym,
+ $x1+$boxsize/2,$ym+$boxsize);
+ }
+ $aImg->SetColor($this->color);
+ $aImg->SetLineWeight($fillBoxFrameWeight);
+ $aImg->Rectangle($x1-$boxsize/2,$ym,
+ $x1+$boxsize/2,$ym+$boxsize);
+ }
+ }
+ $aImg->SetColor($this->font_color);
+ $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $aImg->SetTextAlign('left','baseline');
+
+ $debug=false;
+ $aImg->StrokeText($x1+$this->mark_abs_hsize+$this->xmargin,$y1,$p[0],
+ 0,'left',$debug);
+
+ // Add CSIM for Legend if defined
+ if( !empty($p[4]) ) {
+
+ $xs = $x1 - $this->mark_abs_hsize ;
+ $ys = $y1 + 1 ;
+ $xe = $x1 + $aImg->GetTextWidth($p[0]) + $this->mark_abs_hsize + $this->xmargin ;
+ $ye = $y1-$rowheight[$row]+1;
+ $coords = "$xs,$ys,$xe,$y1,$xe,$ye,$xs,$ye";
+ if( ! empty($p[4]) ) {
+ $this->csimareas .= "csimareas .= " target=\"".$p[6]."\"";
+ }
+
+ if( !empty($p[5]) ) {
+ $tmp=sprintf($p[5],$p[0]);
+ $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
+ }
+ $this->csimareas .= " />\n";
+ }
+ }
+
+ if( $i >= $this->layout_n ) {
+ $x1 = $xp+$this->xlmargin;
+ $row++;
+ if( !empty($rowheight[$row]) )
+ $y1 += $rowheight[$row];
+ $i = 1;
+ }
+ else {
+ $x1 += $colwidth[($i-1) % $numcolumns] ;
+ ++$i;
+ }
+ }
+ }
+} // Class
+
+?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_line.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_line.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_line.php 2008-03-24 07:51:47.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_line.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,13 +1,13 @@
Plot($datay,$datax);
- $this->mark = new PlotMark();
- }
-//---------------
-// PUBLIC METHODS
-
- // Set style, filled or open
- function SetFilled($aFlag=true) {
- JpGraphError::RaiseL(10001);//('LinePlot::SetFilled() is deprecated. Use SetFillColor()');
+ public $mark=null;
+ protected $filled=false;
+ protected $fill_color='blue';
+ protected $step_style=false, $center=false;
+ protected $line_style=1; // Default to solid
+ protected $filledAreas = array(); // array of arrays(with min,max,col,filled in them)
+ public $barcenter=false; // When we mix line and bar. Should we center the line in the bar.
+ protected $fillFromMin = false, $fillFromMax = false;
+ protected $fillgrad=false,$fillgrad_fromcolor='navy',$fillgrad_tocolor='silver',$fillgrad_numcolors=100;
+ protected $iFastStroke=false;
+
+ //---------------
+ // CONSTRUCTOR
+ function LinePlot($datay,$datax=false) {
+ parent::__construct($datay,$datax);
+ $this->mark = new PlotMark() ;
+ $this->color = ColorFactory::getColor();
+ $this->fill_color = $this->color;
}
-
+ //---------------
+ // PUBLIC METHODS
+
+ function SetFilled($aFlg=true) {
+ $this->filled = $aFlg;
+ }
+
function SetBarCenter($aFlag=true) {
- $this->barcenter=$aFlag;
+ $this->barcenter=$aFlag;
}
function SetStyle($aStyle) {
- $this->line_style=$aStyle;
+ $this->line_style=$aStyle;
}
-
+
function SetStepStyle($aFlag=true) {
- $this->step_style = $aFlag;
+ $this->step_style = $aFlag;
}
-
+
function SetColor($aColor) {
- parent::SetColor($aColor);
+ parent::SetColor($aColor);
}
-
+
function SetFillFromYMin($f=true) {
- $this->fillFromMin = $f ;
+ $this->fillFromMin = $f ;
+ }
+
+ function SetFillFromYMax($f=true) {
+ $this->fillFromMax = $f ;
}
-
+
function SetFillColor($aColor,$aFilled=true) {
- $this->fill_color=$aColor;
- $this->filled=$aFilled;
+ //$this->color = $aColor;
+ $this->fill_color=$aColor;
+ $this->filled=$aFilled;
}
function SetFillGradient($aFromColor,$aToColor,$aNumColors=100,$aFilled=true) {
- $this->fillgrad_fromcolor = $aFromColor;
- $this->fillgrad_tocolor = $aToColor;
- $this->fillgrad_numcolors = $aNumColors;
- $this->filled = $aFilled;
- $this->fillgrad = true;
- }
-
- function Legend(&$graph) {
- if( $this->legend!="" ) {
- if( $this->filled && !$this->fillgrad ) {
- $graph->legend->Add($this->legend,
- $this->fill_color,$this->mark,0,
- $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
- }
- elseif( $this->fillgrad ) {
- $color=array($this->fillgrad_fromcolor,$this->fillgrad_tocolor);
- // In order to differentiate between gradients and cooors specified as an RGB triple
- $graph->legend->Add($this->legend,$color,"",-2 /* -GRAD_HOR */,
- $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
- }
- else {
- $graph->legend->Add($this->legend,
- $this->color,$this->mark,$this->line_style,
- $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
- }
- }
+ $this->fillgrad_fromcolor = $aFromColor;
+ $this->fillgrad_tocolor = $aToColor;
+ $this->fillgrad_numcolors = $aNumColors;
+ $this->filled = $aFilled;
+ $this->fillgrad = true;
+ }
+
+ function Legend($graph) {
+ if( $this->legend!="" ) {
+ if( $this->filled && !$this->fillgrad ) {
+ $graph->legend->Add($this->legend,
+ $this->fill_color,$this->mark,0,
+ $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ }
+ elseif( $this->fillgrad ) {
+ $color=array($this->fillgrad_fromcolor,$this->fillgrad_tocolor);
+ // In order to differentiate between gradients and cooors specified as an RGB triple
+ $graph->legend->Add($this->legend,$color,"",-2 /* -GRAD_HOR */,
+ $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ } else {
+ $graph->legend->Add($this->legend,
+ $this->color,$this->mark,$this->line_style,
+ $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ }
+ }
}
function AddArea($aMin=0,$aMax=0,$aFilled=LP_AREA_NOT_FILLED,$aColor="gray9",$aBorder=LP_AREA_BORDER) {
- if($aMin > $aMax) {
- // swap
- $tmp = $aMin;
- $aMin = $aMax;
- $aMax = $tmp;
- }
- $this->filledAreas[] = array($aMin,$aMax,$aColor,$aFilled,$aBorder);
+ if($aMin > $aMax) {
+ // swap
+ $tmp = $aMin;
+ $aMin = $aMax;
+ $aMax = $tmp;
+ }
+ $this->filledAreas[] = array($aMin,$aMax,$aColor,$aFilled,$aBorder);
}
-
+
// Gets called before any axis are stroked
- function PreStrokeAdjust(&$graph) {
+ function PreStrokeAdjust($graph) {
- // If another plot type have already adjusted the
- // offset we don't touch it.
- // (We check for empty in case the scale is a log scale
- // and hence doesn't contain any xlabel_offset)
- if( empty($graph->xaxis->scale->ticks->xlabel_offset) ||
- $graph->xaxis->scale->ticks->xlabel_offset == 0 ) {
- if( $this->center ) {
- ++$this->numpoints;
- $a=0.5; $b=0.5;
- } else {
- $a=0; $b=0;
- }
- $graph->xaxis->scale->ticks->SetXLabelOffset($a);
- $graph->SetTextScaleOff($b);
- //$graph->xaxis->scale->ticks->SupressMinorTickMarks();
- }
+ // If another plot type have already adjusted the
+ // offset we don't touch it.
+ // (We check for empty in case the scale is a log scale
+ // and hence doesn't contain any xlabel_offset)
+ if( empty($graph->xaxis->scale->ticks->xlabel_offset) || $graph->xaxis->scale->ticks->xlabel_offset == 0 ) {
+ if( $this->center ) {
+ ++$this->numpoints;
+ $a=0.5; $b=0.5;
+ } else {
+ $a=0; $b=0;
+ }
+ $graph->xaxis->scale->ticks->SetXLabelOffset($a);
+ $graph->SetTextScaleOff($b);
+ //$graph->xaxis->scale->ticks->SupressMinorTickMarks();
+ }
}
function SetFastStroke($aFlg=true) {
- $this->iFastStroke = $aFlg;
+ $this->iFastStroke = $aFlg;
}
- function FastStroke(&$img,&$xscale,&$yscale,$aStartPoint=0,$exist_x=true) {
- // An optimized stroke for many data points with no extra
- // features but 60% faster. You can't have values or line styles, or null
- // values in plots.
- $numpoints=count($this->coords[0]);
- if( $this->barcenter )
- $textadj = 0.5-$xscale->text_scale_off;
- else
- $textadj = 0;
-
- $img->SetColor($this->color);
- $img->SetLineWeight($this->weight);
- $pnts=$aStartPoint;
- while( $pnts < $numpoints ) {
- if( $exist_x ) $x=$this->coords[1][$pnts];
- else $x=$pnts+$textadj;
- $xt = $xscale->Translate($x);
- $y=$this->coords[0][$pnts];
- $yt = $yscale->Translate($y);
- if( is_numeric($y) ) {
- $cord[] = $xt;
- $cord[] = $yt;
- }
- elseif( $y == '-' && $pnts > 0 ) {
- // Just ignore
- }
- else {
- JpGraphError::RaiseL(10002);//('Plot too complicated for fast line Stroke. Use standard Stroke()');
- return;
- }
- ++$pnts;
- } // WHILE
-
- $img->Polygon($cord,false,true);
-
- }
-
- function Stroke(&$img,&$xscale,&$yscale) {
- $idx=0;
- $numpoints=count($this->coords[0]);
- if( isset($this->coords[1]) ) {
- if( count($this->coords[1])!=$numpoints )
- JpGraphError::RaiseL(2003,count($this->coords[1]),$numpoints);
-//("Number of X and Y points are not equal. Number of X-points:".count($this->coords[1])." Number of Y-points:$numpoints");
- else
- $exist_x = true;
- }
- else
- $exist_x = false;
-
- if( $this->barcenter )
- $textadj = 0.5-$xscale->text_scale_off;
- else
- $textadj = 0;
-
- // Find the first numeric data point
- $startpoint=0;
- while( $startpoint < $numpoints && !is_numeric($this->coords[0][$startpoint]) )
- ++$startpoint;
-
- // Bail out if no data points
- if( $startpoint == $numpoints )
- return;
-
- if( $this->iFastStroke ) {
- $this->FastStroke($img,$xscale,$yscale,$startpoint,$exist_x);
- return;
- }
-
- if( $exist_x )
- $xs=$this->coords[1][$startpoint];
- else
- $xs= $textadj+$startpoint;
-
- $img->SetStartPoint($xscale->Translate($xs),
- $yscale->Translate($this->coords[0][$startpoint]));
-
- if( $this->filled ) {
- $min = $yscale->GetMinVal();
- if( $min > 0 || $this->fillFromMin )
- $fillmin = $yscale->scale_abs[0];//Translate($min);
- else
- $fillmin = $yscale->Translate(0);
-
- $cord[$idx++] = $xscale->Translate($xs);
- $cord[$idx++] = $fillmin;
- }
- $xt = $xscale->Translate($xs);
- $yt = $yscale->Translate($this->coords[0][$startpoint]);
- $cord[$idx++] = $xt;
- $cord[$idx++] = $yt;
- $yt_old = $yt;
- $xt_old = $xt;
- $y_old = $this->coords[0][$startpoint];
-
- $this->value->Stroke($img,$this->coords[0][$startpoint],$xt,$yt);
-
- $img->SetColor($this->color);
- $img->SetLineWeight($this->weight);
- $img->SetLineStyle($this->line_style);
- $pnts=$startpoint+1;
- $firstnonumeric = false;
- while( $pnts < $numpoints ) {
-
- if( $exist_x ) $x=$this->coords[1][$pnts];
- else $x=$pnts+$textadj;
- $xt = $xscale->Translate($x);
- $yt = $yscale->Translate($this->coords[0][$pnts]);
-
- $y=$this->coords[0][$pnts];
- if( $this->step_style ) {
- // To handle null values within step style we need to record the
- // first non numeric value so we know from where to start if the
- // non value is '-'.
- if( is_numeric($y) ) {
- $firstnonumeric = false;
- if( is_numeric($y_old) ) {
- $img->StyleLine($xt_old,$yt_old,$xt,$yt_old);
- $img->StyleLine($xt,$yt_old,$xt,$yt);
- }
- elseif( $y_old == '-' ) {
- $img->StyleLine($xt_first,$yt_first,$xt,$yt_first);
- $img->StyleLine($xt,$yt_first,$xt,$yt);
- }
- else {
- $yt_old = $yt;
- $xt_old = $xt;
- }
- $cord[$idx++] = $xt;
- $cord[$idx++] = $yt_old;
- $cord[$idx++] = $xt;
- $cord[$idx++] = $yt;
- }
- elseif( $firstnonumeric==false ) {
- $firstnonumeric = true;
- $yt_first = $yt_old;
- $xt_first = $xt_old;
- }
- }
- else {
- $tmp1=$y;
- $prev=$this->coords[0][$pnts-1];
- if( $tmp1==='' || $tmp1===NULL || $tmp1==='X' ) $tmp1 = 'x';
- if( $prev==='' || $prev===null || $prev==='X' ) $prev = 'x';
-
- if( is_numeric($y) || (is_string($y) && $y != '-') ) {
- if( is_numeric($y) && (is_numeric($prev) || $prev === '-' ) ) {
- $img->StyleLineTo($xt,$yt);
- }
- else {
- $img->SetStartPoint($xt,$yt);
- }
- }
- if( $this->filled && $tmp1 !== '-' ) {
- if( $tmp1 === 'x' ) {
- $cord[$idx++] = $cord[$idx-3];
- $cord[$idx++] = $fillmin;
- }
- elseif( $prev === 'x' ) {
- $cord[$idx++] = $xt;
- $cord[$idx++] = $fillmin;
- $cord[$idx++] = $xt;
- $cord[$idx++] = $yt;
- }
- else {
- $cord[$idx++] = $xt;
- $cord[$idx++] = $yt;
- }
- }
- else {
- if( is_numeric($tmp1) && (is_numeric($prev) || $prev === '-' ) ) {
- $cord[$idx++] = $xt;
- $cord[$idx++] = $yt;
- }
- }
- }
- $yt_old = $yt;
- $xt_old = $xt;
- $y_old = $y;
-
- $this->StrokeDataValue($img,$this->coords[0][$pnts],$xt,$yt);
-
- ++$pnts;
- }
-
- if( $this->filled ) {
- $cord[$idx++] = $xt;
- if( $min > 0 || $this->fillFromMin )
- $cord[$idx++] = $yscale->Translate($min);
- else
- $cord[$idx++] = $yscale->Translate(0);
- if( $this->fillgrad ) {
- $img->SetLineWeight(1);
- $grad = new Gradient($img);
- $grad->SetNumColors($this->fillgrad_numcolors);
- $grad->FilledFlatPolygon($cord,$this->fillgrad_fromcolor,$this->fillgrad_tocolor);
- $img->SetLineWeight($this->weight);
- }
- else {
- $img->SetColor($this->fill_color);
- $img->FilledPolygon($cord);
- }
- if( $this->line_weight > 0 ) {
- $img->SetColor($this->color);
- $img->Polygon($cord);
- }
- }
-
- if(!empty($this->filledAreas)) {
-
- $minY = $yscale->Translate($yscale->GetMinVal());
- $factor = ($this->step_style ? 4 : 2);
-
- for($i = 0; $i < sizeof($this->filledAreas); ++$i) {
- // go through all filled area elements ordered by insertion
- // fill polygon array
- $areaCoords[] = $cord[$this->filledAreas[$i][0] * $factor];
- $areaCoords[] = $minY;
-
- $areaCoords =
- array_merge($areaCoords,
- array_slice($cord,
- $this->filledAreas[$i][0] * $factor,
- ($this->filledAreas[$i][1] - $this->filledAreas[$i][0] + ($this->step_style ? 0 : 1)) * $factor));
- $areaCoords[] = $areaCoords[sizeof($areaCoords)-2]; // last x
- $areaCoords[] = $minY; // last y
-
- if($this->filledAreas[$i][3]) {
- $img->SetColor($this->filledAreas[$i][2]);
- $img->FilledPolygon($areaCoords);
- $img->SetColor($this->color);
- }
- // Check if we should draw the frame.
- // If not we still re-draw the line since it might have been
- // partially overwritten by the filled area and it doesn't look
- // very good.
- // TODO: The behaviour is undefined if the line does not have
- // any line at the position of the area.
- if( $this->filledAreas[$i][4] )
- $img->Polygon($areaCoords);
- else
- $img->Polygon($cord);
-
- $areaCoords = array();
- }
- }
-
- if( $this->mark->type == -1 || $this->mark->show == false )
- return;
-
- for( $pnts=0; $pnts<$numpoints; ++$pnts) {
-
- if( $exist_x ) $x=$this->coords[1][$pnts];
- else $x=$pnts+$textadj;
- $xt = $xscale->Translate($x);
- $yt = $yscale->Translate($this->coords[0][$pnts]);
-
- if( is_numeric($this->coords[0][$pnts]) ) {
- if( !empty($this->csimtargets[$pnts]) ) {
- if( !empty($this->csimwintargets[$pnts]) ) {
- $this->mark->SetCSIMTarget($this->csimtargets[$pnts],$this->csimwintargets[$pnts]);
- }
- else {
- $this->mark->SetCSIMTarget($this->csimtargets[$pnts]);
- }
- $this->mark->SetCSIMAlt($this->csimalts[$pnts]);
- }
- if( $exist_x )
- $x=$this->coords[1][$pnts];
- else
- $x=$pnts;
- $this->mark->SetCSIMAltVal($this->coords[0][$pnts],$x);
- $this->mark->Stroke($img,$xt,$yt);
- $this->csimareas .= $this->mark->GetCSIMAreas();
- }
- }
-
-
+ function FastStroke($img,$xscale,$yscale,$aStartPoint=0,$exist_x=true) {
+ // An optimized stroke for many data points with no extra
+ // features but 60% faster. You can't have values or line styles, or null
+ // values in plots.
+ $numpoints=count($this->coords[0]);
+ if( $this->barcenter ) {
+ $textadj = 0.5-$xscale->text_scale_off;
+ }
+ else {
+ $textadj = 0;
+ }
+
+ $img->SetColor($this->color);
+ $img->SetLineWeight($this->weight);
+ $pnts=$aStartPoint;
+ while( $pnts < $numpoints ) {
+ if( $exist_x ) {
+ $x=$this->coords[1][$pnts];
+ }
+ else {
+ $x=$pnts+$textadj;
+ }
+ $xt = $xscale->Translate($x);
+ $y=$this->coords[0][$pnts];
+ $yt = $yscale->Translate($y);
+ if( is_numeric($y) ) {
+ $cord[] = $xt;
+ $cord[] = $yt;
+ }
+ elseif( $y == '-' && $pnts > 0 ) {
+ // Just ignore
+ }
+ else {
+ JpGraphError::RaiseL(10002);//('Plot too complicated for fast line Stroke. Use standard Stroke()');
+ }
+ ++$pnts;
+ } // WHILE
+
+ $img->Polygon($cord,false,true);
+ }
+
+ function Stroke($img,$xscale,$yscale) {
+ $idx=0;
+ $numpoints=count($this->coords[0]);
+ if( isset($this->coords[1]) ) {
+ if( count($this->coords[1])!=$numpoints ) {
+ JpGraphError::RaiseL(2003,count($this->coords[1]),$numpoints);
+ //("Number of X and Y points are not equal. Number of X-points:".count($this->coords[1])." Number of Y-points:$numpoints");
+ }
+ else {
+ $exist_x = true;
+ }
+ }
+ else {
+ $exist_x = false;
+ }
+
+ if( $this->barcenter ) {
+ $textadj = 0.5-$xscale->text_scale_off;
+ }
+ else {
+ $textadj = 0;
+ }
+
+ // Find the first numeric data point
+ $startpoint=0;
+ while( $startpoint < $numpoints && !is_numeric($this->coords[0][$startpoint]) ) {
+ ++$startpoint;
+ }
+
+ // Bail out if no data points
+ if( $startpoint == $numpoints ) return;
+
+ if( $this->iFastStroke ) {
+ $this->FastStroke($img,$xscale,$yscale,$startpoint,$exist_x);
+ return;
+ }
+
+ if( $exist_x ) {
+ $xs=$this->coords[1][$startpoint];
+ }
+ else {
+ $xs= $textadj+$startpoint;
+ }
+
+ $img->SetStartPoint($xscale->Translate($xs),
+ $yscale->Translate($this->coords[0][$startpoint]));
+
+ if( $this->filled ) {
+ if( $this->fillFromMax ) {
+ //$max = $yscale->GetMaxVal();
+ $cord[$idx++] = $xscale->Translate($xs);
+ $cord[$idx++] = $yscale->scale_abs[1];
+ }
+ else {
+ $min = $yscale->GetMinVal();
+ if( $min > 0 || $this->fillFromMin ) {
+ $fillmin = $yscale->scale_abs[0];//Translate($min);
+ }
+ else {
+ $fillmin = $yscale->Translate(0);
+ }
+
+ $cord[$idx++] = $xscale->Translate($xs);
+ $cord[$idx++] = $fillmin;
+ }
+ }
+ $xt = $xscale->Translate($xs);
+ $yt = $yscale->Translate($this->coords[0][$startpoint]);
+ $cord[$idx++] = $xt;
+ $cord[$idx++] = $yt;
+ $yt_old = $yt;
+ $xt_old = $xt;
+ $y_old = $this->coords[0][$startpoint];
+
+ $this->value->Stroke($img,$this->coords[0][$startpoint],$xt,$yt);
+
+ $img->SetColor($this->color);
+ $img->SetLineWeight($this->weight);
+ $img->SetLineStyle($this->line_style);
+ $pnts=$startpoint+1;
+ $firstnonumeric = false;
+
+
+ while( $pnts < $numpoints ) {
+
+ if( $exist_x ) {
+ $x=$this->coords[1][$pnts];
+ }
+ else {
+ $x=$pnts+$textadj;
+ }
+ $xt = $xscale->Translate($x);
+ $yt = $yscale->Translate($this->coords[0][$pnts]);
+
+ $y=$this->coords[0][$pnts];
+ if( $this->step_style ) {
+ // To handle null values within step style we need to record the
+ // first non numeric value so we know from where to start if the
+ // non value is '-'.
+ if( is_numeric($y) ) {
+ $firstnonumeric = false;
+ if( is_numeric($y_old) ) {
+ $img->StyleLine($xt_old,$yt_old,$xt,$yt_old);
+ $img->StyleLine($xt,$yt_old,$xt,$yt);
+ }
+ elseif( $y_old == '-' ) {
+ $img->StyleLine($xt_first,$yt_first,$xt,$yt_first);
+ $img->StyleLine($xt,$yt_first,$xt,$yt);
+ }
+ else {
+ $yt_old = $yt;
+ $xt_old = $xt;
+ }
+ $cord[$idx++] = $xt;
+ $cord[$idx++] = $yt_old;
+ $cord[$idx++] = $xt;
+ $cord[$idx++] = $yt;
+ }
+ elseif( $firstnonumeric==false ) {
+ $firstnonumeric = true;
+ $yt_first = $yt_old;
+ $xt_first = $xt_old;
+ }
+ }
+ else {
+ $tmp1=$y;
+ $prev=$this->coords[0][$pnts-1];
+ if( $tmp1==='' || $tmp1===NULL || $tmp1==='X' ) $tmp1 = 'x';
+ if( $prev==='' || $prev===null || $prev==='X' ) $prev = 'x';
+
+ if( is_numeric($y) || (is_string($y) && $y != '-') ) {
+ if( is_numeric($y) && (is_numeric($prev) || $prev === '-' ) ) {
+ $img->StyleLineTo($xt,$yt);
+ }
+ else {
+ $img->SetStartPoint($xt,$yt);
+ }
+ }
+ if( $this->filled && $tmp1 !== '-' ) {
+ if( $tmp1 === 'x' ) {
+ $cord[$idx++] = $cord[$idx-3];
+ $cord[$idx++] = $fillmin;
+ }
+ elseif( $prev === 'x' ) {
+ $cord[$idx++] = $xt;
+ $cord[$idx++] = $fillmin;
+ $cord[$idx++] = $xt;
+ $cord[$idx++] = $yt;
+ }
+ else {
+ $cord[$idx++] = $xt;
+ $cord[$idx++] = $yt;
+ }
+ }
+ else {
+ if( is_numeric($tmp1) && (is_numeric($prev) || $prev === '-' ) ) {
+ $cord[$idx++] = $xt;
+ $cord[$idx++] = $yt;
+ }
+ }
+ }
+ $yt_old = $yt;
+ $xt_old = $xt;
+ $y_old = $y;
+
+ $this->StrokeDataValue($img,$this->coords[0][$pnts],$xt,$yt);
+
+ ++$pnts;
+ }
+
+ if( $this->filled ) {
+ $cord[$idx++] = $xt;
+ if( $this->fillFromMax ) {
+ $cord[$idx++] = $yscale->scale_abs[1];
+ }
+ else {
+ if( $min > 0 || $this->fillFromMin ) {
+ $cord[$idx++] = $yscale->Translate($min);
+ }
+ else {
+ $cord[$idx++] = $yscale->Translate(0);
+ }
+ }
+ if( $this->fillgrad ) {
+ $img->SetLineWeight(1);
+ $grad = new Gradient($img);
+ $grad->SetNumColors($this->fillgrad_numcolors);
+ $grad->FilledFlatPolygon($cord,$this->fillgrad_fromcolor,$this->fillgrad_tocolor);
+ $img->SetLineWeight($this->weight);
+ }
+ else {
+ $img->SetColor($this->fill_color);
+ $img->FilledPolygon($cord);
+ }
+ if( $this->weight > 0 ) {
+ $img->SetLineWeight($this->weight);
+ $img->SetColor($this->color);
+ // Remove first and last coordinate before drawing the line
+ // sine we otherwise get the vertical start and end lines which
+ // doesn't look appropriate
+ $img->Polygon(array_slice($cord,2,count($cord)-4));
+ }
+ }
+
+ if(!empty($this->filledAreas)) {
+
+ $minY = $yscale->Translate($yscale->GetMinVal());
+ $factor = ($this->step_style ? 4 : 2);
+
+ for($i = 0; $i < sizeof($this->filledAreas); ++$i) {
+ // go through all filled area elements ordered by insertion
+ // fill polygon array
+ $areaCoords[] = $cord[$this->filledAreas[$i][0] * $factor];
+ $areaCoords[] = $minY;
+
+ $areaCoords =
+ array_merge($areaCoords,
+ array_slice($cord,
+ $this->filledAreas[$i][0] * $factor,
+ ($this->filledAreas[$i][1] - $this->filledAreas[$i][0] + ($this->step_style ? 0 : 1)) * $factor));
+ $areaCoords[] = $areaCoords[sizeof($areaCoords)-2]; // last x
+ $areaCoords[] = $minY; // last y
+
+ if($this->filledAreas[$i][3]) {
+ $img->SetColor($this->filledAreas[$i][2]);
+ $img->FilledPolygon($areaCoords);
+ $img->SetColor($this->color);
+ }
+ // Check if we should draw the frame.
+ // If not we still re-draw the line since it might have been
+ // partially overwritten by the filled area and it doesn't look
+ // very good.
+ if( $this->filledAreas[$i][4] ) {
+ $img->Polygon($areaCoords);
+ }
+ else {
+ $img->Polygon($cord);
+ }
+
+ $areaCoords = array();
+ }
+ }
+
+ if( $this->mark->type == -1 || $this->mark->show == false )
+ return;
+
+ for( $pnts=0; $pnts<$numpoints; ++$pnts) {
+
+ if( $exist_x ) {
+ $x=$this->coords[1][$pnts];
+ }
+ else {
+ $x=$pnts+$textadj;
+ }
+ $xt = $xscale->Translate($x);
+ $yt = $yscale->Translate($this->coords[0][$pnts]);
+
+ if( is_numeric($this->coords[0][$pnts]) ) {
+ if( !empty($this->csimtargets[$pnts]) ) {
+ if( !empty($this->csimwintargets[$pnts]) ) {
+ $this->mark->SetCSIMTarget($this->csimtargets[$pnts],$this->csimwintargets[$pnts]);
+ }
+ else {
+ $this->mark->SetCSIMTarget($this->csimtargets[$pnts]);
+ }
+ $this->mark->SetCSIMAlt($this->csimalts[$pnts]);
+ }
+ if( $exist_x ) {
+ $x=$this->coords[1][$pnts];
+ }
+ else {
+ $x=$pnts;
+ }
+ $this->mark->SetCSIMAltVal($this->coords[0][$pnts],$x);
+ $this->mark->Stroke($img,$xt,$yt);
+ $this->csimareas .= $this->mark->GetCSIMAreas();
+ }
+ }
}
} // Class
//===================================================
// CLASS AccLinePlot
-// Description:
+// Description:
//===================================================
class AccLinePlot extends Plot {
- var $plots=null,$nbrplots=0,$numpoints=0;
- var $iStartEndZero=true;
-//---------------
-// CONSTRUCTOR
- function AccLinePlot($plots) {
+ protected $plots=null,$nbrplots=0;
+ private $iStartEndZero=true;
+ //---------------
+ // CONSTRUCTOR
+ function __construct($plots) {
$this->plots = $plots;
- $this->nbrplots = count($plots);
- $this->numpoints = $plots[0]->numpoints;
+ $this->nbrplots = count($plots);
+ $this->numpoints = $plots[0]->numpoints;
- // Verify that all plots have the same number of data points
- for( $i=1; $i < $this->nbrplots; ++$i ) {
- if( $plots[$i]->numpoints != $this->numpoints ) {
- JpGraphError::RaiseL(10003);//('Each plot in an accumulated lineplot must have the same number of data points',0)
- }
- }
-
- for($i=0; $i < $this->nbrplots; ++$i ) {
- $this->LineInterpolate($this->plots[$i]->coords[0]);
- }
- }
-
-//---------------
-// PUBLIC METHODS
- function Legend(&$graph) {
- $n=count($this->plots);
- for($i=0; $i < $n; ++$i )
- $this->plots[$i]->DoLegend($graph);
+ // Verify that all plots have the same number of data points
+ for( $i=1; $i < $this->nbrplots; ++$i ) {
+ if( $plots[$i]->numpoints != $this->numpoints ) {
+ JpGraphError::RaiseL(10003);//('Each plot in an accumulated lineplot must have the same number of data points',0)
+ }
+ }
+
+ for($i=0; $i < $this->nbrplots; ++$i ) {
+ $this->LineInterpolate($this->plots[$i]->coords[0]);
+ }
+ }
+
+ //---------------
+ // PUBLIC METHODS
+ function Legend($graph) {
+ foreach( $this->plots as $p ) {
+ $p->DoLegend($graph);
+ }
}
-
+
function Max() {
- list($xmax) = $this->plots[0]->Max();
- $nmax=0;
- $n = count($this->plots);
- for($i=0; $i < $n; ++$i) {
- $nc = count($this->plots[$i]->coords[0]);
- $nmax = max($nmax,$nc);
- list($x) = $this->plots[$i]->Max();
- $xmax = Max($xmax,$x);
- }
- for( $i = 0; $i < $nmax; $i++ ) {
- // Get y-value for line $i by adding the
- // individual bars from all the plots added.
- // It would be wrong to just add the
- // individual plots max y-value since that
- // would in most cases give to large y-value.
- $y=$this->plots[0]->coords[0][$i];
- for( $j = 1; $j < $this->nbrplots; $j++ ) {
- $y += $this->plots[ $j ]->coords[0][$i];
- }
- $ymax[$i] = $y;
- }
- $ymax = max($ymax);
- return array($xmax,$ymax);
- }
+ list($xmax) = $this->plots[0]->Max();
+ $nmax=0;
+ $n = count($this->plots);
+ for($i=0; $i < $n; ++$i) {
+ $nc = count($this->plots[$i]->coords[0]);
+ $nmax = max($nmax,$nc);
+ list($x) = $this->plots[$i]->Max();
+ $xmax = Max($xmax,$x);
+ }
+ for( $i = 0; $i < $nmax; $i++ ) {
+ // Get y-value for line $i by adding the
+ // individual bars from all the plots added.
+ // It would be wrong to just add the
+ // individual plots max y-value since that
+ // would in most cases give to large y-value.
+ $y=$this->plots[0]->coords[0][$i];
+ for( $j = 1; $j < $this->nbrplots; $j++ ) {
+ $y += $this->plots[ $j ]->coords[0][$i];
+ }
+ $ymax[$i] = $y;
+ }
+ $ymax = max($ymax);
+ return array($xmax,$ymax);
+ }
function Min() {
- $nmax=0;
- list($xmin,$ysetmin) = $this->plots[0]->Min();
- $n = count($this->plots);
- for($i=0; $i < $n; ++$i) {
- $nc = count($this->plots[$i]->coords[0]);
- $nmax = max($nmax,$nc);
- list($x,$y) = $this->plots[$i]->Min();
- $xmin = Min($xmin,$x);
- $ysetmin = Min($y,$ysetmin);
- }
- for( $i = 0; $i < $nmax; $i++ ) {
- // Get y-value for line $i by adding the
- // individual bars from all the plots added.
- // It would be wrong to just add the
- // individual plots min y-value since that
- // would in most cases give to small y-value.
- $y=$this->plots[0]->coords[0][$i];
- for( $j = 1; $j < $this->nbrplots; $j++ ) {
- $y += $this->plots[ $j ]->coords[0][$i];
- }
- $ymin[$i] = $y;
- }
- $ymin = Min($ysetmin,Min($ymin));
- return array($xmin,$ymin);
+ $nmax=0;
+ list($xmin,$ysetmin) = $this->plots[0]->Min();
+ $n = count($this->plots);
+ for($i=0; $i < $n; ++$i) {
+ $nc = count($this->plots[$i]->coords[0]);
+ $nmax = max($nmax,$nc);
+ list($x,$y) = $this->plots[$i]->Min();
+ $xmin = Min($xmin,$x);
+ $ysetmin = Min($y,$ysetmin);
+ }
+ for( $i = 0; $i < $nmax; $i++ ) {
+ // Get y-value for line $i by adding the
+ // individual bars from all the plots added.
+ // It would be wrong to just add the
+ // individual plots min y-value since that
+ // would in most cases give to small y-value.
+ $y=$this->plots[0]->coords[0][$i];
+ for( $j = 1; $j < $this->nbrplots; $j++ ) {
+ $y += $this->plots[ $j ]->coords[0][$i];
+ }
+ $ymin[$i] = $y;
+ }
+ $ymin = Min($ysetmin,Min($ymin));
+ return array($xmin,$ymin);
}
// Gets called before any axis are stroked
- function PreStrokeAdjust(&$graph) {
+ function PreStrokeAdjust($graph) {
+
+ // If another plot type have already adjusted the
+ // offset we don't touch it.
+ // (We check for empty in case the scale is a log scale
+ // and hence doesn't contain any xlabel_offset)
+
+ if( empty($graph->xaxis->scale->ticks->xlabel_offset) ||
+ $graph->xaxis->scale->ticks->xlabel_offset == 0 ) {
+ if( $this->center ) {
+ ++$this->numpoints;
+ $a=0.5; $b=0.5;
+ } else {
+ $a=0; $b=0;
+ }
+ $graph->xaxis->scale->ticks->SetXLabelOffset($a);
+ $graph->SetTextScaleOff($b);
+ $graph->xaxis->scale->ticks->SupressMinorTickMarks();
+ }
- // If another plot type have already adjusted the
- // offset we don't touch it.
- // (We check for empty in case the scale is a log scale
- // and hence doesn't contain any xlabel_offset)
-
- if( empty($graph->xaxis->scale->ticks->xlabel_offset) ||
- $graph->xaxis->scale->ticks->xlabel_offset == 0 ) {
- if( $this->center ) {
- ++$this->numpoints;
- $a=0.5; $b=0.5;
- } else {
- $a=0; $b=0;
- }
- $graph->xaxis->scale->ticks->SetXLabelOffset($a);
- $graph->SetTextScaleOff($b);
- $graph->xaxis->scale->ticks->SupressMinorTickMarks();
- }
-
}
function SetInterpolateMode($aIntMode) {
- $this->iStartEndZero=$aIntMode;
+ $this->iStartEndZero=$aIntMode;
}
// Replace all '-' with an interpolated value. We use straightforward
@@ -537,65 +582,66 @@
// will be replaced by the the first valid data point
function LineInterpolate(&$aData) {
- $n=count($aData);
- $i=0;
-
- // If first point is undefined we will set it to the same as the first
- // valid data
- if( $aData[$i]==='-' ) {
- // Find the first valid data
- while( $i < $n && $aData[$i]==='-' ) {
- ++$i;
- }
- if( $i < $n ) {
- for($j=0; $j < $i; ++$j ) {
- if( $this->iStartEndZero )
- $aData[$i] = 0;
- else
- $aData[$j] = $aData[$i];
- }
- }
- else {
- // All '-' => Error
- return false;
- }
- }
-
- while($i < $n) {
- while( $i < $n && $aData[$i] !== '-' ) {
- ++$i;
- }
- if( $i < $n ) {
- $pstart=$i-1;
-
- // Now see how long this segment of '-' are
- while( $i < $n && $aData[$i] === '-' )
- ++$i;
- if( $i < $n ) {
- $pend=$i;
- $size=$pend-$pstart;
- $k=($aData[$pend]-$aData[$pstart])/$size;
- // Replace the segment of '-' with a linear interpolated value.
- for($j=1; $j < $size; ++$j ) {
- $aData[$pstart+$j] = $aData[$pstart] + $j*$k ;
- }
- }
- else {
- // There are no valid end point. The '-' goes all the way to the end
- // In that case we just set all the remaining values the the same as the
- // last valid data point.
- for( $j=$pstart+1; $j < $n; ++$j )
- if( $this->iStartEndZero )
- $aData[$j] = 0;
- else
- $aData[$j] = $aData[$pstart] ;
- }
- }
- }
- return true;
- }
-
+ $n=count($aData);
+ $i=0;
+ // If first point is undefined we will set it to the same as the first
+ // valid data
+ if( $aData[$i]==='-' ) {
+ // Find the first valid data
+ while( $i < $n && $aData[$i]==='-' ) {
+ ++$i;
+ }
+ if( $i < $n ) {
+ for($j=0; $j < $i; ++$j ) {
+ if( $this->iStartEndZero )
+ $aData[$i] = 0;
+ else
+ $aData[$j] = $aData[$i];
+ }
+ }
+ else {
+ // All '-' => Error
+ return false;
+ }
+ }
+
+ while($i < $n) {
+ while( $i < $n && $aData[$i] !== '-' ) {
+ ++$i;
+ }
+ if( $i < $n ) {
+ $pstart=$i-1;
+
+ // Now see how long this segment of '-' are
+ while( $i < $n && $aData[$i] === '-' ) {
+ ++$i;
+ }
+ if( $i < $n ) {
+ $pend=$i;
+ $size=$pend-$pstart;
+ $k=($aData[$pend]-$aData[$pstart])/$size;
+ // Replace the segment of '-' with a linear interpolated value.
+ for($j=1; $j < $size; ++$j ) {
+ $aData[$pstart+$j] = $aData[$pstart] + $j*$k ;
+ }
+ }
+ else {
+ // There are no valid end point. The '-' goes all the way to the end
+ // In that case we just set all the remaining values the the same as the
+ // last valid data point.
+ for( $j=$pstart+1; $j < $n; ++$j )
+ if( $this->iStartEndZero ) {
+ $aData[$j] = 0;
+ }
+ else {
+ $aData[$j] = $aData[$pstart] ;
+ }
+ }
+ }
+ }
+ return true;
+ }
// To avoid duplicate of line drawing code here we just
// change the y-values for each plot and then restore it
@@ -603,30 +649,31 @@
// it wouldn't be possible to create an acc line plot
// with the same graphs, i.e AccLinePlot(array($pl,$pl,$pl));
// since this method would have a side effect.
- function Stroke(&$img,&$xscale,&$yscale) {
- $img->SetLineWeight($this->weight);
- $this->numpoints = count($this->plots[0]->coords[0]);
- // Allocate array
- $coords[$this->nbrplots][$this->numpoints]=0;
- for($i=0; $i<$this->numpoints; $i++) {
- $coords[0][$i]=$this->plots[0]->coords[0][$i];
- $accy=$coords[0][$i];
- for($j=1; $j<$this->nbrplots; ++$j ) {
- $coords[$j][$i] = $this->plots[$j]->coords[0][$i]+$accy;
- $accy = $coords[$j][$i];
- }
- }
- for($j=$this->nbrplots-1; $j>=0; --$j) {
- $p=$this->plots[$j];
- for( $i=0; $i<$this->numpoints; ++$i) {
- $tmp[$i]=$p->coords[0][$i];
- $p->coords[0][$i]=$coords[$j][$i];
- }
- $p->Stroke($img,$xscale,$yscale);
- for( $i=0; $i<$this->numpoints; ++$i)
- $p->coords[0][$i]=$tmp[$i];
- $p->coords[0][]=$tmp;
- }
+ function Stroke($img,$xscale,$yscale) {
+ $img->SetLineWeight($this->weight);
+ $this->numpoints = count($this->plots[0]->coords[0]);
+ // Allocate array
+ $coords[$this->nbrplots][$this->numpoints]=0;
+ for($i=0; $i<$this->numpoints; $i++) {
+ $coords[0][$i]=$this->plots[0]->coords[0][$i];
+ $accy=$coords[0][$i];
+ for($j=1; $j<$this->nbrplots; ++$j ) {
+ $coords[$j][$i] = $this->plots[$j]->coords[0][$i]+$accy;
+ $accy = $coords[$j][$i];
+ }
+ }
+ for($j=$this->nbrplots-1; $j>=0; --$j) {
+ $p=$this->plots[$j];
+ for( $i=0; $i<$this->numpoints; ++$i) {
+ $tmp[$i]=$p->coords[0][$i];
+ $p->coords[0][$i]=$coords[$j][$i];
+ }
+ $p->Stroke($img,$xscale,$yscale);
+ for( $i=0; $i<$this->numpoints; ++$i) {
+ $p->coords[0][$i]=$tmp[$i];
+ }
+ $p->coords[0][]=$tmp;
+ }
}
} // Class
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_log.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_log.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_log.php 2006-12-13 20:04:01.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_log.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,14 +1,13 @@
LinearScale($min,$max,$type);
- $this->ticks = new LogTicks();
- $this->name = 'log';
+ function __construct($min,$max,$type="y") {
+ parent::__construct($min,$max,$type);
+ $this->ticks = new LogTicks();
+ $this->name = 'log';
}
-//----------------
-// PUBLIC METHODS
+ //----------------
+ // PUBLIC METHODS
// Translate between world and screen
function Translate($a) {
- if( !is_numeric($a) ) {
- if( $a != '' && $a != '-' && $a != 'x' )
- JpGraphError::RaiseL(11001);
-//('Your data contains non-numeric values.');
- return 1;
- }
- if( $a < 0 ) {
- JpGraphError::RaiseL(11002);
-//("Negative data values can not be used in a log scale.");
- exit(1);
- }
- if( $a==0 ) $a=1;
- $a=log10($a);
- return ceil($this->off + ($a*1.0 - $this->scale[0]) * $this->scale_factor);
+ if( !is_numeric($a) ) {
+ if( $a != '' && $a != '-' && $a != 'x' ) {
+ JpGraphError::RaiseL(11001);
+ // ('Your data contains non-numeric values.');
+ }
+ return 1;
+ }
+ if( $a < 0 ) {
+ JpGraphError::RaiseL(11002);
+ //("Negative data values can not be used in a log scale.");
+ exit(1);
+ }
+ if( $a==0 ) $a=1;
+ $a=log10($a);
+ return ceil($this->off + ($a*1.0 - $this->scale[0]) * $this->scale_factor);
}
// Relative translate (don't include offset) usefull when we just want
- // to know the relative position (in pixels) on the axis
+ // to know the relative position (in pixels) on the axis
function RelTranslate($a) {
- if( !is_numeric($a) ) {
- if( $a != '' && $a != '-' && $a != 'x' )
- JpGraphError::RaiseL(11001);
-//('Your data contains non-numeric values.');
- return 1;
- }
- if( $a==0 ) $a=1;
- $a=log10($a);
- return round(($a*1.0 - $this->scale[0]) * $this->scale_factor);
+ if( !is_numeric($a) ) {
+ if( $a != '' && $a != '-' && $a != 'x' ) {
+ JpGraphError::RaiseL(11001);
+ //('Your data contains non-numeric values.');
+ }
+ return 1;
+ }
+ if( $a==0 ) {
+ $a=1;
+ }
+ $a=log10($a);
+ return round(($a*1.0 - $this->scale[0]) * $this->scale_factor);
}
-
+
// Use bcpow() for increased precision
function GetMinVal() {
- if( function_exists("bcpow") )
- return round(bcpow(10,$this->scale[0],15),14);
- else
- return round(pow(10,$this->scale[0]),14);
+ if( function_exists("bcpow") ) {
+ return round(bcpow(10,$this->scale[0],15),14);
+ }
+ else {
+ return round(pow(10,$this->scale[0]),14);
+ }
}
-
+
function GetMaxVal() {
- if( function_exists("bcpow") )
- return round(bcpow(10,$this->scale[1],15),14);
- else
- return round(pow(10,$this->scale[1]),14);
+ if( function_exists("bcpow") ) {
+ return round(bcpow(10,$this->scale[1],15),14);
+ }
+ else {
+ return round(pow(10,$this->scale[1]),14);
+ }
}
-
+
// Logarithmic autoscaling is much simplier since we just
// set the min and max to logs of the min and max values.
// Note that for log autoscale the "maxstep" the fourth argument
// isn't used. This is just included to give the method the same
// signature as the linear counterpart.
- function AutoScale(&$img,$min,$max,$dummy) {
- if( $min==0 ) $min=1;
-
- if( $max <= 0 ) {
- JpGraphError::RaiseL(11004);
-//('Scale error for logarithmic scale. You have a problem with your data values. The max value must be greater than 0. It is mathematically impossible to have 0 in a logarithmic scale.');
- }
- if( is_numeric($this->autoscale_min) ) {
- $smin = round($this->autoscale_min);
- $smax = ceil(log10($max));
- if( $min >= $max ) {
- JpGraphError::RaiseL(25071);//('You have specified a min value with SetAutoMin() which is larger than the maximum value used for the scale. This is not possible.');
- }
- }
- else {
- $smin = floor(log10($min));
- if( is_numeric($this->autoscale_max) ) {
- $smax = round($this->autoscale_max);
- if( $smin >= $smax ) {
- JpGraphError::RaiseL(25072);//('You have specified a max value with SetAutoMax() which is smaller than the miminum value used for the scale. This is not possible.');
- }
- }
- else
- $smax = ceil(log10($max));
- }
- $this->Update($img,$smin,$smax);
+ function AutoScale($img,$min,$max,$maxsteps,$majend=true) {
+ if( $min==0 ) $min=1;
+
+ if( $max <= 0 ) {
+ JpGraphError::RaiseL(11004);
+ //('Scale error for logarithmic scale. You have a problem with your data values. The max value must be greater than 0. It is mathematically impossible to have 0 in a logarithmic scale.');
+ }
+ if( is_numeric($this->autoscale_min) ) {
+ $smin = round($this->autoscale_min);
+ $smax = ceil(log10($max));
+ if( $min >= $max ) {
+ JpGraphError::RaiseL(25071);//('You have specified a min value with SetAutoMin() which is larger than the maximum value used for the scale. This is not possible.');
+ }
+ }
+ else {
+ $smin = floor(log10($min));
+ if( is_numeric($this->autoscale_max) ) {
+ $smax = round($this->autoscale_max);
+ if( $smin >= $smax ) {
+ JpGraphError::RaiseL(25072);//('You have specified a max value with SetAutoMax() which is smaller than the miminum value used for the scale. This is not possible.');
+ }
+ }
+ else
+ $smax = ceil(log10($max));
+ }
+
+ $this->Update($img,$smin,$smax);
}
-//---------------
-// PRIVATE METHODS
+ //---------------
+ // PRIVATE METHODS
} // Class
//===================================================
// CLASS LogTicks
-// Description:
+// Description:
//===================================================
class LogTicks extends Ticks{
- var $label_logtype=LOGLABELS_MAGNITUDE;
-//---------------
-// CONSTRUCTOR
+ private $label_logtype=LOGLABELS_MAGNITUDE;
+ private $ticklabels_pos = array();
+ //---------------
+ // CONSTRUCTOR
function LogTicks() {
}
-//---------------
-// PUBLIC METHODS
+ //---------------
+ // PUBLIC METHODS
function IsSpecified() {
- return true;
+ return true;
}
function SetLabelLogType($aType) {
- $this->label_logtype = $aType;
+ $this->label_logtype = $aType;
}
-
+
// For log scale it's meaningless to speak about a major step
// We just return -1 to make the framework happy (specifically
// StrokeLabels() )
function GetMajor() {
- return -1;
+ return -1;
}
function SetTextLabelStart($aStart) {
- JpGraphError::RaiseL(11005);
-//('Specifying tick interval for a logarithmic scale is undefined. Remove any calls to SetTextLabelStart() or SetTextTickInterval() on the logarithmic scale.');
+ JpGraphError::RaiseL(11005);
+ //('Specifying tick interval for a logarithmic scale is undefined. Remove any calls to SetTextLabelStart() or SetTextTickInterval() on the logarithmic scale.');
}
function SetXLabelOffset($dummy) {
- // For log scales we dont care about XLabel offset
+ // For log scales we dont care about XLabel offset
}
// Draw ticks on image "img" using scale "scale". The axis absolute
// position in the image is specified in pos, i.e. for an x-axis
// it specifies the absolute y-coord and for Y-ticks it specified the
// absolute x-position.
- function Stroke(&$img,&$scale,$pos) {
- $start = $scale->GetMinVal();
- $limit = $scale->GetMaxVal();
- $nextMajor = 10*$start;
- $step = $nextMajor / 10.0;
-
-
- $img->SetLineWeight($this->weight);
-
- if( $scale->type == "y" ) {
- // member direction specified if the ticks should be on
- // left or right side.
- $a=$pos + $this->direction*$this->GetMinTickAbsSize();
- $a2=$pos + $this->direction*$this->GetMajTickAbsSize();
-
- $count=1;
- $this->maj_ticks_pos[0]=$scale->Translate($start);
- $this->maj_ticklabels_pos[0]=$scale->Translate($start);
- if( $this->supress_first )
- $this->maj_ticks_label[0]="";
- else {
- if( $this->label_formfunc != '' ) {
- $f = $this->label_formfunc;
- $this->maj_ticks_label[0]=call_user_func($f,$start);
- }
- elseif( $this->label_logtype == LOGLABELS_PLAIN )
- $this->maj_ticks_label[0]=$start;
- else
- $this->maj_ticks_label[0]='10^'.round(log10($start));
- }
- $i=1;
- for($y=$start; $y<=$limit; $y+=$step,++$count ) {
- $ys=$scale->Translate($y);
- $this->ticks_pos[]=$ys;
- $this->ticklabels_pos[]=$ys;
- if( $count % 10 == 0 ) {
- if( !$this->supress_tickmarks ) {
- if( $this->majcolor!="" ) {
- $img->PushColor($this->majcolor);
- $img->Line($pos,$ys,$a2,$ys);
- $img->PopColor();
- }
- else
- $img->Line($pos,$ys,$a2,$ys);
- }
-
- $this->maj_ticks_pos[$i]=$ys;
- $this->maj_ticklabels_pos[$i]=$ys;
-
- if( $this->label_formfunc != '' ) {
- $f = $this->label_formfunc;
- $this->maj_ticks_label[$i]=call_user_func($f,$nextMajor);
- }
- elseif( $this->label_logtype == 0 )
- $this->maj_ticks_label[$i]=$nextMajor;
- else
- $this->maj_ticks_label[$i]='10^'.round(log10($nextMajor));
- ++$i;
- $nextMajor *= 10;
- $step *= 10;
- $count=1;
- }
- else {
- if( !$this->supress_tickmarks && !$this->supress_minor_tickmarks) {
- if( $this->mincolor!="" ) $img->PushColor($this->mincolor);
- $img->Line($pos,$ys,$a,$ys);
- if( $this->mincolor!="" ) $img->PopColor();
- }
- }
- }
- }
- else {
- $a=$pos - $this->direction*$this->GetMinTickAbsSize();
- $a2=$pos - $this->direction*$this->GetMajTickAbsSize();
- $count=1;
- $this->maj_ticks_pos[0]=$scale->Translate($start);
- $this->maj_ticklabels_pos[0]=$scale->Translate($start);
- if( $this->supress_first )
- $this->maj_ticks_label[0]="";
- else {
- if( $this->label_formfunc != '' ) {
- $f = $this->label_formfunc;
- $this->maj_ticks_label[0]=call_user_func($f,$start);
- }
- elseif( $this->label_logtype == 0 )
- $this->maj_ticks_label[0]=$start;
- else
- $this->maj_ticks_label[0]='10^'.round(log10($start));
- }
- $i=1;
- for($x=$start; $x<=$limit; $x+=$step,++$count ) {
- $xs=$scale->Translate($x);
- $this->ticks_pos[]=$xs;
- $this->ticklabels_pos[]=$xs;
- if( $count % 10 == 0 ) {
- if( !$this->supress_tickmarks ) {
- $img->Line($xs,$pos,$xs,$a2);
- }
- $this->maj_ticks_pos[$i]=$xs;
- $this->maj_ticklabels_pos[$i]=$xs;
-
- if( $this->label_formfunc != '' ) {
- $f = $this->label_formfunc;
- $this->maj_ticks_label[$i]=call_user_func($f,$nextMajor);
- }
- elseif( $this->label_logtype == 0 )
- $this->maj_ticks_label[$i]=$nextMajor;
- else
- $this->maj_ticks_label[$i]='10^'.round(log10($nextMajor));
- ++$i;
- $nextMajor *= 10;
- $step *= 10;
- $count=1;
- }
- else {
- if( !$this->supress_tickmarks && !$this->supress_minor_tickmarks) {
- $img->Line($xs,$pos,$xs,$a);
- }
- }
- }
- }
- return true;
+ function Stroke($img,$scale,$pos) {
+ $start = $scale->GetMinVal();
+ $limit = $scale->GetMaxVal();
+ $nextMajor = 10*$start;
+ $step = $nextMajor / 10.0;
+
+
+ $img->SetLineWeight($this->weight);
+
+ if( $scale->type == "y" ) {
+ // member direction specified if the ticks should be on
+ // left or right side.
+ $a=$pos + $this->direction*$this->GetMinTickAbsSize();
+ $a2=$pos + $this->direction*$this->GetMajTickAbsSize();
+
+ $count=1;
+ $this->maj_ticks_pos[0]=$scale->Translate($start);
+ $this->maj_ticklabels_pos[0]=$scale->Translate($start);
+ if( $this->supress_first )
+ $this->maj_ticks_label[0]="";
+ else {
+ if( $this->label_formfunc != '' ) {
+ $f = $this->label_formfunc;
+ $this->maj_ticks_label[0]=call_user_func($f,$start);
+ }
+ elseif( $this->label_logtype == LOGLABELS_PLAIN ) {
+ $this->maj_ticks_label[0]=$start;
+ }
+ else {
+ $this->maj_ticks_label[0]='10^'.round(log10($start));
+ }
+ }
+ $i=1;
+ for($y=$start; $y<=$limit; $y+=$step,++$count ) {
+ $ys=$scale->Translate($y);
+ $this->ticks_pos[]=$ys;
+ $this->ticklabels_pos[]=$ys;
+ if( $count % 10 == 0 ) {
+ if( !$this->supress_tickmarks ) {
+ if( $this->majcolor!="" ) {
+ $img->PushColor($this->majcolor);
+ $img->Line($pos,$ys,$a2,$ys);
+ $img->PopColor();
+ }
+ else {
+ $img->Line($pos,$ys,$a2,$ys);
+ }
+ }
+
+ $this->maj_ticks_pos[$i]=$ys;
+ $this->maj_ticklabels_pos[$i]=$ys;
+
+ if( $this->label_formfunc != '' ) {
+ $f = $this->label_formfunc;
+ $this->maj_ticks_label[$i]=call_user_func($f,$nextMajor);
+ }
+ elseif( $this->label_logtype == 0 ) {
+ $this->maj_ticks_label[$i]=$nextMajor;
+ }
+ else {
+ $this->maj_ticks_label[$i]='10^'.round(log10($nextMajor));
+ }
+ ++$i;
+ $nextMajor *= 10;
+ $step *= 10;
+ $count=1;
+ }
+ else {
+ if( !$this->supress_tickmarks && !$this->supress_minor_tickmarks) {
+ if( $this->mincolor!="" ) {
+ $img->PushColor($this->mincolor);
+ }
+ $img->Line($pos,$ys,$a,$ys);
+ if( $this->mincolor!="" ) {
+ $img->PopColor();
+ }
+ }
+ }
+ }
+ }
+ else {
+ $a=$pos - $this->direction*$this->GetMinTickAbsSize();
+ $a2=$pos - $this->direction*$this->GetMajTickAbsSize();
+ $count=1;
+ $this->maj_ticks_pos[0]=$scale->Translate($start);
+ $this->maj_ticklabels_pos[0]=$scale->Translate($start);
+ if( $this->supress_first ) {
+ $this->maj_ticks_label[0]="";
+ }
+ else {
+ if( $this->label_formfunc != '' ) {
+ $f = $this->label_formfunc;
+ $this->maj_ticks_label[0]=call_user_func($f,$start);
+ }
+ elseif( $this->label_logtype == 0 ) {
+ $this->maj_ticks_label[0]=$start;
+ }
+ else {
+ $this->maj_ticks_label[0]='10^'.round(log10($start));
+ }
+ }
+ $i=1;
+ for($x=$start; $x<=$limit; $x+=$step,++$count ) {
+ $xs=$scale->Translate($x);
+ $this->ticks_pos[]=$xs;
+ $this->ticklabels_pos[]=$xs;
+ if( $count % 10 == 0 ) {
+ if( !$this->supress_tickmarks ) {
+ $img->Line($xs,$pos,$xs,$a2);
+ }
+ $this->maj_ticks_pos[$i]=$xs;
+ $this->maj_ticklabels_pos[$i]=$xs;
+
+ if( $this->label_formfunc != '' ) {
+ $f = $this->label_formfunc;
+ $this->maj_ticks_label[$i]=call_user_func($f,$nextMajor);
+ }
+ elseif( $this->label_logtype == 0 ) {
+ $this->maj_ticks_label[$i]=$nextMajor;
+ }
+ else {
+ $this->maj_ticks_label[$i]='10^'.round(log10($nextMajor));
+ }
+ ++$i;
+ $nextMajor *= 10;
+ $step *= 10;
+ $count=1;
+ }
+ else {
+ if( !$this->supress_tickmarks && !$this->supress_minor_tickmarks) {
+ $img->Line($xs,$pos,$xs,$a);
+ }
+ }
+ }
+ }
+ return true;
}
} // Class
/* EOF */
-?>
\ Pas de fin de ligne à la fin du fichier.
+?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_meshinterpolate.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_meshinterpolate.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_meshinterpolate.inc.php 1969-12-31 19:00:00.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_meshinterpolate.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -0,0 +1,105 @@
+Linear($aData,$aFactor);
+}
+
+/**
+ * Utility class to interpolate a given data matrix
+ *
+ */
+class MeshInterpolate {
+ private $data = array();
+
+ /**
+ * Calculate the mid points of the given rectangle which has its top left
+ * corner at $row,$col. The $aFactordecides how many spliots should be done.
+ * i.e. how many more divisions should be done recursively
+ *
+ * @param $row Top left corner of square to work with
+ * @param $col Top left corner of square to work with
+ * $param $aFactor In how many subsquare should we split this square. A value of 1 indicates that no action
+ */
+ function IntSquare( $aRow, $aCol, $aFactor ) {
+ if ( $aFactor <= 1 )
+ return;
+
+ $step = pow( 2, $aFactor-1 );
+
+ $v0 = $this->data[$aRow][$aCol];
+ $v1 = $this->data[$aRow][$aCol + $step];
+ $v2 = $this->data[$aRow + $step][$aCol];
+ $v3 = $this->data[$aRow + $step][$aCol + $step];
+
+ $this->data[$aRow][$aCol + $step / 2] = ( $v0 + $v1 ) / 2;
+ $this->data[$aRow + $step / 2][$aCol] = ( $v0 + $v2 ) / 2;
+ $this->data[$aRow + $step][$aCol + $step / 2] = ( $v2 + $v3 ) / 2;
+ $this->data[$aRow + $step / 2][$aCol + $step] = ( $v1 + $v3 ) / 2;
+ $this->data[$aRow + $step / 2][$aCol + $step / 2] = ( $v0 + $v1 + $v2 + $v3 ) / 4;
+
+ $this->IntSquare( $aRow, $aCol, $aFactor-1 );
+ $this->IntSquare( $aRow, $aCol + $step / 2, $aFactor-1 );
+ $this->IntSquare( $aRow + $step / 2, $aCol, $aFactor-1 );
+ $this->IntSquare( $aRow + $step / 2, $aCol + $step / 2, $aFactor-1 );
+ }
+
+ /**
+ * Interpolate values in a matrice so that the total number of data points
+ * in vert and horizontal axis are $aIntNbr more. For example $aIntNbr=2 will
+ * make the data matrice have tiwce as many vertical and horizontal dta points.
+ *
+ * Note: This will blow up the matrcide in memory size in the order of $aInNbr^2
+ *
+ * @param $ &$aData The original data matricde
+ * @param $aInNbr Interpolation factor
+ * @return the interpolated matrice
+ */
+ function Linear( &$aData, $aIntFactor ) {
+ $step = pow( 2, $aIntFactor-1 );
+
+ $orig_cols = count( $aData[0] );
+ $orig_rows = count( $aData );
+ // Number of new columns/rows
+ // N = (a-1) * 2^(f-1) + 1
+ $p = pow( 2, $aIntFactor-1 );
+ $new_cols = $p * ( $orig_cols - 1 ) + 1;
+ $new_rows = $p * ( $orig_rows - 1 ) + 1;
+
+ $this->data = array_fill( 0, $new_rows, array_fill( 0, $new_cols, 0 ) );
+ // Initialize the new matrix with the values that we know
+ for ( $i = 0; $i < $new_rows; $i++ ) {
+ for ( $j = 0; $j < $new_cols; $j++ ) {
+ $v = 0 ;
+ if ( ( $i % $step == 0 ) && ( $j % $step == 0 ) ) {
+ $v = $aData[$i / $step][$j / $step];
+ }
+ $this->data[$i][$j] = $v;
+ }
+ }
+
+ for ( $i = 0; $i < $new_rows-1; $i += $step ) {
+ for ( $j = 0; $j < $new_cols-1; $j += $step ) {
+ $this->IntSquare( $i, $j, $aIntFactor );
+ }
+ }
+
+ return $this->data;
+ }
+}
+
+?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_mgraph.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_mgraph.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_mgraph.php 2008-06-23 11:01:51.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_mgraph.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,381 +1,345 @@
iWidth = $aWidth;
- $this->iHeight = $aHeight;
+ function __construct($aWidth=NULL,$aHeight=NULL,$aCachedName='',$aTimeOut=0,$aInline=true) {
+ $this->iWidth = $aWidth;
+ $this->iHeight = $aHeight;
+
+ // If the cached version exist just read it directly from the
+ // cache, stream it back to browser and exit
+ if( $aCachedName!='' && READ_CACHE && $aInline ) {
+ $this->cache = new ImgStreamCache();
+ $this->cache->SetTimeOut($aTimeOut);
+ $image = new Image();
+ if( $this->cache->GetAndStream($image,$aCachedName) ) {
+ exit();
+ }
+ }
+ $this->inline = $aInline;
+ $this->cache_name = $aCachedName;
+
+ $this->title = new Text();
+ $this->title->ParagraphAlign('center');
+ $this->title->SetFont(FF_FONT2,FS_BOLD);
+ $this->title->SetMargin(3);
+ $this->title->SetAlign('center');
+
+ $this->subtitle = new Text();
+ $this->subtitle->ParagraphAlign('center');
+ $this->subtitle->SetFont(FF_FONT1,FS_BOLD);
+ $this->subtitle->SetMargin(3);
+ $this->subtitle->SetAlign('center');
+
+ $this->subsubtitle = new Text();
+ $this->subsubtitle->ParagraphAlign('center');
+ $this->subsubtitle->SetFont(FF_FONT1,FS_NORMAL);
+ $this->subsubtitle->SetMargin(3);
+ $this->subsubtitle->SetAlign('center');
+
+ $this->footer = new Footer();
+
}
// Specify background fill color for the combined graph
function SetFillColor($aColor) {
- $this->iFillColor = $aColor;
+ $this->iFillColor = $aColor;
}
// Add a frame around the combined graph
function SetFrame($aFlg,$aColor='black',$aWeight=1) {
- $this->iDoFrame = $aFlg;
- $this->iFrameColor = $aColor;
- $this->iFrameWeight = $aWeight;
+ $this->iDoFrame = $aFlg;
+ $this->iFrameColor = $aColor;
+ $this->iFrameWeight = $aWeight;
}
- // Specify a background image blend
+ // Specify a background image blend
function SetBackgroundImageMix($aMix) {
- $this->background_image_mix = $aMix ;
+ $this->background_image_mix = $aMix ;
}
// Specify a background image
function SetBackgroundImage($aFileName,$aCenter_aX=NULL,$aY=NULL) {
- // Second argument can be either a boolean value or
- // a numeric
- $aCenter=TRUE;
- $aX=NULL;
-
- if( is_numeric($aCenter_aX) ) {
- $aX=$aCenter_aX;
- }
-
- // Get extension to determine image type
- $e = explode('.',$aFileName);
- if( !$e ) {
- JpGraphError::RaiseL(12002,$aFileName);
-//('Incorrect file name for MGraph::SetBackgroundImage() : '.$aFileName.' Must have a valid image extension (jpg,gif,png) when using autodetection of image type');
- }
-
- $valid_formats = array('png', 'jpg', 'gif');
- $aImgFormat = strtolower($e[count($e)-1]);
- if ($aImgFormat == 'jpeg') {
- $aImgFormat = 'jpg';
- }
- elseif (!in_array($aImgFormat, $valid_formats) ) {
- JpGraphError::RaiseL(12003,$aImgFormat,$aFileName);
-//('Unknown file extension ($aImgFormat) in MGraph::SetBackgroundImage() for filename: '.$aFileName);
- }
-
- $this->background_image = $aFileName;
- $this->background_image_center=$aCenter;
- $this->background_image_format=$aImgFormat;
- $this->background_image_x = $aX;
- $this->background_image_y = $aY;
- }
-
-
- // Private helper function for backgound image
- function _loadBkgImage($aFile='') {
- if( $aFile == '' )
- $aFile = $this->background_image;
-
- // Remove case sensitivity and setup appropriate function to create image
- // Get file extension. This should be the LAST '.' separated part of the filename
- $e = explode('.',$aFile);
- $ext = strtolower($e[count($e)-1]);
- if ($ext == "jpeg") {
- $ext = "jpg";
- }
-
- if( trim($ext) == '' )
- $ext = 'png'; // Assume PNG if no extension specified
-
- $supported = imagetypes();
- if( ( $ext == 'jpg' && !($supported & IMG_JPG) ) ||
- ( $ext == 'gif' && !($supported & IMG_GIF) ) ||
- ( $ext == 'png' && !($supported & IMG_PNG) ) ) {
- JpGraphError::RaiseL(12004,$aFile);//('The image format of your background image ('.$aFile.') is not supported in your system configuration. ');
- }
-
- if( $ext == "jpg" || $ext == "jpeg") {
- $f = "imagecreatefromjpeg";
- $ext = "jpg";
- }
- else {
- $f = "imagecreatefrom".$ext;
- }
-
- $img = @$f($aFile);
- if( !$img ) {
- JpGraphError::RaiseL(12005,$aFile);
-//(" Can't read background image: '".$aFile."'");
- }
- return $img;
- }
+ // Second argument can be either a boolean value or
+ // a numeric
+ $aCenter=TRUE;
+ $aX=NULL;
+
+ if( is_numeric($aCenter_aX) ) {
+ $aX=$aCenter_aX;
+ }
+
+ // Get extension to determine image type
+ $e = explode('.',$aFileName);
+ if( !$e ) {
+ JpGraphError::RaiseL(12002,$aFileName);
+ //('Incorrect file name for MGraph::SetBackgroundImage() : '.$aFileName.' Must have a valid image extension (jpg,gif,png) when using autodetection of image type');
+ }
+
+ $valid_formats = array('png', 'jpg', 'gif');
+ $aImgFormat = strtolower($e[count($e)-1]);
+ if ($aImgFormat == 'jpeg') {
+ $aImgFormat = 'jpg';
+ }
+ elseif (!in_array($aImgFormat, $valid_formats) ) {
+ JpGraphError::RaiseL(12003,$aImgFormat,$aFileName);
+ //('Unknown file extension ($aImgFormat) in MGraph::SetBackgroundImage() for filename: '.$aFileName);
+ }
+
+ $this->background_image = $aFileName;
+ $this->background_image_center=$aCenter;
+ $this->background_image_format=$aImgFormat;
+ $this->background_image_x = $aX;
+ $this->background_image_y = $aY;
+ }
function _strokeBackgroundImage() {
- if( $this->background_image == '' )
- return;
+ if( $this->background_image == '' ) return;
- $bkgimg = $this->_loadBkgImage();
- // Background width & Heoght
- $bw = imagesx($bkgimg);
- $bh = imagesy($bkgimg);
- // Canvas width and height
- $cw = imagesx($this->img);
- $ch = imagesy($this->img);
-
- if( $this->background_image_x === NULL || $this->background_image_y === NULL ) {
- if( $this->background_image_center ) {
- // Center original image in the plot area
- $x = round($cw/2-$bw/2); $y = round($ch/2-$bh/2);
- }
- else {
- // Just copy the image from left corner, no resizing
- $x=0; $y=0;
- }
- }
- else {
- $x = $this->background_image_x;
- $y = $this->background_image_y;
- }
- $this->_imageCp($bkgimg,$x,$y,0,0,$bw,$bh,$this->background_image_mix);
- }
-
- function _imageCp($aSrcImg,$x,$y,$fx,$fy,$w,$h,$mix=100) {
- imagecopymerge($this->img,$aSrcImg,$x,$y,$fx,$fy,$w,$h,$mix);
- }
-
- function _imageCreate($aWidth,$aHeight) {
- if( $aWidth <= 1 || $aHeight <= 1 ) {
- JpGraphError::RaiseL(12006,$aWidth,$aHeight);
-//("Illegal sizes specified for width or height when creating an image, (width=$aWidth, height=$aHeight)");
- }
- $this->img = @imagecreatetruecolor($aWidth, $aHeight);
- if( $this->img < 1 ) {
- JpGraphError::RaiseL(12011);
-// die("JpGraph Error: Can't create truecolor image. Check that you really have GD2 library installed.");
- }
- ImageAlphaBlending($this->img,true);
- }
-
- function _polygon($p,$closed=FALSE) {
- if( $this->iLineWeight==0 ) return;
- $n=count($p);
- $oldx = $p[0];
- $oldy = $p[1];
- for( $i=2; $i < $n; $i+=2 ) {
- imageline($this->img,$oldx,$oldy,$p[$i],$p[$i+1],$this->iCurrentColor);
- $oldx = $p[$i];
- $oldy = $p[$i+1];
- }
- if( $closed ) {
- imageline($this->img,$p[$n*2-2],$p[$n*2-1],$p[0],$p[1],$this->iCurrentColor);
- }
- }
-
- function _filledPolygon($pts) {
- $n=count($pts);
- for($i=0; $i < $n; ++$i)
- $pts[$i] = round($pts[$i]);
- imagefilledpolygon($this->img,$pts,count($pts)/2,$this->iCurrentColor);
- }
-
- function _rectangle($xl,$yu,$xr,$yl) {
- for($i=0; $i < $this->iLineWeight; ++$i )
- $this->_polygon(array($xl+$i,$yu+$i,$xr-$i,$yu+$i,
- $xr-$i,$yl-$i,$xl+$i,$yl-$i,
- $xl+$i,$yu+$i));
- }
-
- function _filledRectangle($xl,$yu,$xr,$yl) {
- $this->_filledPolygon(array($xl,$yu,$xr,$yu,$xr,$yl,$xl,$yl));
- }
+ $bkgimg = Graph::LoadBkgImage('',$this->background_image);
- function _setColor($aColor) {
- $this->iCurrentColor = $this->iRGB->Allocate($aColor);
+ // Background width & Heoght
+ $bw = imagesx($bkgimg);
+ $bh = imagesy($bkgimg);
+
+ // Canvas width and height
+ $cw = imagesx($this->img);
+ $ch = imagesy($this->img);
+
+ if( $this->doshadow ) {
+ $cw -= $this->shadow_width;
+ $ch -= $this->shadow_width;
+ }
+
+ if( $this->background_image_x === NULL || $this->background_image_y === NULL ) {
+ if( $this->background_image_center ) {
+ // Center original image in the plot area
+ $x = round($cw/2-$bw/2); $y = round($ch/2-$bh/2);
+ }
+ else {
+ // Just copy the image from left corner, no resizing
+ $x=0; $y=0;
+ }
+ }
+ else {
+ $x = $this->background_image_x;
+ $y = $this->background_image_y;
+ }
+ imagecopymerge($this->img,$bkgimg,$x,$y,0,0,$bw,$bh,$this->background_image_mix);
}
function AddMix($aGraph,$x=0,$y=0,$mix=100,$fx=0,$fy=0,$w=0,$h=0) {
- $this->_gdImgHandle($aGraph->Stroke( _IMG_HANDLER),$x,$y,$fx=0,$fy=0,$w,$h,$mix);
- }
+ $this->_gdImgHandle($aGraph->Stroke( _IMG_HANDLER),$x,$y,$fx=0,$fy=0,$w,$h,$mix);
+ }
- function Add($aGraph,$x=0,$y=0,$fx=0,$fy=0,$w=0,$h=0) {
- $this->_gdImgHandle($aGraph->Stroke( _IMG_HANDLER),$x,$y,$fx=0,$fy=0,$w,$h);
- }
+ function Add($aGraph,$x=0,$y=0,$fx=0,$fy=0,$w=0,$h=0) {
+ $this->_gdImgHandle($aGraph->Stroke( _IMG_HANDLER),$x,$y,$fx=0,$fy=0,$w,$h);
+ }
function _gdImgHandle($agdCanvas,$x,$y,$fx=0,$fy=0,$w=0,$h=0,$mix=100) {
- if( $w == 0 ) $w = @imagesx($agdCanvas);
- if( $w === NULL ) {
- JpGraphError::RaiseL(12007);
-//('Argument to MGraph::Add() is not a valid GD image handle.');
- return;
- }
- if( $h == 0 ) $h = @imagesy($agdCanvas);
- $this->iGraphs[$this->iCnt++] = array($agdCanvas,$x,$y,$fx,$fy,$w,$h,$mix);
+ if( $w == 0 ) {
+ $w = @imagesx($agdCanvas);
+ }
+ if( $w === NULL ) {
+ JpGraphError::RaiseL(12007);
+ //('Argument to MGraph::Add() is not a valid GD image handle.');
+ return;
+ }
+ if( $h == 0 ) {
+ $h = @imagesy($agdCanvas);
+ }
+ $this->iGraphs[$this->iCnt++] = array($agdCanvas,$x,$y,$fx,$fy,$w,$h,$mix);
}
function SetMargin($lm,$rm,$tm,$bm) {
- $this->lm = $lm;
- $this->rm = $rm;
- $this->tm = $tm;
- $this->bm = $bm;
+ $this->lm = $lm;
+ $this->rm = $rm;
+ $this->tm = $tm;
+ $this->bm = $bm;
}
function SetExpired($aFlg=true) {
- $this->expired = $aFlg;
+ $this->expired = $aFlg;
}
- // Generate image header
- function Headers() {
-
- // In case we are running from the command line with the client version of
- // PHP we can't send any headers.
- $sapi = php_sapi_name();
- if( $sapi == 'cli' )
- return;
-
- if( headers_sent() ) {
-
- echo "
";
-
- die();
-
- }
-
-
- if ($this->expired) {
- header("Expires: Mon, 26 Jul 1997 05:00:00 GMT");
- header("Last-Modified: " . gmdate("D, d M Y H:i:s") . "GMT");
- header("Cache-Control: no-cache, must-revalidate");
- header("Pragma: no-cache");
- }
- header("Content-type: image/$this->img_format");
+ function SetImgFormat($aFormat,$aQuality=75) {
+ $this->image_format = $aFormat;
+ $this->image_quality = $aQuality;
}
- function SetImgFormat($aFormat,$aQuality=75) {
- $this->image_quality = $aQuality;
- $aFormat = strtolower($aFormat);
- $tst = true;
- $supported = imagetypes();
- if( $aFormat=="auto" ) {
- if( $supported & IMG_PNG )
- $this->img_format="png";
- elseif( $supported & IMG_JPG )
- $this->img_format="jpeg";
- elseif( $supported & IMG_GIF )
- $this->img_format="gif";
- else
- JpGraphError::RaiseL(12008);
-//(" Your PHP (and GD-lib) installation does not appear to support any known graphic formats.".
- return true;
- }
- else {
- if( $aFormat=="jpeg" || $aFormat=="png" || $aFormat=="gif" ) {
- if( $aFormat=="jpeg" && !($supported & IMG_JPG) )
- $tst=false;
- elseif( $aFormat=="png" && !($supported & IMG_PNG) )
- $tst=false;
- elseif( $aFormat=="gif" && !($supported & IMG_GIF) )
- $tst=false;
- else {
- $this->img_format=$aFormat;
- return true;
- }
- }
- else
- $tst=false;
- if( !$tst )
- JpGraphError::RaiseL(12009,$aFormat);
-//(" Your PHP installation does not support the chosen graphic format: $aFormat");
- }
- }
-
- // Stream image to browser or to file
- function Stream($aFile="") {
- $func="image".$this->img_format;
- if( $this->img_format=="jpeg" && $this->image_quality != null ) {
- $res = @$func($this->img,$aFile,$this->image_quality);
- }
- else {
- if( $aFile != "" ) {
- $res = @$func($this->img,$aFile);
- }
- else
- $res = @$func($this->img);
- }
- if( !$res )
- JpGraphError::RaiseL(12010,$aFile);
-//("Can't create or stream image to file $aFile Check that PHP has enough permission to write a file to the current directory.");
+ // Set the shadow around the whole image
+ function SetShadow($aShowShadow=true,$aShadowWidth=4,$aShadowColor='gray@0.3') {
+ $this->doshadow = $aShowShadow;
+ $this->shadow_color = $aShadowColor;
+ $this->shadow_width = $aShadowWidth;
+ $this->footer->iBottomMargin += $aShadowWidth;
+ $this->footer->iRightMargin += $aShadowWidth;
+ }
+
+ function StrokeTitle($image,$w,$h) {
+ // Stroke title
+ if( $this->title->t !== '' ) {
+
+ $margin = 3;
+
+ $y = $this->title->margin;
+ if( $this->title->halign == 'center' ) {
+ $this->title->Center(0,$w,$y);
+ }
+ elseif( $this->title->halign == 'left' ) {
+ $this->title->SetPos($this->title->margin+2,$y);
+ }
+ elseif( $this->title->halign == 'right' ) {
+ $indent = 0;
+ if( $this->doshadow ) {
+ $indent = $this->shadow_width+2;
+ }
+ $this->title->SetPos($w-$this->title->margin-$indent,$y,'right');
+ }
+ $this->title->Stroke($image);
+
+ // ... and subtitle
+ $y += $this->title->GetTextHeight($image) + $margin + $this->subtitle->margin;
+ if( $this->subtitle->halign == 'center' ) {
+ $this->subtitle->Center(0,$w,$y);
+ }
+ elseif( $this->subtitle->halign == 'left' ) {
+ $this->subtitle->SetPos($this->subtitle->margin+2,$y);
+ }
+ elseif( $this->subtitle->halign == 'right' ) {
+ $indent = 0;
+ if( $this->doshadow ) {
+ $indent = $this->shadow_width+2;
+ }
+ $this->subtitle->SetPos($this->img->width-$this->subtitle->margin-$indent,$y,'right');
+ }
+ $this->subtitle->Stroke($image);
+
+ // ... and subsubtitle
+ $y += $this->subtitle->GetTextHeight($image) + $margin + $this->subsubtitle->margin;
+ if( $this->subsubtitle->halign == 'center' ) {
+ $this->subsubtitle->Center(0,$w,$y);
+ }
+ elseif( $this->subsubtitle->halign == 'left' ) {
+ $this->subsubtitle->SetPos($this->subsubtitle->margin+2,$y);
+ }
+ elseif( $this->subsubtitle->halign == 'right' ) {
+ $indent = 0;
+ if( $this->doshadow ) {
+ $indent = $this->shadow_width+2;
+ }
+ $this->subsubtitle->SetPos($w-$this->subsubtitle->margin-$indent,$y,'right');
+ }
+ $this->subsubtitle->Stroke($image);
+
+ }
}
function Stroke($aFileName='') {
- // Find out the necessary size for the container image
- $w=0; $h=0;
- for($i=0; $i < $this->iCnt; ++$i ) {
- $maxw = $this->iGraphs[$i][1]+$this->iGraphs[$i][5];
- $maxh = $this->iGraphs[$i][2]+$this->iGraphs[$i][6];
- $w = max( $w, $maxw );
- $h = max( $h, $maxh );
- }
- $w += $this->lm+$this->rm;
- $h += $this->tm+$this->bm;
-
- // User specified width,height overrides
- if( $this->iWidth !== NULL ) $w = $this->iWidth;
- if( $this->iHeight!== NULL ) $h = $this->iHeight;
-
- $this->_imageCreate($w,$h);
- $this->iRGB = new RGB($this->img);
-
- $this->_setcolor($this->iFillColor);
- $this->_filledRectangle(0,0,$w-1,$h-1);
-
- $this->_strokeBackgroundImage();
-
- if( $this->iDoFrame ) {
- $this->_setColor($this->iFrameColor);
- $this->iLineWeight=$this->iFrameWeight;
- $this->_rectangle(0,0,$w-1,$h-1);
- }
-
- // Copy all sub graphs to the container
- for($i=0; $i < $this->iCnt; ++$i ) {
- $this->_imageCp($this->iGraphs[$i][0],
- $this->iGraphs[$i][1]+$this->lm,$this->iGraphs[$i][2]+$this->tm,
- $this->iGraphs[$i][3],$this->iGraphs[$i][4],
- $this->iGraphs[$i][5],$this->iGraphs[$i][6],
- $this->iGraphs[$i][7]);
- }
-
- // Output image
- if( $aFileName == _IMG_HANDLER ) {
- return $this->img;
- }
- else {
- if( $aFileName != '' ) {
- $this->Stream($aFileName);
- }
- else {
- $this->Headers();
- $this->Stream();
- }
- }
+ // Find out the necessary size for the container image
+ $w=0; $h=0;
+ for($i=0; $i < $this->iCnt; ++$i ) {
+ $maxw = $this->iGraphs[$i][1]+$this->iGraphs[$i][5];
+ $maxh = $this->iGraphs[$i][2]+$this->iGraphs[$i][6];
+ $w = max( $w, $maxw );
+ $h = max( $h, $maxh );
+ }
+ $w += $this->lm+$this->rm;
+ $h += $this->tm+$this->bm;
+
+ // User specified width,height overrides
+ if( $this->iWidth !== NULL && $this->iWidth !== 0 ) $w = $this->iWidth;
+ if( $this->iHeight!== NULL && $this->iHeight !== 0) $h = $this->iHeight;
+
+ if( $this->doshadow ) {
+ $w += $this->shadow_width;
+ $h += $this->shadow_width;
+ }
+
+ $image = new Image($w,$h);
+ $image->SetImgFormat( $this->image_format,$this->image_quality);
+
+ if( $this->doshadow ) {
+ $image->SetColor($this->iFrameColor);
+ $image->ShadowRectangle(0,0,$w-1,$h-1,$this->iFillColor,$this->shadow_width,$this->shadow_color);
+ $w -= $this->shadow_width;
+ $h -= $this->shadow_width;
+ }
+ else {
+ $image->SetColor($this->iFillColor);
+ $image->FilledRectangle(0,0,$w-1,$h-1);
+ }
+ $image->SetExpired($this->expired);
+
+ $this->img = $image->img;
+ $this->_strokeBackgroundImage();
+
+ if( $this->iDoFrame && ! $this->doshadow ) {
+ $image->SetColor($this->iFrameColor);
+ $image->SetLineWeight($this->iFrameWeight);
+ $image->Rectangle(0,0,$w-1,$h-1);
+ }
+
+ // Copy all sub graphs to the container
+ for($i=0; $i < $this->iCnt; ++$i ) {
+ $image->CopyMerge($this->iGraphs[$i][0],
+ $this->iGraphs[$i][1]+$this->lm,$this->iGraphs[$i][2]+$this->tm,
+ $this->iGraphs[$i][3],$this->iGraphs[$i][4],
+ $this->iGraphs[$i][5],$this->iGraphs[$i][6],
+ -1,-1, /* Full from width and height */
+ $this->iGraphs[$i][7]);
+
+
+ }
+
+ $this->StrokeTitle($image,$w,$h);
+ $this->footer->Stroke($image);
+
+ // Output image
+ if( $aFileName == _IMG_HANDLER ) {
+ return $image->img;
+ }
+ else {
+ //Finally stream the generated picture
+ $this->cache = new ImgStreamCache();
+ $this->cache->PutAndStream($image,$this->cache_name,$this->inline,$aFileName);
+ }
}
}
+// EOF
+
?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph.php 2008-09-19 11:43:22.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,199 +1,235 @@
Get(11,$file,$lineno);
- die($msg);
- }
- else {
- DEFINE('CACHE_DIR', $_SERVER['TEMP'] . '/');
- }
- } else {
- DEFINE('CACHE_DIR','/tmp/jpgraph_cache/');
- }
- }
-}
-elseif( !defined('CACHE_DIR') ) {
- DEFINE('CACHE_DIR', '');
-}
-
-if (!defined('TTF_DIR')) {
- if (strstr( PHP_OS, 'WIN') ) {
- $sroot = getenv('SystemRoot');
- if( empty($sroot) ) {
- $t = new ErrMsgText();
- $msg = $t->Get(12,$file,$lineno);
- die($msg);
- }
- else {
- DEFINE('TTF_DIR', $sroot.'/fonts/');
- }
- } else {
- DEFINE('TTF_DIR','/usr/X11R6/lib/X11/fonts/truetype/');
- }
-}
-
-if (!defined('MBTTF_DIR')) {
- if (strstr( PHP_OS, 'WIN') ) {
- $sroot = getenv('SystemRoot');
- if( empty($sroot) ) {
- $t = new ErrMsgText();
- $msg = $t->Get(12,$file,$lineno);
- die($msg);
- }
- else {
- DEFINE('TTF_DIR', $sroot.'/fonts/');
- }
- } else {
- DEFINE('MBTTF_DIR','/usr/share/fonts/ja/TrueType/');
- }
-}
+define('MIN_PHPVERSION','5.1.0');
-//------------------------------------------------------------------
-// Constants which are used as parameters for the method calls
-//------------------------------------------------------------------
+// Special file name to indicate that we only want to calc
+// the image map in the call to Graph::Stroke() used
+// internally from the GetHTMLCSIM() method.
+define('_CSIM_SPECIALFILE','_csim_special_');
+
+// HTTP GET argument that is used with image map
+// to indicate to the script to just generate the image
+// and not the full CSIM HTML page.
+define('_CSIM_DISPLAY','_jpg_csimd');
+
+// Special filename for Graph::Stroke(). If this filename is given
+// then the image will NOT be streamed to browser of file. Instead the
+// Stroke call will return the handler for the created GD image.
+define('_IMG_HANDLER','__handle');
+
+// Special filename for Graph::Stroke(). If this filename is given
+// the image will be stroked to a file with a name based on the script name.
+define('_IMG_AUTO','auto');
// Tick density
-DEFINE("TICKD_DENSE",1);
-DEFINE("TICKD_NORMAL",2);
-DEFINE("TICKD_SPARSE",3);
-DEFINE("TICKD_VERYSPARSE",4);
-
-// Side for ticks and labels.
-DEFINE("SIDE_LEFT",-1);
-DEFINE("SIDE_RIGHT",1);
-DEFINE("SIDE_DOWN",-1);
-DEFINE("SIDE_BOTTOM",-1);
-DEFINE("SIDE_UP",1);
-DEFINE("SIDE_TOP",1);
+define("TICKD_DENSE",1);
+define("TICKD_NORMAL",2);
+define("TICKD_SPARSE",3);
+define("TICKD_VERYSPARSE",4);
+
+// Side for ticks and labels.
+define("SIDE_LEFT",-1);
+define("SIDE_RIGHT",1);
+define("SIDE_DOWN",-1);
+define("SIDE_BOTTOM",-1);
+define("SIDE_UP",1);
+define("SIDE_TOP",1);
// Legend type stacked vertical or horizontal
-DEFINE("LEGEND_VERT",0);
-DEFINE("LEGEND_HOR",1);
+define("LEGEND_VERT",0);
+define("LEGEND_HOR",1);
// Mark types for plot marks
-DEFINE("MARK_SQUARE",1);
-DEFINE("MARK_UTRIANGLE",2);
-DEFINE("MARK_DTRIANGLE",3);
-DEFINE("MARK_DIAMOND",4);
-DEFINE("MARK_CIRCLE",5);
-DEFINE("MARK_FILLEDCIRCLE",6);
-DEFINE("MARK_CROSS",7);
-DEFINE("MARK_STAR",8);
-DEFINE("MARK_X",9);
-DEFINE("MARK_LEFTTRIANGLE",10);
-DEFINE("MARK_RIGHTTRIANGLE",11);
-DEFINE("MARK_FLASH",12);
-DEFINE("MARK_IMG",13);
-DEFINE("MARK_FLAG1",14);
-DEFINE("MARK_FLAG2",15);
-DEFINE("MARK_FLAG3",16);
-DEFINE("MARK_FLAG4",17);
+define("MARK_SQUARE",1);
+define("MARK_UTRIANGLE",2);
+define("MARK_DTRIANGLE",3);
+define("MARK_DIAMOND",4);
+define("MARK_CIRCLE",5);
+define("MARK_FILLEDCIRCLE",6);
+define("MARK_CROSS",7);
+define("MARK_STAR",8);
+define("MARK_X",9);
+define("MARK_LEFTTRIANGLE",10);
+define("MARK_RIGHTTRIANGLE",11);
+define("MARK_FLASH",12);
+define("MARK_IMG",13);
+define("MARK_FLAG1",14);
+define("MARK_FLAG2",15);
+define("MARK_FLAG3",16);
+define("MARK_FLAG4",17);
// Builtin images
-DEFINE("MARK_IMG_PUSHPIN",50);
-DEFINE("MARK_IMG_SPUSHPIN",50);
-DEFINE("MARK_IMG_LPUSHPIN",51);
-DEFINE("MARK_IMG_DIAMOND",52);
-DEFINE("MARK_IMG_SQUARE",53);
-DEFINE("MARK_IMG_STAR",54);
-DEFINE("MARK_IMG_BALL",55);
-DEFINE("MARK_IMG_SBALL",55);
-DEFINE("MARK_IMG_MBALL",56);
-DEFINE("MARK_IMG_LBALL",57);
-DEFINE("MARK_IMG_BEVEL",58);
+define("MARK_IMG_PUSHPIN",50);
+define("MARK_IMG_SPUSHPIN",50);
+define("MARK_IMG_LPUSHPIN",51);
+define("MARK_IMG_DIAMOND",52);
+define("MARK_IMG_SQUARE",53);
+define("MARK_IMG_STAR",54);
+define("MARK_IMG_BALL",55);
+define("MARK_IMG_SBALL",55);
+define("MARK_IMG_MBALL",56);
+define("MARK_IMG_LBALL",57);
+define("MARK_IMG_BEVEL",58);
// Inline defines
-DEFINE("INLINE_YES",1);
-DEFINE("INLINE_NO",0);
+define("INLINE_YES",1);
+define("INLINE_NO",0);
// Format for background images
-DEFINE("BGIMG_FILLPLOT",1);
-DEFINE("BGIMG_FILLFRAME",2);
-DEFINE("BGIMG_COPY",3);
-DEFINE("BGIMG_CENTER",4);
+define("BGIMG_FILLPLOT",1);
+define("BGIMG_FILLFRAME",2);
+define("BGIMG_COPY",3);
+define("BGIMG_CENTER",4);
+define("BGIMG_FREE",5);
// Depth of objects
-DEFINE("DEPTH_BACK",0);
-DEFINE("DEPTH_FRONT",1);
+define("DEPTH_BACK",0);
+define("DEPTH_FRONT",1);
// Direction
-DEFINE("VERTICAL",1);
-DEFINE("HORIZONTAL",0);
+define("VERTICAL",1);
+define("HORIZONTAL",0);
// Axis styles for scientific style axis
-DEFINE('AXSTYLE_SIMPLE',1);
-DEFINE('AXSTYLE_BOXIN',2);
-DEFINE('AXSTYLE_BOXOUT',3);
-DEFINE('AXSTYLE_YBOXIN',4);
-DEFINE('AXSTYLE_YBOXOUT',5);
+define('AXSTYLE_SIMPLE',1);
+define('AXSTYLE_BOXIN',2);
+define('AXSTYLE_BOXOUT',3);
+define('AXSTYLE_YBOXIN',4);
+define('AXSTYLE_YBOXOUT',5);
// Style for title backgrounds
-DEFINE('TITLEBKG_STYLE1',1);
-DEFINE('TITLEBKG_STYLE2',2);
-DEFINE('TITLEBKG_STYLE3',3);
-DEFINE('TITLEBKG_FRAME_NONE',0);
-DEFINE('TITLEBKG_FRAME_FULL',1);
-DEFINE('TITLEBKG_FRAME_BOTTOM',2);
-DEFINE('TITLEBKG_FRAME_BEVEL',3);
-DEFINE('TITLEBKG_FILLSTYLE_HSTRIPED',1);
-DEFINE('TITLEBKG_FILLSTYLE_VSTRIPED',2);
-DEFINE('TITLEBKG_FILLSTYLE_SOLID',3);
+define('TITLEBKG_STYLE1',1);
+define('TITLEBKG_STYLE2',2);
+define('TITLEBKG_STYLE3',3);
+define('TITLEBKG_FRAME_NONE',0);
+define('TITLEBKG_FRAME_FULL',1);
+define('TITLEBKG_FRAME_BOTTOM',2);
+define('TITLEBKG_FRAME_BEVEL',3);
+define('TITLEBKG_FILLSTYLE_HSTRIPED',1);
+define('TITLEBKG_FILLSTYLE_VSTRIPED',2);
+define('TITLEBKG_FILLSTYLE_SOLID',3);
+
+// Styles for axis labels background
+define('LABELBKG_NONE',0);
+define('LABELBKG_XAXIS',1);
+define('LABELBKG_YAXIS',2);
+define('LABELBKG_XAXISFULL',3);
+define('LABELBKG_YAXISFULL',4);
+define('LABELBKG_XYFULL',5);
+define('LABELBKG_XY',6);
+
// Style for background gradient fills
-DEFINE('BGRAD_FRAME',1);
-DEFINE('BGRAD_MARGIN',2);
-DEFINE('BGRAD_PLOT',3);
+define('BGRAD_FRAME',1);
+define('BGRAD_MARGIN',2);
+define('BGRAD_PLOT',3);
// Width of tab titles
-DEFINE('TABTITLE_WIDTHFIT',0);
-DEFINE('TABTITLE_WIDTHFULL',-1);
+define('TABTITLE_WIDTHFIT',0);
+define('TABTITLE_WIDTHFULL',-1);
// Defines for 3D skew directions
-DEFINE('SKEW3D_UP',0);
-DEFINE('SKEW3D_DOWN',1);
-DEFINE('SKEW3D_LEFT',2);
-DEFINE('SKEW3D_RIGHT',3);
+define('SKEW3D_UP',0);
+define('SKEW3D_DOWN',1);
+define('SKEW3D_LEFT',2);
+define('SKEW3D_RIGHT',3);
// For internal use only
-DEFINE("_JPG_DEBUG",false);
-DEFINE("_FORCE_IMGTOFILE",false);
-DEFINE("_FORCE_IMGDIR",'/tmp/jpgimg/');
+define("_JPG_DEBUG",false);
+define("_FORCE_IMGTOFILE",false);
+define("_FORCE_IMGDIR",'/tmp/jpgimg/');
+
+//
+// Automatic settings of path for cache and font directory
+// if they have not been previously specified
+//
+if(USE_CACHE) {
+ if (!defined('CACHE_DIR')) {
+ if ( strstr( PHP_OS, 'WIN') ) {
+ if( empty($_SERVER['TEMP']) ) {
+ $t = new ErrMsgText();
+ $msg = $t->Get(11,$file,$lineno);
+ die($msg);
+ }
+ else {
+ define('CACHE_DIR', $_SERVER['TEMP'] . '/');
+ }
+ } else {
+ define('CACHE_DIR','/tmp/jpgraph_cache/');
+ }
+ }
+}
+elseif( !defined('CACHE_DIR') ) {
+ define('CACHE_DIR', '');
+}
+
+//
+// Setup path for western/latin TTF fonts
+//
+if (!defined('TTF_DIR')) {
+ if (strstr( PHP_OS, 'WIN') ) {
+ $sroot = getenv('SystemRoot');
+ if( empty($sroot) ) {
+ $t = new ErrMsgText();
+ $msg = $t->Get(12,$file,$lineno);
+ die($msg);
+ }
+ else {
+ define('TTF_DIR', $sroot.'/fonts/');
+ }
+ } else {
+ define('TTF_DIR','/usr/share/fonts/truetype/');
+ }
+}
+
+//
+// Setup path for MultiByte TTF fonts (japanese, chinese etc.)
+//
+if (!defined('MBTTF_DIR')) {
+ if (strstr( PHP_OS, 'WIN') ) {
+ $sroot = getenv('SystemRoot');
+ if( empty($sroot) ) {
+ $t = new ErrMsgText();
+ $msg = $t->Get(12,$file,$lineno);
+ die($msg);
+ }
+ else {
+ define('MBTTF_DIR', $sroot.'/fonts/');
+ }
+ } else {
+ define('MBTTF_DIR','/usr/share/fonts/truetype/');
+ }
+}
+//
+// Check minimum PHP version
+//
+function CheckPHPVersion($aMinVersion) {
+ list($majorC, $minorC, $editC) = preg_split('/[\/.-]/', PHP_VERSION);
+ list($majorR, $minorR, $editR) = preg_split('/[\/.-]/', $aMinVersion);
-function CheckPHPVersion($aMinVersion)
-{
- list($majorC, $minorC, $editC) = split('[/.-]', PHP_VERSION);
- list($majorR, $minorR, $editR) = split('[/.-]', $aMinVersion);
-
- if ($majorC > $majorR) return true;
+ if ($majorC != $majorR) return false;
if ($majorC < $majorR) return false;
// same major - check minor
if ($minorC > $minorR) return true;
@@ -208,33 +244,15 @@
//
if( !CheckPHPVersion(MIN_PHPVERSION) ) {
JpGraphError::RaiseL(13,PHP_VERSION,MIN_PHPVERSION);
+ die();
}
//
-// Routine to determine if GD1 or GD2 is installed
-//
-function CheckGDVersion() {
- if( !function_exists("imagetypes") || !function_exists('imagecreatefromstring') )
- return 0;
- $GDfuncList = get_extension_funcs('gd');
- if( !$GDfuncList )
- return 0 ;
- else {
- if( in_array('imagegd2',$GDfuncList) &&
- in_array('imagecreatetruecolor',$GDfuncList))
- return 2;
- else
- return 1;
- }
-}
-
-//
-// Check what version of the GD library is installed.
+// Make GD sanity check
//
-$gdversion = CheckGDVersion();
-if( $gdversion != 2 ) {
- JpGraphError::RaiseL(25002);
-//(" Your PHP installation does not seem to have the required GD 2.x library. Please see the PHP documentation on how to install and enable the GD library.");
+if( !function_exists("imagetypes") || !function_exists('imagecreatefromstring') ) {
+ JpGraphError::RaiseL(25001);
+ //("This PHP installation is not configured with the GD library. Please recompile PHP with GD support to run JpGraph. (Neither function imagetypes() nor imagecreatefromstring() does exist)");
}
//
@@ -243,7 +261,7 @@
function _phpErrorHandler($errno,$errmsg,$filename, $linenum, $vars) {
// Respect current error level
if( $errno & error_reporting() ) {
- JpGraphError::RaiseL(25003,basename($filename),$linenum,$errmsg);
+ JpGraphError::RaiseL(25003,basename($filename),$linenum,$errmsg);
}
}
@@ -252,42 +270,44 @@
}
//
-//Check if there were any warnings, perhaps some wrong includes by the user
+// Check if there were any warnings, perhaps some wrong includes by the user. In this
+// case we raise it immediately since otherwise the image will not show and makes
+// debugging difficult. This is controlled by the user setting CATCH_PHPERRMSG
//
-if( isset($GLOBALS['php_errormsg']) && CATCH_PHPERRMSG &&
- !preg_match('/|Deprecated|/i', $GLOBALS['php_errormsg'])) {
+if( isset($GLOBALS['php_errormsg']) && CATCH_PHPERRMSG && !preg_match('/|Deprecated|/i', $GLOBALS['php_errormsg']) ) {
JpGraphError::RaiseL(25004,$GLOBALS['php_errormsg']);
}
-
// Useful mathematical function
function sign($a) {return $a >= 0 ? 1 : -1;}
+//
// Utility function to generate an image name based on the filename we
// are running from and assuming we use auto detection of graphic format
// (top level), i.e it is safe to call this function
// from a script that uses JpGraph
+//
function GenImgName() {
- global $_SERVER;
-
// Determine what format we should use when we save the images
$supported = imagetypes();
- if( $supported & IMG_PNG ) $img_format="png";
+ if( $supported & IMG_PNG ) $img_format="png";
elseif( $supported & IMG_GIF ) $img_format="gif";
elseif( $supported & IMG_JPG ) $img_format="jpeg";
elseif( $supported & IMG_WBMP ) $img_format="wbmp";
elseif( $supported & IMG_XPM ) $img_format="xpm";
- if( !isset($_SERVER['PHP_SELF']) )
- JpGraphError::RaiseL(25005);
-//(" Can't access PHP_SELF, PHP global variable. You can't run PHP from command line if you want to use the 'auto' naming of cache or image files.");
+
+ if( !isset($_SERVER['PHP_SELF']) ) {
+ JpGraphError::RaiseL(25005);
+ //(" Can't access PHP_SELF, PHP global variable. You can't run PHP from command line if you want to use the 'auto' naming of cache or image files.");
+ }
$fname = basename($_SERVER['PHP_SELF']);
if( !empty($_SERVER['QUERY_STRING']) ) {
- $q = @$_SERVER['QUERY_STRING'];
- $fname .= '_'.preg_replace("/\W/", "_", $q).'.'.$img_format;
+ $q = @$_SERVER['QUERY_STRING'];
+ $fname .= '_'.preg_replace("/\W/", "_", $q).'.'.$img_format;
}
else {
- $fname = substr($fname,0,strlen($fname)-4).'.'.$img_format;
+ $fname = substr($fname,0,strlen($fname)-4).'.'.$img_format;
}
return $fname;
}
@@ -299,171 +319,167 @@
// timers can be started.
//===================================================
class JpgTimer {
- var $start;
- var $idx;
-//---------------
-// CONSTRUCTOR
- function JpgTimer() {
- $this->idx=0;
- }
+ private $start, $idx;
-//---------------
-// PUBLIC METHODS
+ function __construct() {
+ $this->idx=0;
+ }
// Push a new timer start on stack
function Push() {
- list($ms,$s)=explode(" ",microtime());
- $this->start[$this->idx++]=floor($ms*1000) + 1000*$s;
+ list($ms,$s)=explode(" ",microtime());
+ $this->start[$this->idx++]=floor($ms*1000) + 1000*$s;
}
// Pop the latest timer start and return the diff with the
// current time
function Pop() {
- assert($this->idx>0);
- list($ms,$s)=explode(" ",microtime());
- $etime=floor($ms*1000) + (1000*$s);
- $this->idx--;
- return $etime-$this->start[$this->idx];
+ assert($this->idx>0);
+ list($ms,$s)=explode(" ",microtime());
+ $etime=floor($ms*1000) + (1000*$s);
+ $this->idx--;
+ return $etime-$this->start[$this->idx];
}
} // Class
-$gJpgBrandTiming = BRAND_TIMING;
//===================================================
// CLASS DateLocale
// Description: Hold localized text used in dates
//===================================================
class DateLocale {
-
- var $iLocale = 'C'; // environmental locale be used by default
-
- var $iDayAbb = null;
- var $iShortDay = null;
- var $iShortMonth = null;
- var $iMonthName = null;
-//---------------
-// CONSTRUCTOR
- function DateLocale() {
- settype($this->iDayAbb, 'array');
- settype($this->iShortDay, 'array');
- settype($this->iShortMonth, 'array');
- settype($this->iMonthName, 'array');
+ public $iLocale = 'C'; // environmental locale be used by default
+ private $iDayAbb = null, $iShortDay = null, $iShortMonth = null, $iMonthName = null;
-
- $this->Set('C');
+ function __construct() {
+ settype($this->iDayAbb, 'array');
+ settype($this->iShortDay, 'array');
+ settype($this->iShortMonth, 'array');
+ settype($this->iMonthName, 'array');
+ $this->Set('C');
}
-//---------------
-// PUBLIC METHODS
function Set($aLocale) {
- if ( in_array($aLocale, array_keys($this->iDayAbb)) ){
- $this->iLocale = $aLocale;
- return TRUE; // already cached nothing else to do!
- }
-
- $pLocale = setlocale(LC_TIME, 0); // get current locale for LC_TIME
-
- if (is_array($aLocale)) {
- foreach ($aLocale as $loc) {
- $res = @setlocale(LC_TIME, $loc);
- if ( $res ) {
- $aLocale = $loc;
- break;
- }
- }
- }
- else {
- $res = @setlocale(LC_TIME, $aLocale);
- }
- if ( ! $res ){
- JpGraphError::RaiseL(25007,$aLocale);
-//("You are trying to use the locale ($aLocale) which your PHP installation does not support. Hint: Use '' to indicate the default locale for this geographic region.");
- return FALSE;
- }
-
- $this->iLocale = $aLocale;
-
- for ( $i = 0, $ofs = 0 - strftime('%w'); $i < 7; $i++, $ofs++ ){
- $day = strftime('%a', strtotime("$ofs day"));
- $day{0} = strtoupper($day{0});
- $this->iDayAbb[$aLocale][]= $day{0};
- $this->iShortDay[$aLocale][]= $day;
- }
-
- for($i=1; $i<=12; ++$i) {
- list($short ,$full) = explode('|', strftime("%b|%B",strtotime("2001-$i-01")));
- $this->iShortMonth[$aLocale][] = ucfirst($short);
- $this->iMonthName [$aLocale][] = ucfirst($full);
- }
+ if ( in_array($aLocale, array_keys($this->iDayAbb)) ){
+ $this->iLocale = $aLocale;
+ return TRUE; // already cached nothing else to do!
+ }
+
+ $pLocale = setlocale(LC_TIME, 0); // get current locale for LC_TIME
+
+ if (is_array($aLocale)) {
+ foreach ($aLocale as $loc) {
+ $res = @setlocale(LC_TIME, $loc);
+ if ( $res ) {
+ $aLocale = $loc;
+ break;
+ }
+ }
+ }
+ else {
+ $res = @setlocale(LC_TIME, $aLocale);
+ }
+
+ if ( ! $res ) {
+ JpGraphError::RaiseL(25007,$aLocale);
+ //("You are trying to use the locale ($aLocale) which your PHP installation does not support. Hint: Use '' to indicate the default locale for this geographic region.");
+ return FALSE;
+ }
- // Return to original locale
- setlocale(LC_TIME, $pLocale);
+ $this->iLocale = $aLocale;
+ for( $i = 0, $ofs = 0 - strftime('%w'); $i < 7; $i++, $ofs++ ) {
+ $day = strftime('%a', strtotime("$ofs day"));
+ $day[0] = strtoupper($day[0]);
+ $this->iDayAbb[$aLocale][]= $day[0];
+ $this->iShortDay[$aLocale][]= $day;
+ }
+
+ for($i=1; $i<=12; ++$i) {
+ list($short ,$full) = explode('|', strftime("%b|%B",strtotime("2001-$i-01")));
+ $this->iShortMonth[$aLocale][] = ucfirst($short);
+ $this->iMonthName [$aLocale][] = ucfirst($full);
+ }
+
+ setlocale(LC_TIME, $pLocale);
- return TRUE;
+ return TRUE;
}
function GetDayAbb() {
- return $this->iDayAbb[$this->iLocale];
+ return $this->iDayAbb[$this->iLocale];
}
-
+
function GetShortDay() {
- return $this->iShortDay[$this->iLocale];
+ return $this->iShortDay[$this->iLocale];
}
function GetShortMonth() {
- return $this->iShortMonth[$this->iLocale];
+ return $this->iShortMonth[$this->iLocale];
}
-
+
function GetShortMonthName($aNbr) {
- return $this->iShortMonth[$this->iLocale][$aNbr];
+ return $this->iShortMonth[$this->iLocale][$aNbr];
}
function GetLongMonthName($aNbr) {
- return $this->iMonthName[$this->iLocale][$aNbr];
+ return $this->iMonthName[$this->iLocale][$aNbr];
}
function GetMonth() {
- return $this->iMonthName[$this->iLocale];
+ return $this->iMonthName[$this->iLocale];
}
}
+// Global object handlers
$gDateLocale = new DateLocale();
$gJpgDateLocale = new DateLocale();
-
//=======================================================
// CLASS Footer
// Description: Encapsulates the footer line in the Graph
//=======================================================
class Footer {
- var $left,$center,$right;
- var $iLeftMargin = 3;
- var $iRightMargin = 3;
- var $iBottomMargin = 3;
-
- function Footer() {
- $this->left = new Text();
- $this->left->ParagraphAlign('left');
- $this->center = new Text();
- $this->center->ParagraphAlign('center');
- $this->right = new Text();
- $this->right->ParagraphAlign('right');
- }
-
- function Stroke(&$aImg) {
- $y = $aImg->height - $this->iBottomMargin;
- $x = $this->iLeftMargin;
- $this->left->Align('left','bottom');
- $this->left->Stroke($aImg,$x,$y);
-
- $x = ($aImg->width - $this->iLeftMargin - $this->iRightMargin)/2;
- $this->center->Align('center','bottom');
- $this->center->Stroke($aImg,$x,$y);
-
- $x = $aImg->width - $this->iRightMargin;
- $this->right->Align('right','bottom');
- $this->right->Stroke($aImg,$x,$y);
+ public $iLeftMargin = 3, $iRightMargin = 3, $iBottomMargin = 3 ;
+ public $left,$center,$right;
+ private $iTimer=null, $itimerpoststring='';
+
+ function __construct() {
+ $this->left = new Text();
+ $this->left->ParagraphAlign('left');
+ $this->center = new Text();
+ $this->center->ParagraphAlign('center');
+ $this->right = new Text();
+ $this->right->ParagraphAlign('right');
+ }
+
+ function SetTimer($aTimer,$aTimerPostString='') {
+ $this->iTimer = $aTimer;
+ $this->itimerpoststring = $aTimerPostString;
+ }
+
+ function SetMargin($aLeft=3,$aRight=3,$aBottom=3) {
+ $this->iLeftMargin = $aLeft;
+ $this->iRightMargin = $aRight;
+ $this->iBottomMargin = $aBottom;
+ }
+
+ function Stroke($aImg) {
+ $y = $aImg->height - $this->iBottomMargin;
+ $x = $this->iLeftMargin;
+ $this->left->Align('left','bottom');
+ $this->left->Stroke($aImg,$x,$y);
+
+ $x = ($aImg->width - $this->iLeftMargin - $this->iRightMargin)/2;
+ $this->center->Align('center','bottom');
+ $this->center->Stroke($aImg,$x,$y);
+
+ $x = $aImg->width - $this->iRightMargin;
+ $this->right->Align('right','bottom');
+ if( $this->iTimer != null ) {
+ $this->right->Set( $this->right->t . sprintf('%.3f',$this->iTimer->Pop()/1000.0) . $this->itimerpoststring );
+ }
+ $this->right->Stroke($aImg,$x,$y);
}
}
@@ -473,2703 +489,2668 @@
// Description: Main class to handle graphs
//===================================================
class Graph {
- var $cache=null; // Cache object (singleton)
- var $img=null; // Img object (singleton)
- var $plots=array(); // Array of all plot object in the graph (for Y 1 axis)
- var $y2plots=array();// Array of all plot object in the graph (for Y 2 axis)
- var $ynplots=array();
- var $xscale=null; // X Scale object (could be instance of LinearScale or LogScale
- var $yscale=null,$y2scale=null, $ynscale=array();
- var $iIcons = array(); // Array of Icons to add to
- var $cache_name; // File name to be used for the current graph in the cache directory
- var $xgrid=null; // X Grid object (linear or logarithmic)
- var $ygrid=null,$y2grid=null;
- var $doframe=true,$frame_color=array(0,0,0), $frame_weight=1; // Frame around graph
- var $boxed=false, $box_color=array(0,0,0), $box_weight=1; // Box around plot area
- var $doshadow=false,$shadow_width=4,$shadow_color=array(102,102,102); // Shadow for graph
- var $xaxis=null; // X-axis (instane of Axis class)
- var $yaxis=null, $y2axis=null, $ynaxis=array(); // Y axis (instance of Axis class)
- var $margin_color=array(200,200,200); // Margin color of graph
- var $plotarea_color=array(255,255,255); // Plot area color
- var $title,$subtitle,$subsubtitle; // Title and subtitle(s) text object
- var $axtype="linlin"; // Type of axis
- var $xtick_factor,$ytick_factor; // Factot to determine the maximum number of ticks depending on the plot with
- var $texts=null, $y2texts=null; // Text object to ge shown in the graph
- var $lines=null, $y2lines=null;
- var $bands=null, $y2bands=null;
- var $text_scale_off=0, $text_scale_abscenteroff=-1; // Text scale offset in fractions and for centering bars in absolute pixels
- var $background_image="",$background_image_type=-1,$background_image_format="png";
- var $inline;
- var $showcsim=0,$csimcolor="red"; //debug stuff, draw the csim boundaris on the image if <>0
- var $grid_depth=DEPTH_BACK; // Draw grid under all plots as default
- var $iAxisStyle = AXSTYLE_SIMPLE;
- var $iCSIMdisplay=false,$iHasStroked = false;
- var $footer;
- var $csimcachename = '', $csimcachetimeout = 0, $iCSIMImgAlt='';
- var $iDoClipping = false;
- var $y2orderback=true;
- var $tabtitle;
- var $bkg_gradtype=-1,$bkg_gradstyle=BGRAD_MARGIN;
- var $bkg_gradfrom='navy', $bkg_gradto='silver';
- var $titlebackground = false;
- var $titlebackground_color = 'lightblue',
- $titlebackground_style = 1,
- $titlebackground_framecolor = 'blue',
- $titlebackground_framestyle = 2,
- $titlebackground_frameweight = 1,
- $titlebackground_bevelheight = 3 ;
- var $titlebkg_fillstyle=TITLEBKG_FILLSTYLE_SOLID;
- var $titlebkg_scolor1='black',$titlebkg_scolor2='white';
- var $framebevel = false, $framebeveldepth = 2 ;
- var $framebevelborder = false, $framebevelbordercolor='black';
- var $framebevelcolor1='white@0.4', $framebevelcolor2='black@0.4';
- var $background_image_mix=100;
- var $background_cflag = '';
- var $background_cflag_type = BGIMG_FILLPLOT;
- var $background_cflag_mix = 100;
- var $iImgTrans=false,
- $iImgTransHorizon = 100,$iImgTransSkewDist=150,
- $iImgTransDirection = 1, $iImgTransMinSize = true,
- $iImgTransFillColor='white',$iImgTransHighQ=false,
- $iImgTransBorder=false,$iImgTransHorizonPos=0.5;
- var $iYAxisDeltaPos=50;
- var $iIconDepth=DEPTH_BACK;
- var $iAxisLblBgType = 0,
- $iXAxisLblBgFillColor = 'lightgray', $iXAxisLblBgColor = 'black',
- $iYAxisLblBgFillColor = 'lightgray', $iYAxisLblBgColor = 'black';
- var $iTables=NULL;
- var $legend;
-
-//---------------
-// CONSTRUCTOR
-
- // aWIdth Width in pixels of image
- // aHeight Height in pixels of image
- // aCachedName Name for image file in cache directory
- // aTimeOut Timeout in minutes for image in cache
- // aInline If true the image is streamed back in the call to Stroke()
- // If false the image is just created in the cache
- function Graph($aWidth=300,$aHeight=200,$aCachedName="",$aTimeOut=0,$aInline=true) {
- GLOBAL $gJpgBrandTiming;
- // If timing is used create a new timing object
- if( $gJpgBrandTiming ) {
- global $tim;
- $tim = new JpgTimer();
- $tim->Push();
- }
-
- if( !is_numeric($aWidth) || !is_numeric($aHeight) ) {
- JpGraphError::RaiseL(25008);//('Image width/height argument in Graph::Graph() must be numeric');
- }
-
- // Automatically generate the image file name based on the name of the script that
- // generates the graph
- if( $aCachedName=="auto" )
- $aCachedName=GenImgName();
-
- // Should the image be streamed back to the browser or only to the cache?
- $this->inline=$aInline;
-
- $this->img = new RotImage($aWidth,$aHeight);
-
- $this->cache = new ImgStreamCache($this->img);
- $this->cache->SetTimeOut($aTimeOut);
-
- $this->title = new Text();
- $this->title->ParagraphAlign('center');
- $this->title->SetFont(FF_FONT2,FS_BOLD);
- $this->title->SetMargin(3);
- $this->title->SetAlign('center');
-
- $this->subtitle = new Text();
- $this->subtitle->ParagraphAlign('center');
- $this->subtitle->SetMargin(2);
- $this->subtitle->SetAlign('center');
-
- $this->subsubtitle = new Text();
- $this->subsubtitle->ParagraphAlign('center');
- $this->subsubtitle->SetMargin(2);
- $this->subsubtitle->SetAlign('center');
-
- $this->legend = new Legend();
- $this->footer = new Footer();
-
- // Window doesn't like '?' in the file name so replace it with an '_'
- $aCachedName = str_replace("?","_",$aCachedName);
-
- // If the cached version exist just read it directly from the
- // cache, stream it back to browser and exit
- if( $aCachedName!="" && READ_CACHE && $aInline )
- if( $this->cache->GetAndStream($aCachedName) ) {
- exit();
- }
-
- $this->cache_name = $aCachedName;
- $this->SetTickDensity(); // Normal density
+ public $cache=null; // Cache object (singleton)
+ public $img=null; // Img object (singleton)
+ public $plots=array(); // Array of all plot object in the graph (for Y 1 axis)
+ public $y2plots=array(); // Array of all plot object in the graph (for Y 2 axis)
+ public $ynplots=array();
+ public $xscale=null; // X Scale object (could be instance of LinearScale or LogScale
+ public $yscale=null,$y2scale=null, $ynscale=array();
+ public $iIcons = array(); // Array of Icons to add to
+ public $cache_name; // File name to be used for the current graph in the cache directory
+ public $xgrid=null; // X Grid object (linear or logarithmic)
+ public $ygrid=null,$y2grid=null; //dito for Y
+ public $doframe=true,$frame_color='black', $frame_weight=1; // Frame around graph
+ public $boxed=false, $box_color='black', $box_weight=1; // Box around plot area
+ public $doshadow=false,$shadow_width=4,$shadow_color='gray@0.5'; // Shadow for graph
+ public $xaxis=null; // X-axis (instane of Axis class)
+ public $yaxis=null, $y2axis=null, $ynaxis=array(); // Y axis (instance of Axis class)
+ public $margin_color=array(230,230,230); // Margin color of graph
+ public $plotarea_color=array(255,255,255); // Plot area color
+ public $title,$subtitle,$subsubtitle; // Title and subtitle(s) text object
+ public $axtype="linlin"; // Type of axis
+ public $xtick_factor,$ytick_factor; // Factor to determine the maximum number of ticks depending on the plot width
+ public $texts=null, $y2texts=null; // Text object to ge shown in the graph
+ public $lines=null, $y2lines=null;
+ public $bands=null, $y2bands=null;
+ public $text_scale_off=0, $text_scale_abscenteroff=-1; // Text scale in fractions and for centering bars
+ public $background_image='',$background_image_type=-1,$background_image_format="png";
+ public $background_image_bright=0,$background_image_contr=0,$background_image_sat=0;
+ public $background_image_xpos=0,$background_image_ypos=0;
+ public $image_bright=0, $image_contr=0, $image_sat=0;
+ public $inline;
+ public $showcsim=0,$csimcolor="red";//debug stuff, draw the csim boundaris on the image if <>0
+ public $grid_depth=DEPTH_BACK; // Draw grid under all plots as default
+ public $iAxisStyle = AXSTYLE_SIMPLE;
+ public $iCSIMdisplay=false,$iHasStroked = false;
+ public $footer;
+ public $csimcachename = '', $csimcachetimeout = 0, $iCSIMImgAlt='';
+ public $iDoClipping = false;
+ public $y2orderback=true;
+ public $tabtitle;
+ public $bkg_gradtype=-1,$bkg_gradstyle=BGRAD_MARGIN;
+ public $bkg_gradfrom='navy', $bkg_gradto='silver';
+ public $plot_gradtype=-1,$plot_gradstyle=BGRAD_MARGIN;
+ public $plot_gradfrom='silver', $plot_gradto='navy';
+
+ public $titlebackground = false;
+ public $titlebackground_color = 'lightblue',
+ $titlebackground_style = 1,
+ $titlebackground_framecolor = 'blue',
+ $titlebackground_framestyle = 2,
+ $titlebackground_frameweight = 1,
+ $titlebackground_bevelheight = 3 ;
+ public $titlebkg_fillstyle=TITLEBKG_FILLSTYLE_SOLID;
+ public $titlebkg_scolor1='black',$titlebkg_scolor2='white';
+ public $framebevel = false, $framebeveldepth = 2 ;
+ public $framebevelborder = false, $framebevelbordercolor='black';
+ public $framebevelcolor1='white@0.4', $framebevelcolor2='black@0.4';
+ public $background_image_mix=100;
+ public $background_cflag = '';
+ public $background_cflag_type = BGIMG_FILLPLOT;
+ public $background_cflag_mix = 100;
+ public $iImgTrans=false,
+ $iImgTransHorizon = 100,$iImgTransSkewDist=150,
+ $iImgTransDirection = 1, $iImgTransMinSize = true,
+ $iImgTransFillColor='white',$iImgTransHighQ=false,
+ $iImgTransBorder=false,$iImgTransHorizonPos=0.5;
+ public $legend;
+ protected $iYAxisDeltaPos=50;
+ protected $iIconDepth=DEPTH_BACK;
+ protected $iAxisLblBgType = 0,
+ $iXAxisLblBgFillColor = 'lightgray', $iXAxisLblBgColor = 'black',
+ $iYAxisLblBgFillColor = 'lightgray', $iYAxisLblBgColor = 'black';
+ protected $iTables=NULL;
+
+ // aWIdth Width in pixels of image
+ // aHeight Height in pixels of image
+ // aCachedName Name for image file in cache directory
+ // aTimeOut Timeout in minutes for image in cache
+ // aInline If true the image is streamed back in the call to Stroke()
+ // If false the image is just created in the cache
+ function __construct($aWidth=300,$aHeight=200,$aCachedName='',$aTimeout=0,$aInline=true) {
- $this->tabtitle = new GraphTabTitle();
+ if( !is_numeric($aWidth) || !is_numeric($aHeight) ) {
+ JpGraphError::RaiseL(25008);//('Image width/height argument in Graph::Graph() must be numeric');
+ }
+
+ // Automatically generate the image file name based on the name of the script that
+ // generates the graph
+ if( $aCachedName == 'auto' ) {
+ $aCachedName=GenImgName();
+ }
+
+ // Should the image be streamed back to the browser or only to the cache?
+ $this->inline=$aInline;
+
+ $this->img = new RotImage($aWidth,$aHeight);
+ $this->cache = new ImgStreamCache();
+
+ // Window doesn't like '?' in the file name so replace it with an '_'
+ $aCachedName = str_replace("?","_",$aCachedName);
+ $this->SetupCache($aCachedName, $aTimeout);
+
+ $this->title = new Text();
+ $this->title->ParagraphAlign('center');
+ $this->title->SetFont(FF_FONT2,FS_BOLD);
+ $this->title->SetMargin(5);
+ $this->title->SetAlign('center');
+
+ $this->subtitle = new Text();
+ $this->subtitle->ParagraphAlign('center');
+ $this->subtitle->SetMargin(3);
+ $this->subtitle->SetAlign('center');
+
+ $this->subsubtitle = new Text();
+ $this->subsubtitle->ParagraphAlign('center');
+ $this->subsubtitle->SetMargin(3);
+ $this->subsubtitle->SetAlign('center');
+
+ $this->legend = new Legend();
+ $this->footer = new Footer();
+
+ // If the cached version exist just read it directly from the
+ // cache, stream it back to browser and exit
+ if( $aCachedName!='' && READ_CACHE && $aInline ) {
+ if( $this->cache->GetAndStream($this->img,$aCachedName) ) {
+ exit();
+ }
+ }
+
+ $this->SetTickDensity(); // Normal density
+
+ $this->tabtitle = new GraphTabTitle();
+ }
+
+ function SetupCache($aFilename,$aTimeout=60) {
+ $this->cache_name = $aFilename;
+ $this->cache->SetTimeOut($aTimeout);
}
-//---------------
-// PUBLIC METHODS
+
// Enable final image perspective transformation
function Set3DPerspective($aDir=1,$aHorizon=100,$aSkewDist=120,$aQuality=false,$aFillColor='#FFFFFF',$aBorder=false,$aMinSize=true,$aHorizonPos=0.5) {
- $this->iImgTrans = true;
- $this->iImgTransHorizon = $aHorizon;
- $this->iImgTransSkewDist= $aSkewDist;
- $this->iImgTransDirection = $aDir;
- $this->iImgTransMinSize = $aMinSize;
- $this->iImgTransFillColor=$aFillColor;
- $this->iImgTransHighQ=$aQuality;
- $this->iImgTransBorder=$aBorder;
- $this->iImgTransHorizonPos=$aHorizonPos;
+ $this->iImgTrans = true;
+ $this->iImgTransHorizon = $aHorizon;
+ $this->iImgTransSkewDist= $aSkewDist;
+ $this->iImgTransDirection = $aDir;
+ $this->iImgTransMinSize = $aMinSize;
+ $this->iImgTransFillColor=$aFillColor;
+ $this->iImgTransHighQ=$aQuality;
+ $this->iImgTransBorder=$aBorder;
+ $this->iImgTransHorizonPos=$aHorizonPos;
+ }
+
+ function SetUserFont($aNormal,$aBold='',$aItalic='',$aBoldIt='') {
+ $this->img->ttf->SetUserFont($aNormal,$aBold,$aItalic,$aBoldIt);
+ }
+
+ function SetUserFont1($aNormal,$aBold='',$aItalic='',$aBoldIt='') {
+ $this->img->ttf->SetUserFont1($aNormal,$aBold,$aItalic,$aBoldIt);
+ }
+
+ function SetUserFont2($aNormal,$aBold='',$aItalic='',$aBoldIt='') {
+ $this->img->ttf->SetUserFont2($aNormal,$aBold,$aItalic,$aBoldIt);
+ }
+
+ function SetUserFont3($aNormal,$aBold='',$aItalic='',$aBoldIt='') {
+ $this->img->ttf->SetUserFont3($aNormal,$aBold,$aItalic,$aBoldIt);
}
// Set Image format and optional quality
function SetImgFormat($aFormat,$aQuality=75) {
- $this->img->SetImgFormat($aFormat,$aQuality);
+ $this->img->SetImgFormat($aFormat,$aQuality);
}
// Should the grid be in front or back of the plot?
function SetGridDepth($aDepth) {
- $this->grid_depth=$aDepth;
+ $this->grid_depth=$aDepth;
}
function SetIconDepth($aDepth) {
- $this->iIconDepth=$aDepth;
+ $this->iIconDepth=$aDepth;
}
-
+
// Specify graph angle 0-360 degrees.
function SetAngle($aAngle) {
- $this->img->SetAngle($aAngle);
+ $this->img->SetAngle($aAngle);
}
function SetAlphaBlending($aFlg=true) {
- $this->img->SetAlphaBlending($aFlg);
+ $this->img->SetAlphaBlending($aFlg);
}
// Shortcut to image margin
function SetMargin($lm,$rm,$tm,$bm) {
- $this->img->SetMargin($lm,$rm,$tm,$bm);
+ $this->img->SetMargin($lm,$rm,$tm,$bm);
}
function SetY2OrderBack($aBack=true) {
- $this->y2orderback = $aBack;
+ $this->y2orderback = $aBack;
}
- // Rotate the graph 90 degrees and set the margin
+ // Rotate the graph 90 degrees and set the margin
// when we have done a 90 degree rotation
function Set90AndMargin($lm=0,$rm=0,$tm=0,$bm=0) {
- $lm = $lm ==0 ? floor(0.2 * $this->img->width) : $lm ;
- $rm = $rm ==0 ? floor(0.1 * $this->img->width) : $rm ;
- $tm = $tm ==0 ? floor(0.2 * $this->img->height) : $tm ;
- $bm = $bm ==0 ? floor(0.1 * $this->img->height) : $bm ;
-
- $adj = ($this->img->height - $this->img->width)/2;
- $this->img->SetMargin($tm-$adj,$bm-$adj,$rm+$adj,$lm+$adj);
- $this->img->SetCenter(floor($this->img->width/2),floor($this->img->height/2));
- $this->SetAngle(90);
- if( empty($this->yaxis) || empty($this->xaxis) ) {
- JpgraphError::RaiseL(25009);//('You must specify what scale to use with a call to Graph::SetScale()');
- }
- $this->xaxis->SetLabelAlign('right','center');
- $this->yaxis->SetLabelAlign('center','bottom');
+ $lm = $lm ==0 ? floor(0.2 * $this->img->width) : $lm ;
+ $rm = $rm ==0 ? floor(0.1 * $this->img->width) : $rm ;
+ $tm = $tm ==0 ? floor(0.2 * $this->img->height) : $tm ;
+ $bm = $bm ==0 ? floor(0.1 * $this->img->height) : $bm ;
+
+ $adj = ($this->img->height - $this->img->width)/2;
+ $this->img->SetMargin($tm-$adj,$bm-$adj,$rm+$adj,$lm+$adj);
+ $this->img->SetCenter(floor($this->img->width/2),floor($this->img->height/2));
+ $this->SetAngle(90);
+ if( empty($this->yaxis) || empty($this->xaxis) ) {
+ JpgraphError::RaiseL(25009);//('You must specify what scale to use with a call to Graph::SetScale()');
+ }
+ $this->xaxis->SetLabelAlign('right','center');
+ $this->yaxis->SetLabelAlign('center','bottom');
}
-
+
function SetClipping($aFlg=true) {
- $this->iDoClipping = $aFlg ;
+ $this->iDoClipping = $aFlg ;
}
// Add a plot object to the graph
- function Add(&$aPlot) {
- if( $aPlot == null )
- JpGraphError::RaiseL(25010);//("Graph::Add() You tried to add a null plot to the graph.");
- if( is_array($aPlot) && count($aPlot) > 0 )
- $cl = $aPlot[0];
- else
- $cl = $aPlot;
-
- if( is_a($cl,'Text') )
- $this->AddText($aPlot);
- elseif( is_a($cl,'PlotLine') )
- $this->AddLine($aPlot);
- elseif( is_a($cl,'PlotBand') )
- $this->AddBand($aPlot);
- elseif( is_a($cl,'IconPlot') )
- $this->AddIcon($aPlot);
- elseif( is_a($cl,'GTextTable') )
- $this->AddTable($aPlot);
- else
- $this->plots[] = &$aPlot;
+ function Add($aPlot) {
+ if( $aPlot == null ) {
+ JpGraphError::RaiseL(25010);//("Graph::Add() You tried to add a null plot to the graph.");
+ }
+ if( is_array($aPlot) && count($aPlot) > 0 ) {
+ $cl = $aPlot[0];
+ }
+ else {
+ $cl = $aPlot;
+ }
+
+ if( $cl instanceof Text ) $this->AddText($aPlot);
+ elseif( class_exists('PlotLine',false) && ($cl instanceof PlotLine) ) $this->AddLine($aPlot);
+ elseif( class_exists('PlotBand',false) && ($cl instanceof PlotBand) ) $this->AddBand($aPlot);
+ elseif( class_exists('IconPlot',false) && ($cl instanceof IconPlot) ) $this->AddIcon($aPlot);
+ elseif( class_exists('GTextTable',false) && ($cl instanceof GTextTable) ) $this->AddTable($aPlot);
+ else {
+ if( is_array($aPlot) ) {
+ $this->plots = array_merge($this->plots,$aPlot);
+ }
+ else {
+ $this->plots[] = $aPlot;
+ }
+ }
}
+ function AddTable($aTable) {
+ if( is_array($aTable) ) {
+ for($i=0; $i < count($aTable); ++$i ) {
+ $this->iTables[]=$aTable[$i];
+ }
+ }
+ else {
+ $this->iTables[] = $aTable ;
+ }
+ }
- function AddTable(&$aTable) {
- if( is_array($aTable) ) {
- for($i=0; $i < count($aTable); ++$i )
- $this->iTables[]=&$aTable[$i];
- }
- else {
- $this->iTables[] = &$aTable ;
- }
- }
-
- function AddIcon(&$aIcon) {
- if( is_array($aIcon) ) {
- for($i=0; $i < count($aIcon); ++$i )
- $this->iIcons[]=&$aIcon[$i];
- }
- else {
- $this->iIcons[] = &$aIcon ;
- }
+ function AddIcon($aIcon) {
+ if( is_array($aIcon) ) {
+ for($i=0; $i < count($aIcon); ++$i ) {
+ $this->iIcons[]=$aIcon[$i];
+ }
+ }
+ else {
+ $this->iIcons[] = $aIcon ;
+ }
}
// Add plot to second Y-scale
- function AddY2(&$aPlot) {
- if( $aPlot == null )
- JpGraphError::RaiseL(25011);//("Graph::AddY2() You tried to add a null plot to the graph.");
-
- if( is_array($aPlot) && count($aPlot) > 0 )
- $cl = $aPlot[0];
- else
- $cl = $aPlot;
-
- if( is_a($cl,'Text') )
- $this->AddText($aPlot,true);
- elseif( is_a($cl,'PlotLine') )
- $this->AddLine($aPlot,true);
- elseif( is_a($cl,'PlotBand') )
- $this->AddBand($aPlot,true);
- else
- $this->y2plots[] = &$aPlot;
+ function AddY2($aPlot) {
+ if( $aPlot == null ) {
+ JpGraphError::RaiseL(25011);//("Graph::AddY2() You tried to add a null plot to the graph.");
+ }
+
+ if( is_array($aPlot) && count($aPlot) > 0 ) {
+ $cl = $aPlot[0];
+ }
+ else {
+ $cl = $aPlot;
+ }
+
+ if( $cl instanceof Text ) {
+ $this->AddText($aPlot,true);
+ }
+ elseif( class_exists('PlotLine',false) && ($cl instanceof PlotLine) ) {
+ $this->AddLine($aPlot,true);
+ }
+ elseif( class_exists('PlotBand',false) && ($cl instanceof PlotBand) ) {
+ $this->AddBand($aPlot,true);
+ }
+ else {
+ $this->y2plots[] = $aPlot;
+ }
}
- // Add plot to second Y-scale
- function AddY($aN,&$aPlot) {
+ // Add plot to the extra Y-axises
+ function AddY($aN,$aPlot) {
+
+ if( $aPlot == null ) {
+ JpGraphError::RaiseL(25012);//("Graph::AddYN() You tried to add a null plot to the graph.");
+ }
- if( $aPlot == null )
- JpGraphError::RaiseL(25012);//("Graph::AddYN() You tried to add a null plot to the graph.");
+ if( is_array($aPlot) && count($aPlot) > 0 ) {
+ $cl = $aPlot[0];
+ }
+ else {
+ $cl = $aPlot;
+ }
- if( is_array($aPlot) && count($aPlot) > 0 )
- $cl = $aPlot[0];
- else
- $cl = $aPlot;
-
- if( is_a($cl,'Text') || is_a($cl,'PlotLine') || is_a($cl,'PlotBand') )
- JpGraph::RaiseL(25013);//('You can only add standard plots to multiple Y-axis');
- else
- $this->ynplots[$aN][] = &$aPlot;
+ if( ($cl instanceof Text) ||
+ (class_exists('PlotLine',false) && ($cl instanceof PlotLine)) ||
+ (class_exists('PlotBand',false) && ($cl instanceof PlotBand)) ) {
+ JpGraph::RaiseL(25013);//('You can only add standard plots to multiple Y-axis');
+ }
+ else {
+ $this->ynplots[$aN][] = $aPlot;
+ }
}
-
+
// Add text object to the graph
- function AddText(&$aTxt,$aToY2=false) {
- if( $aTxt == null )
- JpGraphError::RaiseL(25014);//("Graph::AddText() You tried to add a null text to the graph.");
- if( $aToY2 ) {
- if( is_array($aTxt) ) {
- for($i=0; $i < count($aTxt); ++$i )
- $this->y2texts[]=&$aTxt[$i];
- }
- else
- $this->y2texts[] = &$aTxt;
- }
- else {
- if( is_array($aTxt) ) {
- for($i=0; $i < count($aTxt); ++$i )
- $this->texts[]=&$aTxt[$i];
- }
- else
- $this->texts[] = &$aTxt;
- }
+ function AddText($aTxt,$aToY2=false) {
+ if( $aTxt == null ) {
+ JpGraphError::RaiseL(25014);//("Graph::AddText() You tried to add a null text to the graph.");
+ }
+ if( $aToY2 ) {
+ if( is_array($aTxt) ) {
+ for($i=0; $i < count($aTxt); ++$i ) {
+ $this->y2texts[]=$aTxt[$i];
+ }
+ }
+ else {
+ $this->y2texts[] = $aTxt;
+ }
+ }
+ else {
+ if( is_array($aTxt) ) {
+ for($i=0; $i < count($aTxt); ++$i ) {
+ $this->texts[]=$aTxt[$i];
+ }
+ }
+ else {
+ $this->texts[] = $aTxt;
+ }
+ }
}
-
+
// Add a line object (class PlotLine) to the graph
- function AddLine(&$aLine,$aToY2=false) {
- if( $aLine == null )
- JpGraphError::RaiseL(25015);//("Graph::AddLine() You tried to add a null line to the graph.");
-
- if( $aToY2 ) {
- if( is_array($aLine) ) {
- for($i=0; $i < count($aLine); ++$i )
- $this->y2lines[]=&$aLine[$i];
- }
- else
- $this->y2lines[] = &$aLine;
- }
- else {
- if( is_array($aLine) ) {
- for($i=0; $i < count($aLine); ++$i )
- $this->lines[]=&$aLine[$i];
- }
- else
- $this->lines[] = &$aLine;
- }
+ function AddLine($aLine,$aToY2=false) {
+ if( $aLine == null ) {
+ JpGraphError::RaiseL(25015);//("Graph::AddLine() You tried to add a null line to the graph.");
+ }
+
+ if( $aToY2 ) {
+ if( is_array($aLine) ) {
+ for($i=0; $i < count($aLine); ++$i ) {
+ //$this->y2lines[]=$aLine[$i];
+ $this->y2plots[]=$aLine[$i];
+ }
+ }
+ else {
+ //$this->y2lines[] = $aLine;
+ $this->y2plots[]=$aLine;
+ }
+ }
+ else {
+ if( is_array($aLine) ) {
+ for($i=0; $iJpGraph Error:
-HTTP headers have already been sent. Explanation:
HTTP headers have already been sent back to the browser indicating the data as text before the library got a chance to send it's image HTTP header to this browser. This makes it impossible for the library to send back image data to the browser (since that would be interpretated as text by the browser and show up as junk text).iCSIMImgAlt."\" />\n";
-
- if($fh = @fopen($basecsim,'w') ) {
- fwrite($fh,$htmlwrap);
- fclose($fh);
- echo $htmlwrap;
- }
- else
- JpGraphError::RaiseL(25029,$basecsim);//(" Can't write CSIM \"$basecsim\" for writing. Check free space and permissions.");
- }
- else {
-
- if( $aScriptName=='' ) {
- JpGraphError::RaiseL(25030);//('Missing script name in call to StrokeCSIM(). You must specify the name of the actual image script as the first parameter to StrokeCSIM().');
- }
- echo $this->GetHTMLImageMap($aCSIMName);
- echo "
iCSIMImgAlt."\" />\n";
- }
- }
- else {
- $this->Stroke();
- }
- }
-
- function GetTextsYMinMax($aY2=false) {
- if( $aY2 )
- $txts = $this->y2texts;
- else
- $txts = $this->texts;
- $n = count($txts);
- $min=null;
- $max=null;
- for( $i=0; $i < $n; ++$i ) {
- if( $txts[$i]->iScalePosY !== null &&
- $txts[$i]->iScalePosX !== null ) {
- if( $min === null ) {
- $min = $max = $txts[$i]->iScalePosY ;
- }
- else {
- $min = min($min,$txts[$i]->iScalePosY);
- $max = max($max,$txts[$i]->iScalePosY);
- }
- }
- }
- if( $min !== null ) {
- return array($min,$max);
- }
- else
- return null;
- }
+ if( $aCSIMName=='' ) {
+ // create a random map name
+ srand ((double) microtime() * 1000000);
+ $r = rand(0,100000);
+ $aCSIMName='__mapname'.$r.'__';
+ }
- function GetTextsXMinMax($aY2=false) {
- if( $aY2 )
- $txts = $this->y2texts;
- else
- $txts = $this->texts;
- $n = count($txts);
- $min=null;
- $max=null;
- for( $i=0; $i < $n; ++$i ) {
- if( $txts[$i]->iScalePosY !== null &&
- $txts[$i]->iScalePosX !== null ) {
- if( $min === null ) {
- $min = $max = $txts[$i]->iScalePosX ;
- }
- else {
- $min = min($min,$txts[$i]->iScalePosX);
- $max = max($max,$txts[$i]->iScalePosX);
- }
- }
- }
- if( $min !== null ) {
- return array($min,$max);
- }
- else
- return null;
- }
+ if( $aScriptName=='auto' ) {
+ $aScriptName=basename($_SERVER['PHP_SELF']);
+ }
- function GetXMinMax() {
- list($min,$ymin) = $this->plots[0]->Min();
- list($max,$ymax) = $this->plots[0]->Max();
- foreach( $this->plots as $p ) {
- list($xmin,$ymin) = $p->Min();
- list($xmax,$ymax) = $p->Max();
- $min = Min($xmin,$min);
- $max = Max($xmax,$max);
- }
-
- if( $this->y2axis != null ) {
- foreach( $this->y2plots as $p ) {
- list($xmin,$ymin) = $p->Min();
- list($xmax,$ymax) = $p->Max();
- $min = Min($xmin,$min);
- $max = Max($xmax,$max);
- }
- }
-
- $n = count($this->ynaxis);
- for( $i=0; $i < $n; ++$i ) {
- if( $this->ynaxis[$i] != null) {
- foreach( $this->ynplots[$i] as $p ) {
- list($xmin,$ymin) = $p->Min();
- list($xmax,$ymax) = $p->Max();
- $min = Min($xmin,$min);
- $max = Max($xmax,$max);
- }
- }
- }
+ $urlarg = $this->GetURLArguments(true);
- return array($min,$max);
+ if( empty($_GET[_CSIM_DISPLAY]) ) {
+ // First determine if we need to check for a cached version
+ // This differs from the standard cache in the sense that the
+ // image and CSIM map HTML file is written relative to the directory
+ // the script executes in and not the specified cache directory.
+ // The reason for this is that the cache directory is not necessarily
+ // accessible from the HTTP server.
+ if( $this->csimcachename != '' ) {
+ $dir = dirname($this->csimcachename);
+ $base = basename($this->csimcachename);
+ $base = strtok($base,'.');
+ $suffix = strtok('.');
+ $basecsim = $dir.'/'.$base.'?'.$urlarg.'_csim_.html';
+ $baseimg = $base.'?'.$urlarg.'.'.$this->img->img_format;
+
+ // Check that apache can write to directory specified
+
+ if( file_exists($dir) && !is_writeable($dir) ) {
+ JpgraphError::RaiseL(25028,$dir);//('Apache/PHP does not have permission to write to the CSIM cache directory ('.$dir.'). Check permissions.');
+ }
+
+ // Make sure directory exists
+ $this->cache->MakeDirs($dir);
+
+ // Write the image file
+ $this->Stroke(CSIMCACHE_DIR.$baseimg);
+
+ // Construct wrapper HTML and write to file and send it back to browser
+
+ // In the src URL we must replace the '?' with its encoding to prevent the arguments
+ // to be converted to real arguments.
+ $tmp = str_replace('?','%3f',$baseimg);
+ $htmlwrap = $this->GetHTMLImageMap($aCSIMName)."\n".
+ '
img->width.'" height="'.$this->img->height."\" alt=\"".$this->iCSIMImgAlt."\" />\n";
+
+ if($fh = @fopen($basecsim,'w') ) {
+ fwrite($fh,$htmlwrap);
+ fclose($fh);
+ echo $htmlwrap;
+ }
+ else {
+ JpGraphError::RaiseL(25029,$basecsim);//(" Can't write CSIM \"$basecsim\" for writing. Check free space and permissions.");
+ }
+ }
+ else {
+
+ if( $aScriptName=='' ) {
+ JpGraphError::RaiseL(25030);//('Missing script name in call to StrokeCSIM(). You must specify the name of the actual image script as the first parameter to StrokeCSIM().');
+ }
+ echo $this->GetHTMLImageMap($aCSIMName) . $this->GetCSIMImgHTML($aCSIMName, $aScriptName, $aBorder);
+ }
+ }
+ else {
+ $this->Stroke();
+ }
}
- function AdjustMarginsForTitles() {
- $totrequired =
- ($this->title->t != '' ?
- $this->title->GetTextHeight($this->img) + $this->title->margin + 5 : 0 ) +
- ($this->subtitle->t != '' ?
- $this->subtitle->GetTextHeight($this->img) + $this->subtitle->margin + 5 : 0 ) +
- ($this->subsubtitle->t != '' ?
- $this->subsubtitle->GetTextHeight($this->img) + $this->subsubtitle->margin + 5 : 0 ) ;
-
-
- $btotrequired = 0;
- if($this->xaxis != null && !$this->xaxis->hide && !$this->xaxis->hide_labels ) {
- // Minimum bottom margin
- if( $this->xaxis->title->t != '' ) {
- if( $this->img->a == 90 )
- $btotrequired = $this->yaxis->title->GetTextHeight($this->img) + 5 ;
- else
- $btotrequired = $this->xaxis->title->GetTextHeight($this->img) + 5 ;
- }
- else
- $btotrequired = 0;
-
- if( $this->img->a == 90 ) {
- $this->img->SetFont($this->yaxis->font_family,$this->yaxis->font_style,
- $this->yaxis->font_size);
- $lh = $this->img->GetTextHeight('Mg',$this->yaxis->label_angle);
- }
- else {
- $this->img->SetFont($this->xaxis->font_family,$this->xaxis->font_style,
- $this->xaxis->font_size);
- $lh = $this->img->GetTextHeight('Mg',$this->xaxis->label_angle);
- }
-
- $btotrequired += $lh + 5;
- }
-
- if( $this->img->a == 90 ) {
- // DO Nothing. It gets too messy to do this properly for 90 deg...
- }
- else{
- if( $this->img->top_margin < $totrequired ) {
- $this->SetMargin($this->img->left_margin,$this->img->right_margin,
- $totrequired,$this->img->bottom_margin);
- }
- if( $this->img->bottom_margin < $btotrequired ) {
- $this->SetMargin($this->img->left_margin,$this->img->right_margin,
- $this->img->top_margin,$btotrequired);
- }
- }
+ function StrokeCSIMImage() {
+ if( @$_GET[_CSIM_DISPLAY] == 1 ) {
+ $this->Stroke();
+ }
}
- // Stroke the graph
- // $aStrokeFileName If != "" the image will be written to this file and NOT
- // streamed back to the browser
- function Stroke($aStrokeFileName="") {
+ function GetCSIMImgHTML($aCSIMName, $aScriptName='auto', $aBorder=0 ) {
+ if( $aScriptName=='auto' ) {
+ $aScriptName=basename($_SERVER['PHP_SELF']);
+ }
+ $urlarg = $this->GetURLArguments(true);
+ return "
iCSIMImgAlt."\" />\n";
+ }
- // Fist make a sanity check that user has specified a scale
- if( empty($this->yscale) ) {
- JpGraphError::RaiseL(25031);//('You must specify what scale to use with a call to Graph::SetScale().');
- }
-
- // Start by adjusting the margin so that potential titles will fit.
- $this->AdjustMarginsForTitles();
-
- // Setup scale constants
- if( $this->yscale ) $this->yscale->InitConstants($this->img);
- if( $this->xscale ) $this->xscale->InitConstants($this->img);
- if( $this->y2scale ) $this->y2scale->InitConstants($this->img);
-
- $n=count($this->ynscale);
- for($i=0; $i < $n; ++$i) {
- if( $this->ynscale[$i] ) $this->ynscale[$i]->InitConstants($this->img);
- }
-
- // If the filename is the predefined value = '_csim_special_'
- // we assume that the call to stroke only needs to do enough
- // to correctly generate the CSIM maps.
- // We use this variable to skip things we don't strictly need
- // to do to generate the image map to improve performance
- // a best we can. Therefor you will see a lot of tests !$_csim in the
- // code below.
- $_csim = ($aStrokeFileName===_CSIM_SPECIALFILE);
-
- // We need to know if we have stroked the plot in the
- // GetCSIMareas. Otherwise the CSIM hasn't been generated
- // and in the case of GetCSIM called before stroke to generate
- // CSIM without storing an image to disk GetCSIM must call Stroke.
- $this->iHasStroked = true;
-
- // Do any pre-stroke adjustment that is needed by the different plot types
- // (i.e bar plots want's to add an offset to the x-labels etc)
- for($i=0; $i < count($this->plots) ; ++$i ) {
- $this->plots[$i]->PreStrokeAdjust($this);
- $this->plots[$i]->DoLegend($this);
- }
-
- // Any plots on the second Y scale?
- if( $this->y2scale != null ) {
- for($i=0; $i
\nYou have either:
\n";
- // $e .= "1. Specified an Y axis for autoscaling but have not supplied any plots
\n";
- // $e .= "2. Specified a scale manually but have forgot to specify the tick steps";
- JpGraphError::RaiseL(25026);
- }
-
- // Bail out if no plots and no specified X-scale
- if( (!$this->xscale->IsSpecified() && count($this->plots)==0 && count($this->y2plots)==0) )
- JpGraphError::RaiseL(25034);//("JpGraph: Can't draw unspecified X-scale.
No plots.
");
-
- //Check if we should autoscale y-axis
- if( !$this->yscale->IsSpecified() && count($this->plots)>0 ) {
- list($min,$max) = $this->GetPlotsYMinMax($this->plots);
- $lres = $this->GetLinesYMinMax($this->lines);
- if( is_array($lres) ) {
- list($linmin,$linmax) = $lres ;
- $min = min($min,$linmin);
- $max = max($max,$linmax);
- }
- $tres = $this->GetTextsYMinMax();
- if( is_array($tres) ) {
- list($tmin,$tmax) = $tres ;
- $min = min($min,$tmin);
- $max = max($max,$tmax);
- }
- $this->yscale->AutoScale($this->img,$min,$max,
- $this->img->plotheight/$this->ytick_factor);
- }
- elseif( $this->yscale->IsSpecified() &&
- ( $this->yscale->auto_ticks || !$this->yscale->ticks->IsSpecified()) ) {
- // The tick calculation will use the user suplied min/max values to determine
- // the ticks. If auto_ticks is false the exact user specifed min and max
- // values will be used for the scale.
- // If auto_ticks is true then the scale might be slightly adjusted
- // so that the min and max values falls on an even major step.
- $min = $this->yscale->scale[0];
- $max = $this->yscale->scale[1];
- $this->yscale->AutoScale($this->img,$min,$max,
- $this->img->plotheight/$this->ytick_factor,
- $this->yscale->auto_ticks);
- }
-
- if( $this->y2scale != null) {
-
- if( !$this->y2scale->IsSpecified() && count($this->y2plots)>0 ) {
- list($min,$max) = $this->GetPlotsYMinMax($this->y2plots);
- $lres = $this->GetLinesYMinMax($this->y2lines);
- if( is_array($lres) ) {
- list($linmin,$linmax) = $lres ;
- $min = min($min,$linmin);
- $max = max($max,$linmax);
- }
- $tres = $this->GetTextsYMinMax(true);
- if( is_array($tres) ) {
- list($tmin,$tmax) = $tres ;
- $min = min($min,$tmin);
- $max = max($max,$tmax);
- }
- $this->y2scale->AutoScale($this->img,$min,$max,$this->img->plotheight/$this->ytick_factor);
- }
- elseif( $this->y2scale->IsSpecified() &&
- ( $this->y2scale->auto_ticks || !$this->y2scale->ticks->IsSpecified()) ) {
- // The tick calculation will use the user suplied min/max values to determine
- // the ticks. If auto_ticks is false the exact user specifed min and max
- // values will be used for the scale.
- // If auto_ticks is true then the scale might be slightly adjusted
- // so that the min and max values falls on an even major step.
- $min = $this->y2scale->scale[0];
- $max = $this->y2scale->scale[1];
- $this->y2scale->AutoScale($this->img,$min,$max,
- $this->img->plotheight/$this->ytick_factor,
- $this->y2scale->auto_ticks);
- }
- }
-
- //
- // Autoscale the multiple Y-axis
- //
- $n = count($this->ynaxis);
- for( $i=0; $i < $n; ++$i ) {
- if( $this->ynscale[$i] != null) {
- if( !$this->ynscale[$i]->IsSpecified() && count($this->ynplots[$i])>0 ) {
- list($min,$max) = $this->GetPlotsYMinMax($this->ynplots[$i]);
- $this->ynscale[$i]->AutoScale($this->img,$min,$max,$this->img->plotheight/$this->ytick_factor);
- }
- elseif( $this->ynscale[$i]->IsSpecified() &&
- ( $this->ynscale[$i]->auto_ticks || !$this->ynscale[$i]->ticks->IsSpecified()) ) {
- // The tick calculation will use the user suplied min/max values to determine
- // the ticks. If auto_ticks is false the exact user specifed min and max
- // values will be used for the scale.
- // If auto_ticks is true then the scale might be slightly adjusted
- // so that the min and max values falls on an even major step.
- $min = $this->ynscale[$i]->scale[0];
- $max = $this->ynscale[$i]->scale[1];
- $this->ynscale[$i]->AutoScale($this->img,$min,$max,
- $this->img->plotheight/$this->ytick_factor,
- $this->ynscale[$i]->auto_ticks);
- }
- }
- }
-
-
- //Check if we should autoscale x-axis
- if( !$this->xscale->IsSpecified() ) {
- if( substr($this->axtype,0,4) == "text" ) {
- $max=0;
- $n = count($this->plots);
- for($i=0; $i < $n; ++$i ) {
- $p = $this->plots[$i];
- // We need some unfortunate sub class knowledge here in order
- // to increase number of data points in case it is a line plot
- // which has the barcenter set. If not it could mean that the
- // last point of the data is outside the scale since the barcenter
- // settings means that we will shift the entire plot half a tick step
- // to the right in oder to align with the center of the bars.
- if( is_a($p,'BarPlot') || empty($p->barcenter)) {
- $max=max($max,$p->numpoints-1);
- }
- else {
- $max=max($max,$p->numpoints);
- }
- }
- $min=0;
- if( $this->y2axis != null ) {
- foreach( $this->y2plots as $p ) {
- $max=max($max,$p->numpoints-1);
- }
- }
- $n = count($this->ynaxis);
- for( $i=0; $i < $n; ++$i ) {
- if( $this->ynaxis[$i] != null) {
- foreach( $this->ynplots[$i] as $p ) {
- $max=max($max,$p->numpoints-1);
- }
- }
- }
-
- $this->xscale->Update($this->img,$min,$max);
- $this->xscale->ticks->Set($this->xaxis->tick_step,1);
- $this->xscale->ticks->SupressMinorTickMarks();
- }
- else {
- list($min,$max) = $this->GetXMinMax();
-
- $lres = $this->GetLinesXMinMax($this->lines);
- if( $lres ) {
- list($linmin,$linmax) = $lres ;
- $min = min($min,$linmin);
- $max = max($max,$linmax);
- }
- $lres = $this->GetLinesXMinMax($this->y2lines);
- if( $lres ) {
- list($linmin,$linmax) = $lres ;
- $min = min($min,$linmin);
- $max = max($max,$linmax);
- }
-
- $tres = $this->GetTextsXMinMax();
- if( $tres ) {
- list($tmin,$tmax) = $tres ;
- $min = min($min,$tmin);
- $max = max($max,$tmax);
- }
-
- $tres = $this->GetTextsXMinMax(true);
- if( $tres ) {
- list($tmin,$tmax) = $tres ;
- $min = min($min,$tmin);
- $max = max($max,$tmax);
- }
-
- $this->xscale->AutoScale($this->img,$min,$max,round($this->img->plotwidth/$this->xtick_factor));
- }
-
- //Adjust position of y-axis and y2-axis to minimum/maximum of x-scale
- if( !is_numeric($this->yaxis->pos) && !is_string($this->yaxis->pos) )
- $this->yaxis->SetPos($this->xscale->GetMinVal());
- if( $this->y2axis != null ) {
- if( !is_numeric($this->y2axis->pos) && !is_string($this->y2axis->pos) )
- $this->y2axis->SetPos($this->xscale->GetMaxVal());
- $this->y2axis->SetTitleSide(SIDE_RIGHT);
- }
-
- $n = count($this->ynaxis);
- $nY2adj = $this->y2axis != null ? $this->iYAxisDeltaPos : 0;
- for( $i=0; $i < $n; ++$i ) {
- if( $this->ynaxis[$i] != null ) {
- if( !is_numeric($this->ynaxis[$i]->pos) && !is_string($this->ynaxis[$i]->pos) ) {
- $this->ynaxis[$i]->SetPos($this->xscale->GetMaxVal());
- $this->ynaxis[$i]->SetPosAbsDelta($i*$this->iYAxisDeltaPos + $nY2adj);
- }
- $this->ynaxis[$i]->SetTitleSide(SIDE_RIGHT);
- }
- }
- }
- elseif( $this->xscale->IsSpecified() &&
- ( $this->xscale->auto_ticks || !$this->xscale->ticks->IsSpecified()) ) {
- // The tick calculation will use the user suplied min/max values to determine
- // the ticks. If auto_ticks is false the exact user specifed min and max
- // values will be used for the scale.
- // If auto_ticks is true then the scale might be slightly adjusted
- // so that the min and max values falls on an even major step.
- $min = $this->xscale->scale[0];
- $max = $this->xscale->scale[1];
-
-
- $this->xscale->AutoScale($this->img,$min,$max,
- $this->img->plotwidth/$this->xtick_factor,
- false);
-
- if( $this->y2axis != null ) {
- if( !is_numeric($this->y2axis->pos) && !is_string($this->y2axis->pos) )
- $this->y2axis->SetPos($this->xscale->GetMaxVal());
- $this->y2axis->SetTitleSide(SIDE_RIGHT);
- }
-
- }
-
- // If we have a negative values and x-axis position is at 0
- // we need to supress the first and possible the last tick since
- // they will be drawn on top of the y-axis (and possible y2 axis)
- // The test below might seem strange the reasone being that if
- // the user hasn't specified a value for position this will not
- // be set until we do the stroke for the axis so as of now it
- // is undefined.
- // For X-text scale we ignore all this since the tick are usually
- // much further in and not close to the Y-axis. Hence the test
- // for 'text'
-
- if( ($this->yaxis->pos==$this->xscale->GetMinVal() ||
- (is_string($this->yaxis->pos) && $this->yaxis->pos=='min')) &&
- !is_numeric($this->xaxis->pos) && $this->yscale->GetMinVal() < 0 &&
- substr($this->axtype,0,4) != 'text' && $this->xaxis->pos!="min" ) {
-
- //$this->yscale->ticks->SupressZeroLabel(false);
- $this->xscale->ticks->SupressFirst();
- if( $this->y2axis != null ) {
- $this->xscale->ticks->SupressLast();
- }
- }
- elseif( !is_numeric($this->yaxis->pos) && $this->yaxis->pos=='max' ) {
- $this->xscale->ticks->SupressLast();
- }
-
-
- if( !$_csim ) {
- $this->StrokePlotArea();
- if( $this->iIconDepth == DEPTH_BACK ) {
- $this->StrokeIcons();
- }
- }
- $this->StrokeAxis(false);
-
- // Stroke bands
- if( $this->bands != null && !$_csim)
- for($i=0; $i < count($this->bands); ++$i) {
- // Stroke all bands that asks to be in the background
- if( $this->bands[$i]->depth == DEPTH_BACK )
- $this->bands[$i]->Stroke($this->img,$this->xscale,$this->yscale);
- }
-
- if( $this->y2bands != null && $this->y2scale != null && !$_csim )
- for($i=0; $i < count($this->y2bands); ++$i) {
- // Stroke all bands that asks to be in the foreground
- if( $this->y2bands[$i]->depth == DEPTH_BACK )
- $this->y2bands[$i]->Stroke($this->img,$this->xscale,$this->y2scale);
- }
-
-
- if( $this->grid_depth == DEPTH_BACK && !$_csim) {
- $this->ygrid->Stroke();
- $this->xgrid->Stroke();
- }
-
- // Stroke Y2-axis
- if( $this->y2axis != null && !$_csim) {
- $this->y2axis->Stroke($this->xscale);
- $this->y2grid->Stroke();
- }
-
- // Stroke yn-axis
- $n = count($this->ynaxis);
- for( $i=0; $i < $n; ++$i ) {
- $this->ynaxis[$i]->Stroke($this->xscale);
- }
-
- $oldoff=$this->xscale->off;
- if(substr($this->axtype,0,4)=="text") {
- if( $this->text_scale_abscenteroff > -1 ) {
- // For a text scale the scale factor is the number of pixel per step.
- // Hence we can use the scale factor as a substitute for number of pixels
- // per major scale step and use that in order to adjust the offset so that
- // an object of width "abscenteroff" becomes centered.
- $this->xscale->off += round($this->xscale->scale_factor/2)-round($this->text_scale_abscenteroff/2);
- }
- else {
- $this->xscale->off +=
- ceil($this->xscale->scale_factor*$this->text_scale_off*$this->xscale->ticks->minor_step);
- }
- }
-
- if( $this->iDoClipping ) {
- $oldimage = $this->img->CloneCanvasH();
- }
-
- if( ! $this->y2orderback ) {
- // Stroke all plots for Y axis
- for($i=0; $i < count($this->plots); ++$i) {
- $this->plots[$i]->Stroke($this->img,$this->xscale,$this->yscale);
- $this->plots[$i]->StrokeMargin($this->img);
- }
- }
-
- // Stroke all plots for Y2 axis
- if( $this->y2scale != null )
- for($i=0; $i< count($this->y2plots); ++$i ) {
- $this->y2plots[$i]->Stroke($this->img,$this->xscale,$this->y2scale);
- }
-
- if( $this->y2orderback ) {
- // Stroke all plots for Y1 axis
- for($i=0; $i < count($this->plots); ++$i) {
- $this->plots[$i]->Stroke($this->img,$this->xscale,$this->yscale);
- $this->plots[$i]->StrokeMargin($this->img);
- }
- }
-
- $n = count($this->ynaxis);
- for( $i=0; $i < $n; ++$i ) {
- $m = count($this->ynplots[$i]);
- for( $j=0; $j < $m; ++$j ) {
- $this->ynplots[$i][$j]->Stroke($this->img,$this->xscale,$this->ynscale[$i]);
- $this->ynplots[$i][$j]->StrokeMargin($this->img);
- }
- }
-
- if( $this->iIconDepth == DEPTH_FRONT) {
- $this->StrokeIcons();
- }
-
- if( $this->iDoClipping ) {
- // Clipping only supports graphs at 0 and 90 degrees
- if( $this->img->a == 0 ) {
- $this->img->CopyCanvasH($oldimage,$this->img->img,
- $this->img->left_margin,$this->img->top_margin,
- $this->img->left_margin,$this->img->top_margin,
- $this->img->plotwidth+1,$this->img->plotheight);
- }
- elseif( $this->img->a == 90 ) {
- $adj = ($this->img->height - $this->img->width)/2;
- $this->img->CopyCanvasH($oldimage,$this->img->img,
- $this->img->bottom_margin-$adj,$this->img->left_margin+$adj,
- $this->img->bottom_margin-$adj,$this->img->left_margin+$adj,
- $this->img->plotheight+1,$this->img->plotwidth);
- }
- else {
- JpGraphError::RaiseL(25035,$this->img->a);//('You have enabled clipping. Cliping is only supported for graphs at 0 or 90 degrees rotation. Please adjust you current angle (='.$this->img->a.' degrees) or disable clipping.');
- }
- $this->img->Destroy();
- $this->img->SetCanvasH($oldimage);
- }
-
- $this->xscale->off=$oldoff;
-
- if( $this->grid_depth == DEPTH_FRONT && !$_csim ) {
- $this->ygrid->Stroke();
- $this->xgrid->Stroke();
- }
-
- // Stroke bands
- if( $this->bands!= null )
- for($i=0; $i < count($this->bands); ++$i) {
- // Stroke all bands that asks to be in the foreground
- if( $this->bands[$i]->depth == DEPTH_FRONT )
- $this->bands[$i]->Stroke($this->img,$this->xscale,$this->yscale);
- }
-
- if( $this->y2bands!= null && $this->y2scale != null )
- for($i=0; $i < count($this->y2bands); ++$i) {
- // Stroke all bands that asks to be in the foreground
- if( $this->y2bands[$i]->depth == DEPTH_FRONT )
- $this->y2bands[$i]->Stroke($this->img,$this->xscale,$this->y2scale);
- }
-
-
- // Stroke any lines added
- if( $this->lines != null ) {
- for($i=0; $i < count($this->lines); ++$i) {
- $this->lines[$i]->Stroke($this->img,$this->xscale,$this->yscale);
- $this->lines[$i]->DoLegend($this);
- }
- }
-
- if( $this->y2lines != null && $this->y2scale != null ) {
- for($i=0; $i < count($this->y2lines); ++$i) {
- $this->y2lines[$i]->Stroke($this->img,$this->xscale,$this->y2scale);
- $this->y2lines[$i]->DoLegend($this);
- }
- }
-
- // Finally draw the axis again since some plots may have nagged
- // the axis in the edges.However we do no stroke the labels again
- // since any user defined callback would be called twice. It also
- // enhances performance.
-
- if( !$_csim ) {
- $this->StrokeAxis();
- }
-
- if( $this->y2scale != null && !$_csim )
- $this->y2axis->Stroke($this->xscale,false);
-
- if( !$_csim ) {
- $this->StrokePlotBox();
- }
-
- // The titles and legends never gets rotated so make sure
- // that the angle is 0 before stroking them
- $aa = $this->img->SetAngle(0);
- $this->StrokeTitles();
- $this->footer->Stroke($this->img);
- $this->legend->Stroke($this->img);
- $this->img->SetAngle($aa);
- $this->StrokeTexts();
- $this->StrokeTables();
-
- if( !$_csim ) {
-
- $this->img->SetAngle($aa);
-
- // Draw an outline around the image map
- if(_JPG_DEBUG) {
- $this->DisplayClientSideaImageMapAreas();
- }
-
- // Should we do any final image transformation
- if( $this->iImgTrans ) {
- if( !class_exists('ImgTrans') ) {
- require_once('jpgraph_imgtrans.php');
- //JpGraphError::Raise('In order to use image transformation you must include the file jpgraph_imgtrans.php in your script.');
- }
-
- $tform = new ImgTrans($this->img->img);
- $this->img->img = $tform->Skew3D($this->iImgTransHorizon,$this->iImgTransSkewDist,
- $this->iImgTransDirection,$this->iImgTransHighQ,
- $this->iImgTransMinSize,$this->iImgTransFillColor,
- $this->iImgTransBorder);
- }
-
- // If the filename is given as the special "__handle"
- // then the image handler is returned and the image is NOT
- // streamed back
- if( $aStrokeFileName == _IMG_HANDLER ) {
- return $this->img->img;
- }
- else {
- // Finally stream the generated picture
- $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,$aStrokeFileName);
- }
- }
+ function GetTextsYMinMax($aY2=false) {
+ if( $aY2 ) {
+ $txts = $this->y2texts;
+ }
+ else {
+ $txts = $this->texts;
+ }
+ $n = count($txts);
+ $min=null;
+ $max=null;
+ for( $i=0; $i < $n; ++$i ) {
+ if( $txts[$i]->iScalePosY !== null && $txts[$i]->iScalePosX !== null ) {
+ if( $min === null ) {
+ $min = $max = $txts[$i]->iScalePosY ;
+ }
+ else {
+ $min = min($min,$txts[$i]->iScalePosY);
+ $max = max($max,$txts[$i]->iScalePosY);
+ }
+ }
+ }
+ if( $min !== null ) {
+ return array($min,$max);
+ }
+ else {
+ return null;
+ }
}
- function SetAxisLabelBackground($aType,$aXFColor='lightgray',$aXColor='black',$aYFColor='lightgray',$aYColor='black') {
- $this->iAxisLblBgType = $aType;
- $this->iXAxisLblBgFillColor = $aXFColor;
- $this->iXAxisLblBgColor = $aXColor;
- $this->iYAxisLblBgFillColor = $aYFColor;
- $this->iYAxisLblBgColor = $aYColor;
+ function GetTextsXMinMax($aY2=false) {
+ if( $aY2 ) {
+ $txts = $this->y2texts;
+ }
+ else {
+ $txts = $this->texts;
+ }
+ $n = count($txts);
+ $min=null;
+ $max=null;
+ for( $i=0; $i < $n; ++$i ) {
+ if( $txts[$i]->iScalePosY !== null && $txts[$i]->iScalePosX !== null ) {
+ if( $min === null ) {
+ $min = $max = $txts[$i]->iScalePosX ;
+ }
+ else {
+ $min = min($min,$txts[$i]->iScalePosX);
+ $max = max($max,$txts[$i]->iScalePosX);
+ }
+ }
+ }
+ if( $min !== null ) {
+ return array($min,$max);
+ }
+ else {
+ return null;
+ }
}
-//---------------
-// PRIVATE METHODS
+ function GetXMinMax() {
+
+ list($min,$ymin) = $this->plots[0]->Min();
+ list($max,$ymax) = $this->plots[0]->Max();
+
+ $i=0;
+ // Some plots, e.g. PlotLine should not affect the scale
+ // and will return (null,null). We should ignore those
+ // values.
+ while( ($min===null || $max === null) && ($i < count($this->plots)-1) ) {
+ ++$i;
+ list($min,$ymin) = $this->plots[$i]->Min();
+ list($max,$ymax) = $this->plots[$i]->Max();
+ }
+
+ foreach( $this->plots as $p ) {
+ list($xmin,$ymin) = $p->Min();
+ list($xmax,$ymax) = $p->Max();
+
+ if( $xmin !== null && $xmax !== null ) {
+ $min = Min($xmin,$min);
+ $max = Max($xmax,$max);
+ }
+ }
+
+ if( $this->y2axis != null ) {
+ foreach( $this->y2plots as $p ) {
+ list($xmin,$ymin) = $p->Min();
+ list($xmax,$ymax) = $p->Max();
+ $min = Min($xmin,$min);
+ $max = Max($xmax,$max);
+ }
+ }
+
+ $n = count($this->ynaxis);
+ for( $i=0; $i < $n; ++$i ) {
+ if( $this->ynaxis[$i] != null) {
+ foreach( $this->ynplots[$i] as $p ) {
+ list($xmin,$ymin) = $p->Min();
+ list($xmax,$ymax) = $p->Max();
+ $min = Min($xmin,$min);
+ $max = Max($xmax,$max);
+ }
+ }
+ }
+ return array($min,$max);
+ }
+
+ function AdjustMarginsForTitles() {
+ $totrequired = ($this->title->t != '' ? $this->title->GetTextHeight($this->img) + $this->title->margin + 5 : 0 ) +
+ ($this->subtitle->t != '' ? $this->subtitle->GetTextHeight($this->img) + $this->subtitle->margin + 5 : 0 ) +
+ ($this->subsubtitle->t != '' ? $this->subsubtitle->GetTextHeight($this->img) + $this->subsubtitle->margin + 5 : 0 ) ;
+
+ $btotrequired = 0;
+ if($this->xaxis != null && !$this->xaxis->hide && !$this->xaxis->hide_labels ) {
+ // Minimum bottom margin
+ if( $this->xaxis->title->t != '' ) {
+ if( $this->img->a == 90 ) {
+ $btotrequired = $this->yaxis->title->GetTextHeight($this->img) + 7 ;
+ }
+ else {
+ $btotrequired = $this->xaxis->title->GetTextHeight($this->img) + 7 ;
+ }
+ }
+ else {
+ $btotrequired = 0;
+ }
+
+ if( $this->img->a == 90 ) {
+ $this->img->SetFont($this->yaxis->font_family,$this->yaxis->font_style,
+ $this->yaxis->font_size);
+ $lh = $this->img->GetTextHeight('Mg',$this->yaxis->label_angle);
+ }
+ else {
+ $this->img->SetFont($this->xaxis->font_family,$this->xaxis->font_style,
+ $this->xaxis->font_size);
+ $lh = $this->img->GetTextHeight('Mg',$this->xaxis->label_angle);
+ }
+
+ $btotrequired += $lh + 6;
+ }
+
+ if( $this->img->a == 90 ) {
+ // DO Nothing. It gets too messy to do this properly for 90 deg...
+ }
+ else{
+ if( $this->img->top_margin < $totrequired ) {
+ $this->SetMargin($this->img->left_margin,$this->img->right_margin,
+ $totrequired,$this->img->bottom_margin);
+ }
+ if( $this->img->bottom_margin < $btotrequired ) {
+ $this->SetMargin($this->img->left_margin,$this->img->right_margin,
+ $this->img->top_margin,$btotrequired);
+ }
+ }
+ }
+
+ function StrokeStore($aStrokeFileName) {
+ // Get the handler to prevent the library from sending the
+ // image to the browser
+ $ih = $this->Stroke(_IMG_HANDLER);
+
+ // Stroke it to a file
+ $this->img->Stream($aStrokeFileName);
+
+ // Send it back to browser
+ $this->img->Headers();
+ $this->img->Stream();
+ }
+
+ function doAutoscaleXAxis() {
+ //Check if we should autoscale x-axis
+ if( !$this->xscale->IsSpecified() ) {
+ if( substr($this->axtype,0,4) == "text" ) {
+ $max=0;
+ $n = count($this->plots);
+ for($i=0; $i < $n; ++$i ) {
+ $p = $this->plots[$i];
+ // We need some unfortunate sub class knowledge here in order
+ // to increase number of data points in case it is a line plot
+ // which has the barcenter set. If not it could mean that the
+ // last point of the data is outside the scale since the barcenter
+ // settings means that we will shift the entire plot half a tick step
+ // to the right in oder to align with the center of the bars.
+ if( class_exists('BarPlot',false) ) {
+ $cl = strtolower(get_class($p));
+ if( (class_exists('BarPlot',false) && ($p instanceof BarPlot)) || empty($p->barcenter) ) {
+ $max=max($max,$p->numpoints-1);
+ }
+ else {
+ $max=max($max,$p->numpoints);
+ }
+ }
+ else {
+ if( empty($p->barcenter) ) {
+ $max=max($max,$p->numpoints-1);
+ }
+ else {
+ $max=max($max,$p->numpoints);
+ }
+ }
+ }
+ $min=0;
+ if( $this->y2axis != null ) {
+ foreach( $this->y2plots as $p ) {
+ $max=max($max,$p->numpoints-1);
+ }
+ }
+ $n = count($this->ynaxis);
+ for( $i=0; $i < $n; ++$i ) {
+ if( $this->ynaxis[$i] != null) {
+ foreach( $this->ynplots[$i] as $p ) {
+ $max=max($max,$p->numpoints-1);
+ }
+ }
+ }
+
+ $this->xscale->Update($this->img,$min,$max);
+ $this->xscale->ticks->Set($this->xaxis->tick_step,1);
+ $this->xscale->ticks->SupressMinorTickMarks();
+ }
+ else {
+ list($min,$max) = $this->GetXMinMax();
+
+ $lres = $this->GetLinesXMinMax($this->lines);
+ if( $lres ) {
+ list($linmin,$linmax) = $lres ;
+ $min = min($min,$linmin);
+ $max = max($max,$linmax);
+ }
+
+ $lres = $this->GetLinesXMinMax($this->y2lines);
+ if( $lres ) {
+ list($linmin,$linmax) = $lres ;
+ $min = min($min,$linmin);
+ $max = max($max,$linmax);
+ }
+
+ $tres = $this->GetTextsXMinMax();
+ if( $tres ) {
+ list($tmin,$tmax) = $tres ;
+ $min = min($min,$tmin);
+ $max = max($max,$tmax);
+ }
+
+ $tres = $this->GetTextsXMinMax(true);
+ if( $tres ) {
+ list($tmin,$tmax) = $tres ;
+ $min = min($min,$tmin);
+ $max = max($max,$tmax);
+ }
+
+ $this->xscale->AutoScale($this->img,$min,$max,round($this->img->plotwidth/$this->xtick_factor));
+ }
+
+ //Adjust position of y-axis and y2-axis to minimum/maximum of x-scale
+ if( !is_numeric($this->yaxis->pos) && !is_string($this->yaxis->pos) ) {
+ $this->yaxis->SetPos($this->xscale->GetMinVal());
+ }
+ }
+ elseif( $this->xscale->IsSpecified() &&
+ ( $this->xscale->auto_ticks || !$this->xscale->ticks->IsSpecified()) ) {
+ // The tick calculation will use the user suplied min/max values to determine
+ // the ticks. If auto_ticks is false the exact user specifed min and max
+ // values will be used for the scale.
+ // If auto_ticks is true then the scale might be slightly adjusted
+ // so that the min and max values falls on an even major step.
+ $min = $this->xscale->scale[0];
+ $max = $this->xscale->scale[1];
+ $this->xscale->AutoScale($this->img,$min,$max,round($this->img->plotwidth/$this->xtick_factor),false);
+
+ // Now make sure we show enough precision to accurate display the
+ // labels. If this is not done then the user might end up with
+ // a scale that might actually start with, say 13.5, butdue to rounding
+ // the scale label will ony show 14.
+ if( abs(floor($min)-$min) > 0 ) {
+
+ // If the user has set a format then we bail out
+ if( $this->xscale->ticks->label_formatstr == '' && $this->xscale->ticks->label_dateformatstr == '' ) {
+ $this->xscale->ticks->precision = abs( floor(log10( abs(floor($min)-$min))) )+1;
+ }
+ }
+ }
+
+ // Position the optional Y2 and Yn axis to the rightmost position of the x-axis
+ if( $this->y2axis != null ) {
+ if( !is_numeric($this->y2axis->pos) && !is_string($this->y2axis->pos) ) {
+ $this->y2axis->SetPos($this->xscale->GetMaxVal());
+ }
+ $this->y2axis->SetTitleSide(SIDE_RIGHT);
+ }
+
+ $n = count($this->ynaxis);
+ $nY2adj = $this->y2axis != null ? $this->iYAxisDeltaPos : 0;
+ for( $i=0; $i < $n; ++$i ) {
+ if( $this->ynaxis[$i] != null ) {
+ if( !is_numeric($this->ynaxis[$i]->pos) && !is_string($this->ynaxis[$i]->pos) ) {
+ $this->ynaxis[$i]->SetPos($this->xscale->GetMaxVal());
+ $this->ynaxis[$i]->SetPosAbsDelta($i*$this->iYAxisDeltaPos + $nY2adj);
+ }
+ $this->ynaxis[$i]->SetTitleSide(SIDE_RIGHT);
+ }
+ }
+ }
+
+
+ function doAutoScaleYnAxis() {
+
+ if( $this->y2scale != null) {
+ if( !$this->y2scale->IsSpecified() && count($this->y2plots)>0 ) {
+ list($min,$max) = $this->GetPlotsYMinMax($this->y2plots);
+
+ $lres = $this->GetLinesYMinMax($this->y2lines);
+ if( is_array($lres) ) {
+ list($linmin,$linmax) = $lres ;
+ $min = min($min,$linmin);
+ $max = max($max,$linmax);
+ }
+ $tres = $this->GetTextsYMinMax(true);
+ if( is_array($tres) ) {
+ list($tmin,$tmax) = $tres ;
+ $min = min($min,$tmin);
+ $max = max($max,$tmax);
+ }
+ $this->y2scale->AutoScale($this->img,$min,$max,$this->img->plotheight/$this->ytick_factor);
+ }
+ elseif( $this->y2scale->IsSpecified() && ( $this->y2scale->auto_ticks || !$this->y2scale->ticks->IsSpecified()) ) {
+ // The tick calculation will use the user suplied min/max values to determine
+ // the ticks. If auto_ticks is false the exact user specifed min and max
+ // values will be used for the scale.
+ // If auto_ticks is true then the scale might be slightly adjusted
+ // so that the min and max values falls on an even major step.
+ $min = $this->y2scale->scale[0];
+ $max = $this->y2scale->scale[1];
+ $this->y2scale->AutoScale($this->img,$min,$max,
+ $this->img->plotheight/$this->ytick_factor,
+ $this->y2scale->auto_ticks);
+
+ // Now make sure we show enough precision to accurate display the
+ // labels. If this is not done then the user might end up with
+ // a scale that might actually start with, say 13.5, butdue to rounding
+ // the scale label will ony show 14.
+ if( abs(floor($min)-$min) > 0 ) {
+ // If the user has set a format then we bail out
+ if( $this->y2scale->ticks->label_formatstr == '' && $this->y2scale->ticks->label_dateformatstr == '' ) {
+ $this->y2scale->ticks->precision = abs( floor(log10( abs(floor($min)-$min))) )+1;
+ }
+ }
+
+ }
+ }
+
+
+ //
+ // Autoscale the extra Y-axises
+ //
+ $n = count($this->ynaxis);
+ for( $i=0; $i < $n; ++$i ) {
+ if( $this->ynscale[$i] != null) {
+ if( !$this->ynscale[$i]->IsSpecified() && count($this->ynplots[$i])>0 ) {
+ list($min,$max) = $this->GetPlotsYMinMax($this->ynplots[$i]);
+ $this->ynscale[$i]->AutoScale($this->img,$min,$max,$this->img->plotheight/$this->ytick_factor);
+ }
+ elseif( $this->ynscale[$i]->IsSpecified() && ( $this->ynscale[$i]->auto_ticks || !$this->ynscale[$i]->ticks->IsSpecified()) ) {
+ // The tick calculation will use the user suplied min/max values to determine
+ // the ticks. If auto_ticks is false the exact user specifed min and max
+ // values will be used for the scale.
+ // If auto_ticks is true then the scale might be slightly adjusted
+ // so that the min and max values falls on an even major step.
+ $min = $this->ynscale[$i]->scale[0];
+ $max = $this->ynscale[$i]->scale[1];
+ $this->ynscale[$i]->AutoScale($this->img,$min,$max,
+ $this->img->plotheight/$this->ytick_factor,
+ $this->ynscale[$i]->auto_ticks);
+
+ // Now make sure we show enough precision to accurate display the
+ // labels. If this is not done then the user might end up with
+ // a scale that might actually start with, say 13.5, butdue to rounding
+ // the scale label will ony show 14.
+ if( abs(floor($min)-$min) > 0 ) {
+ // If the user has set a format then we bail out
+ if( $this->ynscale[$i]->ticks->label_formatstr == '' && $this->ynscale[$i]->ticks->label_dateformatstr == '' ) {
+ $this->ynscale[$i]->ticks->precision = abs( floor(log10( abs(floor($min)-$min))) )+1;
+ }
+ }
+ }
+ }
+ }
+ }
+
+ function doAutoScaleYAxis() {
+
+ //Check if we should autoscale y-axis
+ if( !$this->yscale->IsSpecified() && count($this->plots)>0 ) {
+ list($min,$max) = $this->GetPlotsYMinMax($this->plots);
+ $lres = $this->GetLinesYMinMax($this->lines);
+ if( is_array($lres) ) {
+ list($linmin,$linmax) = $lres ;
+ $min = min($min,$linmin);
+ $max = max($max,$linmax);
+ }
+ $tres = $this->GetTextsYMinMax();
+ if( is_array($tres) ) {
+ list($tmin,$tmax) = $tres ;
+ $min = min($min,$tmin);
+ $max = max($max,$tmax);
+ }
+ $this->yscale->AutoScale($this->img,$min,$max,
+ $this->img->plotheight/$this->ytick_factor);
+ }
+ elseif( $this->yscale->IsSpecified() && ( $this->yscale->auto_ticks || !$this->yscale->ticks->IsSpecified()) ) {
+ // The tick calculation will use the user suplied min/max values to determine
+ // the ticks. If auto_ticks is false the exact user specifed min and max
+ // values will be used for the scale.
+ // If auto_ticks is true then the scale might be slightly adjusted
+ // so that the min and max values falls on an even major step.
+ $min = $this->yscale->scale[0];
+ $max = $this->yscale->scale[1];
+ $this->yscale->AutoScale($this->img,$min,$max,
+ $this->img->plotheight/$this->ytick_factor,
+ $this->yscale->auto_ticks);
+
+ // Now make sure we show enough precision to accurate display the
+ // labels. If this is not done then the user might end up with
+ // a scale that might actually start with, say 13.5, butdue to rounding
+ // the scale label will ony show 14.
+ if( abs(floor($min)-$min) > 0 ) {
+
+ // If the user has set a format then we bail out
+ if( $this->yscale->ticks->label_formatstr == '' && $this->yscale->ticks->label_dateformatstr == '' ) {
+ $this->yscale->ticks->precision = abs( floor(log10( abs(floor($min)-$min))) )+1;
+ }
+ }
+ }
+
+ }
+
+ function InitScaleConstants() {
+ // Setup scale constants
+ if( $this->yscale ) $this->yscale->InitConstants($this->img);
+ if( $this->xscale ) $this->xscale->InitConstants($this->img);
+ if( $this->y2scale ) $this->y2scale->InitConstants($this->img);
+
+ $n=count($this->ynscale);
+ for($i=0; $i < $n; ++$i) {
+ if( $this->ynscale[$i] ) {
+ $this->ynscale[$i]->InitConstants($this->img);
+ }
+ }
+ }
+
+ function doPrestrokeAdjustments() {
+
+ // Do any pre-stroke adjustment that is needed by the different plot types
+ // (i.e bar plots want's to add an offset to the x-labels etc)
+ for($i=0; $i < count($this->plots) ; ++$i ) {
+ $this->plots[$i]->PreStrokeAdjust($this);
+ $this->plots[$i]->DoLegend($this);
+ }
+
+ // Any plots on the second Y scale?
+ if( $this->y2scale != null ) {
+ for($i=0; $i
\nYou have either:
\n";
+ // $e .= "1. Specified an Y axis for autoscaling but have not supplied any plots
\n";
+ // $e .= "2. Specified a scale manually but have forgot to specify the tick steps";
+ JpGraphError::RaiseL(25026);
+ }
+
+ // Bail out if no plots and no specified X-scale
+ if( (!$this->xscale->IsSpecified() && count($this->plots)==0 && count($this->y2plots)==0) ) {
+ JpGraphError::RaiseL(25034);//("JpGraph: Can't draw unspecified X-scale.
No plots.
");
+ }
+
+ // Autoscale the normal Y-axis
+ $this->doAutoScaleYAxis();
+
+ // Autoscale all additiopnal y-axis
+ $this->doAutoScaleYnAxis();
+
+ // Autoscale the regular x-axis and position the y-axis properly
+ $this->doAutoScaleXAxis();
+
+ // If we have a negative values and x-axis position is at 0
+ // we need to supress the first and possible the last tick since
+ // they will be drawn on top of the y-axis (and possible y2 axis)
+ // The test below might seem strange the reasone being that if
+ // the user hasn't specified a value for position this will not
+ // be set until we do the stroke for the axis so as of now it
+ // is undefined.
+ // For X-text scale we ignore all this since the tick are usually
+ // much further in and not close to the Y-axis. Hence the test
+ // for 'text'
+ if( ($this->yaxis->pos==$this->xscale->GetMinVal() || (is_string($this->yaxis->pos) && $this->yaxis->pos=='min')) &&
+ !is_numeric($this->xaxis->pos) && $this->yscale->GetMinVal() < 0 &&
+ substr($this->axtype,0,4) != 'text' && $this->xaxis->pos != 'min' ) {
+
+ //$this->yscale->ticks->SupressZeroLabel(false);
+ $this->xscale->ticks->SupressFirst();
+ if( $this->y2axis != null ) {
+ $this->xscale->ticks->SupressLast();
+ }
+ }
+ elseif( !is_numeric($this->yaxis->pos) && $this->yaxis->pos=='max' ) {
+ $this->xscale->ticks->SupressLast();
+ }
+
+ if( !$_csim ) {
+ $this->StrokePlotArea();
+ if( $this->iIconDepth == DEPTH_BACK ) {
+ $this->StrokeIcons();
+ }
+ }
+ $this->StrokeAxis(false);
+
+ // Stroke colored bands
+ $this->StrokeBands(DEPTH_BACK,$_csim);
+
+ if( $this->grid_depth == DEPTH_BACK && !$_csim) {
+ $this->ygrid->Stroke();
+ $this->xgrid->Stroke();
+ }
+
+ // Stroke Y2-axis
+ if( $this->y2axis != null && !$_csim) {
+ $this->y2axis->Stroke($this->xscale);
+ $this->y2grid->Stroke();
+ }
+
+ // Stroke yn-axis
+ $n = count($this->ynaxis);
+ for( $i=0; $i < $n; ++$i ) {
+ $this->ynaxis[$i]->Stroke($this->xscale);
+ }
+
+ $oldoff=$this->xscale->off;
+ if( substr($this->axtype,0,4) == 'text' ) {
+ if( $this->text_scale_abscenteroff > -1 ) {
+ // For a text scale the scale factor is the number of pixel per step.
+ // Hence we can use the scale factor as a substitute for number of pixels
+ // per major scale step and use that in order to adjust the offset so that
+ // an object of width "abscenteroff" becomes centered.
+ $this->xscale->off += round($this->xscale->scale_factor/2)-round($this->text_scale_abscenteroff/2);
+ }
+ else {
+ $this->xscale->off += ceil($this->xscale->scale_factor*$this->text_scale_off*$this->xscale->ticks->minor_step);
+ }
+ }
+
+ if( $this->iDoClipping ) {
+ $oldimage = $this->img->CloneCanvasH();
+ }
+
+ if( ! $this->y2orderback ) {
+ // Stroke all plots for Y1 axis
+ for($i=0; $i < count($this->plots); ++$i) {
+ $this->plots[$i]->Stroke($this->img,$this->xscale,$this->yscale);
+ $this->plots[$i]->StrokeMargin($this->img);
+ }
+ }
+
+ // Stroke all plots for Y2 axis
+ if( $this->y2scale != null ) {
+ for($i=0; $i< count($this->y2plots); ++$i ) {
+ $this->y2plots[$i]->Stroke($this->img,$this->xscale,$this->y2scale);
+ }
+ }
+
+ if( $this->y2orderback ) {
+ // Stroke all plots for Y1 axis
+ for($i=0; $i < count($this->plots); ++$i) {
+ $this->plots[$i]->Stroke($this->img,$this->xscale,$this->yscale);
+ $this->plots[$i]->StrokeMargin($this->img);
+ }
+ }
+
+ $n = count($this->ynaxis);
+ for( $i=0; $i < $n; ++$i ) {
+ $m = count($this->ynplots[$i]);
+ for( $j=0; $j < $m; ++$j ) {
+ $this->ynplots[$i][$j]->Stroke($this->img,$this->xscale,$this->ynscale[$i]);
+ $this->ynplots[$i][$j]->StrokeMargin($this->img);
+ }
+ }
+
+ if( $this->iIconDepth == DEPTH_FRONT) {
+ $this->StrokeIcons();
+ }
+
+ if( $this->iDoClipping ) {
+ // Clipping only supports graphs at 0 and 90 degrees
+ if( $this->img->a == 0 ) {
+ $this->img->CopyCanvasH($oldimage,$this->img->img,
+ $this->img->left_margin,$this->img->top_margin,
+ $this->img->left_margin,$this->img->top_margin,
+ $this->img->plotwidth+1,$this->img->plotheight);
+ }
+ elseif( $this->img->a == 90 ) {
+ $adj = ($this->img->height - $this->img->width)/2;
+ $this->img->CopyCanvasH($oldimage,$this->img->img,
+ $this->img->bottom_margin-$adj,$this->img->left_margin+$adj,
+ $this->img->bottom_margin-$adj,$this->img->left_margin+$adj,
+ $this->img->plotheight+1,$this->img->plotwidth);
+ }
+ else {
+ JpGraphError::RaiseL(25035,$this->img->a);//('You have enabled clipping. Cliping is only supported for graphs at 0 or 90 degrees rotation. Please adjust you current angle (='.$this->img->a.' degrees) or disable clipping.');
+ }
+ $this->img->Destroy();
+ $this->img->SetCanvasH($oldimage);
+ }
+
+ $this->xscale->off=$oldoff;
+
+ if( $this->grid_depth == DEPTH_FRONT && !$_csim ) {
+ $this->ygrid->Stroke();
+ $this->xgrid->Stroke();
+ }
+
+ // Stroke colored bands
+ $this->StrokeBands(DEPTH_FRONT,$_csim);
+
+ // Finally draw the axis again since some plots may have nagged
+ // the axis in the edges.
+ if( !$_csim ) {
+ $this->StrokeAxis();
+ }
+
+ if( $this->y2scale != null && !$_csim ) {
+ $this->y2axis->Stroke($this->xscale,false);
+ }
+
+ if( !$_csim ) {
+ $this->StrokePlotBox();
+ }
+
+ // The titles and legends never gets rotated so make sure
+ // that the angle is 0 before stroking them
+ $aa = $this->img->SetAngle(0);
+ $this->StrokeTitles();
+ $this->footer->Stroke($this->img);
+ $this->legend->Stroke($this->img);
+ $this->img->SetAngle($aa);
+ $this->StrokeTexts();
+ $this->StrokeTables();
+
+ if( !$_csim ) {
+
+ $this->img->SetAngle($aa);
+
+ // Draw an outline around the image map
+ if(_JPG_DEBUG) {
+ $this->DisplayClientSideaImageMapAreas();
+ }
+
+ // Should we do any final image transformation
+ if( $this->iImgTrans ) {
+ if( !class_exists('ImgTrans',false) ) {
+ require_once('jpgraph_imgtrans.php');
+ //JpGraphError::Raise('In order to use image transformation you must include the file jpgraph_imgtrans.php in your script.');
+ }
+
+ $tform = new ImgTrans($this->img->img);
+ $this->img->img = $tform->Skew3D($this->iImgTransHorizon,$this->iImgTransSkewDist,
+ $this->iImgTransDirection,$this->iImgTransHighQ,
+ $this->iImgTransMinSize,$this->iImgTransFillColor,
+ $this->iImgTransBorder);
+ }
+
+ // If the filename is given as the special "__handle"
+ // then the image handler is returned and the image is NOT
+ // streamed back
+ if( $aStrokeFileName == _IMG_HANDLER ) {
+ return $this->img->img;
+ }
+ else {
+ // Finally stream the generated picture
+ $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,$aStrokeFileName);
+ }
+ }
+ }
+
+ function SetAxisLabelBackground($aType,$aXFColor='lightgray',$aXColor='black',$aYFColor='lightgray',$aYColor='black') {
+ $this->iAxisLblBgType = $aType;
+ $this->iXAxisLblBgFillColor = $aXFColor;
+ $this->iXAxisLblBgColor = $aXColor;
+ $this->iYAxisLblBgFillColor = $aYFColor;
+ $this->iYAxisLblBgColor = $aYColor;
+ }
function StrokeAxisLabelBackground() {
- // Types
- // 0 = No background
- // 1 = Only X-labels, length of axis
- // 2 = Only Y-labels, length of axis
- // 3 = As 1 but extends to width of graph
- // 4 = As 2 but extends to height of graph
- // 5 = Combination of 3 & 4
- // 6 = Combination of 1 & 2
-
- $t = $this->iAxisLblBgType ;
- if( $t < 1 ) return;
- // Stroke optional X-axis label background color
- if( $t == 1 || $t == 3 || $t == 5 || $t == 6 ) {
- $this->img->PushColor($this->iXAxisLblBgFillColor);
- if( $t == 1 || $t == 6 ) {
- $xl = $this->img->left_margin;
- $yu = $this->img->height - $this->img->bottom_margin + 1;
- $xr = $this->img->width - $this->img->right_margin ;
- $yl = $this->img->height-1-$this->frame_weight;
- }
- else { // t==3 || t==5
- $xl = $this->frame_weight;
- $yu = $this->img->height - $this->img->bottom_margin + 1;
- $xr = $this->img->width - 1 - $this->frame_weight;
- $yl = $this->img->height-1-$this->frame_weight;
- }
-
- $this->img->FilledRectangle($xl,$yu,$xr,$yl);
- $this->img->PopColor();
-
- // Check if we should add the vertical lines at left and right edge
- if( $this->iXAxisLblBgColor !== '' ) {
- $this->img->PushColor($this->iXAxisLblBgColor);
- if( $t == 1 || $t == 6 ) {
- $this->img->Line($xl,$yu,$xl,$yl);
- $this->img->Line($xr,$yu,$xr,$yl);
- }
- else {
- $xl = $this->img->width - $this->img->right_margin ;
- $this->img->Line($xl,$yu-1,$xr,$yu-1);
- }
- $this->img->PopColor();
- }
- }
-
- if( $t == 2 || $t == 4 || $t == 5 || $t == 6 ) {
- $this->img->PushColor($this->iYAxisLblBgFillColor);
- if( $t == 2 || $t == 6 ) {
- $xl = $this->frame_weight;
- $yu = $this->frame_weight+$this->img->top_margin;
- $xr = $this->img->left_margin - 1;
- $yl = $this->img->height - $this->img->bottom_margin + 1;
- }
- else {
- $xl = $this->frame_weight;
- $yu = $this->frame_weight;
- $xr = $this->img->left_margin - 1;
- $yl = $this->img->height-1-$this->frame_weight;
- }
-
- $this->img->FilledRectangle($xl,$yu,$xr,$yl);
- $this->img->PopColor();
-
- // Check if we should add the vertical lines at left and right edge
- if( $this->iXAxisLblBgColor !== '' ) {
- $this->img->PushColor($this->iXAxisLblBgColor);
- if( $t == 2 || $t == 6 ) {
- $this->img->Line($xl,$yu-1,$xr,$yu-1);
- $this->img->Line($xl,$yl-1,$xr,$yl-1);
- }
- else {
- $this->img->Line($xr+1,$yu,$xr+1,$this->img->top_margin);
- }
- $this->img->PopColor();
- }
+ // Types
+ // 0 = No background
+ // 1 = Only X-labels, length of axis
+ // 2 = Only Y-labels, length of axis
+ // 3 = As 1 but extends to width of graph
+ // 4 = As 2 but extends to height of graph
+ // 5 = Combination of 3 & 4
+ // 6 = Combination of 1 & 2
+
+ $t = $this->iAxisLblBgType ;
+ if( $t < 1 ) return;
+
+ // Stroke optional X-axis label background color
+ if( $t == 1 || $t == 3 || $t == 5 || $t == 6 ) {
+ $this->img->PushColor($this->iXAxisLblBgFillColor);
+ if( $t == 1 || $t == 6 ) {
+ $xl = $this->img->left_margin;
+ $yu = $this->img->height - $this->img->bottom_margin + 1;
+ $xr = $this->img->width - $this->img->right_margin ;
+ $yl = $this->img->height-1-$this->frame_weight;
+ }
+ else { // t==3 || t==5
+ $xl = $this->frame_weight;
+ $yu = $this->img->height - $this->img->bottom_margin + 1;
+ $xr = $this->img->width - 1 - $this->frame_weight;
+ $yl = $this->img->height-1-$this->frame_weight;
+ }
+
+ $this->img->FilledRectangle($xl,$yu,$xr,$yl);
+ $this->img->PopColor();
+
+ // Check if we should add the vertical lines at left and right edge
+ if( $this->iXAxisLblBgColor !== '' ) {
+ // Hardcode to one pixel wide
+ $this->img->SetLineWeight(1);
+ $this->img->PushColor($this->iXAxisLblBgColor);
+ if( $t == 1 || $t == 6 ) {
+ $this->img->Line($xl,$yu,$xl,$yl);
+ $this->img->Line($xr,$yu,$xr,$yl);
+ }
+ else {
+ $xl = $this->img->width - $this->img->right_margin ;
+ $this->img->Line($xl,$yu-1,$xr,$yu-1);
+ }
+ $this->img->PopColor();
+ }
+ }
+
+ if( $t == 2 || $t == 4 || $t == 5 || $t == 6 ) {
+ $this->img->PushColor($this->iYAxisLblBgFillColor);
+ if( $t == 2 || $t == 6 ) {
+ $xl = $this->frame_weight;
+ $yu = $this->frame_weight+$this->img->top_margin;
+ $xr = $this->img->left_margin - 1;
+ $yl = $this->img->height - $this->img->bottom_margin + 1;
+ }
+ else {
+ $xl = $this->frame_weight;
+ $yu = $this->frame_weight;
+ $xr = $this->img->left_margin - 1;
+ $yl = $this->img->height-1-$this->frame_weight;
+ }
+
+ $this->img->FilledRectangle($xl,$yu,$xr,$yl);
+ $this->img->PopColor();
+
+ // Check if we should add the vertical lines at left and right edge
+ if( $this->iXAxisLblBgColor !== '' ) {
+ $this->img->PushColor($this->iXAxisLblBgColor);
+ if( $t == 2 || $t == 6 ) {
+ $this->img->Line($xl,$yu-1,$xr,$yu-1);
+ $this->img->Line($xl,$yl-1,$xr,$yl-1);
+ }
+ else {
+ $this->img->Line($xr+1,$yu,$xr+1,$this->img->top_margin);
+ }
+ $this->img->PopColor();
+ }
- }
+ }
}
function StrokeAxis($aStrokeLabels=true) {
-
- if( $aStrokeLabels ) {
- $this->StrokeAxisLabelBackground();
- }
-
- // Stroke axis
- if( $this->iAxisStyle != AXSTYLE_SIMPLE ) {
- switch( $this->iAxisStyle ) {
- case AXSTYLE_BOXIN :
- $toppos = SIDE_DOWN;
- $bottompos = SIDE_UP;
- $leftpos = SIDE_RIGHT;
- $rightpos = SIDE_LEFT;
- break;
- case AXSTYLE_BOXOUT :
- $toppos = SIDE_UP;
- $bottompos = SIDE_DOWN;
- $leftpos = SIDE_LEFT;
- $rightpos = SIDE_RIGHT;
- break;
- case AXSTYLE_YBOXIN:
- $toppos = -100;
- $bottompos = SIDE_UP;
- $leftpos = SIDE_RIGHT;
- $rightpos = SIDE_LEFT;
- break;
- case AXSTYLE_YBOXOUT:
- $toppos = -100;
- $bottompos = SIDE_DOWN;
- $leftpos = SIDE_LEFT;
- $rightpos = SIDE_RIGHT;
- break;
- default:
- JpGRaphError::RaiseL(25036,$this->iAxisStyle); //('Unknown AxisStyle() : '.$this->iAxisStyle);
- break;
- }
- $this->xaxis->SetPos('min');
-
- // By default we hide the first label so it doesn't cross the
- // Y-axis in case the positon hasn't been set by the user.
- // However, if we use a box we always want the first value
- // displayed so we make sure it will be displayed.
- $this->xscale->ticks->SupressFirst(false);
-
- $this->xaxis->SetLabelSide(SIDE_DOWN);
- $this->xaxis->scale->ticks->SetSide($bottompos);
- $this->xaxis->Stroke($this->yscale);
-
- if( $toppos != -100 ) {
- // To avoid side effects we work on a new copy
- $maxis = $this->xaxis;
- $maxis->SetPos('max');
- $maxis->SetLabelSide(SIDE_UP);
- $maxis->SetLabelMargin(7);
- $this->xaxis->scale->ticks->SetSide($toppos);
- $maxis->Stroke($this->yscale);
- }
-
- $this->yaxis->SetPos('min');
- $this->yaxis->SetLabelMargin(10);
- $this->yaxis->SetLabelSide(SIDE_LEFT);
- $this->yaxis->scale->ticks->SetSide($leftpos);
- $this->yaxis->Stroke($this->xscale);
-
- $myaxis = $this->yaxis;
- $myaxis->SetPos('max');
- $myaxis->SetLabelMargin(10);
- $myaxis->SetLabelSide(SIDE_RIGHT);
- $myaxis->title->Set('');
- $myaxis->scale->ticks->SetSide($rightpos);
- $myaxis->Stroke($this->xscale);
-
- }
- else {
- $this->xaxis->Stroke($this->yscale,$aStrokeLabels);
- $this->yaxis->Stroke($this->xscale,$aStrokeLabels);
- }
+
+ if( $aStrokeLabels ) {
+ $this->StrokeAxisLabelBackground();
+ }
+
+ // Stroke axis
+ if( $this->iAxisStyle != AXSTYLE_SIMPLE ) {
+ switch( $this->iAxisStyle ) {
+ case AXSTYLE_BOXIN :
+ $toppos = SIDE_DOWN;
+ $bottompos = SIDE_UP;
+ $leftpos = SIDE_RIGHT;
+ $rightpos = SIDE_LEFT;
+ break;
+ case AXSTYLE_BOXOUT :
+ $toppos = SIDE_UP;
+ $bottompos = SIDE_DOWN;
+ $leftpos = SIDE_LEFT;
+ $rightpos = SIDE_RIGHT;
+ break;
+ case AXSTYLE_YBOXIN:
+ $toppos = FALSE;
+ $bottompos = SIDE_UP;
+ $leftpos = SIDE_RIGHT;
+ $rightpos = SIDE_LEFT;
+ break;
+ case AXSTYLE_YBOXOUT:
+ $toppos = FALSE;
+ $bottompos = SIDE_DOWN;
+ $leftpos = SIDE_LEFT;
+ $rightpos = SIDE_RIGHT;
+ break;
+ default:
+ JpGRaphError::RaiseL(25036,$this->iAxisStyle); //('Unknown AxisStyle() : '.$this->iAxisStyle);
+ break;
+ }
+
+ // By default we hide the first label so it doesn't cross the
+ // Y-axis in case the positon hasn't been set by the user.
+ // However, if we use a box we always want the first value
+ // displayed so we make sure it will be displayed.
+ $this->xscale->ticks->SupressFirst(false);
+
+ // Now draw the bottom X-axis
+ $this->xaxis->SetPos('min');
+ $this->xaxis->SetLabelSide(SIDE_DOWN);
+ $this->xaxis->scale->ticks->SetSide($bottompos);
+ $this->xaxis->Stroke($this->yscale,$aStrokeLabels);
+
+ if( $toppos !== FALSE ) {
+ // We also want a top X-axis
+ $this->xaxis = $this->xaxis;
+ $this->xaxis->SetPos('max');
+ $this->xaxis->SetLabelSide(SIDE_UP);
+ // No title for the top X-axis
+ if( $aStrokeLabels ) {
+ $this->xaxis->title->Set('');
+ }
+ $this->xaxis->scale->ticks->SetSide($toppos);
+ $this->xaxis->Stroke($this->yscale,$aStrokeLabels);
+ }
+
+ // Stroke the left Y-axis
+ $this->yaxis->SetPos('min');
+ $this->yaxis->SetLabelSide(SIDE_LEFT);
+ $this->yaxis->scale->ticks->SetSide($leftpos);
+ $this->yaxis->Stroke($this->xscale,$aStrokeLabels);
+
+ // Stroke the right Y-axis
+ $this->yaxis->SetPos('max');
+ // No title for the right side
+ if( $aStrokeLabels ) {
+ $this->yaxis->title->Set('');
+ }
+ $this->yaxis->SetLabelSide(SIDE_RIGHT);
+ $this->yaxis->scale->ticks->SetSide($rightpos);
+ $this->yaxis->Stroke($this->xscale,$aStrokeLabels);
+ }
+ else {
+ $this->xaxis->Stroke($this->yscale,$aStrokeLabels);
+ $this->yaxis->Stroke($this->xscale,$aStrokeLabels);
+ }
}
// Private helper function for backgound image
- function LoadBkgImage($aImgFormat='',$aFile='',$aImgStr='') {
- if( $aImgStr != '' ) {
- return Image::CreateFromString($aImgStr);
- }
-
- // Remove case sensitivity and setup appropriate function to create image
- // Get file extension. This should be the LAST '.' separated part of the filename
- $e = explode('.',$aFile);
- $ext = strtolower($e[count($e)-1]);
- if ($ext == "jpeg") {
- $ext = "jpg";
- }
-
- if( trim($ext) == '' )
- $ext = 'png'; // Assume PNG if no extension specified
-
- if( $aImgFormat == '' )
- $imgtag = $ext;
- else
- $imgtag = $aImgFormat;
-
- $supported = imagetypes();
- if( ( $ext == 'jpg' && !($supported & IMG_JPG) ) ||
- ( $ext == 'gif' && !($supported & IMG_GIF) ) ||
- ( $ext == 'png' && !($supported & IMG_PNG) ) ||
- ( $ext == 'bmp' && !($supported & IMG_WBMP) ) ||
- ( $ext == 'xpm' && !($supported & IMG_XPM) ) ) {
- JpGraphError::RaiseL(25037,$aFile);//('The image format of your background image ('.$aFile.') is not supported in your system configuration. ');
- }
-
-
- if( $imgtag == "jpg" || $imgtag == "jpeg")
- {
- $f = "imagecreatefromjpeg";
- $imgtag = "jpg";
- }
- else
- {
- $f = "imagecreatefrom".$imgtag;
- }
-
- // Compare specified image type and file extension
- if( $imgtag != $ext ) {
- //$t = "Background image seems to be of different type (has different file extension) than specified imagetype. Specified: '".$aImgFormat."'File: '".$aFile."'";
- JpGraphError::RaiseL(25038, $aImgFormat, $aFile);
- }
-
- $img = @$f($aFile);
- if( !$img ) {
- JpGraphError::RaiseL(25039,$aFile);//(" Can't read background image: '".$aFile."'");
- }
- return $img;
- }
+ static function LoadBkgImage($aImgFormat='',$aFile='',$aImgStr='') {
+ if( $aImgStr != '' ) {
+ return Image::CreateFromString($aImgStr);
+ }
+
+ // Remove case sensitivity and setup appropriate function to create image
+ // Get file extension. This should be the LAST '.' separated part of the filename
+ $e = explode('.',$aFile);
+ $ext = strtolower($e[count($e)-1]);
+ if ($ext == "jpeg") {
+ $ext = "jpg";
+ }
+
+ if( trim($ext) == '' ) {
+ $ext = 'png'; // Assume PNG if no extension specified
+ }
+
+ if( $aImgFormat == '' ) {
+ $imgtag = $ext;
+ }
+ else {
+ $imgtag = $aImgFormat;
+ }
+
+ $supported = imagetypes();
+ if( ( $ext == 'jpg' && !($supported & IMG_JPG) ) ||
+ ( $ext == 'gif' && !($supported & IMG_GIF) ) ||
+ ( $ext == 'png' && !($supported & IMG_PNG) ) ||
+ ( $ext == 'bmp' && !($supported & IMG_WBMP) ) ||
+ ( $ext == 'xpm' && !($supported & IMG_XPM) ) ) {
+
+ JpGraphError::RaiseL(25037,$aFile);//('The image format of your background image ('.$aFile.') is not supported in your system configuration. ');
+ }
+
+
+ if( $imgtag == "jpg" || $imgtag == "jpeg") {
+ $f = "imagecreatefromjpeg";
+ $imgtag = "jpg";
+ }
+ else {
+ $f = "imagecreatefrom".$imgtag;
+ }
+
+ // Compare specified image type and file extension
+ if( $imgtag != $ext ) {
+ //$t = "Background image seems to be of different type (has different file extension) than specified imagetype. Specified: '".$aImgFormat."'File: '".$aFile."'";
+ JpGraphError::RaiseL(25038, $aImgFormat, $aFile);
+ }
+
+ $img = @$f($aFile);
+ if( !$img ) {
+ JpGraphError::RaiseL(25039,$aFile);//(" Can't read background image: '".$aFile."'");
+ }
+ return $img;
+ }
+
+ function StrokePlotGrad() {
+ if( $this->plot_gradtype < 0 )
+ return;
+
+ $grad = new Gradient($this->img);
+ $xl = $this->img->left_margin;
+ $yt = $this->img->top_margin;
+ $xr = $xl + $this->img->plotwidth+1 ;
+ $yb = $yt + $this->img->plotheight ;
+ $grad->FilledRectangle($xl,$yt,$xr,$yb,$this->plot_gradfrom,$this->plot_gradto,$this->plot_gradtype);
+
+ }
function StrokeBackgroundGrad() {
- if( $this->bkg_gradtype < 0 )
- return;
- $grad = new Gradient($this->img);
- if( $this->bkg_gradstyle == BGRAD_PLOT ) {
- $xl = $this->img->left_margin;
- $yt = $this->img->top_margin;
- $xr = $xl + $this->img->plotwidth+1 ;
- $yb = $yt + $this->img->plotheight ;
- $grad->FilledRectangle($xl,$yt,$xr,$yb,$this->bkg_gradfrom,$this->bkg_gradto,$this->bkg_gradtype);
- }
- else {
- $xl = 0;
- $yt = 0;
- $xr = $xl + $this->img->width - 1;
- $yb = $yt + $this->img->height;
- if( $this->doshadow ) {
- $xr -= $this->shadow_width;
- $yb -= $this->shadow_width;
- }
- if( $this->doframe ) {
- $yt += $this->frame_weight;
- $yb -= $this->frame_weight;
- $xl += $this->frame_weight;
- $xr -= $this->frame_weight;
- }
- $aa = $this->img->SetAngle(0);
- $grad->FilledRectangle($xl,$yt,$xr,$yb,$this->bkg_gradfrom,$this->bkg_gradto,$this->bkg_gradtype);
- $aa = $this->img->SetAngle($aa);
- }
+ if( $this->bkg_gradtype < 0 )
+ return;
+
+ $grad = new Gradient($this->img);
+ if( $this->bkg_gradstyle == BGRAD_PLOT ) {
+ $xl = $this->img->left_margin;
+ $yt = $this->img->top_margin;
+ $xr = $xl + $this->img->plotwidth+1 ;
+ $yb = $yt + $this->img->plotheight ;
+ $grad->FilledRectangle($xl,$yt,$xr,$yb,$this->bkg_gradfrom,$this->bkg_gradto,$this->bkg_gradtype);
+ }
+ else {
+ $xl = 0;
+ $yt = 0;
+ $xr = $xl + $this->img->width - 1;
+ $yb = $yt + $this->img->height - 1 ;
+ if( $this->doshadow ) {
+ $xr -= $this->shadow_width;
+ $yb -= $this->shadow_width;
+ }
+ if( $this->doframe ) {
+ $yt += $this->frame_weight;
+ $yb -= $this->frame_weight;
+ $xl += $this->frame_weight;
+ $xr -= $this->frame_weight;
+ }
+ $aa = $this->img->SetAngle(0);
+ $grad->FilledRectangle($xl,$yt,$xr,$yb,$this->bkg_gradfrom,$this->bkg_gradto,$this->bkg_gradtype);
+ $aa = $this->img->SetAngle($aa);
+ }
}
function StrokeFrameBackground() {
- if( $this->background_image != "" && $this->background_cflag != "" ) {
- JpGraphError::RaiseL(25040);//('It is not possible to specify both a background image and a background country flag.');
- }
- if( $this->background_image != "" ) {
- $bkgimg = $this->LoadBkgImage($this->background_image_format,$this->background_image);
- }
- elseif( $this->background_cflag != "" ) {
- if( ! class_exists('FlagImages') ) {
- JpGraphError::RaiseL(25041);//('In order to use Country flags as backgrounds you must include the "jpgraph_flags.php" file.');
- }
- $fobj = new FlagImages(FLAGSIZE4);
- $dummy='';
- $bkgimg = $fobj->GetImgByName($this->background_cflag,$dummy);
- $this->background_image_mix = $this->background_cflag_mix;
- $this->background_image_type = $this->background_cflag_type;
- }
- else {
- return ;
- }
-
- $bw = ImageSX($bkgimg);
- $bh = ImageSY($bkgimg);
-
- // No matter what the angle is we always stroke the image and frame
- // assuming it is 0 degree
- $aa = $this->img->SetAngle(0);
-
- switch( $this->background_image_type ) {
- case BGIMG_FILLPLOT: // Resize to just fill the plotarea
- $this->FillMarginArea();
- $this->StrokeFrame();
- // Special case to hande 90 degree rotated graph corectly
- if( $aa == 90 ) {
- $this->img->SetAngle(90);
- $this->FillPlotArea();
- $aa = $this->img->SetAngle(0);
- $adj = ($this->img->height - $this->img->width)/2;
- $this->img->CopyMerge($bkgimg,
- $this->img->bottom_margin-$adj,$this->img->left_margin+$adj,
- 0,0,
- $this->img->plotheight+1,$this->img->plotwidth,
- $bw,$bh,$this->background_image_mix);
-
- }
- else {
- $this->FillPlotArea();
- $this->img->CopyMerge($bkgimg,
- $this->img->left_margin,$this->img->top_margin,
- 0,0,$this->img->plotwidth+1,$this->img->plotheight,
- $bw,$bh,$this->background_image_mix);
- }
- break;
- case BGIMG_FILLFRAME: // Fill the whole area from upper left corner, resize to just fit
- $hadj=0; $vadj=0;
- if( $this->doshadow ) {
- $hadj = $this->shadow_width;
- $vadj = $this->shadow_width;
- }
- $this->FillMarginArea();
- $this->FillPlotArea();
- $this->img->CopyMerge($bkgimg,0,0,0,0,$this->img->width-$hadj,$this->img->height-$vadj,
- $bw,$bh,$this->background_image_mix);
- $this->StrokeFrame();
- break;
- case BGIMG_COPY: // Just copy the image from left corner, no resizing
- $this->FillMarginArea();
- $this->FillPlotArea();
- $this->img->CopyMerge($bkgimg,0,0,0,0,$bw,$bh,
- $bw,$bh,$this->background_image_mix);
- $this->StrokeFrame();
- break;
- case BGIMG_CENTER: // Center original image in the plot area
- $this->FillMarginArea();
- $this->FillPlotArea();
- $centerx = round($this->img->plotwidth/2+$this->img->left_margin-$bw/2);
- $centery = round($this->img->plotheight/2+$this->img->top_margin-$bh/2);
- $this->img->CopyMerge($bkgimg,$centerx,$centery,0,0,$bw,$bh,
- $bw,$bh,$this->background_image_mix);
- $this->StrokeFrame();
- break;
- default:
- JpGraphError::RaiseL(25042);//(" Unknown background image layout");
- }
- $this->img->SetAngle($aa);
+ if( $this->background_image != '' && $this->background_cflag != '' ) {
+ JpGraphError::RaiseL(25040);//('It is not possible to specify both a background image and a background country flag.');
+ }
+ if( $this->background_image != '' ) {
+ $bkgimg = $this->LoadBkgImage($this->background_image_format,$this->background_image);
+ }
+ elseif( $this->background_cflag != '' ) {
+ if( ! class_exists('FlagImages',false) ) {
+ JpGraphError::RaiseL(25041);//('In order to use Country flags as backgrounds you must include the "jpgraph_flags.php" file.');
+ }
+ $fobj = new FlagImages(FLAGSIZE4);
+ $dummy='';
+ $bkgimg = $fobj->GetImgByName($this->background_cflag,$dummy);
+ $this->background_image_mix = $this->background_cflag_mix;
+ $this->background_image_type = $this->background_cflag_type;
+ }
+ else {
+ return ;
+ }
+
+ $bw = ImageSX($bkgimg);
+ $bh = ImageSY($bkgimg);
+
+ // No matter what the angle is we always stroke the image and frame
+ // assuming it is 0 degree
+ $aa = $this->img->SetAngle(0);
+
+ switch( $this->background_image_type ) {
+ case BGIMG_FILLPLOT: // Resize to just fill the plotarea
+ $this->FillMarginArea();
+ $this->StrokeFrame();
+ // Special case to hande 90 degree rotated graph corectly
+ if( $aa == 90 ) {
+ $this->img->SetAngle(90);
+ $this->FillPlotArea();
+ $aa = $this->img->SetAngle(0);
+ $adj = ($this->img->height - $this->img->width)/2;
+ $this->img->CopyMerge($bkgimg,
+ $this->img->bottom_margin-$adj,$this->img->left_margin+$adj,
+ 0,0,
+ $this->img->plotheight+1,$this->img->plotwidth,
+ $bw,$bh,$this->background_image_mix);
+ }
+ else {
+ $this->FillPlotArea();
+ $this->img->CopyMerge($bkgimg,
+ $this->img->left_margin,$this->img->top_margin+1,
+ 0,0,$this->img->plotwidth+1,$this->img->plotheight,
+ $bw,$bh,$this->background_image_mix);
+ }
+ break;
+ case BGIMG_FILLFRAME: // Fill the whole area from upper left corner, resize to just fit
+ $hadj=0; $vadj=0;
+ if( $this->doshadow ) {
+ $hadj = $this->shadow_width;
+ $vadj = $this->shadow_width;
+ }
+ $this->FillMarginArea();
+ $this->FillPlotArea();
+ $this->img->CopyMerge($bkgimg,0,0,0,0,$this->img->width-$hadj,$this->img->height-$vadj,
+ $bw,$bh,$this->background_image_mix);
+ $this->StrokeFrame();
+ break;
+ case BGIMG_COPY: // Just copy the image from left corner, no resizing
+ $this->FillMarginArea();
+ $this->FillPlotArea();
+ $this->img->CopyMerge($bkgimg,0,0,0,0,$bw,$bh,
+ $bw,$bh,$this->background_image_mix);
+ $this->StrokeFrame();
+ break;
+ case BGIMG_CENTER: // Center original image in the plot area
+ $this->FillMarginArea();
+ $this->FillPlotArea();
+ $centerx = round($this->img->plotwidth/2+$this->img->left_margin-$bw/2);
+ $centery = round($this->img->plotheight/2+$this->img->top_margin-$bh/2);
+ $this->img->CopyMerge($bkgimg,$centerx,$centery,0,0,$bw,$bh,
+ $bw,$bh,$this->background_image_mix);
+ $this->StrokeFrame();
+ break;
+ case BGIMG_FREE: // Just copy the image to the specified location
+ $this->img->CopyMerge($bkgimg,
+ $this->background_image_xpos,$this->background_image_ypos,
+ 0,0,$bw,$bh,$bw,$bh,$this->background_image_mix);
+ $this->StrokeFrame(); // New
+ break;
+ default:
+ JpGraphError::RaiseL(25042);//(" Unknown background image layout");
+ }
+ $this->img->SetAngle($aa);
}
// Private
// Draw a frame around the image
function StrokeFrame() {
- if( !$this->doframe ) return;
+ if( !$this->doframe ) return;
- if( $this->background_image_type <= 1 &&
- ($this->bkg_gradtype < 0 || ($this->bkg_gradtype > 0 && $this->bkg_gradstyle==BGRAD_PLOT)) ) {
- $c = $this->margin_color;
- }
- else {
- $c = false;
- }
-
- if( $this->doshadow ) {
- $this->img->SetColor($this->frame_color);
- $this->img->ShadowRectangle(0,0,$this->img->width,$this->img->height,
- $c,$this->shadow_width,$this->shadow_color);
- }
- elseif( $this->framebevel ) {
- if( $c ) {
- $this->img->SetColor($this->margin_color);
- $this->img->FilledRectangle(0,0,$this->img->width-1,$this->img->height-1);
- }
- $this->img->Bevel(1,1,$this->img->width-2,$this->img->height-2,
- $this->framebeveldepth,
- $this->framebevelcolor1,$this->framebevelcolor2);
- if( $this->framebevelborder ) {
- $this->img->SetColor($this->framebevelbordercolor);
- $this->img->Rectangle(0,0,$this->img->width-1,$this->img->height-1);
- }
- }
- else {
- $this->img->SetLineWeight($this->frame_weight);
- if( $c ) {
- $this->img->SetColor($this->margin_color);
- $this->img->FilledRectangle(0,0,$this->img->width-1,$this->img->height-1);
- }
- $this->img->SetColor($this->frame_color);
- $this->img->Rectangle(0,0,$this->img->width-1,$this->img->height-1);
- }
+ if( $this->background_image_type <= 1 && ($this->bkg_gradtype < 0 || ($this->bkg_gradtype > 0 && $this->bkg_gradstyle==BGRAD_PLOT)) ) {
+ $c = $this->margin_color;
+ }
+ else {
+ $c = false;
+ }
+
+ if( $this->doshadow ) {
+ $this->img->SetColor($this->frame_color);
+ $this->img->ShadowRectangle(0,0,$this->img->width,$this->img->height,
+ $c,$this->shadow_width,$this->shadow_color);
+ }
+ elseif( $this->framebevel ) {
+ if( $c ) {
+ $this->img->SetColor($this->margin_color);
+ $this->img->FilledRectangle(0,0,$this->img->width-1,$this->img->height-1);
+ }
+ $this->img->Bevel(1,1,$this->img->width-2,$this->img->height-2,
+ $this->framebeveldepth,
+ $this->framebevelcolor1,$this->framebevelcolor2);
+ if( $this->framebevelborder ) {
+ $this->img->SetColor($this->framebevelbordercolor);
+ $this->img->Rectangle(0,0,$this->img->width-1,$this->img->height-1);
+ }
+ }
+ else {
+ $this->img->SetLineWeight($this->frame_weight);
+ if( $c ) {
+ $this->img->SetColor($this->margin_color);
+ $this->img->FilledRectangle(0,0,$this->img->width-1,$this->img->height-1);
+ }
+ $this->img->SetColor($this->frame_color);
+ $this->img->Rectangle(0,0,$this->img->width-1,$this->img->height-1);
+ }
}
function FillMarginArea() {
- $hadj=0; $vadj=0;
- if( $this->doshadow ) {
- $hadj = $this->shadow_width;
- $vadj = $this->shadow_width;
- }
-
- $this->img->SetColor($this->margin_color);
-// $this->img->FilledRectangle(0,0,$this->img->width-1-$hadj,$this->img->height-1-$vadj);
-
- $this->img->FilledRectangle(0,0,$this->img->width-1-$hadj,$this->img->top_margin);
- $this->img->FilledRectangle(0,$this->img->top_margin,$this->img->left_margin,$this->img->height-1-$hadj);
- $this->img->FilledRectangle($this->img->left_margin+1,
- $this->img->height-$this->img->bottom_margin,
- $this->img->width-1-$hadj,
- $this->img->height-1-$hadj);
- $this->img->FilledRectangle($this->img->width-$this->img->right_margin,
- $this->img->top_margin+1,
- $this->img->width-1-$hadj,
- $this->img->height-$this->img->bottom_margin-1);
+ $hadj=0; $vadj=0;
+ if( $this->doshadow ) {
+ $hadj = $this->shadow_width;
+ $vadj = $this->shadow_width;
+ }
+
+ $this->img->SetColor($this->margin_color);
+ // $this->img->FilledRectangle(0,0,$this->img->width-1-$hadj,$this->img->height-1-$vadj);
+
+ $this->img->FilledRectangle(0,0,$this->img->width-1-$hadj,$this->img->top_margin);
+ $this->img->FilledRectangle(0,$this->img->top_margin,$this->img->left_margin,$this->img->height-1-$hadj);
+ $this->img->FilledRectangle($this->img->left_margin+1,
+ $this->img->height-$this->img->bottom_margin,
+ $this->img->width-1-$hadj,
+ $this->img->height-1-$hadj);
+ $this->img->FilledRectangle($this->img->width-$this->img->right_margin,
+ $this->img->top_margin+1,
+ $this->img->width-1-$hadj,
+ $this->img->height-$this->img->bottom_margin-1);
}
function FillPlotArea() {
- $this->img->PushColor($this->plotarea_color);
- $this->img->FilledRectangle($this->img->left_margin,
- $this->img->top_margin,
- $this->img->width-$this->img->right_margin,
- $this->img->height-$this->img->bottom_margin);
- $this->img->PopColor();
+ $this->img->PushColor($this->plotarea_color);
+ $this->img->FilledRectangle($this->img->left_margin,
+ $this->img->top_margin,
+ $this->img->width-$this->img->right_margin,
+ $this->img->height-$this->img->bottom_margin);
+ $this->img->PopColor();
}
-
+
// Stroke the plot area with either a solid color or a background image
function StrokePlotArea() {
- // Note: To be consistent we really should take a possible shadow
- // into account. However, that causes some problem for the LinearScale class
- // since in the current design it does not have any links to class Graph which
- // means it has no way of compensating for the adjusted plotarea in case of a
- // shadow. So, until I redesign LinearScale we can't compensate for this.
- // So just set the two adjustment parameters to zero for now.
- $boxadj = 0; //$this->doframe ? $this->frame_weight : 0 ;
- $adj = 0; //$this->doshadow ? $this->shadow_width : 0 ;
-
- if( $this->background_image != "" || $this->background_cflag != "" ) {
- $this->StrokeFrameBackground();
- }
- else {
- $aa = $this->img->SetAngle(0);
- $this->StrokeFrame();
- $aa = $this->img->SetAngle($aa);
- $this->StrokeBackgroundGrad();
- if( $this->bkg_gradtype < 0 ||
- ($this->bkg_gradtype > 0 && $this->bkg_gradstyle==BGRAD_MARGIN) ) {
- $this->FillPlotArea();
- }
- }
- }
+ // Note: To be consistent we really should take a possible shadow
+ // into account. However, that causes some problem for the LinearScale class
+ // since in the current design it does not have any links to class Graph which
+ // means it has no way of compensating for the adjusted plotarea in case of a
+ // shadow. So, until I redesign LinearScale we can't compensate for this.
+ // So just set the two adjustment parameters to zero for now.
+ $boxadj = 0; //$this->doframe ? $this->frame_weight : 0 ;
+ $adj = 0; //$this->doshadow ? $this->shadow_width : 0 ;
+
+ if( $this->background_image != '' || $this->background_cflag != '' ) {
+ $this->StrokeFrameBackground();
+ }
+ else {
+ $aa = $this->img->SetAngle(0);
+ $this->StrokeFrame();
+ $aa = $this->img->SetAngle($aa);
+ $this->StrokeBackgroundGrad();
+ if( $this->bkg_gradtype < 0 || ($this->bkg_gradtype > 0 && $this->bkg_gradstyle==BGRAD_MARGIN) ) {
+ $this->FillPlotArea();
+ }
+ $this->StrokePlotGrad();
+ }
+ }
function StrokeIcons() {
- $n = count($this->iIcons);
- for( $i=0; $i < $n; ++$i ) {
- $this->iIcons[$i]->StrokeWithScale($this->img,$this->xscale,$this->yscale);
- }
+ $n = count($this->iIcons);
+ for( $i=0; $i < $n; ++$i ) {
+ $this->iIcons[$i]->StrokeWithScale($this->img,$this->xscale,$this->yscale);
+ }
}
-
+
function StrokePlotBox() {
- // Should we draw a box around the plot area?
- if( $this->boxed ) {
- $this->img->SetLineWeight(1);
- $this->img->SetLineStyle('solid');
- $this->img->SetColor($this->box_color);
- for($i=0; $i < $this->box_weight; ++$i ) {
- $this->img->Rectangle(
- $this->img->left_margin-$i,$this->img->top_margin-$i,
- $this->img->width-$this->img->right_margin+$i,
- $this->img->height-$this->img->bottom_margin+$i);
- }
- }
- }
+ // Should we draw a box around the plot area?
+ if( $this->boxed ) {
+ $this->img->SetLineWeight(1);
+ $this->img->SetLineStyle('solid');
+ $this->img->SetColor($this->box_color);
+ for($i=0; $i < $this->box_weight; ++$i ) {
+ $this->img->Rectangle(
+ $this->img->left_margin-$i,$this->img->top_margin-$i,
+ $this->img->width-$this->img->right_margin+$i,
+ $this->img->height-$this->img->bottom_margin+$i);
+ }
+ }
+ }
function SetTitleBackgroundFillStyle($aStyle,$aColor1='black',$aColor2='white') {
- $this->titlebkg_fillstyle = $aStyle;
- $this->titlebkg_scolor1 = $aColor1;
- $this->titlebkg_scolor2 = $aColor2;
+ $this->titlebkg_fillstyle = $aStyle;
+ $this->titlebkg_scolor1 = $aColor1;
+ $this->titlebkg_scolor2 = $aColor2;
}
function SetTitleBackground($aBackColor='gray', $aStyle=TITLEBKG_STYLE1, $aFrameStyle=TITLEBKG_FRAME_NONE, $aFrameColor='black', $aFrameWeight=1, $aBevelHeight=3, $aEnable=true) {
- $this->titlebackground = $aEnable;
- $this->titlebackground_color = $aBackColor;
- $this->titlebackground_style = $aStyle;
- $this->titlebackground_framecolor = $aFrameColor;
- $this->titlebackground_framestyle = $aFrameStyle;
- $this->titlebackground_frameweight = $aFrameWeight;
- $this->titlebackground_bevelheight = $aBevelHeight ;
+ $this->titlebackground = $aEnable;
+ $this->titlebackground_color = $aBackColor;
+ $this->titlebackground_style = $aStyle;
+ $this->titlebackground_framecolor = $aFrameColor;
+ $this->titlebackground_framestyle = $aFrameStyle;
+ $this->titlebackground_frameweight = $aFrameWeight;
+ $this->titlebackground_bevelheight = $aBevelHeight ;
}
function StrokeTitles() {
- $margin=3;
+ $margin=3;
+
+ if( $this->titlebackground ) {
+ // Find out height
+ $this->title->margin += 2 ;
+ $h = $this->title->GetTextHeight($this->img)+$this->title->margin+$margin;
+ if( $this->subtitle->t != '' && !$this->subtitle->hide ) {
+ $h += $this->subtitle->GetTextHeight($this->img)+$margin+
+ $this->subtitle->margin;
+ $h += 2;
+ }
+ if( $this->subsubtitle->t != '' && !$this->subsubtitle->hide ) {
+ $h += $this->subsubtitle->GetTextHeight($this->img)+$margin+
+ $this->subsubtitle->margin;
+ $h += 2;
+ }
+ $this->img->PushColor($this->titlebackground_color);
+ if( $this->titlebackground_style === TITLEBKG_STYLE1 ) {
+ // Inside the frame
+ if( $this->framebevel ) {
+ $x1 = $y1 = $this->framebeveldepth + 1 ;
+ $x2 = $this->img->width - $this->framebeveldepth - 2 ;
+ $this->title->margin += $this->framebeveldepth + 1 ;
+ $h += $y1 ;
+ $h += 2;
+ }
+ else {
+ $x1 = $y1 = $this->frame_weight;
+ $x2 = $this->img->width - $this->frame_weight-1;
+ }
+ }
+ elseif( $this->titlebackground_style === TITLEBKG_STYLE2 ) {
+ // Cover the frame as well
+ $x1 = $y1 = 0;
+ $x2 = $this->img->width - 1 ;
+ }
+ elseif( $this->titlebackground_style === TITLEBKG_STYLE3 ) {
+ // Cover the frame as well (the difference is that
+ // for style==3 a bevel frame border is on top
+ // of the title background)
+ $x1 = $y1 = 0;
+ $x2 = $this->img->width - 1 ;
+ $h += $this->framebeveldepth ;
+ $this->title->margin += $this->framebeveldepth ;
+ }
+ else {
+ JpGraphError::RaiseL(25043);//('Unknown title background style.');
+ }
+
+ if( $this->titlebackground_framestyle === 3 ) {
+ $h += $this->titlebackground_bevelheight*2 + 1 ;
+ $this->title->margin += $this->titlebackground_bevelheight ;
+ }
+
+ if( $this->doshadow ) {
+ $x2 -= $this->shadow_width ;
+ }
+
+ $indent=0;
+ if( $this->titlebackground_framestyle == TITLEBKG_FRAME_BEVEL ) {
+ $indent = $this->titlebackground_bevelheight;
+ }
+
+ if( $this->titlebkg_fillstyle==TITLEBKG_FILLSTYLE_HSTRIPED ) {
+ $this->img->FilledRectangle2($x1+$indent,$y1+$indent,$x2-$indent,$h-$indent,
+ $this->titlebkg_scolor1,
+ $this->titlebkg_scolor2);
+ }
+ elseif( $this->titlebkg_fillstyle==TITLEBKG_FILLSTYLE_VSTRIPED ) {
+ $this->img->FilledRectangle2($x1+$indent,$y1+$indent,$x2-$indent,$h-$indent,
+ $this->titlebkg_scolor1,
+ $this->titlebkg_scolor2,2);
+ }
+ else {
+ // Solid fill
+ $this->img->FilledRectangle($x1,$y1,$x2,$h);
+ }
+ $this->img->PopColor();
+
+ $this->img->PushColor($this->titlebackground_framecolor);
+ $this->img->SetLineWeight($this->titlebackground_frameweight);
+ if( $this->titlebackground_framestyle == TITLEBKG_FRAME_FULL ) {
+ // Frame background
+ $this->img->Rectangle($x1,$y1,$x2,$h);
+ }
+ elseif( $this->titlebackground_framestyle == TITLEBKG_FRAME_BOTTOM ) {
+ // Bottom line only
+ $this->img->Line($x1,$h,$x2,$h);
+ }
+ elseif( $this->titlebackground_framestyle == TITLEBKG_FRAME_BEVEL ) {
+ $this->img->Bevel($x1,$y1,$x2,$h,$this->titlebackground_bevelheight);
+ }
+ $this->img->PopColor();
+
+ // This is clumsy. But we neeed to stroke the whole graph frame if it is
+ // set to bevel to get the bevel shading on top of the text background
+ if( $this->framebevel && $this->doframe && $this->titlebackground_style === 3 ) {
+ $this->img->Bevel(1,1,$this->img->width-2,$this->img->height-2,
+ $this->framebeveldepth,
+ $this->framebevelcolor1,$this->framebevelcolor2);
+ if( $this->framebevelborder ) {
+ $this->img->SetColor($this->framebevelbordercolor);
+ $this->img->Rectangle(0,0,$this->img->width-1,$this->img->height-1);
+ }
+ }
+ }
+
+ // Stroke title
+ $y = $this->title->margin;
+ if( $this->title->halign == 'center' ) {
+ $this->title->Center(0,$this->img->width,$y);
+ }
+ elseif( $this->title->halign == 'left' ) {
+ $this->title->SetPos($this->title->margin+2,$y);
+ }
+ elseif( $this->title->halign == 'right' ) {
+ $indent = 0;
+ if( $this->doshadow ) {
+ $indent = $this->shadow_width+2;
+ }
+ $this->title->SetPos($this->img->width-$this->title->margin-$indent,$y,'right');
+ }
+ $this->title->Stroke($this->img);
- if( $this->titlebackground ) {
+ // ... and subtitle
+ $y += $this->title->GetTextHeight($this->img) + $margin + $this->subtitle->margin;
+ if( $this->subtitle->halign == 'center' ) {
+ $this->subtitle->Center(0,$this->img->width,$y);
+ }
+ elseif( $this->subtitle->halign == 'left' ) {
+ $this->subtitle->SetPos($this->subtitle->margin+2,$y);
+ }
+ elseif( $this->subtitle->halign == 'right' ) {
+ $indent = 0;
+ if( $this->doshadow )
+ $indent = $this->shadow_width+2;
+ $this->subtitle->SetPos($this->img->width-$this->subtitle->margin-$indent,$y,'right');
+ }
+ $this->subtitle->Stroke($this->img);
- // Find out height
- $this->title->margin += 2 ;
- $h = $this->title->GetTextHeight($this->img)+$this->title->margin+$margin;
- if( $this->subtitle->t != "" && !$this->subtitle->hide ) {
- $h += $this->subtitle->GetTextHeight($this->img)+$margin+
- $this->subtitle->margin;
- $h += 2;
- }
- if( $this->subsubtitle->t != "" && !$this->subsubtitle->hide ) {
- $h += $this->subsubtitle->GetTextHeight($this->img)+$margin+
- $this->subsubtitle->margin;
- $h += 2;
- }
- $this->img->PushColor($this->titlebackground_color);
- if( $this->titlebackground_style === TITLEBKG_STYLE1 ) {
- // Inside the frame
- if( $this->framebevel ) {
- $x1 = $y1 = $this->framebeveldepth + 1 ;
- $x2 = $this->img->width - $this->framebeveldepth - 2 ;
- $this->title->margin += $this->framebeveldepth + 1 ;
- $h += $y1 ;
- $h += 2;
- }
- else {
- $x1 = $y1 = $this->frame_weight;
- $x2 = $this->img->width - 2*$x1;
- }
- }
- elseif( $this->titlebackground_style === TITLEBKG_STYLE2 ) {
- // Cover the frame as well
- $x1 = $y1 = 0;
- $x2 = $this->img->width - 1 ;
- }
- elseif( $this->titlebackground_style === TITLEBKG_STYLE3 ) {
- // Cover the frame as well (the difference is that
- // for style==3 a bevel frame border is on top
- // of the title background)
- $x1 = $y1 = 0;
- $x2 = $this->img->width - 1 ;
- $h += $this->framebeveldepth ;
- $this->title->margin += $this->framebeveldepth ;
- }
- else {
- JpGraphError::RaiseL(25043);//('Unknown title background style.');
- }
-
- if( $this->titlebackground_framestyle === 3 ) {
- $h += $this->titlebackground_bevelheight*2 + 1 ;
- $this->title->margin += $this->titlebackground_bevelheight ;
- }
-
- if( $this->doshadow ) {
- $x2 -= $this->shadow_width ;
- }
-
- $indent=0;
- if( $this->titlebackground_framestyle == TITLEBKG_FRAME_BEVEL ) {
- $ind = $this->titlebackground_bevelheight;
- }
-
- if( $this->titlebkg_fillstyle==TITLEBKG_FILLSTYLE_HSTRIPED ) {
- $this->img->FilledRectangle2($x1+$ind,$y1+$ind,$x2-$ind,$h-$ind,
- $this->titlebkg_scolor1,
- $this->titlebkg_scolor2);
- }
- elseif( $this->titlebkg_fillstyle==TITLEBKG_FILLSTYLE_VSTRIPED ) {
- $this->img->FilledRectangle2($x1+$ind,$y1+$ind,$x2-$ind,$h-$ind,
- $this->titlebkg_scolor1,
- $this->titlebkg_scolor2,2);
- }
- else {
- // Solid fill
- $this->img->FilledRectangle($x1,$y1,$x2,$h);
- }
- $this->img->PopColor();
-
- $this->img->PushColor($this->titlebackground_framecolor);
- $this->img->SetLineWeight($this->titlebackground_frameweight);
- if( $this->titlebackground_framestyle == TITLEBKG_FRAME_FULL ) {
- // Frame background
- $this->img->Rectangle($x1,$y1,$x2,$h);
- }
- elseif( $this->titlebackground_framestyle == TITLEBKG_FRAME_BOTTOM ) {
- // Bottom line only
- $this->img->Line($x1,$h,$x2,$h);
- }
- elseif( $this->titlebackground_framestyle == TITLEBKG_FRAME_BEVEL ) {
- $this->img->Bevel($x1,$y1,$x2,$h,$this->titlebackground_bevelheight);
- }
- $this->img->PopColor();
-
- // This is clumsy. But we neeed to stroke the whole graph frame if it is
- // set to bevel to get the bevel shading on top of the text background
- if( $this->framebevel && $this->doframe &&
- $this->titlebackground_style === 3 ) {
- $this->img->Bevel(1,1,$this->img->width-2,$this->img->height-2,
- $this->framebeveldepth,
- $this->framebevelcolor1,$this->framebevelcolor2);
- if( $this->framebevelborder ) {
- $this->img->SetColor($this->framebevelbordercolor);
- $this->img->Rectangle(0,0,$this->img->width-1,$this->img->height-1);
- }
- }
- }
-
- // Stroke title
- $y = $this->title->margin;
- if( $this->title->halign == 'center' )
- $this->title->Center(0,$this->img->width,$y);
- elseif( $this->title->halign == 'left' ) {
- $this->title->SetPos($this->title->margin+2,$y);
- }
- elseif( $this->title->halign == 'right' ) {
- $indent = 0;
- if( $this->doshadow )
- $indent = $this->shadow_width+2;
- $this->title->SetPos($this->img->width-$this->title->margin-$indent,$y,'right');
- }
- $this->title->Stroke($this->img);
-
- // ... and subtitle
- $y += $this->title->GetTextHeight($this->img) + $margin + $this->subtitle->margin;
- if( $this->subtitle->halign == 'center' )
- $this->subtitle->Center(0,$this->img->width,$y);
- elseif( $this->subtitle->halign == 'left' ) {
- $this->subtitle->SetPos($this->subtitle->margin+2,$y);
- }
- elseif( $this->subtitle->halign == 'right' ) {
- $indent = 0;
- if( $this->doshadow )
- $indent = $this->shadow_width+2;
- $this->subtitle->SetPos($this->img->width-$this->subtitle->margin-$indent,$y,'right');
- }
- $this->subtitle->Stroke($this->img);
-
- // ... and subsubtitle
- $y += $this->subtitle->GetTextHeight($this->img) + $margin + $this->subsubtitle->margin;
- if( $this->subsubtitle->halign == 'center' )
- $this->subsubtitle->Center(0,$this->img->width,$y);
- elseif( $this->subsubtitle->halign == 'left' ) {
- $this->subsubtitle->SetPos($this->subsubtitle->margin+2,$y);
- }
- elseif( $this->subsubtitle->halign == 'right' ) {
- $indent = 0;
- if( $this->doshadow )
- $indent = $this->shadow_width+2;
- $this->subsubtitle->SetPos($this->img->width-$this->subsubtitle->margin-$indent,$y,'right');
- }
- $this->subsubtitle->Stroke($this->img);
+ // ... and subsubtitle
+ $y += $this->subtitle->GetTextHeight($this->img) + $margin + $this->subsubtitle->margin;
+ if( $this->subsubtitle->halign == 'center' ) {
+ $this->subsubtitle->Center(0,$this->img->width,$y);
+ }
+ elseif( $this->subsubtitle->halign == 'left' ) {
+ $this->subsubtitle->SetPos($this->subsubtitle->margin+2,$y);
+ }
+ elseif( $this->subsubtitle->halign == 'right' ) {
+ $indent = 0;
+ if( $this->doshadow )
+ $indent = $this->shadow_width+2;
+ $this->subsubtitle->SetPos($this->img->width-$this->subsubtitle->margin-$indent,$y,'right');
+ }
+ $this->subsubtitle->Stroke($this->img);
- // ... and fancy title
- $this->tabtitle->Stroke($this->img);
+ // ... and fancy title
+ $this->tabtitle->Stroke($this->img);
}
function StrokeTexts() {
- // Stroke any user added text objects
- if( $this->texts != null ) {
- for($i=0; $i < count($this->texts); ++$i) {
- $this->texts[$i]->StrokeWithScale($this->img,$this->xscale,$this->yscale);
- }
- }
-
- if( $this->y2texts != null && $this->y2scale != null ) {
- for($i=0; $i < count($this->y2texts); ++$i) {
- $this->y2texts[$i]->StrokeWithScale($this->img,$this->xscale,$this->y2scale);
- }
- }
+ // Stroke any user added text objects
+ if( $this->texts != null ) {
+ for($i=0; $i < count($this->texts); ++$i) {
+ $this->texts[$i]->StrokeWithScale($this->img,$this->xscale,$this->yscale);
+ }
+ }
+
+ if( $this->y2texts != null && $this->y2scale != null ) {
+ for($i=0; $i < count($this->y2texts); ++$i) {
+ $this->y2texts[$i]->StrokeWithScale($this->img,$this->xscale,$this->y2scale);
+ }
+ }
}
function StrokeTables() {
- if( $this->iTables != null ) {
- $n = count($this->iTables);
- for( $i=0; $i < $n; ++$i ) {
- $this->iTables[$i]->StrokeWithScale($this->img,$this->xscale,$this->yscale);
- }
- }
+ if( $this->iTables != null ) {
+ $n = count($this->iTables);
+ for( $i=0; $i < $n; ++$i ) {
+ $this->iTables[$i]->StrokeWithScale($this->img,$this->xscale,$this->yscale);
+ }
+ }
}
function DisplayClientSideaImageMapAreas() {
- // Debug stuff - display the outline of the image map areas
- $csim='';
- foreach ($this->plots as $p) {
- $csim.= $p->GetCSIMareas();
- }
- $csim .= $this->legend->GetCSIMareas();
- if (preg_match_all("/area shape=\"(\w+)\" coords=\"([0-9\, ]+)\"/", $csim, $coords)) {
- $this->img->SetColor($this->csimcolor);
- $n = count($coords[0]);
- for ($i=0; $i < $n; $i++) {
- if ($coords[1][$i]=="poly") {
- preg_match_all('/\s*([0-9]+)\s*,\s*([0-9]+)\s*,*/',$coords[2][$i],$pts);
- $this->img->SetStartPoint($pts[1][count($pts[0])-1],$pts[2][count($pts[0])-1]);
- $m = count($pts[0]);
- for ($j=0; $j < $m; $j++) {
- $this->img->LineTo($pts[1][$j],$pts[2][$j]);
- }
- } else if ($coords[1][$i]=="rect") {
- $pts = preg_split('/,/', $coords[2][$i]);
- $this->img->SetStartPoint($pts[0],$pts[1]);
- $this->img->LineTo($pts[2],$pts[1]);
- $this->img->LineTo($pts[2],$pts[3]);
- $this->img->LineTo($pts[0],$pts[3]);
- $this->img->LineTo($pts[0],$pts[1]);
- }
- }
- }
+ // Debug stuff - display the outline of the image map areas
+ $csim='';
+ foreach ($this->plots as $p) {
+ $csim.= $p->GetCSIMareas();
+ }
+ $csim .= $this->legend->GetCSIMareas();
+ if (preg_match_all("/area shape=\"(\w+)\" coords=\"([0-9\, ]+)\"/", $csim, $coords)) {
+ $this->img->SetColor($this->csimcolor);
+ $n = count($coords[0]);
+ for ($i=0; $i < $n; $i++) {
+ if ( $coords[1][$i] == 'poly' ) {
+ preg_match_all('/\s*([0-9]+)\s*,\s*([0-9]+)\s*,*/',$coords[2][$i],$pts);
+ $this->img->SetStartPoint($pts[1][count($pts[0])-1],$pts[2][count($pts[0])-1]);
+ $m = count($pts[0]);
+ for ($j=0; $j < $m; $j++) {
+ $this->img->LineTo($pts[1][$j],$pts[2][$j]);
+ }
+ } elseif ( $coords[1][$i] == 'rect' ) {
+ $pts = preg_split('/,/', $coords[2][$i]);
+ $this->img->SetStartPoint($pts[0],$pts[1]);
+ $this->img->LineTo($pts[2],$pts[1]);
+ $this->img->LineTo($pts[2],$pts[3]);
+ $this->img->LineTo($pts[0],$pts[3]);
+ $this->img->LineTo($pts[0],$pts[1]);
+ }
+ }
+ }
}
- // Text scale offset in fractions of a major scale step
+ // Text scale offset in world coordinates
function SetTextScaleOff($aOff) {
- $this->text_scale_off = $aOff;
- $this->xscale->text_scale_off = $aOff;
+ $this->text_scale_off = $aOff;
+ $this->xscale->text_scale_off = $aOff;
}
// Text width of bar to be centered in absolute pixels
function SetTextScaleAbsCenterOff($aOff) {
- $this->text_scale_abscenteroff = $aOff;
+ $this->text_scale_abscenteroff = $aOff;
}
// Get Y min and max values for added lines
function GetLinesYMinMax( $aLines ) {
- $n = count($aLines);
- if( $n == 0 ) return false;
- $min = $aLines[0]->scaleposition ;
- $max = $min ;
- $flg = false;
- for( $i=0; $i < $n; ++$i ) {
- if( $aLines[$i]->direction == HORIZONTAL ) {
- $flg = true ;
- $v = $aLines[$i]->scaleposition ;
- if( $min > $v ) $min = $v ;
- if( $max < $v ) $max = $v ;
- }
- }
- return $flg ? array($min,$max) : false ;
+ $n = count($aLines);
+ if( $n == 0 ) return false;
+ $min = $aLines[0]->scaleposition ;
+ $max = $min ;
+ $flg = false;
+ for( $i=0; $i < $n; ++$i ) {
+ if( $aLines[$i]->direction == HORIZONTAL ) {
+ $flg = true ;
+ $v = $aLines[$i]->scaleposition ;
+ if( $min > $v ) $min = $v ;
+ if( $max < $v ) $max = $v ;
+ }
+ }
+ return $flg ? array($min,$max) : false ;
}
// Get X min and max values for added lines
function GetLinesXMinMax( $aLines ) {
- $n = count($aLines);
- if( $n == 0 ) return false ;
- $min = $aLines[0]->scaleposition ;
- $max = $min ;
- $flg = false;
- for( $i=0; $i < $n; ++$i ) {
- if( $aLines[$i]->direction == VERTICAL ) {
- $flg = true ;
- $v = $aLines[$i]->scaleposition ;
- if( $min > $v ) $min = $v ;
- if( $max < $v ) $max = $v ;
- }
- }
- return $flg ? array($min,$max) : false ;
+ $n = count($aLines);
+ if( $n == 0 ) return false ;
+ $min = $aLines[0]->scaleposition ;
+ $max = $min ;
+ $flg = false;
+ for( $i=0; $i < $n; ++$i ) {
+ if( $aLines[$i]->direction == VERTICAL ) {
+ $flg = true ;
+ $v = $aLines[$i]->scaleposition ;
+ if( $min > $v ) $min = $v ;
+ if( $max < $v ) $max = $v ;
+ }
+ }
+ return $flg ? array($min,$max) : false ;
}
// Get min and max values for all included plots
- function GetPlotsYMinMax(&$aPlots) {
- $n = count($aPlots);
- $i=0;
- do {
- list($xmax,$max) = $aPlots[$i]->Max();
- } while( ++$i < $n && !is_numeric($max) );
-
- $i=0;
- do {
- list($xmin,$min) = $aPlots[$i]->Min();
- } while( ++$i < $n && !is_numeric($min) );
-
- if( !is_numeric($min) || !is_numeric($max) ) {
- JpGraphError::RaiseL(25044);//('Cannot use autoscaling since it is impossible to determine a valid min/max value of the Y-axis (only null values).');
- }
-
- list($xmax,$max) = $aPlots[0]->Max();
- list($xmin,$min) = $aPlots[0]->Min();
- for($i=0; $i < count($aPlots); ++$i ) {
- list($xmax,$ymax)=$aPlots[$i]->Max();
- list($xmin,$ymin)=$aPlots[$i]->Min();
- if (is_numeric($ymax)) $max=max($max,$ymax);
- if (is_numeric($ymin)) $min=min($min,$ymin);
- }
- if( $min == '' ) $min = 0;
- if( $max == '' ) $max = 0;
- if( $min == 0 && $max == 0 ) {
- // Special case if all values are 0
- $min=0;$max=1;
- }
- return array($min,$max);
- }
+ function GetPlotsYMinMax($aPlots) {
+ $n = count($aPlots);
+ $i=0;
+ do {
+ list($xmax,$max) = $aPlots[$i]->Max();
+ } while( ++$i < $n && !is_numeric($max) );
+
+ $i=0;
+ do {
+ list($xmin,$min) = $aPlots[$i]->Min();
+ } while( ++$i < $n && !is_numeric($min) );
-} // Class
+ if( !is_numeric($min) || !is_numeric($max) ) {
+ JpGraphError::RaiseL(25044);//('Cannot use autoscaling since it is impossible to determine a valid min/max value of the Y-axis (only null values).');
+ }
+ for($i=0; $i < $n; ++$i ) {
+ list($xmax,$ymax)=$aPlots[$i]->Max();
+ list($xmin,$ymin)=$aPlots[$i]->Min();
+ if (is_numeric($ymax)) $max=max($max,$ymax);
+ if (is_numeric($ymin)) $min=min($min,$ymin);
+ }
+ if( $min == '' ) $min = 0;
+ if( $max == '' ) $max = 0;
+ if( $min == 0 && $max == 0 ) {
+ // Special case if all values are 0
+ $min=0;$max=1;
+ }
+ return array($min,$max);
+ }
+} // Class
//===================================================
// CLASS LineProperty
// Description: Holds properties for a line
//===================================================
class LineProperty {
- var $iWeight=1, $iColor="black",$iStyle="solid";
- var $iShow=true;
-
-//---------------
-// PUBLIC METHODS
- function SetColor($aColor) {
- $this->iColor = $aColor;
- }
-
- function SetWeight($aWeight) {
- $this->iWeight = $aWeight;
- }
-
- function SetStyle($aStyle) {
- $this->iStyle = $aStyle;
- }
-
- function Show($aShow=true) {
- $this->iShow=$aShow;
- }
-
- function Stroke(&$aImg,$aX1,$aY1,$aX2,$aY2) {
- if( $this->iShow ) {
- $aImg->PushColor($this->iColor);
- $oldls = $aImg->line_style;
- $oldlw = $aImg->line_weight;
- $aImg->SetLineWeight($this->iWeight);
- $aImg->SetLineStyle($this->iStyle);
- $aImg->StyleLine($aX1,$aY1,$aX2,$aY2);
- $aImg->PopColor($this->iColor);
- $aImg->line_style = $oldls;
- $aImg->line_weight = $oldlw;
+ public $iWeight=1, $iColor='black', $iStyle='solid', $iShow=true;
- }
+ function __construct($aWeight=1,$aColor='black',$aStyle='solid') {
+ $this->iWeight = $aWeight;
+ $this->iColor = $aColor;
+ $this->iStyle = $aStyle;
}
-}
-
-//===================================================
-// CLASS Text
-// Description: Arbitrary text object that can be added to the graph
-//===================================================
-class Text {
- var $t,$x=0,$y=0,$halign="left",$valign="top",$color=array(0,0,0);
- var $font_family=FF_FONT1,$font_style=FS_NORMAL,$font_size=10;
- var $hide=false, $dir=0;
- var $boxed=false; // Should the text be boxed
- var $paragraph_align="left";
- var $margin=0;
- var $icornerradius=0,$ishadowwidth=3;
- var $iScalePosY=null,$iScalePosX=null;
- var $iWordwrap=0;
- var $fcolor='white',$bcolor='black',$shadow=false;
- var $iCSIMarea='',$iCSIMalt='',$iCSIMtarget='',$iCSIMWinTarget='';
-
-//---------------
-// CONSTRUCTOR
-
- // Create new text at absolute pixel coordinates
- function Text($aTxt='',$aXAbsPos=0,$aYAbsPos=0) {
- if( ! is_string($aTxt) ) {
- JpGraphError::RaiseL(25050);//('First argument to Text::Text() must be s atring.');
- }
- $this->t = $aTxt;
- $this->x = round($aXAbsPos);
- $this->y = round($aYAbsPos);
- $this->margin = 0;
- }
-//---------------
-// PUBLIC METHODS
- // Set the string in the text object
- function Set($aTxt) {
- $this->t = $aTxt;
- }
-
- // Alias for Pos()
- function SetPos($aXAbsPos=0,$aYAbsPos=0,$aHAlign="left",$aVAlign="top") {
- $this->Pos($aXAbsPos,$aYAbsPos,$aHAlign,$aVAlign);
- }
-
- // Specify the position and alignment for the text object
- function Pos($aXAbsPos=0,$aYAbsPos=0,$aHAlign="left",$aVAlign="top") {
- $this->x = $aXAbsPos;
- $this->y = $aYAbsPos;
- $this->halign = $aHAlign;
- $this->valign = $aVAlign;
- }
-
- function SetScalePos($aX,$aY) {
- $this->iScalePosX = $aX;
- $this->iScalePosY = $aY;
- }
-
- // Specify alignment for the text
- function Align($aHAlign,$aVAlign="top",$aParagraphAlign="") {
- $this->halign = $aHAlign;
- $this->valign = $aVAlign;
- if( $aParagraphAlign != "" )
- $this->paragraph_align = $aParagraphAlign;
- }
-
- // Alias
- function SetAlign($aHAlign,$aVAlign="top",$aParagraphAlign="") {
- $this->Align($aHAlign,$aVAlign,$aParagraphAlign);
- }
-
- // Specifies the alignment for a multi line text
- function ParagraphAlign($aAlign) {
- $this->paragraph_align = $aAlign;
- }
-
- // Specifies the alignment for a multi line text
- function SetParagraphAlign($aAlign) {
- $this->paragraph_align = $aAlign;
- }
-
- function SetShadow($aShadowColor='darkgray',$aShadowWidth=3) {
- $this->ishadowwidth=$aShadowWidth;
- $this->shadow=$aShadowColor;
- $this->boxed=true;
- }
-
- function SetWordWrap($aCol) {
- $this->iWordwrap = $aCol ;
- }
-
- // Specify that the text should be boxed. fcolor=frame color, bcolor=border color,
- // $shadow=drop shadow should be added around the text.
- function SetBox($aFrameColor=array(255,255,255),$aBorderColor=array(0,0,0),$aShadowColor=false,$aCornerRadius=4,$aShadowWidth=3) {
- if( $aFrameColor==false )
- $this->boxed=false;
- else
- $this->boxed=true;
- $this->fcolor=$aFrameColor;
- $this->bcolor=$aBorderColor;
- // For backwards compatibility when shadow was just true or false
- if( $aShadowColor === true )
- $aShadowColor = 'gray';
- $this->shadow=$aShadowColor;
- $this->icornerradius=$aCornerRadius;
- $this->ishadowwidth=$aShadowWidth;
- }
-
- // Hide the text
- function Hide($aHide=true) {
- $this->hide=$aHide;
- }
-
- // This looks ugly since it's not a very orthogonal design
- // but I added this "inverse" of Hide() to harmonize
- // with some classes which I designed more recently (especially)
- // jpgraph_gantt
- function Show($aShow=true) {
- $this->hide=!$aShow;
- }
-
- // Specify font
- function SetFont($aFamily,$aStyle=FS_NORMAL,$aSize=10) {
- $this->font_family=$aFamily;
- $this->font_style=$aStyle;
- $this->font_size=$aSize;
- }
-
- // Center the text between $left and $right coordinates
- function Center($aLeft,$aRight,$aYAbsPos=false) {
- $this->x = $aLeft + ($aRight-$aLeft )/2;
- $this->halign = "center";
- if( is_numeric($aYAbsPos) )
- $this->y = $aYAbsPos;
- }
-
- // Set text color
function SetColor($aColor) {
- $this->color = $aColor;
+ $this->iColor = $aColor;
}
-
- function SetAngle($aAngle) {
- $this->SetOrientation($aAngle);
- }
-
- // Orientation of text. Note only TTF fonts can have an arbitrary angle
- function SetOrientation($aDirection=0) {
- if( is_numeric($aDirection) )
- $this->dir=$aDirection;
- elseif( $aDirection=="h" )
- $this->dir = 0;
- elseif( $aDirection=="v" )
- $this->dir = 90;
- else JpGraphError::RaiseL(25051);//(" Invalid direction specified for text.");
- }
-
- // Total width of text
- function GetWidth(&$aImg) {
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
- $w = $aImg->GetTextWidth($this->t,$this->dir);
- return $w;
- }
-
- // Hight of font
- function GetFontHeight(&$aImg) {
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
- $h = $aImg->GetFontHeight();
- return $h;
+ function SetWeight($aWeight) {
+ $this->iWeight = $aWeight;
}
- function GetTextHeight(&$aImg) {
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
- $h = $aImg->GetTextHeight($this->t,$this->dir);
- return $h;
- }
-
- function GetHeight(&$aImg) {
- // Synonym for GetTextHeight()
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
- $h = $aImg->GetTextHeight($this->t,$this->dir);
- return $h;
- }
-
- // Set the margin which will be interpretated differently depending
- // on the context.
- function SetMargin($aMarg) {
- $this->margin = $aMarg;
- }
-
- function StrokeWithScale(&$aImg,$axscale,$ayscale) {
- if( $this->iScalePosX === null ||
- $this->iScalePosY === null ) {
- $this->Stroke($aImg);
- }
- else {
- $this->Stroke($aImg,
- round($axscale->Translate($this->iScalePosX)),
- round($ayscale->Translate($this->iScalePosY)));
- }
- }
-
- function SetCSIMTarget($aURITarget,$aAlt='',$aWinTarget='') {
- $this->iCSIMtarget = $aURITarget;
- $this->iCSIMalt = $aAlt;
- $this->iCSIMWinTarget = $aWinTarget;
+ function SetStyle($aStyle) {
+ $this->iStyle = $aStyle;
}
- function GetCSIMareas() {
- if( $this->iCSIMtarget !== '' )
- return $this->iCSIMarea;
- else
- return '';
- }
-
- // Display text in image
- function Stroke(&$aImg,$x=null,$y=null) {
-
- if( !empty($x) ) $this->x = round($x);
- if( !empty($y) ) $this->y = round($y);
-
- // Insert newlines
- if( $this->iWordwrap > 0 ) {
- $this->t = wordwrap($this->t,$this->iWordwrap,"\n");
- }
-
- // If position been given as a fraction of the image size
- // calculate the absolute position
- if( $this->x < 1 && $this->x > 0 ) $this->x *= $aImg->width;
- if( $this->y < 1 && $this->y > 0 ) $this->y *= $aImg->height;
-
- $aImg->PushColor($this->color);
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
- $aImg->SetTextAlign($this->halign,$this->valign);
- if( $this->boxed ) {
- if( $this->fcolor=="nofill" )
- $this->fcolor=false;
- $aImg->SetLineWeight(1);
- $bbox = $aImg->StrokeBoxedText($this->x,$this->y,$this->t,
- $this->dir,$this->fcolor,$this->bcolor,$this->shadow,
- $this->paragraph_align,5,5,$this->icornerradius,
- $this->ishadowwidth);
- }
- else {
- $bbox = $aImg->StrokeText($this->x,$this->y,$this->t,$this->dir,$this->paragraph_align);
- }
-
- // Create CSIM targets
- $coords = $bbox[0].','.$bbox[1].','.$bbox[2].','.$bbox[3].','.$bbox[4].','.$bbox[5].','.$bbox[6].','.$bbox[7];
- $this->iCSIMarea = "iCSIMtarget)."\" ";
- if( trim($this->iCSIMalt) != '' ) {
- $this->iCSIMarea .= " alt=\"".$this->iCSIMalt."\" ";
- $this->iCSIMarea .= " title=\"".$this->iCSIMalt."\" ";
- }
- if( trim($this->iCSIMWinTarget) != '' ) {
- $this->iCSIMarea .= " target=\"".$this->iCSIMWinTarget."\" ";
- }
- $this->iCSIMarea .= " />\n";
+ function Show($aShow=true) {
+ $this->iShow=$aShow;
+ }
- $aImg->PopColor($this->color);
+ function Stroke($aImg,$aX1,$aY1,$aX2,$aY2) {
+ if( $this->iShow ) {
+ $aImg->PushColor($this->iColor);
+ $oldls = $aImg->line_style;
+ $oldlw = $aImg->line_weight;
+ $aImg->SetLineWeight($this->iWeight);
+ $aImg->SetLineStyle($this->iStyle);
+ $aImg->StyleLine($aX1,$aY1,$aX2,$aY2);
+ $aImg->PopColor($this->iColor);
+ $aImg->line_style = $oldls;
+ $aImg->line_weight = $oldlw;
+ }
}
-} // Class
+}
+//===================================================
+// CLASS GraphTabTitle
+// Description: Draw "tab" titles on top of graphs
+//===================================================
class GraphTabTitle extends Text{
- var $corner = 6 , $posx = 7, $posy = 4;
- var $color='darkred',$fillcolor='lightyellow',$bordercolor='black';
- var $align = 'left', $width=TABTITLE_WIDTHFIT;
- function GraphTabTitle() {
- $this->t = '';
- $this->font_style = FS_BOLD;
- $this->hide = true;
+ private $corner = 6 , $posx = 7, $posy = 4;
+ private $fillcolor='lightyellow',$bordercolor='black';
+ private $align = 'left', $width=TABTITLE_WIDTHFIT;
+ function __construct() {
+ $this->t = '';
+ $this->font_style = FS_BOLD;
+ $this->hide = true;
+ $this->color = 'darkred';
}
function SetColor($aTxtColor,$aFillColor='lightyellow',$aBorderColor='black') {
- $this->color = $aTxtColor;
- $this->fillcolor = $aFillColor;
- $this->bordercolor = $aBorderColor;
+ $this->color = $aTxtColor;
+ $this->fillcolor = $aFillColor;
+ $this->bordercolor = $aBorderColor;
}
function SetFillColor($aFillColor) {
- $this->fillcolor = $aFillColor;
+ $this->fillcolor = $aFillColor;
}
function SetTabAlign($aAlign) {
- // Synonym for SetPos
- $this->align = $aAlign;
+ $this->align = $aAlign;
}
- function SetPos($aAlign) {
- $this->align = $aAlign;
- }
-
function SetWidth($aWidth) {
- $this->width = $aWidth ;
+ $this->width = $aWidth ;
}
function Set($t) {
- $this->t = $t;
- $this->hide = false;
+ $this->t = $t;
+ $this->hide = false;
}
function SetCorner($aD) {
- $this->corner = $aD ;
+ $this->corner = $aD ;
}
- function Stroke(&$aImg) {
- if( $this->hide )
- return;
- $this->boxed = false;
- $w = $this->GetWidth($aImg) + 2*$this->posx;
- $h = $this->GetTextHeight($aImg) + 2*$this->posy;
-
- $x = $aImg->left_margin;
- $y = $aImg->top_margin;
-
- if( $this->width === TABTITLE_WIDTHFIT ) {
- if( $this->align == 'left' ) {
- $p = array($x, $y,
- $x, $y-$h+$this->corner,
- $x + $this->corner,$y-$h,
- $x + $w - $this->corner, $y-$h,
- $x + $w, $y-$h+$this->corner,
- $x + $w, $y);
- }
- elseif( $this->align == 'center' ) {
- $x += round($aImg->plotwidth/2) - round($w/2);
- $p = array($x, $y,
- $x, $y-$h+$this->corner,
- $x + $this->corner, $y-$h,
- $x + $w - $this->corner, $y-$h,
- $x + $w, $y-$h+$this->corner,
- $x + $w, $y);
- }
- else {
- $x += $aImg->plotwidth -$w;
- $p = array($x, $y,
- $x, $y-$h+$this->corner,
- $x + $this->corner,$y-$h,
- $x + $w - $this->corner, $y-$h,
- $x + $w, $y-$h+$this->corner,
- $x + $w, $y);
- }
- }
- else {
- if( $this->width === TABTITLE_WIDTHFULL )
- $w = $aImg->plotwidth ;
- else
- $w = $this->width ;
-
- // Make the tab fit the width of the plot area
- $p = array($x, $y,
- $x, $y-$h+$this->corner,
- $x + $this->corner,$y-$h,
- $x + $w - $this->corner, $y-$h,
- $x + $w, $y-$h+$this->corner,
- $x + $w, $y);
-
- }
- if( $this->halign == 'left' ) {
- $aImg->SetTextAlign('left','bottom');
- $x += $this->posx;
- $y -= $this->posy;
- }
- elseif( $this->halign == 'center' ) {
- $aImg->SetTextAlign('center','bottom');
- $x += $w/2;
- $y -= $this->posy;
- }
- else {
- $aImg->SetTextAlign('right','bottom');
- $x += $w - $this->posx;
- $y -= $this->posy;
- }
-
- $aImg->SetColor($this->fillcolor);
- $aImg->FilledPolygon($p);
-
- $aImg->SetColor($this->bordercolor);
- $aImg->Polygon($p,true);
-
- $aImg->SetColor($this->color);
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
- $aImg->StrokeText($x,$y,$this->t,0,'center');
+ function Stroke($aImg,$aDummy1=null,$aDummy2=null) {
+ if( $this->hide )
+ return;
+ $this->boxed = false;
+ $w = $this->GetWidth($aImg) + 2*$this->posx;
+ $h = $this->GetTextHeight($aImg) + 2*$this->posy;
+
+ $x = $aImg->left_margin;
+ $y = $aImg->top_margin;
+
+ if( $this->width === TABTITLE_WIDTHFIT ) {
+ if( $this->align == 'left' ) {
+ $p = array($x, $y,
+ $x, $y-$h+$this->corner,
+ $x + $this->corner,$y-$h,
+ $x + $w - $this->corner, $y-$h,
+ $x + $w, $y-$h+$this->corner,
+ $x + $w, $y);
+ }
+ elseif( $this->align == 'center' ) {
+ $x += round($aImg->plotwidth/2) - round($w/2);
+ $p = array($x, $y,
+ $x, $y-$h+$this->corner,
+ $x + $this->corner, $y-$h,
+ $x + $w - $this->corner, $y-$h,
+ $x + $w, $y-$h+$this->corner,
+ $x + $w, $y);
+ }
+ else {
+ $x += $aImg->plotwidth -$w;
+ $p = array($x, $y,
+ $x, $y-$h+$this->corner,
+ $x + $this->corner,$y-$h,
+ $x + $w - $this->corner, $y-$h,
+ $x + $w, $y-$h+$this->corner,
+ $x + $w, $y);
+ }
+ }
+ else {
+ if( $this->width === TABTITLE_WIDTHFULL ) {
+ $w = $aImg->plotwidth ;
+ }
+ else {
+ $w = $this->width ;
+ }
+
+ // Make the tab fit the width of the plot area
+ $p = array($x, $y,
+ $x, $y-$h+$this->corner,
+ $x + $this->corner,$y-$h,
+ $x + $w - $this->corner, $y-$h,
+ $x + $w, $y-$h+$this->corner,
+ $x + $w, $y);
+
+ }
+ if( $this->halign == 'left' ) {
+ $aImg->SetTextAlign('left','bottom');
+ $x += $this->posx;
+ $y -= $this->posy;
+ }
+ elseif( $this->halign == 'center' ) {
+ $aImg->SetTextAlign('center','bottom');
+ $x += $w/2;
+ $y -= $this->posy;
+ }
+ else {
+ $aImg->SetTextAlign('right','bottom');
+ $x += $w - $this->posx;
+ $y -= $this->posy;
+ }
+
+ $aImg->SetColor($this->fillcolor);
+ $aImg->FilledPolygon($p);
+
+ $aImg->SetColor($this->bordercolor);
+ $aImg->Polygon($p,true);
+
+ $aImg->SetColor($this->color);
+ $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $aImg->StrokeText($x,$y,$this->t,0,'center');
}
}
@@ -3179,173 +3160,177 @@
// Description: Format a superscript text
//===================================================
class SuperScriptText extends Text {
- var $iSuper="";
- var $sfont_family="",$sfont_style="",$sfont_size=8;
- var $iSuperMargin=2,$iVertOverlap=4,$iSuperScale=0.65;
- var $iSDir=0;
- var $iSimple=false;
-
- function SuperScriptText($aTxt="",$aSuper="",$aXAbsPos=0,$aYAbsPos=0) {
- parent::Text($aTxt,$aXAbsPos,$aYAbsPos);
- $this->iSuper = $aSuper;
+ private $iSuper='';
+ private $sfont_family='',$sfont_style='',$sfont_size=8;
+ private $iSuperMargin=2,$iVertOverlap=4,$iSuperScale=0.65;
+ private $iSDir=0;
+ private $iSimple=false;
+
+ function __construct($aTxt='',$aSuper='',$aXAbsPos=0,$aYAbsPos=0) {
+ parent::__construct($aTxt,$aXAbsPos,$aYAbsPos);
+ $this->iSuper = $aSuper;
}
function FromReal($aVal,$aPrecision=2) {
- // Convert a floating point number to scientific notation
- $neg=1.0;
- if( $aVal < 0 ) {
- $neg = -1.0;
- $aVal = -$aVal;
- }
-
- $l = floor(log10($aVal));
- $a = sprintf("%0.".$aPrecision."f",round($aVal / pow(10,$l),$aPrecision));
- $a *= $neg;
- if( $this->iSimple && ($a == 1 || $a==-1) ) $a = '';
-
- if( $a != '' )
- $this->t = $a.' * 10';
- else {
- if( $neg == 1 )
- $this->t = '10';
- else
- $this->t = '-10';
- }
- $this->iSuper = $l;
- }
-
- function Set($aTxt,$aSuper="") {
- $this->t = $aTxt;
- $this->iSuper = $aSuper;
+ // Convert a floating point number to scientific notation
+ $neg=1.0;
+ if( $aVal < 0 ) {
+ $neg = -1.0;
+ $aVal = -$aVal;
+ }
+
+ $l = floor(log10($aVal));
+ $a = sprintf("%0.".$aPrecision."f",round($aVal / pow(10,$l),$aPrecision));
+ $a *= $neg;
+ if( $this->iSimple && ($a == 1 || $a==-1) ) $a = '';
+
+ if( $a != '' ) {
+ $this->t = $a.' * 10';
+ }
+ else {
+ if( $neg == 1 ) {
+ $this->t = '10';
+ }
+ else {
+ $this->t = '-10';
+ }
+ }
+ $this->iSuper = $l;
+ }
+
+ function Set($aTxt,$aSuper='') {
+ $this->t = $aTxt;
+ $this->iSuper = $aSuper;
}
function SetSuperFont($aFontFam,$aFontStyle=FS_NORMAL,$aFontSize=8) {
- $this->sfont_family = $aFontFam;
- $this->sfont_style = $aFontStyle;
- $this->sfont_size = $aFontSize;
+ $this->sfont_family = $aFontFam;
+ $this->sfont_style = $aFontStyle;
+ $this->sfont_size = $aFontSize;
}
// Total width of text
- function GetWidth(&$aImg) {
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
- $w = $aImg->GetTextWidth($this->t);
- $aImg->SetFont($this->sfont_family,$this->sfont_style,$this->sfont_size);
- $w += $aImg->GetTextWidth($this->iSuper);
- $w += $this->iSuperMargin;
- return $w;
+ function GetWidth($aImg) {
+ $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $w = $aImg->GetTextWidth($this->t);
+ $aImg->SetFont($this->sfont_family,$this->sfont_style,$this->sfont_size);
+ $w += $aImg->GetTextWidth($this->iSuper);
+ $w += $this->iSuperMargin;
+ return $w;
}
-
+
// Hight of font (approximate the height of the text)
- function GetFontHeight(&$aImg) {
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
- $h = $aImg->GetFontHeight();
- $aImg->SetFont($this->sfont_family,$this->sfont_style,$this->sfont_size);
- $h += $aImg->GetFontHeight();
- return $h;
+ function GetFontHeight($aImg) {
+ $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $h = $aImg->GetFontHeight();
+ $aImg->SetFont($this->sfont_family,$this->sfont_style,$this->sfont_size);
+ $h += $aImg->GetFontHeight();
+ return $h;
}
// Hight of text
- function GetTextHeight(&$aImg) {
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
- $h = $aImg->GetTextHeight($this->t);
- $aImg->SetFont($this->sfont_family,$this->sfont_style,$this->sfont_size);
- $h += $aImg->GetTextHeight($this->iSuper);
- return $h;
+ function GetTextHeight($aImg) {
+ $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $h = $aImg->GetTextHeight($this->t);
+ $aImg->SetFont($this->sfont_family,$this->sfont_style,$this->sfont_size);
+ $h += $aImg->GetTextHeight($this->iSuper);
+ return $h;
}
- function Stroke(&$aImg,$ax=-1,$ay=-1) {
-
+ function Stroke($aImg,$ax=-1,$ay=-1) {
+
// To position the super script correctly we need different
- // cases to handle the alignmewnt specified since that will
- // determine how we can interpret the x,y coordinates
-
- $w = parent::GetWidth($aImg);
- $h = parent::GetTextHeight($aImg);
- switch( $this->valign ) {
- case 'top':
- $sy = $this->y;
- break;
- case 'center':
- $sy = $this->y - $h/2;
- break;
- case 'bottom':
- $sy = $this->y - $h;
- break;
- default:
- JpGraphError::RaiseL(25052);//('PANIC: Internal error in SuperScript::Stroke(). Unknown vertical alignment for text');
- break;
- }
-
- switch( $this->halign ) {
- case 'left':
- $sx = $this->x + $w;
- break;
- case 'center':
- $sx = $this->x + $w/2;
- break;
- case 'right':
- $sx = $this->x;
- break;
- default:
- JpGraphError::RaiseL(25053);//('PANIC: Internal error in SuperScript::Stroke(). Unknown horizontal alignment for text');
- break;
- }
-
- $sx += $this->iSuperMargin;
- $sy += $this->iVertOverlap;
-
- // Should we automatically determine the font or
- // has the user specified it explicetly?
- if( $this->sfont_family == "" ) {
- if( $this->font_family <= FF_FONT2 ) {
- if( $this->font_family == FF_FONT0 ) {
- $sff = FF_FONT0;
- }
- elseif( $this->font_family == FF_FONT1 ) {
- if( $this->font_style == FS_NORMAL )
- $sff = FF_FONT0;
- else
- $sff = FF_FONT1;
- }
- else {
- $sff = FF_FONT1;
- }
- $sfs = $this->font_style;
- $sfz = $this->font_size;
- }
- else {
- // TTF fonts
- $sff = $this->font_family;
- $sfs = $this->font_style;
- $sfz = floor($this->font_size*$this->iSuperScale);
- if( $sfz < 8 ) $sfz = 8;
- }
- $this->sfont_family = $sff;
- $this->sfont_style = $sfs;
- $this->sfont_size = $sfz;
- }
- else {
- $sff = $this->sfont_family;
- $sfs = $this->sfont_style;
- $sfz = $this->sfont_size;
- }
-
- parent::Stroke($aImg,$ax,$ay);
-
-
- // For the builtin fonts we need to reduce the margins
- // since the bounding bx reported for the builtin fonts
- // are much larger than for the TTF fonts.
- if( $sff <= FF_FONT2 ) {
- $sx -= 2;
- $sy += 3;
- }
-
- $aImg->SetTextAlign('left','bottom');
- $aImg->SetFont($sff,$sfs,$sfz);
- $aImg->PushColor($this->color);
- $aImg->StrokeText($sx,$sy,$this->iSuper,$this->iSDir,'left');
- $aImg->PopColor();
+ // cases to handle the alignmewnt specified since that will
+ // determine how we can interpret the x,y coordinates
+
+ $w = parent::GetWidth($aImg);
+ $h = parent::GetTextHeight($aImg);
+ switch( $this->valign ) {
+ case 'top':
+ $sy = $this->y;
+ break;
+ case 'center':
+ $sy = $this->y - $h/2;
+ break;
+ case 'bottom':
+ $sy = $this->y - $h;
+ break;
+ default:
+ JpGraphError::RaiseL(25052);//('PANIC: Internal error in SuperScript::Stroke(). Unknown vertical alignment for text');
+ break;
+ }
+
+ switch( $this->halign ) {
+ case 'left':
+ $sx = $this->x + $w;
+ break;
+ case 'center':
+ $sx = $this->x + $w/2;
+ break;
+ case 'right':
+ $sx = $this->x;
+ break;
+ default:
+ JpGraphError::RaiseL(25053);//('PANIC: Internal error in SuperScript::Stroke(). Unknown horizontal alignment for text');
+ break;
+ }
+
+ $sx += $this->iSuperMargin;
+ $sy += $this->iVertOverlap;
+
+ // Should we automatically determine the font or
+ // has the user specified it explicetly?
+ if( $this->sfont_family == '' ) {
+ if( $this->font_family <= FF_FONT2 ) {
+ if( $this->font_family == FF_FONT0 ) {
+ $sff = FF_FONT0;
+ }
+ elseif( $this->font_family == FF_FONT1 ) {
+ if( $this->font_style == FS_NORMAL ) {
+ $sff = FF_FONT0;
+ }
+ else {
+ $sff = FF_FONT1;
+ }
+ }
+ else {
+ $sff = FF_FONT1;
+ }
+ $sfs = $this->font_style;
+ $sfz = $this->font_size;
+ }
+ else {
+ // TTF fonts
+ $sff = $this->font_family;
+ $sfs = $this->font_style;
+ $sfz = floor($this->font_size*$this->iSuperScale);
+ if( $sfz < 8 ) $sfz = 8;
+ }
+ $this->sfont_family = $sff;
+ $this->sfont_style = $sfs;
+ $this->sfont_size = $sfz;
+ }
+ else {
+ $sff = $this->sfont_family;
+ $sfs = $this->sfont_style;
+ $sfz = $this->sfont_size;
+ }
+
+ parent::Stroke($aImg,$ax,$ay);
+
+ // For the builtin fonts we need to reduce the margins
+ // since the bounding bx reported for the builtin fonts
+ // are much larger than for the TTF fonts.
+ if( $sff <= FF_FONT2 ) {
+ $sx -= 2;
+ $sy += 3;
+ }
+
+ $aImg->SetTextAlign('left','bottom');
+ $aImg->SetFont($sff,$sfs,$sfz);
+ $aImg->PushColor($this->color);
+ $aImg->StrokeText($sx,$sy,$this->iSuper,$this->iSDir,'left');
+ $aImg->PopColor();
}
}
@@ -3355,146 +3340,142 @@
// Description: responsible for drawing grid lines in graph
//===================================================
class Grid {
- var $img;
- var $scale;
- var $grid_color='#DDDDDD',$grid_mincolor='#DDDDDD';
- var $type="solid";
- var $show=false, $showMinor=false,$weight=1;
- var $fill=false,$fillcolor=array('#EFEFEF','#BBCCFF');
-//---------------
-// CONSTRUCTOR
- function Grid(&$aAxis) {
- $this->scale = &$aAxis->scale;
- $this->img = &$aAxis->img;
+ protected $img;
+ protected $scale;
+ protected $majorcolor='#DDDDDD',$minorcolor='#EEEEEE';
+ protected $majortype='solid',$minortype='solid';
+ protected $show=false, $showMinor=false,$majorweight=1,$minorweight=1;
+ protected $fill=false,$fillcolor=array('#EFEFEF','#BBCCFF');
+
+ function __construct($aAxis) {
+ $this->scale = $aAxis->scale;
+ $this->img = $aAxis->img;
}
-//---------------
-// PUBLIC METHODS
+
function SetColor($aMajColor,$aMinColor=false) {
- $this->grid_color=$aMajColor;
- if( $aMinColor === false )
- $aMinColor = $aMajColor ;
- $this->grid_mincolor = $aMinColor;
+ $this->majorcolor=$aMajColor;
+ if( $aMinColor === false ) {
+ $aMinColor = $aMajColor ;
+ }
+ $this->minorcolor = $aMinColor;
}
-
- function SetWeight($aWeight) {
- $this->weight=$aWeight;
+
+ function SetWeight($aMajorWeight,$aMinorWeight=1) {
+ $this->majorweight=$aMajorWeight;
+ $this->minorweight=$aMinorWeight;
}
-
+
// Specify if grid should be dashed, dotted or solid
- function SetLineStyle($aType) {
- $this->type = $aType;
+ function SetLineStyle($aMajorType,$aMinorType='solid') {
+ $this->majortype = $aMajorType;
+ $this->minortype = $aMinorType;
}
-
+
+ function SetStyle($aMajorType,$aMinorType='solid') {
+ $this->SetLineStyle($aMajorType,$aMinorType);
+ }
+
// Decide if both major and minor grid should be displayed
function Show($aShowMajor=true,$aShowMinor=false) {
- $this->show=$aShowMajor;
- $this->showMinor=$aShowMinor;
+ $this->show=$aShowMajor;
+ $this->showMinor=$aShowMinor;
}
-
+
function SetFill($aFlg=true,$aColor1='lightgray',$aColor2='lightblue') {
- $this->fill = $aFlg;
- $this->fillcolor = array( $aColor1, $aColor2 );
+ $this->fill = $aFlg;
+ $this->fillcolor = array( $aColor1, $aColor2 );
}
-
+
// Display the grid
function Stroke() {
+ if( $this->showMinor && !$this->scale->textscale ) {
+ $this->DoStroke($this->scale->ticks->ticks_pos,$this->minortype,$this->minorcolor,$this->minorweight);
+ $this->DoStroke($this->scale->ticks->maj_ticks_pos,$this->majortype,$this->majorcolor,$this->majorweight);
+ }
+ else {
+ $this->DoStroke($this->scale->ticks->maj_ticks_pos,$this->majortype,$this->majorcolor,$this->majorweight);
+ }
+ }
- // We do not have minor ticks (or grids) for text scales
- if( $this->showMinor && !$this->scale->textscale ) {
- $tmp = $this->grid_color;
- $this->grid_color = $this->grid_mincolor;
- $this->DoStroke($this->scale->ticks->ticks_pos);
-
- $this->grid_color = $tmp;
- $this->DoStroke($this->scale->ticks->maj_ticks_pos);
- }
- else {
- $this->DoStroke($this->scale->ticks->maj_ticks_pos);
- }
- }
-
-//--------------
-// Private methods
+ //--------------
+ // Private methods
// Draw the grid
- function DoStroke(&$aTicksPos) {
- if( !$this->show )
- return;
- $nbrgrids = count($aTicksPos);
-
- if( $this->scale->type=="y" ) {
- $xl=$this->img->left_margin;
- $xr=$this->img->width-$this->img->right_margin;
-
- if( $this->fill ) {
- // Draw filled areas
- $y2 = $aTicksPos[0];
- $i=1;
- while( $i < $nbrgrids ) {
- $y1 = $y2;
- $y2 = $aTicksPos[$i++];
- $this->img->SetColor($this->fillcolor[$i & 1]);
- $this->img->FilledRectangle($xl,$y1,$xr,$y2);
- }
- }
-
- $this->img->SetColor($this->grid_color);
- $this->img->SetLineWeight($this->weight);
-
- // Draw grid lines
- for($i=0; $i<$nbrgrids; ++$i) {
- $y=$aTicksPos[$i];
- if( $this->type == "solid" )
- $this->img->Line($xl,$y,$xr,$y);
- elseif( $this->type == "dotted" )
- $this->img->DashedLine($xl,$y,$xr,$y,1,6);
- elseif( $this->type == "dashed" )
- $this->img->DashedLine($xl,$y,$xr,$y,2,4);
- elseif( $this->type == "longdashed" )
- $this->img->DashedLine($xl,$y,$xr,$y,8,6);
- }
- }
- elseif( $this->scale->type=="x" ) {
- $yu=$this->img->top_margin;
- $yl=$this->img->height-$this->img->bottom_margin;
- $limit=$this->img->width-$this->img->right_margin;
-
- if( $this->fill ) {
- // Draw filled areas
- $x2 = $aTicksPos[0];
- $i=1;
- while( $i < $nbrgrids ) {
- $x1 = $x2;
- $x2 = min($aTicksPos[$i++],$limit) ;
- $this->img->SetColor($this->fillcolor[$i & 1]);
- $this->img->FilledRectangle($x1,$yu,$x2,$yl);
- }
- }
-
- $this->img->SetColor($this->grid_color);
- $this->img->SetLineWeight($this->weight);
-
- // We must also test for limit since we might have
- // an offset and the number of ticks is calculated with
- // assumption offset==0 so we might end up drawing one
- // to many gridlines
- $i=0;
- $x=$aTicksPos[$i];
- while( $i
Please report Bug #01 to jpgraph@aditus.nu and include the script that gave this error. This problem could potentially be caused by trying to use \"illegal\" values in the input data arrays (like trying to send in strings or only NULL values) which causes the autoscaling to fail.");
-
- }
-
- // scale_factor = number of pixels per world unit
- $this->scale_factor=$this->world_abs_size/($this->world_size*1.0);
-
- // scale_abs = start and end points of scale in absolute pixels
- $this->scale_abs=array($this->off,$this->off+$this->world_size*$this->scale_factor);
+ $this->world_abs_size=$aLen;
+ $this->off=$aStart;
+
+ if( $this->world_size<=0 ) {
+ // This should never ever happen !!
+ JpGraphError::RaiseL(25074);
+ //("You have unfortunately stumbled upon a bug in JpGraph. It seems like the scale range is ".$this->world_size." [for ".$this->type." scale]
Please report Bug #01 to jpgraph@aditus.nu and include the script that gave this error. This problem could potentially be caused by trying to use \"illegal\" values in the input data arrays (like trying to send in strings or only NULL values) which causes the autoscaling to fail.");
+ }
+
+ // scale_factor = number of pixels per world unit
+ $this->scale_factor=$this->world_abs_size/($this->world_size*1.0);
+
+ // scale_abs = start and end points of scale in absolute pixels
+ $this->scale_abs=array($this->off,$this->off+$this->world_size*$this->scale_factor);
}
-
-
+
+
// Calculate number of ticks steps with a specific division
// $a is the divisor of 10**x to generate the first maj tick intervall
// $a=1, $b=2 give major ticks with multiple of 10, ...,0.1,1,10,...
// $a=5, $b=2 give major ticks with multiple of 2:s ...,0.2,2,20,...
// $a=2, $b=5 give major ticks with multiple of 5:s ...,0.5,5,50,...
// We return a vector of
- // [$numsteps,$adjmin,$adjmax,$minstep,$majstep]
+ // [$numsteps,$adjmin,$adjmax,$minstep,$majstep]
// If $majend==true then the first and last marks on the axis will be major
// labeled tick marks otherwise it will be adjusted to the closest min tick mark
function CalcTicks($maxsteps,$min,$max,$a,$b,$majend=true) {
- $diff=$max-$min;
- if( $diff==0 )
- $ld=0;
- else
- $ld=floor(log10($diff));
-
- // Gravitate min towards zero if we are close
- if( $min>0 && $min < pow(10,$ld) ) $min=0;
-
- //$majstep=pow(10,$ld-1)/$a;
- $majstep=pow(10,$ld)/$a;
- $minstep=$majstep/$b;
-
- $adjmax=ceil($max/$minstep)*$minstep;
- $adjmin=floor($min/$minstep)*$minstep;
- $adjdiff = $adjmax-$adjmin;
- $numsteps=$adjdiff/$majstep;
-
- while( $numsteps>$maxsteps ) {
- $majstep=pow(10,$ld)/$a;
- $numsteps=$adjdiff/$majstep;
- ++$ld;
- }
-
- $minstep=$majstep/$b;
- $adjmin=floor($min/$minstep)*$minstep;
- $adjdiff = $adjmax-$adjmin;
- if( $majend ) {
- $adjmin = floor($min/$majstep)*$majstep;
- $adjdiff = $adjmax-$adjmin;
- $adjmax = ceil($adjdiff/$majstep)*$majstep+$adjmin;
- }
- else
- $adjmax=ceil($max/$minstep)*$minstep;
-
- return array($numsteps,$adjmin,$adjmax,$minstep,$majstep);
- }
+ $diff=$max-$min;
+ if( $diff==0 ) {
+ $ld=0;
+ }
+ else {
+ $ld=floor(log10($diff));
+ }
- function CalcTicksFreeze($maxsteps,$min,$max,$a,$b) {
- // Same as CalcTicks but don't adjust min/max values
- $diff=$max-$min;
- if( $diff==0 )
- $ld=0;
- else
- $ld=floor(log10($diff));
-
- //$majstep=pow(10,$ld-1)/$a;
- $majstep=pow(10,$ld)/$a;
- $minstep=$majstep/$b;
- $numsteps=floor($diff/$majstep);
-
- while( $numsteps > $maxsteps ) {
- $majstep=pow(10,$ld)/$a;
- $numsteps=floor($diff/$majstep);
- ++$ld;
- }
- $minstep=$majstep/$b;
- return array($numsteps,$minstep,$majstep);
- }
+ // Gravitate min towards zero if we are close
+ if( $min>0 && $min < pow(10,$ld) ) $min=0;
-
- function IntCalcTicks($maxsteps,$min,$max,$a,$majend=true) {
- $diff=$max-$min;
- if( $diff==0 )
- JpGraphError::RaiseL(25075);//('Can\'t automatically determine ticks since min==max.');
- else
- $ld=floor(log10($diff));
-
- // Gravitate min towards zero if we are close
- if( $min>0 && $min < pow(10,$ld) ) $min=0;
-
- if( $ld == 0 ) $ld=1;
-
- if( $a == 1 )
- $majstep = 1;
- else
- $majstep=pow(10,$ld)/$a;
- $adjmax=ceil($max/$majstep)*$majstep;
-
- $adjmin=floor($min/$majstep)*$majstep;
- $adjdiff = $adjmax-$adjmin;
- $numsteps=$adjdiff/$majstep;
- while( $numsteps>$maxsteps ) {
- $majstep=pow(10,$ld)/$a;
- $numsteps=$adjdiff/$majstep;
- ++$ld;
- }
-
- $adjmin=floor($min/$majstep)*$majstep;
- $adjdiff = $adjmax-$adjmin;
- if( $majend ) {
- $adjmin = floor($min/$majstep)*$majstep;
- $adjdiff = $adjmax-$adjmin;
- $adjmax = ceil($adjdiff/$majstep)*$majstep+$adjmin;
- }
- else
- $adjmax=ceil($max/$majstep)*$majstep;
-
- return array($numsteps,$adjmin,$adjmax,$majstep);
- }
+ //$majstep=pow(10,$ld-1)/$a;
+ $majstep=pow(10,$ld)/$a;
+ $minstep=$majstep/$b;
+
+ $adjmax=ceil($max/$minstep)*$minstep;
+ $adjmin=floor($min/$minstep)*$minstep;
+ $adjdiff = $adjmax-$adjmin;
+ $numsteps=$adjdiff/$majstep;
+
+ while( $numsteps>$maxsteps ) {
+ $majstep=pow(10,$ld)/$a;
+ $numsteps=$adjdiff/$majstep;
+ ++$ld;
+ }
+ $minstep=$majstep/$b;
+ $adjmin=floor($min/$minstep)*$minstep;
+ $adjdiff = $adjmax-$adjmin;
+ if( $majend ) {
+ $adjmin = floor($min/$majstep)*$majstep;
+ $adjdiff = $adjmax-$adjmin;
+ $adjmax = ceil($adjdiff/$majstep)*$majstep+$adjmin;
+ }
+ else {
+ $adjmax=ceil($max/$minstep)*$minstep;
+ }
- function IntCalcTicksFreeze($maxsteps,$min,$max,$a) {
- // Same as IntCalcTick but don't change min/max values
- $diff=$max-$min;
- if( $diff==0 )
- JpGraphError::RaiseL(25075);//('Can\'t automatically determine ticks since min==max.');
- else
- $ld=floor(log10($diff));
-
- if( $ld == 0 ) $ld=1;
-
- if( $a == 1 )
- $majstep = 1;
- else
- $majstep=pow(10,$ld)/$a;
-
- $numsteps=floor($diff/$majstep);
- while( $numsteps > $maxsteps ) {
- $majstep=pow(10,$ld)/$a;
- $numsteps=floor($diff/$majstep);
- ++$ld;
- }
-
- return array($numsteps,$majstep);
+ return array($numsteps,$adjmin,$adjmax,$minstep,$majstep);
}
+ function CalcTicksFreeze($maxsteps,$min,$max,$a,$b) {
+ // Same as CalcTicks but don't adjust min/max values
+ $diff=$max-$min;
+ if( $diff==0 ) {
+ $ld=0;
+ }
+ else {
+ $ld=floor(log10($diff));
+ }
-
- // Determine the minimum of three values witha weight for last value
- function MatchMin3($a,$b,$c,$weight) {
- if( $a < $b ) {
- if( $a < ($c*$weight) )
- return 1; // $a smallest
- else
- return 3; // $c smallest
- }
- elseif( $b < ($c*$weight) )
- return 2; // $b smallest
- return 3; // $c smallest
- }
-} // Class
-//===================================================
-// CLASS ImgStreamCache
-// Description: Handle caching of graphs to files
-//===================================================
-class ImgStreamCache {
- var $cache_dir;
- var $img=null;
- var $timeout=0; // Infinite timeout
- //---------------
- // CONSTRUCTOR
- function ImgStreamCache(&$aImg, $aCacheDir=CACHE_DIR) {
- $this->img = &$aImg;
- $this->cache_dir = $aCacheDir;
- }
-
-//---------------
-// PUBLIC METHODS
-
- // Specify a timeout (in minutes) for the file. If the file is older then the
- // timeout value it will be overwritten with a newer version.
- // If timeout is set to 0 this is the same as infinite large timeout and if
- // timeout is set to -1 this is the same as infinite small timeout
- function SetTimeout($aTimeout) {
- $this->timeout=$aTimeout;
- }
-
- // Output image to browser and also write it to the cache
- function PutAndStream(&$aImage,$aCacheFileName,$aInline,$aStrokeFileName) {
- // Some debugging code to brand the image with numbe of colors
- // used
- GLOBAL $gJpgBrandTiming;
-
- if( $gJpgBrandTiming ) {
- global $tim;
- $t=$tim->Pop()/1000.0;
- $c=$aImage->SetColor("black");
- $t=sprintf(BRAND_TIME_FORMAT,round($t,3));
- imagestring($this->img->img,2,5,$this->img->height-20,$t,$c);
- }
-
- // Check if we should stroke the image to an arbitrary file
- if( _FORCE_IMGTOFILE ) {
- $aStrokeFileName = _FORCE_IMGDIR.GenImgName();
- }
-
- if( $aStrokeFileName!="" ) {
- if( $aStrokeFileName == "auto" )
- $aStrokeFileName = GenImgName();
- if( file_exists($aStrokeFileName) ) {
- // Delete the old file
- if( !@unlink($aStrokeFileName) )
- JpGraphError::RaiseL(25111,$aStrokeFileName);//(" Can't delete cached image $aStrokeFileName. Permission problem?");
- }
- $aImage->Stream($aStrokeFileName);
- return;
- }
-
- if( $aCacheFileName != "" && USE_CACHE) {
-
- $aCacheFileName = $this->cache_dir . $aCacheFileName;
- if( file_exists($aCacheFileName) ) {
- if( !$aInline ) {
- // If we are generating image off-line (just writing to the cache)
- // and the file exists and is still valid (no timeout)
- // then do nothing, just return.
- $diff=time()-filemtime($aCacheFileName);
- if( $diff < 0 )
- JpGraphError::RaiseL(25112,$aCacheFileName);//(" Cached imagefile ($aCacheFileName) has file date in the future!!");
- if( $this->timeout>0 && ($diff <= $this->timeout*60) )
- return;
- }
- if( !@unlink($aCacheFileName) )
- JpGraphError::RaiseL(25113,$aStrokeFileName);//(" Can't delete cached image $aStrokeFileName. Permission problem?");
- $aImage->Stream($aCacheFileName);
- }
- else {
- $this->MakeDirs(dirname($aCacheFileName));
- if( !is_writeable(dirname($aCacheFileName)) ) {
- JpGraphError::RaiseL(25114,$aCacheFileName);//('PHP has not enough permissions to write to the cache file '.$aCacheFileName.'. Please make sure that the user running PHP has write permission for this file if you wan to use the cache system with JpGraph.');
- }
- $aImage->Stream($aCacheFileName);
- }
-
- $res=true;
- // Set group to specified
- if( CACHE_FILE_GROUP != "" )
- $res = @chgrp($aCacheFileName,CACHE_FILE_GROUP);
- if( CACHE_FILE_MOD != "" )
- $res = @chmod($aCacheFileName,CACHE_FILE_MOD);
- if( !$res )
- JpGraphError::RaiseL(25115,$aStrokeFileName);//(" Can't set permission for cached image $aStrokeFileName. Permission problem?");
-
- $aImage->Destroy();
- if( $aInline ) {
- if ($fh = @fopen($aCacheFileName, "rb") ) {
- $this->img->Headers();
- fpassthru($fh);
- return;
- }
- else
- JpGraphError::RaiseL(25116,$aFile);//(" Cant open file from cache [$aFile]");
- }
- }
- elseif( $aInline ) {
- $this->img->Headers();
- $aImage->Stream();
- return;
- }
- }
-
- // Check if a given image is in cache and in that case
- // pass it directly on to web browser. Return false if the
- // image file doesn't exist or exists but is to old
- function GetAndStream($aCacheFileName) {
- $aCacheFileName = $this->cache_dir.$aCacheFileName;
- if ( USE_CACHE && file_exists($aCacheFileName) && $this->timeout>=0 ) {
- $diff=time()-filemtime($aCacheFileName);
- if( $this->timeout>0 && ($diff > $this->timeout*60) ) {
- return false;
- }
- else {
- if ($fh = @fopen($aCacheFileName, "rb")) {
- $this->img->Headers();
- fpassthru($fh);
- return true;
- }
- else
- JpGraphError::RaiseL(25117,$aCacheFileName);//(" Can't open cached image \"$aCacheFileName\" for reading.");
- }
- }
- return false;
- }
-
- //---------------
- // PRIVATE METHODS
- // Create all necessary directories in a path
- function MakeDirs($aFile) {
- $dirs = array();
- while ( !(file_exists($aFile)) ) {
- $dirs[] = $aFile;
- $aFile = dirname($aFile);
- }
- for ($i = sizeof($dirs)-1; $i>=0; $i--) {
- if(! @mkdir($dirs[$i],0777) )
- JpGraphError::RaiseL(25118,$aFile);//(" Can't create directory $aFile. Make sure PHP has write permission to this directory.");
- // We also specify mode here after we have changed group.
- // This is necessary if Apache user doesn't belong the
- // default group and hence can't specify group permission
- // in the previous mkdir() call
- if( CACHE_FILE_GROUP != "" ) {
- $res=true;
- $res =@chgrp($dirs[$i],CACHE_FILE_GROUP);
- $res &= @chmod($dirs[$i],0777);
- if( !$res )
- JpGraphError::RaiseL(25119,$aFile);//(" Can't set permissions for $aFile. Permission problems?");
- }
- }
- return true;
- }
-} // CLASS Cache
-
-//===================================================
-// CLASS Legend
-// Description: Responsible for drawing the box containing
-// all the legend text for the graph
-//===================================================
-DEFINE('_DEFAULT_LPM_SIZE',8);
-class Legend {
- var $color=array(0,0,0); // Default fram color
- var $fill_color=array(235,235,235); // Default fill color
- var $shadow=true; // Shadow around legend "box"
- var $shadow_color='gray';
- var $txtcol=array();
- var $mark_abs_hsize=_DEFAULT_LPM_SIZE, $mark_abs_vsize=_DEFAULT_LPM_SIZE;
- var $xmargin=10,$ymargin=3,$shadow_width=2;
- var $xlmargin=2, $ylmargin='';
- var $xpos=0.05, $ypos=0.15, $xabspos=-1, $yabspos=-1;
- var $halign="right", $valign="top";
- var $font_family=FF_FONT1,$font_style=FS_NORMAL,$font_size=10;
- var $font_color='black';
- var $hide=false,$layout_n=1;
- var $weight=1,$frameweight=1;
- var $csimareas='';
- var $reverse = false ;
-//---------------
-// CONSTRUCTOR
- function Legend() {
- // Empty
- }
-//---------------
-// PUBLIC METHODS
- function Hide($aHide=true) {
- $this->hide=$aHide;
- }
-
- function SetHColMargin($aXMarg) {
- $this->xmargin = $aXMarg;
+ //$majstep=pow(10,$ld-1)/$a;
+ $majstep=pow(10,$ld)/$a;
+ $minstep=$majstep/$b;
+ $numsteps=floor($diff/$majstep);
+
+ while( $numsteps > $maxsteps ) {
+ $majstep=pow(10,$ld)/$a;
+ $numsteps=floor($diff/$majstep);
+ ++$ld;
+ }
+ $minstep=$majstep/$b;
+ return array($numsteps,$minstep,$majstep);
}
- function SetVColMargin($aSpacing) {
- $this->ymargin = $aSpacing ;
- }
- function SetLeftMargin($aXMarg) {
- $this->xlmargin = $aXMarg;
- }
+ function IntCalcTicks($maxsteps,$min,$max,$a,$majend=true) {
+ $diff=$max-$min;
+ if( $diff==0 ) {
+ JpGraphError::RaiseL(25075);//('Can\'t automatically determine ticks since min==max.');
+ }
+ else {
+ $ld=floor(log10($diff));
+ }
- // Synonym
- function SetLineSpacing($aSpacing) {
- $this->ymargin = $aSpacing ;
- }
+ // Gravitate min towards zero if we are close
+ if( $min>0 && $min < pow(10,$ld) ) {
+ $min=0;
+ }
+ if( $ld == 0 ) {
+ $ld=1;
+ }
+ if( $a == 1 ) {
+ $majstep = 1;
+ }
+ else {
+ $majstep=pow(10,$ld)/$a;
+ }
+ $adjmax=ceil($max/$majstep)*$majstep;
- function SetShadow($aShow='gray',$aWidth=2) {
- if( is_string($aShow) ) {
- $this->shadow_color = $aShow;
- $this->shadow=true;
- }
- else
- $this->shadow=$aShow;
- $this->shadow_width=$aWidth;
- }
+ $adjmin=floor($min/$majstep)*$majstep;
+ $adjdiff = $adjmax-$adjmin;
+ $numsteps=$adjdiff/$majstep;
+ while( $numsteps>$maxsteps ) {
+ $majstep=pow(10,$ld)/$a;
+ $numsteps=$adjdiff/$majstep;
+ ++$ld;
+ }
- function SetMarkAbsSize($aSize) {
- $this->mark_abs_vsize = $aSize ;
- $this->mark_abs_hsize = $aSize ;
- }
+ $adjmin=floor($min/$majstep)*$majstep;
+ $adjdiff = $adjmax-$adjmin;
+ if( $majend ) {
+ $adjmin = floor($min/$majstep)*$majstep;
+ $adjdiff = $adjmax-$adjmin;
+ $adjmax = ceil($adjdiff/$majstep)*$majstep+$adjmin;
+ }
+ else {
+ $adjmax=ceil($max/$majstep)*$majstep;
+ }
- function SetMarkAbsVSize($aSize) {
- $this->mark_abs_vsize = $aSize ;
+ return array($numsteps,$adjmin,$adjmax,$majstep);
}
- function SetMarkAbsHSize($aSize) {
- $this->mark_abs_hsize = $aSize ;
- }
- function SetLineWeight($aWeight) {
- $this->weight = $aWeight;
- }
+ function IntCalcTicksFreeze($maxsteps,$min,$max,$a) {
+ // Same as IntCalcTick but don't change min/max values
+ $diff=$max-$min;
+ if( $diff==0 ) {
+ JpGraphError::RaiseL(25075);//('Can\'t automatically determine ticks since min==max.');
+ }
+ else {
+ $ld=floor(log10($diff));
+ }
+ if( $ld == 0 ) {
+ $ld=1;
+ }
+ if( $a == 1 ) {
+ $majstep = 1;
+ }
+ else {
+ $majstep=pow(10,$ld)/$a;
+ }
- function SetFrameWeight($aWeight) {
- $this->frameweight = $aWeight;
- }
-
- function SetLayout($aDirection=LEGEND_VERT) {
- $this->layout_n = $aDirection==LEGEND_VERT ? 1 : 99 ;
- }
-
- function SetColumns($aCols) {
- $this->layout_n = $aCols ;
- }
+ $numsteps=floor($diff/$majstep);
+ while( $numsteps > $maxsteps ) {
+ $majstep=pow(10,$ld)/$a;
+ $numsteps=floor($diff/$majstep);
+ ++$ld;
+ }
- function SetReverse($f=true) {
- $this->reverse = $f ;
+ return array($numsteps,$majstep);
}
- // Set color on frame around box
- function SetColor($aFontColor,$aColor='black') {
- $this->font_color=$aFontColor;
- $this->color=$aColor;
- }
-
- function SetFont($aFamily,$aStyle=FS_NORMAL,$aSize=10) {
- $this->font_family = $aFamily;
- $this->font_style = $aStyle;
- $this->font_size = $aSize;
- }
-
- function SetPos($aX,$aY,$aHAlign="right",$aVAlign="top") {
- $this->Pos($aX,$aY,$aHAlign,$aVAlign);
- }
-
- function SetAbsPos($aX,$aY,$aHAlign="right",$aVAlign="top") {
- $this->xabspos=$aX;
- $this->yabspos=$aY;
- $this->halign=$aHAlign;
- $this->valign=$aVAlign;
- }
-
-
- function Pos($aX,$aY,$aHAlign="right",$aVAlign="top") {
- if( !($aX<1 && $aY<1) )
- JpGraphError::RaiseL(25120);//(" Position for legend must be given as percentage in range 0-1");
- $this->xpos=$aX;
- $this->ypos=$aY;
- $this->halign=$aHAlign;
- $this->valign=$aVAlign;
- }
-
- function SetFillColor($aColor) {
- $this->fill_color=$aColor;
- }
-
- function Add($aTxt,$aColor,$aPlotmark="",$aLinestyle=0,$csimtarget='',$csimalt='',$csimwintarget='') {
- $this->txtcol[]=array($aTxt,$aColor,$aPlotmark,$aLinestyle,$csimtarget,$csimalt,$csimwintarget);
- }
-
- function GetCSIMAreas() {
- return $this->csimareas;
- }
-
- function Stroke(&$aImg) {
- // Constant
- $fillBoxFrameWeight=1;
-
- if( $this->hide ) return;
-
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
-
- if( $this->reverse ) {
- $this->txtcol = array_reverse($this->txtcol);
- }
-
- $n=count($this->txtcol);
- if( $n == 0 ) return;
-
- // Find out the max width and height of each column to be able
- // to size the legend box.
- $numcolumns = ($n > $this->layout_n ? $this->layout_n : $n);
- for( $i=0; $i < $numcolumns; ++$i ) {
- $colwidth[$i] = $aImg->GetTextWidth($this->txtcol[$i][0]) +
- 2*$this->xmargin + 2*$this->mark_abs_hsize;
- $colheight[$i] = 0;
- }
-
- // Find our maximum height in each row
- $rows = 0 ; $rowheight[0] = 0;
- for( $i=0; $i < $n; ++$i ) {
- $h = max($this->mark_abs_vsize,$aImg->GetTextHeight($this->txtcol[$i][0]))+$this->ymargin;
- if( $i % $numcolumns == 0 ) {
- $rows++;
- $rowheight[$rows-1] = 0;
- }
- $rowheight[$rows-1] = max($rowheight[$rows-1],$h);
- }
-
- $abs_height = 0;
- for( $i=0; $i < $rows; ++$i ) {
- $abs_height += $rowheight[$i] ;
- }
-
- // Make sure that the height is at least as high as mark size + ymargin
- $abs_height = max($abs_height,$this->mark_abs_vsize);
-
- // We add 3 extra pixels height to compensate for the difficult in
- // calculating font height
- $abs_height += $this->ymargin+3;
-
- // Find out the maximum width in each column
- for( $i=$numcolumns; $i < $n; ++$i ) {
- $colwidth[$i % $numcolumns] = max(
- $aImg->GetTextWidth($this->txtcol[$i][0])+2*$this->xmargin+2*$this->mark_abs_hsize,$colwidth[$i % $numcolumns]);
- }
-
- // Get the total width
- $mtw = 0;
- for( $i=0; $i < $numcolumns; ++$i ) {
- $mtw += $colwidth[$i] ;
- }
-
- // Find out maximum width we need for legend box
- $abs_width = $mtw+$this->xlmargin;
-
- if( $this->xabspos === -1 && $this->yabspos === -1 ) {
- $this->xabspos = $this->xpos*$aImg->width ;
- $this->yabspos = $this->ypos*$aImg->height ;
- }
-
- // Positioning of the legend box
- if( $this->halign=="left" )
- $xp = $this->xabspos;
- elseif( $this->halign=="center" )
- $xp = $this->xabspos - $abs_width/2;
- else
- $xp = $aImg->width - $this->xabspos - $abs_width;
-
- $yp=$this->yabspos;
- if( $this->valign=="center" )
- $yp-=$abs_height/2;
- elseif( $this->valign=="bottom" )
- $yp-=$abs_height;
-
- // Stroke legend box
- $aImg->SetColor($this->color);
- $aImg->SetLineWeight($this->frameweight);
- $aImg->SetLineStyle('solid');
-
- if( $this->shadow )
- $aImg->ShadowRectangle($xp,$yp,$xp+$abs_width+$this->shadow_width,
- $yp+$abs_height+$this->shadow_width,
- $this->fill_color,$this->shadow_width,$this->shadow_color);
- else {
- $aImg->SetColor($this->fill_color);
- $aImg->FilledRectangle($xp,$yp,$xp+$abs_width,$yp+$abs_height);
- $aImg->SetColor($this->color);
- $aImg->Rectangle($xp,$yp,$xp+$abs_width,$yp+$abs_height);
- }
-
- // x1,y1 is the position for the legend mark
- $x1=$xp+$this->mark_abs_hsize+$this->xlmargin;
- $y1=$yp + $this->ymargin;
-
- $f2 = round($aImg->GetTextHeight('X')/2);
-
- $grad = new Gradient($aImg);
- $patternFactory = null;
-
- // Now stroke each legend in turn
- // Each plot has added the following information to the legend
- // p[0] = Legend text
- // p[1] = Color,
- // p[2] = For markers a reference to the PlotMark object
- // p[3] = For lines the line style, for gradient the negative gradient style
- // p[4] = CSIM target
- // p[5] = CSIM Alt text
- $i = 1 ; $row = 0;
- foreach($this->txtcol as $p) {
-
- // STROKE DEBUG BOX
- if( _JPG_DEBUG ) {
- $aImg->SetLineWeight(1);
- $aImg->SetColor('red');
- $aImg->SetLineStyle('solid');
- $aImg->Rectangle($xp,$y1,$xp+$abs_width,$y1+$rowheight[$row]);
- }
-
- $aImg->SetLineWeight($this->weight);
- $x1 = round($x1); $y1=round($y1);
- if ( $p[2] && $p[2]->GetType() > -1 ) {
- // Make a plot mark legend
- $aImg->SetColor($p[1]);
- if( is_string($p[3]) || $p[3]>0 ) {
- $aImg->SetLineStyle($p[3]);
- $aImg->StyleLine($x1-$this->mark_abs_hsize,$y1+$f2,$x1+$this->mark_abs_hsize,$y1+$f2);
- }
- // Stroke a mark with the standard size
- // (As long as it is not an image mark )
- if( $p[2]->GetType() != MARK_IMG ) {
-
- // Clear any user callbacks since we ont want them called for
- // the legend marks
- $p[2]->iFormatCallback = '';
- $p[2]->iFormatCallback2 = '';
-
- // Since size for circles is specified as the radius
- // this means that we must half the size to make the total
- // width behave as the other marks
- if( $p[2]->GetType() == MARK_FILLEDCIRCLE || $p[2]->GetType() == MARK_CIRCLE ) {
- $p[2]->SetSize(min($this->mark_abs_vsize,$this->mark_abs_hsize)/2);
- $p[2]->Stroke($aImg,$x1,$y1+$f2);
- }
- else {
- $p[2]->SetSize(min($this->mark_abs_vsize,$this->mark_abs_hsize));
- $p[2]->Stroke($aImg,$x1,$y1+$f2);
- }
- }
- }
- elseif ( $p[2] && (is_string($p[3]) || $p[3]>0 ) ) {
- // Draw a styled line
- $aImg->SetColor($p[1]);
- $aImg->SetLineStyle($p[3]);
- $aImg->StyleLine($x1-1,$y1+$f2,$x1+$this->mark_abs_hsize,$y1+$f2);
- $aImg->StyleLine($x1-1,$y1+$f2+1,$x1+$this->mark_abs_hsize,$y1+$f2+1);
- }
- else {
- // Draw a colored box
- $color = $p[1] ;
- // We make boxes slightly larger to better show
- $boxsize = min($this->mark_abs_vsize,$this->mark_abs_hsize) + 2 ;
- $ym = round($y1 + $f2 - $boxsize/2);
- // We either need to plot a gradient or a
- // pattern. To differentiate we use a kludge.
- // Patterns have a p[3] value of < -100
- if( $p[3] < -100 ) {
- // p[1][0] == iPattern, p[1][1] == iPatternColor, p[1][2] == iPatternDensity
- if( $patternFactory == null ) {
- $patternFactory = new RectPatternFactory();
- }
- $prect = $patternFactory->Create($p[1][0],$p[1][1],1);
- $prect->SetBackground($p[1][3]);
- $prect->SetDensity($p[1][2]+1);
- $prect->SetPos(new Rectangle($x1,$ym,$boxsize,$boxsize));
- $prect->Stroke($aImg);
- $prect=null;
- }
- else {
- if( is_array($color) && count($color)==2 ) {
- // The client want a gradient color
- $grad->FilledRectangle($x1,$ym,
- $x1+$boxsize,$ym+$boxsize,
- $color[0],$color[1],-$p[3]);
- }
- else {
- $aImg->SetColor($p[1]);
- $aImg->FilledRectangle($x1,$ym,$x1+$boxsize,$ym+$boxsize);
- }
- $aImg->SetColor($this->color);
- $aImg->SetLineWeight($fillBoxFrameWeight);
- $aImg->Rectangle($x1,$ym,$x1+$boxsize,$ym+$boxsize);
- }
- }
- $aImg->SetColor($this->font_color);
- $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
- $aImg->SetTextAlign("left","top");
- $aImg->StrokeText(round($x1+$this->mark_abs_hsize+$this->xmargin),$y1,$p[0]);
-
- // Add CSIM for Legend if defined
- if( $p[4] != "" ) {
- $xe = $x1 + $this->xmargin+$this->mark_abs_hsize+$aImg->GetTextWidth($p[0]);
- $ye = $y1 + max($this->mark_abs_vsize,$aImg->GetTextHeight($p[0]));
- $coords = "$x1,$y1,$xe,$y1,$xe,$ye,$x1,$ye";
- if( ! empty($p[4]) ) {
- $this->csimareas .= "csimareas .= " target=\"".$p[6]."\"";
- }
-
- if( !empty($p[5]) ) {
- $tmp=sprintf($p[5],$p[0]);
- $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
- }
- $this->csimareas .= " />\n";
- }
- }
- if( $i >= $this->layout_n ) {
- $x1 = $xp+$this->mark_abs_hsize+$this->xlmargin;
- $y1 += $rowheight[$row++];
- $i = 1;
- }
- else {
- $x1 += $colwidth[($i-1) % $numcolumns] ;
- ++$i;
- }
- }
+ // Determine the minimum of three values witha weight for last value
+ function MatchMin3($a,$b,$c,$weight) {
+ if( $a < $b ) {
+ if( $a < ($c*$weight) ) {
+ return 1; // $a smallest
+ }
+ else {
+ return 3; // $c smallest
+ }
+ }
+ elseif( $b < ($c*$weight) ) {
+ return 2; // $b smallest
+ }
+ return 3; // $c smallest
}
} // Class
-
+
//===================================================
// CLASS DisplayValue
// Description: Used to print data values at data points
//===================================================
class DisplayValue {
- var $show=false,$format="%.1f",$negformat="";
- var $iFormCallback='';
- var $angle=0;
- var $ff=FF_FONT1,$fs=FS_NORMAL,$fsize=10;
- var $color="navy",$negcolor="";
- var $margin=5,$valign="",$halign="center";
- var $iHideZero=false;
+ public $margin=5;
+ public $show=false;
+ public $valign='',$halign='center';
+ public $format='%.1f',$negformat='';
+ private $ff=FF_FONT1,$fs=FS_NORMAL,$fsize=10;
+ private $iFormCallback='';
+ private $angle=0;
+ private $color='navy',$negcolor='';
+ private $iHideZero=false;
+ public $txt=null;
+
+ function __construct() {
+ $this->txt = new Text();
+ }
function Show($aFlag=true) {
- $this->show=$aFlag;
+ $this->show=$aFlag;
}
- function SetColor($aColor,$aNegcolor="") {
- $this->color = $aColor;
- $this->negcolor = $aNegcolor;
+ function SetColor($aColor,$aNegcolor='') {
+ $this->color = $aColor;
+ $this->negcolor = $aNegcolor;
}
function SetFont($aFontFamily,$aFontStyle=FS_NORMAL,$aFontSize=10) {
- $this->ff=$aFontFamily;
- $this->fs=$aFontStyle;
- $this->fsize=$aFontSize;
+ $this->ff=$aFontFamily;
+ $this->fs=$aFontStyle;
+ $this->fsize=$aFontSize;
+ }
+
+ function ApplyFont($aImg) {
+ $aImg->SetFont($this->ff,$this->fs,$this->fsize);
}
function SetMargin($aMargin) {
- $this->margin = $aMargin;
+ $this->margin = $aMargin;
}
function SetAngle($aAngle) {
- $this->angle = $aAngle;
+ $this->angle = $aAngle;
}
function SetAlign($aHAlign,$aVAlign='') {
- $this->halign = $aHAlign;
- $this->valign = $aVAlign;
+ $this->halign = $aHAlign;
+ $this->valign = $aVAlign;
}
- function SetFormat($aFormat,$aNegFormat="") {
- $this->format= $aFormat;
- $this->negformat= $aNegFormat;
+ function SetFormat($aFormat,$aNegFormat='') {
+ $this->format= $aFormat;
+ $this->negformat= $aNegFormat;
}
function SetFormatCallback($aFunc) {
- $this->iFormCallback = $aFunc;
+ $this->iFormCallback = $aFunc;
}
function HideZero($aFlag=true) {
- $this->iHideZero=$aFlag;
+ $this->iHideZero=$aFlag;
}
- function Stroke(&$img,$aVal,$x,$y) {
-
- if( $this->show )
- {
- if( $this->negformat=="" ) $this->negformat=$this->format;
- if( $this->negcolor=="" ) $this->negcolor=$this->color;
-
- if( $aVal===NULL || (is_string($aVal) && ($aVal=="" || $aVal=="-" || $aVal=="x" ) ) )
- return;
-
- if( is_numeric($aVal) && $aVal==0 && $this->iHideZero ) {
- return;
- }
-
- // Since the value is used in different cirumstances we need to check what
- // kind of formatting we shall use. For example, to display values in a line
- // graph we simply display the formatted value, but in the case where the user
- // has already specified a text string we don't fo anything.
- if( $this->iFormCallback != '' ) {
- $f = $this->iFormCallback;
- $sval = call_user_func($f,$aVal);
- }
- elseif( is_numeric($aVal) ) {
- if( $aVal >= 0 )
- $sval=sprintf($this->format,$aVal);
- else
- $sval=sprintf($this->negformat,$aVal);
- }
- else
- $sval=$aVal;
-
- $y = $y-sign($aVal)*$this->margin;
-
- $txt = new Text($sval,$x,$y);
- $txt->SetFont($this->ff,$this->fs,$this->fsize);
- if( $this->valign == "" ) {
- if( $aVal >= 0 )
- $valign = "bottom";
- else
- $valign = "top";
- }
- else
- $valign = $this->valign;
- $txt->Align($this->halign,$valign);
-
- $txt->SetOrientation($this->angle);
- if( $aVal > 0 )
- $txt->SetColor($this->color);
- else
- $txt->SetColor($this->negcolor);
- $txt->Stroke($img);
- }
+ function Stroke($img,$aVal,$x,$y) {
+
+ if( $this->show )
+ {
+ if( $this->negformat=='' ) {
+ $this->negformat=$this->format;
+ }
+ if( $this->negcolor=='' ) {
+ $this->negcolor=$this->color;
+ }
+
+ if( $aVal===NULL || (is_string($aVal) && ($aVal=='' || $aVal=='-' || $aVal=='x' ) ) ) {
+ return;
+ }
+
+ if( is_numeric($aVal) && $aVal==0 && $this->iHideZero ) {
+ return;
+ }
+
+ // Since the value is used in different cirumstances we need to check what
+ // kind of formatting we shall use. For example, to display values in a line
+ // graph we simply display the formatted value, but in the case where the user
+ // has already specified a text string we don't fo anything.
+ if( $this->iFormCallback != '' ) {
+ $f = $this->iFormCallback;
+ $sval = call_user_func($f,$aVal);
+ }
+ elseif( is_numeric($aVal) ) {
+ if( $aVal >= 0 ) {
+ $sval=sprintf($this->format,$aVal);
+ }
+ else {
+ $sval=sprintf($this->negformat,$aVal);
+ }
+ }
+ else {
+ $sval=$aVal;
+ }
+
+ $y = $y-sign($aVal)*$this->margin;
+
+ $this->txt->Set($sval);
+ $this->txt->SetPos($x,$y);
+ $this->txt->SetFont($this->ff,$this->fs,$this->fsize);
+ if( $this->valign == '' ) {
+ if( $aVal >= 0 ) {
+ $valign = "bottom";
+ }
+ else {
+ $valign = "top";
+ }
+ }
+ else {
+ $valign = $this->valign;
+ }
+ $this->txt->Align($this->halign,$valign);
+
+ $this->txt->SetOrientation($this->angle);
+ if( $aVal > 0 ) {
+ $this->txt->SetColor($this->color);
+ }
+ else {
+ $this->txt->SetColor($this->negcolor);
+ }
+ $this->txt->Stroke($img);
+ }
}
}
@@ -5654,296 +5160,241 @@
// Description: Abstract base class for all concrete plot classes
//===================================================
class Plot {
- var $line_weight=1;
- var $coords=array();
- var $legend='',$hidelegend=false;
- var $csimtargets=array(); // Array of targets for CSIM
- var $csimwintargets=array(); // Array of window targets for CSIM
- var $csimareas=""; // Resultant CSIM area tags
- var $csimalts=null; // ALT:s for corresponding target
- var $color="black";
- var $numpoints=0;
- var $weight=1;
- var $value;
- var $center=false;
- var $legendcsimtarget='',$legendcsimwintarget='';
- var $legendcsimalt='';
-//---------------
-// CONSTRUCTOR
- function Plot(&$aDatay,$aDatax=false) {
- $this->numpoints = count($aDatay);
- if( $this->numpoints==0 )
- JpGraphError::RaiseL(25121);//("Empty input data array specified for plot. Must have at least one data point.");
- $this->coords[0]=$aDatay;
- if( is_array($aDatax) ) {
- $this->coords[1]=$aDatax;
- $n = count($aDatax);
- for($i=0; $i < $n; ++$i ) {
- if( !is_numeric($aDatax[$i])) {
- JpGraphError::RaiseL(25070);
- }
- }
- }
- $this->value = new DisplayValue();
+ public $numpoints=0;
+ public $value;
+ public $legend='';
+ public $coords=array();
+ public $color='black';
+ public $hidelegend=false;
+ public $line_weight=1;
+ public $csimtargets=array(),$csimwintargets=array(); // Array of targets for CSIM
+ public $csimareas=''; // Resultant CSIM area tags
+ public $csimalts=null; // ALT:s for corresponding target
+ public $legendcsimtarget='',$legendcsimwintarget='';
+ public $legendcsimalt='';
+ protected $weight=1;
+ protected $center=false;
+
+ function __construct($aDatay,$aDatax=false) {
+ $this->numpoints = count($aDatay);
+ if( $this->numpoints==0 ) {
+ JpGraphError::RaiseL(25121);//("Empty input data array specified for plot. Must have at least one data point.");
+ }
+ $this->coords[0]=$aDatay;
+ if( is_array($aDatax) ) {
+ $this->coords[1]=$aDatax;
+ $n = count($aDatax);
+ for( $i=0; $i < $n; ++$i ) {
+ if( !is_numeric($aDatax[$i]) ) {
+ JpGraphError::RaiseL(25070);
+ }
+ }
+ }
+ $this->value = new DisplayValue();
}
-//---------------
-// PUBLIC METHODS
-
// Stroke the plot
// "virtual" function which must be implemented by
// the subclasses
- function Stroke(&$aImg,&$aXScale,&$aYScale) {
- JpGraphError::RaiseL(25122);//("JpGraph: Stroke() must be implemented by concrete subclass to class Plot");
+ function Stroke($aImg,$aXScale,$aYScale) {
+ JpGraphError::RaiseL(25122);//("JpGraph: Stroke() must be implemented by concrete subclass to class Plot");
}
function HideLegend($f=true) {
- $this->hidelegend = $f;
+ $this->hidelegend = $f;
}
- function DoLegend(&$graph) {
- if( !$this->hidelegend )
- $this->Legend($graph);
+ function DoLegend($graph) {
+ if( !$this->hidelegend )
+ $this->Legend($graph);
}
function StrokeDataValue($img,$aVal,$x,$y) {
- $this->value->Stroke($img,$aVal,$x,$y);
+ $this->value->Stroke($img,$aVal,$x,$y);
}
-
- // Set href targets for CSIM
+
+ // Set href targets for CSIM
function SetCSIMTargets($aTargets,$aAlts='',$aWinTargets='') {
- $this->csimtargets=$aTargets;
- $this->csimwintargets=$aWinTargets;
- $this->csimalts=$aAlts;
+ $this->csimtargets=$aTargets;
+ $this->csimwintargets=$aWinTargets;
+ $this->csimalts=$aAlts;
}
-
+
// Get all created areas
function GetCSIMareas() {
- return $this->csimareas;
- }
-
+ return $this->csimareas;
+ }
+
// "Virtual" function which gets called before any scale
// or axis are stroked used to do any plot specific adjustment
- function PreStrokeAdjust(&$aGraph) {
- if( substr($aGraph->axtype,0,4) == "text" && (isset($this->coords[1])) )
- JpGraphError::RaiseL(25123);//("JpGraph: You can't use a text X-scale with specified X-coords. Use a \"int\" or \"lin\" scale instead.");
- return true;
+ function PreStrokeAdjust($aGraph) {
+ if( substr($aGraph->axtype,0,4) == "text" && (isset($this->coords[1])) ) {
+ JpGraphError::RaiseL(25123);//("JpGraph: You can't use a text X-scale with specified X-coords. Use a \"int\" or \"lin\" scale instead.");
+ }
+ return true;
+ }
+
+ // Virtual function to the the concrete plot class to make any changes to the graph
+ // and scale before the stroke process begins
+ function PreScaleSetup($aGraph) {
+ // Empty
}
-
+
// Get minimum values in plot
function Min() {
- if( isset($this->coords[1]) )
- $x=$this->coords[1];
- else
- $x="";
- if( $x != "" && count($x) > 0 ) {
- $xm=min($x);
- }
- else
- $xm=0;
- $y=$this->coords[0];
- $cnt = count($y);
- if( $cnt > 0 ) {
- /*
- if( ! isset($y[0]) ) {
- JpGraphError('The input data array must have consecutive values from position 0 and forward. The given y-array starts with empty values (NULL)');
- }
- */
- //$ym = $y[0];
- $i=0;
- while( $i<$cnt && !is_numeric($ym=$y[$i]) )
- $i++;
- while( $i < $cnt) {
- if( is_numeric($y[$i]) )
- $ym=min($ym,$y[$i]);
- ++$i;
- }
- }
- else
- $ym="";
- return array($xm,$ym);
+ if( isset($this->coords[1]) ) {
+ $x=$this->coords[1];
+ }
+ else {
+ $x='';
+ }
+ if( $x != '' && count($x) > 0 ) {
+ $xm=min($x);
+ }
+ else {
+ $xm=0;
+ }
+ $y=$this->coords[0];
+ $cnt = count($y);
+ if( $cnt > 0 ) {
+ $i=0;
+ while( $i<$cnt && !is_numeric($ym=$y[$i]) ) {
+ $i++;
+ }
+ while( $i < $cnt) {
+ if( is_numeric($y[$i]) ) {
+ $ym=min($ym,$y[$i]);
+ }
+ ++$i;
+ }
+ }
+ else {
+ $ym='';
+ }
+ return array($xm,$ym);
}
-
+
// Get maximum value in plot
function Max() {
- if( isset($this->coords[1]) )
- $x=$this->coords[1];
- else
- $x="";
-
- if( $x!="" && count($x) > 0 )
- $xm=max($x);
- else {
- $xm = $this->numpoints-1;
- }
- $y=$this->coords[0];
- if( count($y) > 0 ) {
- /*
- if( !isset($y[0]) ) {
- JpGraphError::Raise('The input data array must have consecutive values from position 0 and forward. The given y-array starts with empty values (NULL)');
- //$y[0] = 0;
-// Change in 1.5.1 Don't treat this as an error any more. Just silently convert to 0
-// Change in 1.17 Treat his as an error again !! This is the right way to do !!
- }
- */
- $cnt = count($y);
- $i=0;
- while( $i<$cnt && !is_numeric($ym=$y[$i]) )
- $i++;
- while( $i < $cnt ) {
- if( is_numeric($y[$i]) )
- $ym=max($ym,$y[$i]);
- ++$i;
- }
-
- }
- else
- $ym="";
- return array($xm,$ym);
+ if( isset($this->coords[1]) ) {
+ $x=$this->coords[1];
+ }
+ else {
+ $x='';
+ }
+
+ if( $x!='' && count($x) > 0 ) {
+ $xm=max($x);
+ }
+ else {
+ $xm = $this->numpoints-1;
+ }
+ $y=$this->coords[0];
+ if( count($y) > 0 ) {
+ $cnt = count($y);
+ $i=0;
+ while( $i<$cnt && !is_numeric($ym=$y[$i]) ) {
+ $i++;
+ }
+ while( $i < $cnt ) {
+ if( is_numeric($y[$i]) ) {
+ $ym=max($ym,$y[$i]);
+ }
+ ++$i;
+ }
+ }
+ else {
+ $ym='';
+ }
+ return array($xm,$ym);
}
-
+
function SetColor($aColor) {
- $this->color=$aColor;
+ $this->color=$aColor;
}
-
+
function SetLegend($aLegend,$aCSIM='',$aCSIMAlt='',$aCSIMWinTarget='') {
- $this->legend = $aLegend;
- $this->legendcsimtarget = $aCSIM;
- $this->legendcsimwintarget = $aCSIMWinTarget;
- $this->legendcsimalt = $aCSIMAlt;
+ $this->legend = $aLegend;
+ $this->legendcsimtarget = $aCSIM;
+ $this->legendcsimwintarget = $aCSIMWinTarget;
+ $this->legendcsimalt = $aCSIMAlt;
}
function SetWeight($aWeight) {
- $this->weight=$aWeight;
+ $this->weight=$aWeight;
}
-
+
function SetLineWeight($aWeight=1) {
- $this->line_weight=$aWeight;
+ $this->line_weight=$aWeight;
}
-
+
function SetCenter($aCenter=true) {
- $this->center = $aCenter;
+ $this->center = $aCenter;
}
-
+
// This method gets called by Graph class to plot anything that should go
// into the margin after the margin color has been set.
- function StrokeMargin(&$aImg) {
- return true;
+ function StrokeMargin($aImg) {
+ return true;
}
// Framework function the chance for each plot class to set a legend
- function Legend(&$aGraph) {
- if( $this->legend != "" )
- $aGraph->legend->Add($this->legend,$this->color,"",0,$this->legendcsimtarget,
- $this->legendcsimalt,$this->legendcsimwintarget);
- }
-
-} // Class
-
-
-//===================================================
-// CLASS PlotLine
-// Description:
-// Data container class to hold properties for a static
-// line that is drawn directly in the plot area.
-// Usefull to add static borders inside a plot to show
-// for example set-values
-//===================================================
-class PlotLine {
- var $weight=1;
- var $color="black";
- var $direction=-1;
- var $scaleposition;
- var $legend='',$hidelegend=false, $legendcsimtarget='', $legendcsimalt='', $legendcsimwintarget='';
- var $iLineStyle='solid';
-
-
-//---------------
-// CONSTRUCTOR
- function PlotLine($aDir=HORIZONTAL,$aPos=0,$aColor="black",$aWeight=1) {
- $this->direction = $aDir;
- $this->color=$aColor;
- $this->weight=$aWeight;
- $this->scaleposition=$aPos;
- }
-
-//---------------
-// PUBLIC METHODS
-
- function SetLegend($aLegend,$aCSIM='',$aCSIMAlt='',$aCSIMWinTarget='') {
- $this->legend = $aLegend;
- $this->legendcsimtarget = $aCSIM;
- $this->legendcsimwintarget = $aCSIMWinTarget;
- $this->legendcsimalt = $aCSIMAlt;
- }
-
- function HideLegend($f=true) {
- $this->hidelegend = $f;
- }
-
- function SetPosition($aScalePosition) {
- $this->scaleposition=$aScalePosition;
- }
-
- function SetDirection($aDir) {
- $this->direction = $aDir;
- }
-
- function SetColor($aColor) {
- $this->color=$aColor;
- }
-
- function SetWeight($aWeight) {
- $this->weight=$aWeight;
- }
-
- function SetLineStyle($aStyle) {
- $this->iLineStyle = $aStyle;
+ function Legend($aGraph) {
+ if( $this->legend != '' ) {
+ $aGraph->legend->Add($this->legend,$this->color,'',0,$this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ }
}
-//---------------
-// PRIVATE METHODS
+} // Class
- function DoLegend(&$graph) {
- if( !$this->hidelegend )
- $this->Legend($graph);
- }
- // Framework function the chance for each plot class to set a legend
- function Legend(&$aGraph) {
- if( $this->legend != "" ) {
- $dummyPlotMark = new PlotMark();
- $lineStyle = 1;
- $aGraph->legend->Add($this->legend,$this->color,$dummyPlotMark,$lineStyle,
- $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
- }
+// Provide a deterministic list of new colors whenever the getColor() method
+// is called. Used to automatically set colors of plots.
+class ColorFactory {
+
+ static private $iIdx = 0;
+ static private $iColorList = array(
+ 'black',
+ 'blue',
+ 'orange',
+ 'darkgreen',
+ 'red',
+ 'AntiqueWhite3',
+ 'aquamarine3',
+ 'azure4',
+ 'brown',
+ 'cadetblue3',
+ 'chartreuse4',
+ 'chocolate',
+ 'darkblue',
+ 'darkgoldenrod3',
+ 'darkorchid3',
+ 'darksalmon',
+ 'darkseagreen4',
+ 'deepskyblue2',
+ 'dodgerblue4',
+ 'gold3',
+ 'hotpink',
+ 'lawngreen',
+ 'lightcoral',
+ 'lightpink3',
+ 'lightseagreen',
+ 'lightslateblue',
+ 'mediumpurple',
+ 'olivedrab',
+ 'orangered1',
+ 'peru',
+ 'slategray',
+ 'yellow4',
+ 'springgreen2');
+ static private $iNum = 33;
+
+ static function getColor() {
+ if( ColorFactory::$iIdx >= ColorFactory::$iNum )
+ ColorFactory::$iIdx = 0;
+ return ColorFactory::$iColorList[ColorFactory::$iIdx++];
}
- function PreStrokeAdjust($aGraph) {
- // Nothing to do
- }
-
- function Stroke(&$aImg,&$aXScale,&$aYScale) {
- $aImg->SetColor($this->color);
- $aImg->SetLineWeight($this->weight);
- $oldStyle = $aImg->SetLineStyle($this->iLineStyle);
- if( $this->direction == VERTICAL ) {
- $ymin_abs=$aYScale->Translate($aYScale->GetMinVal());
- $ymax_abs=$aYScale->Translate($aYScale->GetMaxVal());
- $xpos_abs=$aXScale->Translate($this->scaleposition);
- $aImg->StyleLine($xpos_abs, $ymin_abs, $xpos_abs, $ymax_abs);
- }
- elseif( $this->direction == HORIZONTAL ) {
- $xmin_abs=$aXScale->Translate($aXScale->GetMinVal());
- $xmax_abs=$aXScale->Translate($aXScale->GetMaxVal());
- $ypos_abs=$aYScale->Translate($this->scaleposition);
- $aImg->StyleLine($xmin_abs, $ypos_abs, $xmax_abs, $ypos_abs);
- }
- else {
- JpGraphError::RaiseL(25125);//(" Illegal direction for static line");
- }
- $aImg->SetLineStyle($oldStyle);
- }
}
//
";
-
- // Too avoid rounding problems we skip the slice if it is too small
- if( $d < 0.00001 ) continue;
-
- // If the user has specified an array of colors for each slice then use
- // that a color otherwise use the theme array (ta) of colors
- if( $this->setslicecolors==null )
- $slicecolor=$colors[$ta[$i%$numcolors]];
- else
- $slicecolor=$this->setslicecolors[$i%$numcolors];
-
- // If we have enabled antialias then we don't draw any border so
- // make the bordedr color the same as the slice color
- if( $this->pie_interior_border && $aaoption===0 )
- $img->SetColor($this->color);
- else
- $img->SetColor($slicecolor);
- $arccolor = $this->pie_border && $aaoption===0 ? $this->color : "";
-
- // Calculate the x,y coordinates for the base of this slice taking
- // the exploded distance into account. Here we use the mid angle as the
- // ray of extension and we have the mid angle handy as it is also the
- // label angle
- $xcm = $xc + $this->explode_radius[$j]*cos($this->la[$i])*$expscale;
- $ycm = $yc - $this->explode_radius[$j]*sin($this->la[$i])*$expscale;
-
- // If we are not just drawing the labels then draw this cake slice
- if( $aaoption !== 2 ) {
-
-
- $_sa = round($angle1*180/M_PI);
- $_ea = round($angle2*180/M_PI);
- $_la = round($this->la[$i]*180/M_PI);
- //echo "[$i] sa=$_sa, ea=$_ea, la[$i]=$_la, (color=$slicecolor)
";
-
-
- // The CakeSlice method draws a full circle in case of start angle = end angle
- // for pie slices we don't want this behaviour unless we only have one
- // slice in the pie in case it is the wanted behaviour
- if( abs($_ea-$_sa) > 0.1 || $n==1 ) {
- $img->CakeSlice($xcm,$ycm,$radius-1,$radius-1,$_sa,$_ea,$slicecolor,$arccolor);
- }
- }
-
- // If the CSIM is used then make sure we register a CSIM area for this slice as well
- if( $this->csimtargets && $aaoption !== 1 ) {
- $this->AddSliceToCSIM($i,$xcm,$ycm,$radius,$angle1,$angle2);
- }
- }
-
- // Format the titles for each slice
- if( $aaoption!==2) {
- for( $i=0; $i < $n; ++$i) {
- if( $this->labeltype==0 ) {
- if( $sum != 0 )
- $l = 100.0*$this->data[$i]/$sum;
- else
- $l = 0.0;
- }
- elseif( $this->labeltype==1 ) {
- $l = $this->data[$i]*1.0;
- }
- else {
- $l = $this->adjusted_data[$i];
- }
- if( isset($this->labels[$i]) && is_string($this->labels[$i]) )
- $this->labels[$i]=sprintf($this->labels[$i],$l);
- else
- $this->labels[$i]=$l;
- }
- }
-
- If( $this->value->show && $aaoption !== 1 ) {
- $this->StrokeAllLabels($img,$xc,$yc,$radius);
- }
-
- // Adjust title position
- if( $aaoption !== 1 ) {
- $this->title->Pos($xc,
- $yc-$this->title->GetFontHeight($img)-$radius-$this->title->margin,
- "center","bottom");
- $this->title->Stroke($img);
- }
+ $mul=100;
+ if( $aPrec > 0 && $aPrec < 3 ) {
+ if( $aPrec == 1 )
+ $mul=1000;
+ else
+ $mul=10000;
+ }
+
+ $tmp = array();
+ $result = array();
+ $quote_sum=0;
+ $n = count($aData) ;
+ for( $i=0, $sum=0; $i < $n; ++$i )
+ $sum+=$aData[$i];
+ foreach($aData as $index => $value) {
+ $tmp_percentage=$value/$sum*$mul;
+ $result[$index]=floor($tmp_percentage);
+ $tmp[$index]=$tmp_percentage-$result[$index];
+ $quote_sum+=$result[$index];
+ }
+ if( $quote_sum == $mul) {
+ if( $mul > 100 ) {
+ $tmp = $mul / 100;
+ for( $i=0; $i < $n; ++$i ) {
+ $result[$i] /= $tmp ;
+ }
+ }
+ return $result;
+ }
+ arsort($tmp,SORT_NUMERIC);
+ reset($tmp);
+ for($i=0; $i < $mul-$quote_sum; $i++)
+ {
+ $result[key($tmp)]++;
+ next($tmp);
+ }
+ if( $mul > 100 ) {
+ $tmp = $mul / 100;
+ for( $i=0; $i < $n; ++$i ) {
+ $result[$i] /= $tmp ;
+ }
+ }
+ return $result;
+ }
+
+
+ function Stroke($img,$aaoption=0) {
+ // aaoption is used to handle antialias
+ // aaoption == 0 a normal pie
+ // aaoption == 1 just the body
+ // aaoption == 2 just the values
+
+ // Explode scaling. If anti alias we scale the image
+ // twice and we also need to scale the exploding distance
+ $expscale = $aaoption === 1 ? 2 : 1;
+
+ if( $this->labeltype == 2 ) {
+ // Adjust the data so that it will add up to 100%
+ $this->adjusted_data = $this->AdjPercentage($this->data);
+ }
+
+ $colors = array_keys($img->rgb->rgb_table);
+ sort($colors);
+ $ta=$this->themearr[$this->theme];
+ $n = count($this->data);
+
+ if( $this->setslicecolors==null ) {
+ $numcolors=count($ta);
+ }
+ else {
+ // We need to create an array of colors as long as the data
+ // since we need to reverse it to get the colors in the right order
+ $numcolors=count($this->setslicecolors);
+ $i = 2*$numcolors;
+ while( $n > $i ) {
+ $this->setslicecolors = array_merge($this->setslicecolors,$this->setslicecolors);
+ $i += $n;
+ }
+ $tt = array_slice($this->setslicecolors,0,$n % $numcolors);
+ $this->setslicecolors = array_merge($this->setslicecolors,$tt);
+ $this->setslicecolors = array_reverse($this->setslicecolors);
+ }
+
+ // Draw the slices
+ $sum=0;
+ for($i=0; $i < $n; ++$i)
+ $sum += $this->data[$i];
+
+ // Bail out with error if the sum is 0
+ if( $sum==0 ) {
+ JpGraphError::RaiseL(15009);//("Sum of all data is 0 for Pie.");
+ }
+
+ // Set up the pie-circle
+ if( $this->radius <= 1 ) {
+ $radius = floor($this->radius*min($img->width,$img->height));
+ }
+ else {
+ $radius = $aaoption === 1 ? $this->radius*2 : $this->radius;
+ }
+
+ if( $this->posx <= 1 && $this->posx > 0 ) {
+ $xc = round($this->posx*$img->width);
+ }
+ else {
+ $xc = $this->posx ;
+ }
+
+ if( $this->posy <= 1 && $this->posy > 0 ) {
+ $yc = round($this->posy*$img->height);
+ }
+ else {
+ $yc = $this->posy ;
+ }
+
+ $n = count($this->data);
+
+ if( $this->explode_all ) {
+ for($i=0; $i < $n; ++$i) {
+ $this->explode_radius[$i]=$this->explode_r;
+ }
+ }
+
+ // If we have a shadow and not just drawing the labels
+ if( $this->ishadowcolor != "" && $aaoption !== 2) {
+ $accsum=0;
+ $angle2 = $this->startangle;
+ $img->SetColor($this->ishadowcolor);
+ for($i=0; $sum > 0 && $i < $n; ++$i) {
+ $j = $n-$i-1;
+ $d = $this->data[$i];
+ $angle1 = $angle2;
+ $accsum += $d;
+ $angle2 = $this->startangle+2*M_PI*$accsum/$sum;
+ if( empty($this->explode_radius[$j]) ) {
+ $this->explode_radius[$j]=0;
+ }
+
+ if( $d < 0.00001 ) continue;
+
+ $la = 2*M_PI - (abs($angle2-$angle1)/2.0+$angle1);
+
+ $xcm = $xc + $this->explode_radius[$j]*cos($la)*$expscale;
+ $ycm = $yc - $this->explode_radius[$j]*sin($la)*$expscale;
+
+ $xcm += $this->ishadowdrop*$expscale;
+ $ycm += $this->ishadowdrop*$expscale;
+
+ $_sa = round($angle1*180/M_PI);
+ $_ea = round($angle2*180/M_PI);
+
+ // The CakeSlice method draws a full circle in case of start angle = end angle
+ // for pie slices we don't want this behaviour unless we only have one
+ // slice in the pie in case it is the wanted behaviour
+ if( $_ea-$_sa > 0.1 || $n==1 ) {
+ $img->CakeSlice($xcm,$ycm,$radius-1,$radius-1,
+ $angle1*180/M_PI,$angle2*180/M_PI,$this->ishadowcolor);
+ }
+ }
+ }
+
+ //--------------------------------------------------------------------------------
+ // This is the main loop to draw each cake slice
+ //--------------------------------------------------------------------------------
+
+ // Set up the accumulated sum, start angle for first slice and border color
+ $accsum=0;
+ $angle2 = $this->startangle;
+ $img->SetColor($this->color);
+
+ // Loop though all the slices if there is a pie to draw (sum>0)
+ // There are n slices in total
+ for($i=0; $sum>0 && $i < $n; ++$i) {
+
+ // $j is the actual index used for the slice
+ $j = $n-$i-1;
+
+ // Make sure we havea valid distance to explode the slice
+ if( empty($this->explode_radius[$j]) ) {
+ $this->explode_radius[$j]=0;
+ }
+
+ // The actual numeric value for the slice
+ $d = $this->data[$i];
+
+ $angle1 = $angle2;
+
+ // Accumlate the sum
+ $accsum += $d;
+
+ // The new angle when we add the "size" of this slice
+ // angle1 is then the start and angle2 the end of this slice
+ $angle2 = $this->NormAngle($this->startangle+2*M_PI*$accsum/$sum);
+
+ // We avoid some trouble by not allowing end angle to be 0, in that case
+ // we translate to 360
+
+ // la is used to hold the label angle, which is centered on the slice
+ if( $angle2 < 0.0001 && $angle1 > 0.0001 ) {
+ $this->la[$i] = 2*M_PI - (abs(2*M_PI-$angle1)/2.0+$angle1);
+ }
+ elseif( $angle1 > $angle2 ) {
+ // The case where the slice crosses the 3 a'clock line
+ // Remember that the slices are counted clockwise and
+ // labels are counted counter clockwise so we need to revert with 2 PI
+ $this->la[$i] = 2*M_PI-$this->NormAngle($angle1 + ((2*M_PI - $angle1)+$angle2)/2);
+ }
+ else {
+ $this->la[$i] = 2*M_PI - (abs($angle2-$angle1)/2.0+$angle1);
+ }
+
+ // Too avoid rounding problems we skip the slice if it is too small
+ if( $d < 0.00001 ) continue;
+
+ // If the user has specified an array of colors for each slice then use
+ // that a color otherwise use the theme array (ta) of colors
+ if( $this->setslicecolors==null ) {
+ $slicecolor=$colors[$ta[$i%$numcolors]];
+ }
+ else {
+ $slicecolor=$this->setslicecolors[$i%$numcolors];
+ }
+
+// $_sa = round($angle1*180/M_PI);
+// $_ea = round($angle2*180/M_PI);
+// $_la = round($this->la[$i]*180/M_PI);
+// echo "Slice#$i: ang1=$_sa , ang2=$_ea, la=$_la, color=$slicecolor
";
+
+
+ // If we have enabled antialias then we don't draw any border so
+ // make the bordedr color the same as the slice color
+ if( $this->pie_interior_border && $aaoption===0 ) {
+ $img->SetColor($this->color);
+ }
+ else {
+ $img->SetColor($slicecolor);
+ }
+ $arccolor = $this->pie_border && $aaoption===0 ? $this->color : "";
+
+ // Calculate the x,y coordinates for the base of this slice taking
+ // the exploded distance into account. Here we use the mid angle as the
+ // ray of extension and we have the mid angle handy as it is also the
+ // label angle
+ $xcm = $xc + $this->explode_radius[$j]*cos($this->la[$i])*$expscale;
+ $ycm = $yc - $this->explode_radius[$j]*sin($this->la[$i])*$expscale;
+
+ // If we are not just drawing the labels then draw this cake slice
+ if( $aaoption !== 2 ) {
+
+ $_sa = round($angle1*180/M_PI);
+ $_ea = round($angle2*180/M_PI);
+ $_la = round($this->la[$i]*180/M_PI);
+ //echo "[$i] sa=$_sa, ea=$_ea, la[$i]=$_la, (color=$slicecolor)
";
+
+ // The CakeSlice method draws a full circle in case of start angle = end angle
+ // for pie slices we want this in case the slice have a value larger than 99% of the
+ // total sum
+ if( abs($_ea-$_sa) >= 1 || $d == $sum ) {
+ $img->CakeSlice($xcm,$ycm,$radius-1,$radius-1,$_sa,$_ea,$slicecolor,$arccolor);
+ }
+ }
+
+ // If the CSIM is used then make sure we register a CSIM area for this slice as well
+ if( $this->csimtargets && $aaoption !== 1 ) {
+ $this->AddSliceToCSIM($i,$xcm,$ycm,$radius,$angle1,$angle2);
+ }
+ }
+
+ // Format the titles for each slice
+ if( $aaoption !== 2 ) {
+ for( $i=0; $i < $n; ++$i) {
+ if( $this->labeltype==0 ) {
+ if( $sum != 0 )
+ $l = 100.0*$this->data[$i]/$sum;
+ else
+ $l = 0.0;
+ }
+ elseif( $this->labeltype==1 ) {
+ $l = $this->data[$i]*1.0;
+ }
+ else {
+ $l = $this->adjusted_data[$i];
+ }
+ if( isset($this->labels[$i]) && is_string($this->labels[$i]) )
+ $this->labels[$i]=sprintf($this->labels[$i],$l);
+ else
+ $this->labels[$i]=$l;
+ }
+ }
+
+ if( $this->value->show && $aaoption !== 1 ) {
+ $this->StrokeAllLabels($img,$xc,$yc,$radius);
+ }
+
+ // Adjust title position
+ if( $aaoption !== 1 ) {
+ $this->title->SetPos($xc,
+ $yc-$this->title->GetFontHeight($img)-$radius-$this->title->margin,
+ "center","bottom");
+ $this->title->Stroke($img);
+ }
}
-//---------------
-// PRIVATE METHODS
+ //---------------
+ // PRIVATE METHODS
function NormAngle($a) {
- while( $a < 0 ) $a += 2*M_PI;
- while( $a > 2*M_PI ) $a -= 2*M_PI;
- return $a;
+ while( $a < 0 ) $a += 2*M_PI;
+ while( $a > 2*M_PI ) $a -= 2*M_PI;
+ return $a;
}
function Quadrant($a) {
- $a=$this->NormAngle($a);
- if( $a > 0 && $a <= M_PI/2 )
- return 0;
- if( $a > M_PI/2 && $a <= M_PI )
- return 1;
- if( $a > M_PI && $a <= 1.5*M_PI )
- return 2;
- if( $a > 1.5*M_PI )
- return 3;
- }
-
- function StrokeGuideLabels(&$img,$xc,$yc,$radius) {
- $n = count($this->labels);
-
- //-----------------------------------------------------------------------
- // Step 1 of the algorithm is to construct a number of clusters
- // a cluster is defined as all slices within the same quadrant (almost)
- // that has an angular distance less than the treshold
- //-----------------------------------------------------------------------
- $tresh_hold=25 * M_PI/180; // 25 degrees difference to be in a cluster
- $incluster=false; // flag if we are currently in a cluster or not
- $clusters = array(); // array of clusters
- $cidx=-1; // running cluster index
-
- // Go through all the labels and construct a number of clusters
- for($i=0; $i < $n-1; ++$i) {
- // Calc the angle distance between two consecutive slices
- $a1=$this->la[$i];
- $a2=$this->la[$i+1];
- $q1 = $this->Quadrant($a1);
- $q2 = $this->Quadrant($a2);
- $diff = abs($a1-$a2);
- if( $diff < $tresh_hold ) {
- if( $incluster ) {
- $clusters[$cidx][1]++;
- // Each cluster can only cover one quadrant
- // Do we cross a quadrant ( and must break the cluster)
- if( $q1 != $q2 ) {
- // If we cross a quadrant boundary we normally start a
- // new cluster. However we need to take the 12'a clock
- // and 6'a clock positions into a special consideration.
- // Case 1: WE go from q=1 to q=2 if the last slice on
- // the cluster for q=1 is close to 12'a clock and the
- // first slice in q=0 is small we extend the previous
- // cluster
- if( $q1 == 1 && $q2 == 0 && $a2 > (90-15)*M_PI/180 ) {
- if( $i < $n-2 ) {
- $a3 = $this->la[$i+2];
- // If there isn't a cluster coming up with the next-next slice
- // we extend the previous cluster to cover this slice as well
- if( abs($a3-$a2) >= $tresh_hold ) {
- $clusters[$cidx][1]++;
- $i++;
- }
- }
- }
- elseif( $q1 == 3 && $q2 == 2 && $a2 > (270-15)*M_PI/180 ) {
- if( $i < $n-2 ) {
- $a3 = $this->la[$i+2];
- // If there isn't a cluster coming up with the next-next slice
- // we extend the previous cluster to cover this slice as well
- if( abs($a3-$a2) >= $tresh_hold ) {
- $clusters[$cidx][1]++;
- $i++;
- }
- }
- }
-
- if( $q1==2 && $q2==1 && $a2 > (180-15)*M_PI/180 ) {
- $clusters[$cidx][1]++;
- $i++;
- }
-
- $incluster = false;
- }
- }
- elseif( $q1 == $q2) {
- $incluster = true;
- // Now we have a special case for quadrant 0. If we previously
- // have a cluster of one in quadrant 0 we just extend that
- // cluster. If we don't do this then we risk that the label
- // for the cluster of one will cross the guide-line
- if( $q1 == 0 && $cidx > -1 &&
- $clusters[$cidx][1] == 1 &&
- $this->Quadrant($this->la[$clusters[$cidx][0]]) == 0 ) {
- $clusters[$cidx][1]++;
- }
- else {
- $cidx++;
- $clusters[$cidx][0] = $i;
- $clusters[$cidx][1] = 1;
- }
- }
- else {
- // Create a "cluster" of one since we are just crossing
- // a quadrant
- $cidx++;
- $clusters[$cidx][0] = $i;
- $clusters[$cidx][1] = 1;
- }
- }
- else {
- if( $incluster ) {
- // Add the last slice
- $clusters[$cidx][1]++;
- $incluster = false;
- }
- else { // Create a "cluster" of one
- $cidx++;
- $clusters[$cidx][0] = $i;
- $clusters[$cidx][1] = 1;
- }
- }
- }
- // Handle the very last slice
- if( $incluster ) {
- $clusters[$cidx][1]++;
- }
- else { // Create a "cluster" of one
- $cidx++;
- $clusters[$cidx][0] = $i;
- $clusters[$cidx][1] = 1;
- }
-
- /*
- if( true ) {
- // Debug printout in labels
- for( $i=0; $i <= $cidx; ++$i ) {
- for( $j=0; $j < $clusters[$i][1]; ++$j ) {
- $a = $this->la[$clusters[$i][0]+$j];
- $aa = round($a*180/M_PI);
- $q = $this->Quadrant($a);
- $this->labels[$clusters[$i][0]+$j]="[$q:$aa] $i:$j";
- }
- }
- }
- */
-
- //-----------------------------------------------------------------------
- // Step 2 of the algorithm is use the clusters and draw the labels
- // and guidelines
- //-----------------------------------------------------------------------
-
- // We use the font height as the base factor for how far we need to
- // spread the labels in the Y-direction.
- $img->SetFont($this->value->ff,$this->value->fs,$this->value->fsize);
- $fh = $img->GetFontHeight();
- $origvstep=$fh*$this->iGuideVFactor;
- $this->value->SetMargin(0);
-
- // Number of clusters found
- $nc = count($clusters);
-
- // Walk through all the clusters
- for($i=0; $i < $nc; ++$i) {
-
- // Start angle and number of slices in this cluster
- $csize = $clusters[$i][1];
- $a = $this->la[$clusters[$i][0]];
- $q = $this->Quadrant($a);
-
- // Now set up the start and end conditions to make sure that
- // in each cluster we walk through the all the slices starting with the slice
- // closest to the equator. Since all slices are numbered clockwise from "3'a clock"
- // we have different conditions depending on in which quadrant the slice lies within.
- if( $q == 0 ) {
- $start = $csize-1; $idx = $start; $step = -1; $vstep = -$origvstep;
- }
- elseif( $q == 1 ) {
- $start = 0; $idx = $start; $step = 1; $vstep = -$origvstep;
- }
- elseif( $q == 2 ) {
- $start = $csize-1; $idx = $start; $step = -1; $vstep = $origvstep;
- }
- elseif( $q == 3 ) {
- $start = 0; $idx = $start; $step = 1; $vstep = $origvstep;
- }
-
- // Walk through all slices within this cluster
- for($j=0; $j < $csize; ++$j) {
- // Now adjust the position of the labels in each cluster starting
- // with the slice that is closest to the equator of the pie
- $a = $this->la[$clusters[$i][0]+$idx];
-
- // Guide line start in the center of the arc of the slice
- $r = $radius+$this->explode_radius[$n-1-($clusters[$i][0]+$idx)];
- $x = round($r*cos($a)+$xc);
- $y = round($yc-$r*sin($a));
-
- // The distance from the arc depends on chosen font and the "R-Factor"
- $r += $fh*$this->iGuideLineRFactor;
-
- // Should the labels be placed curved along the pie or in straight columns
- // outside the pie?
- if( $this->iGuideLineCurve )
- $xt=round($r*cos($a)+$xc);
-
- // If this is the first slice in the cluster we need some first time
- // proessing
- if( $idx == $start ) {
- if( ! $this->iGuideLineCurve )
- $xt=round($r*cos($a)+$xc);
- $yt=round($yc-$r*sin($a));
-
- // Some special consideration in case this cluster starts
- // in quadrant 1 or 3 very close to the "equator" (< 20 degrees)
- // and the previous clusters last slice is within the tolerance.
- // In that case we add a font height to this labels Y-position
- // so it doesn't collide with
- // the slice in the previous cluster
- $prevcluster = ($i + ($nc-1) ) % $nc;
- $previdx=$clusters[$prevcluster][0]+$clusters[$prevcluster][1]-1;
- if( $q == 1 && $a > 160*M_PI/180 ) {
- // Get the angle for the previous clusters last slice
- $diff = abs($a-$this->la[$previdx]);
- if( $diff < $tresh_hold ) {
- $yt -= $fh;
- }
- }
- elseif( $q == 3 && $a > 340*M_PI/180 ) {
- // We need to subtract 360 to compare angle distance between
- // q=0 and q=3
- $diff = abs($a-$this->la[$previdx]-360*M_PI/180);
- if( $diff < $tresh_hold ) {
- $yt += $fh;
- }
- }
-
- }
- else {
- // The step is at minimum $vstep but if the slices are relatively large
- // we make sure that we add at least a step that corresponds to the vertical
- // distance between the centers at the arc on the slice
- $prev_a = $this->la[$clusters[$i][0]+($idx-$step)];
- $dy = abs($radius*(sin($a)-sin($prev_a))*1.2);
- if( $vstep > 0 )
- $yt += max($vstep,$dy);
- else
- $yt += min($vstep,-$dy);
- }
-
- $label = $this->labels[$clusters[$i][0]+$idx];
-
- if( $csize == 1 ) {
- // A "meta" cluster with only one slice
- $r = $radius+$this->explode_radius[$n-1-($clusters[$i][0]+$idx)];
- $rr = $r+$img->GetFontHeight()/2;
- $xt=round($rr*cos($a)+$xc);
- $yt=round($yc-$rr*sin($a));
- $this->StrokeLabel($label,$img,$xc,$yc,$a,$r);
- if( $this->iShowGuideLineForSingle )
- $this->guideline->Stroke($img,$x,$y,$xt,$yt);
- }
- else {
- $this->guideline->Stroke($img,$x,$y,$xt,$yt);
- if( $q==1 || $q==2 ) {
- // Left side of Pie
- $this->guideline->Stroke($img,$xt,$yt,$xt-$this->guidelinemargin,$yt);
- $lbladj = -$this->guidelinemargin-5;
- $this->value->halign = "right";
- $this->value->valign = "center";
- }
- else {
- // Right side of pie
- $this->guideline->Stroke($img,$xt,$yt,$xt+$this->guidelinemargin,$yt);
- $lbladj = $this->guidelinemargin+5;
- $this->value->halign = "left";
- $this->value->valign = "center";
- }
- $this->value->Stroke($img,$label,$xt+$lbladj,$yt);
- }
-
- // Udate idx to point to next slice in the cluster to process
- $idx += $step;
- }
- }
- }
-
- function StrokeAllLabels(&$img,$xc,$yc,$radius) {
- // First normalize all angles for labels
- $n = count($this->la);
- for($i=0; $i < $n; ++$i) {
- $this->la[$i] = $this->NormAngle($this->la[$i]);
- }
- if( $this->guideline->iShow ) {
- $this->StrokeGuideLabels($img,$xc,$yc,$radius);
- }
- else {
- $n = count($this->labels);
- for($i=0; $i < $n; ++$i) {
- $this->StrokeLabel($this->labels[$i],$img,$xc,$yc,
- $this->la[$i],
- $radius + $this->explode_radius[$n-1-$i]);
- }
- }
+ $a=$this->NormAngle($a);
+ if( $a > 0 && $a <= M_PI/2 )
+ return 0;
+ if( $a > M_PI/2 && $a <= M_PI )
+ return 1;
+ if( $a > M_PI && $a <= 1.5*M_PI )
+ return 2;
+ if( $a > 1.5*M_PI )
+ return 3;
+ }
+
+ function StrokeGuideLabels($img,$xc,$yc,$radius) {
+ $n = count($this->labels);
+
+ //-----------------------------------------------------------------------
+ // Step 1 of the algorithm is to construct a number of clusters
+ // a cluster is defined as all slices within the same quadrant (almost)
+ // that has an angular distance less than the treshold
+ //-----------------------------------------------------------------------
+ $tresh_hold=25 * M_PI/180; // 25 degrees difference to be in a cluster
+ $incluster=false; // flag if we are currently in a cluster or not
+ $clusters = array(); // array of clusters
+ $cidx=-1; // running cluster index
+
+ // Go through all the labels and construct a number of clusters
+ for($i=0; $i < $n-1; ++$i) {
+ // Calc the angle distance between two consecutive slices
+ $a1=$this->la[$i];
+ $a2=$this->la[$i+1];
+ $q1 = $this->Quadrant($a1);
+ $q2 = $this->Quadrant($a2);
+ $diff = abs($a1-$a2);
+ if( $diff < $tresh_hold ) {
+ if( $incluster ) {
+ $clusters[$cidx][1]++;
+ // Each cluster can only cover one quadrant
+ // Do we cross a quadrant ( and must break the cluster)
+ if( $q1 != $q2 ) {
+ // If we cross a quadrant boundary we normally start a
+ // new cluster. However we need to take the 12'a clock
+ // and 6'a clock positions into a special consideration.
+ // Case 1: WE go from q=1 to q=2 if the last slice on
+ // the cluster for q=1 is close to 12'a clock and the
+ // first slice in q=0 is small we extend the previous
+ // cluster
+ if( $q1 == 1 && $q2 == 0 && $a2 > (90-15)*M_PI/180 ) {
+ if( $i < $n-2 ) {
+ $a3 = $this->la[$i+2];
+ // If there isn't a cluster coming up with the next-next slice
+ // we extend the previous cluster to cover this slice as well
+ if( abs($a3-$a2) >= $tresh_hold ) {
+ $clusters[$cidx][1]++;
+ $i++;
+ }
+ }
+ }
+ elseif( $q1 == 3 && $q2 == 2 && $a2 > (270-15)*M_PI/180 ) {
+ if( $i < $n-2 ) {
+ $a3 = $this->la[$i+2];
+ // If there isn't a cluster coming up with the next-next slice
+ // we extend the previous cluster to cover this slice as well
+ if( abs($a3-$a2) >= $tresh_hold ) {
+ $clusters[$cidx][1]++;
+ $i++;
+ }
+ }
+ }
+
+ if( $q1==2 && $q2==1 && $a2 > (180-15)*M_PI/180 ) {
+ $clusters[$cidx][1]++;
+ $i++;
+ }
+
+ $incluster = false;
+ }
+ }
+ elseif( $q1 == $q2) {
+ $incluster = true;
+ // Now we have a special case for quadrant 0. If we previously
+ // have a cluster of one in quadrant 0 we just extend that
+ // cluster. If we don't do this then we risk that the label
+ // for the cluster of one will cross the guide-line
+ if( $q1 == 0 && $cidx > -1 &&
+ $clusters[$cidx][1] == 1 &&
+ $this->Quadrant($this->la[$clusters[$cidx][0]]) == 0 ) {
+ $clusters[$cidx][1]++;
+ }
+ else {
+ $cidx++;
+ $clusters[$cidx][0] = $i;
+ $clusters[$cidx][1] = 1;
+ }
+ }
+ else {
+ // Create a "cluster" of one since we are just crossing
+ // a quadrant
+ $cidx++;
+ $clusters[$cidx][0] = $i;
+ $clusters[$cidx][1] = 1;
+ }
+ }
+ else {
+ if( $incluster ) {
+ // Add the last slice
+ $clusters[$cidx][1]++;
+ $incluster = false;
+ }
+ else { // Create a "cluster" of one
+ $cidx++;
+ $clusters[$cidx][0] = $i;
+ $clusters[$cidx][1] = 1;
+ }
+ }
+ }
+ // Handle the very last slice
+ if( $incluster ) {
+ $clusters[$cidx][1]++;
+ }
+ else { // Create a "cluster" of one
+ $cidx++;
+ $clusters[$cidx][0] = $i;
+ $clusters[$cidx][1] = 1;
+ }
+
+ /*
+ if( true ) {
+ // Debug printout in labels
+ for( $i=0; $i <= $cidx; ++$i ) {
+ for( $j=0; $j < $clusters[$i][1]; ++$j ) {
+ $a = $this->la[$clusters[$i][0]+$j];
+ $aa = round($a*180/M_PI);
+ $q = $this->Quadrant($a);
+ $this->labels[$clusters[$i][0]+$j]="[$q:$aa] $i:$j";
+ }
+ }
+ }
+ */
+
+ //-----------------------------------------------------------------------
+ // Step 2 of the algorithm is use the clusters and draw the labels
+ // and guidelines
+ //-----------------------------------------------------------------------
+
+ // We use the font height as the base factor for how far we need to
+ // spread the labels in the Y-direction.
+ $this->value->ApplyFont($img);
+ $fh = $img->GetFontHeight();
+ $origvstep=$fh*$this->iGuideVFactor;
+ $this->value->SetMargin(0);
+
+ // Number of clusters found
+ $nc = count($clusters);
+
+ // Walk through all the clusters
+ for($i=0; $i < $nc; ++$i) {
+
+ // Start angle and number of slices in this cluster
+ $csize = $clusters[$i][1];
+ $a = $this->la[$clusters[$i][0]];
+ $q = $this->Quadrant($a);
+
+ // Now set up the start and end conditions to make sure that
+ // in each cluster we walk through the all the slices starting with the slice
+ // closest to the equator. Since all slices are numbered clockwise from "3'a clock"
+ // we have different conditions depending on in which quadrant the slice lies within.
+ if( $q == 0 ) {
+ $start = $csize-1; $idx = $start; $step = -1; $vstep = -$origvstep;
+ }
+ elseif( $q == 1 ) {
+ $start = 0; $idx = $start; $step = 1; $vstep = -$origvstep;
+ }
+ elseif( $q == 2 ) {
+ $start = $csize-1; $idx = $start; $step = -1; $vstep = $origvstep;
+ }
+ elseif( $q == 3 ) {
+ $start = 0; $idx = $start; $step = 1; $vstep = $origvstep;
+ }
+
+ // Walk through all slices within this cluster
+ for($j=0; $j < $csize; ++$j) {
+ // Now adjust the position of the labels in each cluster starting
+ // with the slice that is closest to the equator of the pie
+ $a = $this->la[$clusters[$i][0]+$idx];
+
+ // Guide line start in the center of the arc of the slice
+ $r = $radius+$this->explode_radius[$n-1-($clusters[$i][0]+$idx)];
+ $x = round($r*cos($a)+$xc);
+ $y = round($yc-$r*sin($a));
+
+ // The distance from the arc depends on chosen font and the "R-Factor"
+ $r += $fh*$this->iGuideLineRFactor;
+
+ // Should the labels be placed curved along the pie or in straight columns
+ // outside the pie?
+ if( $this->iGuideLineCurve )
+ $xt=round($r*cos($a)+$xc);
+
+ // If this is the first slice in the cluster we need some first time
+ // proessing
+ if( $idx == $start ) {
+ if( ! $this->iGuideLineCurve )
+ $xt=round($r*cos($a)+$xc);
+ $yt=round($yc-$r*sin($a));
+
+ // Some special consideration in case this cluster starts
+ // in quadrant 1 or 3 very close to the "equator" (< 20 degrees)
+ // and the previous clusters last slice is within the tolerance.
+ // In that case we add a font height to this labels Y-position
+ // so it doesn't collide with
+ // the slice in the previous cluster
+ $prevcluster = ($i + ($nc-1) ) % $nc;
+ $previdx=$clusters[$prevcluster][0]+$clusters[$prevcluster][1]-1;
+ if( $q == 1 && $a > 160*M_PI/180 ) {
+ // Get the angle for the previous clusters last slice
+ $diff = abs($a-$this->la[$previdx]);
+ if( $diff < $tresh_hold ) {
+ $yt -= $fh;
+ }
+ }
+ elseif( $q == 3 && $a > 340*M_PI/180 ) {
+ // We need to subtract 360 to compare angle distance between
+ // q=0 and q=3
+ $diff = abs($a-$this->la[$previdx]-360*M_PI/180);
+ if( $diff < $tresh_hold ) {
+ $yt += $fh;
+ }
+ }
+
+ }
+ else {
+ // The step is at minimum $vstep but if the slices are relatively large
+ // we make sure that we add at least a step that corresponds to the vertical
+ // distance between the centers at the arc on the slice
+ $prev_a = $this->la[$clusters[$i][0]+($idx-$step)];
+ $dy = abs($radius*(sin($a)-sin($prev_a))*1.2);
+ if( $vstep > 0 )
+ $yt += max($vstep,$dy);
+ else
+ $yt += min($vstep,-$dy);
+ }
+
+ $label = $this->labels[$clusters[$i][0]+$idx];
+
+ if( $csize == 1 ) {
+ // A "meta" cluster with only one slice
+ $r = $radius+$this->explode_radius[$n-1-($clusters[$i][0]+$idx)];
+ $rr = $r+$img->GetFontHeight()/2;
+ $xt=round($rr*cos($a)+$xc);
+ $yt=round($yc-$rr*sin($a));
+ $this->StrokeLabel($label,$img,$xc,$yc,$a,$r);
+ if( $this->iShowGuideLineForSingle )
+ $this->guideline->Stroke($img,$x,$y,$xt,$yt);
+ }
+ else {
+ $this->guideline->Stroke($img,$x,$y,$xt,$yt);
+ if( $q==1 || $q==2 ) {
+ // Left side of Pie
+ $this->guideline->Stroke($img,$xt,$yt,$xt-$this->guidelinemargin,$yt);
+ $lbladj = -$this->guidelinemargin-5;
+ $this->value->halign = "right";
+ $this->value->valign = "center";
+ }
+ else {
+ // Right side of pie
+ $this->guideline->Stroke($img,$xt,$yt,$xt+$this->guidelinemargin,$yt);
+ $lbladj = $this->guidelinemargin+5;
+ $this->value->halign = "left";
+ $this->value->valign = "center";
+ }
+ $this->value->Stroke($img,$label,$xt+$lbladj,$yt);
+ }
+
+ // Udate idx to point to next slice in the cluster to process
+ $idx += $step;
+ }
+ }
+ }
+
+ function StrokeAllLabels($img,$xc,$yc,$radius) {
+ // First normalize all angles for labels
+ $n = count($this->la);
+ for($i=0; $i < $n; ++$i) {
+ $this->la[$i] = $this->NormAngle($this->la[$i]);
+ }
+ if( $this->guideline->iShow ) {
+ $this->StrokeGuideLabels($img,$xc,$yc,$radius);
+ }
+ else {
+ $n = count($this->labels);
+ for($i=0; $i < $n; ++$i) {
+ $this->StrokeLabel($this->labels[$i],$img,$xc,$yc,
+ $this->la[$i],
+ $radius + $this->explode_radius[$n-1-$i]);
+ }
+ }
}
// Position the labels of each slice
- function StrokeLabel($label,&$img,$xc,$yc,$a,$radius) {
+ function StrokeLabel($label,$img,$xc,$yc,$a,$r) {
+
+ // Default value
+ if( $this->ilabelposadj === 'auto' )
+ $this->ilabelposadj = 0.65;
+
+ // We position the values diferently depending on if they are inside
+ // or outside the pie
+ if( $this->ilabelposadj < 1.0 ) {
+
+ $this->value->SetAlign('center','center');
+ $this->value->margin = 0;
+
+ $xt=round($this->ilabelposadj*$r*cos($a)+$xc);
+ $yt=round($yc-$this->ilabelposadj*$r*sin($a));
+
+ $this->value->Stroke($img,$label,$xt,$yt);
+ }
+ else {
+
+ $this->value->halign = "left";
+ $this->value->valign = "top";
+ $this->value->margin = 0;
+
+ // Position the axis title.
+ // dx, dy is the offset from the top left corner of the bounding box that sorrounds the text
+ // that intersects with the extension of the corresponding axis. The code looks a little
+ // bit messy but this is really the only way of having a reasonable position of the
+ // axis titles.
+ $this->value->ApplyFont($img);
+ $h=$img->GetTextHeight($label);
+ // For numeric values the format of the display value
+ // must be taken into account
+ if( is_numeric($label) ) {
+ if( $label > 0 )
+ $w=$img->GetTextWidth(sprintf($this->value->format,$label));
+ else
+ $w=$img->GetTextWidth(sprintf($this->value->negformat,$label));
+ }
+ else
+ $w=$img->GetTextWidth($label);
+
+ if( $this->ilabelposadj > 1.0 && $this->ilabelposadj < 5.0) {
+ $r *= $this->ilabelposadj;
+ }
+
+ $r += $img->GetFontHeight()/1.5;
+
+ $xt=round($r*cos($a)+$xc);
+ $yt=round($yc-$r*sin($a));
+
+ // Normalize angle
+ while( $a < 0 ) $a += 2*M_PI;
+ while( $a > 2*M_PI ) $a -= 2*M_PI;
+
+ if( $a>=7*M_PI/4 || $a <= M_PI/4 ) $dx=0;
+ if( $a>=M_PI/4 && $a <= 3*M_PI/4 ) $dx=($a-M_PI/4)*2/M_PI;
+ if( $a>=3*M_PI/4 && $a <= 5*M_PI/4 ) $dx=1;
+ if( $a>=5*M_PI/4 && $a <= 7*M_PI/4 ) $dx=(1-($a-M_PI*5/4)*2/M_PI);
+
+ if( $a>=7*M_PI/4 ) $dy=(($a-M_PI)-3*M_PI/4)*2/M_PI;
+ if( $a<=M_PI/4 ) $dy=(1-$a*2/M_PI);
+ if( $a>=M_PI/4 && $a <= 3*M_PI/4 ) $dy=1;
+ if( $a>=3*M_PI/4 && $a <= 5*M_PI/4 ) $dy=(1-($a-3*M_PI/4)*2/M_PI);
+ if( $a>=5*M_PI/4 && $a <= 7*M_PI/4 ) $dy=0;
- // Default value
- if( $this->ilabelposadj === 'auto' )
- $this->ilabelposadj = 0.65;
- $r = $radius;
-
- // We position the values diferently depending on if they are inside
- // or outside the pie
- if( $this->ilabelposadj < 1.0 ) {
-
- $this->value->SetAlign('center','center');
- $this->value->margin = 0;
-
- $xt=round($this->ilabelposadj*$r*cos($a)+$xc);
- $yt=round($yc-$this->ilabelposadj*$r*sin($a));
-
- $this->value->Stroke($img,$label,$xt,$yt);
- }
- else {
-
- $this->value->halign = "left";
- $this->value->valign = "top";
- $this->value->margin = 0;
-
- // Position the axis title.
- // dx, dy is the offset from the top left corner of the bounding box that sorrounds the text
- // that intersects with the extension of the corresponding axis. The code looks a little
- // bit messy but this is really the only way of having a reasonable position of the
- // axis titles.
- $img->SetFont($this->value->ff,$this->value->fs,$this->value->fsize);
- $h=$img->GetTextHeight($label);
- // For numeric values the format of the display value
- // must be taken into account
- if( is_numeric($label) ) {
- if( $label > 0 )
- $w=$img->GetTextWidth(sprintf($this->value->format,$label));
- else
- $w=$img->GetTextWidth(sprintf($this->value->negformat,$label));
- }
- else
- $w=$img->GetTextWidth($label);
- if( $this->ilabelposadj > 1.0 && $this->ilabelposadj < 5.0) {
- $r *= $this->ilabelposadj;
- }
-
- $r += $img->GetFontHeight()/1.5;
-
- $xt=round($r*cos($a)+$xc);
- $yt=round($yc-$r*sin($a));
-
- // Normalize angle
- while( $a < 0 ) $a += 2*M_PI;
- while( $a > 2*M_PI ) $a -= 2*M_PI;
-
- if( $a>=7*M_PI/4 || $a <= M_PI/4 ) $dx=0;
- if( $a>=M_PI/4 && $a <= 3*M_PI/4 ) $dx=($a-M_PI/4)*2/M_PI;
- if( $a>=3*M_PI/4 && $a <= 5*M_PI/4 ) $dx=1;
- if( $a>=5*M_PI/4 && $a <= 7*M_PI/4 ) $dx=(1-($a-M_PI*5/4)*2/M_PI);
-
- if( $a>=7*M_PI/4 ) $dy=(($a-M_PI)-3*M_PI/4)*2/M_PI;
- if( $a<=M_PI/4 ) $dy=(1-$a*2/M_PI);
- if( $a>=M_PI/4 && $a <= 3*M_PI/4 ) $dy=1;
- if( $a>=3*M_PI/4 && $a <= 5*M_PI/4 ) $dy=(1-($a-3*M_PI/4)*2/M_PI);
- if( $a>=5*M_PI/4 && $a <= 7*M_PI/4 ) $dy=0;
-
- $this->value->Stroke($img,$label,$xt-$dx*$w,$yt-$dy*$h);
- }
- }
+ $this->value->Stroke($img,$label,$xt-$dx*$w,$yt-$dy*$h);
+ }
+ }
} // Class
//===================================================
// CLASS PiePlotC
-// Description: Same as a normal pie plot but with a
+// Description: Same as a normal pie plot but with a
// filled circle in the center
//===================================================
class PiePlotC extends PiePlot {
- var $imidsize=0.5; // Fraction of total width
- var $imidcolor='white';
- var $midtitle='';
- var $middlecsimtarget='',$middlecsimwintarget='',$middlecsimalt='';
-
- function PiePlotC($data,$aCenterTitle='') {
- parent::PiePlot($data);
- $this->midtitle = new Text();
- $this->midtitle->ParagraphAlign('center');
+ private $imidsize=0.5; // Fraction of total width
+ private $imidcolor='white';
+ public $midtitle='';
+ private $middlecsimtarget='',$middlecsimwintarget='',$middlecsimalt='';
+
+ function __construct($data,$aCenterTitle='') {
+ parent::__construct($data);
+ $this->midtitle = new Text();
+ $this->midtitle->ParagraphAlign('center');
}
function SetMid($aTitle,$aColor='white',$aSize=0.5) {
- $this->midtitle->Set($aTitle);
+ $this->midtitle->Set($aTitle);
- $this->imidsize = $aSize ;
- $this->imidcolor = $aColor ;
+ $this->imidsize = $aSize ;
+ $this->imidcolor = $aColor ;
}
function SetMidTitle($aTitle) {
- $this->midtitle->Set($aTitle);
+ $this->midtitle->Set($aTitle);
}
function SetMidSize($aSize) {
- $this->imidsize = $aSize ;
+ $this->imidsize = $aSize ;
}
function SetMidColor($aColor) {
- $this->imidcolor = $aColor ;
+ $this->imidcolor = $aColor ;
}
function SetMidCSIM($aTarget,$aAlt='',$aWinTarget='') {
- $this->middlecsimtarget = $aTarget;
- $this->middlecsimwintarget = $aWinTarget;
- $this->middlecsimalt = $aAlt;
+ $this->middlecsimtarget = $aTarget;
+ $this->middlecsimwintarget = $aWinTarget;
+ $this->middlecsimalt = $aAlt;
}
- function AddSliceToCSIM($i,$xc,$yc,$radius,$sa,$ea) {
-
+ function AddSliceToCSIM($i,$xc,$yc,$radius,$sa,$ea) {
//Slice number, ellipse centre (x,y), radius, start angle, end angle
- while( $sa > 2*M_PI ) $sa = $sa - 2*M_PI;
- while( $ea > 2*M_PI ) $ea = $ea - 2*M_PI;
+ while( $sa > 2*M_PI ) $sa = $sa - 2*M_PI;
+ while( $ea > 2*M_PI ) $ea = $ea - 2*M_PI;
- $sa = 2*M_PI - $sa;
- $ea = 2*M_PI - $ea;
+ $sa = 2*M_PI - $sa;
+ $ea = 2*M_PI - $ea;
- // Special case when we have only one slice since then both start and end
- // angle will be == 0
- if( abs($sa - $ea) < 0.0001 ) {
- $sa=2*M_PI; $ea=0;
- }
-
- // Add inner circle first point
- $xp = floor(($this->imidsize*$radius*cos($ea))+$xc);
- $yp = floor($yc-($this->imidsize*$radius*sin($ea)));
- $coords = "$xp, $yp";
-
- //add coordinates every 0.25 radians
- $a=$ea+0.25;
-
- // If we cross the 260-limit with a slice we need to handle
- // the fact that end angle is smaller than start
- if( $sa < $ea ) {
- while ($a <= 2*M_PI) {
- $xp = floor($radius*cos($a)+$xc);
- $yp = floor($yc-$radius*sin($a));
- $coords.= ", $xp, $yp";
- $a += 0.25;
- }
- $a -= 2*M_PI;
- }
-
- while ($a < $sa) {
- $xp = floor(($this->imidsize*$radius*cos($a)+$xc));
- $yp = floor($yc-($this->imidsize*$radius*sin($a)));
- $coords.= ", $xp, $yp";
- $a += 0.25;
- }
-
- // Make sure we end at the last point
- $xp = floor(($this->imidsize*$radius*cos($sa)+$xc));
- $yp = floor($yc-($this->imidsize*$radius*sin($sa)));
- $coords.= ", $xp, $yp";
-
- // Straight line to outer circle
- $xp = floor($radius*cos($sa)+$xc);
- $yp = floor($yc-$radius*sin($sa));
- $coords.= ", $xp, $yp";
-
- //add coordinates every 0.25 radians
- $a=$sa - 0.25;
- while ($a > $ea) {
- $xp = floor($radius*cos($a)+$xc);
- $yp = floor($yc-$radius*sin($a));
- $coords.= ", $xp, $yp";
- $a -= 0.25;
- }
-
- //Add the last point on the arc
- $xp = floor($radius*cos($ea)+$xc);
- $yp = floor($yc-$radius*sin($ea));
- $coords.= ", $xp, $yp";
-
- // Close the arc
- $xp = floor(($this->imidsize*$radius*cos($ea))+$xc);
- $yp = floor($yc-($this->imidsize*$radius*sin($ea)));
- $coords .= ", $xp, $yp";
-
- if( !empty($this->csimtargets[$i]) ) {
- $this->csimareas .= "csimtargets[$i]."\"";
- if( !empty($this->csimwintargets[$i]) ) {
- $this->csimareas .= " target=\"".$this->csimwintargets[$i]."\" ";
- }
- if( !empty($this->csimalts[$i]) ) {
- $tmp=sprintf($this->csimalts[$i],$this->data[$i]);
- $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
- }
- $this->csimareas .= " />\n";
- }
- }
-
-
- function Stroke(&$img,$aaoption=0) {
-
- // Stroke the pie but don't stroke values
- $tmp = $this->value->show;
- $this->value->show = false;
- parent::Stroke($img,$aaoption);
- $this->value->show = $tmp;
-
- $xc = round($this->posx*$img->width);
- $yc = round($this->posy*$img->height);
-
- $radius = floor($this->radius * min($img->width,$img->height)) ;
-
-
- if( $this->imidsize > 0 && $aaoption !== 2 ) {
-
- if( $this->ishadowcolor != "" ) {
- $img->SetColor($this->ishadowcolor);
- $img->FilledCircle($xc+$this->ishadowdrop,$yc+$this->ishadowdrop,
- round($radius*$this->imidsize));
- }
-
- $img->SetColor($this->imidcolor);
- $img->FilledCircle($xc,$yc,round($radius*$this->imidsize));
-
- if( $this->pie_border && $aaoption === 0 ) {
- $img->SetColor($this->color);
- $img->Circle($xc,$yc,round($radius*$this->imidsize));
- }
-
- if( !empty($this->middlecsimtarget) )
- $this->AddMiddleCSIM($xc,$yc,round($radius*$this->imidsize));
-
- }
-
- if( $this->value->show && $aaoption !== 1) {
- $this->StrokeAllLabels($img,$xc,$yc,$radius);
- $this->midtitle->Pos($xc,$yc,'center','center');
- $this->midtitle->Stroke($img);
- }
+ // Special case when we have only one slice since then both start and end
+ // angle will be == 0
+ if( abs($sa - $ea) < 0.0001 ) {
+ $sa=2*M_PI; $ea=0;
+ }
+
+ // Add inner circle first point
+ $xp = floor(($this->imidsize*$radius*cos($ea))+$xc);
+ $yp = floor($yc-($this->imidsize*$radius*sin($ea)));
+ $coords = "$xp, $yp";
+
+ //add coordinates every 0.25 radians
+ $a=$ea+0.25;
+
+ // If we cross the 360-limit with a slice we need to handle
+ // the fact that end angle is smaller than start
+ if( $sa < $ea ) {
+ while ($a <= 2*M_PI) {
+ $xp = floor($radius*cos($a)+$xc);
+ $yp = floor($yc-$radius*sin($a));
+ $coords.= ", $xp, $yp";
+ $a += 0.25;
+ }
+ $a -= 2*M_PI;
+ }
+
+ while ($a < $sa) {
+ $xp = floor(($this->imidsize*$radius*cos($a)+$xc));
+ $yp = floor($yc-($this->imidsize*$radius*sin($a)));
+ $coords.= ", $xp, $yp";
+ $a += 0.25;
+ }
+
+ // Make sure we end at the last point
+ $xp = floor(($this->imidsize*$radius*cos($sa)+$xc));
+ $yp = floor($yc-($this->imidsize*$radius*sin($sa)));
+ $coords.= ", $xp, $yp";
+
+ // Straight line to outer circle
+ $xp = floor($radius*cos($sa)+$xc);
+ $yp = floor($yc-$radius*sin($sa));
+ $coords.= ", $xp, $yp";
+
+ //add coordinates every 0.25 radians
+ $a=$sa - 0.25;
+ while ($a > $ea) {
+ $xp = floor($radius*cos($a)+$xc);
+ $yp = floor($yc-$radius*sin($a));
+ $coords.= ", $xp, $yp";
+ $a -= 0.25;
+ }
+
+ //Add the last point on the arc
+ $xp = floor($radius*cos($ea)+$xc);
+ $yp = floor($yc-$radius*sin($ea));
+ $coords.= ", $xp, $yp";
+
+ // Close the arc
+ $xp = floor(($this->imidsize*$radius*cos($ea))+$xc);
+ $yp = floor($yc-($this->imidsize*$radius*sin($ea)));
+ $coords .= ", $xp, $yp";
+
+ if( !empty($this->csimtargets[$i]) ) {
+ $this->csimareas .= "csimtargets[$i]."\"";
+ if( !empty($this->csimwintargets[$i]) ) {
+ $this->csimareas .= " target=\"".$this->csimwintargets[$i]."\" ";
+ }
+ if( !empty($this->csimalts[$i]) ) {
+ $tmp=sprintf($this->csimalts[$i],$this->data[$i]);
+ $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
+ }
+ $this->csimareas .= " />\n";
+ }
+ }
+
+
+ function Stroke($img,$aaoption=0) {
+
+ // Stroke the pie but don't stroke values
+ $tmp = $this->value->show;
+ $this->value->show = false;
+ parent::Stroke($img,$aaoption);
+ $this->value->show = $tmp;
+
+ $xc = round($this->posx*$img->width);
+ $yc = round($this->posy*$img->height);
+
+ $radius = floor($this->radius * min($img->width,$img->height)) ;
+
+
+ if( $this->imidsize > 0 && $aaoption !== 2 ) {
+
+ if( $this->ishadowcolor != "" ) {
+ $img->SetColor($this->ishadowcolor);
+ $img->FilledCircle($xc+$this->ishadowdrop,$yc+$this->ishadowdrop,
+ round($radius*$this->imidsize));
+ }
+
+ $img->SetColor($this->imidcolor);
+ $img->FilledCircle($xc,$yc,round($radius*$this->imidsize));
+
+ if( $this->pie_border && $aaoption === 0 ) {
+ $img->SetColor($this->color);
+ $img->Circle($xc,$yc,round($radius*$this->imidsize));
+ }
+
+ if( !empty($this->middlecsimtarget) )
+ $this->AddMiddleCSIM($xc,$yc,round($radius*$this->imidsize));
+
+ }
+
+ if( $this->value->show && $aaoption !== 1) {
+ $this->StrokeAllLabels($img,$xc,$yc,$radius);
+ $this->midtitle->SetPos($xc,$yc,'center','center');
+ $this->midtitle->Stroke($img);
+ }
}
function AddMiddleCSIM($xc,$yc,$r) {
- $xc=round($xc);$yc=round($yc);$r=round($r);
- $this->csimareas .= "middlecsimtarget."\"";
- if( !empty($this->middlecsimwintarget) ) {
- $this->csimareas .= " target=\"".$this->middlecsimwintarget."\"";
- }
- if( !empty($this->middlecsimalt) ) {
- $tmp = $this->middlecsimalt;
- $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
- }
- $this->csimareas .= " />\n";
+ $xc=round($xc);$yc=round($yc);$r=round($r);
+ $this->csimareas .= "middlecsimtarget."\"";
+ if( !empty($this->middlecsimwintarget) ) {
+ $this->csimareas .= " target=\"".$this->middlecsimwintarget."\"";
+ }
+ if( !empty($this->middlecsimalt) ) {
+ $tmp = $this->middlecsimalt;
+ $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
+ }
+ $this->csimareas .= " />\n";
}
function StrokeLabel($label,$img,$xc,$yc,$a,$r) {
- if( $this->ilabelposadj === 'auto' )
- $this->ilabelposadj = (1-$this->imidsize)/2+$this->imidsize;
+ if( $this->ilabelposadj === 'auto' )
+ $this->ilabelposadj = (1-$this->imidsize)/2+$this->imidsize;
- parent::StrokeLabel($label,$img,$xc,$yc,$a,$r);
+ parent::StrokeLabel($label,$img,$xc,$yc,$a,$r);
}
@@ -1205,231 +1219,242 @@
//===================================================
// CLASS PieGraph
-// Description:
+// Description:
//===================================================
class PieGraph extends Graph {
- var $posx, $posy, $radius;
- var $legends=array();
- var $plots=array();
- var $pieaa = false ;
-//---------------
-// CONSTRUCTOR
- function PieGraph($width=300,$height=200,$cachedName="",$timeout=0,$inline=1) {
- $this->Graph($width,$height,$cachedName,$timeout,$inline);
- $this->posx=$width/2;
- $this->posy=$height/2;
- $this->SetColor(array(255,255,255));
+ private $posx, $posy, $radius;
+ private $legends=array();
+ public $plots=array();
+ public $pieaa = false ;
+ //---------------
+ // CONSTRUCTOR
+ function __construct($width=300,$height=200,$cachedName="",$timeout=0,$inline=1) {
+ parent::__construct($width,$height,$cachedName,$timeout,$inline);
+ $this->posx=$width/2;
+ $this->posy=$height/2;
+ $this->SetColor(array(255,255,255));
}
-//---------------
-// PUBLIC METHODS
+ //---------------
+ // PUBLIC METHODS
function Add($aObj) {
- if( is_array($aObj) && count($aObj) > 0 )
- $cl = $aObj[0];
- else
- $cl = $aObj;
-
- if( is_a($cl,'Text') )
- $this->AddText($aObj);
- elseif( is_a($cl,'IconPlot') )
- $this->AddIcon($aObj);
- else {
- if( is_array($aObj) ) {
- $n = count($aObj);
- for($i=0; $i < $n; ++$i ) {
- $this->plots[] = $aObj[$i];
- }
- }
- else {
- $this->plots[] = $aObj;
- }
- }
+ if( is_array($aObj) && count($aObj) > 0 )
+ $cl = $aObj[0];
+ else
+ $cl = $aObj;
+
+ if( $cl instanceof Text )
+ $this->AddText($aObj);
+ elseif( class_exists('IconPlot',false) && ($cl instanceof IconPlot) )
+ $this->AddIcon($aObj);
+ else {
+ if( is_array($aObj) ) {
+ $n = count($aObj);
+ for($i=0; $i < $n; ++$i ) {
+ $this->plots[] = $aObj[$i];
+ }
+ }
+ else {
+ $this->plots[] = $aObj;
+ }
+ }
}
function SetAntiAliasing($aFlg=true) {
- $this->pieaa = $aFlg;
+ $this->pieaa = $aFlg;
}
-
+
function SetColor($c) {
- $this->SetMarginColor($c);
+ $this->SetMarginColor($c);
}
+
function DisplayCSIMAreas() {
- $csim="";
- foreach($this->plots as $p ) {
- $csim .= $p->GetCSIMareas();
- }
- //$csim.= $this->legend->GetCSIMareas();
- if (preg_match_all("/area shape=\"(\w+)\" coords=\"([0-9\, ]+)\"/", $csim, $coords)) {
- $this->img->SetColor($this->csimcolor);
- $n = count($coords[0]);
- for ($i=0; $i < $n; $i++) {
- if ($coords[1][$i]=="poly") {
- preg_match_all('/\s*([0-9]+)\s*,\s*([0-9]+)\s*,*/',$coords[2][$i],$pts);
- $this->img->SetStartPoint($pts[1][count($pts[0])-1],$pts[2][count($pts[0])-1]);
- $m = count($pts[0]);
- for ($j=0; $j < $m; $j++) {
- $this->img->LineTo($pts[1][$j],$pts[2][$j]);
- }
- } else if ($coords[1][$i]=="rect") {
- $pts = preg_split('/,/', $coords[2][$i]);
- $this->img->SetStartPoint($pts[0],$pts[1]);
- $this->img->LineTo($pts[2],$pts[1]);
- $this->img->LineTo($pts[2],$pts[3]);
- $this->img->LineTo($pts[0],$pts[3]);
- $this->img->LineTo($pts[0],$pts[1]);
-
- }
- }
- }
+ $csim="";
+ foreach($this->plots as $p ) {
+ $csim .= $p->GetCSIMareas();
+ }
+
+ $csim.= $this->legend->GetCSIMareas();
+ if (preg_match_all("/area shape=\"(\w+)\" coords=\"([0-9\, ]+)\"/", $csim, $coords)) {
+ $this->img->SetColor($this->csimcolor);
+ $n = count($coords[0]);
+ for ($i=0; $i < $n; $i++) {
+ if ($coords[1][$i]=="poly") {
+ preg_match_all('/\s*([0-9]+)\s*,\s*([0-9]+)\s*,*/',$coords[2][$i],$pts);
+ $this->img->SetStartPoint($pts[1][count($pts[0])-1],$pts[2][count($pts[0])-1]);
+ $m = count($pts[0]);
+ for ($j=0; $j < $m; $j++) {
+ $this->img->LineTo($pts[1][$j],$pts[2][$j]);
+ }
+ } else if ($coords[1][$i]=="rect") {
+ $pts = preg_split('/,/', $coords[2][$i]);
+ $this->img->SetStartPoint($pts[0],$pts[1]);
+ $this->img->LineTo($pts[2],$pts[1]);
+ $this->img->LineTo($pts[2],$pts[3]);
+ $this->img->LineTo($pts[0],$pts[3]);
+ $this->img->LineTo($pts[0],$pts[1]);
+
+ }
+ }
+ }
}
// Method description
function Stroke($aStrokeFileName="") {
- // If the filename is the predefined value = '_csim_special_'
- // we assume that the call to stroke only needs to do enough
- // to correctly generate the CSIM maps.
- // We use this variable to skip things we don't strictly need
- // to do to generate the image map to improve performance
- // a best we can. Therefor you will see a lot of tests !$_csim in the
- // code below.
- $_csim = ($aStrokeFileName===_CSIM_SPECIALFILE);
-
- // We need to know if we have stroked the plot in the
- // GetCSIMareas. Otherwise the CSIM hasn't been generated
- // and in the case of GetCSIM called before stroke to generate
- // CSIM without storing an image to disk GetCSIM must call Stroke.
- $this->iHasStroked = true;
-
- $n = count($this->plots);
-
- if( $this->pieaa ) {
-
- if( !$_csim ) {
- if( $this->background_image != "" ) {
- $this->StrokeFrameBackground();
- }
- else {
- $this->StrokeFrame();
- }
- }
-
-
- $w = $this->img->width;
- $h = $this->img->height;
- $oldimg = $this->img->img;
-
- $this->img->CreateImgCanvas(2*$w,2*$h);
-
- $this->img->SetColor( $this->margin_color );
- $this->img->FilledRectangle(0,0,2*$w-1,2*$h-1);
-
- // Make all icons *2 i size since we will be scaling down the
- // image to do the anti aliasing
- $ni = count($this->iIcons);
- for($i=0; $i < $ni; ++$i) {
- $this->iIcons[$i]->iScale *= 2 ;
- if( $this->iIcons[$i]->iX > 1 )
- $this->iIcons[$i]->iX *= 2 ;
- if( $this->iIcons[$i]->iY > 1 )
- $this->iIcons[$i]->iY *= 2 ;
- }
-
- $this->StrokeIcons();
-
- for($i=0; $i < $n; ++$i) {
- if( $this->plots[$i]->posx > 1 )
- $this->plots[$i]->posx *= 2 ;
- if( $this->plots[$i]->posy > 1 )
- $this->plots[$i]->posy *= 2 ;
-
- $this->plots[$i]->Stroke($this->img,1);
-
- if( $this->plots[$i]->posx > 1 )
- $this->plots[$i]->posx /= 2 ;
- if( $this->plots[$i]->posy > 1 )
- $this->plots[$i]->posy /= 2 ;
- }
- $indent = $this->doframe ? ($this->frame_weight + ($this->doshadow ? $this->shadow_width : 0 )) : 0 ;
- $indent += $this->framebevel ? $this->framebeveldepth + 1 : 0 ;
- $this->img->CopyCanvasH($oldimg,$this->img->img,$indent,$indent,$indent,$indent,
- $w-2*$indent,$h-2*$indent,2*($w-$indent),2*($h-$indent));
-
- $this->img->img = $oldimg ;
- $this->img->width = $w ;
- $this->img->height = $h ;
-
- for($i=0; $i < $n; ++$i) {
- $this->plots[$i]->Stroke($this->img,2); // Stroke labels
- $this->plots[$i]->Legend($this);
- }
-
- }
- else {
- // No antialias
- if( !$_csim ) {
- if( $this->background_image != "" ) {
- $this->StrokeFrameBackground();
- }
- else {
- $this->StrokeFrame();
- $this->StrokeBackgroundGrad();
- }
- }
-
- $this->StrokeIcons();
- for($i=0; $i < $n; ++$i) {
- $this->plots[$i]->Stroke($this->img);
- $this->plots[$i]->Legend($this);
- }
- }
-
- $this->legend->Stroke($this->img);
- $this->footer->Stroke($this->img);
- $this->StrokeTitles();
-
- if( !$_csim ) {
-
- // Stroke texts
- if( $this->texts != null ) {
- $n = count($this->texts);
- for($i=0; $i < $n; ++$i ) {
- $this->texts[$i]->Stroke($this->img);
- }
- }
-
- if( _JPG_DEBUG ) {
- $this->DisplayCSIMAreas();
- }
-
- // Should we do any final image transformation
- if( $this->iImgTrans ) {
- if( !class_exists('ImgTrans') ) {
- require_once('jpgraph_imgtrans.php');
- //JpGraphError::Raise('In order to use image transformation you must include the file jpgraph_imgtrans.php in your script.');
- }
-
- $tform = new ImgTrans($this->img->img);
- $this->img->img = $tform->Skew3D($this->iImgTransHorizon,$this->iImgTransSkewDist,
- $this->iImgTransDirection,$this->iImgTransHighQ,
- $this->iImgTransMinSize,$this->iImgTransFillColor,
- $this->iImgTransBorder);
- }
-
-
- // If the filename is given as the special "__handle"
- // then the image handler is returned and the image is NOT
- // streamed back
- if( $aStrokeFileName == _IMG_HANDLER ) {
- return $this->img->img;
- }
- else {
- // Finally stream the generated picture
- $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,
- $aStrokeFileName);
- }
- }
+ // If the filename is the predefined value = '_csim_special_'
+ // we assume that the call to stroke only needs to do enough
+ // to correctly generate the CSIM maps.
+ // We use this variable to skip things we don't strictly need
+ // to do to generate the image map to improve performance
+ // a best we can. Therefor you will see a lot of tests !$_csim in the
+ // code below.
+ $_csim = ($aStrokeFileName===_CSIM_SPECIALFILE);
+
+ // If we are called the second time (perhaps the user has called GetHTMLImageMap()
+ // himself then the legends have alsready been populated once in order to get the
+ // CSIM coordinats. Since we do not want the legends to be populated a second time
+ // we clear the legends
+ $this->legend->Clear();
+
+ // We need to know if we have stroked the plot in the
+ // GetCSIMareas. Otherwise the CSIM hasn't been generated
+ // and in the case of GetCSIM called before stroke to generate
+ // CSIM without storing an image to disk GetCSIM must call Stroke.
+ $this->iHasStroked = true;
+
+ $n = count($this->plots);
+
+ if( $this->pieaa ) {
+
+ if( !$_csim ) {
+ if( $this->background_image != "" ) {
+ $this->StrokeFrameBackground();
+ }
+ else {
+ $this->StrokeFrame();
+ $this->StrokeBackgroundGrad();
+ }
+ }
+
+
+ $w = $this->img->width;
+ $h = $this->img->height;
+ $oldimg = $this->img->img;
+
+ $this->img->CreateImgCanvas(2*$w,2*$h);
+
+ $this->img->SetColor( $this->margin_color );
+ $this->img->FilledRectangle(0,0,2*$w-1,2*$h-1);
+
+ // Make all icons *2 i size since we will be scaling down the
+ // imahe to do the anti aliasing
+ $ni = count($this->iIcons);
+ for($i=0; $i < $ni; ++$i) {
+ $this->iIcons[$i]->iScale *= 2 ;
+ if( $this->iIcons[$i]->iX > 1 )
+ $this->iIcons[$i]->iX *= 2 ;
+ if( $this->iIcons[$i]->iY > 1 )
+ $this->iIcons[$i]->iY *= 2 ;
+ }
+
+ $this->StrokeIcons();
+
+ for($i=0; $i < $n; ++$i) {
+ if( $this->plots[$i]->posx > 1 )
+ $this->plots[$i]->posx *= 2 ;
+ if( $this->plots[$i]->posy > 1 )
+ $this->plots[$i]->posy *= 2 ;
+
+ $this->plots[$i]->Stroke($this->img,1);
+
+ if( $this->plots[$i]->posx > 1 )
+ $this->plots[$i]->posx /= 2 ;
+ if( $this->plots[$i]->posy > 1 )
+ $this->plots[$i]->posy /= 2 ;
+ }
+
+ $indent = $this->doframe ? ($this->frame_weight + ($this->doshadow ? $this->shadow_width : 0 )) : 0 ;
+ $indent += $this->framebevel ? $this->framebeveldepth + 1 : 0 ;
+ $this->img->CopyCanvasH($oldimg,$this->img->img,$indent,$indent,$indent,$indent,
+ $w-2*$indent,$h-2*$indent,2*($w-$indent),2*($h-$indent));
+
+ $this->img->img = $oldimg ;
+ $this->img->width = $w ;
+ $this->img->height = $h ;
+
+ for($i=0; $i < $n; ++$i) {
+ $this->plots[$i]->Stroke($this->img,2); // Stroke labels
+ $this->plots[$i]->Legend($this);
+ }
+
+ }
+ else {
+
+ if( !$_csim ) {
+ if( $this->background_image != "" ) {
+ $this->StrokeFrameBackground();
+ }
+ else {
+ $this->StrokeFrame();
+ $this->StrokeBackgroundGrad();
+ }
+ }
+
+ $this->StrokeIcons();
+
+ for($i=0; $i < $n; ++$i) {
+ $this->plots[$i]->Stroke($this->img);
+ $this->plots[$i]->Legend($this);
+ }
+ }
+
+ $this->legend->Stroke($this->img);
+ $this->footer->Stroke($this->img);
+ $this->StrokeTitles();
+
+ if( !$_csim ) {
+
+ // Stroke texts
+ if( $this->texts != null ) {
+ $n = count($this->texts);
+ for($i=0; $i < $n; ++$i ) {
+ $this->texts[$i]->Stroke($this->img);
+ }
+ }
+
+ if( _JPG_DEBUG ) {
+ $this->DisplayCSIMAreas();
+ }
+
+ // Should we do any final image transformation
+ if( $this->iImgTrans ) {
+ if( !class_exists('ImgTrans',false) ) {
+ require_once('jpgraph_imgtrans.php');
+ //JpGraphError::Raise('In order to use image transformation you must include the file jpgraph_imgtrans.php in your script.');
+ }
+
+ $tform = new ImgTrans($this->img->img);
+ $this->img->img = $tform->Skew3D($this->iImgTransHorizon,$this->iImgTransSkewDist,
+ $this->iImgTransDirection,$this->iImgTransHighQ,
+ $this->iImgTransMinSize,$this->iImgTransFillColor,
+ $this->iImgTransBorder);
+ }
+
+
+ // If the filename is given as the special "__handle"
+ // then the image handler is returned and the image is NOT
+ // streamed back
+ if( $aStrokeFileName == _IMG_HANDLER ) {
+ return $this->img->img;
+ }
+ else {
+ // Finally stream the generated picture
+ $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,
+ $aStrokeFileName);
+ }
+ }
}
} // Class
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotband.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotband.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotband.php 2006-10-08 04:09:02.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotband.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,35 +1,35 @@
x=$aX;
- $this->y=$aY;
- $this->w=$aWidth;
- $this->h=$aHeight;
- $this->xe=$aX+$aWidth-1;
- $this->ye=$aY+$aHeight-1;
+ public $x,$y,$w,$h;
+ public $xe, $ye;
+ function __construct($aX,$aY,$aWidth,$aHeight) {
+ $this->x=$aX;
+ $this->y=$aY;
+ $this->w=$aWidth;
+ $this->h=$aHeight;
+ $this->xe=$aX+$aWidth-1;
+ $this->ye=$aY+$aHeight-1;
}
}
@@ -37,63 +37,63 @@
// Class RectPattern
// Base class for pattern hierarchi that is used to display patterned
// bands on the graph. Any subclass that doesn't override Stroke()
-// must at least implement method DoPattern(&$aImg) which is responsible
+// must at least implement method DoPattern($aImg) which is responsible
// for drawing the pattern onto the graph.
//=====================================================================
class RectPattern {
- var $color;
- var $weight;
- var $rect=null;
- var $doframe=true;
- var $linespacing; // Line spacing in pixels
- var $iBackgroundColor=-1; // Default is no background fill
-
- function RectPattern($aColor,$aWeight=1) {
- $this->color = $aColor;
- $this->weight = $aWeight;
+ protected $color;
+ protected $weight;
+ protected $rect=null;
+ protected $doframe=true;
+ protected $linespacing; // Line spacing in pixels
+ protected $iBackgroundColor=-1; // Default is no background fill
+
+ function __construct($aColor,$aWeight=1) {
+ $this->color = $aColor;
+ $this->weight = $aWeight;
}
function SetBackground($aBackgroundColor) {
- $this->iBackgroundColor=$aBackgroundColor;
+ $this->iBackgroundColor=$aBackgroundColor;
}
- function SetPos(&$aRect) {
- $this->rect = $aRect;
+ function SetPos($aRect) {
+ $this->rect = $aRect;
}
-
+
function ShowFrame($aShow=true) {
- $this->doframe=$aShow;
+ $this->doframe=$aShow;
}
function SetDensity($aDens) {
- if( $aDens < 1 || $aDens > 100 )
- JpGraphError::RaiseL(16001,$aDens);
-//(" Desity for pattern must be between 1 and 100. (You tried $aDens)");
- // 1% corresponds to linespacing=50
- // 100 % corresponds to linespacing 1
- $this->linespacing = floor(((100-$aDens)/100.0)*50)+1;
+ if( $aDens < 1 || $aDens > 100 )
+ JpGraphError::RaiseL(16001,$aDens);
+ //(" Desity for pattern must be between 1 and 100. (You tried $aDens)");
+ // 1% corresponds to linespacing=50
+ // 100 % corresponds to linespacing 1
+ $this->linespacing = floor(((100-$aDens)/100.0)*50)+1;
}
- function Stroke(&$aImg) {
- if( $this->rect == null )
- JpGraphError::RaiseL(16002);
-//(" No positions specified for pattern.");
-
- if( !(is_numeric($this->iBackgroundColor) && $this->iBackgroundColor==-1) ) {
- $aImg->SetColor($this->iBackgroundColor);
- $aImg->FilledRectangle($this->rect->x,$this->rect->y,$this->rect->xe,$this->rect->ye);
- }
-
- $aImg->SetColor($this->color);
- $aImg->SetLineWeight($this->weight);
-
- // Virtual function implemented by subclass
- $this->DoPattern($aImg);
-
- // Frame around the pattern area
- if( $this->doframe )
- $aImg->Rectangle($this->rect->x,$this->rect->y,$this->rect->xe,$this->rect->ye);
+ function Stroke($aImg) {
+ if( $this->rect == null )
+ JpGraphError::RaiseL(16002);
+ //(" No positions specified for pattern.");
+
+ if( !(is_numeric($this->iBackgroundColor) && $this->iBackgroundColor==-1) ) {
+ $aImg->SetColor($this->iBackgroundColor);
+ $aImg->FilledRectangle($this->rect->x,$this->rect->y,$this->rect->xe,$this->rect->ye);
+ }
+
+ $aImg->SetColor($this->color);
+ $aImg->SetLineWeight($this->weight);
+
+ // Virtual function implemented by subclass
+ $this->DoPattern($aImg);
+
+ // Frame around the pattern area
+ if( $this->doframe )
+ $aImg->Rectangle($this->rect->x,$this->rect->y,$this->rect->xe,$this->rect->ye);
}
}
@@ -105,14 +105,14 @@
//=====================================================================
class RectPatternSolid extends RectPattern {
- function RectPatternSolid($aColor="black",$aWeight=1) {
- parent::RectPattern($aColor,$aWeight);
+ function __construct($aColor="black",$aWeight=1) {
+ parent::__construct($aColor,$aWeight);
}
- function DoPattern(&$aImg) {
- $aImg->SetColor($this->color);
- $aImg->FilledRectangle($this->rect->x,$this->rect->y,
- $this->rect->xe,$this->rect->ye);
+ function DoPattern($aImg) {
+ $aImg->SetColor($this->color);
+ $aImg->FilledRectangle($this->rect->x,$this->rect->y,
+ $this->rect->xe,$this->rect->ye);
}
}
@@ -121,20 +121,20 @@
// Implements horizontal line pattern
//=====================================================================
class RectPatternHor extends RectPattern {
-
- function RectPatternHor($aColor="black",$aWeight=1,$aLineSpacing=7) {
- parent::RectPattern($aColor,$aWeight);
- $this->linespacing = $aLineSpacing;
- }
-
- function DoPattern(&$aImg) {
- $x0 = $this->rect->x;
- $x1 = $this->rect->xe;
- $y = $this->rect->y;
- while( $y < $this->rect->ye ) {
- $aImg->Line($x0,$y,$x1,$y);
- $y += $this->linespacing;
- }
+
+ function __construct($aColor="black",$aWeight=1,$aLineSpacing=7) {
+ parent::__construct($aColor,$aWeight);
+ $this->linespacing = $aLineSpacing;
+ }
+
+ function DoPattern($aImg) {
+ $x0 = $this->rect->x;
+ $x1 = $this->rect->xe;
+ $y = $this->rect->y;
+ while( $y < $this->rect->ye ) {
+ $aImg->Line($x0,$y,$x1,$y);
+ $y += $this->linespacing;
+ }
}
}
@@ -143,24 +143,23 @@
// Implements vertical line pattern
//=====================================================================
class RectPatternVert extends RectPattern {
- var $linespacing=10; // Line spacing in pixels
-
- function RectPatternVert($aColor="black",$aWeight=1,$aLineSpacing=7) {
- parent::RectPattern($aColor,$aWeight);
- $this->linespacing = $aLineSpacing;
+
+ function __construct($aColor="black",$aWeight=1,$aLineSpacing=7) {
+ parent::__construct($aColor,$aWeight);
+ $this->linespacing = $aLineSpacing;
}
//--------------------
// Private methods
//
- function DoPattern(&$aImg) {
- $x = $this->rect->x;
- $y0 = $this->rect->y;
- $y1 = $this->rect->ye;
- while( $x < $this->rect->xe ) {
- $aImg->Line($x,$y0,$x,$y1);
- $x += $this->linespacing;
- }
+ function DoPattern($aImg) {
+ $x = $this->rect->x;
+ $y0 = $this->rect->y;
+ $y1 = $this->rect->ye;
+ while( $x < $this->rect->xe ) {
+ $aImg->Line($x,$y0,$x,$y1);
+ $x += $this->linespacing;
+ }
}
}
@@ -170,133 +169,131 @@
// Implements right diagonal pattern
//=====================================================================
class RectPatternRDiag extends RectPattern {
- var $linespacing; // Line spacing in pixels
-
- function RectPatternRDiag($aColor="black",$aWeight=1,$aLineSpacing=12) {
- parent::RectPattern($aColor,$aWeight);
- $this->linespacing = $aLineSpacing;
- }
-
- function DoPattern(&$aImg) {
- // --------------------
- // | / / / / /|
- // |/ / / / / |
- // | / / / / |
- // --------------------
- $xe = $this->rect->xe;
- $ye = $this->rect->ye;
- $x0 = $this->rect->x + round($this->linespacing/2);
- $y0 = $this->rect->y;
- $x1 = $this->rect->x;
- $y1 = $this->rect->y + round($this->linespacing/2);
-
- while($x0<=$xe && $y1<=$ye) {
- $aImg->Line($x0,$y0,$x1,$y1);
- $x0 += $this->linespacing;
- $y1 += $this->linespacing;
- }
-
- if( $xe-$x1 > $ye-$y0 ) {
- // Width larger than height
- $x1 = $this->rect->x + ($y1-$ye);
- $y1 = $ye;
- $y0 = $this->rect->y;
- while( $x0 <= $xe ) {
- $aImg->Line($x0,$y0,$x1,$y1);
- $x0 += $this->linespacing;
- $x1 += $this->linespacing;
- }
-
- $y0=$this->rect->y + ($x0-$xe);
- $x0=$xe;
- }
- else {
- // Height larger than width
- $diff = $x0-$xe;
- $y0 = $diff+$this->rect->y;
- $x0 = $xe;
- $x1 = $this->rect->x;
- while( $y1 <= $ye ) {
- $aImg->Line($x0,$y0,$x1,$y1);
- $y1 += $this->linespacing;
- $y0 += $this->linespacing;
- }
-
- $diff = $y1-$ye;
- $y1 = $ye;
- $x1 = $diff + $this->rect->x;
- }
-
- while( $y0 <= $ye ) {
- $aImg->Line($x0,$y0,$x1,$y1);
- $y0 += $this->linespacing;
- $x1 += $this->linespacing;
- }
+
+ function __construct($aColor="black",$aWeight=1,$aLineSpacing=12) {
+ parent::__construct($aColor,$aWeight);
+ $this->linespacing = $aLineSpacing;
+ }
+
+ function DoPattern($aImg) {
+ // --------------------
+ // | / / / / /|
+ // |/ / / / / |
+ // | / / / / |
+ // --------------------
+ $xe = $this->rect->xe;
+ $ye = $this->rect->ye;
+ $x0 = $this->rect->x + round($this->linespacing/2);
+ $y0 = $this->rect->y;
+ $x1 = $this->rect->x;
+ $y1 = $this->rect->y + round($this->linespacing/2);
+
+ while($x0<=$xe && $y1<=$ye) {
+ $aImg->Line($x0,$y0,$x1,$y1);
+ $x0 += $this->linespacing;
+ $y1 += $this->linespacing;
+ }
+
+ if( $xe-$x1 > $ye-$y0 ) {
+ // Width larger than height
+ $x1 = $this->rect->x + ($y1-$ye);
+ $y1 = $ye;
+ $y0 = $this->rect->y;
+ while( $x0 <= $xe ) {
+ $aImg->Line($x0,$y0,$x1,$y1);
+ $x0 += $this->linespacing;
+ $x1 += $this->linespacing;
+ }
+
+ $y0=$this->rect->y + ($x0-$xe);
+ $x0=$xe;
+ }
+ else {
+ // Height larger than width
+ $diff = $x0-$xe;
+ $y0 = $diff+$this->rect->y;
+ $x0 = $xe;
+ $x1 = $this->rect->x;
+ while( $y1 <= $ye ) {
+ $aImg->Line($x0,$y0,$x1,$y1);
+ $y1 += $this->linespacing;
+ $y0 += $this->linespacing;
+ }
+
+ $diff = $y1-$ye;
+ $y1 = $ye;
+ $x1 = $diff + $this->rect->x;
+ }
+
+ while( $y0 <= $ye ) {
+ $aImg->Line($x0,$y0,$x1,$y1);
+ $y0 += $this->linespacing;
+ $x1 += $this->linespacing;
+ }
}
}
-
+
//=====================================================================
// Class RectPatternLDiag
// Implements left diagonal pattern
//=====================================================================
class RectPatternLDiag extends RectPattern {
- var $linespacing; // Line spacing in pixels
-
- function RectPatternLDiag($aColor="black",$aWeight=1,$aLineSpacing=12) {
- $this->linespacing = $aLineSpacing;
- parent::RectPattern($aColor,$aWeight);
- }
-
- function DoPattern(&$aImg) {
- // --------------------
- // |\ \ \ \ \ |
- // | \ \ \ \ \|
- // | \ \ \ \ |
- // |------------------|
- $xe = $this->rect->xe;
- $ye = $this->rect->ye;
- $x0 = $this->rect->x + round($this->linespacing/2);
- $y0 = $this->rect->ye;
- $x1 = $this->rect->x;
- $y1 = $this->rect->ye - round($this->linespacing/2);
-
- while($x0<=$xe && $y1>=$this->rect->y) {
- $aImg->Line($x0,$y0,$x1,$y1);
- $x0 += $this->linespacing;
- $y1 -= $this->linespacing;
- }
- if( $xe-$x1 > $ye-$this->rect->y ) {
- // Width larger than height
- $x1 = $this->rect->x + ($this->rect->y-$y1);
- $y0=$ye; $y1=$this->rect->y;
- while( $x0 <= $xe ) {
- $aImg->Line($x0,$y0,$x1,$y1);
- $x0 += $this->linespacing;
- $x1 += $this->linespacing;
- }
-
- $y0=$this->rect->ye - ($x0-$xe);
- $x0=$xe;
- }
- else {
- // Height larger than width
- $diff = $x0-$xe;
- $y0 = $ye-$diff;
- $x0 = $xe;
- while( $y1 >= $this->rect->y ) {
- $aImg->Line($x0,$y0,$x1,$y1);
- $y0 -= $this->linespacing;
- $y1 -= $this->linespacing;
- }
- $diff = $this->rect->y - $y1;
- $x1 = $this->rect->x + $diff;
- $y1 = $this->rect->y;
- }
- while( $y0 >= $this->rect->y ) {
- $aImg->Line($x0,$y0,$x1,$y1);
- $y0 -= $this->linespacing;
- $x1 += $this->linespacing;
- }
+
+ function __construct($aColor="black",$aWeight=1,$aLineSpacing=12) {
+ $this->linespacing = $aLineSpacing;
+ parent::__construct($aColor,$aWeight);
+ }
+
+ function DoPattern($aImg) {
+ // --------------------
+ // |\ \ \ \ \ |
+ // | \ \ \ \ \|
+ // | \ \ \ \ |
+ // |------------------|
+ $xe = $this->rect->xe;
+ $ye = $this->rect->ye;
+ $x0 = $this->rect->x + round($this->linespacing/2);
+ $y0 = $this->rect->ye;
+ $x1 = $this->rect->x;
+ $y1 = $this->rect->ye - round($this->linespacing/2);
+
+ while($x0<=$xe && $y1>=$this->rect->y) {
+ $aImg->Line($x0,$y0,$x1,$y1);
+ $x0 += $this->linespacing;
+ $y1 -= $this->linespacing;
+ }
+ if( $xe-$x1 > $ye-$this->rect->y ) {
+ // Width larger than height
+ $x1 = $this->rect->x + ($this->rect->y-$y1);
+ $y0=$ye; $y1=$this->rect->y;
+ while( $x0 <= $xe ) {
+ $aImg->Line($x0,$y0,$x1,$y1);
+ $x0 += $this->linespacing;
+ $x1 += $this->linespacing;
+ }
+
+ $y0=$this->rect->ye - ($x0-$xe);
+ $x0=$xe;
+ }
+ else {
+ // Height larger than width
+ $diff = $x0-$xe;
+ $y0 = $ye-$diff;
+ $x0 = $xe;
+ while( $y1 >= $this->rect->y ) {
+ $aImg->Line($x0,$y0,$x1,$y1);
+ $y0 -= $this->linespacing;
+ $y1 -= $this->linespacing;
+ }
+ $diff = $this->rect->y - $y1;
+ $x1 = $this->rect->x + $diff;
+ $y1 = $this->rect->y;
+ }
+ while( $y0 >= $this->rect->y ) {
+ $aImg->Line($x0,$y0,$x1,$y1);
+ $y0 -= $this->linespacing;
+ $x1 += $this->linespacing;
+ }
}
}
@@ -305,115 +302,115 @@
// Implements "3D" plane pattern
//=====================================================================
class RectPattern3DPlane extends RectPattern {
- var $alpha=50; // Parameter that specifies the distance
+ private $alpha=50; // Parameter that specifies the distance
// to "simulated" horizon in pixel from the
// top of the band. Specifies how fast the lines
// converge.
- function RectPattern3DPlane($aColor="black",$aWeight=1) {
- parent::RectPattern($aColor,$aWeight);
- $this->SetDensity(10); // Slightly larger default
+ function __construct($aColor="black",$aWeight=1) {
+ parent::__construct($aColor,$aWeight);
+ $this->SetDensity(10); // Slightly larger default
}
function SetHorizon($aHorizon) {
- $this->alpha=$aHorizon;
+ $this->alpha=$aHorizon;
}
-
- function DoPattern(&$aImg) {
- // "Fake" a nice 3D grid-effect.
- $x0 = $this->rect->x + $this->rect->w/2;
- $y0 = $this->rect->y;
- $x1 = $x0;
- $y1 = $this->rect->ye;
- $x0_right = $x0;
- $x1_right = $x1;
-
- // BTW "apa" means monkey in Swedish but is really a shortform for
- // "alpha+a" which was the labels I used on paper when I derived the
- // geometric to get the 3D perspective right.
- // $apa is the height of the bounding rectangle plus the distance to the
- // artifical horizon (alpha)
- $apa = $this->rect->h + $this->alpha;
-
- // Three cases and three loops
- // 1) The endpoint of the line ends on the bottom line
- // 2) The endpoint ends on the side
- // 3) Horizontal lines
-
- // Endpoint falls on bottom line
- $middle=$this->rect->x + $this->rect->w/2;
- $dist=$this->linespacing;
- $factor=$this->alpha /($apa);
- while($x1>$this->rect->x) {
- $aImg->Line($x0,$y0,$x1,$y1);
- $aImg->Line($x0_right,$y0,$x1_right,$y1);
- $x1 = $middle - $dist;
- $x0 = $middle - $dist * $factor;
- $x1_right = $middle + $dist;
- $x0_right = $middle + $dist * $factor;
- $dist += $this->linespacing;
- }
-
- // Endpoint falls on sides
- $dist -= $this->linespacing;
- $d=$this->rect->w/2;
- $c = $apa - $d*$apa/$dist;
- while( $x0>$this->rect->x ) {
- $aImg->Line($x0,$y0,$this->rect->x,$this->rect->ye-$c);
- $aImg->Line($x0_right,$y0,$this->rect->xe,$this->rect->ye-$c);
- $dist += $this->linespacing;
- $x0 = $middle - $dist * $factor;
- $x1 = $middle - $dist;
- $x0_right = $middle + $dist * $factor;
- $c = $apa - $d*$apa/$dist;
- }
-
- // Horizontal lines
- // They need some serious consideration since they are a function
- // of perspective depth (alpha) and density (linespacing)
- $x0=$this->rect->x;
- $x1=$this->rect->xe;
- $y=$this->rect->ye;
-
- // The first line is drawn directly. Makes the loop below slightly
- // more readable.
- $aImg->Line($x0,$y,$x1,$y);
- $hls = $this->linespacing;
-
- // A correction factor for vertical "brick" line spacing to account for
- // a) the difference in number of pixels hor vs vert
- // b) visual apperance to make the first layer of "bricks" look more
- // square.
- $vls = $this->linespacing*0.6;
-
- $ds = $hls*($apa-$vls)/$apa;
- // Get the slope for the "perspective line" going from bottom right
- // corner to top left corner of the "first" brick.
-
- // Uncomment the following lines if you want to get a visual understanding
- // of what this helpline does. BTW this mimics the way you would get the
- // perspective right when drawing on paper.
- /*
- $x0 = $middle;
- $y0 = $this->rect->ye;
- $len=floor(($this->rect->ye-$this->rect->y)/$vls);
- $x1 = $middle+round($len*$ds);
- $y1 = $this->rect->ye-$len*$vls;
- $aImg->PushColor("red");
- $aImg->Line($x0,$y0,$x1,$y1);
- $aImg->PopColor();
- */
-
- $y -= $vls;
- $k=($this->rect->ye-($this->rect->ye-$vls))/($middle-($middle-$ds));
- $dist = $hls;
- while( $y>$this->rect->y ) {
- $aImg->Line($this->rect->x,$y,$this->rect->xe,$y);
- $adj = $k*$dist/(1+$dist*$k/$apa);
- if( $adj < 2 ) $adj=1;
- $y = $this->rect->ye - round($adj);
- $dist += $hls;
- }
+
+ function DoPattern($aImg) {
+ // "Fake" a nice 3D grid-effect.
+ $x0 = $this->rect->x + $this->rect->w/2;
+ $y0 = $this->rect->y;
+ $x1 = $x0;
+ $y1 = $this->rect->ye;
+ $x0_right = $x0;
+ $x1_right = $x1;
+
+ // BTW "apa" means monkey in Swedish but is really a shortform for
+ // "alpha+a" which was the labels I used on paper when I derived the
+ // geometric to get the 3D perspective right.
+ // $apa is the height of the bounding rectangle plus the distance to the
+ // artifical horizon (alpha)
+ $apa = $this->rect->h + $this->alpha;
+
+ // Three cases and three loops
+ // 1) The endpoint of the line ends on the bottom line
+ // 2) The endpoint ends on the side
+ // 3) Horizontal lines
+
+ // Endpoint falls on bottom line
+ $middle=$this->rect->x + $this->rect->w/2;
+ $dist=$this->linespacing;
+ $factor=$this->alpha /($apa);
+ while($x1>$this->rect->x) {
+ $aImg->Line($x0,$y0,$x1,$y1);
+ $aImg->Line($x0_right,$y0,$x1_right,$y1);
+ $x1 = $middle - $dist;
+ $x0 = $middle - $dist * $factor;
+ $x1_right = $middle + $dist;
+ $x0_right = $middle + $dist * $factor;
+ $dist += $this->linespacing;
+ }
+
+ // Endpoint falls on sides
+ $dist -= $this->linespacing;
+ $d=$this->rect->w/2;
+ $c = $apa - $d*$apa/$dist;
+ while( $x0>$this->rect->x ) {
+ $aImg->Line($x0,$y0,$this->rect->x,$this->rect->ye-$c);
+ $aImg->Line($x0_right,$y0,$this->rect->xe,$this->rect->ye-$c);
+ $dist += $this->linespacing;
+ $x0 = $middle - $dist * $factor;
+ $x1 = $middle - $dist;
+ $x0_right = $middle + $dist * $factor;
+ $c = $apa - $d*$apa/$dist;
+ }
+
+ // Horizontal lines
+ // They need some serious consideration since they are a function
+ // of perspective depth (alpha) and density (linespacing)
+ $x0=$this->rect->x;
+ $x1=$this->rect->xe;
+ $y=$this->rect->ye;
+
+ // The first line is drawn directly. Makes the loop below slightly
+ // more readable.
+ $aImg->Line($x0,$y,$x1,$y);
+ $hls = $this->linespacing;
+
+ // A correction factor for vertical "brick" line spacing to account for
+ // a) the difference in number of pixels hor vs vert
+ // b) visual apperance to make the first layer of "bricks" look more
+ // square.
+ $vls = $this->linespacing*0.6;
+
+ $ds = $hls*($apa-$vls)/$apa;
+ // Get the slope for the "perspective line" going from bottom right
+ // corner to top left corner of the "first" brick.
+
+ // Uncomment the following lines if you want to get a visual understanding
+ // of what this helpline does. BTW this mimics the way you would get the
+ // perspective right when drawing on paper.
+ /*
+ $x0 = $middle;
+ $y0 = $this->rect->ye;
+ $len=floor(($this->rect->ye-$this->rect->y)/$vls);
+ $x1 = $middle+round($len*$ds);
+ $y1 = $this->rect->ye-$len*$vls;
+ $aImg->PushColor("red");
+ $aImg->Line($x0,$y0,$x1,$y1);
+ $aImg->PopColor();
+ */
+
+ $y -= $vls;
+ $k=($this->rect->ye-($this->rect->ye-$vls))/($middle-($middle-$ds));
+ $dist = $hls;
+ while( $y>$this->rect->y ) {
+ $aImg->Line($this->rect->x,$y,$this->rect->xe,$y);
+ $adj = $k*$dist/(1+$dist*$k/$apa);
+ if( $adj < 2 ) $adj=1;
+ $y = $this->rect->ye - round($adj);
+ $dist += $hls;
+ }
}
}
@@ -422,33 +419,33 @@
// Vert/Hor crosses
//=====================================================================
class RectPatternCross extends RectPattern {
- var $vert=null;
- var $hor=null;
- function RectPatternCross($aColor="black",$aWeight=1) {
- parent::RectPattern($aColor,$aWeight);
- $this->vert = new RectPatternVert($aColor,$aWeight);
- $this->hor = new RectPatternHor($aColor,$aWeight);
+ private $vert=null;
+ private $hor=null;
+ function __construct($aColor="black",$aWeight=1) {
+ parent::__construct($aColor,$aWeight);
+ $this->vert = new RectPatternVert($aColor,$aWeight);
+ $this->hor = new RectPatternHor($aColor,$aWeight);
}
function SetOrder($aDepth) {
- $this->vert->SetOrder($aDepth);
- $this->hor->SetOrder($aDepth);
+ $this->vert->SetOrder($aDepth);
+ $this->hor->SetOrder($aDepth);
}
- function SetPos(&$aRect) {
- parent::SetPos($aRect);
- $this->vert->SetPos($aRect);
- $this->hor->SetPos($aRect);
+ function SetPos($aRect) {
+ parent::SetPos($aRect);
+ $this->vert->SetPos($aRect);
+ $this->hor->SetPos($aRect);
}
function SetDensity($aDens) {
- $this->vert->SetDensity($aDens);
- $this->hor->SetDensity($aDens);
+ $this->vert->SetDensity($aDens);
+ $this->hor->SetDensity($aDens);
}
- function DoPattern(&$aImg) {
- $this->vert->DoPattern($aImg);
- $this->hor->DoPattern($aImg);
+ function DoPattern($aImg) {
+ $this->vert->DoPattern($aImg);
+ $this->hor->DoPattern($aImg);
}
}
@@ -458,76 +455,76 @@
//=====================================================================
class RectPatternDiagCross extends RectPattern {
- var $left=null;
- var $right=null;
- function RectPatternDiagCross($aColor="black",$aWeight=1) {
- parent::RectPattern($aColor,$aWeight);
- $this->right = new RectPatternRDiag($aColor,$aWeight);
- $this->left = new RectPatternLDiag($aColor,$aWeight);
+ private $left=null;
+ private $right=null;
+ function __construct($aColor="black",$aWeight=1) {
+ parent::__construct($aColor,$aWeight);
+ $this->right = new RectPatternRDiag($aColor,$aWeight);
+ $this->left = new RectPatternLDiag($aColor,$aWeight);
}
function SetOrder($aDepth) {
- $this->left->SetOrder($aDepth);
- $this->right->SetOrder($aDepth);
+ $this->left->SetOrder($aDepth);
+ $this->right->SetOrder($aDepth);
}
- function SetPos(&$aRect) {
- parent::SetPos($aRect);
- $this->left->SetPos($aRect);
- $this->right->SetPos($aRect);
+ function SetPos($aRect) {
+ parent::SetPos($aRect);
+ $this->left->SetPos($aRect);
+ $this->right->SetPos($aRect);
}
function SetDensity($aDens) {
- $this->left->SetDensity($aDens);
- $this->right->SetDensity($aDens);
+ $this->left->SetDensity($aDens);
+ $this->right->SetDensity($aDens);
}
- function DoPattern(&$aImg) {
- $this->left->DoPattern($aImg);
- $this->right->DoPattern($aImg);
+ function DoPattern($aImg) {
+ $this->left->DoPattern($aImg);
+ $this->right->DoPattern($aImg);
}
}
//=====================================================================
// Class RectPatternFactory
-// Factory class for rectangular pattern
+// Factory class for rectangular pattern
//=====================================================================
class RectPatternFactory {
- function RectPatternFactory() {
- // Empty
+ function __construct() {
+ // Empty
}
function Create($aPattern,$aColor,$aWeight=1) {
- switch($aPattern) {
- case BAND_RDIAG:
- $obj = new RectPatternRDiag($aColor,$aWeight);
- break;
- case BAND_LDIAG:
- $obj = new RectPatternLDiag($aColor,$aWeight);
- break;
- case BAND_SOLID:
- $obj = new RectPatternSolid($aColor,$aWeight);
- break;
- case BAND_VLINE:
- $obj = new RectPatternVert($aColor,$aWeight);
- break;
- case BAND_HLINE:
- $obj = new RectPatternHor($aColor,$aWeight);
- break;
- case BAND_3DPLANE:
- $obj = new RectPattern3DPlane($aColor,$aWeight);
- break;
- case BAND_HVCROSS:
- $obj = new RectPatternCross($aColor,$aWeight);
- break;
- case BAND_DIAGCROSS:
- $obj = new RectPatternDiagCross($aColor,$aWeight);
- break;
- default:
- JpGraphError::RaiseL(16003,$aPattern);
-//(" Unknown pattern specification ($aPattern)");
- }
- return $obj;
+ switch($aPattern) {
+ case BAND_RDIAG:
+ $obj = new RectPatternRDiag($aColor,$aWeight);
+ break;
+ case BAND_LDIAG:
+ $obj = new RectPatternLDiag($aColor,$aWeight);
+ break;
+ case BAND_SOLID:
+ $obj = new RectPatternSolid($aColor,$aWeight);
+ break;
+ case BAND_VLINE:
+ $obj = new RectPatternVert($aColor,$aWeight);
+ break;
+ case BAND_HLINE:
+ $obj = new RectPatternHor($aColor,$aWeight);
+ break;
+ case BAND_3DPLANE:
+ $obj = new RectPattern3DPlane($aColor,$aWeight);
+ break;
+ case BAND_HVCROSS:
+ $obj = new RectPatternCross($aColor,$aWeight);
+ break;
+ case BAND_DIAGCROSS:
+ $obj = new RectPatternDiagCross($aColor,$aWeight);
+ break;
+ default:
+ JpGraphError::RaiseL(16003,$aPattern);
+ //(" Unknown pattern specification ($aPattern)");
+ }
+ return $obj;
}
}
@@ -539,94 +536,98 @@
// concrete class.
//=====================================================================
class PlotBand {
- var $prect=null;
- var $depth;
- var $dir, $min, $max;
-
- function PlotBand($aDir,$aPattern,$aMin,$aMax,$aColor="black",$aWeight=1,$aDepth=DEPTH_BACK) {
- $f = new RectPatternFactory();
- $this->prect = $f->Create($aPattern,$aColor,$aWeight);
- if( is_numeric($aMin) && is_numeric($aMax) && ($aMin > $aMax) )
- JpGraphError::RaiseL(16004);
-//('Min value for plotband is larger than specified max value. Please correct.');
- $this->dir = $aDir;
- $this->min = $aMin;
- $this->max = $aMax;
- $this->depth=$aDepth;
+ public $depth; // Determine if band should be over or under the plots
+ private $prect=null;
+ private $dir, $min, $max;
+
+ function __construct($aDir,$aPattern,$aMin,$aMax,$aColor="black",$aWeight=1,$aDepth=DEPTH_BACK) {
+ $f = new RectPatternFactory();
+ $this->prect = $f->Create($aPattern,$aColor,$aWeight);
+ if( is_numeric($aMin) && is_numeric($aMax) && ($aMin > $aMax) )
+ JpGraphError::RaiseL(16004);
+ //('Min value for plotband is larger than specified max value. Please correct.');
+ $this->dir = $aDir;
+ $this->min = $aMin;
+ $this->max = $aMax;
+ $this->depth=$aDepth;
}
-
+
// Set position. aRect contains absolute image coordinates
- function SetPos(&$aRect) {
- assert( $this->prect != null ) ;
- $this->prect->SetPos($aRect);
+ function SetPos($aRect) {
+ assert( $this->prect != null ) ;
+ $this->prect->SetPos($aRect);
}
-
+
function ShowFrame($aFlag=true) {
- $this->prect->ShowFrame($aFlag);
+ $this->prect->ShowFrame($aFlag);
}
// Set z-order. In front of pplot or in the back
function SetOrder($aDepth) {
- $this->depth=$aDepth;
+ $this->depth=$aDepth;
}
-
+
function SetDensity($aDens) {
- $this->prect->SetDensity($aDens);
+ $this->prect->SetDensity($aDens);
}
-
+
function GetDir() {
- return $this->dir;
+ return $this->dir;
}
-
+
function GetMin() {
- return $this->min;
+ return $this->min;
}
-
+
function GetMax() {
- return $this->max;
+ return $this->max;
+ }
+
+ function PreStrokeAdjust($aGraph) {
+ // Nothing to do
}
-
+
// Display band
- function Stroke(&$aImg,&$aXScale,&$aYScale) {
- assert( $this->prect != null ) ;
- if( $this->dir == HORIZONTAL ) {
- if( $this->min === 'min' ) $this->min = $aYScale->GetMinVal();
- if( $this->max === 'max' ) $this->max = $aYScale->GetMaxVal();
+ function Stroke($aImg,$aXScale,$aYScale) {
+ assert( $this->prect != null ) ;
+ if( $this->dir == HORIZONTAL ) {
+ if( $this->min === 'min' ) $this->min = $aYScale->GetMinVal();
+ if( $this->max === 'max' ) $this->max = $aYScale->GetMaxVal();
// Only draw the bar if it actually appears in the range
if ($this->min < $aYScale->GetMaxVal() && $this->max > $aYScale->GetMinVal()) {
-
- // Trucate to limit of axis
- $this->min = max($this->min, $aYScale->GetMinVal());
- $this->max = min($this->max, $aYScale->GetMaxVal());
-
- $x=$aXScale->scale_abs[0];
- $y=$aYScale->Translate($this->max);
- $width=$aXScale->scale_abs[1]-$aXScale->scale_abs[0]+1;
- $height=abs($y-$aYScale->Translate($this->min))+1;
- $this->prect->SetPos(new Rectangle($x,$y,$width,$height));
- $this->prect->Stroke($aImg);
+
+ // Trucate to limit of axis
+ $this->min = max($this->min, $aYScale->GetMinVal());
+ $this->max = min($this->max, $aYScale->GetMaxVal());
+
+ $x=$aXScale->scale_abs[0];
+ $y=$aYScale->Translate($this->max);
+ $width=$aXScale->scale_abs[1]-$aXScale->scale_abs[0]+1;
+ $height=abs($y-$aYScale->Translate($this->min))+1;
+ $this->prect->SetPos(new Rectangle($x,$y,$width,$height));
+ $this->prect->Stroke($aImg);
}
- }
- else { // VERTICAL
- if( $this->min === 'min' ) $this->min = $aXScale->GetMinVal();
- if( $this->max === 'max' ) $this->max = $aXScale->GetMaxVal();
-
+ }
+ else { // VERTICAL
+ if( $this->min === 'min' ) $this->min = $aXScale->GetMinVal();
+ if( $this->max === 'max' ) $this->max = $aXScale->GetMaxVal();
+
// Only draw the bar if it actually appears in the range
- if ($this->min < $aXScale->GetMaxVal() && $this->max > $aXScale->GetMinVal()) {
-
- // Trucate to limit of axis
- $this->min = max($this->min, $aXScale->GetMinVal());
- $this->max = min($this->max, $aXScale->GetMaxVal());
-
- $y=$aYScale->scale_abs[1];
- $x=$aXScale->Translate($this->min);
- $height=abs($aYScale->scale_abs[1]-$aYScale->scale_abs[0]);
- $width=abs($x-$aXScale->Translate($this->max));
- $this->prect->SetPos(new Rectangle($x,$y,$width,$height));
- $this->prect->Stroke($aImg);
+ if ($this->min < $aXScale->GetMaxVal() && $this->max > $aXScale->GetMinVal()) {
+
+ // Trucate to limit of axis
+ $this->min = max($this->min, $aXScale->GetMinVal());
+ $this->max = min($this->max, $aXScale->GetMaxVal());
+
+ $y=$aYScale->scale_abs[1];
+ $x=$aXScale->Translate($this->min);
+ $height=abs($aYScale->scale_abs[1]-$aYScale->scale_abs[0]);
+ $width=abs($x-$aXScale->Translate($this->max));
+ $this->prect->SetPos(new Rectangle($x,$y,$width,$height));
+ $this->prect->Stroke($aImg);
}
- }
+ }
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotline.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotline.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotline.php 1969-12-31 19:00:00.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotline.php 1970-01-01 04:13:08.000000000 -0500
@@ -0,0 +1,138 @@
+direction = $aDir;
+ $this->color=$aColor;
+ $this->weight=$aWeight;
+ $this->scaleposition=$aPos;
+ }
+
+ function SetLegend($aLegend,$aCSIM='',$aCSIMAlt='',$aCSIMWinTarget='') {
+ $this->legend = $aLegend;
+ $this->legendcsimtarget = $aCSIM;
+ $this->legendcsimwintarget = $aCSIMWinTarget;
+ $this->legendcsimalt = $aCSIMAlt;
+ }
+
+ function HideLegend($f=true) {
+ $this->hidelegend = $f;
+ }
+
+ function SetPosition($aScalePosition) {
+ $this->scaleposition=$aScalePosition;
+ }
+
+ function SetDirection($aDir) {
+ $this->direction = $aDir;
+ }
+
+ function SetColor($aColor) {
+ $this->color=$aColor;
+ }
+
+ function SetWeight($aWeight) {
+ $this->weight=$aWeight;
+ }
+
+ function SetLineStyle($aStyle) {
+ $this->iLineStyle = $aStyle;
+ }
+
+ //---------------
+ // PRIVATE METHODS
+
+ function DoLegend($graph) {
+ if( !$this->hidelegend ) $this->Legend($graph);
+ }
+
+ // Framework function the chance for each plot class to set a legend
+ function Legend($aGraph) {
+ if( $this->legend != '' ) {
+ $dummyPlotMark = new PlotMark();
+ $lineStyle = 1;
+ $aGraph->legend->Add($this->legend,$this->color,$dummyPlotMark,$lineStyle,
+ $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ }
+ }
+
+ function PreStrokeAdjust($aGraph) {
+ // Nothing to do
+ }
+
+ // Called by framework to allow the object to draw
+ // optional information in the margin area
+ function StrokeMargin($aImg) {
+ // Nothing to do
+ }
+
+ // Framework function to allow the object to adjust the scale
+ function PrescaleSetup($aGraph) {
+ // Nothing to do
+ }
+
+ function Min() {
+ return array(null,null);
+ }
+
+ function Max() {
+ return array(null,null);
+ }
+
+ function _Stroke($aImg,$aMinX,$aMinY,$aMaxX,$aMaxY,$aXPos,$aYPos) {
+ $aImg->SetColor($this->color);
+ $aImg->SetLineWeight($this->weight);
+ $oldStyle = $aImg->SetLineStyle($this->iLineStyle);
+ if( $this->direction == VERTICAL ) {
+ $ymin_abs = $aMinY;
+ $ymax_abs = $aMaxY;
+ $xpos_abs = $aXPos;
+ $aImg->StyleLine($xpos_abs, $ymin_abs, $xpos_abs, $ymax_abs);
+ }
+ elseif( $this->direction == HORIZONTAL ) {
+ $xmin_abs = $aMinX;
+ $xmax_abs = $aMaxX;
+ $ypos_abs = $aYPos;
+ $aImg->StyleLine($xmin_abs, $ypos_abs, $xmax_abs, $ypos_abs);
+ }
+ else {
+ JpGraphError::RaiseL(25125);//(" Illegal direction for static line");
+ }
+ $aImg->SetLineStyle($oldStyle);
+ }
+
+ function Stroke($aImg,$aXScale,$aYScale) {
+ $this->_Stroke($aImg,
+ $aImg->left_margin,
+ $aYScale->Translate($aYScale->GetMinVal()),
+ $aImg->width-$aImg->right_margin,
+ $aYScale->Translate($aYScale->GetMaxVal()),
+ $aXScale->Translate($this->scaleposition),
+ $aYScale->Translate($this->scaleposition)
+ );
+ }
+}
+
+
+?>
\ Pas de fin de ligne à la fin du fichier.
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotmark.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotmark.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotmark.inc.php 2007-11-17 06:41:42.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_plotmark.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,496 +1,504 @@
an[$aMark];
- if( is_string($aIdx) ) {
- if( !in_array($aIdx,$this->colors) ) {
- JpGraphError::RaiseL(23001,$this->name,$aIdx); //('This marker "'.($this->name).'" does not exist in color: '.$aIdx);
- }
- $idx = $this->index[$aIdx];
- }
- elseif( !is_integer($aIdx) ||
- (is_integer($aIdx) && $aIdx > $this->maxidx ) ) {
- JpGraphError::RaiseL(23002,$this->name);
-//('Mark color index too large for marker "'.($this->name).'"');
- }
- else
- $idx = $aIdx ;
- return Image::CreateFromString(base64_decode($this->{$n}[$idx][1]));
- }
- function GetAnchor() {
- return array($this->anchor_x,$this->anchor_y);
- }
-}
-
-
-// Keep a global flag cache to reduce memory usage
-$_gFlagCache=array(
- 1 => null,
- 2 => null,
- 3 => null,
- 4 => null,
-);
-// Only supposed to b called as statics
-class FlagCache {
- function GetFlagImgByName($aSize,$aName) {
- global $_gFlagCache;
- require_once('jpgraph_flags.php');
- if( $_gFlagCache[$aSize] === null ) {
- $_gFlagCache[$aSize] =& new FlagImages($aSize);
- }
- $f =& $_gFlagCache[$aSize];
- $idx = $f->GetIdxByName($aName,$aFullName);
- return $f->GetImgByIdx($idx);
- }
-}
-
//===================================================
// CLASS PlotMark
// Description: Handles the plot marks in graphs
//===================================================
+
class PlotMark {
- var $title, $show=true;
- var $type,$weight=1;
- var $color="black", $width=4, $fill_color="blue";
- var $yvalue,$xvalue='',$csimtarget='',$csimwintarget='',$csimalt='',$csimareas;
- var $iFormatCallback="";
- var $iFormatCallback2="";
- var $markimg='',$iScale=1.0;
- var $oldfilename='',$iFileName='';
- var $imgdata_balls = null;
- var $imgdata_diamonds = null;
- var $imgdata_squares = null;
- var $imgdata_bevels = null;
- var $imgdata_stars = null;
- var $imgdata_pushpins = null;
-
-//--------------
-// CONSTRUCTOR
- function PlotMark() {
- $this->title = new Text();
- $this->title->Hide();
- $this->csimareas = '';
- $this->type=-1;
+ public $title, $show=true;
+ public $type,$weight=1;
+ public $iFormatCallback="", $iFormatCallback2="";
+ public $fill_color="blue";
+ public $color="black", $width=4;
+ private $yvalue,$xvalue='',$csimtarget,$csimwintarget='',$csimalt,$csimareas;
+ private $markimg='',$iScale=1.0;
+ private $oldfilename='',$iFileName='';
+ private $imgdata_balls = null;
+ private $imgdata_diamonds = null;
+ private $imgdata_squares = null;
+ private $imgdata_bevels = null;
+ private $imgdata_stars = null;
+ private $imgdata_pushpins = null;
+
+ //--------------
+ // CONSTRUCTOR
+ function __construct() {
+ $this->title = new Text();
+ $this->title->Hide();
+ $this->csimareas = '';
+ $this->type=-1;
}
-//---------------
-// PUBLIC METHODS
+ //---------------
+ // PUBLIC METHODS
function SetType($aType,$aFileName='',$aScale=1.0) {
- $this->type = $aType;
- if( $aType == MARK_IMG && $aFileName=='' ) {
- JpGraphError::RaiseL(23003);//('A filename must be specified if you set the mark type to MARK_IMG.');
- }
- $this->iFileName = $aFileName;
- $this->iScale = $aScale;
+ $this->type = $aType;
+ if( $aType == MARK_IMG && $aFileName=='' ) {
+ JpGraphError::RaiseL(23003);//('A filename must be specified if you set the mark type to MARK_IMG.');
+ }
+ $this->iFileName = $aFileName;
+ $this->iScale = $aScale;
}
-
+
function SetCallback($aFunc) {
- $this->iFormatCallback = $aFunc;
+ $this->iFormatCallback = $aFunc;
}
function SetCallbackYX($aFunc) {
- $this->iFormatCallback2 = $aFunc;
+ $this->iFormatCallback2 = $aFunc;
}
-
+
function GetType() {
- return $this->type;
+ return $this->type;
}
-
+
function SetColor($aColor) {
- $this->color=$aColor;
+ $this->color=$aColor;
}
-
+
function SetFillColor($aFillColor) {
- $this->fill_color = $aFillColor;
+ $this->fill_color = $aFillColor;
}
function SetWeight($aWeight) {
- $this->weight = $aWeight;
+ $this->weight = $aWeight;
}
// Synonym for SetWidth()
function SetSize($aWidth) {
- $this->width=$aWidth;
+ $this->width=$aWidth;
}
-
+
function SetWidth($aWidth) {
- $this->width=$aWidth;
+ $this->width=$aWidth;
}
function SetDefaultWidth() {
- switch( $this->type ) {
- case MARK_CIRCLE:
- case MARK_FILLEDCIRCLE:
- $this->width=4;
- break;
- default:
- $this->width=7;
- }
+ switch( $this->type ) {
+ case MARK_CIRCLE:
+ case MARK_FILLEDCIRCLE:
+ $this->width=4;
+ break;
+ default:
+ $this->width=7;
+ }
}
-
+
function GetWidth() {
- return $this->width;
+ return $this->width;
}
-
+
function Hide($aHide=true) {
- $this->show = !$aHide;
+ $this->show = !$aHide;
}
-
+
function Show($aShow=true) {
- $this->show = $aShow;
+ $this->show = $aShow;
}
function SetCSIMAltVal($aY,$aX='') {
- $this->yvalue=$aY;
- $this->xvalue=$aX;
+ $this->yvalue=$aY;
+ $this->xvalue=$aX;
}
-
+
function SetCSIMTarget($aTarget,$aWinTarget='') {
$this->csimtarget=$aTarget;
$this->csimwintarget=$aWinTarget;
}
-
+
function SetCSIMAlt($aAlt) {
$this->csimalt=$aAlt;
}
-
+
function GetCSIMAreas(){
return $this->csimareas;
}
-
+
function AddCSIMPoly($aPts) {
$coords = round($aPts[0]).", ".round($aPts[1]);
$n = count($aPts)/2;
for( $i=1; $i < $n; ++$i){
$coords .= ", ".round($aPts[2*$i]).", ".round($aPts[2*$i+1]);
}
- $this->csimareas="";
+ $this->csimareas="";
if( !empty($this->csimtarget) ) {
- $this->csimareas .= "csimtarget)."\"";
+ $this->csimareas .= "csimtarget)."\"";
- if( !empty($this->csimwintarget) ) {
- $this->csimareas .= " target=\"".$this->csimwintarget."\" ";
- }
-
- if( !empty($this->csimalt) ) {
- $tmp=sprintf($this->csimalt,$this->yvalue,$this->xvalue);
- $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
- }
- $this->csimareas .= " />\n";
- }
+ if( !empty($this->csimwintarget) ) {
+ $this->csimareas .= " target=\"".$this->csimwintarget."\" ";
+ }
+
+ if( !empty($this->csimalt) ) {
+ $tmp=sprintf($this->csimalt,$this->yvalue,$this->xvalue);
+ $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\"";
+ }
+ $this->csimareas .= " />\n";
+ }
}
-
+
function AddCSIMCircle($x,$y,$r) {
- $x = round($x); $y=round($y); $r=round($r);
- $this->csimareas="";
+ $x = round($x); $y=round($y); $r=round($r);
+ $this->csimareas="";
if( !empty($this->csimtarget) ) {
- $this->csimareas .= "csimtarget)."\"";
+ $this->csimareas .= "csimtarget)."\"";
+
+ if( !empty($this->csimwintarget) ) {
+ $this->csimareas .= " target=\"".$this->csimwintarget."\" ";
+ }
+
+ if( !empty($this->csimalt) ) {
+ $tmp=sprintf($this->csimalt,$this->yvalue,$this->xvalue);
+ $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
+ }
+ $this->csimareas .= " />\n";
+ }
+ }
+
+ function Stroke($img,$x,$y) {
+ if( !$this->show ) return;
+
+ if( $this->iFormatCallback != '' || $this->iFormatCallback2 != '' ) {
+
+ if( $this->iFormatCallback != '' ) {
+ $f = $this->iFormatCallback;
+ list($width,$color,$fcolor) = call_user_func($f,$this->yvalue);
+ $filename = $this->iFileName;
+ $imgscale = $this->iScale;
+ }
+ else {
+ $f = $this->iFormatCallback2;
+ list($width,$color,$fcolor,$filename,$imgscale) = call_user_func($f,$this->yvalue,$this->xvalue);
+ if( $filename=="" ) $filename = $this->iFileName;
+ if( $imgscale=="" ) $imgscale = $this->iScale;
+ }
+
+ if( $width=="" ) $width = $this->width;
+ if( $color=="" ) $color = $this->color;
+ if( $fcolor=="" ) $fcolor = $this->fill_color;
+
+ }
+ else {
+ $fcolor = $this->fill_color;
+ $color = $this->color;
+ $width = $this->width;
+ $filename = $this->iFileName;
+ $imgscale = $this->iScale;
+ }
+
+ if( $this->type == MARK_IMG ||
+ ($this->type >= MARK_FLAG1 && $this->type <= MARK_FLAG4 ) ||
+ $this->type >= MARK_IMG_PUSHPIN ) {
+
+ // Note: For the builtin images we use the "filename" parameter
+ // to denote the color
+ $anchor_x = 0.5;
+ $anchor_y = 0.5;
+ switch( $this->type ) {
+ case MARK_FLAG1:
+ case MARK_FLAG2:
+ case MARK_FLAG3:
+ case MARK_FLAG4:
+ $this->markimg = FlagCache::GetFlagImgByName($this->type-MARK_FLAG1+1,$filename);
+ break;
+
+ case MARK_IMG :
+ // Load an image and use that as a marker
+ // Small optimization, if we have already read an image don't
+ // waste time reading it again.
+ if( $this->markimg == '' || !($this->oldfilename === $filename) ) {
+ $this->markimg = Graph::LoadBkgImage('',$filename);
+ $this->oldfilename = $filename ;
+ }
+ break;
+
+ case MARK_IMG_PUSHPIN:
+ case MARK_IMG_SPUSHPIN:
+ case MARK_IMG_LPUSHPIN:
+ if( $this->imgdata_pushpins == null ) {
+ require_once 'imgdata_pushpins.inc.php';
+ $this->imgdata_pushpins = new ImgData_PushPins();
+ }
+ $this->markimg = $this->imgdata_pushpins->GetImg($this->type,$filename);
+ list($anchor_x,$anchor_y) = $this->imgdata_pushpins->GetAnchor();
+ break;
+
+ case MARK_IMG_SQUARE:
+ if( $this->imgdata_squares == null ) {
+ require_once 'imgdata_squares.inc.php';
+ $this->imgdata_squares = new ImgData_Squares();
+ }
+ $this->markimg = $this->imgdata_squares->GetImg($this->type,$filename);
+ list($anchor_x,$anchor_y) = $this->imgdata_squares->GetAnchor();
+ break;
+
+ case MARK_IMG_STAR:
+ if( $this->imgdata_stars == null ) {
+ require_once 'imgdata_stars.inc.php';
+ $this->imgdata_stars = new ImgData_Stars();
+ }
+ $this->markimg = $this->imgdata_stars->GetImg($this->type,$filename);
+ list($anchor_x,$anchor_y) = $this->imgdata_stars->GetAnchor();
+ break;
+
+ case MARK_IMG_BEVEL:
+ if( $this->imgdata_bevels == null ) {
+ require_once 'imgdata_bevels.inc.php';
+ $this->imgdata_bevels = new ImgData_Bevels();
+ }
+ $this->markimg = $this->imgdata_bevels->GetImg($this->type,$filename);
+ list($anchor_x,$anchor_y) = $this->imgdata_bevels->GetAnchor();
+ break;
+
+ case MARK_IMG_DIAMOND:
+ if( $this->imgdata_diamonds == null ) {
+ require_once 'imgdata_diamonds.inc.php';
+ $this->imgdata_diamonds = new ImgData_Diamonds();
+ }
+ $this->markimg = $this->imgdata_diamonds->GetImg($this->type,$filename);
+ list($anchor_x,$anchor_y) = $this->imgdata_diamonds->GetAnchor();
+ break;
+
+ case MARK_IMG_BALL:
+ case MARK_IMG_SBALL:
+ case MARK_IMG_MBALL:
+ case MARK_IMG_LBALL:
+ if( $this->imgdata_balls == null ) {
+ require_once 'imgdata_balls.inc.php';
+ $this->imgdata_balls = new ImgData_Balls();
+ }
+ $this->markimg = $this->imgdata_balls->GetImg($this->type,$filename);
+ list($anchor_x,$anchor_y) = $this->imgdata_balls->GetAnchor();
+ break;
+ }
+
+ $w = $img->GetWidth($this->markimg);
+ $h = $img->GetHeight($this->markimg);
+
+ $dw = round($imgscale * $w );
+ $dh = round($imgscale * $h );
+
+ // Do potential rotation
+ list($x,$y) = $img->Rotate($x,$y);
+
+ $dx = round($x-$dw*$anchor_x);
+ $dy = round($y-$dh*$anchor_y);
+
+ $this->width = max($dx,$dy);
+
+ $img->Copy($this->markimg,$dx,$dy,0,0,$dw,$dh,$w,$h);
+ if( !empty($this->csimtarget) ) {
+ $this->csimareas = "csimtarget)."\"";
+
+ if( !empty($this->csimwintarget) ) {
+ $this->csimareas .= " target=\"".$this->csimwintarget."\" ";
+ }
+
+ if( !empty($this->csimalt) ) {
+ $tmp=sprintf($this->csimalt,$this->yvalue,$this->xvalue);
+ $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
+ }
+ $this->csimareas .= " />\n";
+ }
+
+ // Stroke title
+ $this->title->Align("center","top");
+ $this->title->Stroke($img,$x,$y+round($dh/2));
+ return;
+ }
- if( !empty($this->csimwintarget) ) {
- $this->csimareas .= " target=\"".$this->csimwintarget."\" ";
- }
-
- if( !empty($this->csimalt) ) {
- $tmp=sprintf($this->csimalt,$this->yvalue,$this->xvalue);
- $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
- }
- $this->csimareas .= " />\n";
- }
- }
-
- function Stroke(&$img,$x,$y) {
- if( !$this->show ) return;
-
- if( $this->iFormatCallback != '' || $this->iFormatCallback2 != '' ) {
-
- if( $this->iFormatCallback != '' ) {
- $f = $this->iFormatCallback;
- list($width,$color,$fcolor) = call_user_func($f,$this->yvalue);
- $filename = $this->iFileName;
- $imgscale = $this->iScale;
- }
- else {
- $f = $this->iFormatCallback2;
- list($width,$color,$fcolor,$filename,$imgscale) = call_user_func($f,$this->yvalue,$this->xvalue);
- if( $filename=="" ) $filename = $this->iFileName;
- if( $imgscale=="" ) $imgscale = $this->iScale;
- }
-
- if( $width=="" ) $width = $this->width;
- if( $color=="" ) $color = $this->color;
- if( $fcolor=="" ) $fcolor = $this->fill_color;
-
- }
- else {
- $fcolor = $this->fill_color;
- $color = $this->color;
- $width = $this->width;
- $filename = $this->iFileName;
- $imgscale = $this->iScale;
- }
-
- if( $this->type == MARK_IMG ||
- ($this->type >= MARK_FLAG1 && $this->type <= MARK_FLAG4 ) ||
- $this->type >= MARK_IMG_PUSHPIN ) {
-
- // Note: For the builtin images we use the "filename" parameter
- // to denote the color
- $anchor_x = 0.5;
- $anchor_y = 0.5;
- switch( $this->type ) {
- case MARK_FLAG1:
- case MARK_FLAG2:
- case MARK_FLAG3:
- case MARK_FLAG4:
- $this->markimg = FlagCache::GetFlagImgByName($this->type-MARK_FLAG1+1,$filename);
- break;
-
- case MARK_IMG :
- // Load an image and use that as a marker
- // Small optimization, if we have already read an image don't
- // waste time reading it again.
- if( $this->markimg == '' || !($this->oldfilename === $filename) ) {
- $this->markimg = Graph::LoadBkgImage('',$filename);
- $this->oldfilename = $filename ;
- }
- break;
-
- case MARK_IMG_PUSHPIN:
- case MARK_IMG_SPUSHPIN:
- case MARK_IMG_LPUSHPIN:
- if( $this->imgdata_pushpins == null ) {
- require_once 'imgdata_pushpins.inc.php';
- $this->imgdata_pushpins = new ImgData_PushPins();
- }
- $this->markimg = $this->imgdata_pushpins->GetImg($this->type,$filename);
- list($anchor_x,$anchor_y) = $this->imgdata_pushpins->GetAnchor();
- break;
-
- case MARK_IMG_SQUARE:
- if( $this->imgdata_squares == null ) {
- require_once 'imgdata_squares.inc.php';
- $this->imgdata_squares = new ImgData_Squares();
- }
- $this->markimg = $this->imgdata_squares->GetImg($this->type,$filename);
- list($anchor_x,$anchor_y) = $this->imgdata_squares->GetAnchor();
- break;
-
- case MARK_IMG_STAR:
- if( $this->imgdata_stars == null ) {
- require_once 'imgdata_stars.inc.php';
- $this->imgdata_stars = new ImgData_Stars();
- }
- $this->markimg = $this->imgdata_stars->GetImg($this->type,$filename);
- list($anchor_x,$anchor_y) = $this->imgdata_stars->GetAnchor();
- break;
-
- case MARK_IMG_BEVEL:
- if( $this->imgdata_bevels == null ) {
- require_once 'imgdata_bevels.inc.php';
- $this->imgdata_bevels = new ImgData_Bevels();
- }
- $this->markimg = $this->imgdata_bevels->GetImg($this->type,$filename);
- list($anchor_x,$anchor_y) = $this->imgdata_bevels->GetAnchor();
- break;
-
- case MARK_IMG_DIAMOND:
- if( $this->imgdata_diamonds == null ) {
- require_once 'imgdata_diamonds.inc.php';
- $this->imgdata_diamonds = new ImgData_Diamonds();
- }
- $this->markimg = $this->imgdata_diamonds->GetImg($this->type,$filename);
- list($anchor_x,$anchor_y) = $this->imgdata_diamonds->GetAnchor();
- break;
-
- case MARK_IMG_BALL:
- case MARK_IMG_SBALL:
- case MARK_IMG_MBALL:
- case MARK_IMG_LBALL:
- if( $this->imgdata_balls == null ) {
- require_once 'imgdata_balls.inc.php';
- $this->imgdata_balls = new ImgData_Balls();
- }
- $this->markimg = $this->imgdata_balls->GetImg($this->type,$filename);
- list($anchor_x,$anchor_y) = $this->imgdata_balls->GetAnchor();
- break;
- }
-
- $w = $img->GetWidth($this->markimg);
- $h = $img->GetHeight($this->markimg);
-
- $dw = round($imgscale * $w );
- $dh = round($imgscale * $h );
-
- // Do potential rotation
- list($x,$y) = $img->Rotate($x,$y);
-
- $dx = round($x-$dw*$anchor_x);
- $dy = round($y-$dh*$anchor_y);
-
- $this->width = max($dx,$dy);
-
- $img->Copy($this->markimg,$dx,$dy,0,0,$dw,$dh,$w,$h);
- if( !empty($this->csimtarget) ) {
- $this->csimareas = "csimtarget)."\"";
-
- if( !empty($this->csimwintarget) ) {
- $this->csimareas .= " target=\"".$this->csimwintarget."\" ";
- }
-
- if( !empty($this->csimalt) ) {
- $tmp=sprintf($this->csimalt,$this->yvalue,$this->xvalue);
- $this->csimareas .= " title=\"$tmp\" alt=\"$tmp\" ";
- }
- $this->csimareas .= " />\n";
- }
-
- // Stroke title
- $this->title->Align("center","top");
- $this->title->Stroke($img,$x,$y+round($dh/2));
- return;
- }
-
- $weight = $this->weight;
- $dx=round($width/2,0);
- $dy=round($width/2,0);
- $pts=0;
-
- switch( $this->type ) {
- case MARK_SQUARE:
- $c[]=$x-$dx;$c[]=$y-$dy;
- $c[]=$x+$dx;$c[]=$y-$dy;
- $c[]=$x+$dx;$c[]=$y+$dy;
- $c[]=$x-$dx;$c[]=$y+$dy;
- $c[]=$x-$dx;$c[]=$y-$dy;
- $pts=5;
- break;
- case MARK_UTRIANGLE:
- ++$dx;++$dy;
- $c[]=$x-$dx;$c[]=$y+0.87*$dy; // tan(60)/2*$dx
- $c[]=$x;$c[]=$y-0.87*$dy;
- $c[]=$x+$dx;$c[]=$y+0.87*$dy;
- $c[]=$x-$dx;$c[]=$y+0.87*$dy; // tan(60)/2*$dx
- $pts=4;
- break;
- case MARK_DTRIANGLE:
- ++$dx;++$dy;
- $c[]=$x;$c[]=$y+0.87*$dy; // tan(60)/2*$dx
- $c[]=$x-$dx;$c[]=$y-0.87*$dy;
- $c[]=$x+$dx;$c[]=$y-0.87*$dy;
- $c[]=$x;$c[]=$y+0.87*$dy; // tan(60)/2*$dx
- $pts=4;
- break;
- case MARK_DIAMOND:
- $c[]=$x;$c[]=$y+$dy;
- $c[]=$x-$dx;$c[]=$y;
- $c[]=$x;$c[]=$y-$dy;
- $c[]=$x+$dx;$c[]=$y;
- $c[]=$x;$c[]=$y+$dy;
- $pts=5;
- break;
- case MARK_LEFTTRIANGLE:
- $c[]=$x;$c[]=$y;
- $c[]=$x;$c[]=$y+2*$dy;
- $c[]=$x+$dx*2;$c[]=$y;
- $c[]=$x;$c[]=$y;
- $pts=4;
- break;
- case MARK_RIGHTTRIANGLE:
- $c[]=$x-$dx*2;$c[]=$y;
- $c[]=$x;$c[]=$y+2*$dy;
- $c[]=$x;$c[]=$y;
- $c[]=$x-$dx*2;$c[]=$y;
- $pts=4;
- break;
- case MARK_FLASH:
- $dy *= 2;
- $c[]=$x+$dx/2; $c[]=$y-$dy;
- $c[]=$x-$dx+$dx/2; $c[]=$y+$dy*0.7-$dy;
- $c[]=$x+$dx/2; $c[]=$y+$dy*1.3-$dy;
- $c[]=$x-$dx+$dx/2; $c[]=$y+2*$dy-$dy;
- $img->SetLineWeight($weight);
- $img->SetColor($color);
- $img->Polygon($c);
- $img->SetLineWeight(1);
- $this->AddCSIMPoly($c);
- break;
- }
-
- if( $pts>0 ) {
- $this->AddCSIMPoly($c);
- $img->SetLineWeight($weight);
- $img->SetColor($fcolor);
- $img->FilledPolygon($c);
- $img->SetColor($color);
- $img->Polygon($c);
- $img->SetLineWeight(1);
- }
- elseif( $this->type==MARK_CIRCLE ) {
- $img->SetColor($color);
- $img->Circle($x,$y,$width);
- $this->AddCSIMCircle($x,$y,$width);
- }
- elseif( $this->type==MARK_FILLEDCIRCLE ) {
- $img->SetColor($fcolor);
- $img->FilledCircle($x,$y,$width);
- $img->SetColor($color);
- $img->Circle($x,$y,$width);
- $this->AddCSIMCircle($x,$y,$width);
- }
- elseif( $this->type==MARK_CROSS ) {
- // Oversize by a pixel to match the X
- $img->SetColor($color);
- $img->SetLineWeight($weight);
- $img->Line($x,$y+$dy+1,$x,$y-$dy-1);
- $img->Line($x-$dx-1,$y,$x+$dx+1,$y);
- $this->AddCSIMCircle($x,$y,$dx);
- }
- elseif( $this->type==MARK_X ) {
- $img->SetColor($color);
- $img->SetLineWeight($weight);
- $img->Line($x+$dx,$y+$dy,$x-$dx,$y-$dy);
- $img->Line($x-$dx,$y+$dy,$x+$dx,$y-$dy);
- $this->AddCSIMCircle($x,$y,$dx+$dy);
- }
- elseif( $this->type==MARK_STAR ) {
- $img->SetColor($color);
- $img->SetLineWeight($weight);
- $img->Line($x+$dx,$y+$dy,$x-$dx,$y-$dy);
- $img->Line($x-$dx,$y+$dy,$x+$dx,$y-$dy);
- // Oversize by a pixel to match the X
- $img->Line($x,$y+$dy+1,$x,$y-$dy-1);
- $img->Line($x-$dx-1,$y,$x+$dx+1,$y);
- $this->AddCSIMCircle($x,$y,$dx+$dy);
- }
-
- // Stroke title
- $this->title->Align("center","center");
- $this->title->Stroke($img,$x,$y);
+ $weight = $this->weight;
+ $dx=round($width/2,0);
+ $dy=round($width/2,0);
+ $pts=0;
+
+ switch( $this->type ) {
+ case MARK_SQUARE:
+ $c[]=$x-$dx;$c[]=$y-$dy;
+ $c[]=$x+$dx;$c[]=$y-$dy;
+ $c[]=$x+$dx;$c[]=$y+$dy;
+ $c[]=$x-$dx;$c[]=$y+$dy;
+ $c[]=$x-$dx;$c[]=$y-$dy;
+ $pts=5;
+ break;
+ case MARK_UTRIANGLE:
+ ++$dx;++$dy;
+ $c[]=$x-$dx;$c[]=$y+0.87*$dy; // tan(60)/2*$dx
+ $c[]=$x;$c[]=$y-0.87*$dy;
+ $c[]=$x+$dx;$c[]=$y+0.87*$dy;
+ $c[]=$x-$dx;$c[]=$y+0.87*$dy; // tan(60)/2*$dx
+ $pts=4;
+ break;
+ case MARK_DTRIANGLE:
+ ++$dx;++$dy;
+ $c[]=$x;$c[]=$y+0.87*$dy; // tan(60)/2*$dx
+ $c[]=$x-$dx;$c[]=$y-0.87*$dy;
+ $c[]=$x+$dx;$c[]=$y-0.87*$dy;
+ $c[]=$x;$c[]=$y+0.87*$dy; // tan(60)/2*$dx
+ $pts=4;
+ break;
+ case MARK_DIAMOND:
+ $c[]=$x;$c[]=$y+$dy;
+ $c[]=$x-$dx;$c[]=$y;
+ $c[]=$x;$c[]=$y-$dy;
+ $c[]=$x+$dx;$c[]=$y;
+ $c[]=$x;$c[]=$y+$dy;
+ $pts=5;
+ break;
+ case MARK_LEFTTRIANGLE:
+ $c[]=$x;$c[]=$y;
+ $c[]=$x;$c[]=$y+2*$dy;
+ $c[]=$x+$dx*2;$c[]=$y;
+ $c[]=$x;$c[]=$y;
+ $pts=4;
+ break;
+ case MARK_RIGHTTRIANGLE:
+ $c[]=$x-$dx*2;$c[]=$y;
+ $c[]=$x;$c[]=$y+2*$dy;
+ $c[]=$x;$c[]=$y;
+ $c[]=$x-$dx*2;$c[]=$y;
+ $pts=4;
+ break;
+ case MARK_FLASH:
+ $dy *= 2;
+ $c[]=$x+$dx/2; $c[]=$y-$dy;
+ $c[]=$x-$dx+$dx/2; $c[]=$y+$dy*0.7-$dy;
+ $c[]=$x+$dx/2; $c[]=$y+$dy*1.3-$dy;
+ $c[]=$x-$dx+$dx/2; $c[]=$y+2*$dy-$dy;
+ $img->SetLineWeight($weight);
+ $img->SetColor($color);
+ $img->Polygon($c);
+ $img->SetLineWeight(1);
+ $this->AddCSIMPoly($c);
+ break;
+ }
+
+ if( $pts>0 ) {
+ $this->AddCSIMPoly($c);
+ $img->SetLineWeight($weight);
+ $img->SetColor($fcolor);
+ $img->FilledPolygon($c);
+ $img->SetColor($color);
+ $img->Polygon($c);
+ $img->SetLineWeight(1);
+ }
+ elseif( $this->type==MARK_CIRCLE ) {
+ $img->SetColor($color);
+ $img->Circle($x,$y,$width);
+ $this->AddCSIMCircle($x,$y,$width);
+ }
+ elseif( $this->type==MARK_FILLEDCIRCLE ) {
+ $img->SetColor($fcolor);
+ $img->FilledCircle($x,$y,$width);
+ $img->SetColor($color);
+ $img->Circle($x,$y,$width);
+ $this->AddCSIMCircle($x,$y,$width);
+ }
+ elseif( $this->type==MARK_CROSS ) {
+ // Oversize by a pixel to match the X
+ $img->SetColor($color);
+ $img->SetLineWeight($weight);
+ $img->Line($x,$y+$dy+1,$x,$y-$dy-1);
+ $img->Line($x-$dx-1,$y,$x+$dx+1,$y);
+ $this->AddCSIMCircle($x,$y,$dx);
+ }
+ elseif( $this->type==MARK_X ) {
+ $img->SetColor($color);
+ $img->SetLineWeight($weight);
+ $img->Line($x+$dx,$y+$dy,$x-$dx,$y-$dy);
+ $img->Line($x-$dx,$y+$dy,$x+$dx,$y-$dy);
+ $this->AddCSIMCircle($x,$y,$dx+$dy);
+ }
+ elseif( $this->type==MARK_STAR ) {
+ $img->SetColor($color);
+ $img->SetLineWeight($weight);
+ $img->Line($x+$dx,$y+$dy,$x-$dx,$y-$dy);
+ $img->Line($x-$dx,$y+$dy,$x+$dx,$y-$dy);
+ // Oversize by a pixel to match the X
+ $img->Line($x,$y+$dy+1,$x,$y-$dy-1);
+ $img->Line($x-$dx-1,$y,$x+$dx+1,$y);
+ $this->AddCSIMCircle($x,$y,$dx+$dy);
+ }
+
+ // Stroke title
+ $this->title->Align("center","center");
+ $this->title->Stroke($img,$x,$y);
}
} // Class
+
+//========================================================================
+// CLASS ImgData
+// Description: Base class for all image data classes that contains the
+// real image data.
+//========================================================================
+class ImgData {
+ protected $name = ''; // Each subclass gives a name
+ protected $an = array(); // Data array names
+ protected $colors = array(); // Available colors
+ protected $index = array(); // Index for colors
+ protected $maxidx = 0 ; // Max color index
+ protected $anchor_x=0.5, $anchor_y=0.5 ; // Where is the center of the image
+
+ function __construct() {
+ // Empty
+ }
+
+ // Create a GD image from the data and return a GD handle
+ function GetImg($aMark,$aIdx) {
+ $n = $this->an[$aMark];
+ if( is_string($aIdx) ) {
+ if( !in_array($aIdx,$this->colors) ) {
+ JpGraphError::RaiseL(23001,$this->name,$aIdx);//('This marker "'.($this->name).'" does not exist in color: '.$aIdx);
+ }
+ $idx = $this->index[$aIdx];
+ }
+ elseif( !is_integer($aIdx) ||
+ (is_integer($aIdx) && $aIdx > $this->maxidx ) ) {
+ JpGraphError::RaiseL(23002,$this->name);//('Mark color index too large for marker "'.($this->name).'"');
+ }
+ else
+ $idx = $aIdx ;
+ return Image::CreateFromString(base64_decode($this->{$n}[$idx][1]));
+ }
+
+ function GetAnchor() {
+ return array($this->anchor_x,$this->anchor_y);
+ }
+}
+
+
+// Keep a global flag cache to reduce memory usage
+$_gFlagCache=array(
+1 => null,
+2 => null,
+3 => null,
+4 => null,
+);
+// Only supposed to b called as statics
+class FlagCache {
+
+ static function GetFlagImgByName($aSize,$aName) {
+ global $_gFlagCache;
+ require_once('jpgraph_flags.php');
+ if( $_gFlagCache[$aSize] === null ) {
+ $_gFlagCache[$aSize] = new FlagImages($aSize);
+ }
+ $f = $_gFlagCache[$aSize];
+ $idx = $f->GetIdxByName($aName,$aFullName);
+ return $f->GetImgByIdx($idx);
+ }
+}
+
?>
\ Pas de fin de ligne à la fin du fichier.
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_polar.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_polar.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_polar.php 2007-03-24 07:19:13.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_polar.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,20 +1,20 @@
numpoints = $n/2;
- $this->coord = $aData;
- $this->mark = new PlotMark();
+ public $line_style='solid',$mark;
+ public $legendcsimtarget='';
+ public $legendcsimalt='';
+ public $legend="";
+ public $csimtargets=array(); // Array of targets for CSIM
+ public $csimareas=""; // Resultant CSIM area tags
+ public $csimalts=null; // ALT:s for corresponding target
+ public $scale=null;
+ private $numpoints=0;
+ private $iColor='navy',$iFillColor='';
+ private $iLineWeight=1;
+ private $coord=null;
+
+ function __construct($aData) {
+ $n = count($aData);
+ if( $n & 1 ) {
+ JpGraphError::RaiseL(17001);
+ //('Polar plots must have an even number of data point. Each data point is a tuple (angle,radius).');
+ }
+ $this->numpoints = $n/2;
+ $this->coord = $aData;
+ $this->mark = new PlotMark();
}
function SetWeight($aWeight) {
- $this->iLineWeight = $aWeight;
+ $this->iLineWeight = $aWeight;
}
function SetColor($aColor){
- $this->iColor = $aColor;
+ $this->iColor = $aColor;
}
function SetFillColor($aColor){
- $this->iFillColor = $aColor;
+ $this->iFillColor = $aColor;
}
function Max() {
- $m = $this->coord[1];
- $i=1;
- while( $i < $this->numpoints ) {
- $m = max($m,$this->coord[2*$i+1]);
- ++$i;
- }
- return $m;
+ $m = $this->coord[1];
+ $i=1;
+ while( $i < $this->numpoints ) {
+ $m = max($m,$this->coord[2*$i+1]);
+ ++$i;
+ }
+ return $m;
}
- // Set href targets for CSIM
+ // Set href targets for CSIM
function SetCSIMTargets($aTargets,$aAlts=null) {
- $this->csimtargets=$aTargets;
- $this->csimalts=$aAlts;
+ $this->csimtargets=$aTargets;
+ $this->csimalts=$aAlts;
}
-
+
// Get all created areas
function GetCSIMareas() {
- return $this->csimareas;
- }
-
+ return $this->csimareas;
+ }
+
function SetLegend($aLegend,$aCSIM="",$aCSIMAlt="") {
- $this->legend = $aLegend;
- $this->legendcsimtarget = $aCSIM;
- $this->legendcsimalt = $aCSIMAlt;
+ $this->legend = $aLegend;
+ $this->legendcsimtarget = $aCSIM;
+ $this->legendcsimalt = $aCSIMAlt;
}
// Private methods
- function Legend(&$aGraph) {
- $color = $this->iColor ;
- if( $this->legend != "" ) {
- if( $this->iFillColor!='' ) {
- $color = $this->iFillColor;
- $aGraph->legend->Add($this->legend,$color,$this->mark,0,
- $this->legendcsimtarget,$this->legendcsimalt);
- }
- else {
- $aGraph->legend->Add($this->legend,$color,$this->mark,$this->line_style,
- $this->legendcsimtarget,$this->legendcsimalt);
- }
- }
- }
-
- function Stroke(&$img,$scale) {
-
- $i=0;
- $p=array();
- $this->csimareas='';
- while($i < $this->numpoints) {
- list($x1,$y1) = $scale->PTranslate($this->coord[2*$i],$this->coord[2*$i+1]);
- $p[2*$i] = $x1;
- $p[2*$i+1] = $y1;
-
- if( isset($this->csimtargets[$i]) ) {
- $this->mark->SetCSIMTarget($this->csimtargets[$i]);
- $this->mark->SetCSIMAlt($this->csimalts[$i]);
- $this->mark->SetCSIMAltVal($this->coord[2*$i], $this->coord[2*$i+1]);
- $this->mark->Stroke($img,$x1,$y1);
- $this->csimareas .= $this->mark->GetCSIMAreas();
- }
- else
- $this->mark->Stroke($img,$x1,$y1);
-
- ++$i;
- }
-
- if( $this->iFillColor != '' ) {
- $img->SetColor($this->iFillColor);
- $img->FilledPolygon($p);
- }
- $img->SetLineWeight($this->iLineWeight);
- $img->SetColor($this->iColor);
- $img->Polygon($p,$this->iFillColor!='');
+ function Legend($aGraph) {
+ $color = $this->iColor ;
+ if( $this->legend != "" ) {
+ if( $this->iFillColor!='' ) {
+ $color = $this->iFillColor;
+ $aGraph->legend->Add($this->legend,$color,$this->mark,0,
+ $this->legendcsimtarget,$this->legendcsimalt);
+ }
+ else {
+ $aGraph->legend->Add($this->legend,$color,$this->mark,$this->line_style,
+ $this->legendcsimtarget,$this->legendcsimalt);
+ }
+ }
+ }
+
+ function Stroke($img,$scale) {
+
+ $i=0;
+ $p=array();
+ $this->csimareas='';
+ while($i < $this->numpoints) {
+ list($x1,$y1) = $scale->PTranslate($this->coord[2*$i],$this->coord[2*$i+1]);
+ $p[2*$i] = $x1;
+ $p[2*$i+1] = $y1;
+
+ if( isset($this->csimtargets[$i]) ) {
+ $this->mark->SetCSIMTarget($this->csimtargets[$i]);
+ $this->mark->SetCSIMAlt($this->csimalts[$i]);
+ $this->mark->SetCSIMAltVal($this->coord[2*$i], $this->coord[2*$i+1]);
+ $this->mark->Stroke($img,$x1,$y1);
+ $this->csimareas .= $this->mark->GetCSIMAreas();
+ }
+ else {
+ $this->mark->Stroke($img,$x1,$y1);
+ }
+
+ ++$i;
+ }
+
+ if( $this->iFillColor != '' ) {
+ $img->SetColor($this->iFillColor);
+ $img->FilledPolygon($p);
+ }
+ $img->SetLineWeight($this->iLineWeight);
+ $img->SetColor($this->iColor);
+ $img->Polygon($p,$this->iFillColor!='');
}
}
@@ -147,690 +149,746 @@
// class PolarAxis
//--------------------------------------------------------------------------
class PolarAxis extends Axis {
- var $angle_step=15,$angle_color='lightgray',$angle_label_color='black';
- var $angle_fontfam=FF_FONT1,$angle_fontstyle=FS_NORMAL,$angle_fontsize=10;
- var $angle_fontcolor = 'navy';
- var $gridminor_color='lightgray',$gridmajor_color='lightgray';
- var $show_minor_grid = false, $show_major_grid = true ;
- var $show_angle_mark=true, $show_angle_grid=true, $show_angle_label=true;
- var $angle_tick_len=3, $angle_tick_len2=3, $angle_tick_color='black';
- var $show_angle_tick=true;
- var $radius_tick_color='black';
+ private $angle_step=15,$angle_color='lightgray',$angle_label_color='black';
+ private $angle_fontfam=FF_FONT1,$angle_fontstyle=FS_NORMAL,$angle_fontsize=10;
+ private $angle_fontcolor = 'navy';
+ private $gridminor_color='lightgray',$gridmajor_color='lightgray';
+ private $show_minor_grid = false, $show_major_grid = true ;
+ private $show_angle_mark=true, $show_angle_grid=true, $show_angle_label=true;
+ private $angle_tick_len=3, $angle_tick_len2=3, $angle_tick_color='black';
+ private $show_angle_tick=true;
+ private $radius_tick_color='black';
- function PolarAxis(&$img,&$aScale) {
- parent::Axis($img,$aScale);
+ function __construct($img,$aScale) {
+ parent::__construct($img,$aScale);
}
function ShowAngleDegreeMark($aFlg=true) {
- $this->show_angle_mark = $aFlg;
+ $this->show_angle_mark = $aFlg;
}
function SetAngleStep($aStep) {
- $this->angle_step=$aStep;
+ $this->angle_step=$aStep;
}
function HideTicks($aFlg=true,$aAngleFlg=true) {
- parent::HideTicks($aFlg,$aFlg);
- $this->show_angle_tick = !$aAngleFlg;
+ parent::HideTicks($aFlg,$aFlg);
+ $this->show_angle_tick = !$aAngleFlg;
}
function ShowAngleLabel($aFlg=true) {
- $this->show_angle_label = $aFlg;
+ $this->show_angle_label = $aFlg;
}
function ShowGrid($aMajor=true,$aMinor=false,$aAngle=true) {
- $this->show_minor_grid = $aMinor;
- $this->show_major_grid = $aMajor;
- $this->show_angle_grid = $aAngle ;
+ $this->show_minor_grid = $aMinor;
+ $this->show_major_grid = $aMajor;
+ $this->show_angle_grid = $aAngle ;
}
function SetAngleFont($aFontFam,$aFontStyle=FS_NORMAL,$aFontSize=10) {
- $this->angle_fontfam = $aFontFam;
- $this->angle_fontstyle = $aFontStyle;
- $this->angle_fontsize = $aFontSize;
+ $this->angle_fontfam = $aFontFam;
+ $this->angle_fontstyle = $aFontStyle;
+ $this->angle_fontsize = $aFontSize;
}
function SetColor($aColor,$aRadColor='',$aAngleColor='') {
- if( $aAngleColor == '' )
- $aAngleColor=$aColor;
- parent::SetColor($aColor,$aRadColor);
- $this->angle_fontcolor = $aAngleColor;
+ if( $aAngleColor == '' )
+ $aAngleColor=$aColor;
+ parent::SetColor($aColor,$aRadColor);
+ $this->angle_fontcolor = $aAngleColor;
}
function SetGridColor($aMajorColor,$aMinorColor='',$aAngleColor='') {
- if( $aMinorColor == '' )
- $aMinorColor = $aMajorColor;
- if( $aAngleColor == '' )
- $aAngleColor = $aMajorColor;
-
- $this->gridminor_color = $aMinorColor;
- $this->gridmajor_color = $aMajorColor;
- $this->angle_color = $aAngleColor;
+ if( $aMinorColor == '' )
+ $aMinorColor = $aMajorColor;
+ if( $aAngleColor == '' )
+ $aAngleColor = $aMajorColor;
+
+ $this->gridminor_color = $aMinorColor;
+ $this->gridmajor_color = $aMajorColor;
+ $this->angle_color = $aAngleColor;
}
function SetTickColors($aRadColor,$aAngleColor='') {
- $this->radius_tick_color = $aRadColor;
- $this->angle_tick_color = $aAngleColor;
+ $this->radius_tick_color = $aRadColor;
+ $this->angle_tick_color = $aAngleColor;
}
-
+
// Private methods
function StrokeGrid($pos) {
- $x = round($this->img->left_margin + $this->img->plotwidth/2);
- $this->scale->ticks->Stroke($this->img,$this->scale,$pos);
+ $x = round($this->img->left_margin + $this->img->plotwidth/2);
+ $this->scale->ticks->Stroke($this->img,$this->scale,$pos);
- // Stroke the minor arcs
- $pmin = array();
- $p = $this->scale->ticks->ticks_pos;
- $n = count($p);
- $i = 0;
- $this->img->SetColor($this->gridminor_color);
- while( $i < $n ) {
- $r = $p[$i]-$x+1;
- $pmin[]=$r;
- if( $this->show_minor_grid ) {
- $this->img->Circle($x,$pos,$r);
- }
- $i++;
- }
-
- $limit = max($this->img->plotwidth,$this->img->plotheight)*1.4 ;
- while( $r < $limit ) {
- $off = $r;
- $i=1;
- $r = $off + round($p[$i]-$x+1);
- while( $r < $limit && $i < $n ) {
- $r = $off+$p[$i]-$x;
- $pmin[]=$r;
- if( $this->show_minor_grid ) {
- $this->img->Circle($x,$pos,$r);
- }
- $i++;
- }
- }
-
- // Stroke the major arcs
- if( $this->show_major_grid ) {
- // First determine how many minor step on
- // every major step. We have recorded the minor radius
- // in pmin and use these values. This is done in order
- // to avoid rounding errors if we were to recalculate the
- // different major radius.
- $pmaj = $this->scale->ticks->maj_ticks_pos;
- $p = $this->scale->ticks->ticks_pos;
- if( $this->scale->name == 'lin' ) {
- $step=round(($pmaj[1] - $pmaj[0])/($p[1] - $p[0]));
- }
- else {
- $step=9;
- }
- $n = round(count($pmin)/$step);
- $i = 0;
- $this->img->SetColor($this->gridmajor_color);
- $limit = max($this->img->plotwidth,$this->img->plotheight)*1.4 ;
- $off = $r;
- $i=0;
- $r = $pmin[$i*$step];
- while( $r < $limit && $i < $n ) {
- $r = $pmin[$i*$step];
- $this->img->Circle($x,$pos,$r);
- $i++;
- }
- }
-
- // Draw angles
- if( $this->show_angle_grid ) {
- $this->img->SetColor($this->angle_color);
- $d = max($this->img->plotheight,$this->img->plotwidth)*1.4 ;
- $a = 0;
- $p = $this->scale->ticks->ticks_pos;
- $start_radius = $p[1]-$x;
- while( $a < 360 ) {
- if( $a == 90 || $a == 270 ) {
- // Make sure there are no rounding problem with
- // exactly vertical lines
- $this->img->Line($x+$start_radius*cos($a/180*M_PI)+1,
- $pos-$start_radius*sin($a/180*M_PI),
- $x+$start_radius*cos($a/180*M_PI)+1,
- $pos-$d*sin($a/180*M_PI));
-
- }
- else {
- $this->img->Line($x+$start_radius*cos($a/180*M_PI)+1,
- $pos-$start_radius*sin($a/180*M_PI),
- $x+$d*cos($a/180*M_PI),
- $pos-$d*sin($a/180*M_PI));
- }
- $a += $this->angle_step;
- }
- }
+ // Stroke the minor arcs
+ $pmin = array();
+ $p = $this->scale->ticks->ticks_pos;
+ $n = count($p);
+ $i = 0;
+ $this->img->SetColor($this->gridminor_color);
+ while( $i < $n ) {
+ $r = $p[$i]-$x+1;
+ $pmin[]=$r;
+ if( $this->show_minor_grid ) {
+ $this->img->Circle($x,$pos,$r);
+ }
+ $i++;
+ }
+
+ $limit = max($this->img->plotwidth,$this->img->plotheight)*1.4 ;
+ while( $r < $limit ) {
+ $off = $r;
+ $i=1;
+ $r = $off + round($p[$i]-$x+1);
+ while( $r < $limit && $i < $n ) {
+ $r = $off+$p[$i]-$x;
+ $pmin[]=$r;
+ if( $this->show_minor_grid ) {
+ $this->img->Circle($x,$pos,$r);
+ }
+ $i++;
+ }
+ }
+
+ // Stroke the major arcs
+ if( $this->show_major_grid ) {
+ // First determine how many minor step on
+ // every major step. We have recorded the minor radius
+ // in pmin and use these values. This is done in order
+ // to avoid rounding errors if we were to recalculate the
+ // different major radius.
+ $pmaj = $this->scale->ticks->maj_ticks_pos;
+ $p = $this->scale->ticks->ticks_pos;
+ if( $this->scale->name == 'lin' ) {
+ $step=round(($pmaj[1] - $pmaj[0])/($p[1] - $p[0]));
+ }
+ else {
+ $step=9;
+ }
+ $n = round(count($pmin)/$step);
+ $i = 0;
+ $this->img->SetColor($this->gridmajor_color);
+ $limit = max($this->img->plotwidth,$this->img->plotheight)*1.4 ;
+ $off = $r;
+ $i=0;
+ $r = $pmin[$i*$step];
+ while( $r < $limit && $i < $n ) {
+ $r = $pmin[$i*$step];
+ $this->img->Circle($x,$pos,$r);
+ $i++;
+ }
+ }
+
+ // Draw angles
+ if( $this->show_angle_grid ) {
+ $this->img->SetColor($this->angle_color);
+ $d = max($this->img->plotheight,$this->img->plotwidth)*1.4 ;
+ $a = 0;
+ $p = $this->scale->ticks->ticks_pos;
+ $start_radius = $p[1]-$x;
+ while( $a < 360 ) {
+ if( $a == 90 || $a == 270 ) {
+ // Make sure there are no rounding problem with
+ // exactly vertical lines
+ $this->img->Line($x+$start_radius*cos($a/180*M_PI)+1,
+ $pos-$start_radius*sin($a/180*M_PI),
+ $x+$start_radius*cos($a/180*M_PI)+1,
+ $pos-$d*sin($a/180*M_PI));
+
+ }
+ else {
+ $this->img->Line($x+$start_radius*cos($a/180*M_PI)+1,
+ $pos-$start_radius*sin($a/180*M_PI),
+ $x+$d*cos($a/180*M_PI),
+ $pos-$d*sin($a/180*M_PI));
+ }
+ $a += $this->angle_step;
+ }
+ }
}
function StrokeAngleLabels($pos,$type) {
- if( !$this->show_angle_label )
- return;
-
- $x0 = round($this->img->left_margin+$this->img->plotwidth/2)+1;
-
- $d = max($this->img->plotwidth,$this->img->plotheight)*1.42;
- $a = $this->angle_step;
- $t = new Text();
- $t->SetColor($this->angle_fontcolor);
- $t->SetFont($this->angle_fontfam,$this->angle_fontstyle,$this->angle_fontsize);
- $xright = $this->img->width - $this->img->right_margin;
- $ytop = $this->img->top_margin;
- $xleft = $this->img->left_margin;
- $ybottom = $this->img->height - $this->img->bottom_margin;
- $ha = 'left';
- $va = 'center';
- $w = $this->img->plotwidth/2;
- $h = $this->img->plotheight/2;
- $xt = $x0; $yt = $pos;
- $margin=5;
-
- $tl = $this->angle_tick_len ; // Outer len
- $tl2 = $this->angle_tick_len2 ; // Interior len
-
- $this->img->SetColor($this->angle_tick_color);
- $rot90 = $this->img->a == 90 ;
-
- if( $type == POLAR_360 ) {
- $ca1 = atan($h/$w)/M_PI*180;
- $ca2 = 180-$ca1;
- $ca3 = $ca1+180;
- $ca4 = 360-$ca1;
- $end = 360;
- while( $a < $end ) {
- $ca = cos($a/180*M_PI);
- $sa = sin($a/180*M_PI);
- $x = $d*$ca;
- $y = $d*$sa;
- $xt=1000;$yt=1000;
- if( $a <= $ca1 || $a >= $ca4 ) {
- $yt = $pos - $w * $y/$x;
- $xt = $xright + $margin;
- if( $rot90 ) {
- $ha = 'center';
- $va = 'top';
- }
- else {
- $ha = 'left';
- $va = 'center';
- }
- $x1=$xright-$tl2; $x2=$xright+$tl;
- $y1=$y2=$yt;
- }
- elseif( $a > $ca1 && $a < $ca2 ) {
- $xt = $x0 + $h * $x/$y;
- $yt = $ytop - $margin;
- if( $rot90 ) {
- $ha = 'left';
- $va = 'center';
- }
- else {
- $ha = 'center';
- $va = 'bottom';
- }
- $y1=$ytop+$tl2;$y2=$ytop-$tl;
- $x1=$x2=$xt;
- }
- elseif( $a >= $ca2 && $a <= $ca3 ) {
- $yt = $pos + $w * $y/$x;
- $xt = $xleft - $margin;
- if( $rot90 ) {
- $ha = 'center';
- $va = 'bottom';
- }
- else {
- $ha = 'right';
- $va = 'center';
- }
- $x1=$xleft+$tl2;$x2=$xleft-$tl;
- $y1=$y2=$yt;
- }
- else {
- $xt = $x0 - $h * $x/$y;
- $yt = $ybottom + $margin;
- if( $rot90 ) {
- $ha = 'right';
- $va = 'center';
- }
- else {
- $ha = 'center';
- $va = 'top';
- }
- $y1=$ybottom-$tl2;$y2=$ybottom+$tl;
- $x1=$x2=$xt;
- }
- if( $a != 0 && $a != 180 ) {
- $t->Align($ha,$va);
- if( $this->show_angle_mark )
- $a .= '°';
- $t->Set($a);
- $t->Stroke($this->img,$xt,$yt);
- if( $this->show_angle_tick )
- $this->img->Line($x1,$y1,$x2,$y2);
- }
- $a += $this->angle_step;
- }
- }
- else {
- // POLAR_HALF
- $ca1 = atan($h/$w*2)/M_PI*180;
- $ca2 = 180-$ca1;
- $end = 180;
- while( $a < $end ) {
- $ca = cos($a/180*M_PI);
- $sa = sin($a/180*M_PI);
- $x = $d*$ca;
- $y = $d*$sa;
- if( $a <= $ca1 ) {
- $yt = $pos - $w * $y/$x;
- $xt = $xright + $margin;
- if( $rot90 ) {
- $ha = 'center';
- $va = 'top';
- }
- else {
- $ha = 'left';
- $va = 'center';
- }
- $x1=$xright-$tl2; $x2=$xright+$tl;
- $y1=$y2=$yt;
- }
- elseif( $a > $ca1 && $a < $ca2 ) {
- $xt = $x0 + 2*$h * $x/$y;
- $yt = $ytop - $margin;
- if( $rot90 ) {
- $ha = 'left';
- $va = 'center';
- }
- else {
- $ha = 'center';
- $va = 'bottom';
- }
- $y1=$ytop+$tl2;$y2=$ytop-$tl;
- $x1=$x2=$xt;
- }
- elseif( $a >= $ca2 ) {
- $yt = $pos + $w * $y/$x;
- $xt = $xleft - $margin;
- if( $rot90 ) {
- $ha = 'center';
- $va = 'bottom';
- }
- else {
- $ha = 'right';
- $va = 'center';
- }
- $x1=$xleft+$tl2;$x2=$xleft-$tl;
- $y1=$y2=$yt;
- }
- $t->Align($ha,$va);
- if( $this->show_angle_mark )
- $a .= '°';
- $t->Set($a);
- $t->Stroke($this->img,$xt,$yt);
- if( $this->show_angle_tick )
- $this->img->Line($x1,$y1,$x2,$y2);
- $a += $this->angle_step;
- }
- }
- }
-
- function Stroke($pos) {
-
- $this->img->SetLineWeight($this->weight);
- $this->img->SetColor($this->color);
- $this->img->SetFont($this->font_family,$this->font_style,$this->font_size);
- if( !$this->hide_line )
- $this->img->FilledRectangle($this->img->left_margin,$pos,
- $this->img->width-$this->img->right_margin,$pos+$this->weight-1);
- $y=$pos+$this->img->GetFontHeight()+$this->title_margin+$this->title->margin;
- if( $this->title_adjust=="high" )
- $this->title->Pos($this->img->width-$this->img->right_margin,$y,"right","top");
- elseif( $this->title_adjust=="middle" || $this->title_adjust=="center" )
- $this->title->Pos(($this->img->width-$this->img->left_margin-
- $this->img->right_margin)/2+$this->img->left_margin,
- $y,"center","top");
- elseif($this->title_adjust=="low")
- $this->title->Pos($this->img->left_margin,$y,"left","top");
- else {
- JpGraphError::RaiseL(17002,$this->title_adjust);
-//('Unknown alignment specified for X-axis title. ('.$this->title_adjust.')');
- }
-
-
- if (!$this->hide_labels) {
- $this->StrokeLabels($pos,false);
- }
- $this->img->SetColor($this->radius_tick_color);
- $this->scale->ticks->Stroke($this->img,$this->scale,$pos);
+ if( !$this->show_angle_label )
+ return;
+
+ $x0 = round($this->img->left_margin+$this->img->plotwidth/2)+1;
+
+ $d = max($this->img->plotwidth,$this->img->plotheight)*1.42;
+ $a = $this->angle_step;
+ $t = new Text();
+ $t->SetColor($this->angle_fontcolor);
+ $t->SetFont($this->angle_fontfam,$this->angle_fontstyle,$this->angle_fontsize);
+ $xright = $this->img->width - $this->img->right_margin;
+ $ytop = $this->img->top_margin;
+ $xleft = $this->img->left_margin;
+ $ybottom = $this->img->height - $this->img->bottom_margin;
+ $ha = 'left';
+ $va = 'center';
+ $w = $this->img->plotwidth/2;
+ $h = $this->img->plotheight/2;
+ $xt = $x0; $yt = $pos;
+ $margin=5;
+
+ $tl = $this->angle_tick_len ; // Outer len
+ $tl2 = $this->angle_tick_len2 ; // Interior len
+
+ $this->img->SetColor($this->angle_tick_color);
+ $rot90 = $this->img->a == 90 ;
+
+ if( $type == POLAR_360 ) {
+
+ // Corner angles of the four corners
+ $ca1 = atan($h/$w)/M_PI*180;
+ $ca2 = 180-$ca1;
+ $ca3 = $ca1+180;
+ $ca4 = 360-$ca1;
+ $end = 360;
+
+ while( $a < $end ) {
+ $ca = cos($a/180*M_PI);
+ $sa = sin($a/180*M_PI);
+ $x = $d*$ca;
+ $y = $d*$sa;
+ $xt=1000;$yt=1000;
+ if( $a <= $ca1 || $a >= $ca4 ) {
+ $yt = $pos - $w * $y/$x;
+ $xt = $xright + $margin;
+ if( $rot90 ) {
+ $ha = 'center';
+ $va = 'top';
+ }
+ else {
+ $ha = 'left';
+ $va = 'center';
+ }
+ $x1=$xright-$tl2; $x2=$xright+$tl;
+ $y1=$y2=$yt;
+ }
+ elseif( $a > $ca1 && $a < $ca2 ) {
+ $xt = $x0 + $h * $x/$y;
+ $yt = $ytop - $margin;
+ if( $rot90 ) {
+ $ha = 'left';
+ $va = 'center';
+ }
+ else {
+ $ha = 'center';
+ $va = 'bottom';
+ }
+ $y1=$ytop+$tl2;$y2=$ytop-$tl;
+ $x1=$x2=$xt;
+ }
+ elseif( $a >= $ca2 && $a <= $ca3 ) {
+ $yt = $pos + $w * $y/$x;
+ $xt = $xleft - $margin;
+ if( $rot90 ) {
+ $ha = 'center';
+ $va = 'bottom';
+ }
+ else {
+ $ha = 'right';
+ $va = 'center';
+ }
+ $x1=$xleft+$tl2;$x2=$xleft-$tl;
+ $y1=$y2=$yt;
+ }
+ else {
+ $xt = $x0 - $h * $x/$y;
+ $yt = $ybottom + $margin;
+ if( $rot90 ) {
+ $ha = 'right';
+ $va = 'center';
+ }
+ else {
+ $ha = 'center';
+ $va = 'top';
+ }
+ $y1=$ybottom-$tl2;$y2=$ybottom+$tl;
+ $x1=$x2=$xt;
+ }
+ if( $a != 0 && $a != 180 ) {
+ $t->Align($ha,$va);
+ if( $this->scale->clockwise ) {
+ $t->Set(360-$a);
+ }
+ else {
+ $t->Set($a);
+ }
+ if( $this->show_angle_mark && $t->font_family > 4 ) {
+ $a .= SymChar::Get('degree');
+ }
+ $t->Stroke($this->img,$xt,$yt);
+ if( $this->show_angle_tick ) {
+ $this->img->Line($x1,$y1,$x2,$y2);
+ }
+ }
+ $a += $this->angle_step;
+ }
+ }
+ else {
+ // POLAR_HALF
+ $ca1 = atan($h/$w*2)/M_PI*180;
+ $ca2 = 180-$ca1;
+ $end = 180;
+ while( $a < $end ) {
+ $ca = cos($a/180*M_PI);
+ $sa = sin($a/180*M_PI);
+ $x = $d*$ca;
+ $y = $d*$sa;
+ if( $a <= $ca1 ) {
+ $yt = $pos - $w * $y/$x;
+ $xt = $xright + $margin;
+ if( $rot90 ) {
+ $ha = 'center';
+ $va = 'top';
+ }
+ else {
+ $ha = 'left';
+ $va = 'center';
+ }
+ $x1=$xright-$tl2; $x2=$xright+$tl;
+ $y1=$y2=$yt;
+ }
+ elseif( $a > $ca1 && $a < $ca2 ) {
+ $xt = $x0 + 2*$h * $x/$y;
+ $yt = $ytop - $margin;
+ if( $rot90 ) {
+ $ha = 'left';
+ $va = 'center';
+ }
+ else {
+ $ha = 'center';
+ $va = 'bottom';
+ }
+ $y1=$ytop+$tl2;$y2=$ytop-$tl;
+ $x1=$x2=$xt;
+ }
+ elseif( $a >= $ca2 ) {
+ $yt = $pos + $w * $y/$x;
+ $xt = $xleft - $margin;
+ if( $rot90 ) {
+ $ha = 'center';
+ $va = 'bottom';
+ }
+ else {
+ $ha = 'right';
+ $va = 'center';
+ }
+ $x1=$xleft+$tl2;$x2=$xleft-$tl;
+ $y1=$y2=$yt;
+ }
+ $t->Align($ha,$va);
+ if( $this->show_angle_mark && $t->font_family > 4 ) {
+ $a .= SymChar::Get('degree');
+ }
+ $t->Set($a);
+ $t->Stroke($this->img,$xt,$yt);
+ if( $this->show_angle_tick ) {
+ $this->img->Line($x1,$y1,$x2,$y2);
+ }
+ $a += $this->angle_step;
+ }
+ }
+ }
+
+ function Stroke($pos,$dummy=true) {
+
+ $this->img->SetLineWeight($this->weight);
+ $this->img->SetColor($this->color);
+ $this->img->SetFont($this->font_family,$this->font_style,$this->font_size);
+ if( !$this->hide_line ) {
+ $this->img->FilledRectangle($this->img->left_margin,$pos,
+ $this->img->width-$this->img->right_margin,
+ $pos+$this->weight-1);
+ }
+ $y=$pos+$this->img->GetFontHeight()+$this->title_margin+$this->title->margin;
+ if( $this->title_adjust=="high" ) {
+ $this->title->SetPos($this->img->width-$this->img->right_margin,$y,"right","top");
+ }
+ elseif( $this->title_adjust=="middle" || $this->title_adjust=="center" ) {
+ $this->title->SetPos(($this->img->width-$this->img->left_margin-$this->img->right_margin)/2+$this->img->left_margin,
+ $y,"center","top");
+ }
+ elseif($this->title_adjust=="low") {
+ $this->title->SetPos($this->img->left_margin,$y,"left","top");
+ }
+ else {
+ JpGraphError::RaiseL(17002,$this->title_adjust);
+ //('Unknown alignment specified for X-axis title. ('.$this->title_adjust.')');
+ }
+
+
+ if (!$this->hide_labels) {
+ $this->StrokeLabels($pos,false);
+ }
+ $this->img->SetColor($this->radius_tick_color);
+ $this->scale->ticks->Stroke($this->img,$this->scale,$pos);
- //
- // Mirror the positions for the left side of the scale
//
- $mid = 2*($this->img->left_margin+$this->img->plotwidth/2);
- $n = count($this->scale->ticks->ticks_pos);
- $i=0;
- while( $i < $n ) {
- $this->scale->ticks->ticks_pos[$i] =
- $mid-$this->scale->ticks->ticks_pos[$i] ;
- ++$i;
- }
-
- $n = count($this->scale->ticks->maj_ticks_pos);
- $i=0;
- while( $i < $n ) {
- $this->scale->ticks->maj_ticks_pos[$i] =
- $mid-$this->scale->ticks->maj_ticks_pos[$i] ;
- ++$i;
- }
-
- $n = count($this->scale->ticks->maj_ticklabels_pos);
- $i=1;
- while( $i < $n ) {
- $this->scale->ticks->maj_ticklabels_pos[$i] =
- $mid-$this->scale->ticks->maj_ticklabels_pos[$i] ;
- ++$i;
- }
-
- // Draw the left side of the scale
- $n = count($this->scale->ticks->ticks_pos);
- $yu = $pos - $this->scale->ticks->direction*$this->scale->ticks->GetMinTickAbsSize();
-
-
- // Minor ticks
- if( ! $this->scale->ticks->supress_minor_tickmarks ) {
- $i=1;
- while( $i < $n/2 ) {
- $x = round($this->scale->ticks->ticks_pos[$i]) ;
- $this->img->Line($x,$pos,$x,$yu);
- ++$i;
- }
- }
-
- $n = count($this->scale->ticks->maj_ticks_pos);
- $yu = $pos - $this->scale->ticks->direction*$this->scale->ticks->GetMajTickAbsSize();
-
-
- // Major ticks
- if( ! $this->scale->ticks->supress_tickmarks ) {
- $i=1;
- while( $i < $n/2 ) {
- $x = round($this->scale->ticks->maj_ticks_pos[$i]) ;
- $this->img->Line($x,$pos,$x,$yu);
- ++$i;
- }
- }
- if (!$this->hide_labels) {
- $this->StrokeLabels($pos,false);
- }
- $this->title->Stroke($this->img);
+ // Mirror the positions for the left side of the scale
+ //
+ $mid = 2*($this->img->left_margin+$this->img->plotwidth/2);
+ $n = count($this->scale->ticks->ticks_pos);
+ $i=0;
+ while( $i < $n ) {
+ $this->scale->ticks->ticks_pos[$i] =
+ $mid-$this->scale->ticks->ticks_pos[$i] ;
+ ++$i;
+ }
+
+ $n = count($this->scale->ticks->maj_ticks_pos);
+ $i=0;
+ while( $i < $n ) {
+ $this->scale->ticks->maj_ticks_pos[$i] =
+ $mid-$this->scale->ticks->maj_ticks_pos[$i] ;
+ ++$i;
+ }
+
+ $n = count($this->scale->ticks->maj_ticklabels_pos);
+ $i=1;
+ while( $i < $n ) {
+ $this->scale->ticks->maj_ticklabels_pos[$i] =
+ $mid-$this->scale->ticks->maj_ticklabels_pos[$i] ;
+ ++$i;
+ }
+
+ // Draw the left side of the scale
+ $n = count($this->scale->ticks->ticks_pos);
+ $yu = $pos - $this->scale->ticks->direction*$this->scale->ticks->GetMinTickAbsSize();
+
+
+ // Minor ticks
+ if( ! $this->scale->ticks->supress_minor_tickmarks ) {
+ $i=1;
+ while( $i < $n/2 ) {
+ $x = round($this->scale->ticks->ticks_pos[$i]) ;
+ $this->img->Line($x,$pos,$x,$yu);
+ ++$i;
+ }
+ }
+
+ $n = count($this->scale->ticks->maj_ticks_pos);
+ $yu = $pos - $this->scale->ticks->direction*$this->scale->ticks->GetMajTickAbsSize();
+
+
+ // Major ticks
+ if( ! $this->scale->ticks->supress_tickmarks ) {
+ $i=1;
+ while( $i < $n/2 ) {
+ $x = round($this->scale->ticks->maj_ticks_pos[$i]) ;
+ $this->img->Line($x,$pos,$x,$yu);
+ ++$i;
+ }
+ }
+ if (!$this->hide_labels) {
+ $this->StrokeLabels($pos,false);
+ }
+ $this->title->Stroke($this->img);
}
}
class PolarScale extends LinearScale {
- var $graph;
- function PolarScale($aMax=0,&$graph) {
- parent::LinearScale(0,$aMax,'x');
- $this->graph = &$graph;
+ private $graph;
+ public $clockwise=false;
+
+ function __construct($aMax,$graph,$aClockwise) {
+ parent::__construct(0,$aMax,'x');
+ $this->graph = $graph;
+ $this->clockwise = $aClockwise;
+ }
+
+ function SetClockwise($aFlg) {
+ $this->clockwise = $aFlg;
}
function _Translate($v) {
- return parent::Translate($v);
+ return parent::Translate($v);
}
function PTranslate($aAngle,$aRad) {
-
- $m = $this->scale[1];
- $w = $this->graph->img->plotwidth/2;
- $aRad = $aRad/$m*$w;
-
- $x = cos( $aAngle/180 * M_PI ) * $aRad;
- $y = sin( $aAngle/180 * M_PI ) * $aRad;
-
- $x += $this->_Translate(0);
-
- if( $this->graph->iType == POLAR_360 ) {
- $y = ($this->graph->img->top_margin + $this->graph->img->plotheight/2) - $y;
- }
- else {
- $y = ($this->graph->img->top_margin + $this->graph->img->plotheight) - $y;
- }
- return array($x,$y);
+
+ $m = $this->scale[1];
+ $w = $this->graph->img->plotwidth/2;
+ $aRad = $aRad/$m*$w;
+
+ $a = $aAngle/180 * M_PI;
+ if( $this->clockwise ) {
+ $a = 2*M_PI-$a;
+ }
+
+ $x = cos($a) * $aRad;
+ $y = sin($a) * $aRad;
+
+ $x += $this->_Translate(0);
+
+ if( $this->graph->iType == POLAR_360 ) {
+ $y = ($this->graph->img->top_margin + $this->graph->img->plotheight/2) - $y;
+ }
+ else {
+ $y = ($this->graph->img->top_margin + $this->graph->img->plotheight) - $y;
+ }
+ return array($x,$y);
}
}
class PolarLogScale extends LogScale {
- var $graph;
- function PolarLogScale($aMax=1,&$graph) {
- parent::LogScale(0,$aMax,'x');
- $this->graph = &$graph;
- $this->ticks->SetLabelLogType(LOGLABELS_MAGNITUDE);
+ private $graph;
+ public $clockwise=false;
+
+ function __construct($aMax,$graph,$aClockwise=false) {
+ parent::__construct(0,$aMax,'x');
+ $this->graph = $graph;
+ $this->ticks->SetLabelLogType(LOGLABELS_MAGNITUDE);
+ $this->clockwise = $aClockwise;
}
+ function SetClockwise($aFlg) {
+ $this->clockwise = $aFlg;
+ }
+
function PTranslate($aAngle,$aRad) {
- if( $aRad == 0 )
- $aRad = 1;
- $aRad = log10($aRad);
- $m = $this->scale[1];
- $w = $this->graph->img->plotwidth/2;
- $aRad = $aRad/$m*$w;
-
- $x = cos( $aAngle/180 * M_PI ) * $aRad;
- $y = sin( $aAngle/180 * M_PI ) * $aRad;
-
- $x += $w+$this->graph->img->left_margin;//$this->_Translate(0);
- if( $this->graph->iType == POLAR_360 ) {
- $y = ($this->graph->img->top_margin + $this->graph->img->plotheight/2) - $y;
- }
- else {
- $y = ($this->graph->img->top_margin + $this->graph->img->plotheight) - $y;
- }
- return array($x,$y);
+ if( $aRad == 0 )
+ $aRad = 1;
+ $aRad = log10($aRad);
+ $m = $this->scale[1];
+ $w = $this->graph->img->plotwidth/2;
+ $aRad = $aRad/$m*$w;
+
+ $a = $aAngle/180 * M_PI;
+ if( $this->clockwise ) {
+ $a = 2*M_PI-$a;
+ }
+
+ $x = cos( $a ) * $aRad;
+ $y = sin( $a ) * $aRad;
+
+ $x += $w+$this->graph->img->left_margin;//$this->_Translate(0);
+ if( $this->graph->iType == POLAR_360 ) {
+ $y = ($this->graph->img->top_margin + $this->graph->img->plotheight/2) - $y;
+ }
+ else {
+ $y = ($this->graph->img->top_margin + $this->graph->img->plotheight) - $y;
+ }
+ return array($x,$y);
}
}
class PolarGraph extends Graph {
- var $scale;
- var $iType=POLAR_360;
- var $axis;
-
- function PolarGraph($aWidth=300,$aHeight=200,$aCachedName="",$aTimeOut=0,$aInline=true) {
- parent::Graph($aWidth,$aHeight,$aCachedName,$aTimeOut,$aInline) ;
- $this->SetDensity(TICKD_DENSE);
- $this->SetBox();
- $this->SetMarginColor('white');
+ public $scale;
+ public $axis;
+ public $iType=POLAR_360;
+ private $iClockwise=false;
+
+ function __construct($aWidth=300,$aHeight=200,$aCachedName="",$aTimeOut=0,$aInline=true) {
+ parent::__construct($aWidth,$aHeight,$aCachedName,$aTimeOut,$aInline) ;
+ $this->SetDensity(TICKD_DENSE);
+ $this->SetBox();
+ $this->SetMarginColor('white');
}
function SetDensity($aDense) {
- $this->SetTickDensity(TICKD_NORMAL,$aDense);
+ $this->SetTickDensity(TICKD_NORMAL,$aDense);
+ }
+
+ function SetClockwise($aFlg) {
+ $this->scale->SetClockwise($aFlg);
}
function Set90AndMargin($lm=0,$rm=0,$tm=0,$bm=0) {
- $adj = ($this->img->height - $this->img->width)/2;
- $this->SetAngle(90);
- $this->img->SetMargin($lm-$adj,$rm-$adj,$tm+$adj,$bm+$adj);
- $this->img->SetCenter(floor($this->img->width/2),floor($this->img->height/2));
- $this->axis->SetLabelAlign('right','center');
- //JpGraphError::Raise('Set90AndMargin() is not supported for polar graphs.');
- }
-
- function SetScale($aScale,$rmax=0) {
- if( $aScale == 'lin' )
- $this->scale = new PolarScale($rmax,$this);
- elseif( $aScale == 'log' ) {
- $this->scale = new PolarLogScale($rmax,$this);
- }
- else {
- JpGraphError::RaiseL(17004);//('Unknown scale type for polar graph. Must be "lin" or "log"');
- }
+ $adj = ($this->img->height - $this->img->width)/2;
+ $this->SetAngle(90);
+ $lm2 = -$adj + ($lm-$rm+$tm+$bm)/2;
+ $rm2 = -$adj + (-$lm+$rm+$tm+$bm)/2;
+ $tm2 = $adj + ($tm-$bm+$lm+$rm)/2;
+ $bm2 = $adj + (-$tm+$bm+$lm+$rm)/2;
+ $this->SetMargin($lm2, $rm2, $tm2, $bm2);
+ $this->axis->SetLabelAlign('right','center');
+ }
+
+ function SetScale($aScale,$rmax=0,$dummy1=1,$dummy2=1,$dummy3=1) {
+ if( $aScale == 'lin' ) {
+ $this->scale = new PolarScale($rmax,$this,$this->iClockwise);
+ }
+ elseif( $aScale == 'log' ) {
+ $this->scale = new PolarLogScale($rmax,$this,$this->iClockwise);
+ }
+ else {
+ JpGraphError::RaiseL(17004);//('Unknown scale type for polar graph. Must be "lin" or "log"');
+ }
- $this->axis = new PolarAxis($this->img,$this->scale);
- $this->SetMargin(40,40,50,40);
+ $this->axis = new PolarAxis($this->img,$this->scale);
+ $this->SetMargin(40,40,50,40);
}
function SetType($aType) {
- $this->iType = $aType;
+ $this->iType = $aType;
}
function SetPlotSize($w,$h) {
- $this->SetMargin(($this->img->width-$w)/2,($this->img->width-$w)/2,
- ($this->img->height-$h)/2,($this->img->height-$h)/2);
+ $this->SetMargin(($this->img->width-$w)/2,($this->img->width-$w)/2,
+ ($this->img->height-$h)/2,($this->img->height-$h)/2);
}
// Private methods
function GetPlotsMax() {
- $n = count($this->plots);
- $m = $this->plots[0]->Max();
- $i=1;
- while($i < $n) {
- $m = max($this->plots[$i]->Max(),$m);
- ++$i;
- }
- return $m;
+ $n = count($this->plots);
+ $m = $this->plots[0]->Max();
+ $i=1;
+ while($i < $n) {
+ $m = max($this->plots[$i]->Max(),$m);
+ ++$i;
+ }
+ return $m;
}
function Stroke($aStrokeFileName="") {
- // Start by adjusting the margin so that potential titles will fit.
- $this->AdjustMarginsForTitles();
-
- // If the filename is the predefined value = '_csim_special_'
- // we assume that the call to stroke only needs to do enough
- // to correctly generate the CSIM maps.
- // We use this variable to skip things we don't strictly need
- // to do to generate the image map to improve performance
- // a best we can. Therefor you will see a lot of tests !$_csim in the
- // code below.
- $_csim = ($aStrokeFileName===_CSIM_SPECIALFILE);
-
- // We need to know if we have stroked the plot in the
- // GetCSIMareas. Otherwise the CSIM hasn't been generated
- // and in the case of GetCSIM called before stroke to generate
- // CSIM without storing an image to disk GetCSIM must call Stroke.
- $this->iHasStroked = true;
-
- //Check if we should autoscale axis
- if( !$this->scale->IsSpecified() && count($this->plots)>0 ) {
- $max = $this->GetPlotsMax();
- $t1 = $this->img->plotwidth;
- $this->img->plotwidth /= 2;
- $t2 = $this->img->left_margin;
- $this->img->left_margin += $this->img->plotwidth+1;
- $this->scale->AutoScale($this->img,0,$max,
- $this->img->plotwidth/$this->xtick_factor/2);
- $this->img->plotwidth = $t1;
- $this->img->left_margin = $t2;
- }
- else {
- // The tick calculation will use the user suplied min/max values to determine
- // the ticks. If auto_ticks is false the exact user specifed min and max
- // values will be used for the scale.
- // If auto_ticks is true then the scale might be slightly adjusted
- // so that the min and max values falls on an even major step.
- //$min = 0;
- $max = $this->scale->scale[1];
- $t1 = $this->img->plotwidth;
- $this->img->plotwidth /= 2;
- $t2 = $this->img->left_margin;
- $this->img->left_margin += $this->img->plotwidth+1;
- $this->scale->AutoScale($this->img,0,$max,
- $this->img->plotwidth/$this->xtick_factor/2);
- $this->img->plotwidth = $t1;
- $this->img->left_margin = $t2;
- }
-
- if( $this->iType == POLAR_180 )
- $pos = $this->img->height - $this->img->bottom_margin;
- else
- $pos = $this->img->plotheight/2 + $this->img->top_margin;
-
-
- if( !$_csim ) {
- $this->StrokePlotArea();
- }
-
- $this->iDoClipping = true;
-
- if( $this->iDoClipping ) {
- $oldimage = $this->img->CloneCanvasH();
- }
-
- if( !$_csim ) {
- $this->axis->StrokeGrid($pos);
- }
-
- // Stroke all plots for Y1 axis
- for($i=0; $i < count($this->plots); ++$i) {
- $this->plots[$i]->Stroke($this->img,$this->scale);
- }
-
-
- if( $this->iDoClipping ) {
- // Clipping only supports graphs at 0 and 90 degrees
- if( $this->img->a == 0 ) {
- $this->img->CopyCanvasH($oldimage,$this->img->img,
- $this->img->left_margin,$this->img->top_margin,
- $this->img->left_margin,$this->img->top_margin,
- $this->img->plotwidth+1,$this->img->plotheight+1);
- }
- elseif( $this->img->a == 90 ) {
- $adj = round(($this->img->height - $this->img->width)/2);
- $this->img->CopyCanvasH($oldimage,$this->img->img,
- $this->img->bottom_margin-$adj,$this->img->left_margin+$adj,
- $this->img->bottom_margin-$adj,$this->img->left_margin+$adj,
- $this->img->plotheight,$this->img->plotwidth);
- }
- $this->img->Destroy();
- $this->img->SetCanvasH($oldimage);
- }
-
- if( !$_csim ) {
- $this->axis->Stroke($pos);
- $this->axis->StrokeAngleLabels($pos,$this->iType);
- }
-
- if( !$_csim ) {
- $this->StrokePlotBox();
- $this->footer->Stroke($this->img);
-
- // The titles and legends never gets rotated so make sure
- // that the angle is 0 before stroking them
- $aa = $this->img->SetAngle(0);
- $this->StrokeTitles();
- }
-
- for($i=0; $i < count($this->plots) ; ++$i ) {
- $this->plots[$i]->Legend($this);
- }
-
- $this->legend->Stroke($this->img);
-
- if( !$_csim ) {
-
- $this->StrokeTexts();
- $this->img->SetAngle($aa);
-
- // Draw an outline around the image map
- if(_JPG_DEBUG)
- $this->DisplayClientSideaImageMapAreas();
-
- // If the filename is given as the special "__handle"
- // then the image handler is returned and the image is NOT
- // streamed back
- if( $aStrokeFileName == _IMG_HANDLER ) {
- return $this->img->img;
- }
- else {
- // Finally stream the generated picture
- $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,
- $aStrokeFileName);
- }
- }
+ // Start by adjusting the margin so that potential titles will fit.
+ $this->AdjustMarginsForTitles();
+
+ // If the filename is the predefined value = '_csim_special_'
+ // we assume that the call to stroke only needs to do enough
+ // to correctly generate the CSIM maps.
+ // We use this variable to skip things we don't strictly need
+ // to do to generate the image map to improve performance
+ // a best we can. Therefor you will see a lot of tests !$_csim in the
+ // code below.
+ $_csim = ($aStrokeFileName===_CSIM_SPECIALFILE);
+
+ // We need to know if we have stroked the plot in the
+ // GetCSIMareas. Otherwise the CSIM hasn't been generated
+ // and in the case of GetCSIM called before stroke to generate
+ // CSIM without storing an image to disk GetCSIM must call Stroke.
+ $this->iHasStroked = true;
+
+ //Check if we should autoscale axis
+ if( !$this->scale->IsSpecified() && count($this->plots)>0 ) {
+ $max = $this->GetPlotsMax();
+ $t1 = $this->img->plotwidth;
+ $this->img->plotwidth /= 2;
+ $t2 = $this->img->left_margin;
+ $this->img->left_margin += $this->img->plotwidth+1;
+ $this->scale->AutoScale($this->img,0,$max,
+ $this->img->plotwidth/$this->xtick_factor/2);
+ $this->img->plotwidth = $t1;
+ $this->img->left_margin = $t2;
+ }
+ else {
+ // The tick calculation will use the user suplied min/max values to determine
+ // the ticks. If auto_ticks is false the exact user specifed min and max
+ // values will be used for the scale.
+ // If auto_ticks is true then the scale might be slightly adjusted
+ // so that the min and max values falls on an even major step.
+ //$min = 0;
+ $max = $this->scale->scale[1];
+ $t1 = $this->img->plotwidth;
+ $this->img->plotwidth /= 2;
+ $t2 = $this->img->left_margin;
+ $this->img->left_margin += $this->img->plotwidth+1;
+ $this->scale->AutoScale($this->img,0,$max,
+ $this->img->plotwidth/$this->xtick_factor/2);
+ $this->img->plotwidth = $t1;
+ $this->img->left_margin = $t2;
+ }
+
+ if( $this->iType == POLAR_180 ) {
+ $pos = $this->img->height - $this->img->bottom_margin;
+ }
+ else {
+ $pos = $this->img->plotheight/2 + $this->img->top_margin;
+ }
+
+ if( !$_csim ) {
+ $this->StrokePlotArea();
+ }
+
+ $this->iDoClipping = true;
+
+ if( $this->iDoClipping ) {
+ $oldimage = $this->img->CloneCanvasH();
+ }
+
+ if( !$_csim ) {
+ $this->axis->StrokeGrid($pos);
+ }
+
+ // Stroke all plots for Y1 axis
+ for($i=0; $i < count($this->plots); ++$i) {
+ $this->plots[$i]->Stroke($this->img,$this->scale);
+ }
+
+
+ if( $this->iDoClipping ) {
+ // Clipping only supports graphs at 0 and 90 degrees
+ if( $this->img->a == 0 ) {
+ $this->img->CopyCanvasH($oldimage,$this->img->img,
+ $this->img->left_margin,$this->img->top_margin,
+ $this->img->left_margin,$this->img->top_margin,
+ $this->img->plotwidth+1,$this->img->plotheight+1);
+ }
+ elseif( $this->img->a == 90 ) {
+ $adj1 = round(($this->img->height - $this->img->width)/2);
+ $adj2 = round(($this->img->width - $this->img->height)/2);
+ $lm = $this->img->left_margin;
+ $rm = $this->img->right_margin;
+ $tm = $this->img->top_margin;
+ $bm = $this->img->bottom_margin;
+ $this->img->CopyCanvasH($oldimage,$this->img->img,
+ $adj2 + round(($lm-$rm+$tm+$bm)/2),
+ $adj1 + round(($tm-$bm+$lm+$rm)/2),
+ $adj2 + round(($lm-$rm+$tm+$bm)/2),
+ $adj1 + round(($tm-$bm+$lm+$rm)/2),
+ $this->img->plotheight+1,
+ $this->img->plotwidth+1);
+ }
+ $this->img->Destroy();
+ $this->img->SetCanvasH($oldimage);
+ }
+
+ if( !$_csim ) {
+ $this->axis->Stroke($pos);
+ $this->axis->StrokeAngleLabels($pos,$this->iType);
+ }
+
+ if( !$_csim ) {
+ $this->StrokePlotBox();
+ $this->footer->Stroke($this->img);
+
+ // The titles and legends never gets rotated so make sure
+ // that the angle is 0 before stroking them
+ $aa = $this->img->SetAngle(0);
+ $this->StrokeTitles();
+ }
+
+ for($i=0; $i < count($this->plots) ; ++$i ) {
+ $this->plots[$i]->Legend($this);
+ }
+
+ $this->legend->Stroke($this->img);
+
+ if( !$_csim ) {
+
+ $this->StrokeTexts();
+ $this->img->SetAngle($aa);
+
+ // Draw an outline around the image map
+ if(_JPG_DEBUG)
+ $this->DisplayClientSideaImageMapAreas();
+
+ // If the filename is given as the special "__handle"
+ // then the image handler is returned and the image is NOT
+ // streamed back
+ if( $aStrokeFileName == _IMG_HANDLER ) {
+ return $this->img->img;
+ }
+ else {
+ // Finally stream the generated picture
+ $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,$aStrokeFileName);
+ }
+ }
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_radar.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_radar.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_radar.php 2007-03-23 15:03:13.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_radar.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,269 +1,331 @@
GetMinVal();
- $limit = $aScale->GetMaxVal();
- $nextMajor = 10*$start;
- $step = $nextMajor / 10.0;
- $count=1;
-
- $ticklen_maj=5;
- $dx_maj=round(sin($aAxisAngle)*$ticklen_maj);
- $dy_maj=round(cos($aAxisAngle)*$ticklen_maj);
- $ticklen_min=3;
- $dx_min=round(sin($aAxisAngle)*$ticklen_min);
- $dy_min=round(cos($aAxisAngle)*$ticklen_min);
-
- $aMajPos=array();
- $aMajLabel=array();
-
- if( $this->supress_first )
- $aMajLabel[]="";
- else
- $aMajLabel[]=$start;
- $yr=$aScale->RelTranslate($start);
- $xt=round($yr*cos($aAxisAngle))+$aScale->scale_abs[0];
- $yt=$aPos-round($yr*sin($aAxisAngle));
- $aMajPos[]=$xt+2*$dx_maj;
- $aMajPos[]=$yt-$aImg->GetFontheight()/2;
- $grid[]=$xt;
- $grid[]=$yt;
-
- $aImg->SetLineWeight($this->weight);
-
- for($y=$start; $y<=$limit; $y+=$step,++$count ) {
- $yr=$aScale->RelTranslate($y);
- $xt=round($yr*cos($aAxisAngle))+$aScale->scale_abs[0];
- $yt=$aPos-round($yr*sin($aAxisAngle));
- if( $count % 10 == 0 ) {
- $grid[]=$xt;
- $grid[]=$yt;
- $aMajPos[]=$xt+2*$dx_maj;
- $aMajPos[]=$yt-$aImg->GetFontheight()/2;
- if( !$this->supress_tickmarks ) {
- if( $this->majcolor!="" ) $aImg->PushColor($this->majcolor);
- $aImg->Line($xt+$dx_maj,$yt+$dy_maj,$xt-$dx_maj,$yt-$dy_maj);
- if( $this->majcolor!="" ) $aImg->PopColor();
- }
- if( $this->label_formfunc != "" ) {
- $f=$this->label_formfunc;
- $l = call_user_func($f,$nextMajor);
- }
- else
- $l = $nextMajor;
- $aMajLabel[]=$l;
- $nextMajor *= 10;
- $step *= 10;
- $count=1;
- }
- else
- if( !$this->supress_minor_tickmarks ) {
- if( $this->mincolor!="" ) $aImg->PushColor($this->mincolor);
- $aImg->Line($xt+$dx_min,$yt+$dy_min,$xt-$dx_min,$yt-$dy_min);
- if( $this->mincolor!="" ) $aImg->PopColor();
- }
- }
- }
+
+ function __construct() {
+ // Empty
+ }
+
+ function Stroke($aImg,&$grid,$aPos,$aAxisAngle,$aScale,&$aMajPos,&$aMajLabel) {
+ $start = $aScale->GetMinVal();
+ $limit = $aScale->GetMaxVal();
+ $nextMajor = 10*$start;
+ $step = $nextMajor / 10.0;
+ $count=1;
+
+ $ticklen_maj=5;
+ $dx_maj=round(sin($aAxisAngle)*$ticklen_maj);
+ $dy_maj=round(cos($aAxisAngle)*$ticklen_maj);
+ $ticklen_min=3;
+ $dx_min=round(sin($aAxisAngle)*$ticklen_min);
+ $dy_min=round(cos($aAxisAngle)*$ticklen_min);
+
+ $aMajPos=array();
+ $aMajLabel=array();
+
+ if( $this->supress_first ) {
+ $aMajLabel[] = '';
+ }
+ else {
+ $aMajLabel[]=$start;
+ }
+
+ $yr=$aScale->RelTranslate($start);
+ $xt=round($yr*cos($aAxisAngle))+$aScale->scale_abs[0];
+ $yt=$aPos-round($yr*sin($aAxisAngle));
+ $aMajPos[]=$xt+2*$dx_maj;
+ $aMajPos[]=$yt-$aImg->GetFontheight()/2;
+ $grid[]=$xt;
+ $grid[]=$yt;
+
+ $aImg->SetLineWeight($this->weight);
+
+ for($y=$start; $y<=$limit; $y+=$step,++$count ) {
+ $yr=$aScale->RelTranslate($y);
+ $xt=round($yr*cos($aAxisAngle))+$aScale->scale_abs[0];
+ $yt=$aPos-round($yr*sin($aAxisAngle));
+ if( $count % 10 == 0 ) {
+ $grid[]=$xt;
+ $grid[]=$yt;
+ $aMajPos[]=$xt+2*$dx_maj;
+ $aMajPos[]=$yt-$aImg->GetFontheight()/2;
+ if( !$this->supress_tickmarks ) {
+ if( $this->majcolor != '' ) {
+ $aImg->PushColor($this->majcolor);
+ }
+ $aImg->Line($xt+$dx_maj,$yt+$dy_maj,$xt-$dx_maj,$yt-$dy_maj);
+ if( $this->majcolor != '' ) {
+ $aImg->PopColor();
+ }
+ }
+ if( $this->label_formfunc != '' ) {
+ $f=$this->label_formfunc;
+ $l = call_user_func($f,$nextMajor);
+ }
+ else {
+ $l = $nextMajor;
+ }
+
+ $aMajLabel[]=$l;
+ $nextMajor *= 10;
+ $step *= 10;
+ $count=1;
+ }
+ else {
+ if( !$this->supress_minor_tickmarks ) {
+ if( $this->mincolor != '' ) {
+ $aImg->PushColor($this->mincolor);
+ }
+ $aImg->Line($xt+$dx_min,$yt+$dy_min,$xt-$dx_min,$yt-$dy_min);
+ if( $this->mincolor != '' ) {
+ $aImg->PopColor();
+ }
+ }
+ }
+ }
+ }
}
-
-class RadarLinearTicks extends LinearTicks {
-//---------------
-// CONSTRUCTOR
- function RadarLinearTicks() {
- // Empty
- }
-
-//---------------
-// PUBLIC METHODS
-
- // TODO: Add argument grid
- function Stroke(&$aImg,&$grid,$aPos,$aAxisAngle,&$aScale,&$aMajPos,&$aMajLabel) {
- // Prepare to draw linear ticks
- $maj_step_abs = abs($aScale->scale_factor*$this->major_step);
- $min_step_abs = abs($aScale->scale_factor*$this->minor_step);
- $nbrmaj = floor(($aScale->world_abs_size)/$maj_step_abs);
- $nbrmin = floor(($aScale->world_abs_size)/$min_step_abs);
- $skip = round($nbrmin/$nbrmaj); // Don't draw minor ontop of major
-
- // Draw major ticks
- $ticklen2=$this->major_abs_size;
- $dx=round(sin($aAxisAngle)*$ticklen2);
- $dy=round(cos($aAxisAngle)*$ticklen2);
- $label=$aScale->scale[0]+$this->major_step;
-
- $aImg->SetLineWeight($this->weight);
-
- for($i=1; $i<=$nbrmaj; ++$i) {
- $xt=round($i*$maj_step_abs*cos($aAxisAngle))+$aScale->scale_abs[0];
- $yt=$aPos-round($i*$maj_step_abs*sin($aAxisAngle));
-
- if( $this->label_formfunc != "" ) {
- $f=$this->label_formfunc;
- $l = call_user_func($f,$label);
- }
- else
- $l = $label;
-
- $aMajLabel[]=$l;
- $label += $this->major_step;
- $grid[]=$xt;
- $grid[]=$yt;
- $aMajPos[($i-1)*2]=$xt+2*$dx;
- $aMajPos[($i-1)*2+1]=$yt-$aImg->GetFontheight()/2;
- if( !$this->supress_tickmarks ) {
- if( $this->majcolor!="" ) $aImg->PushColor($this->majcolor);
- $aImg->Line($xt+$dx,$yt+$dy,$xt-$dx,$yt-$dy);
- if( $this->majcolor!="" ) $aImg->PopColor();
- }
- }
-
- // Draw minor ticks
- $ticklen2=$this->minor_abs_size;
- $dx=round(sin($aAxisAngle)*$ticklen2);
- $dy=round(cos($aAxisAngle)*$ticklen2);
- if( !$this->supress_tickmarks && !$this->supress_minor_tickmarks) {
- if( $this->mincolor!="" ) $aImg->PushColor($this->mincolor);
- for($i=1; $i<=$nbrmin; ++$i) {
- if( ($i % $skip) == 0 ) continue;
- $xt=round($i*$min_step_abs*cos($aAxisAngle))+$aScale->scale_abs[0];
- $yt=$aPos-round($i*$min_step_abs*sin($aAxisAngle));
- $aImg->Line($xt+$dx,$yt+$dy,$xt-$dx,$yt-$dy);
- }
- if( $this->mincolor!="" ) $aImg->PopColor();
- }
+
+//===================================================
+// CLASS RadarLinear
+// Description: Linear ticks
+//===================================================
+class RadarLinearTicks extends Ticks {
+
+ private $minor_step=1, $major_step=2;
+ private $xlabel_offset=0,$xtick_offset=0;
+
+ function __construct() {
+ // Empty
+ }
+
+ // Return major step size in world coordinates
+ function GetMajor() {
+ return $this->major_step;
+ }
+
+ // Return minor step size in world coordinates
+ function GetMinor() {
+ return $this->minor_step;
+ }
+
+ // Set Minor and Major ticks (in world coordinates)
+ function Set($aMajStep,$aMinStep=false) {
+ if( $aMinStep==false ) {
+ $aMinStep=$aMajStep;
+ }
+
+ if( $aMajStep <= 0 || $aMinStep <= 0 ) {
+ JpGraphError::RaiseL(25064);
+ //JpGraphError::Raise(" Minor or major step size is 0. Check that you haven't got an accidental SetTextTicks(0) in your code. If this is not the case you might have stumbled upon a bug in JpGraph. Please report this and if possible include the data that caused the problem.");
+ }
+
+ $this->major_step=$aMajStep;
+ $this->minor_step=$aMinStep;
+ $this->is_set = true;
+ }
+
+ function Stroke($aImg,&$grid,$aPos,$aAxisAngle,$aScale,&$aMajPos,&$aMajLabel) {
+ // Prepare to draw linear ticks
+ $maj_step_abs = abs($aScale->scale_factor*$this->major_step);
+ $min_step_abs = abs($aScale->scale_factor*$this->minor_step);
+ $nbrmaj = round($aScale->world_abs_size/$maj_step_abs);
+ $nbrmin = round($aScale->world_abs_size/$min_step_abs);
+ $skip = round($nbrmin/$nbrmaj); // Don't draw minor on top of major
+
+ // Draw major ticks
+ $ticklen2=$this->major_abs_size;
+ $dx=round(sin($aAxisAngle)*$ticklen2);
+ $dy=round(cos($aAxisAngle)*$ticklen2);
+ $label=$aScale->scale[0]+$this->major_step;
+
+ $aImg->SetLineWeight($this->weight);
+
+ $aMajPos = array();
+ $aMajLabel = array();
+
+ for($i=1; $i<=$nbrmaj; ++$i) {
+ $xt=round($i*$maj_step_abs*cos($aAxisAngle))+$aScale->scale_abs[0];
+ $yt=$aPos-round($i*$maj_step_abs*sin($aAxisAngle));
+
+ if( $this->label_formfunc != '' ) {
+ $f=$this->label_formfunc;
+ $l = call_user_func($f,$label);
+ }
+ else {
+ $l = $label;
+ }
+
+ $aMajLabel[]=$l;
+ $label += $this->major_step;
+ $grid[]=$xt;
+ $grid[]=$yt;
+ $aMajPos[($i-1)*2]=$xt+2*$dx;
+ $aMajPos[($i-1)*2+1]=$yt-$aImg->GetFontheight()/2;
+ if( !$this->supress_tickmarks ) {
+ if( $this->majcolor != '' ) {
+ $aImg->PushColor($this->majcolor);
+ }
+ $aImg->Line($xt+$dx,$yt+$dy,$xt-$dx,$yt-$dy);
+ if( $this->majcolor != '' ) {
+ $aImg->PopColor();
+ }
+ }
+ }
+
+ // Draw minor ticks
+ $ticklen2=$this->minor_abs_size;
+ $dx=round(sin($aAxisAngle)*$ticklen2);
+ $dy=round(cos($aAxisAngle)*$ticklen2);
+ if( !$this->supress_tickmarks && !$this->supress_minor_tickmarks) {
+ if( $this->mincolor != '' ) {
+ $aImg->PushColor($this->mincolor);
+ }
+ for($i=1; $i<=$nbrmin; ++$i) {
+ if( ($i % $skip) == 0 ) {
+ continue;
+ }
+ $xt=round($i*$min_step_abs*cos($aAxisAngle))+$aScale->scale_abs[0];
+ $yt=$aPos-round($i*$min_step_abs*sin($aAxisAngle));
+ $aImg->Line($xt+$dx,$yt+$dy,$xt-$dx,$yt-$dy);
+ }
+ if( $this->mincolor != '' ) {
+ $aImg->PopColor();
+ }
+ }
}
}
-
//===================================================
// CLASS RadarAxis
// Description: Implements axis for the radar graph
//===================================================
-class RadarAxis extends Axis {
- var $title_color="navy";
- var $title=null;
-//---------------
-// CONSTRUCTOR
- function RadarAxis(&$img,&$aScale,$color=array(0,0,0)) {
- parent::Axis($img,$aScale,$color);
- $this->len=$img->plotheight;
- $this->title = new Text();
- $this->title->SetFont(FF_FONT1,FS_BOLD);
- $this->color = array(0,0,0);
- }
-//---------------
-// PUBLIC METHODS
- function SetTickLabels($l) {
- $this->ticks_label = $l;
- }
-
-
- // Stroke the axis
- // $pos = Vertical position of axis
+class RadarAxis extends AxisPrototype {
+ public $title=null;
+ private $title_color='navy';
+ private $len=0;
+
+ function __construct($img,$aScale,$color=array(0,0,0)) {
+ parent::__construct($img,$aScale,$color);
+ $this->len = $img->plotheight;
+ $this->title = new Text();
+ $this->title->SetFont(FF_FONT1,FS_BOLD);
+ $this->color = array(0,0,0);
+ }
+
+ // Stroke the axis
+ // $pos = Vertical position of axis
// $aAxisAngle = Axis angle
- // $grid = Returns an array with positions used to draw the grid
- // $lf = Label flag, TRUE if the axis should have labels
+ // $grid = Returns an array with positions used to draw the grid
+ // $lf = Label flag, TRUE if the axis should have labels
function Stroke($pos,$aAxisAngle,&$grid,$title,$lf) {
- $this->img->SetColor($this->color);
-
- // Determine end points for the axis
- $x=round($this->scale->world_abs_size*cos($aAxisAngle)+$this->scale->scale_abs[0]);
- $y=round($pos-$this->scale->world_abs_size*sin($aAxisAngle));
-
- // Draw axis
- $this->img->SetColor($this->color);
- $this->img->SetLineWeight($this->weight);
- if( !$this->hide )
- $this->img->Line($this->scale->scale_abs[0],$pos,$x,$y);
-
- $this->scale->ticks->Stroke($this->img,$grid,$pos,$aAxisAngle,$this->scale,$majpos,$majlabel);
-
- // Draw labels
- if( $lf && !$this->hide ) {
- $this->img->SetFont($this->font_family,$this->font_style,$this->font_size);
- $this->img->SetTextAlign("left","top");
- $this->img->SetColor($this->label_color);
-
- // majpos contains (x,y) coordinates for labels
- if( ! $this->hide_labels ) {
- $n = floor(count($majpos)/2);
- for($i=0; $i < $n; ++$i) {
- if( $this->ticks_label != null && isset($this->ticks_label[$i]) )
- $this->img->StrokeText($majpos[$i*2],$majpos[$i*2+1],$this->ticks_label[$i]);
- else
- $this->img->StrokeText($majpos[$i*2],$majpos[$i*2+1],$majlabel[$i]);
- }
- }
- }
- $this->_StrokeAxisTitle($pos,$aAxisAngle,$title);
- }
-//---------------
-// PRIVATE METHODS
-
+ $this->img->SetColor($this->color);
+
+ // Determine end points for the axis
+ $x=round($this->scale->world_abs_size*cos($aAxisAngle)+$this->scale->scale_abs[0]);
+ $y=round($pos-$this->scale->world_abs_size*sin($aAxisAngle));
+
+ // Draw axis
+ $this->img->SetColor($this->color);
+ $this->img->SetLineWeight($this->weight);
+ if( !$this->hide ) {
+ $this->img->Line($this->scale->scale_abs[0],$pos,$x,$y);
+ }
+
+ $this->scale->ticks->Stroke($this->img,$grid,$pos,$aAxisAngle,$this->scale,$majpos,$majlabel);
+ $ncolor=0;
+ if( isset($this->ticks_label_colors) ) {
+ $ncolor=count($this->ticks_label_colors);
+ }
+
+ // Draw labels
+ if( $lf && !$this->hide ) {
+ $this->img->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $this->img->SetTextAlign('left','top');
+ $this->img->SetColor($this->label_color);
+
+ // majpos contains (x,y) coordinates for labels
+ if( ! $this->hide_labels ) {
+ $n = floor(count($majpos)/2);
+ for($i=0; $i < $n; ++$i) {
+ // Set specific label color if specified
+ if( $ncolor > 0 ) {
+ $this->img->SetColor($this->ticks_label_colors[$i % $ncolor]);
+ }
+
+ if( $this->ticks_label != null && isset($this->ticks_label[$i]) ) {
+ $this->img->StrokeText($majpos[$i*2],$majpos[$i*2+1],$this->ticks_label[$i]);
+ }
+ else {
+ $this->img->StrokeText($majpos[$i*2],$majpos[$i*2+1],$majlabel[$i]);
+ }
+ }
+ }
+ }
+ $this->_StrokeAxisTitle($pos,$aAxisAngle,$title);
+ }
+
function _StrokeAxisTitle($pos,$aAxisAngle,$title) {
- $this->title->Set($title);
- $marg=6+$this->title->margin;
- $xt=round(($this->scale->world_abs_size+$marg)*cos($aAxisAngle)+$this->scale->scale_abs[0]);
- $yt=round($pos-($this->scale->world_abs_size+$marg)*sin($aAxisAngle));
-
- // Position the axis title.
- // dx, dy is the offset from the top left corner of the bounding box that sorrounds the text
- // that intersects with the extension of the corresponding axis. The code looks a little
- // bit messy but this is really the only way of having a reasonable position of the
- // axis titles.
- if( $this->title->iWordwrap > 0 ) {
- $title = wordwrap($title,$this->title->iWordwrap,"\n");
- }
-
- $h=$this->img->GetTextHeight($title)*1.2;
- $w=$this->img->GetTextWidth($title)*1.2;
- while( $aAxisAngle > 2*M_PI ) $aAxisAngle -= 2*M_PI;
-
-
- // Around 3 a'clock
- if( $aAxisAngle>=7*M_PI/4 || $aAxisAngle <= M_PI/4 ) $dx=-0.15; // Small trimming to make the dist to the axis more even
- // Around 12 a'clock
- if( $aAxisAngle>=M_PI/4 && $aAxisAngle <= 3*M_PI/4 ) $dx=($aAxisAngle-M_PI/4)*2/M_PI;
- // Around 9 a'clock
- if( $aAxisAngle>=3*M_PI/4 && $aAxisAngle <= 5*M_PI/4 ) $dx=1;
- // Around 6 a'clock
- if( $aAxisAngle>=5*M_PI/4 && $aAxisAngle <= 7*M_PI/4 ) $dx=(1-($aAxisAngle-M_PI*5/4)*2/M_PI);
-
-
- if( $aAxisAngle>=7*M_PI/4 ) $dy=(($aAxisAngle-M_PI)-3*M_PI/4)*2/M_PI;
- if( $aAxisAngle<=M_PI/12 ) $dy=(0.5-$aAxisAngle*2/M_PI);
- if( $aAxisAngle<=M_PI/4 && $aAxisAngle > M_PI/12) $dy=(1-$aAxisAngle*2/M_PI);
- if( $aAxisAngle>=M_PI/4 && $aAxisAngle <= 3*M_PI/4 ) $dy=1;
- if( $aAxisAngle>=3*M_PI/4 && $aAxisAngle <= 5*M_PI/4 ) $dy=(1-($aAxisAngle-3*M_PI/4)*2/M_PI);
- if( $aAxisAngle>=5*M_PI/4 && $aAxisAngle <= 7*M_PI/4 ) $dy=0;
-
- if( !$this->hide ) {
- $this->title->Stroke($this->img,$xt-$dx*$w,$yt-$dy*$h,$title);
- }
+ $this->title->Set($title);
+ $marg=6+$this->title->margin;
+ $xt=round(($this->scale->world_abs_size+$marg)*cos($aAxisAngle)+$this->scale->scale_abs[0]);
+ $yt=round($pos-($this->scale->world_abs_size+$marg)*sin($aAxisAngle));
+
+ // Position the axis title.
+ // dx, dy is the offset from the top left corner of the bounding box that sorrounds the text
+ // that intersects with the extension of the corresponding axis. The code looks a little
+ // bit messy but this is really the only way of having a reasonable position of the
+ // axis titles.
+ if( $this->title->iWordwrap > 0 ) {
+ $title = wordwrap($title,$this->title->iWordwrap,"\n");
+ }
+
+ $h=$this->img->GetTextHeight($title)*1.2;
+ $w=$this->img->GetTextWidth($title)*1.2;
+
+ while( $aAxisAngle > 2*M_PI )
+ $aAxisAngle -= 2*M_PI;
+
+ // Around 3 a'clock
+ if( $aAxisAngle>=7*M_PI/4 || $aAxisAngle <= M_PI/4 ) $dx=-0.15; // Small trimming to make the dist to the axis more even
+
+ // Around 12 a'clock
+ if( $aAxisAngle>=M_PI/4 && $aAxisAngle <= 3*M_PI/4 ) $dx=($aAxisAngle-M_PI/4)*2/M_PI;
+
+ // Around 9 a'clock
+ if( $aAxisAngle>=3*M_PI/4 && $aAxisAngle <= 5*M_PI/4 ) $dx=1;
+
+ // Around 6 a'clock
+ if( $aAxisAngle>=5*M_PI/4 && $aAxisAngle <= 7*M_PI/4 ) $dx=(1-($aAxisAngle-M_PI*5/4)*2/M_PI);
+
+ if( $aAxisAngle>=7*M_PI/4 ) $dy=(($aAxisAngle-M_PI)-3*M_PI/4)*2/M_PI;
+ if( $aAxisAngle<=M_PI/12 ) $dy=(0.5-$aAxisAngle*2/M_PI);
+ if( $aAxisAngle<=M_PI/4 && $aAxisAngle > M_PI/12) $dy=(1-$aAxisAngle*2/M_PI);
+ if( $aAxisAngle>=M_PI/4 && $aAxisAngle <= 3*M_PI/4 ) $dy=1;
+ if( $aAxisAngle>=3*M_PI/4 && $aAxisAngle <= 5*M_PI/4 ) $dy=(1-($aAxisAngle-3*M_PI/4)*2/M_PI);
+ if( $aAxisAngle>=5*M_PI/4 && $aAxisAngle <= 7*M_PI/4 ) $dy=0;
+
+ if( !$this->hide ) {
+ $this->title->Stroke($this->img,$xt-$dx*$w,$yt-$dy*$h,$title);
+ }
}
-
-
+
} // Class
@@ -271,38 +333,61 @@
// CLASS RadarGrid
// Description: Draws grid for the radar graph
//===================================================
-class RadarGrid extends Grid {
-//------------
-// CONSTRUCTOR
- function RadarGrid() {
- }
-
-//----------------
-// PRIVATE METHODS
- function Stroke(&$img,&$grid) {
- if( !$this->show ) return;
- $nbrticks = count($grid[0])/2;
- $nbrpnts = count($grid);
- $img->SetColor($this->grid_color);
- $img->SetLineWeight($this->weight);
- for($i=0; $i<$nbrticks; ++$i) {
- for($j=0; $j<$nbrpnts; ++$j) {
- $pnts[$j*2]=$grid[$j][$i*2];
- $pnts[$j*2+1]=$grid[$j][$i*2+1];
- }
- for($k=0; $k<$nbrpnts; ++$k ){
- $l=($k+1)%$nbrpnts;
- if( $this->type == "solid" )
- $img->Line($pnts[$k*2],$pnts[$k*2+1],$pnts[$l*2],$pnts[$l*2+1]);
- elseif( $this->type == "dotted" )
- $img->DashedLine($pnts[$k*2],$pnts[$k*2+1],$pnts[$l*2],$pnts[$l*2+1],1,6);
- elseif( $this->type == "dashed" )
- $img->DashedLine($pnts[$k*2],$pnts[$k*2+1],$pnts[$l*2],$pnts[$l*2+1],2,4);
- elseif( $this->type == "longdashed" )
- $img->DashedLine($pnts[$k*2],$pnts[$k*2+1],$pnts[$l*2],$pnts[$l*2+1],8,6);
- }
- $pnts=array();
- }
+class RadarGrid { //extends Grid {
+ private $type='solid';
+ private $grid_color='#DDDDDD';
+ private $show=false, $weight=1;
+
+ function __construct() {
+ // Empty
+ }
+
+ function SetColor($aMajColor) {
+ $this->grid_color = $aMajColor;
+ }
+
+ function SetWeight($aWeight) {
+ $this->weight=$aWeight;
+ }
+
+ // Specify if grid should be dashed, dotted or solid
+ function SetLineStyle($aType) {
+ $this->type = $aType;
+ }
+
+ // Decide if both major and minor grid should be displayed
+ function Show($aShowMajor=true) {
+ $this->show=$aShowMajor;
+ }
+
+ function Stroke($img,$grid) {
+ if( !$this->show ) {
+ return;
+ }
+
+ $nbrticks = count($grid[0])/2;
+ $nbrpnts = count($grid);
+ $img->SetColor($this->grid_color);
+ $img->SetLineWeight($this->weight);
+
+ for($i=0; $i<$nbrticks; ++$i) {
+ for($j=0; $j<$nbrpnts; ++$j) {
+ $pnts[$j*2]=$grid[$j][$i*2];
+ $pnts[$j*2+1]=$grid[$j][$i*2+1];
+ }
+ for($k=0; $k<$nbrpnts; ++$k ){
+ $l=($k+1)%$nbrpnts;
+ if( $this->type == 'solid' )
+ $img->Line($pnts[$k*2],$pnts[$k*2+1],$pnts[$l*2],$pnts[$l*2+1]);
+ elseif( $this->type == 'dotted' )
+ $img->DashedLine($pnts[$k*2],$pnts[$k*2+1],$pnts[$l*2],$pnts[$l*2+1],1,6);
+ elseif( $this->type == 'dashed' )
+ $img->DashedLine($pnts[$k*2],$pnts[$k*2+1],$pnts[$l*2],$pnts[$l*2+1],2,4);
+ elseif( $this->type == 'longdashed' )
+ $img->DashedLine($pnts[$k*2],$pnts[$k*2+1],$pnts[$l*2],$pnts[$l*2+1],8,6);
+ }
+ $pnts=array();
+ }
}
} // Class
@@ -312,119 +397,154 @@
// Description: Plot a radarplot
//===================================================
class RadarPlot {
- var $data=array();
- var $fill=false, $fill_color=array(200,170,180);
- var $color=array(0,0,0);
- var $legend="";
- var $weight=1;
- var $linestyle='solid';
- var $mark=null;
-//---------------
-// CONSTRUCTOR
- function RadarPlot($data) {
- $this->data = $data;
- $this->mark = new PlotMark();
+ public $mark=null;
+ public $legend='';
+ public $legendcsimtarget='';
+ public $legendcsimalt='';
+ public $csimtargets=array(); // Array of targets for CSIM
+ public $csimareas=""; // Resultant CSIM area tags
+ public $csimalts=null; // ALT:s for corresponding target
+ private $data=array();
+ private $fill=false, $fill_color=array(200,170,180);
+ private $color=array(0,0,0);
+ private $weight=1;
+ private $linestyle='solid';
+
+ //---------------
+ // CONSTRUCTOR
+ function __construct($data) {
+ $this->data = $data;
+ $this->mark = new PlotMark();
}
-//---------------
-// PUBLIC METHODS
function Min() {
- return Min($this->data);
+ return Min($this->data);
}
-
+
function Max() {
- return Max($this->data);
+ return Max($this->data);
}
-
+
function SetLegend($legend) {
- $this->legend=$legend;
+ $this->legend=$legend;
}
function SetLineStyle($aStyle) {
- $this->linestyle=$aStyle;
+ $this->linestyle=$aStyle;
}
-
+
function SetLineWeight($w) {
- $this->weight=$w;
+ $this->weight=$w;
}
-
+
function SetFillColor($aColor) {
- $this->fill_color = $aColor;
- $this->fill = true;
+ $this->fill_color = $aColor;
+ $this->fill = true;
}
-
+
function SetFill($f=true) {
- $this->fill = $f;
+ $this->fill = $f;
}
-
+
function SetColor($aColor,$aFillColor=false) {
- $this->color = $aColor;
- if( $aFillColor ) {
- $this->SetFillColor($aFillColor);
- $this->fill = true;
- }
+ $this->color = $aColor;
+ if( $aFillColor ) {
+ $this->SetFillColor($aFillColor);
+ $this->fill = true;
+ }
+ }
+
+ // Set href targets for CSIM
+ function SetCSIMTargets($aTargets,$aAlts=null) {
+ $this->csimtargets=$aTargets;
+ $this->csimalts=$aAlts;
}
-
+
+ // Get all created areas
function GetCSIMareas() {
- JpGraphError::RaiseL(18001);
-//("Client side image maps not supported for RadarPlots.");
+ return $this->csimareas;
+ }
+
+ function Stroke($img, $pos, $scale, $startangle) {
+ $nbrpnts = count($this->data);
+ $astep=2*M_PI/$nbrpnts;
+ $a=$startangle;
+
+ for($i=0; $i<$nbrpnts; ++$i) {
+
+ // Rotate each non null point to the correct axis-angle
+ $cs=$scale->RelTranslate($this->data[$i]);
+ $x=round($cs*cos($a)+$scale->scale_abs[0]);
+ $y=round($pos-$cs*sin($a));
+
+ $pnts[$i*2]=$x;
+ $pnts[$i*2+1]=$y;
+
+ // If the next point is null then we draw this polygon segment
+ // to the center, skip the next and draw the next segment from
+ // the center up to the point on the axis with the first non-null
+ // value and continues from that point. Some additoinal logic is necessary
+ // to handle the boundary conditions
+ if( $i < $nbrpnts-1 ) {
+ if( is_null($this->data[$i+1]) ) {
+ $cs = 0;
+ $x=round($cs*cos($a)+$scale->scale_abs[0]);
+ $y=round($pos-$cs*sin($a));
+ $pnts[$i*2]=$x;
+ $pnts[$i*2+1]=$y;
+ $a += $astep;
+ }
+ }
+
+ $a += $astep;
+ }
+
+ if( $this->fill ) {
+ $img->SetColor($this->fill_color);
+ $img->FilledPolygon($pnts);
+ }
+
+ $img->SetLineWeight($this->weight);
+ $img->SetColor($this->color);
+ $img->SetLineStyle($this->linestyle);
+ $pnts[] = $pnts[0];
+ $pnts[] = $pnts[1];
+ $img->Polygon($pnts);
+ $img->SetLineStyle('solid'); // Reset line style to default
+
+ // Add plotmarks on top
+ if( $this->mark->show ) {
+ for($i=0; $i < $nbrpnts; ++$i) {
+ if( isset($this->csimtargets[$i]) ) {
+ $this->mark->SetCSIMTarget($this->csimtargets[$i]);
+ $this->mark->SetCSIMAlt($this->csimalts[$i]);
+ $this->mark->SetCSIMAltVal($pnts[$i*2], $pnts[$i*2+1]);
+ $this->mark->Stroke($img, $pnts[$i*2], $pnts[$i*2+1]);
+ $this->csimareas .= $this->mark->GetCSIMAreas();
+ }
+ else {
+ $this->mark->Stroke($img,$pnts[$i*2],$pnts[$i*2+1]);
+ }
+ }
+ }
+
}
-
- function Stroke(&$img, $pos, &$scale, $startangle) {
- $nbrpnts = count($this->data);
- $astep=2*M_PI/$nbrpnts;
- $a=$startangle;
-
- // Rotate each point to the correct axis-angle
- // TODO: Update for LogScale
- for($i=0; $i<$nbrpnts; ++$i) {
- //$c=$this->data[$i];
- $cs=$scale->RelTranslate($this->data[$i]);
- $x=round($cs*cos($a)+$scale->scale_abs[0]);
- $y=round($pos-$cs*sin($a));
- /*
- $c=log10($c);
- $x=round(($c-$scale->scale[0])*$scale->scale_factor*cos($a)+$scale->scale_abs[0]);
- $y=round($pos-($c-$scale->scale[0])*$scale->scale_factor*sin($a));
- */
- $pnts[$i*2]=$x;
- $pnts[$i*2+1]=$y;
- $a += $astep;
- }
- if( $this->fill ) {
- $img->SetColor($this->fill_color);
- $img->FilledPolygon($pnts);
- }
- $img->SetLineWeight($this->weight);
- $img->SetColor($this->color);
- $img->SetLineStyle($this->linestyle);
- $pnts[]=$pnts[0];
- $pnts[]=$pnts[1];
- $img->Polygon($pnts);
- $img->SetLineStyle('solid'); // Reset line style to default
- // Add plotmarks on top
- if( $this->mark->show ) {
- for($i=0; $i < $nbrpnts; ++$i) {
- $this->mark->Stroke($img,$pnts[$i*2],$pnts[$i*2+1]);
- }
- }
-
- }
-
-//---------------
-// PRIVATE METHODS
+
function GetCount() {
- return count($this->data);
+ return count($this->data);
}
-
- function Legend(&$graph) {
- if( $this->legend=="" ) return;
- if( $this->fill )
- $graph->legend->Add($this->legend,$this->fill_color,$this->mark);
- else
- $graph->legend->Add($this->legend,$this->color,$this->mark);
+
+ function Legend($graph) {
+ if( $this->legend == '' ) {
+ return;
+ }
+ if( $this->fill ) {
+ $graph->legend->Add($this->legend,$this->fill_color,$this->mark);
+ } else {
+ $graph->legend->Add($this->legend,$this->color,$this->mark);
+ }
}
-
+
} // Class
//===================================================
@@ -432,236 +552,310 @@
// Description: Main container for a radar graph
//===================================================
class RadarGraph extends Graph {
- var $posx;
- var $posy;
- var $len;
- var $plots=null, $axis_title=null;
- var $grid,$axis=null;
-//---------------
-// CONSTRUCTOR
- function RadarGraph($width=300,$height=200,$cachedName="",$timeout=0,$inline=1) {
- $this->Graph($width,$height,$cachedName,$timeout,$inline);
- $this->posx=$width/2;
- $this->posy=$height/2;
- $this->len=min($width,$height)*0.35;
- $this->SetColor(array(255,255,255));
- $this->SetTickDensity(TICKD_NORMAL);
- $this->SetScale("lin");
- $this->SetGridDepth(DEPTH_FRONT);
-
- }
-
-//---------------
-// PUBLIC METHODS
- function SupressTickMarks($f=true) {
- if( ERR_DEPRECATED )
- JpGraphError::RaiseL(18002);
-//('RadarGraph::SupressTickMarks() is deprecated. Use HideTickMarks() instead.');
- $this->axis->scale->ticks->SupressTickMarks($f);
+ public $grid,$axis=null;
+ private $posx,$posy;
+ private $len;
+ private $axis_title=null;
+
+ function __construct($width=300,$height=200,$cachedName="",$timeout=0,$inline=1) {
+ parent::__construct($width,$height,$cachedName,$timeout,$inline);
+ $this->posx = $width/2;
+ $this->posy = $height/2;
+ $this->len = min($width,$height)*0.35;
+ $this->SetColor(array(255,255,255));
+ $this->SetTickDensity(TICKD_NORMAL);
+ $this->SetScale('lin');
+ $this->SetGridDepth(DEPTH_FRONT);
}
function HideTickMarks($aFlag=true) {
- $this->axis->scale->ticks->SupressTickMarks($aFlag);
+ $this->axis->scale->ticks->SupressTickMarks($aFlag);
}
-
+
function ShowMinorTickmarks($aFlag=true) {
- $this->yscale->ticks->SupressMinorTickMarks(!$aFlag);
+ $this->yscale->ticks->SupressMinorTickMarks(!$aFlag);
}
-
- function SetScale($axtype,$ymin=1,$ymax=1) {
- if( $axtype != "lin" && $axtype != "log" ) {
- JpGraphError::RaiseL(18003,$axtype);
-//("Illegal scale for radarplot ($axtype). Must be \"lin\" or \"log\"");
- }
- if( $axtype=="lin" ) {
- $this->yscale = & new LinearScale($ymin,$ymax);
- $this->yscale->ticks = & new RadarLinearTicks();
- $this->yscale->ticks->SupressMinorTickMarks();
- }
- elseif( $axtype=="log" ) {
- $this->yscale = & new LogScale($ymin,$ymax);
- $this->yscale->ticks = & new RadarLogTicks();
- }
-
- $this->axis = & new RadarAxis($this->img,$this->yscale);
- $this->grid = & new RadarGrid();
+
+ function SetScale($axtype,$ymin=1,$ymax=1,$dummy1=null,$dumy2=null) {
+ if( $axtype != 'lin' && $axtype != 'log' ) {
+ JpGraphError::RaiseL(18003,$axtype);
+ //("Illegal scale for radarplot ($axtype). Must be \"lin\" or \"log\"");
+ }
+ if( $axtype == 'lin' ) {
+ $this->yscale = new LinearScale($ymin,$ymax);
+ $this->yscale->ticks = new RadarLinearTicks();
+ $this->yscale->ticks->SupressMinorTickMarks();
+ }
+ elseif( $axtype == 'log' ) {
+ $this->yscale = new LogScale($ymin,$ymax);
+ $this->yscale->ticks = new RadarLogTicks();
+ }
+
+ $this->axis = new RadarAxis($this->img,$this->yscale);
+ $this->grid = new RadarGrid();
}
function SetSize($aSize) {
- if( $aSize < 0.1 || $aSize>1 )
- JpGraphError::RaiseL(18004,$aSize);
-//("Radar Plot size must be between 0.1 and 1. (Your value=$s)");
- $this->len=min($this->img->width,$this->img->height)*$aSize/2;
+ if( $aSize < 0.1 || $aSize>1 ) {
+ JpGraphError::RaiseL(18004,$aSize);
+ //("Radar Plot size must be between 0.1 and 1. (Your value=$s)");
+ }
+ $this->len=min($this->img->width,$this->img->height)*$aSize/2;
}
function SetPlotSize($aSize) {
- $this->SetSize($aSize);
+ $this->SetSize($aSize);
}
- function SetTickDensity($densy=TICKD_NORMAL) {
- $this->ytick_factor=25;
- switch( $densy ) {
- case TICKD_DENSE:
- $this->ytick_factor=12;
- break;
- case TICKD_NORMAL:
- $this->ytick_factor=25;
- break;
- case TICKD_SPARSE:
- $this->ytick_factor=40;
- break;
- case TICKD_VERYSPARSE:
- $this->ytick_factor=70;
- break;
- default:
- JpGraphError::RaiseL(18005,$densy);
-//("RadarPlot Unsupported Tick density: $densy");
- }
+ function SetTickDensity($densy=TICKD_NORMAL,$dummy1=null) {
+ $this->ytick_factor=25;
+ switch( $densy ) {
+ case TICKD_DENSE:
+ $this->ytick_factor=12;
+ break;
+ case TICKD_NORMAL:
+ $this->ytick_factor=25;
+ break;
+ case TICKD_SPARSE:
+ $this->ytick_factor=40;
+ break;
+ case TICKD_VERYSPARSE:
+ $this->ytick_factor=70;
+ break;
+ default:
+ JpGraphError::RaiseL(18005,$densy);
+ //("RadarPlot Unsupported Tick density: $densy");
+ }
}
function SetPos($px,$py=0.5) {
- $this->SetCenter($px,$py);
+ $this->SetCenter($px,$py);
}
function SetCenter($px,$py=0.5) {
- assert($px > 0 && $py > 0 );
- $this->posx=$this->img->width*$px;
- $this->posy=$this->img->height*$py;
- }
-
- function SetColor($c) {
- $this->SetMarginColor($c);
- }
-
- function SetTitles($title) {
- $this->axis_title = $title;
- }
-
- function Add(&$splot) {
- $this->plots[]=$splot;
- }
-
- function GetPlotsYMinMax() {
- $min=$this->plots[0]->Min();
- $max=$this->plots[0]->Max();
- foreach( $this->plots as $p ) {
- $max=max($max,$p->Max());
- $min=min($min,$p->Min());
- }
- if( $min < 0 )
- JpGraphError::RaiseL(18006,$min);
-//("Minimum data $min (Radar plots should only be used when all data points > 0)");
- return array($min,$max);
- }
+ if( $px >= 0 && $px <= 1 ) {
+ $this->posx = $this->img->width*$px;
+ }
+ else {
+ $this->posx = $px;
+ }
+ if( $py >= 0 && $py <= 1 ) {
+ $this->posy = $this->img->height*$py;
+ }
+ else {
+ $this->posy = $py;
+ }
+ }
+
+ function SetColor($aColor) {
+ $this->SetMarginColor($aColor);
+ }
+
+ function SetTitles($aTitleArray) {
+ $this->axis_title = $aTitleArray;
+ }
+
+ function Add($aPlot) {
+ if( $aPlot == null ) {
+ JpGraphError::RaiseL(25010);//("Graph::Add() You tried to add a null plot to the graph.");
+ }
+ if( is_array($aPlot) && count($aPlot) > 0 ) {
+ $cl = $aPlot[0];
+ }
+ else {
+ $cl = $aPlot;
+ }
+
+ if( $cl instanceof Text ) $this->AddText($aPlot);
+ elseif( class_exists('IconPlot',false) && ($cl instanceof IconPlot) ) $this->AddIcon($aPlot);
+ else {
+ $this->plots[] = $aPlot;
+ }
+ }
+
+ function GetPlotsYMinMax($aPlots) {
+ $min=$aPlots[0]->Min();
+ $max=$aPlots[0]->Max();
+ foreach( $this->plots as $p ) {
+ $max=max($max,$p->Max());
+ $min=min($min,$p->Min());
+ }
+ if( $min < 0 ) {
+ JpGraphError::RaiseL(18006,$min);
+ //("Minimum data $min (Radar plots should only be used when all data points > 0)");
+ }
+ return array($min,$max);
+ }
+
+ function StrokeIcons() {
+ if( $this->iIcons != null ) {
+ $n = count($this->iIcons);
+ for( $i=0; $i < $n; ++$i ) {
+ $this->iIcons[$i]->Stroke($this->img);
+ }
+ }
+ }
+
+ function StrokeTexts() {
+ if( $this->texts != null ) {
+ $n = count($this->texts);
+ for( $i=0; $i < $n; ++$i ) {
+ $this->texts[$i]->Stroke($this->img);
+ }
+ }
+ }
// Stroke the Radar graph
- function Stroke($aStrokeFileName="") {
- $n = count($this->plots);
- // Set Y-scale
- if( !$this->yscale->IsSpecified() && count($this->plots)>0 ) {
- list($min,$max) = $this->GetPlotsYMinMax();
- $this->yscale->AutoScale($this->img,0,$max,$this->len/$this->ytick_factor);
- }
- elseif( $this->yscale->IsSpecified() &&
- ( $this->yscale->auto_ticks || !$this->yscale->ticks->IsSpecified()) ) {
- // The tick calculation will use the user suplied min/max values to determine
- // the ticks. If auto_ticks is false the exact user specifed min and max
- // values will be used for the scale.
- // If auto_ticks is true then the scale might be slightly adjusted
- // so that the min and max values falls on an even major step.
- $min = $this->yscale->scale[0];
- $max = $this->yscale->scale[1];
- $this->yscale->AutoScale($this->img,$min,$max,
- $this->len/$this->ytick_factor,
- $this->yscale->auto_ticks);
- }
-
- // Set start position end length of scale (in absolute pixels)
- $this->yscale->SetConstants($this->posx,$this->len);
-
- // We need as many axis as there are data points
- $nbrpnts=$this->plots[0]->GetCount();
-
- // If we have no titles just number the axis 1,2,3,...
- if( $this->axis_title==null ) {
- for($i=0; $i < $nbrpnts; ++$i )
- $this->axis_title[$i] = $i+1;
- }
- elseif(count($this->axis_title)<$nbrpnts)
- JpGraphError::RaiseL(18007);
-//("Number of titles does not match number of points in plot.");
- for($i=0; $i < $n; ++$i )
- if( $nbrpnts != $this->plots[$i]->GetCount() )
- JpGraphError::RaiseL(18008);
-//("Each radar plot must have the same number of data points.");
-
- if( $this->background_image != "" ) {
- $this->StrokeFrameBackground();
- }
- else {
- $this->StrokeFrame();
- }
- $astep=2*M_PI/$nbrpnts;
-
- // Prepare legends
- for($i=0; $i < $n; ++$i)
- $this->plots[$i]->Legend($this);
- $this->legend->Stroke($this->img);
- $this->footer->Stroke($this->img);
-
- if( $this->grid_depth == DEPTH_BACK ) {
- // Draw axis and grid
- for( $i=0,$a=M_PI/2; $i < $nbrpnts; ++$i, $a += $astep ) {
- $this->axis->Stroke($this->posy,$a,$grid[$i],$this->axis_title[$i],$i==0);
- }
- }
-
- // Plot points
- $a=M_PI/2;
- for($i=0; $i < $n; ++$i )
- $this->plots[$i]->Stroke($this->img, $this->posy, $this->yscale, $a);
-
- if( $this->grid_depth != DEPTH_BACK ) {
- // Draw axis and grid
- for( $i=0,$a=M_PI/2; $i < $nbrpnts; ++$i, $a += $astep ) {
- $this->axis->Stroke($this->posy,$a,$grid[$i],$this->axis_title[$i],$i==0);
- }
- }
- $this->grid->Stroke($this->img,$grid);
- $this->StrokeTitles();
-
- // Stroke texts
- if( $this->texts != null ) {
- foreach( $this->texts as $t)
- $t->Stroke($this->img);
- }
-
- // Should we do any final image transformation
- if( $this->iImgTrans ) {
- if( !class_exists('ImgTrans') ) {
- require_once('jpgraph_imgtrans.php');
- }
-
- $tform = new ImgTrans($this->img->img);
- $this->img->img = $tform->Skew3D($this->iImgTransHorizon,$this->iImgTransSkewDist,
- $this->iImgTransDirection,$this->iImgTransHighQ,
- $this->iImgTransMinSize,$this->iImgTransFillColor,
- $this->iImgTransBorder);
- }
-
- // If the filename is given as the special "__handle"
- // then the image handler is returned and the image is NOT
- // streamed back
- if( $aStrokeFileName == _IMG_HANDLER ) {
- return $this->img->img;
- }
- else {
- // Finally stream the generated picture
- $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,
- $aStrokeFileName);
- }
+ function Stroke($aStrokeFileName='') {
+
+ // If the filename is the predefined value = '_csim_special_'
+ // we assume that the call to stroke only needs to do enough
+ // to correctly generate the CSIM maps.
+ // We use this variable to skip things we don't strictly need
+ // to do to generate the image map to improve performance
+ // a best we can. Therefor you will see a lot of tests !$_csim in the
+ // code below.
+ $_csim = ( $aStrokeFileName === _CSIM_SPECIALFILE );
+
+ // We need to know if we have stroked the plot in the
+ // GetCSIMareas. Otherwise the CSIM hasn't been generated
+ // and in the case of GetCSIM called before stroke to generate
+ // CSIM without storing an image to disk GetCSIM must call Stroke.
+ $this->iHasStroked = true;
+
+ $n = count($this->plots);
+ // Set Y-scale
+
+ if( !$this->yscale->IsSpecified() && count($this->plots) > 0 ) {
+ list($min,$max) = $this->GetPlotsYMinMax($this->plots);
+ $this->yscale->AutoScale($this->img,0,$max,$this->len/$this->ytick_factor);
+ }
+ elseif( $this->yscale->IsSpecified() &&
+ ( $this->yscale->auto_ticks || !$this->yscale->ticks->IsSpecified()) ) {
+
+ // The tick calculation will use the user suplied min/max values to determine
+ // the ticks. If auto_ticks is false the exact user specifed min and max
+ // values will be used for the scale.
+ // If auto_ticks is true then the scale might be slightly adjusted
+ // so that the min and max values falls on an even major step.
+ $min = $this->yscale->scale[0];
+ $max = $this->yscale->scale[1];
+ $this->yscale->AutoScale($this->img,$min,$max,
+ $this->len/$this->ytick_factor,
+ $this->yscale->auto_ticks);
+ }
+
+ // Set start position end length of scale (in absolute pixels)
+ $this->yscale->SetConstants($this->posx,$this->len);
+
+ // We need as many axis as there are data points
+ $nbrpnts=$this->plots[0]->GetCount();
+
+ // If we have no titles just number the axis 1,2,3,...
+ if( $this->axis_title==null ) {
+ for($i=0; $i < $nbrpnts; ++$i ) {
+ $this->axis_title[$i] = $i+1;
+ }
+ }
+ elseif( count($this->axis_title) < $nbrpnts) {
+ JpGraphError::RaiseL(18007);
+ // ("Number of titles does not match number of points in plot.");
+ }
+ for( $i=0; $i < $n; ++$i ) {
+ if( $nbrpnts != $this->plots[$i]->GetCount() ) {
+ JpGraphError::RaiseL(18008);
+ //("Each radar plot must have the same number of data points.");
+ }
+ }
+
+ if( !$_csim ) {
+ if( $this->background_image != '' ) {
+ $this->StrokeFrameBackground();
+ }
+ else {
+ $this->StrokeFrame();
+ $this->StrokeBackgroundGrad();
+ }
+ }
+ $astep=2*M_PI/$nbrpnts;
+
+ if( !$_csim ) {
+ if( $this->iIconDepth == DEPTH_BACK ) {
+ $this->StrokeIcons();
+ }
+
+
+ // Prepare legends
+ for($i=0; $i < $n; ++$i) {
+ $this->plots[$i]->Legend($this);
+ }
+ $this->legend->Stroke($this->img);
+ $this->footer->Stroke($this->img);
+ }
+
+ if( !$_csim ) {
+ if( $this->grid_depth == DEPTH_BACK ) {
+ // Draw axis and grid
+ for( $i=0,$a=M_PI/2; $i < $nbrpnts; ++$i, $a += $astep ) {
+ $this->axis->Stroke($this->posy,$a,$grid[$i],$this->axis_title[$i],$i==0);
+ }
+ $this->grid->Stroke($this->img,$grid);
+ }
+ if( $this->iIconDepth == DEPTH_BACK ) {
+ $this->StrokeIcons();
+ }
+
+ }
+
+ // Plot points
+ $a=M_PI/2;
+ for($i=0; $i < $n; ++$i ) {
+ $this->plots[$i]->Stroke($this->img, $this->posy, $this->yscale, $a);
+ }
+
+ if( !$_csim ) {
+ if( $this->grid_depth != DEPTH_BACK ) {
+ // Draw axis and grid
+ for( $i=0,$a=M_PI/2; $i < $nbrpnts; ++$i, $a += $astep ) {
+ $this->axis->Stroke($this->posy,$a,$grid[$i],$this->axis_title[$i],$i==0);
+ }
+ $this->grid->Stroke($this->img,$grid);
+ }
+
+ $this->StrokeTitles();
+ $this->StrokeTexts();
+ if( $this->iIconDepth == DEPTH_FRONT ) {
+ $this->StrokeIcons();
+ }
+ }
+
+ // Should we do any final image transformation
+ if( $this->iImgTrans && !$_csim ) {
+ if( !class_exists('ImgTrans',false) ) {
+ require_once('jpgraph_imgtrans.php');
+ }
+
+ $tform = new ImgTrans($this->img->img);
+ $this->img->img = $tform->Skew3D($this->iImgTransHorizon,$this->iImgTransSkewDist,
+ $this->iImgTransDirection,$this->iImgTransHighQ,
+ $this->iImgTransMinSize,$this->iImgTransFillColor,
+ $this->iImgTransBorder);
+ }
+
+ if( !$_csim ) {
+ // If the filename is given as the special "__handle"
+ // then the image handler is returned and the image is NOT
+ // streamed back
+ if( $aStrokeFileName == _IMG_HANDLER ) {
+ return $this->img->img;
+ }
+ else {
+ // Finally stream the generated picture
+ $this->cache->PutAndStream($this->img,$this->cache_name,$this->inline,$aStrokeFileName);
+ }
+ }
}
} // Class
/* EOF */
-?>
\ Pas de fin de ligne à la fin du fichier.
+?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_regstat.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_regstat.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_regstat.php 2006-10-08 04:09:02.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_regstat.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,13 +1,13 @@
-y2 = array();
- $this->xdata = $xdata;
- $this->ydata = $ydata;
-
- $n = count($ydata);
- $this->n = $n;
- if( $this->n !== count($xdata) ) {
- JpGraphError::RaiseL(19001);
-//('Spline: Number of X and Y coordinates must be the same');
- }
-
- // Natural spline 2:derivate == 0 at endpoints
- $this->y2[0] = 0.0;
- $this->y2[$n-1] = 0.0;
- $delta[0] = 0.0;
-
- // Calculate 2:nd derivate
- for($i=1; $i < $n-1; ++$i) {
- $d = ($xdata[$i+1]-$xdata[$i-1]);
- if( $d == 0 ) {
- JpGraphError::RaiseL(19002);
-//('Invalid input data for spline. Two or more consecutive input X-values are equal. Each input X-value must differ since from a mathematical point of view it must be a one-to-one mapping, i.e. each X-value must correspond to exactly one Y-value.');
- }
- $s = ($xdata[$i]-$xdata[$i-1])/$d;
- $p = $s*$this->y2[$i-1]+2.0;
- $this->y2[$i] = ($s-1.0)/$p;
- $delta[$i] = ($ydata[$i+1]-$ydata[$i])/($xdata[$i+1]-$xdata[$i]) -
- ($ydata[$i]-$ydata[$i-1])/($xdata[$i]-$xdata[$i-1]);
- $delta[$i] = (6.0*$delta[$i]/($xdata[$i+1]-$xdata[$i-1])-$s*$delta[$i-1])/$p;
- }
-
- // Backward substitution
- for( $j=$n-2; $j >= 0; --$j ) {
- $this->y2[$j] = $this->y2[$j]*$this->y2[$j+1] + $delta[$j];
- }
+ private $xdata,$ydata; // Data vectors
+ private $y2; // 2:nd derivate of ydata
+ private $n=0;
+
+ function __construct($xdata,$ydata) {
+ $this->y2 = array();
+ $this->xdata = $xdata;
+ $this->ydata = $ydata;
+
+ $n = count($ydata);
+ $this->n = $n;
+ if( $this->n !== count($xdata) ) {
+ JpGraphError::RaiseL(19001);
+ //('Spline: Number of X and Y coordinates must be the same');
+ }
+
+ // Natural spline 2:derivate == 0 at endpoints
+ $this->y2[0] = 0.0;
+ $this->y2[$n-1] = 0.0;
+ $delta[0] = 0.0;
+
+ // Calculate 2:nd derivate
+ for($i=1; $i < $n-1; ++$i) {
+ $d = ($xdata[$i+1]-$xdata[$i-1]);
+ if( $d == 0 ) {
+ JpGraphError::RaiseL(19002);
+ //('Invalid input data for spline. Two or more consecutive input X-values are equal. Each input X-value must differ since from a mathematical point of view it must be a one-to-one mapping, i.e. each X-value must correspond to exactly one Y-value.');
+ }
+ $s = ($xdata[$i]-$xdata[$i-1])/$d;
+ $p = $s*$this->y2[$i-1]+2.0;
+ $this->y2[$i] = ($s-1.0)/$p;
+ $delta[$i] = ($ydata[$i+1]-$ydata[$i])/($xdata[$i+1]-$xdata[$i]) -
+ ($ydata[$i]-$ydata[$i-1])/($xdata[$i]-$xdata[$i-1]);
+ $delta[$i] = (6.0*$delta[$i]/($xdata[$i+1]-$xdata[$i-1])-$s*$delta[$i-1])/$p;
+ }
+
+ // Backward substitution
+ for( $j=$n-2; $j >= 0; --$j ) {
+ $this->y2[$j] = $this->y2[$j]*$this->y2[$j+1] + $delta[$j];
+ }
}
// Return the two new data vectors
function Get($num=50) {
- $n = $this->n ;
- $step = ($this->xdata[$n-1]-$this->xdata[0]) / ($num-1);
- $xnew=array();
- $ynew=array();
- $xnew[0] = $this->xdata[0];
- $ynew[0] = $this->ydata[0];
- for( $j=1; $j < $num; ++$j ) {
- $xnew[$j] = $xnew[0]+$j*$step;
- $ynew[$j] = $this->Interpolate($xnew[$j]);
- }
- return array($xnew,$ynew);
+ $n = $this->n ;
+ $step = ($this->xdata[$n-1]-$this->xdata[0]) / ($num-1);
+ $xnew=array();
+ $ynew=array();
+ $xnew[0] = $this->xdata[0];
+ $ynew[0] = $this->ydata[0];
+ for( $j=1; $j < $num; ++$j ) {
+ $xnew[$j] = $xnew[0]+$j*$step;
+ $ynew[$j] = $this->Interpolate($xnew[$j]);
+ }
+ return array($xnew,$ynew);
}
// Return a single interpolated Y-value from an x value
function Interpolate($xpoint) {
- $max = $this->n-1;
- $min = 0;
+ $max = $this->n-1;
+ $min = 0;
- // Binary search to find interval
- while( $max-$min > 1 ) {
- $k = ($max+$min) / 2;
- if( $this->xdata[$k] > $xpoint )
- $max=$k;
- else
- $min=$k;
- }
-
- // Each interval is interpolated by a 3:degree polynom function
- $h = $this->xdata[$max]-$this->xdata[$min];
-
- if( $h == 0 ) {
- JpGraphError::RaiseL(19002);
-//('Invalid input data for spline. Two or more consecutive input X-values are equal. Each input X-value must differ since from a mathematical point of view it must be a one-to-one mapping, i.e. each X-value must correspond to exactly one Y-value.');
- }
-
-
- $a = ($this->xdata[$max]-$xpoint)/$h;
- $b = ($xpoint-$this->xdata[$min])/$h;
- return $a*$this->ydata[$min]+$b*$this->ydata[$max]+
- (($a*$a*$a-$a)*$this->y2[$min]+($b*$b*$b-$b)*$this->y2[$max])*($h*$h)/6.0;
+ // Binary search to find interval
+ while( $max-$min > 1 ) {
+ $k = ($max+$min) / 2;
+ if( $this->xdata[$k] > $xpoint )
+ $max=$k;
+ else
+ $min=$k;
+ }
+
+ // Each interval is interpolated by a 3:degree polynom function
+ $h = $this->xdata[$max]-$this->xdata[$min];
+
+ if( $h == 0 ) {
+ JpGraphError::RaiseL(19002);
+ //('Invalid input data for spline. Two or more consecutive input X-values are equal. Each input X-value must differ since from a mathematical point of view it must be a one-to-one mapping, i.e. each X-value must correspond to exactly one Y-value.');
+ }
+
+
+ $a = ($this->xdata[$max]-$xpoint)/$h;
+ $b = ($xpoint-$this->xdata[$min])/$h;
+ return $a*$this->ydata[$min]+$b*$this->ydata[$max]+
+ (($a*$a*$a-$a)*$this->y2[$min]+($b*$b*$b-$b)*$this->y2[$max])*($h*$h)/6.0;
}
}
@@ -110,91 +110,104 @@
// Create a new data array from a number of control points
//------------------------------------------------------------------------
class Bezier {
-/**
- * @author Thomas Despoix, openXtrem company
- * @license released under QPL
- * @abstract Bezier interoplated point generation,
- * computed from control points data sets, based on Paul Bourke algorithm :
- * http://astronomy.swin.edu.au/~pbourke/curves/bezier/
- */
- var $datax = array();
- var $datay = array();
- var $n=0;
-
- function Bezier($datax, $datay, $attraction_factor = 1) {
- // Adding control point multiple time will raise their attraction power over the curve
- $this->n = count($datax);
- if( $this->n !== count($datay) ) {
- JpGraphError::RaiseL(19003);
-//('Bezier: Number of X and Y coordinates must be the same');
- }
- $idx=0;
- foreach($datax as $datumx) {
- for ($i = 0; $i < $attraction_factor; $i++) {
- $this->datax[$idx++] = $datumx;
- }
- }
- $idx=0;
- foreach($datay as $datumy) {
- for ($i = 0; $i < $attraction_factor; $i++) {
- $this->datay[$idx++] = $datumy;
- }
- }
- $this->n *= $attraction_factor;
- }
-
+ /**
+ * @author Thomas Despoix, openXtrem company
+ * @license released under QPL
+ * @abstract Bezier interoplated point generation,
+ * computed from control points data sets, based on Paul Bourke algorithm :
+ * http://local.wasp.uwa.edu.au/~pbourke/geometry/bezier/index2.html
+ */
+ private $datax = array();
+ private $datay = array();
+ private $n=0;
+
+ function __construct($datax, $datay, $attraction_factor = 1) {
+ // Adding control point multiple time will raise their attraction power over the curve
+ $this->n = count($datax);
+ if( $this->n !== count($datay) ) {
+ JpGraphError::RaiseL(19003);
+ //('Bezier: Number of X and Y coordinates must be the same');
+ }
+ $idx=0;
+ foreach($datax as $datumx) {
+ for ($i = 0; $i < $attraction_factor; $i++) {
+ $this->datax[$idx++] = $datumx;
+ }
+ }
+ $idx=0;
+ foreach($datay as $datumy) {
+ for ($i = 0; $i < $attraction_factor; $i++) {
+ $this->datay[$idx++] = $datumy;
+ }
+ }
+ $this->n *= $attraction_factor;
+ }
+
+ /**
+ * Return a set of data points that specifies the bezier curve with $steps points
+ * @param $steps Number of new points to return
+ * @return array($datax, $datay)
+ */
function Get($steps) {
- $datax = array();
- $datay = array();
- for ($i = 0; $i < $steps; $i++) {
- list($datumx, $datumy) = $this->GetPoint((double) $i / (double) $steps);
- $datax[] = $datumx;
- $datay[] = $datumy;
- }
-
- $datax[] = end($this->datax);
- $datay[] = end($this->datay);
-
- return array($datax, $datay);
- }
-
+ $datax = array();
+ $datay = array();
+ for ($i = 0; $i < $steps; $i++) {
+ list($datumx, $datumy) = $this->GetPoint((double) $i / (double) $steps);
+ $datax[$i] = $datumx;
+ $datay[$i] = $datumy;
+ }
+
+ $datax[] = end($this->datax);
+ $datay[] = end($this->datay);
+
+ return array($datax, $datay);
+ }
+
+ /**
+ * Return one point on the bezier curve. $mu is the position on the curve where $mu is in the
+ * range 0 $mu < 1 where 0 is tha start point and 1 is the end point. Note that every newly computed
+ * point depends on all the existing points
+ *
+ * @param $mu Position on the bezier curve
+ * @return array($x, $y)
+ */
function GetPoint($mu) {
- $n = $this->n - 1;
- $k = 0;
- $kn = 0;
- $nn = 0;
- $nkn = 0;
- $blend = 0.0;
- $newx = 0.0;
- $newy = 0.0;
-
- $muk = 1.0;
- $munk = (double) pow(1-$mu,(double) $n);
-
- for ($k = 0; $k <= $n; $k++) {
- $nn = $n;
- $kn = $k;
- $nkn = $n - $k;
- $blend = $muk * $munk;
- $muk *= $mu;
- $munk /= (1-$mu);
- while ($nn >= 1) {
- $blend *= $nn;
- $nn--;
- if ($kn > 1) {
- $blend /= (double) $kn;
- $kn--;
- }
- if ($nkn > 1) {
- $blend /= (double) $nkn;
- $nkn--;
- }
- }
- $newx += $this->datax[$k] * $blend;
- $newy += $this->datay[$k] * $blend;
- }
+ $n = $this->n - 1;
+ $k = 0;
+ $kn = 0;
+ $nn = 0;
+ $nkn = 0;
+ $blend = 0.0;
+ $newx = 0.0;
+ $newy = 0.0;
+
+ $muk = 1.0;
+ $munk = (double) pow(1-$mu,(double) $n);
+
+ for ($k = 0; $k <= $n; $k++) {
+ $nn = $n;
+ $kn = $k;
+ $nkn = $n - $k;
+ $blend = $muk * $munk;
+ $muk *= $mu;
+ $munk /= (1-$mu);
+ while ($nn >= 1) {
+ $blend *= $nn;
+ $nn--;
+ if ($kn > 1) {
+ $blend /= (double) $kn;
+ $kn--;
+ }
+ if ($nkn > 1) {
+ $blend /= (double) $nkn;
+ $nkn--;
+ }
+ }
+ $newx += $this->datax[$k] * $blend;
+ $newy += $this->datay[$k] * $blend;
+ }
- return array($newx, $newy);
+ return array($newx, $newy);
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_rgb.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_rgb.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_rgb.inc.php 1969-12-31 19:00:00.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_rgb.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -0,0 +1,615 @@
+img = $aImg;
+
+ // Conversion array between color names and RGB
+ $this->rgb_table = array(
+ 'aqua'=> array(0,255,255),
+ 'lime'=> array(0,255,0),
+ 'teal'=> array(0,128,128),
+ 'whitesmoke'=>array(245,245,245),
+ 'gainsboro'=>array(220,220,220),
+ 'oldlace'=>array(253,245,230),
+ 'linen'=>array(250,240,230),
+ 'antiquewhite'=>array(250,235,215),
+ 'papayawhip'=>array(255,239,213),
+ 'blanchedalmond'=>array(255,235,205),
+ 'bisque'=>array(255,228,196),
+ 'peachpuff'=>array(255,218,185),
+ 'navajowhite'=>array(255,222,173),
+ 'moccasin'=>array(255,228,181),
+ 'cornsilk'=>array(255,248,220),
+ 'ivory'=>array(255,255,240),
+ 'lemonchiffon'=>array(255,250,205),
+ 'seashell'=>array(255,245,238),
+ 'mintcream'=>array(245,255,250),
+ 'azure'=>array(240,255,255),
+ 'aliceblue'=>array(240,248,255),
+ 'lavender'=>array(230,230,250),
+ 'lavenderblush'=>array(255,240,245),
+ 'mistyrose'=>array(255,228,225),
+ 'white'=>array(255,255,255),
+ 'black'=>array(0,0,0),
+ 'darkslategray'=>array(47,79,79),
+ 'dimgray'=>array(105,105,105),
+ 'slategray'=>array(112,128,144),
+ 'lightslategray'=>array(119,136,153),
+ 'gray'=>array(190,190,190),
+ 'lightgray'=>array(211,211,211),
+ 'midnightblue'=>array(25,25,112),
+ 'navy'=>array(0,0,128),
+ 'indigo'=>array(75,0,130),
+ 'electricindigo'=>array(102,0,255),
+ 'deepindigo'=>array(138,43,226),
+ 'pigmentindigo'=>array(75,0,130),
+ 'indigodye'=>array(0,65,106),
+ 'cornflowerblue'=>array(100,149,237),
+ 'darkslateblue'=>array(72,61,139),
+ 'slateblue'=>array(106,90,205),
+ 'mediumslateblue'=>array(123,104,238),
+ 'lightslateblue'=>array(132,112,255),
+ 'mediumblue'=>array(0,0,205),
+ 'royalblue'=>array(65,105,225),
+ 'blue'=>array(0,0,255),
+ 'dodgerblue'=>array(30,144,255),
+ 'deepskyblue'=>array(0,191,255),
+ 'skyblue'=>array(135,206,235),
+ 'lightskyblue'=>array(135,206,250),
+ 'steelblue'=>array(70,130,180),
+ 'lightred'=>array(211,167,168),
+ 'lightsteelblue'=>array(176,196,222),
+ 'lightblue'=>array(173,216,230),
+ 'powderblue'=>array(176,224,230),
+ 'paleturquoise'=>array(175,238,238),
+ 'darkturquoise'=>array(0,206,209),
+ 'mediumturquoise'=>array(72,209,204),
+ 'turquoise'=>array(64,224,208),
+ 'cyan'=>array(0,255,255),
+ 'lightcyan'=>array(224,255,255),
+ 'cadetblue'=>array(95,158,160),
+ 'mediumaquamarine'=>array(102,205,170),
+ 'aquamarine'=>array(127,255,212),
+ 'darkgreen'=>array(0,100,0),
+ 'darkolivegreen'=>array(85,107,47),
+ 'darkseagreen'=>array(143,188,143),
+ 'seagreen'=>array(46,139,87),
+ 'mediumseagreen'=>array(60,179,113),
+ 'lightseagreen'=>array(32,178,170),
+ 'palegreen'=>array(152,251,152),
+ 'springgreen'=>array(0,255,127),
+ 'lawngreen'=>array(124,252,0),
+ 'green'=>array(0,255,0),
+ 'chartreuse'=>array(127,255,0),
+ 'mediumspringgreen'=>array(0,250,154),
+ 'greenyellow'=>array(173,255,47),
+ 'limegreen'=>array(50,205,50),
+ 'yellowgreen'=>array(154,205,50),
+ 'forestgreen'=>array(34,139,34),
+ 'olivedrab'=>array(107,142,35),
+ 'darkkhaki'=>array(189,183,107),
+ 'khaki'=>array(240,230,140),
+ 'palegoldenrod'=>array(238,232,170),
+ 'lightgoldenrodyellow'=>array(250,250,210),
+ 'lightyellow'=>array(255,255,200),
+ 'yellow'=>array(255,255,0),
+ 'gold'=>array(255,215,0),
+ 'lightgoldenrod'=>array(238,221,130),
+ 'goldenrod'=>array(218,165,32),
+ 'darkgoldenrod'=>array(184,134,11),
+ 'rosybrown'=>array(188,143,143),
+ 'indianred'=>array(205,92,92),
+ 'saddlebrown'=>array(139,69,19),
+ 'sienna'=>array(160,82,45),
+ 'peru'=>array(205,133,63),
+ 'burlywood'=>array(222,184,135),
+ 'beige'=>array(245,245,220),
+ 'wheat'=>array(245,222,179),
+ 'sandybrown'=>array(244,164,96),
+ 'tan'=>array(210,180,140),
+ 'chocolate'=>array(210,105,30),
+ 'firebrick'=>array(178,34,34),
+ 'brown'=>array(165,42,42),
+ 'darksalmon'=>array(233,150,122),
+ 'salmon'=>array(250,128,114),
+ 'lightsalmon'=>array(255,160,122),
+ 'orange'=>array(255,165,0),
+ 'darkorange'=>array(255,140,0),
+ 'coral'=>array(255,127,80),
+ 'lightcoral'=>array(240,128,128),
+ 'tomato'=>array(255,99,71),
+ 'orangered'=>array(255,69,0),
+ 'red'=>array(255,0,0),
+ 'hotpink'=>array(255,105,180),
+ 'deeppink'=>array(255,20,147),
+ 'pink'=>array(255,192,203),
+ 'lightpink'=>array(255,182,193),
+ 'palevioletred'=>array(219,112,147),
+ 'maroon'=>array(176,48,96),
+ 'mediumvioletred'=>array(199,21,133),
+ 'violetred'=>array(208,32,144),
+ 'magenta'=>array(255,0,255),
+ 'violet'=>array(238,130,238),
+ 'plum'=>array(221,160,221),
+ 'orchid'=>array(218,112,214),
+ 'mediumorchid'=>array(186,85,211),
+ 'darkorchid'=>array(153,50,204),
+ 'darkviolet'=>array(148,0,211),
+ 'blueviolet'=>array(138,43,226),
+ 'purple'=>array(160,32,240),
+ 'mediumpurple'=>array(147,112,219),
+ 'thistle'=>array(216,191,216),
+ 'snow1'=>array(255,250,250),
+ 'snow2'=>array(238,233,233),
+ 'snow3'=>array(205,201,201),
+ 'snow4'=>array(139,137,137),
+ 'seashell1'=>array(255,245,238),
+ 'seashell2'=>array(238,229,222),
+ 'seashell3'=>array(205,197,191),
+ 'seashell4'=>array(139,134,130),
+ 'AntiqueWhite1'=>array(255,239,219),
+ 'AntiqueWhite2'=>array(238,223,204),
+ 'AntiqueWhite3'=>array(205,192,176),
+ 'AntiqueWhite4'=>array(139,131,120),
+ 'bisque1'=>array(255,228,196),
+ 'bisque2'=>array(238,213,183),
+ 'bisque3'=>array(205,183,158),
+ 'bisque4'=>array(139,125,107),
+ 'peachPuff1'=>array(255,218,185),
+ 'peachpuff2'=>array(238,203,173),
+ 'peachpuff3'=>array(205,175,149),
+ 'peachpuff4'=>array(139,119,101),
+ 'navajowhite1'=>array(255,222,173),
+ 'navajowhite2'=>array(238,207,161),
+ 'navajowhite3'=>array(205,179,139),
+ 'navajowhite4'=>array(139,121,94),
+ 'lemonchiffon1'=>array(255,250,205),
+ 'lemonchiffon2'=>array(238,233,191),
+ 'lemonchiffon3'=>array(205,201,165),
+ 'lemonchiffon4'=>array(139,137,112),
+ 'ivory1'=>array(255,255,240),
+ 'ivory2'=>array(238,238,224),
+ 'ivory3'=>array(205,205,193),
+ 'ivory4'=>array(139,139,131),
+ 'honeydew'=>array(193,205,193),
+ 'lavenderblush1'=>array(255,240,245),
+ 'lavenderblush2'=>array(238,224,229),
+ 'lavenderblush3'=>array(205,193,197),
+ 'lavenderblush4'=>array(139,131,134),
+ 'mistyrose1'=>array(255,228,225),
+ 'mistyrose2'=>array(238,213,210),
+ 'mistyrose3'=>array(205,183,181),
+ 'mistyrose4'=>array(139,125,123),
+ 'azure1'=>array(240,255,255),
+ 'azure2'=>array(224,238,238),
+ 'azure3'=>array(193,205,205),
+ 'azure4'=>array(131,139,139),
+ 'slateblue1'=>array(131,111,255),
+ 'slateblue2'=>array(122,103,238),
+ 'slateblue3'=>array(105,89,205),
+ 'slateblue4'=>array(71,60,139),
+ 'royalblue1'=>array(72,118,255),
+ 'royalblue2'=>array(67,110,238),
+ 'royalblue3'=>array(58,95,205),
+ 'royalblue4'=>array(39,64,139),
+ 'dodgerblue1'=>array(30,144,255),
+ 'dodgerblue2'=>array(28,134,238),
+ 'dodgerblue3'=>array(24,116,205),
+ 'dodgerblue4'=>array(16,78,139),
+ 'steelblue1'=>array(99,184,255),
+ 'steelblue2'=>array(92,172,238),
+ 'steelblue3'=>array(79,148,205),
+ 'steelblue4'=>array(54,100,139),
+ 'deepskyblue1'=>array(0,191,255),
+ 'deepskyblue2'=>array(0,178,238),
+ 'deepskyblue3'=>array(0,154,205),
+ 'deepskyblue4'=>array(0,104,139),
+ 'skyblue1'=>array(135,206,255),
+ 'skyblue2'=>array(126,192,238),
+ 'skyblue3'=>array(108,166,205),
+ 'skyblue4'=>array(74,112,139),
+ 'lightskyblue1'=>array(176,226,255),
+ 'lightskyblue2'=>array(164,211,238),
+ 'lightskyblue3'=>array(141,182,205),
+ 'lightskyblue4'=>array(96,123,139),
+ 'slategray1'=>array(198,226,255),
+ 'slategray2'=>array(185,211,238),
+ 'slategray3'=>array(159,182,205),
+ 'slategray4'=>array(108,123,139),
+ 'lightsteelblue1'=>array(202,225,255),
+ 'lightsteelblue2'=>array(188,210,238),
+ 'lightsteelblue3'=>array(162,181,205),
+ 'lightsteelblue4'=>array(110,123,139),
+ 'lightblue1'=>array(191,239,255),
+ 'lightblue2'=>array(178,223,238),
+ 'lightblue3'=>array(154,192,205),
+ 'lightblue4'=>array(104,131,139),
+ 'lightcyan1'=>array(224,255,255),
+ 'lightcyan2'=>array(209,238,238),
+ 'lightcyan3'=>array(180,205,205),
+ 'lightcyan4'=>array(122,139,139),
+ 'paleturquoise1'=>array(187,255,255),
+ 'paleturquoise2'=>array(174,238,238),
+ 'paleturquoise3'=>array(150,205,205),
+ 'paleturquoise4'=>array(102,139,139),
+ 'cadetblue1'=>array(152,245,255),
+ 'cadetblue2'=>array(142,229,238),
+ 'cadetblue3'=>array(122,197,205),
+ 'cadetblue4'=>array(83,134,139),
+ 'turquoise1'=>array(0,245,255),
+ 'turquoise2'=>array(0,229,238),
+ 'turquoise3'=>array(0,197,205),
+ 'turquoise4'=>array(0,134,139),
+ 'cyan1'=>array(0,255,255),
+ 'cyan2'=>array(0,238,238),
+ 'cyan3'=>array(0,205,205),
+ 'cyan4'=>array(0,139,139),
+ 'darkslategray1'=>array(151,255,255),
+ 'darkslategray2'=>array(141,238,238),
+ 'darkslategray3'=>array(121,205,205),
+ 'darkslategray4'=>array(82,139,139),
+ 'aquamarine1'=>array(127,255,212),
+ 'aquamarine2'=>array(118,238,198),
+ 'aquamarine3'=>array(102,205,170),
+ 'aquamarine4'=>array(69,139,116),
+ 'darkseagreen1'=>array(193,255,193),
+ 'darkseagreen2'=>array(180,238,180),
+ 'darkseagreen3'=>array(155,205,155),
+ 'darkseagreen4'=>array(105,139,105),
+ 'seagreen1'=>array(84,255,159),
+ 'seagreen2'=>array(78,238,148),
+ 'seagreen3'=>array(67,205,128),
+ 'seagreen4'=>array(46,139,87),
+ 'palegreen1'=>array(154,255,154),
+ 'palegreen2'=>array(144,238,144),
+ 'palegreen3'=>array(124,205,124),
+ 'palegreen4'=>array(84,139,84),
+ 'springgreen1'=>array(0,255,127),
+ 'springgreen2'=>array(0,238,118),
+ 'springgreen3'=>array(0,205,102),
+ 'springgreen4'=>array(0,139,69),
+ 'chartreuse1'=>array(127,255,0),
+ 'chartreuse2'=>array(118,238,0),
+ 'chartreuse3'=>array(102,205,0),
+ 'chartreuse4'=>array(69,139,0),
+ 'olivedrab1'=>array(192,255,62),
+ 'olivedrab2'=>array(179,238,58),
+ 'olivedrab3'=>array(154,205,50),
+ 'olivedrab4'=>array(105,139,34),
+ 'darkolivegreen1'=>array(202,255,112),
+ 'darkolivegreen2'=>array(188,238,104),
+ 'darkolivegreen3'=>array(162,205,90),
+ 'darkolivegreen4'=>array(110,139,61),
+ 'khaki1'=>array(255,246,143),
+ 'khaki2'=>array(238,230,133),
+ 'khaki3'=>array(205,198,115),
+ 'khaki4'=>array(139,134,78),
+ 'lightgoldenrod1'=>array(255,236,139),
+ 'lightgoldenrod2'=>array(238,220,130),
+ 'lightgoldenrod3'=>array(205,190,112),
+ 'lightgoldenrod4'=>array(139,129,76),
+ 'yellow1'=>array(255,255,0),
+ 'yellow2'=>array(238,238,0),
+ 'yellow3'=>array(205,205,0),
+ 'yellow4'=>array(139,139,0),
+ 'gold1'=>array(255,215,0),
+ 'gold2'=>array(238,201,0),
+ 'gold3'=>array(205,173,0),
+ 'gold4'=>array(139,117,0),
+ 'goldenrod1'=>array(255,193,37),
+ 'goldenrod2'=>array(238,180,34),
+ 'goldenrod3'=>array(205,155,29),
+ 'goldenrod4'=>array(139,105,20),
+ 'darkgoldenrod1'=>array(255,185,15),
+ 'darkgoldenrod2'=>array(238,173,14),
+ 'darkgoldenrod3'=>array(205,149,12),
+ 'darkgoldenrod4'=>array(139,101,8),
+ 'rosybrown1'=>array(255,193,193),
+ 'rosybrown2'=>array(238,180,180),
+ 'rosybrown3'=>array(205,155,155),
+ 'rosybrown4'=>array(139,105,105),
+ 'indianred1'=>array(255,106,106),
+ 'indianred2'=>array(238,99,99),
+ 'indianred3'=>array(205,85,85),
+ 'indianred4'=>array(139,58,58),
+ 'sienna1'=>array(255,130,71),
+ 'sienna2'=>array(238,121,66),
+ 'sienna3'=>array(205,104,57),
+ 'sienna4'=>array(139,71,38),
+ 'burlywood1'=>array(255,211,155),
+ 'burlywood2'=>array(238,197,145),
+ 'burlywood3'=>array(205,170,125),
+ 'burlywood4'=>array(139,115,85),
+ 'wheat1'=>array(255,231,186),
+ 'wheat2'=>array(238,216,174),
+ 'wheat3'=>array(205,186,150),
+ 'wheat4'=>array(139,126,102),
+ 'tan1'=>array(255,165,79),
+ 'tan2'=>array(238,154,73),
+ 'tan3'=>array(205,133,63),
+ 'tan4'=>array(139,90,43),
+ 'chocolate1'=>array(255,127,36),
+ 'chocolate2'=>array(238,118,33),
+ 'chocolate3'=>array(205,102,29),
+ 'chocolate4'=>array(139,69,19),
+ 'firebrick1'=>array(255,48,48),
+ 'firebrick2'=>array(238,44,44),
+ 'firebrick3'=>array(205,38,38),
+ 'firebrick4'=>array(139,26,26),
+ 'brown1'=>array(255,64,64),
+ 'brown2'=>array(238,59,59),
+ 'brown3'=>array(205,51,51),
+ 'brown4'=>array(139,35,35),
+ 'salmon1'=>array(255,140,105),
+ 'salmon2'=>array(238,130,98),
+ 'salmon3'=>array(205,112,84),
+ 'salmon4'=>array(139,76,57),
+ 'lightsalmon1'=>array(255,160,122),
+ 'lightsalmon2'=>array(238,149,114),
+ 'lightsalmon3'=>array(205,129,98),
+ 'lightsalmon4'=>array(139,87,66),
+ 'orange1'=>array(255,165,0),
+ 'orange2'=>array(238,154,0),
+ 'orange3'=>array(205,133,0),
+ 'orange4'=>array(139,90,0),
+ 'darkorange1'=>array(255,127,0),
+ 'darkorange2'=>array(238,118,0),
+ 'darkorange3'=>array(205,102,0),
+ 'darkorange4'=>array(139,69,0),
+ 'coral1'=>array(255,114,86),
+ 'coral2'=>array(238,106,80),
+ 'coral3'=>array(205,91,69),
+ 'coral4'=>array(139,62,47),
+ 'tomato1'=>array(255,99,71),
+ 'tomato2'=>array(238,92,66),
+ 'tomato3'=>array(205,79,57),
+ 'tomato4'=>array(139,54,38),
+ 'orangered1'=>array(255,69,0),
+ 'orangered2'=>array(238,64,0),
+ 'orangered3'=>array(205,55,0),
+ 'orangered4'=>array(139,37,0),
+ 'deeppink1'=>array(255,20,147),
+ 'deeppink2'=>array(238,18,137),
+ 'deeppink3'=>array(205,16,118),
+ 'deeppink4'=>array(139,10,80),
+ 'hotpink1'=>array(255,110,180),
+ 'hotpink2'=>array(238,106,167),
+ 'hotpink3'=>array(205,96,144),
+ 'hotpink4'=>array(139,58,98),
+ 'pink1'=>array(255,181,197),
+ 'pink2'=>array(238,169,184),
+ 'pink3'=>array(205,145,158),
+ 'pink4'=>array(139,99,108),
+ 'lightpink1'=>array(255,174,185),
+ 'lightpink2'=>array(238,162,173),
+ 'lightpink3'=>array(205,140,149),
+ 'lightpink4'=>array(139,95,101),
+ 'palevioletred1'=>array(255,130,171),
+ 'palevioletred2'=>array(238,121,159),
+ 'palevioletred3'=>array(205,104,137),
+ 'palevioletred4'=>array(139,71,93),
+ 'maroon1'=>array(255,52,179),
+ 'maroon2'=>array(238,48,167),
+ 'maroon3'=>array(205,41,144),
+ 'maroon4'=>array(139,28,98),
+ 'violetred1'=>array(255,62,150),
+ 'violetred2'=>array(238,58,140),
+ 'violetred3'=>array(205,50,120),
+ 'violetred4'=>array(139,34,82),
+ 'magenta1'=>array(255,0,255),
+ 'magenta2'=>array(238,0,238),
+ 'magenta3'=>array(205,0,205),
+ 'magenta4'=>array(139,0,139),
+ 'mediumred'=>array(140,34,34),
+ 'orchid1'=>array(255,131,250),
+ 'orchid2'=>array(238,122,233),
+ 'orchid3'=>array(205,105,201),
+ 'orchid4'=>array(139,71,137),
+ 'plum1'=>array(255,187,255),
+ 'plum2'=>array(238,174,238),
+ 'plum3'=>array(205,150,205),
+ 'plum4'=>array(139,102,139),
+ 'mediumorchid1'=>array(224,102,255),
+ 'mediumorchid2'=>array(209,95,238),
+ 'mediumorchid3'=>array(180,82,205),
+ 'mediumorchid4'=>array(122,55,139),
+ 'darkorchid1'=>array(191,62,255),
+ 'darkorchid2'=>array(178,58,238),
+ 'darkorchid3'=>array(154,50,205),
+ 'darkorchid4'=>array(104,34,139),
+ 'purple1'=>array(155,48,255),
+ 'purple2'=>array(145,44,238),
+ 'purple3'=>array(125,38,205),
+ 'purple4'=>array(85,26,139),
+ 'mediumpurple1'=>array(171,130,255),
+ 'mediumpurple2'=>array(159,121,238),
+ 'mediumpurple3'=>array(137,104,205),
+ 'mediumpurple4'=>array(93,71,139),
+ 'thistle1'=>array(255,225,255),
+ 'thistle2'=>array(238,210,238),
+ 'thistle3'=>array(205,181,205),
+ 'thistle4'=>array(139,123,139),
+ 'gray1'=>array(10,10,10),
+ 'gray2'=>array(40,40,30),
+ 'gray3'=>array(70,70,70),
+ 'gray4'=>array(100,100,100),
+ 'gray5'=>array(130,130,130),
+ 'gray6'=>array(160,160,160),
+ 'gray7'=>array(190,190,190),
+ 'gray8'=>array(210,210,210),
+ 'gray9'=>array(240,240,240),
+ 'darkgray'=>array(100,100,100),
+ 'darkblue'=>array(0,0,139),
+ 'darkcyan'=>array(0,139,139),
+ 'darkmagenta'=>array(139,0,139),
+ 'darkred'=>array(139,0,0),
+ 'silver'=>array(192, 192, 192),
+ 'eggplant'=>array(144,176,168),
+ 'lightgreen'=>array(144,238,144));
+ }
+
+
+ //----------------
+ // PUBLIC METHODS
+ // Colors can be specified as either
+ // 1. #xxxxxx HTML style
+ // 2. "colorname" as a named color
+ // 3. array(r,g,b) RGB triple
+ // This function translates this to a native RGB format and returns an
+ // RGB triple.
+
+ function Color($aColor) {
+ if (is_string($aColor)) {
+ $matches = array();
+ // this regex will parse a color string and fill the $matches array as such:
+ // 0: the full match if any
+ // 1: a hex string preceded by a hash, can be 3 characters (#fff) or 6 (#ffffff) (4 or 5 also accepted but...)
+ // 2,3,4: r,g,b values in hex if the first character of the string is #
+ // 5: all alpha-numeric characters at the beginning of the string if string does not start with #
+ // 6: alpha value prefixed by @ if supplied
+ // 7: alpha value with @ stripped
+ // 8: adjust value prefixed with : if supplied
+ // 9: adjust value with : stripped
+ $regex = '/(#([0-9a-fA-F]{1,2})([0-9a-fA-F]{1,2})([0-9a-fA-F]{1,2}))?([\w]+)?(@([\d\.,]+))?(:([\d\.,]+))?/';
+ if(!preg_match($regex, $aColor, $matches)) {
+ JpGraphError::RaiseL(25078,$aColor);//(" Unknown color: $aColor");
+ }
+ if(empty($matches[5])) {
+ $r = strlen($matches[2]) == 1 ? $matches[2].$matches[2] : $matches[2];
+ $g = strlen($matches[3]) == 1 ? $matches[3].$matches[3] : $matches[3];
+ $b = strlen($matches[4]) == 1 ? $matches[4].$matches[4] : $matches[4];
+ $r = hexdec($r);
+ $g = hexdec($g);
+ $b = hexdec($b);
+ }else {
+ if(!isset($this->rgb_table[$matches[5]]) ) {
+ JpGraphError::RaiseL(25078,$aColor);//(" Unknown color: $aColor");
+ }
+ $r = $this->rgb_table[$matches[5]][0];
+ $g = $this->rgb_table[$matches[5]][1];
+ $b = $this->rgb_table[$matches[5]][2];
+ }
+ $alpha = isset($matches[7]) ? str_replace(',','.',$matches[7]) : 0;
+ $adj = isset($matches[9]) ? str_replace(',','.',$matches[9]) : 1.0;
+
+ if( $adj < 0 ) {
+ JpGraphError::RaiseL(25077);//('Adjustment factor for color must be > 0');
+ }
+
+ // Scale adj so that an adj=2 always
+ // makes the color 100% white (i.e. 255,255,255.
+ // and adj=1 neutral and adj=0 black.
+ if( $adj == 1) {
+ return array($r,$g,$b,$alpha);
+ }
+ elseif( $adj > 1 ) {
+ $m = ($adj-1.0)*(255-min(255,min($r,min($g,$b))));
+ return array(min(255,$r+$m), min(255,$g+$m), min(255,$b+$m),$alpha);
+ }
+ elseif( $adj < 1 ) {
+ $m = ($adj-1.0)*max(255,max($r,max($g,$b)));
+ return array(max(0,$r+$m), max(0,$g+$m), max(0,$b+$m),$alpha);
+ }
+ } elseif( is_array($aColor) ) {
+ if(!isset($aColor[3])) $aColor[3] = 0;
+ return $aColor;
+ }
+ else {
+ JpGraphError::RaiseL(25079,$aColor,count($aColor));//(" Unknown color specification: $aColor , size=".count($aColor));
+ }
+ }
+
+ // Compare two colors
+ // return true if equal
+ function Equal($aCol1,$aCol2) {
+ $c1 = $this->Color($aCol1);
+ $c2 = $this->Color($aCol2);
+ return $c1[0]==$c2[0] && $c1[1]==$c2[1] && $c1[2]==$c2[2] ;
+ }
+
+ // Allocate a new color in the current image
+ // Return new color index, -1 if no more colors could be allocated
+ function Allocate($aColor,$aAlpha=0.0) {
+ list ($r, $g, $b, $a) = $this->color($aColor);
+ // If alpha is specified in the color string then this
+ // takes precedence over the second argument
+ if( $a > 0 ) {
+ $aAlpha = $a;
+ }
+ if( $aAlpha < 0 || $aAlpha > 1 ) {
+ JpGraphError::RaiseL(25080);//('Alpha parameter for color must be between 0.0 and 1.0');
+ }
+ return imagecolorresolvealpha($this->img, $r, $g, $b, round($aAlpha * 127));
+ }
+
+ // Try to convert an array with three valid numbers to the corresponding hex array
+ // This is currenly only used in processing the colors for barplots in order to be able
+ // to handle the case where the color might be specified as an array of colros as well.
+ // In that case we must be able to find out if an array of values should be interpretated as
+ // a single color (specifeid as an RGB triple)
+ static function tryHexConversion($aColor) {
+ if( is_array( $aColor ) ) {
+ if( count( $aColor ) == 3 ) {
+ if( is_numeric($aColor[0]) && is_numeric($aColor[1]) && is_numeric($aColor[2]) ) {
+ if( ($aColor[0] >= 0 && $aColor[0] <= 255) &&
+ ($aColor[1] >= 0 && $aColor[1] <= 255) &&
+ ($aColor[2] >= 0 && $aColor[2] <= 255) ) {
+ return sprintf('#%02x%02x%02x',$aColor[0],$aColor[1],$aColor[2]);
+ }
+ }
+ }
+ }
+ return $aColor;
+ }
+
+ // Return a RGB tripple corresponding to a position in the normal light spectrum
+ // The argumen values is in the range [0, 1] where a value of 0 correponds to blue and
+ // a value of 1 corresponds to red. Values in betwen is mapped to a linear interpolation
+ // of the constituting colors in the visible color spectra.
+ // The $aDynamicRange specified how much of the dynamic range we shold use
+ // a value of 1.0 give the full dyanmic range and a lower value give more dark
+ // colors. In the extreme of 0.0 then all colors will be black.
+ static function GetSpectrum($aVal,$aDynamicRange=1.0) {
+ if( $aVal < 0 || $aVal > 1.0001 ) {
+ return array(0,0,0); // Invalid case - just return black
+ }
+
+ $sat = round(255*$aDynamicRange);
+ $a = 0.25;
+ if( $aVal <= 0.25 ) {
+ return array(0, round($sat*$aVal/$a), $sat);
+ }
+ elseif( $aVal <= 0.5 ) {
+ return array(0, $sat, round($sat-$sat*($aVal-0.25)/$a));
+ }
+ elseif( $aVal <= 0.75 ) {
+ return array(round($sat*($aVal-0.5)/$a), $sat, 0);
+ }
+ else {
+ return array($sat, round($sat-$sat*($aVal-0.75)/$a), 0);
+ }
+ }
+
+} // Class
+
+?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_scatter.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_scatter.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_scatter.php 2007-11-17 06:41:42.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_scatter.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,13 +1,13 @@
-iSize = $aSize;
- $this->iArrowSize = $aArrowSize;
+ $this->iSize = $aSize;
+ $this->iArrowSize = $aArrowSize;
}
function SetColor($aColor) {
- $this->iColor = $aColor;
+ $this->iColor = $aColor;
}
- function Stroke(&$aImg,$x,$y,$a) {
- // First rotate the center coordinates
- list($x,$y) = $aImg->Rotate($x,$y);
+ function Stroke($aImg,$x,$y,$a) {
+ // First rotate the center coordinates
+ list($x,$y) = $aImg->Rotate($x,$y);
- $old_origin = $aImg->SetCenter($x,$y);
- $old_a = $aImg->a;
- $aImg->SetAngle(-$a+$old_a);
+ $old_origin = $aImg->SetCenter($x,$y);
+ $old_a = $aImg->a;
+ $aImg->SetAngle(-$a+$old_a);
- $dx = round($this->iSize/2);
- $c = array($x-$dx,$y,$x+$dx,$y);
- $x += $dx;
+ $dx = round($this->iSize/2);
+ $c = array($x-$dx,$y,$x+$dx,$y);
+ $x += $dx;
- list($dx,$dy) = $this->isizespec[$this->iArrowSize];
- $ca = array($x,$y,$x-$dx,$y-$dy,$x-$dx,$y+$dy,$x,$y);
+ list($dx,$dy) = $this->isizespec[$this->iArrowSize];
+ $ca = array($x,$y,$x-$dx,$y-$dy,$x-$dx,$y+$dy,$x,$y);
- $aImg->SetColor($this->iColor);
- $aImg->Polygon($c);
- $aImg->FilledPolygon($ca);
+ $aImg->SetColor($this->iColor);
+ $aImg->Polygon($c);
+ $aImg->FilledPolygon($ca);
- $aImg->SetCenter($old_origin[0],$old_origin[1]);
- $aImg->SetAngle($old_a);
+ $aImg->SetCenter($old_origin[0],$old_origin[1]);
+ $aImg->SetAngle($old_a);
}
}
@@ -61,65 +63,67 @@
// Description: Render a field plot
//===================================================
class FieldPlot extends Plot {
- var $iAngles;
- var $iCallback='';
- function FieldPlot($datay,$datax,$angles) {
- if( (count($datax) != count($datay)) )
- JpGraphError::RaiseL(20001);//("Fieldplots must have equal number of X and Y points.");
- if( (count($datax) != count($angles)) )
- JpGraphError::RaiseL(20002);//("Fieldplots must have an angle specified for each X and Y points.");
-
- $this->iAngles = $angles;
-
- $this->Plot($datay,$datax);
- $this->value->SetAlign('center','center');
- $this->value->SetMargin(15);
+ public $arrow = '';
+ private $iAngles = array();
+ private $iCallback = '';
+
+ function __construct($datay,$datax,$angles) {
+ if( (count($datax) != count($datay)) )
+ JpGraphError::RaiseL(20001);//("Fieldplots must have equal number of X and Y points.");
+ if( (count($datax) != count($angles)) )
+ JpGraphError::RaiseL(20002);//("Fieldplots must have an angle specified for each X and Y points.");
+
+ $this->iAngles = $angles;
+
+ parent::__construct($datay,$datax);
+ $this->value->SetAlign('center','center');
+ $this->value->SetMargin(15);
- $this->arrow = new FieldArrow();
+ $this->arrow = new FieldArrow();
}
function SetCallback($aFunc) {
- $this->iCallback = $aFunc;
+ $this->iCallback = $aFunc;
}
- function Stroke(&$img,&$xscale,&$yscale) {
+ function Stroke($img,$xscale,$yscale) {
- // Remeber base color and size
- $bc = $this->arrow->iColor;
- $bs = $this->arrow->iSize;
- $bas = $this->arrow->iArrowSize;
-
- for( $i=0; $i<$this->numpoints; ++$i ) {
- // Skip null values
- if( $this->coords[0][$i]==="" )
- continue;
-
- $f = $this->iCallback;
- if( $f != "" ) {
- list($cc,$cs,$cas) = call_user_func($f,$this->coords[1][$i],$this->coords[0][$i],$this->iAngles[$i]);
- // Fall back on global data if the callback isn't set
- if( $cc == "" ) $cc = $bc;
- if( $cs == "" ) $cs = $bs;
- if( $cas == "" ) $cas = $bas;
- $this->arrow->SetColor($cc);
- $this->arrow->SetSize($cs,$cas);
- }
-
- $xt = $xscale->Translate($this->coords[1][$i]);
- $yt = $yscale->Translate($this->coords[0][$i]);
-
- $this->arrow->Stroke($img,$xt,$yt,$this->iAngles[$i]);
- $this->value->Stroke($img,$this->coords[0][$i],$xt,$yt);
- }
+ // Remeber base color and size
+ $bc = $this->arrow->iColor;
+ $bs = $this->arrow->iSize;
+ $bas = $this->arrow->iArrowSize;
+
+ for( $i=0; $i<$this->numpoints; ++$i ) {
+ // Skip null values
+ if( $this->coords[0][$i]==="" )
+ continue;
+
+ $f = $this->iCallback;
+ if( $f != "" ) {
+ list($cc,$cs,$cas) = call_user_func($f,$this->coords[1][$i],$this->coords[0][$i],$this->iAngles[$i]);
+ // Fall back on global data if the callback isn't set
+ if( $cc == "" ) $cc = $bc;
+ if( $cs == "" ) $cs = $bs;
+ if( $cas == "" ) $cas = $bas;
+ $this->arrow->SetColor($cc);
+ $this->arrow->SetSize($cs,$cas);
+ }
+
+ $xt = $xscale->Translate($this->coords[1][$i]);
+ $yt = $yscale->Translate($this->coords[0][$i]);
+
+ $this->arrow->Stroke($img,$xt,$yt,$this->iAngles[$i]);
+ $this->value->Stroke($img,$this->coords[0][$i],$xt,$yt);
+ }
}
-
+
// Framework function
- function Legend(&$aGraph) {
- if( $this->legend != "" ) {
- $aGraph->legend->Add($this->legend,$this->mark->fill_color,$this->mark,0,
- $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
- }
- }
+ function Legend($aGraph) {
+ if( $this->legend != "" ) {
+ $aGraph->legend->Add($this->legend,$this->mark->fill_color,$this->mark,0,
+ $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ }
+ }
}
//===================================================
@@ -127,102 +131,112 @@
// Description: Render X and Y plots
//===================================================
class ScatterPlot extends Plot {
- var $impuls = false;
- var $linkpoints = false, $linkpointweight=1, $linkpointcolor="black";
-//---------------
-// CONSTRUCTOR
- function ScatterPlot($datay,$datax=false) {
- if( (count($datax) != count($datay)) && is_array($datax))
- JpGraphError::RaiseL(20003);//("Scatterplot must have equal number of X and Y points.");
- $this->Plot($datay,$datax);
- $this->mark = new PlotMark();
- $this->mark->SetType(MARK_SQUARE);
- $this->mark->SetColor($this->color);
- $this->value->SetAlign('center','center');
- $this->value->SetMargin(0);
+ public $mark,$link;
+ private $impuls = false;
+ //---------------
+ // CONSTRUCTOR
+ function __construct($datay,$datax=false) {
+ if( (count($datax) != count($datay)) && is_array($datax)) {
+ JpGraphError::RaiseL(20003);//("Scatterplot must have equal number of X and Y points.");
+ }
+ parent::__construct($datay,$datax);
+ $this->mark = new PlotMark();
+ $this->mark->SetType(MARK_SQUARE);
+ $this->mark->SetColor($this->color);
+ $this->value->SetAlign('center','center');
+ $this->value->SetMargin(0);
+ $this->link = new LineProperty(1,'black','solid');
+ $this->link->iShow = false;
}
-//---------------
-// PUBLIC METHODS
+ //---------------
+ // PUBLIC METHODS
function SetImpuls($f=true) {
- $this->impuls = $f;
- }
+ $this->impuls = $f;
+ }
+
+ function SetStem($f=true) {
+ $this->impuls = $f;
+ }
// Combine the scatter plot points with a line
- function SetLinkPoints($aFlag=true,$aColor="black",$aWeight=1) {
- $this->linkpoints=$aFlag;
- $this->linkpointcolor=$aColor;
- $this->linkpointweight=$aWeight;
- }
-
- function Stroke(&$img,&$xscale,&$yscale) {
-
- $ymin=$yscale->scale_abs[0];
- if( $yscale->scale[0] < 0 )
- $yzero=$yscale->Translate(0);
- else
- $yzero=$yscale->scale_abs[0];
-
- $this->csimareas = '';
- for( $i=0; $i < $this->numpoints; ++$i ) {
-
- // Skip null values
- if( $this->coords[0][$i]==="" || $this->coords[0][$i]==='-' || $this->coords[0][$i]==='x')
- continue;
-
- if( isset($this->coords[1]) )
- $xt = $xscale->Translate($this->coords[1][$i]);
- else
- $xt = $xscale->Translate($i);
- $yt = $yscale->Translate($this->coords[0][$i]);
-
-
- if( $this->linkpoints && isset($yt_old) ) {
- $img->SetColor($this->linkpointcolor);
- $img->SetLineWeight($this->linkpointweight);
- $img->Line($xt_old,$yt_old,$xt,$yt);
- }
-
- if( $this->impuls ) {
- $img->SetColor($this->color);
- $img->SetLineWeight($this->weight);
- $img->Line($xt,$yzero,$xt,$yt);
- }
-
- if( !empty($this->csimtargets[$i]) ) {
- if( !empty($this->csimwintargets[$i]) ) {
- $this->mark->SetCSIMTarget($this->csimtargets[$i],$this->csimwintargets[$i]);
- }
- else {
- $this->mark->SetCSIMTarget($this->csimtargets[$i]);
- }
- $this->mark->SetCSIMAlt($this->csimalts[$i]);
- }
-
- if( isset($this->coords[1]) ) {
- $this->mark->SetCSIMAltVal($this->coords[0][$i],$this->coords[1][$i]);
- }
- else {
- $this->mark->SetCSIMAltVal($this->coords[0][$i],$i);
- }
-
- $this->mark->Stroke($img,$xt,$yt);
-
- $this->csimareas .= $this->mark->GetCSIMAreas();
- $this->value->Stroke($img,$this->coords[0][$i],$xt,$yt);
-
- $xt_old = $xt;
- $yt_old = $yt;
- }
+ function SetLinkPoints($aFlag=true,$aColor="black",$aWeight=1,$aStyle='solid') {
+ $this->link->iShow = $aFlag;
+ $this->link->iColor = $aColor;
+ $this->link->iWeight = $aWeight;
+ $this->link->iStyle = $aStyle;
+ }
+
+ function Stroke($img,$xscale,$yscale) {
+
+ $ymin=$yscale->scale_abs[0];
+ if( $yscale->scale[0] < 0 )
+ $yzero=$yscale->Translate(0);
+ else
+ $yzero=$yscale->scale_abs[0];
+
+ $this->csimareas = '';
+ for( $i=0; $i<$this->numpoints; ++$i ) {
+
+ // Skip null values
+ if( $this->coords[0][$i]==='' || $this->coords[0][$i]==='-' || $this->coords[0][$i]==='x')
+ continue;
+
+ if( isset($this->coords[1]) )
+ $xt = $xscale->Translate($this->coords[1][$i]);
+ else
+ $xt = $xscale->Translate($i);
+ $yt = $yscale->Translate($this->coords[0][$i]);
+
+
+ if( $this->link->iShow && isset($yt_old) ) {
+ $img->SetColor($this->link->iColor);
+ $img->SetLineWeight($this->link->iWeight);
+ $old = $img->SetLineStyle($this->link->iStyle);
+ $img->StyleLine($xt_old,$yt_old,$xt,$yt);
+ $img->SetLineStyle($old);
+ }
+
+ if( $this->impuls ) {
+ $img->SetColor($this->color);
+ $img->SetLineWeight($this->weight);
+ $img->Line($xt,$yzero,$xt,$yt);
+ }
+
+ if( !empty($this->csimtargets[$i]) ) {
+ if( !empty($this->csimwintargets[$i]) ) {
+ $this->mark->SetCSIMTarget($this->csimtargets[$i],$this->csimwintargets[$i]);
+ }
+ else {
+ $this->mark->SetCSIMTarget($this->csimtargets[$i]);
+ }
+ $this->mark->SetCSIMAlt($this->csimalts[$i]);
+ }
+
+ if( isset($this->coords[1]) ) {
+ $this->mark->SetCSIMAltVal($this->coords[0][$i],$this->coords[1][$i]);
+ }
+ else {
+ $this->mark->SetCSIMAltVal($this->coords[0][$i],$i);
+ }
+
+ $this->mark->Stroke($img,$xt,$yt);
+
+ $this->csimareas .= $this->mark->GetCSIMAreas();
+ $this->value->Stroke($img,$this->coords[0][$i],$xt,$yt);
+
+ $xt_old = $xt;
+ $yt_old = $yt;
+ }
}
-
+
// Framework function
- function Legend(&$aGraph) {
- if( $this->legend != "" ) {
- $aGraph->legend->Add($this->legend,$this->mark->fill_color,$this->mark,0,
- $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
- }
- }
+ function Legend($aGraph) {
+ if( $this->legend != "" ) {
+ $aGraph->legend->Add($this->legend,$this->mark->fill_color,$this->mark,0,
+ $this->legendcsimtarget,$this->legendcsimalt,$this->legendcsimwintarget);
+ }
+ }
} // Class
/* EOF */
?>
\ Pas de fin de ligne à la fin du fichier.
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_stock.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_stock.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_stock.php 2008-09-19 11:46:20.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_stock.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,150 +1,165 @@
iTupleSize ) {
- JpGraphError::RaiseL(21001,$this->iTupleSize);//('Data values for Stock charts must contain an even multiple of '.$this->iTupleSize.' data points.');
- }
- $this->Plot($datay,$datax);
- $this->numpoints /= $this->iTupleSize;
- }
-//---------------
-// PUBLIC METHODS
-
+ protected $iTupleSize = 4;
+ private $iWidth=9;
+ private $iEndLines=1;
+ private $iStockColor1='white',$iStockColor2='darkred',$iStockColor3='darkred';
+ //---------------
+ // CONSTRUCTOR
+ function __construct($datay,$datax=false) {
+ if( count($datay) % $this->iTupleSize ) {
+ JpGraphError::RaiseL(21001,$this->iTupleSize);
+ //('Data values for Stock charts must contain an even multiple of '.$this->iTupleSize.' data points.');
+ }
+ parent::__construct($datay,$datax);
+ $this->numpoints /= $this->iTupleSize;
+ }
+ //---------------
+ // PUBLIC METHODS
+
function SetColor($aColor,$aColor1='white',$aColor2='darkred',$aColor3='darkred') {
- $this->color = $aColor;
- $this->iStockColor1 = $aColor1;
- $this->iStockColor2 = $aColor2;
- $this->iStockColor3 = $aColor3;
+ $this->color = $aColor;
+ $this->iStockColor1 = $aColor1;
+ $this->iStockColor2 = $aColor2;
+ $this->iStockColor3 = $aColor3;
}
function SetWidth($aWidth) {
- // Make sure it's odd
- $this->iWidth = 2*floor($aWidth/2)+1;
+ // Make sure it's odd
+ $this->iWidth = 2*floor($aWidth/2)+1;
}
function HideEndLines($aHide=true) {
- $this->iEndLines = !$aHide;
+ $this->iEndLines = !$aHide;
}
// Gets called before any axis are stroked
- function PreStrokeAdjust(&$graph) {
- if( $this->center ) {
- $a=0.5; $b=0.5;
- $this->numpoints++;
- } else {
- $a=0; $b=0;
- }
- $graph->xaxis->scale->ticks->SetXLabelOffset($a);
- $graph->SetTextScaleOff($b);
- }
-
- // Stroke stock plot
- function Stroke(&$img,$xscale,$yscale) {
- $n=$this->numpoints;
- if( $this->center ) $n--;
- if( isset($this->coords[1]) ) {
- if( count($this->coords[1])!=$n )
- JpGraphError::RaiseL(2003,count($this->coords[1]),$n);
-//("Number of X and Y points are not equal. Number of X-points:".count($this->coords[1])." Number of Y-points:$numpoints");
- else
- $exist_x = true;
- }
- else
- $exist_x = false;
-
- if( $exist_x )
- $xs=$this->coords[1][0];
- else
- $xs=0;
-
- $ts = $this->iTupleSize;
- $this->csimareas = '';
- for( $i=0; $i<$n; ++$i) {
-
- //If value is NULL, then don't draw a bar at all
- if ($this->coords[0][$i] === null) continue;
-
- if( $exist_x ) $x=$this->coords[1][$i];
- else $x=$i;
- $xt = $xscale->Translate($x);
-
- $neg = $this->coords[0][$i*$ts] > $this->coords[0][$i*$ts+1] ;
- $yopen = $yscale->Translate($this->coords[0][$i*$ts]);
- $yclose = $yscale->Translate($this->coords[0][$i*$ts+1]);
- $ymin = $yscale->Translate($this->coords[0][$i*$ts+2]);
- $ymax = $yscale->Translate($this->coords[0][$i*$ts+3]);
-
- $dx = floor($this->iWidth/2);
- $xl = $xt - $dx;
- $xr = $xt + $dx;
-
- if( $neg )
- $img->SetColor($this->iStockColor3);
- else
- $img->SetColor($this->iStockColor1);
- $img->FilledRectangle($xl,$yopen,$xr,$yclose);
- $img->SetLineWeight($this->weight);
- if( $neg )
- $img->SetColor($this->iStockColor2);
- else
- $img->SetColor($this->color);
-
- $img->Rectangle($xl,$yopen,$xr,$yclose);
-
- if( $yopen < $yclose ) {
- $ytop = $yopen ;
- $ybottom = $yclose ;
- }
- else {
- $ytop = $yclose ;
- $ybottom = $yopen ;
- }
- $img->SetColor($this->color);
- $img->Line($xt,$ytop,$xt,$ymax);
- $img->Line($xt,$ybottom,$xt,$ymin);
-
- if( $this->iEndLines ) {
- $img->Line($xl,$ymax,$xr,$ymax);
- $img->Line($xl,$ymin,$xr,$ymin);
- }
-
- // A chance for subclasses to add things to the bar
- // for data point i
- $this->ModBox($img,$xscale,$yscale,$i,$xl,$xr,$neg);
-
- // Setup image maps
- if( !empty($this->csimtargets[$i]) ) {
- $this->csimareas.= 'csimareas .= ' href="'.$this->csimtargets[$i].'"';
- if( !empty($this->csimalts[$i]) ) {
- $sval=$this->csimalts[$i];
- $this->csimareas .= " title=\"$sval\" alt=\"$sval\" ";
- }
- $this->csimareas.= " />\n";
- }
- }
- return true;
+ function PreStrokeAdjust($graph) {
+ if( $this->center ) {
+ $a=0.5; $b=0.5;
+ $this->numpoints++;
+ } else {
+ $a=0; $b=0;
+ }
+ $graph->xaxis->scale->ticks->SetXLabelOffset($a);
+ $graph->SetTextScaleOff($b);
+ }
+
+ // Method description
+ function Stroke($img,$xscale,$yscale) {
+ $n=$this->numpoints;
+ if( $this->center ) $n--;
+ if( isset($this->coords[1]) ) {
+ if( count($this->coords[1])!=$n ) {
+ JpGraphError::RaiseL(2003,count($this->coords[1]),$n);
+ // ("Number of X and Y points are not equal. Number of X-points:".count($this->coords[1])." Number of Y-points:$numpoints");
+ }
+ else {
+ $exist_x = true;
+ }
+ }
+ else {
+ $exist_x = false;
+ }
+
+ if( $exist_x ) {
+ $xs=$this->coords[1][0];
+ }
+ else {
+ $xs=0;
+ }
+
+ $ts = $this->iTupleSize;
+ $this->csimareas = '';
+ for( $i=0; $i<$n; ++$i) {
+
+ //If value is NULL, then don't draw a bar at all
+ if ($this->coords[0][$i*$ts] === null) continue;
+
+ if( $exist_x ) {
+ $x=$this->coords[1][$i];
+ if ($x === null) continue;
+ }
+ else {
+ $x=$i;
+ }
+ $xt = $xscale->Translate($x);
+
+ $neg = $this->coords[0][$i*$ts] > $this->coords[0][$i*$ts+1] ;
+ $yopen = $yscale->Translate($this->coords[0][$i*$ts]);
+ $yclose = $yscale->Translate($this->coords[0][$i*$ts+1]);
+ $ymin = $yscale->Translate($this->coords[0][$i*$ts+2]);
+ $ymax = $yscale->Translate($this->coords[0][$i*$ts+3]);
+
+ $dx = floor($this->iWidth/2);
+ $xl = $xt - $dx;
+ $xr = $xt + $dx;
+
+ if( $neg ) {
+ $img->SetColor($this->iStockColor3);
+ }
+ else {
+ $img->SetColor($this->iStockColor1);
+ }
+ $img->FilledRectangle($xl,$yopen,$xr,$yclose);
+ $img->SetLineWeight($this->weight);
+ if( $neg ) {
+ $img->SetColor($this->iStockColor2);
+ }
+ else {
+ $img->SetColor($this->color);
+ }
+
+ $img->Rectangle($xl,$yopen,$xr,$yclose);
+
+ if( $yopen < $yclose ) {
+ $ytop = $yopen ;
+ $ybottom = $yclose ;
+ }
+ else {
+ $ytop = $yclose ;
+ $ybottom = $yopen ;
+ }
+ $img->SetColor($this->color);
+ $img->Line($xt,$ytop,$xt,$ymax);
+ $img->Line($xt,$ybottom,$xt,$ymin);
+
+ if( $this->iEndLines ) {
+ $img->Line($xl,$ymax,$xr,$ymax);
+ $img->Line($xl,$ymin,$xr,$ymin);
+ }
+
+ // A chance for subclasses to add things to the bar
+ // for data point i
+ $this->ModBox($img,$xscale,$yscale,$i,$xl,$xr,$neg);
+
+ // Setup image maps
+ if( !empty($this->csimtargets[$i]) ) {
+ $this->csimareas.= 'csimareas .= ' href="'.$this->csimtargets[$i].'"';
+ if( !empty($this->csimalts[$i]) ) {
+ $sval=$this->csimalts[$i];
+ $this->csimareas .= " title=\"$sval\" alt=\"$sval\" ";
+ }
+ $this->csimareas.= " />\n";
+ }
+ }
+ return true;
}
// A hook for subclasses to modify the plot
@@ -156,25 +171,26 @@
// CLASS BoxPlot
//===================================================
class BoxPlot extends StockPlot {
- var $iPColor='black',$iNColor='white';
- function BoxPlot($datay,$datax=false) {
- $this->iTupleSize=5;
- parent::StockPlot($datay,$datax);
+ private $iPColor='black',$iNColor='white';
+
+ function __construct($datay,$datax=false) {
+ $this->iTupleSize=5;
+ parent::__construct($datay,$datax);
}
function SetMedianColor($aPos,$aNeg) {
- $this->iPColor = $aPos;
- $this->iNColor = $aNeg;
+ $this->iPColor = $aPos;
+ $this->iNColor = $aNeg;
}
- function ModBox(&$img,$xscale,$yscale,$i,$xl,$xr,$neg) {
- if( $neg )
- $img->SetColor($this->iNColor);
- else
- $img->SetColor($this->iPColor);
-
- $y = $yscale->Translate($this->coords[0][$i*5+4]);
- $img->Line($xl,$y,$xr,$y);
+ function ModBox($img,$xscale,$yscale,$i,$xl,$xr,$neg) {
+ if( $neg )
+ $img->SetColor($this->iNColor);
+ else
+ $img->SetColor($this->iPColor);
+
+ $y = $yscale->Translate($this->coords[0][$i*5+4]);
+ $img->Line($xl,$y,$xr,$y);
}
}
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_text.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_text.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_text.inc.php 1969-12-31 19:00:00.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_text.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -0,0 +1,302 @@
+t = $aTxt;
+ $this->x = round($aXAbsPos);
+ $this->y = round($aYAbsPos);
+ $this->margin = 0;
+ }
+ //---------------
+ // PUBLIC METHODS
+ // Set the string in the text object
+ function Set($aTxt) {
+ $this->t = $aTxt;
+ }
+
+ // Alias for Pos()
+ function SetPos($aXAbsPos=0,$aYAbsPos=0,$aHAlign="left",$aVAlign="top") {
+ //$this->Pos($aXAbsPos,$aYAbsPos,$aHAlign,$aVAlign);
+ $this->x = $aXAbsPos;
+ $this->y = $aYAbsPos;
+ $this->halign = $aHAlign;
+ $this->valign = $aVAlign;
+ }
+
+ function SetScalePos($aX,$aY) {
+ $this->iScalePosX = $aX;
+ $this->iScalePosY = $aY;
+ }
+
+ // Specify alignment for the text
+ function Align($aHAlign,$aVAlign="top",$aParagraphAlign="") {
+ $this->halign = $aHAlign;
+ $this->valign = $aVAlign;
+ if( $aParagraphAlign != "" )
+ $this->paragraph_align = $aParagraphAlign;
+ }
+
+ // Alias
+ function SetAlign($aHAlign,$aVAlign="top",$aParagraphAlign="") {
+ $this->Align($aHAlign,$aVAlign,$aParagraphAlign);
+ }
+
+ // Specifies the alignment for a multi line text
+ function ParagraphAlign($aAlign) {
+ $this->paragraph_align = $aAlign;
+ }
+
+ // Specifies the alignment for a multi line text
+ function SetParagraphAlign($aAlign) {
+ $this->paragraph_align = $aAlign;
+ }
+
+ function SetShadow($aShadowColor='gray',$aShadowWidth=3) {
+ $this->ishadowwidth=$aShadowWidth;
+ $this->shadow=$aShadowColor;
+ $this->boxed=true;
+ }
+
+ function SetWordWrap($aCol) {
+ $this->iWordwrap = $aCol ;
+ }
+
+ // Specify that the text should be boxed. fcolor=frame color, bcolor=border color,
+ // $shadow=drop shadow should be added around the text.
+ function SetBox($aFrameColor=array(255,255,255),$aBorderColor=array(0,0,0),$aShadowColor=false,$aCornerRadius=4,$aShadowWidth=3) {
+ if( $aFrameColor === false ) {
+ $this->boxed=false;
+ }
+ else {
+ $this->boxed=true;
+ }
+ $this->fcolor=$aFrameColor;
+ $this->bcolor=$aBorderColor;
+ // For backwards compatibility when shadow was just true or false
+ if( $aShadowColor === true ) {
+ $aShadowColor = 'gray';
+ }
+ $this->shadow=$aShadowColor;
+ $this->icornerradius=$aCornerRadius;
+ $this->ishadowwidth=$aShadowWidth;
+ }
+
+ function SetBox2($aFrameColor=array(255,255,255),$aBorderColor=array(0,0,0),$aShadowColor=false,$aCornerRadius=4,$aShadowWidth=3) {
+ $this->iBoxType=2;
+ $this->SetBox($aFrameColor,$aBorderColor,$aShadowColor,$aCornerRadius,$aShadowWidth);
+ }
+
+ // Hide the text
+ function Hide($aHide=true) {
+ $this->hide=$aHide;
+ }
+
+ // This looks ugly since it's not a very orthogonal design
+ // but I added this "inverse" of Hide() to harmonize
+ // with some classes which I designed more recently (especially)
+ // jpgraph_gantt
+ function Show($aShow=true) {
+ $this->hide=!$aShow;
+ }
+
+ // Specify font
+ function SetFont($aFamily,$aStyle=FS_NORMAL,$aSize=10) {
+ $this->font_family=$aFamily;
+ $this->font_style=$aStyle;
+ $this->font_size=$aSize;
+ }
+
+ // Center the text between $left and $right coordinates
+ function Center($aLeft,$aRight,$aYAbsPos=false) {
+ $this->x = $aLeft + ($aRight-$aLeft )/2;
+ $this->halign = "center";
+ if( is_numeric($aYAbsPos) )
+ $this->y = $aYAbsPos;
+ }
+
+ // Set text color
+ function SetColor($aColor) {
+ $this->color = $aColor;
+ }
+
+ function SetAngle($aAngle) {
+ $this->SetOrientation($aAngle);
+ }
+
+ // Orientation of text. Note only TTF fonts can have an arbitrary angle
+ function SetOrientation($aDirection=0) {
+ if( is_numeric($aDirection) )
+ $this->dir=$aDirection;
+ elseif( $aDirection=="h" )
+ $this->dir = 0;
+ elseif( $aDirection=="v" )
+ $this->dir = 90;
+ else
+ JpGraphError::RaiseL(25051);//(" Invalid direction specified for text.");
+ }
+
+ // Total width of text
+ function GetWidth($aImg) {
+ $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $w = $aImg->GetTextWidth($this->t,$this->dir);
+ return $w;
+ }
+
+ // Hight of font
+ function GetFontHeight($aImg) {
+ $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $h = $aImg->GetFontHeight();
+ return $h;
+
+ }
+
+ function GetTextHeight($aImg) {
+ $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $h = $aImg->GetTextHeight($this->t,$this->dir);
+ return $h;
+ }
+
+ function GetHeight($aImg) {
+ // Synonym for GetTextHeight()
+ $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $h = $aImg->GetTextHeight($this->t,$this->dir);
+ return $h;
+ }
+
+ // Set the margin which will be interpretated differently depending
+ // on the context.
+ function SetMargin($aMarg) {
+ $this->margin = $aMarg;
+ }
+
+ function StrokeWithScale($aImg,$axscale,$ayscale) {
+ if( $this->iScalePosX === null || $this->iScalePosY === null ) {
+ $this->Stroke($aImg);
+ }
+ else {
+ $this->Stroke($aImg,
+ round($axscale->Translate($this->iScalePosX)),
+ round($ayscale->Translate($this->iScalePosY)));
+ }
+ }
+
+ function SetCSIMTarget($aURITarget,$aAlt='',$aWinTarget='') {
+ $this->iCSIMtarget = $aURITarget;
+ $this->iCSIMalt = $aAlt;
+ $this->iCSIMWinTarget = $aWinTarget;
+ }
+
+ function GetCSIMareas() {
+ if( $this->iCSIMtarget !== '' ) {
+ return $this->iCSIMarea;
+ }
+ else {
+ return '';
+ }
+ }
+
+ // Display text in image
+ function Stroke($aImg,$x=null,$y=null) {
+
+ if( $x !== null ) $this->x = round($x);
+ if( $y !== null ) $this->y = round($y);
+
+ // Insert newlines
+ if( $this->iWordwrap > 0 ) {
+ $this->t = wordwrap($this->t,$this->iWordwrap,"\n");
+ }
+
+ // If position been given as a fraction of the image size
+ // calculate the absolute position
+ if( $this->x < 1 && $this->x > 0 ) $this->x *= $aImg->width;
+ if( $this->y < 1 && $this->y > 0 ) $this->y *= $aImg->height;
+
+ $aImg->PushColor($this->color);
+ $aImg->SetFont($this->font_family,$this->font_style,$this->font_size);
+ $aImg->SetTextAlign($this->halign,$this->valign);
+
+ if( $this->boxed ) {
+ if( $this->fcolor=="nofill" ) {
+ $this->fcolor=false;
+ }
+
+ $oldweight=$aImg->SetLineWeight(1);
+
+ if( $this->iBoxType == 2 && $this->font_family > FF_FONT2+2 ) {
+
+ $bbox = $aImg->StrokeBoxedText2($this->x, $this->y,
+ $this->t, $this->dir,
+ $this->fcolor,
+ $this->bcolor,
+ $this->shadow,
+ $this->paragraph_align,
+ 2,4,
+ $this->icornerradius,
+ $this->ishadowwidth);
+ }
+ else {
+ $bbox = $aImg->StrokeBoxedText($this->x,$this->y,$this->t,
+ $this->dir,$this->fcolor,$this->bcolor,$this->shadow,
+ $this->paragraph_align,3,3,$this->icornerradius,
+ $this->ishadowwidth);
+ }
+
+ $aImg->SetLineWeight($oldweight);
+ }
+ else {
+ $debug=false;
+ $bbox = $aImg->StrokeText($this->x,$this->y,$this->t,$this->dir,$this->paragraph_align,$debug);
+ }
+
+ // Create CSIM targets
+ $coords = $bbox[0].','.$bbox[1].','.$bbox[2].','.$bbox[3].','.$bbox[4].','.$bbox[5].','.$bbox[6].','.$bbox[7];
+ $this->iCSIMarea = "iCSIMtarget)."\" ";
+ if( trim($this->iCSIMalt) != '' ) {
+ $this->iCSIMarea .= " alt=\"".$this->iCSIMalt."\" ";
+ $this->iCSIMarea .= " title=\"".$this->iCSIMalt."\" ";
+ }
+ if( trim($this->iCSIMWinTarget) != '' ) {
+ $this->iCSIMarea .= " target=\"".$this->iCSIMWinTarget."\" ";
+ }
+ $this->iCSIMarea .= " />\n";
+
+ $aImg->PopColor($this->color);
+ }
+} // Class
+
+
+?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_ttf.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_ttf.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_ttf.inc.php 2008-09-19 12:06:46.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_ttf.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,379 +1,617 @@
g2312 == null ) {
- include_once 'jpgraph_gb2312.php' ;
- $this->g2312 = new GB2312toUTF8();
- }
- return $this->g2312->gb2utf8($aTxt);
- }
- elseif( $aFF === FF_CHINESE ) {
- if( !function_exists('iconv') ) {
- JpGraphError::RaiseL(25006);
-//('Usage of FF_CHINESE (FF_BIG5) font family requires that your PHP setup has the iconv() function. By default this is not compiled into PHP (needs the "--width-iconv" when configured).');
- }
- return iconv('BIG5','UTF-8',$aTxt);
- }
- elseif( ASSUME_EUCJP_ENCODING &&
- ($aFF == FF_MINCHO || $aFF == FF_GOTHIC || $aFF == FF_PMINCHO || $aFF == FF_PGOTHIC) ) {
- if( !function_exists('mb_convert_encoding') ) {
- JpGraphError::RaiseL(25127);
- }
- return mb_convert_encoding($aTxt, 'UTF-8','EUC-JP');
- }
- elseif( $aFF == FF_DAVID || $aFF == FF_MIRIAM || $aFF == FF_AHRON ) {
- return $this->heb_iso2uni($aTxt);
- }
- else
- return $aTxt;
+ if( LANGUAGE_GREEK ) {
+ if( GREEK_FROM_WINDOWS ) {
+ $unistring = LanguageConv::gr_win2uni($aTxt);
+ } else {
+ $unistring = LanguageConv::gr_iso2uni($aTxt);
+ }
+ return $unistring;
+ } elseif( LANGUAGE_CYRILLIC ) {
+ if( CYRILLIC_FROM_WINDOWS && (!defined('LANGUAGE_CHARSET') || stristr(LANGUAGE_CHARSET, 'windows-1251')) ) {
+ $aTxt = convert_cyr_string($aTxt, "w", "k");
+ }
+ if( !defined('LANGUAGE_CHARSET') || stristr(LANGUAGE_CHARSET, 'koi8-r') || stristr(LANGUAGE_CHARSET, 'windows-1251')) {
+ $isostring = convert_cyr_string($aTxt, "k", "i");
+ $unistring = LanguageConv::iso2uni($isostring);
+ }
+ else {
+ $unistring = $aTxt;
+ }
+ return $unistring;
+ }
+ elseif( $aFF === FF_SIMSUN ) {
+ // Do Chinese conversion
+ if( $this->g2312 == null ) {
+ include_once 'jpgraph_gb2312.php' ;
+ $this->g2312 = new GB2312toUTF8();
+ }
+ return $this->g2312->gb2utf8($aTxt);
+ }
+ elseif( $aFF === FF_BIG5 ) {
+ if( !function_exists('iconv') ) {
+ JpGraphError::RaiseL(25006);
+ //('Usage of FF_CHINESE (FF_BIG5) font family requires that your PHP setup has the iconv() function. By default this is not compiled into PHP (needs the "--width-iconv" when configured).');
+ }
+ return iconv('BIG5','UTF-8',$aTxt);
+ }
+ elseif( ASSUME_EUCJP_ENCODING &&
+ ($aFF == FF_MINCHO || $aFF == FF_GOTHIC || $aFF == FF_PMINCHO || $aFF == FF_PGOTHIC) ) {
+ if( !function_exists('mb_convert_encoding') ) {
+ JpGraphError::RaiseL(25127);
+ }
+ return mb_convert_encoding($aTxt, 'UTF-8','EUC-JP');
+ }
+ elseif( $aFF == FF_DAVID || $aFF == FF_MIRIAM || $aFF == FF_AHRON ) {
+ return LanguageConv::heb_iso2uni($aTxt);
+ }
+ else
+ return $aTxt;
}
// Translate iso encoding to unicode
- function iso2uni ($isoline){
- $uniline='';
- for ($i=0; $i < strlen($isoline); $i++){
- $thischar = substr($isoline,$i,1);
- $charcode = ord($thischar);
- $uniline .= ($charcode>175) ? "" . (1040+($charcode-176)). ";" : $thischar;
- }
- return $uniline;
+ public static function iso2uni ($isoline){
+ $uniline='';
+ for ($i=0; $i < strlen($isoline); $i++){
+ $thischar=substr($isoline,$i,1);
+ $charcode=ord($thischar);
+ $uniline.=($charcode>175) ? "" . (1040+($charcode-176)). ";" : $thischar;
+ }
+ return $uniline;
}
// Translate greek iso encoding to unicode
- function gr_iso2uni ($isoline) {
- $uniline='';
- for ($i=0; $i < strlen($isoline); $i++) {
- $thischar=substr($isoline,$i,1);
- $charcode=ord($thischar);
- $uniline.=($charcode>179 && $charcode!=183 && $charcode!=187 && $charcode!=189) ? "" . (900+($charcode-180)). ";" : $thischar;
- }
- return $uniline;
+ public static function gr_iso2uni ($isoline) {
+ $uniline='';
+ for ($i=0; $i < strlen($isoline); $i++) {
+ $thischar=substr($isoline,$i,1);
+ $charcode=ord($thischar);
+ $uniline.=($charcode>179 && $charcode!=183 && $charcode!=187 && $charcode!=189) ? "" . (900+($charcode-180)). ";" : $thischar;
+ }
+ return $uniline;
}
// Translate greek win encoding to unicode
- function gr_win2uni ($winline) {
- $uniline='';
- $n = strlen($winline);
- for ($i=0; $i < $n; $i++) {
- $thischar=substr($winline,$i,1);
- $charcode=ord($thischar);
- if ($charcode==161 || $charcode==162) {
- $uniline.="" . (740+$charcode). ";";
- }
- else {
- $uniline.=(($charcode>183 && $charcode!=187 && $charcode!=189) || $charcode==180) ? "" . (900+($charcode-180)). ";" : $thischar;
- }
- }
- return $uniline;
- }
-
- function heb_iso2uni($isoline) {
- $isoline = hebrev($isoline);
- $o = '';
-
- $n = strlen($isoline);
- for($i=0; $i < $n; $i++) {
- $c=ord( substr($isoline,$i,1) );
- $o .= ($c > 223) && ($c < 251) ? ''.(1264+$c).';' : chr($c);
- }
- return utf8_encode($o);
+ public static function gr_win2uni ($winline) {
+ $uniline='';
+ for ($i=0; $i < strlen($winline); $i++) {
+ $thischar=substr($winline,$i,1);
+ $charcode=ord($thischar);
+ if ($charcode==161 || $charcode==162) {
+ $uniline.="" . (740+$charcode). ";";
+ }
+ else {
+ $uniline.=(($charcode>183 && $charcode!=187 && $charcode!=189) || $charcode==180) ? "" . (900+($charcode-180)). ";" : $thischar;
+ }
+ }
+ return $uniline;
+ }
+
+ public static function heb_iso2uni($isoline) {
+ $isoline = hebrev($isoline);
+ $o = '';
+
+ $n = strlen($isoline);
+ for($i=0; $i < $n; $i++) {
+ $c=ord( substr($isoline,$i,1) );
+ $o .= ($c > 223) && ($c < 251) ? ''.(1264+$c).';' : chr($c);
+ }
+ return utf8_encode($o);
}
}
-//=================================================================
+//=============================================================
// CLASS TTF
-// Description: Handle TTF font names and loading of font files
-//=================================================================
+// Description: Handle TTF font names and mapping and loading of
+// font files
+//=============================================================
class TTF {
- var $font_files,$style_names;
+ private $font_files,$style_names;
-//---------------
-// CONSTRUCTOR
- function TTF() {
-
- // String names for font styles to be used in error messages
- $this->style_names=array(FS_NORMAL =>'normal',
- FS_BOLD =>'bold',
- FS_ITALIC =>'italic',
- FS_BOLDITALIC =>'bolditalic');
-
- // File names for available fonts
- $this->font_files=array(
- FF_COURIER => array(FS_NORMAL =>'cour.ttf',
- FS_BOLD =>'courbd.ttf',
- FS_ITALIC =>'couri.ttf',
- FS_BOLDITALIC =>'courbi.ttf' ),
- FF_GEORGIA => array(FS_NORMAL =>'georgia.ttf',
- FS_BOLD =>'georgiab.ttf',
- FS_ITALIC =>'georgiai.ttf',
- FS_BOLDITALIC =>'' ),
- FF_TREBUCHE =>array(FS_NORMAL =>'trebuc.ttf',
- FS_BOLD =>'trebucbd.ttf',
- FS_ITALIC =>'trebucit.ttf',
- FS_BOLDITALIC =>'trebucbi.ttf' ),
- FF_VERDANA => array(FS_NORMAL =>'verdana.ttf',
- FS_BOLD =>'verdanab.ttf',
- FS_ITALIC =>'verdanai.ttf',
- FS_BOLDITALIC =>'' ),
- FF_TIMES => array(FS_NORMAL =>'times.ttf',
- FS_BOLD =>'timesbd.ttf',
- FS_ITALIC =>'timesi.ttf',
- FS_BOLDITALIC =>'timesbi.ttf' ),
- FF_COMIC => array(FS_NORMAL =>'comic.ttf',
- FS_BOLD =>'comicbd.ttf',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
- FF_ARIAL => array(FS_NORMAL =>'arial.ttf',
- FS_BOLD =>'arialbd.ttf',
- FS_ITALIC =>'ariali.ttf',
- FS_BOLDITALIC =>'arialbi.ttf' ) ,
- FF_VERA => array(FS_NORMAL =>'Vera.ttf',
- FS_BOLD =>'VeraBd.ttf',
- FS_ITALIC =>'VeraIt.ttf',
- FS_BOLDITALIC =>'VeraBI.ttf' ),
- FF_VERAMONO => array(FS_NORMAL =>'VeraMono.ttf',
- FS_BOLD =>'VeraMoBd.ttf',
- FS_ITALIC =>'VeraMoIt.ttf',
- FS_BOLDITALIC =>'VeraMoBI.ttf' ),
- FF_VERASERIF=> array(FS_NORMAL =>'VeraSe.ttf',
- FS_BOLD =>'VeraSeBd.ttf',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ) ,
+ function __construct() {
+
+ // String names for font styles to be used in error messages
+ $this->style_names=array(
+ FS_NORMAL =>'normal',
+ FS_BOLD =>'bold',
+ FS_ITALIC =>'italic',
+ FS_BOLDITALIC =>'bolditalic');
+
+ // File names for available fonts
+ $this->font_files=array(
+ FF_COURIER => array(FS_NORMAL =>'cour.ttf',
+ FS_BOLD =>'courbd.ttf',
+ FS_ITALIC =>'couri.ttf',
+ FS_BOLDITALIC =>'courbi.ttf' ),
+ FF_GEORGIA => array(FS_NORMAL =>'georgia.ttf',
+ FS_BOLD =>'georgiab.ttf',
+ FS_ITALIC =>'georgiai.ttf',
+ FS_BOLDITALIC =>'' ),
+ FF_TREBUCHE =>array(FS_NORMAL =>'trebuc.ttf',
+ FS_BOLD =>'trebucbd.ttf',
+ FS_ITALIC =>'trebucit.ttf',
+ FS_BOLDITALIC =>'trebucbi.ttf' ),
+ FF_VERDANA => array(FS_NORMAL =>'verdana.ttf',
+ FS_BOLD =>'verdanab.ttf',
+ FS_ITALIC =>'verdanai.ttf',
+ FS_BOLDITALIC =>'' ),
+ FF_TIMES => array(FS_NORMAL =>'times.ttf',
+ FS_BOLD =>'timesbd.ttf',
+ FS_ITALIC =>'timesi.ttf',
+ FS_BOLDITALIC =>'timesbi.ttf' ),
+ FF_COMIC => array(FS_NORMAL =>'comic.ttf',
+ FS_BOLD =>'comicbd.ttf',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+ FF_ARIAL => array(FS_NORMAL =>'arial.ttf',
+ FS_BOLD =>'arialbd.ttf',
+ FS_ITALIC =>'ariali.ttf',
+ FS_BOLDITALIC =>'arialbi.ttf' ) ,
+ FF_VERA => array(FS_NORMAL =>'Vera.ttf',
+ FS_BOLD =>'VeraBd.ttf',
+ FS_ITALIC =>'VeraIt.ttf',
+ FS_BOLDITALIC =>'VeraBI.ttf' ),
+ FF_VERAMONO => array(FS_NORMAL =>'VeraMono.ttf',
+ FS_BOLD =>'VeraMoBd.ttf',
+ FS_ITALIC =>'VeraMoIt.ttf',
+ FS_BOLDITALIC =>'VeraMoBI.ttf' ),
+ FF_VERASERIF=> array(FS_NORMAL =>'VeraSe.ttf',
+ FS_BOLD =>'VeraSeBd.ttf',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ) ,
/* Chinese fonts */
- FF_SIMSUN => array(FS_NORMAL =>'simsun.ttc',
- FS_BOLD =>'simhei.ttf',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
- FF_CHINESE => array(FS_NORMAL =>CHINESE_TTF_FONT,
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
+ FF_SIMSUN => array(
+ FS_NORMAL =>'simsun.ttc',
+ FS_BOLD =>'simhei.ttf',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+ FF_CHINESE => array(
+ FS_NORMAL =>CHINESE_TTF_FONT,
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+ FF_BIG5 => array(
+ FS_NORMAL =>CHINESE_TTF_FONT,
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
/* Japanese fonts */
- FF_MINCHO => array(FS_NORMAL =>MINCHO_TTF_FONT,
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
- FF_PMINCHO => array(FS_NORMAL =>PMINCHO_TTF_FONT,
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
- FF_GOTHIC => array(FS_NORMAL =>GOTHIC_TTF_FONT,
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
- FF_PGOTHIC => array(FS_NORMAL =>PGOTHIC_TTF_FONT,
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
- FF_MINCHO => array(FS_NORMAL =>PMINCHO_TTF_FONT,
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
+ FF_MINCHO => array(
+ FS_NORMAL =>MINCHO_TTF_FONT,
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+
+ FF_PMINCHO => array(
+ FS_NORMAL =>PMINCHO_TTF_FONT,
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+
+ FF_GOTHIC => array(
+ FS_NORMAL =>GOTHIC_TTF_FONT,
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+
+ FF_PGOTHIC => array(
+ FS_NORMAL =>PGOTHIC_TTF_FONT,
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
/* Hebrew fonts */
- FF_DAVID => array(FS_NORMAL =>'DAVIDNEW.TTF',
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
-
- FF_MIRIAM => array(FS_NORMAL =>'MRIAMY.TTF',
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
-
- FF_AHRON => array(FS_NORMAL =>'ahronbd.ttf',
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
+ FF_DAVID => array(
+ FS_NORMAL =>'DAVIDNEW.TTF',
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+
+ FF_MIRIAM => array(
+ FS_NORMAL =>'MRIAMY.TTF',
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+
+ FF_AHRON => array(
+ FS_NORMAL =>'ahronbd.ttf',
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+
+ /* Misc fonts */
+ FF_DIGITAL => array(
+ FS_NORMAL =>'DIGIRU__.TTF',
+ FS_BOLD =>'Digirtu_.ttf',
+ FS_ITALIC =>'Digir___.ttf',
+ FS_BOLDITALIC =>'DIGIRT__.TTF' ),
+
+ /* This is an experimental font for the speedometer development
+ FF_SPEEDO => array(
+ FS_NORMAL =>'Speedo.ttf',
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+ */
+
+ FF_COMPUTER => array(
+ FS_NORMAL =>'COMPUTER.TTF',
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+
+ FF_CALCULATOR => array(
+ FS_NORMAL =>'Triad_xs.ttf',
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
/* Dejavu fonts */
- FF_DV_SANSSERIF => array(FS_NORMAL =>'DejaVuSans.ttf',
- FS_BOLD =>'DejaVuSans-Bold.ttf',
- FS_ITALIC =>'DejaVuSans-Oblique.ttf',
- FS_BOLDITALIC =>'DejaVuSans-BoldOblique.ttf' ),
-
- FF_DV_SANSSERIFMONO => array(FS_NORMAL =>'DejaVuSansMono.ttf',
- FS_BOLD =>'DejaVuSansMono-Bold.ttf',
- FS_ITALIC =>'DejaVuSansMono-Oblique.ttf',
- FS_BOLDITALIC =>'DejaVuSansMono-BoldOblique.ttf' ),
-
- FF_DV_SANSSERIFCOND => array(FS_NORMAL =>'DejaVuSansCondensed.ttf',
- FS_BOLD =>'DejaVuSansCondensed-Bold.ttf',
- FS_ITALIC =>'DejaVuSansCondensed-Oblique.ttf',
- FS_BOLDITALIC =>'DejaVuSansCondensed-BoldOblique.ttf' ),
-
- FF_DV_SERIF => array(FS_NORMAL =>'DejaVuSerif.ttf',
- FS_BOLD =>'DejaVuSerif-Bold.ttf',
- FS_ITALIC =>'DejaVuSerif-Italic.ttf',
- FS_BOLDITALIC =>'DejaVuSerif-BoldItalic.ttf' ),
-
- FF_DV_SERIFCOND => array(FS_NORMAL =>'DejaVuSerifCondensed.ttf',
- FS_BOLD =>'DejaVuSerifCondensed-Bold.ttf',
- FS_ITALIC =>'DejaVuSerifCondensed-Italic.ttf',
- FS_BOLDITALIC =>'DejaVuSerifCondensed-BoldItalic.ttf' ),
+ FF_DV_SANSSERIF => array(
+ FS_NORMAL =>array('DejaVuSans.ttf'),
+ FS_BOLD =>array('DejaVuSans-Bold.ttf','DejaVuSansBold.ttf'),
+ FS_ITALIC =>array('DejaVuSans-Oblique.ttf','DejaVuSansOblique.ttf'),
+ FS_BOLDITALIC =>array('DejaVuSans-BoldOblique.ttf','DejaVuSansBoldOblique.ttf') ),
+
+ FF_DV_SANSSERIFMONO => array(
+ FS_NORMAL =>array('DejaVuSansMono.ttf','DejaVuMonoSans.ttf'),
+ FS_BOLD =>array('DejaVuSansMono-Bold.ttf','DejaVuMonoSansBold.ttf'),
+ FS_ITALIC =>array('DejaVuSansMono-Oblique.ttf','DejaVuMonoSansOblique.ttf'),
+ FS_BOLDITALIC =>array('DejaVuSansMono-BoldOblique.ttf','DejaVuMonoSansBoldOblique.ttf') ),
+
+ FF_DV_SANSSERIFCOND => array(
+ FS_NORMAL =>array('DejaVuSansCondensed.ttf','DejaVuCondensedSans.ttf'),
+ FS_BOLD =>array('DejaVuSansCondensed-Bold.ttf','DejaVuCondensedSansBold.ttf'),
+ FS_ITALIC =>array('DejaVuSansCondensed-Oblique.ttf','DejaVuCondensedSansOblique.ttf'),
+ FS_BOLDITALIC =>array('DejaVuSansCondensed-BoldOblique.ttf','DejaVuCondensedSansBoldOblique.ttf') ),
+
+ FF_DV_SERIF => array(
+ FS_NORMAL =>array('DejaVuSerif.ttf'),
+ FS_BOLD =>array('DejaVuSerif-Bold.ttf','DejaVuSerifBold.ttf'),
+ FS_ITALIC =>array('DejaVuSerif-Italic.ttf','DejaVuSerifItalic.ttf'),
+ FS_BOLDITALIC =>array('DejaVuSerif-BoldItalic.ttf','DejaVuSerifBoldItalic.ttf') ),
+
+ FF_DV_SERIFCOND => array(
+ FS_NORMAL =>array('DejaVuSerifCondensed.ttf','DejaVuCondensedSerif.ttf'),
+ FS_BOLD =>array('DejaVuSerifCondensed-Bold.ttf','DejaVuCondensedSerifBold.ttf'),
+ FS_ITALIC =>array('DejaVuSerifCondensed-Italic.ttf','DejaVuCondensedSerifItalic.ttf'),
+ FS_BOLDITALIC =>array('DejaVuSerifCondensed-BoldItalic.ttf','DejaVuCondensedSerifBoldItalic.ttf') ),
+
+
+ /* Placeholders for defined fonts */
+ FF_USERFONT1 => array(
+ FS_NORMAL =>'',
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+
+ FF_USERFONT2 => array(
+ FS_NORMAL =>'',
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
+
+ FF_USERFONT3 => array(
+ FS_NORMAL =>'',
+ FS_BOLD =>'',
+ FS_ITALIC =>'',
+ FS_BOLDITALIC =>'' ),
- /* Misc fonts */
- FF_DIGITAL => array(FS_NORMAL =>'DIGIRU__.TTF',
- FS_BOLD =>'Digirtu_.ttf',
- FS_ITALIC =>'Digir___.ttf',
- FS_BOLDITALIC =>'DIGIRT__.TTF' ),
- FF_SPEEDO => array(FS_NORMAL =>'Speedo.ttf',
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
- FF_COMPUTER => array(FS_NORMAL =>'COMPUTER.TTF',
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
- FF_CALCULATOR =>array(FS_NORMAL =>'Triad_xs.ttf',
- FS_BOLD =>'',
- FS_ITALIC =>'',
- FS_BOLDITALIC =>'' ),
);
}
-//---------------
-// PUBLIC METHODS
+ //---------------
+ // PUBLIC METHODS
// Create the TTF file from the font specification
function File($family,$style=FS_NORMAL) {
-
- if( $family == FF_HANDWRT || $family==FF_BOOK ) {
- JpGraphError::RaiseL(25045);//('Font families FF_HANDWRT and FF_BOOK are no longer available due to copyright problem with these fonts. Fonts can no longer be distributed with JpGraph. Please download fonts from http://corefonts.sourceforge.net/');
- }
-
- $fam = @$this->font_files[$family];
- if( !$fam ) {
- JpGraphError::RaiseL(25046,$family);//("Specified TTF font family (id=$family) is unknown or does not exist. Please note that TTF fonts are not distributed with JpGraph for copyright reasons. You can find the MS TTF WEB-fonts (arial, courier etc) for download at http://corefonts.sourceforge.net/");
- }
- $f = @$fam[$style];
-
- if( $f==='' )
- JpGraphError::RaiseL(25047,$this->style_names[$style],$this->font_files[$family][FS_NORMAL]);//('Style "'.$this->style_names[$style].'" is not available for font family '.$this->font_files[$family][FS_NORMAL].'.');
- if( !$f ) {
- JpGraphError::RaiseL(25048,$fam);//("Unknown font style specification [$fam].");
- }
-
- if ($family >= FF_MINCHO && $family <= FF_PGOTHIC) {
- $f = MBTTF_DIR.$f;
- } else {
- $f = TTF_DIR.$f;
- }
-
- if( file_exists($f) === false || is_readable($f) === false ) {
- JpGraphError::RaiseL(25049,$f);//("Font file \"$f\" is not readable or does not exist.");
- }
- return $f;
+ $fam = @$this->font_files[$family];
+ if( !$fam ) {
+ JpGraphError::RaiseL(25046,$family);//("Specified TTF font family (id=$family) is unknown or does not exist. Please note that TTF fonts are not distributed with JpGraph for copyright reasons. You can find the MS TTF WEB-fonts (arial, courier etc) for download at http://corefonts.sourceforge.net/");
+ }
+ $ff = @$fam[$style];
+
+ if( is_array($ff) ) {
+ // There are several optional file names. They are tried in order
+ // and the first one found is used
+ $n = count($ff);
+ } else {
+ $n = 1;
+ $ff = array($ff);
+ }
+ $i = 0;
+ do {
+ $f = $ff[$i];
+ // All font families are guaranteed to have the normal style
+
+ if( $f==='' )
+ JpGraphError::RaiseL(25047,$this->style_names[$style],$this->font_files[$family][FS_NORMAL]);//('Style "'.$this->style_names[$style].'" is not available for font family '.$this->font_files[$family][FS_NORMAL].'.');
+ if( !$f ) {
+ JpGraphError::RaiseL(25048,$fam);//("Unknown font style specification [$fam].");
+ }
+
+ if ($family >= FF_MINCHO && $family <= FF_PGOTHIC) {
+ $f = MBTTF_DIR.$f;
+ } else {
+ $f = TTF_DIR.$f;
+ }
+ ++$i;
+ } while( $i < $n && (file_exists($f) === false || is_readable($f) === false) );
+
+ if( !file_exists($f) ) {
+ JpGraphError::RaiseL(25049,$f);//("Font file \"$f\" is not readable or does not exist.");
+ }
+ return $f;
+ }
+
+ function SetUserFont($aNormal,$aBold='',$aItalic='',$aBoldIt='') {
+ $this->font_files[FF_USERFONT] =
+ array(FS_NORMAL => $aNormal,
+ FS_BOLD => $aBold,
+ FS_ITALIC => $aItalic,
+ FS_BOLDITALIC => $aBoldIt ) ;
+ }
+
+ function SetUserFont1($aNormal,$aBold='',$aItalic='',$aBoldIt='') {
+ $this->font_files[FF_USERFONT1] =
+ array(FS_NORMAL => $aNormal,
+ FS_BOLD => $aBold,
+ FS_ITALIC => $aItalic,
+ FS_BOLDITALIC => $aBoldIt ) ;
+ }
+
+ function SetUserFont2($aNormal,$aBold='',$aItalic='',$aBoldIt='') {
+ $this->font_files[FF_USERFONT2] =
+ array(FS_NORMAL => $aNormal,
+ FS_BOLD => $aBold,
+ FS_ITALIC => $aItalic,
+ FS_BOLDITALIC => $aBoldIt ) ;
}
+
+ function SetUserFont3($aNormal,$aBold='',$aItalic='',$aBoldIt='') {
+ $this->font_files[FF_USERFONT3] =
+ array(FS_NORMAL => $aNormal,
+ FS_BOLD => $aBold,
+ FS_ITALIC => $aItalic,
+ FS_BOLDITALIC => $aBoldIt ) ;
+ }
+
} // Class
+
+//=============================================================================
+// CLASS SymChar
+// Description: Code values for some commonly used characters that
+// normally isn't available directly on the keyboard, for example
+// mathematical and greek symbols.
+//=============================================================================
+class SymChar {
+ static function Get($aSymb,$aCapital=FALSE) {
+ $iSymbols = array(
+ /* Greek */
+ array('alpha','03B1','0391'),
+ array('beta','03B2','0392'),
+ array('gamma','03B3','0393'),
+ array('delta','03B4','0394'),
+ array('epsilon','03B5','0395'),
+ array('zeta','03B6','0396'),
+ array('ny','03B7','0397'),
+ array('eta','03B8','0398'),
+ array('theta','03B8','0398'),
+ array('iota','03B9','0399'),
+ array('kappa','03BA','039A'),
+ array('lambda','03BB','039B'),
+ array('mu','03BC','039C'),
+ array('nu','03BD','039D'),
+ array('xi','03BE','039E'),
+ array('omicron','03BF','039F'),
+ array('pi','03C0','03A0'),
+ array('rho','03C1','03A1'),
+ array('sigma','03C3','03A3'),
+ array('tau','03C4','03A4'),
+ array('upsilon','03C5','03A5'),
+ array('phi','03C6','03A6'),
+ array('chi','03C7','03A7'),
+ array('psi','03C8','03A8'),
+ array('omega','03C9','03A9'),
+ /* Money */
+ array('euro','20AC'),
+ array('yen','00A5'),
+ array('pound','20A4'),
+ /* Math */
+ array('approx','2248'),
+ array('neq','2260'),
+ array('not','2310'),
+ array('def','2261'),
+ array('inf','221E'),
+ array('sqrt','221A'),
+ array('int','222B'),
+ /* Misc */
+ array('copy','00A9'),
+ array('para','00A7'),
+ array('tm','2122'), /* Trademark symbol */
+ array('rtm','00AE'), /* Registered trademark */
+ array('degree','00b0'),
+ array('lte','2264'), /* Less than or equal */
+ array('gte','2265'), /* Greater than or equal */
+
+ );
+
+ $n = count($iSymbols);
+ $i=0;
+ $found = false;
+ $aSymb = strtolower($aSymb);
+ while( $i < $n && !$found ) {
+ $found = $aSymb === $iSymbols[$i++][0];
+ }
+ if( $found ) {
+ $ca = $iSymbols[--$i];
+ if( $aCapital && count($ca)==3 )
+ $s = $ca[2];
+ else
+ $s = $ca[1];
+ return sprintf('%04d;',hexdec($s));
+ }
+ else
+ return '';
+ }
+}
+
+
?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_utils.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_utils.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/jpgraph_utils.inc.php 2009-01-18 17:30:30.000000000 -0500
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/jpgraph_utils.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,121 +1,47 @@
iFunc = $aFunc;
- $this->iXFunc = $aXFunc;
+ private $iFunc='',$iXFunc='',$iMin,$iMax,$iStepSize;
+
+ function __construct($aFunc,$aXFunc='') {
+ $this->iFunc = $aFunc;
+ $this->iXFunc = $aXFunc;
}
-
+
function E($aXMin,$aXMax,$aSteps=50) {
- $this->iMin = $aXMin;
- $this->iMax = $aXMax;
- $this->iStepSize = ($aXMax-$aXMin)/$aSteps;
-
- if( $this->iXFunc != '' )
- $t = 'for($i='.$aXMin.'; $i<='.$aXMax.'; $i += '.$this->iStepSize.') {$ya[]='.$this->iFunc.';$xa[]='.$this->iXFunc.';}';
- elseif( $this->iFunc != '' )
- $t = 'for($x='.$aXMin.'; $x<='.$aXMax.'; $x += '.$this->iStepSize.') {$ya[]='.$this->iFunc.';$xa[]=$x;} $x='.$aXMax.';$ya[]='.$this->iFunc.';$xa[]=$x;';
- else
- JpGraphError::RaiseL(24001);//('FuncGenerator : No function specified. ');
-
- @eval($t);
-
- // If there is an error in the function specifcation this is the only
- // way we can discover that.
- if( empty($xa) || empty($ya) )
- JpGraphError::RaiseL(24002);//('FuncGenerator : Syntax error in function specification ');
-
- return array($xa,$ya);
- }
-}
+ $this->iMin = $aXMin;
+ $this->iMax = $aXMax;
+ $this->iStepSize = ($aXMax-$aXMin)/$aSteps;
+
+ if( $this->iXFunc != '' )
+ $t = 'for($i='.$aXMin.'; $i<='.$aXMax.'; $i += '.$this->iStepSize.') {$ya[]='.$this->iFunc.';$xa[]='.$this->iXFunc.';}';
+ elseif( $this->iFunc != '' )
+ $t = 'for($x='.$aXMin.'; $x<='.$aXMax.'; $x += '.$this->iStepSize.') {$ya[]='.$this->iFunc.';$xa[]=$x;} $x='.$aXMax.';$ya[]='.$this->iFunc.';$xa[]=$x;';
+ else
+ JpGraphError::RaiseL(24001);//('FuncGenerator : No function specified. ');
+
+ @eval($t);
+
+ // If there is an error in the function specifcation this is the only
+ // way we can discover that.
+ if( empty($xa) || empty($ya) )
+ JpGraphError::RaiseL(24002);//('FuncGenerator : Syntax error in function specification ');
-//=============================================================================
-// CLASS SymChar
-// Description: Code values for some commonly used characters that
-// normally isn't available directly on the keyboard, for example
-// mathematical and greek symbols.
-//=============================================================================
-class SymChar {
- function Get($aSymb,$aCapital=FALSE) {
- static $iSymbols = array(
- /* Greek */
- array('alpha','03B1','0391'),
- array('beta','03B2','0392'),
- array('gamma','03B3','0393'),
- array('delta','03B4','0394'),
- array('epsilon','03B5','0395'),
- array('zeta','03B6','0396'),
- array('ny','03B7','0397'),
- array('eta','03B8','0398'),
- array('theta','03B8','0398'),
- array('iota','03B9','0399'),
- array('kappa','03BA','039A'),
- array('lambda','03BB','039B'),
- array('mu','03BC','039C'),
- array('nu','03BD','039D'),
- array('xi','03BE','039E'),
- array('omicron','03BF','039F'),
- array('pi','03C0','03A0'),
- array('rho','03C1','03A1'),
- array('sigma','03C3','03A3'),
- array('tau','03C4','03A4'),
- array('upsilon','03C5','03A5'),
- array('phi','03C6','03A6'),
- array('chi','03C7','03A7'),
- array('psi','03C8','03A8'),
- array('omega','03C9','03A9'),
- /* Money */
- array('euro','20AC'),
- array('yen','00A5'),
- array('pound','20A4'),
- /* Math */
- array('approx','2248'),
- array('neq','2260'),
- array('not','2310'),
- array('def','2261'),
- array('inf','221E'),
- array('sqrt','221A'),
- array('int','222B'),
- /* Misc */
- array('copy','00A9'),
- array('para','00A7'),
- array('tm','2122'), /* Trademark symbol */
- array('rtm','00AE') /* Registered trademark */
-);
-
- $n = count($iSymbols);
- $i=0;
- $found = false;
- $aSymb = strtolower($aSymb);
- while( $i < $n && !$found ) {
- $found = $aSymb === $iSymbols[$i++][0];
- }
- if( $found ) {
- $ca = $iSymbols[--$i];
- if( $aCapital && count($ca)==3 )
- $s = $ca[2];
- else
- $s = $ca[1];
- return sprintf('%04d;',hexdec($s));
- }
- else
- return '';
+ return array($xa,$ya);
}
}
@@ -124,400 +50,636 @@
// CLASS DateScaleUtils
// Description: Help to create a manual date scale
//=============================================================================
-DEFINE('DSUTILS_MONTH',1); // Major and minor ticks on a monthly basis
-DEFINE('DSUTILS_MONTH1',1); // Major and minor ticks on a monthly basis
-DEFINE('DSUTILS_MONTH2',2); // Major ticks on a bi-monthly basis
-DEFINE('DSUTILS_MONTH3',3); // Major icks on a tri-monthly basis
-DEFINE('DSUTILS_MONTH6',4); // Major on a six-monthly basis
-DEFINE('DSUTILS_WEEK1',5); // Major ticks on a weekly basis
-DEFINE('DSUTILS_WEEK2',6); // Major ticks on a bi-weekly basis
-DEFINE('DSUTILS_WEEK4',7); // Major ticks on a quod-weekly basis
-DEFINE('DSUTILS_DAY1',8); // Major ticks on a daily basis
-DEFINE('DSUTILS_DAY2',9); // Major ticks on a bi-daily basis
-DEFINE('DSUTILS_DAY4',10); // Major ticks on a qoud-daily basis
-DEFINE('DSUTILS_YEAR1',11); // Major ticks on a yearly basis
-DEFINE('DSUTILS_YEAR2',12); // Major ticks on a bi-yearly basis
-DEFINE('DSUTILS_YEAR5',13); // Major ticks on a five-yearly basis
+define('DSUTILS_MONTH',1); // Major and minor ticks on a monthly basis
+define('DSUTILS_MONTH1',1); // Major and minor ticks on a monthly basis
+define('DSUTILS_MONTH2',2); // Major ticks on a bi-monthly basis
+define('DSUTILS_MONTH3',3); // Major icks on a tri-monthly basis
+define('DSUTILS_MONTH6',4); // Major on a six-monthly basis
+define('DSUTILS_WEEK1',5); // Major ticks on a weekly basis
+define('DSUTILS_WEEK2',6); // Major ticks on a bi-weekly basis
+define('DSUTILS_WEEK4',7); // Major ticks on a quod-weekly basis
+define('DSUTILS_DAY1',8); // Major ticks on a daily basis
+define('DSUTILS_DAY2',9); // Major ticks on a bi-daily basis
+define('DSUTILS_DAY4',10); // Major ticks on a qoud-daily basis
+define('DSUTILS_YEAR1',11); // Major ticks on a yearly basis
+define('DSUTILS_YEAR2',12); // Major ticks on a bi-yearly basis
+define('DSUTILS_YEAR5',13); // Major ticks on a five-yearly basis
class DateScaleUtils {
- var $iMin=0, $iMax=0;
- var $starthour,$startmonth, $startday, $startyear;
- var $endmonth, $endyear, $endday;
- var $tickPositions=array(),$minTickPositions=array();
- var $iUseWeeks = true;
-
- function UseWeekFormat($aFlg) {
- $this->iUseWeeks = $aFlg;
- }
-
- function doYearly($aType,$aMinor=false) {
- $i=0; $j=0;
- $m = $this->startmonth;
- $y = $this->startyear;
-
- if( $this->startday == 1 ) {
- $this->tickPositions[$i++] = mktime(0,0,0,$m,1,$y);
- }
- ++$m;
-
- switch( $aType ) {
- case DSUTILS_YEAR1:
- for($y=$this->startyear; $y <= $this->endyear; ++$y ) {
- if( $aMinor ) {
- while( $m <= 12 ) {
- if( !($y == $this->endyear && $m > $this->endmonth) ) {
- $this->minTickPositions[$j++] = mktime(0,0,0,$m,1,$y);
- }
- ++$m;
- }
- $m=1;
- }
- $this->tickPositions[$i++] = mktime(0,0,0,1,1,$y);
- }
- break;
- case DSUTILS_YEAR2:
- $y=$this->startyear;
- while( $y <= $this->endyear ) {
- $this->tickPositions[$i++] = mktime(0,0,0,1,1,$y);
- for($k=0; $k < 1; ++$k ) {
- ++$y;
- if( $aMinor ) {
- $this->minTickPositions[$j++] = mktime(0,0,0,1,1,$y);
- }
- }
- ++$y;
- }
- break;
- case DSUTILS_YEAR5:
- $y=$this->startyear;
- while( $y <= $this->endyear ) {
- $this->tickPositions[$i++] = mktime(0,0,0,1,1,$y);
- for($k=0; $k < 4; ++$k ) {
- ++$y;
- if( $aMinor ) {
- $this->minTickPositions[$j++] = mktime(0,0,0,1,1,$y);
- }
- }
- ++$y;
- }
- break;
- }
- }
-
- function doDaily($aType,$aMinor=false) {
- $m = $this->startmonth;
- $y = $this->startyear;
- $d = $this->startday;
- $h = $this->starthour;
- $i=0;$j=0;
-
- if( $h == 0 ) {
- $this->tickPositions[$i++] = mktime(0,0,0,$m,$d,$y);
- }
- $t = mktime(0,0,0,$m,$d,$y);
- switch($aType) {
- case DSUTILS_DAY1:
- while( $t <= self::$iMax ) {
- $t = strtotime('+1 day',$t);
- $this->tickPositions[$i++] = $t;
- if( $aMinor ) {
- $this->minTickPositions[$j++] = strtotime('+12 hours',$t);
- }
- }
- break;
- case DSUTILS_DAY2:
- while( $t <= $this->iMax ) {
- $t = strtotime('+1 day',$t);
- if( $aMinor ) {
- $this->minTickPositions[$j++] = $t;
- }
- $t = strtotime('+1 day',$t);
- $this->tickPositions[$i++] = $t;
- }
- break;
- case DSUTILS_DAY4:
- while( $t <= $this->iMax ) {
- for($k=0; $k < 3; ++$k ) {
- $t = strtotime('+1 day',$t);
- if( $aMinor ) {
- $this->minTickPositions[$j++] = $t;
- }
- }
- $t = strtotime('+1 day',$t);
- $this->tickPositions[$i++] = $t;
- }
- break;
- }
- }
-
- function doWeekly($aType,$aMinor=false) {
- $hpd = 3600*24;
- $hpw = 3600*24*7;
- // Find out week number of min date
- $thursday = $this->iMin + $hpd * (3 - (date('w', $this->iMin) + 6) % 7);
- $week = 1 + (date('z', $thursday) - (11 - date('w', mktime(0, 0, 0, 1, 1, date('Y', $thursday)))) % 7) / 7;
- $daynumber = date('w',$this->iMin);
- if( $daynumber == 0 ) $daynumber = 7;
- $m = $this->startmonth;
- $y = $this->startyear;
- $d = $this->startday;
- $i=0;$j=0;
- // The assumption is that the weeks start on Monday. If the first day
- // is later in the week then the first week tick has to be on the following
- // week.
- if( $daynumber == 1 ) {
- $this->tickPositions[$i++] = mktime(0,0,0,$m,$d,$y);
- $t = mktime(0,0,0,$m,$d,$y) + $hpw;
- }
- else {
- $t = mktime(0,0,0,$m,$d,$y) + $hpd*(8-$daynumber);
- }
-
- switch($aType) {
- case DSUTILS_WEEK1:
- $cnt=0;
- break;
- case DSUTILS_WEEK2:
- $cnt=1;
- break;
- case DSUTILS_WEEK4:
- $cnt=3;
- break;
- }
- while( $t <= $this->iMax ) {
- $this->tickPositions[$i++] = $t;
- for($k=0; $k < $cnt; ++$k ) {
- $t += $hpw;
- if( $aMinor ) {
- $this->minTickPositions[$j++] = $t;
- }
- }
- $t += $hpw;
- }
- }
-
- function doMonthly($aType,$aMinor=false) {
- $monthcount=0;
- $m = $this->startmonth;
- $y = $this->startyear;
- $i=0; $j=0;
-
- // Skip the first month label if it is before the startdate
- if( $this->startday == 1 ) {
- $this->tickPositions[$i++] = mktime(0,0,0,$m,1,$y);
- $monthcount=1;
- }
- if( $aType == 1 ) {
- if( $this->startday < 15 ) {
- $this->minTickPositions[$j++] = mktime(0,0,0,$m,15,$y);
- }
- }
- ++$m;
-
- // Loop through all the years included in the scale
- for($y=$this->startyear; $y <= $this->endyear; ++$y ) {
- // Loop through all the months. There are three cases to consider:
- // 1. We are in the first year and must start with the startmonth
- // 2. We are in the end year and we must stop at last month of the scale
- // 3. A year in between where we run through all the 12 months
- $stopmonth = $y == $this->endyear ? $this->endmonth : 12;
- while( $m <= $stopmonth ) {
- switch( $aType ) {
- case DSUTILS_MONTH1:
- // Set minor tick at the middle of the month
- if( $aMinor ) {
- if( $m <= $stopmonth ) {
- if( !($y==$this->endyear && $m==$stopmonth && $this->endday < 15) )
- $this->minTickPositions[$j++] = mktime(0,0,0,$m,15,$y);
- }
- }
- // Major at month
- // Get timestamp of first hour of first day in each month
- $this->tickPositions[$i++] = mktime(0,0,0,$m,1,$y);
-
- break;
- case DSUTILS_MONTH2:
- if( $aMinor ) {
- // Set minor tick at start of each month
- $this->minTickPositions[$j++] = mktime(0,0,0,$m,1,$y);
- }
-
- // Major at every second month
- // Get timestamp of first hour of first day in each month
- if( $monthcount % 2 == 0 ) {
- $this->tickPositions[$i++] = mktime(0,0,0,$m,1,$y);
- }
- break;
- case DSUTILS_MONTH3:
- if( $aMinor ) {
- // Set minor tick at start of each month
- $this->minTickPositions[$j++] = mktime(0,0,0,$m,1,$y);
- }
- // Major at every third month
- // Get timestamp of first hour of first day in each month
- if( $monthcount % 3 == 0 ) {
- $this->tickPositions[$i++] = mktime(0,0,0,$m,1,$y);
- }
- break;
- case DSUTILS_MONTH6:
- if( $aMinor ) {
- // Set minor tick at start of each month
- $this->minTickPositions[$j++] = mktime(0,0,0,$m,1,$y);
- }
- // Major at every third month
- // Get timestamp of first hour of first day in each month
- if( $monthcount % 6 == 0 ) {
- $this->tickPositions[$i++] = mktime(0,0,0,$m,1,$y);
- }
- break;
- }
- ++$m;
- ++$monthcount;
- }
- $m=1;
- }
-
- // For the case where all dates are within the same month
- // we want to make sure we have at least two ticks on the scale
- // since the scale want work properly otherwise
- if($this->startmonth == $this->endmonth && $this->startyear == $this->endyear && $aType==1 ) {
- $this->tickPositions[$i++] = mktime(0 ,0 ,0, $this->startmonth + 1, 1, $this->startyear);
- }
-
- return array($this->tickPositions,$this->minTickPositions);
- }
-
- function GetTicks($aData,$aType=1,$aMinor=false,$aEndPoints=false) {
- $n = count($aData);
- return $this->GetTicksFromMinMax($aData[0],$aData[$n-1],$aType,$aMinor,$aEndPoints);
- }
-
- function GetAutoTicks($aMin,$aMax,$aMaxTicks=10,$aMinor=false) {
- $diff = $aMax - $aMin;
- $spd = 3600*24;
- $spw = $spd*7;
- $spm = $spd*30;
- $spy = $spd*352;
-
- if( $this->iUseWeeks )
- $w = 'W';
- else
- $w = 'd M';
-
- // Decision table for suitable scales
- // First value: Main decision point
- // Second value: Array of formatting depending on divisor for wanted max number of ticks.
',2),
+HTTP header wurden bereits gesendet.JpGraph Fehler:
-HTTP header wurden bereits gesendet.
Fehler in der Datei %s in der Zeile %d.Erklärung:
HTTP header wurden bereits zum Browser gesendet, wobei die Daten als Text gekennzeichnet wurden, bevor die Bibliothek die Chance hatte, seinen Bild-HTTP-Header zum Browser zu schicken. Dies verhindert, dass die Bibliothek Bilddaten zum Browser schicken kann (weil sie vom Browser als Text interpretiert würden und daher nur Mist dargestellt würde).
Fehler in der Datei %s in der Zeile %d. ',2),
/*
** Setup Fehler
*/
-11 => array('Es wurde kein Pfad für CACHE_DIR angegeben. Bitte gib einen Pfad CACHE_DIR in der Datei jpg-config.inc an.',0),
-12 => array('Es wurde kein Pfad für TTF_DIR angegeben und der Pfad kann nicht automatisch ermittelt werden. Bitte gib den Pfad in der Datei jpg-config.inc an.',0),
+11 => array('Es wurde kein Pfad für CACHE_DIR angegeben. Bitte gib einen Pfad CACHE_DIR in der Datei jpg-config.inc an.',0),
+12 => array('Es wurde kein Pfad für TTF_DIR angegeben und der Pfad kann nicht automatisch ermittelt werden. Bitte gib den Pfad in der Datei jpg-config.inc an.',0),
13 => array('The installed PHP version (%s) is not compatible with this release of the library. The library requires at least PHP version %s',2),
/*
@@ -33,24 +34,25 @@
2001 => array('Die Anzahl der Farben ist nicht gleich der Anzahl der Vorlagen in BarPlot::SetPattern().',0),
2002 => array('Unbekannte Vorlage im Aufruf von BarPlot::SetPattern().',0),
2003 => array('Anzahl der X- und Y-Koordinaten sind nicht identisch. Anzahl der X-Koordinaten: %d; Anzahl der Y-Koordinaten: %d.',2),
-2004 => array('Alle Werte für ein Balkendiagramm (barplot) müssen numerisch sein. Du hast den Wert nr [%d] == %s angegeben.',2),
-2005 => array('Du hast einen leeren Vektor für die Schattierungsfarben im Balkendiagramm (barplot) angegeben.',0),
-2006 => array('Unbekannte Position für die Werte der Balken: %s.',1),
+2004 => array('Alle Werte für ein Balkendiagramm (barplot) müssen numerisch sein. Du hast den Wert nr [%d] == %s angegeben.',2),
+2005 => array('Du hast einen leeren Vektor für die Schattierungsfarben im Balkendiagramm (barplot) angegeben.',0),
+2006 => array('Unbekannte Position für die Werte der Balken: %s.',1),
2007 => array('Kann GroupBarPlot nicht aus einem leeren Vektor erzeugen.',0),
2008 => array('GroupBarPlot Element nbr %d wurde nicht definiert oder ist leer.',0),
2009 => array('Eins der Objekte, das an GroupBar weitergegeben wurde ist kein Balkendiagramm (BarPlot). Versichere Dich, dass Du den GroupBarPlot aus einem Vektor von Balkendiagrammen (barplot) oder AccBarPlot-Objekten erzeugst. (Class = %s)',1),
2010 => array('Kann AccBarPlot nicht aus einem leeren Vektor erzeugen.',0),
2011 => array('AccBarPlot-Element nbr %d wurde nicht definiert oder ist leer.',1),
2012 => array('Eins der Objekte, das an AccBar weitergegeben wurde ist kein Balkendiagramm (barplot). Versichere Dich, dass Du den AccBar-Plot aus einem Vektor von Balkendiagrammen (barplot) erzeugst. (Class=%s)',1),
-2013 => array('Du hast einen leeren Vektor für die Schattierungsfarben im Balkendiagramm (barplot) angegeben.',0),
+2013 => array('Du hast einen leeren Vektor für die Schattierungsfarben im Balkendiagramm (barplot) angegeben.',0),
2014 => array('Die Anzahl der Datenpunkte jeder Datenreihe in AccBarPlot muss gleich sein.',0),
+2015 => array('Individual bar plots in an AccBarPlot or GroupBarPlot can not have specified X-coordinates',0),
/*
** jpgraph_date
*/
-3001 => array('Es ist nur möglich, entweder SetDateAlign() oder SetTimeAlign() zu benutzen, nicht beides!',0),
+3001 => array('Es ist nur möglich, entweder SetDateAlign() oder SetTimeAlign() zu benutzen, nicht beides!',0),
/*
** jpgraph_error
@@ -62,9 +64,9 @@
** jpgraph_flags
*/
-5001 => array('Unbekannte Flaggen-Größe (%d).',1),
+5001 => array('Unbekannte Flaggen-Größe (%d).',1),
5002 => array('Der Flaggen-Index %s existiert nicht.',1),
-5003 => array('Es wurde eine ungültige Ordnungszahl (%d) für den Flaggen-Index angegeben.',1),
+5003 => array('Es wurde eine ungültige Ordnungszahl (%d) für den Flaggen-Index angegeben.',1),
5004 => array('Der Landesname %s hat kein korrespondierendes Flaggenbild. Die Flagge mag existieren, abr eventuell unter einem anderen Namen, z.B. versuche "united states" statt "usa".',1),
@@ -72,35 +74,36 @@
** jpgraph_gantt
*/
-6001 => array('Interner Fehler. Die Höhe für ActivityTitles ist < 0.',0),
-6002 => array('Es dürfen keine negativen Werte für die Gantt-Diagramm-Dimensionen angegeben werden. Verwende 0, wenn die Dimensionen automatisch ermittelt werden sollen.',0),
-6003 => array('Ungültiges Format für den Bedingungs-Parameter bei Index=%d in CreateSimple(). Der Parameter muss bei index 0 starten und Vektoren in der Form (Row,Constrain-To,Constrain-Type) enthalten.',1),
-6004 => array('Ungültiges Format für den Fortschritts-Parameter bei Index=%d in CreateSimple(). Der Parameter muss bei Index 0 starten und Vektoren in der Form (Row,Progress) enthalten.',1),
+6001 => array('Interner Fehler. Die Höhe für ActivityTitles ist < 0.',0),
+6002 => array('Es dürfen keine negativen Werte für die Gantt-Diagramm-Dimensionen angegeben werden. Verwende 0, wenn die Dimensionen automatisch ermittelt werden sollen.',0),
+6003 => array('Ungültiges Format für den Bedingungs-Parameter bei Index=%d in CreateSimple(). Der Parameter muss bei index 0 starten und Vektoren in der Form (Row,Constrain-To,Constrain-Type) enthalten.',1),
+6004 => array('Ungültiges Format für den Fortschritts-Parameter bei Index=%d in CreateSimple(). Der Parameter muss bei Index 0 starten und Vektoren in der Form (Row,Progress) enthalten.',1),
6005 => array('SetScale() ist nicht sinnvoll bei Gantt-Diagrammen.',0),
-6006 => array('Das Gantt-Diagramm kann nicht automatisch skaliert werden. Es existieren keine Aktivitäten mit Termin. [GetBarMinMax() start >= n]',0),
-6007 => array('Plausibiltätsprüfung für die automatische Gantt-Diagramm-Größe schlug fehl. Entweder die Breite (=%d) oder die Höhe (=%d) ist größer als MAX_GANTTIMG_SIZE. Dies kann möglicherweise durch einen falschen Wert bei einer Aktivität hervorgerufen worden sein.',2),
-6008 => array('Du hast eine Bedingung angegeben von Reihe=%d bis Reihe=%d, die keine Aktivität hat.',2),
+6006 => array('Das Gantt-Diagramm kann nicht automatisch skaliert werden. Es existieren keine Aktivitäten mit Termin. [GetBarMinMax() start >= n]',0),
+6007 => array('Plausibiltätsprüfung für die automatische Gantt-Diagramm-Größe schlug fehl. Entweder die Breite (=%d) oder die Höhe (=%d) ist größer als MAX_GANTTIMG_SIZE. Dies kann möglicherweise durch einen falschen Wert bei einer Aktivität hervorgerufen worden sein.',2),
+6008 => array('Du hast eine Bedingung angegeben von Reihe=%d bis Reihe=%d, die keine Aktivität hat.',2),
6009 => array('Unbekannter Bedingungstyp von Reihe=%d bis Reihe=%d',2),
-6010 => array('Ungültiger Icon-Index für das eingebaute Gantt-Icon [%d]',1),
-6011 => array('Argument für IconImage muss entweder ein String oder ein Integer sein.',0),
+6010 => array('Ungültiger Icon-Index für das eingebaute Gantt-Icon [%d]',1),
+6011 => array('Argument für IconImage muss entweder ein String oder ein Integer sein.',0),
6012 => array('Unbekannter Typ bei der Gantt-Objekt-Title-Definition.',0),
-6015 => array('Ungültige vertikale Position %d',1),
-6016 => array('Der eingegebene Datums-String (%s) für eine Gantt-Aktivität kann nicht interpretiert werden. Versichere Dich, dass es ein gültiger Datumsstring ist, z.B. 2005-04-23 13:30',1),
+6015 => array('Ungültige vertikale Position %d',1),
+6016 => array('Der eingegebene Datums-String (%s) für eine Gantt-Aktivität kann nicht interpretiert werden. Versichere Dich, dass es ein gültiger Datumsstring ist, z.B. 2005-04-23 13:30',1),
6017 => array('Unbekannter Datumstyp in GanttScale (%s).',1),
-6018 => array('Intervall für Minuten muss ein gerader Teiler einer Stunde sein, z.B. 1,5,10,12,15,20,30, etc. Du hast ein Intervall von %d Minuten angegeben.',1),
-6019 => array('Die vorhandene Breite (%d) für die Minuten ist zu klein, um angezeigt zu werden. Bitte benutze die automatische Größenermittlung oder vergrößere die Breite des Diagramms.',1),
-6020 => array('Das Intervall für die Stunden muss ein gerader Teiler eines Tages sein, z.B. 0:30, 1:00, 1:30, 4:00, etc. Du hast ein Intervall von %d eingegeben.',1),
-6021 => array('Unbekanntes Format für die Woche.',0),
+6018 => array('Intervall für Minuten muss ein gerader Teiler einer Stunde sein, z.B. 1,5,10,12,15,20,30, etc. Du hast ein Intervall von %d Minuten angegeben.',1),
+6019 => array('Die vorhandene Breite (%d) für die Minuten ist zu klein, um angezeigt zu werden. Bitte benutze die automatische Größenermittlung oder vergrößere die Breite des Diagramms.',1),
+6020 => array('Das Intervall für die Stunden muss ein gerader Teiler eines Tages sein, z.B. 0:30, 1:00, 1:30, 4:00, etc. Du hast ein Intervall von %d eingegeben.',1),
+6021 => array('Unbekanntes Format für die Woche.',0),
6022 => array('Die Gantt-Skala wurde nicht eingegeben.',0),
6023 => array('Wenn Du sowohl Stunden als auch Minuten anzeigen lassen willst, muss das Stunden-Interval gleich 1 sein (anderenfalls ist es nicht sinnvoll, Minuten anzeigen zu lassen).',0),
6024 => array('Das CSIM-Ziel muss als String angegeben werden. Der Start des Ziels ist: %d',1),
6025 => array('Der CSIM-Alt-Text muss als String angegeben werden. Der Beginn des Alt-Textes ist: %d',1),
6027 => array('Der Fortschrittswert muss im Bereich [0, 1] liegen.',0),
-6028 => array('Die eingegebene Höhe (%d) für GanttBar ist nicht im zulässigen Bereich.',1),
-6029 => array('Der Offset für die vertikale Linie muss im Bereich [0,1] sein.',0),
-6030 => array('Unbekannte Pfeilrichtung für eine Verbindung.',0),
-6031 => array('Unbekannter Pfeiltyp für eine Verbindung.',0),
-6032 => array('Interner Fehler: Unbekannter Pfadtyp (=%d) für eine Verbindung.',1),
+6028 => array('Die eingegebene Höhe (%d) für GanttBar ist nicht im zulässigen Bereich.',1),
+6029 => array('Der Offset für die vertikale Linie muss im Bereich [0,1] sein.',0),
+6030 => array('Unbekannte Pfeilrichtung für eine Verbindung.',0),
+6031 => array('Unbekannter Pfeiltyp für eine Verbindung.',0),
+6032 => array('Interner Fehler: Unbekannter Pfadtyp (=%d) für eine Verbindung.',1),
+6033 => array('Array of fonts must contain arrays with 3 elements, i.e. (Family, Style, Size)',0),
/*
** jpgraph_gradient
@@ -112,107 +115,107 @@
** jpgraph_iconplot
*/
-8001 => array('Der Mix-Wert für das Icon muss zwischen 0 und 100 sein.',0),
-8002 => array('Die Ankerposition für Icons muss entweder "top", "bottom", "left", "right" oder "center" sein.',0),
-8003 => array('Es ist nicht möglich, gleichzeitig ein Bild und eine Landesflagge für dasselbe Icon zu definieren',0),
-8004 => array('Wenn Du Landesflaggen benutzen willst, musst Du die Datei "jpgraph_flags.php" hinzufügen (per include).',0),
+8001 => array('Der Mix-Wert für das Icon muss zwischen 0 und 100 sein.',0),
+8002 => array('Die Ankerposition für Icons muss entweder "top", "bottom", "left", "right" oder "center" sein.',0),
+8003 => array('Es ist nicht möglich, gleichzeitig ein Bild und eine Landesflagge für dasselbe Icon zu definieren',0),
+8004 => array('Wenn Du Landesflaggen benutzen willst, musst Du die Datei "jpgraph_flags.php" hinzufügen (per include).',0),
/*
** jpgraph_imgtrans
*/
-9001 => array('Der Wert für die Bildtransformation ist außerhalb des zulässigen Bereichs. Der verschwindende Punkt am Horizont muss als Wert zwischen 0 und 1 angegeben werden.',0),
+9001 => array('Der Wert für die Bildtransformation ist außerhalb des zulässigen Bereichs. Der verschwindende Punkt am Horizont muss als Wert zwischen 0 und 1 angegeben werden.',0),
/*
** jpgraph_lineplot
*/
10001 => array('Die Methode LinePlot::SetFilled() sollte nicht mehr benutzt werden. Benutze lieber SetFillColor()',0),
-10002 => array('Der Plot ist zu kompliziert für FastLineStroke. Benutze lieber den StandardStroke()',0),
+10002 => array('Der Plot ist zu kompliziert für FastLineStroke. Benutze lieber den StandardStroke()',0),
10003 => array('Each plot in an accumulated lineplot must have the same number of data points.',0),
/*
** jpgraph_log
*/
11001 => array('Deine Daten enthalten nicht-numerische Werte.',0),
-11002 => array('Negative Werte können nicht für logarithmische Achsen verwendet werden.',0),
+11002 => array('Negative Werte können nicht für logarithmische Achsen verwendet werden.',0),
11003 => array('Deine Daten enthalten nicht-numerische Werte.',0),
-11004 => array('Skalierungsfehler für die logarithmische Achse. Es gibt ein Problem mit den Daten der Achse. Der größte Wert muss größer sein als Null. Es ist mathematisch nicht möglich, einen Wert gleich Null in der Skala zu haben.',0),
-11005 => array('Das Tick-Intervall für die logarithmische Achse ist nicht definiert. Lösche jeden Aufruf von SetTextLabelStart() oder SetTextTickInterval() bei der logarithmischen Achse.',0),
+11004 => array('Skalierungsfehler für die logarithmische Achse. Es gibt ein Problem mit den Daten der Achse. Der größte Wert muss größer sein als Null. Es ist mathematisch nicht möglich, einen Wert gleich Null in der Skala zu haben.',0),
+11005 => array('Das Tick-Intervall für die logarithmische Achse ist nicht definiert. Lösche jeden Aufruf von SetTextLabelStart() oder SetTextTickInterval() bei der logarithmischen Achse.',0),
/*
** jpgraph_mgraph
*/
-12001 => array("Du benutzt GD 2.x und versuchst ein Nicht-Truecolor-Bild als Hintergrundbild zu benutzen. Um Hintergrundbilder mit GD 2.x zu benutzen, ist es notwendig Truecolor zu aktivieren, indem die USE_TRUECOLOR-Konstante auf TRUE gesetzt wird. Wegen eines Bugs in GD 2.0.1 ist die Qualität der Truetype-Schriften sehr schlecht, wenn man Truetype-Schriften mit Truecolor-Bildern verwendet.",0),
-12002 => array('Ungültiger Dateiname für MGraph::SetBackgroundImage() : %s. Die Datei muss eine gültige Dateierweiterung haben (jpg,gif,png), wenn die automatische Typerkennung verwendet wird.',1),
-12003 => array('Unbekannte Dateierweiterung (%s) in MGraph::SetBackgroundImage() für Dateiname: %s',2),
-12004 => array('Das Bildformat des Hintergrundbildes (%s) wird von Deiner System-Konfiguration nicht unterstützt. ',1),
+12001 => array("Du benutzt GD 2.x und versuchst ein Nicht-Truecolor-Bild als Hintergrundbild zu benutzen. Um Hintergrundbilder mit GD 2.x zu benutzen, ist es notwendig Truecolor zu aktivieren, indem die USE_TRUECOLOR-Konstante auf TRUE gesetzt wird. Wegen eines Bugs in GD 2.0.1 ist die Qualität der Truetype-Schriften sehr schlecht, wenn man Truetype-Schriften mit Truecolor-Bildern verwendet.",0),
+12002 => array('Ungültiger Dateiname für MGraph::SetBackgroundImage() : %s. Die Datei muss eine gültige Dateierweiterung haben (jpg,gif,png), wenn die automatische Typerkennung verwendet wird.',1),
+12003 => array('Unbekannte Dateierweiterung (%s) in MGraph::SetBackgroundImage() für Dateiname: %s',2),
+12004 => array('Das Bildformat des Hintergrundbildes (%s) wird von Deiner System-Konfiguration nicht unterstützt. ',1),
12005 => array('Das Hintergrundbild kann nicht gelesen werden: %s',1),
-12006 => array('Es wurden ungültige Größen für Breite oder Höhe beim Erstellen des Bildes angegeben, (Breite=%d, Höhe=%d)',2),
-12007 => array('Das Argument für MGraph::Add() ist nicht gültig für GD.',0),
-12008 => array('Deine PHP- (und GD-lib-) Installation scheint keine bekannten Bildformate zu unterstützen.',0),
-12009 => array('Deine PHP-Installation unterstützt das gewählte Bildformat nicht: %s',1),
-12010 => array('Es konnte kein Bild als Datei %s erzeugt werden. Überprüfe, ob Du die entsprechenden Schreibrechte im aktuellen Verzeichnis hast.',1),
-12011 => array('Es konnte kein Truecolor-Bild erzeugt werden. Überprüfe, ob Du wirklich die GD2-Bibliothek installiert hast.',0),
-12012 => array('Es konnte kein Bild erzeugt werden. Überprüfe, ob Du wirklich die GD2-Bibliothek installiert hast.',0),
+12006 => array('Es wurden ungültige Größen für Breite oder Höhe beim Erstellen des Bildes angegeben, (Breite=%d, Höhe=%d)',2),
+12007 => array('Das Argument für MGraph::Add() ist nicht gültig für GD.',0),
+12008 => array('Deine PHP- (und GD-lib-) Installation scheint keine bekannten Bildformate zu unterstützen.',0),
+12009 => array('Deine PHP-Installation unterstützt das gewählte Bildformat nicht: %s',1),
+12010 => array('Es konnte kein Bild als Datei %s erzeugt werden. Überprüfe, ob Du die entsprechenden Schreibrechte im aktuellen Verzeichnis hast.',1),
+12011 => array('Es konnte kein Truecolor-Bild erzeugt werden. Überprüfe, ob Du wirklich die GD2-Bibliothek installiert hast.',0),
+12012 => array('Es konnte kein Bild erzeugt werden. Überprüfe, ob Du wirklich die GD2-Bibliothek installiert hast.',0),
/*
** jpgraph_pie3d
*/
-14001 => array('Pie3D::ShowBorder(). Missbilligte Funktion. Benutze Pie3D::SetEdge(), um die Ecken der Tortenstücke zu kontrollieren.',0),
+14001 => array('Pie3D::ShowBorder(). Missbilligte Funktion. Benutze Pie3D::SetEdge(), um die Ecken der Tortenstücke zu kontrollieren.',0),
14002 => array('PiePlot3D::SetAngle() 3D-Torten-Projektionswinkel muss zwischen 5 und 85 Grad sein.',0),
14003 => array('Interne Festlegung schlug fehl. Pie3D::Pie3DSlice',0),
-14004 => array('Tortenstück-Startwinkel muss zwischen 0 und 360 Grad sein.',0),
-14005 => array('Pie3D Interner Fehler: Versuch, zweimal zu umhüllen bei der Suche nach dem Startindex.',0,),
-14006 => array('Pie3D Interner Fehler: Z-Sortier-Algorithmus für 3D-Tortendiagramme funktioniert nicht einwandfrei (2). Versuch, zweimal zu umhüllen beim Erstellen des Bildes.',0),
-14007 => array('Die Breite für das 3D-Tortendiagramm ist 0. Gib eine Breite > 0 an.',0),
+14004 => array('Tortenstück-Startwinkel muss zwischen 0 und 360 Grad sein.',0),
+14005 => array('Pie3D Interner Fehler: Versuch, zweimal zu umhüllen bei der Suche nach dem Startindex.',0,),
+14006 => array('Pie3D Interner Fehler: Z-Sortier-Algorithmus für 3D-Tortendiagramme funktioniert nicht einwandfrei (2). Versuch, zweimal zu umhüllen beim Erstellen des Bildes.',0),
+14007 => array('Die Breite für das 3D-Tortendiagramm ist 0. Gib eine Breite > 0 an.',0),
/*
** jpgraph_pie
*/
15001 => array('PiePLot::SetTheme() Unbekannter Stil: %s',1),
-15002 => array('Argument für PiePlot::ExplodeSlice() muss ein Integer-Wert sein',0),
-15003 => array('Argument für PiePlot::Explode() muss ein Vektor mit Integer-Werten sein.',0),
-15004 => array('Tortenstück-Startwinkel muss zwischen 0 und 360 Grad sein.',0),
+15002 => array('Argument für PiePlot::ExplodeSlice() muss ein Integer-Wert sein',0),
+15003 => array('Argument für PiePlot::Explode() muss ein Vektor mit Integer-Werten sein.',0),
+15004 => array('Tortenstück-Startwinkel muss zwischen 0 und 360 Grad sein.',0),
15005 => array('PiePlot::SetFont() sollte nicht mehr verwendet werden. Benutze stattdessen PiePlot->value->SetFont().',0),
-15006 => array('PiePlot::SetSize() Radius für Tortendiagramm muss entweder als Bruch [0, 0.5] der Bildgröße oder als Absoluwert in Pixel im Bereich [10, 1000] angegeben werden.',0),
+15006 => array('PiePlot::SetSize() Radius für Tortendiagramm muss entweder als Bruch [0, 0.5] der Bildgröße oder als Absoluwert in Pixel im Bereich [10, 1000] angegeben werden.',0),
15007 => array('PiePlot::SetFontColor() sollte nicht mehr verwendet werden. Benutze stattdessen PiePlot->value->SetColor()..',0),
-15008 => array('PiePlot::SetLabelType() der Typ für Tortendiagramme muss entweder 0 or 1 sein (nicht %d).',1),
-15009 => array('Ungültiges Tortendiagramm. Die Summe aller Daten ist Null.',0),
+15008 => array('PiePlot::SetLabelType() der Typ für Tortendiagramme muss entweder 0 or 1 sein (nicht %d).',1),
+15009 => array('Ungültiges Tortendiagramm. Die Summe aller Daten ist Null.',0),
15010 => array('Die Summe aller Daten ist Null.',0),
-15011 => array('Um Bildtransformationen benutzen zu können, muss die Datei jpgraph_imgtrans.php eingefügt werden (per include).',0),
+15011 => array('Um Bildtransformationen benutzen zu können, muss die Datei jpgraph_imgtrans.php eingefügt werden (per include).',0),
/*
** jpgraph_plotband
*/
-16001 => array('Die Dichte für das Pattern muss zwischen 1 und 100 sein. (Du hast %f eingegeben)',1),
-16002 => array('Es wurde keine Position für das Pattern angegeben.',0),
+16001 => array('Die Dichte für das Pattern muss zwischen 1 und 100 sein. (Du hast %f eingegeben)',1),
+16002 => array('Es wurde keine Position für das Pattern angegeben.',0),
16003 => array('Unbekannte Pattern-Definition (%d)',0),
-16004 => array('Der Mindeswert für das PlotBand ist größer als der Maximalwert. Bitte korrigiere dies!',0),
+16004 => array('Der Mindeswert für das PlotBand ist größer als der Maximalwert. Bitte korrigiere dies!',0),
/*
** jpgraph_polar
*/
-17001 => array('PolarPlots müssen eine gerade Anzahl von Datenpunkten haben. Jeder Datenpunkt ist ein Tupel (Winkel, Radius).',0),
-17002 => array('Unbekannte Ausrichtung für X-Achsen-Titel. (%s)',1),
-//17003 => array('Set90AndMargin() wird für PolarGraph nicht unterstützt.',0),
-17004 => array('Unbekannter Achsentyp für PolarGraph. Er muss entweder \'lin\' oder \'log\' sein.',0),
+17001 => array('PolarPlots müssen eine gerade Anzahl von Datenpunkten haben. Jeder Datenpunkt ist ein Tupel (Winkel, Radius).',0),
+17002 => array('Unbekannte Ausrichtung für X-Achsen-Titel. (%s)',1),
+//17003 => array('Set90AndMargin() wird für PolarGraph nicht unterstützt.',0),
+17004 => array('Unbekannter Achsentyp für PolarGraph. Er muss entweder \'lin\' oder \'log\' sein.',0),
/*
** jpgraph_radar
*/
-18001 => array('ClientSideImageMaps werden für RadarPlots nicht unterstützt.',0),
+18001 => array('ClientSideImageMaps werden für RadarPlots nicht unterstützt.',0),
18002 => array('RadarGraph::SupressTickMarks() sollte nicht mehr verwendet werden. Benutze stattdessen HideTickMarks().',0),
-18003 => array('Ungültiger Achsentyp für RadarPlot (%s). Er muss entweder \'lin\' oder \'log\' sein.',1),
-18004 => array('Die RadarPlot-Größe muss zwischen 0.1 und 1 sein. (Dein Wert=%f)',1),
-18005 => array('RadarPlot: nicht unterstützte Tick-Dichte: %d',1),
+18003 => array('Ungültiger Achsentyp für RadarPlot (%s). Er muss entweder \'lin\' oder \'log\' sein.',1),
+18004 => array('Die RadarPlot-Größe muss zwischen 0.1 und 1 sein. (Dein Wert=%f)',1),
+18005 => array('RadarPlot: nicht unterstützte Tick-Dichte: %d',1),
18006 => array('Minimum Daten %f (RadarPlots sollten nur verwendet werden, wenn alle Datenpunkte einen Wert > 0 haben).',1),
18007 => array('Die Anzahl der Titel entspricht nicht der Anzahl der Datenpunkte.',0),
18008 => array('Jeder RadarPlot muss die gleiche Anzahl von Datenpunkten haben.',0),
@@ -222,29 +225,29 @@
*/
19001 => array('Spline: Anzahl der X- und Y-Koordinaten muss gleich sein.',0),
-19002 => array('Ungültige Dateneingabe für Spline. Zwei oder mehr aufeinanderfolgende X-Werte sind identisch. Jeder eigegebene X-Wert muss unterschiedlich sein, weil vom mathematischen Standpunkt ein Eins-zu-Eins-Mapping vorliegen muss, d.h. jeder X-Wert korrespondiert mit exakt einem Y-Wert.',0),
+19002 => array('Ungültige Dateneingabe für Spline. Zwei oder mehr aufeinanderfolgende X-Werte sind identisch. Jeder eigegebene X-Wert muss unterschiedlich sein, weil vom mathematischen Standpunkt ein Eins-zu-Eins-Mapping vorliegen muss, d.h. jeder X-Wert korrespondiert mit exakt einem Y-Wert.',0),
19003 => array('Bezier: Anzahl der X- und Y-Koordinaten muss gleich sein.',0),
/*
** jpgraph_scatter
*/
-20001 => array('Fieldplots müssen die gleiche Anzahl von X und Y Datenpunkten haben.',0),
-20002 => array('Bei Fieldplots muss ein Winkel für jeden X und Y Datenpunkt angegeben werden.',0),
-20003 => array('Scatterplots müssen die gleiche Anzahl von X- und Y-Datenpunkten haben.',0),
+20001 => array('Fieldplots müssen die gleiche Anzahl von X und Y Datenpunkten haben.',0),
+20002 => array('Bei Fieldplots muss ein Winkel für jeden X und Y Datenpunkt angegeben werden.',0),
+20003 => array('Scatterplots müssen die gleiche Anzahl von X- und Y-Datenpunkten haben.',0),
/*
** jpgraph_stock
*/
-21001 => array('Die Anzahl der Datenwerte für Stock-Charts müssen ein Mehrfaches von %d Datenpunkten sein.',1),
+21001 => array('Die Anzahl der Datenwerte für Stock-Charts müssen ein Mehrfaches von %d Datenpunkten sein.',1),
/*
** jpgraph_plotmark
*/
23001 => array('Der Marker "%s" existiert nicht in der Farbe: %d',2),
-23002 => array('Der Farb-Index ist zu hoch für den Marker "%s"',1),
+23002 => array('Der Farb-Index ist zu hoch für den Marker "%s"',1),
23003 => array('Ein Dateiname muss angegeben werden, wenn Du den Marker-Typ auf MARK_IMG setzt.',0),
/*
@@ -254,69 +257,69 @@
24001 => array('FuncGenerator : Keine Funktion definiert. ',0),
24002 => array('FuncGenerator : Syntax-Fehler in der Funktionsdefinition ',0),
24003 => array('DateScaleUtils: Unknown tick type specified in call to GetTicks()',0),
-
+24004 => array('ReadCSV2: Die anzahl der spalten fehler in %s reihe %d',2),
/*
** jpgraph
*/
-25001 => array('Diese PHP-Installation ist nicht mit der GD-Bibliothek kompiliert. Bitte kompiliere PHP mit GD-Unterstützung neu, damit JpGraph funktioniert. (Weder die Funktion imagetypes() noch imagecreatefromstring() existiert!)',0),
-25002 => array('Diese PHP-Installation scheint nicht die benötigte GD-Bibliothek zu unterstützen. Bitte schau in der PHP-Dokumentation nach, wie man die GD-Bibliothek installiert und aktiviert.',0),
+25001 => array('Diese PHP-Installation ist nicht mit der GD-Bibliothek kompiliert. Bitte kompiliere PHP mit GD-Unterstützung neu, damit JpGraph funktioniert. (Weder die Funktion imagetypes() noch imagecreatefromstring() existiert!)',0),
+25002 => array('Diese PHP-Installation scheint nicht die benötigte GD-Bibliothek zu unterstützen. Bitte schau in der PHP-Dokumentation nach, wie man die GD-Bibliothek installiert und aktiviert.',0),
25003 => array('Genereller PHP Fehler : Bei %s:%d : %s',3),
25004 => array('Genereller PHP Fehler : %s ',1),
25005 => array('PHP_SELF, die PHP-Global-Variable kann nicht ermittelt werden. PHP kann nicht von der Kommandozeile gestartet werden, wenn der Cache oder die Bilddateien automatisch benannt werden sollen.',0),
-25006 => array('Die Benutzung der FF_CHINESE (FF_BIG5) Schriftfamilie benötigt die iconv() Funktion in Deiner PHP-Konfiguration. Dies wird nicht defaultmäßig in PHP kompiliert (benötigt "--width-iconv" bei der Konfiguration).',0),
-25007 => array('Du versuchst das lokale (%s) zu verwenden, was von Deiner PHP-Installation nicht unterstützt wird. Hinweis: Benutze \'\', um das defaultmäßige Lokale für diese geographische Region festzulegen.',1),
-25008 => array('Die Bild-Breite und Höhe in Graph::Graph() müssen numerisch sein',0),
+25006 => array('Die Benutzung der FF_CHINESE (FF_BIG5) Schriftfamilie benötigt die iconv() Funktion in Deiner PHP-Konfiguration. Dies wird nicht defaultmäßig in PHP kompiliert (benötigt "--width-iconv" bei der Konfiguration).',0),
+25007 => array('Du versuchst das lokale (%s) zu verwenden, was von Deiner PHP-Installation nicht unterstützt wird. Hinweis: Benutze \'\', um das defaultmäßige Lokale für diese geographische Region festzulegen.',1),
+25008 => array('Die Bild-Breite und Höhe in Graph::Graph() müssen numerisch sein',0),
25009 => array('Die Skalierung der Achsen muss angegeben werden mit Graph::SetScale()',0),
-25010 => array('Graph::Add() Du hast versucht, einen leeren Plot zum Graph hinzuzufügen.',0),
-25011 => array('Graph::AddY2() Du hast versucht, einen leeren Plot zum Graph hinzuzufügen.',0),
-25012 => array('Graph::AddYN() Du hast versucht, einen leeren Plot zum Graph hinzuzufügen.',0),
-25013 => array('Es können nur Standard-Plots zu multiplen Y-Achsen hinzugefügt werden',0),
-25014 => array('Graph::AddText() Du hast versucht, einen leeren Text zum Graph hinzuzufügen.',0),
-25015 => array('Graph::AddLine() Du hast versucht, eine leere Linie zum Graph hinzuzufügen.',0),
-25016 => array('Graph::AddBand() Du hast versucht, ein leeres Band zum Graph hinzuzufügen.',0),
-25017 => array('Du benutzt GD 2.x und versuchst, ein Hintergrundbild in einem Truecolor-Bild zu verwenden. Um Hintergrundbilder mit GD 2.x zu verwenden, ist es notwendig, Truecolor zu aktivieren, indem die USE_TRUECOLOR-Konstante auf TRUE gesetzt wird. Wegen eines Bugs in GD 2.0.1 ist die Qualität der Schrift sehr schlecht, wenn Truetype-Schrift in Truecolor-Bildern verwendet werden.',0),
-25018 => array('Falscher Dateiname für Graph::SetBackgroundImage() : "%s" muss eine gültige Dateinamenerweiterung (jpg,gif,png) haben, wenn die automatische Dateityperkennung verwenndet werden soll.',1),
-25019 => array('Unbekannte Dateinamenerweiterung (%s) in Graph::SetBackgroundImage() für Dateiname: "%s"',2),
-
-25020 => array('Graph::SetScale(): Dar Maximalwert muss größer sein als der Mindestwert.',0),
-25021 => array('Unbekannte Achsendefinition für die Y-Achse. (%s)',1),
-25022 => array('Unbekannte Achsendefinition für die X-Achse. (%s)',1),
-25023 => array('Nicht unterstützter Y2-Achsentyp: "%s" muss einer von (lin,log,int) sein.',1),
-25024 => array('Nicht unterstützter X-Achsentyp: "%s" muss einer von (lin,log,int) sein.',1),
-25025 => array('Nicht unterstützte Tick-Dichte: %d',1),
-25026 => array('Nicht unterstützter Typ der nicht angegebenen Y-Achse. Du hast entweder: 1. einen Y-Achsentyp für automatisches Skalieren definiert, aber keine Plots angegeben. 2. eine Achse direkt definiert, aber vergessen, die Tick-Dichte zu festzulegen.',0),
-25027 => array('Kann cached CSIM "%s" zum Lesen nicht öffnen.',1),
-25028 => array('Apache/PHP hat keine Schreibrechte, in das CSIM-Cache-Verzeichnis (%s) zu schreiben. Überprüfe die Rechte.',1),
-25029 => array('Kann nicht in das CSIM "%s" schreiben. Überprüfe die Schreibrechte und den freien Speicherplatz.',1),
+25010 => array('Graph::Add() Du hast versucht, einen leeren Plot zum Graph hinzuzufügen.',0),
+25011 => array('Graph::AddY2() Du hast versucht, einen leeren Plot zum Graph hinzuzufügen.',0),
+25012 => array('Graph::AddYN() Du hast versucht, einen leeren Plot zum Graph hinzuzufügen.',0),
+25013 => array('Es können nur Standard-Plots zu multiplen Y-Achsen hinzugefügt werden',0),
+25014 => array('Graph::AddText() Du hast versucht, einen leeren Text zum Graph hinzuzufügen.',0),
+25015 => array('Graph::AddLine() Du hast versucht, eine leere Linie zum Graph hinzuzufügen.',0),
+25016 => array('Graph::AddBand() Du hast versucht, ein leeres Band zum Graph hinzuzufügen.',0),
+25017 => array('Du benutzt GD 2.x und versuchst, ein Hintergrundbild in einem Truecolor-Bild zu verwenden. Um Hintergrundbilder mit GD 2.x zu verwenden, ist es notwendig, Truecolor zu aktivieren, indem die USE_TRUECOLOR-Konstante auf TRUE gesetzt wird. Wegen eines Bugs in GD 2.0.1 ist die Qualität der Schrift sehr schlecht, wenn Truetype-Schrift in Truecolor-Bildern verwendet werden.',0),
+25018 => array('Falscher Dateiname für Graph::SetBackgroundImage() : "%s" muss eine gültige Dateinamenerweiterung (jpg,gif,png) haben, wenn die automatische Dateityperkennung verwenndet werden soll.',1),
+25019 => array('Unbekannte Dateinamenerweiterung (%s) in Graph::SetBackgroundImage() für Dateiname: "%s"',2),
+
+25020 => array('Graph::SetScale(): Dar Maximalwert muss größer sein als der Mindestwert.',0),
+25021 => array('Unbekannte Achsendefinition für die Y-Achse. (%s)',1),
+25022 => array('Unbekannte Achsendefinition für die X-Achse. (%s)',1),
+25023 => array('Nicht unterstützter Y2-Achsentyp: "%s" muss einer von (lin,log,int) sein.',1),
+25024 => array('Nicht unterstützter X-Achsentyp: "%s" muss einer von (lin,log,int) sein.',1),
+25025 => array('Nicht unterstützte Tick-Dichte: %d',1),
+25026 => array('Nicht unterstützter Typ der nicht angegebenen Y-Achse. Du hast entweder: 1. einen Y-Achsentyp für automatisches Skalieren definiert, aber keine Plots angegeben. 2. eine Achse direkt definiert, aber vergessen, die Tick-Dichte zu festzulegen.',0),
+25027 => array('Kann cached CSIM "%s" zum Lesen nicht öffnen.',1),
+25028 => array('Apache/PHP hat keine Schreibrechte, in das CSIM-Cache-Verzeichnis (%s) zu schreiben. Überprüfe die Rechte.',1),
+25029 => array('Kann nicht in das CSIM "%s" schreiben. Überprüfe die Schreibrechte und den freien Speicherplatz.',1),
-25030 => array('Fehlender Skriptname für StrokeCSIM(). Der Name des aktuellen Skriptes muss als erster Parameter von StrokeCSIM() angegeben werden.',0),
+25030 => array('Fehlender Skriptname für StrokeCSIM(). Der Name des aktuellen Skriptes muss als erster Parameter von StrokeCSIM() angegeben werden.',0),
25031 => array('Der Achsentyp muss mittels Graph::SetScale() angegeben werden.',0),
-25032 => array('Es existieren keine Plots für die Y-Achse nbr:%d',1),
+25032 => array('Es existieren keine Plots für die Y-Achse nbr:%d',1),
25033 => array('',0),
25034 => array('Undefinierte X-Achse kann nicht gezeichnet werden. Es wurden keine Plots definiert.',0),
-25035 => array('Du hast Clipping aktiviert. Clipping wird nur für Diagramme mit 0 oder 90 Grad Rotation unterstützt. Bitte verändere Deinen Rotationswinkel (=%d Grad) dementsprechend oder deaktiviere Clipping.',1),
+25035 => array('Du hast Clipping aktiviert. Clipping wird nur für Diagramme mit 0 oder 90 Grad Rotation unterstützt. Bitte verändere Deinen Rotationswinkel (=%d Grad) dementsprechend oder deaktiviere Clipping.',1),
25036 => array('Unbekannter Achsentyp AxisStyle() : %s',1),
-25037 => array('Das Bildformat Deines Hintergrundbildes (%s) wird von Deiner System-Konfiguration nicht unterstützt. ',1),
+25037 => array('Das Bildformat Deines Hintergrundbildes (%s) wird von Deiner System-Konfiguration nicht unterstützt. ',1),
25038 => array('Das Hintergrundbild scheint von einem anderen Typ (unterschiedliche Dateierweiterung) zu sein als der angegebene Typ. Angegebenen: %s; Datei: %s',2),
25039 => array('Hintergrundbild kann nicht gelesen werden: "%s"',1),
-25040 => array('Es ist nicht möglich, sowohl ein Hintergrundbild als auch eine Hintergrund-Landesflagge anzugeben.',0),
-25041 => array('Um Landesflaggen als Hintergrund benutzen zu können, muss die Datei "jpgraph_flags.php" eingefügt werden (per include).',0),
+25040 => array('Es ist nicht möglich, sowohl ein Hintergrundbild als auch eine Hintergrund-Landesflagge anzugeben.',0),
+25041 => array('Um Landesflaggen als Hintergrund benutzen zu können, muss die Datei "jpgraph_flags.php" eingefügt werden (per include).',0),
25042 => array('Unbekanntes Hintergrundbild-Layout',0),
25043 => array('Unbekannter Titelhintergrund-Stil.',0),
-25044 => array('Automatisches Skalieren kann nicht verwendet werden, weil es unmöglich ist, einen gültigen min/max Wert für die Y-Achse zu ermitteln (nur Null-Werte).',0),
-25045 => array('Die Schriftfamilien FF_HANDWRT und FF_BOOK sind wegen Copyright-Problemen nicht mehr verfügbar. Diese Schriften können nicht mehr mit JpGraph verteilt werden. Bitte lade Dir Schriften von http://corefonts.sourceforge.net/ herunter.',0),
+25044 => array('Automatisches Skalieren kann nicht verwendet werden, weil es unmöglich ist, einen gültigen min/max Wert für die Y-Achse zu ermitteln (nur Null-Werte).',0),
+25045 => array('Die Schriftfamilien FF_HANDWRT und FF_BOOK sind wegen Copyright-Problemen nicht mehr verfügbar. Diese Schriften können nicht mehr mit JpGraph verteilt werden. Bitte lade Dir Schriften von http://corefonts.sourceforge.net/ herunter.',0),
25046 => array('Angegebene TTF-Schriftfamilie (id=%d) ist unbekannt oder existiert nicht. Bitte merke Dir, dass TTF-Schriften wegen Copyright-Problemen nicht mit JpGraph mitgeliefert werden. Du findest MS-TTF-Internetschriften (arial, courier, etc.) zum Herunterladen unter http://corefonts.sourceforge.net/',1),
-25047 => array('Stil %s ist nicht verfügbar für Schriftfamilie %s',2),
+25047 => array('Stil %s ist nicht verfügbar für Schriftfamilie %s',2),
25048 => array('Unbekannte Schriftstildefinition [%s].',1),
25049 => array('Schriftdatei "%s" ist nicht lesbar oder existiert nicht.',1),
-25050 => array('Erstes Argument für Text::Text() muss ein String sein.',0),
-25051 => array('Ungültige Richtung angegeben für Text.',0),
-25052 => array('PANIK: Interner Fehler in SuperScript::Stroke(). Unbekannte vertikale Ausrichtung für Text.',0),
-25053 => array('PANIK: Interner Fehler in SuperScript::Stroke(). Unbekannte horizontale Ausrichtung für Text.',0),
+25050 => array('Erstes Argument für Text::Text() muss ein String sein.',0),
+25051 => array('Ungültige Richtung angegeben für Text.',0),
+25052 => array('PANIK: Interner Fehler in SuperScript::Stroke(). Unbekannte vertikale Ausrichtung für Text.',0),
+25053 => array('PANIK: Interner Fehler in SuperScript::Stroke(). Unbekannte horizontale Ausrichtung für Text.',0),
25054 => array('Interner Fehler: Unbekannte Grid-Achse %s',1),
25055 => array('Axis::SetTickDirection() sollte nicht mehr verwendet werden. Benutze stattdessen Axis::SetTickSide().',0),
25056 => array('SetTickLabelMargin() sollte nicht mehr verwendet werden. Benutze stattdessen Axis::SetLabelMargin().',0),
@@ -324,79 +327,91 @@
25058 => array('TextLabelIntevall >= 1 muss angegeben werden.',0),
25059 => array('SetLabelPos() sollte nicht mehr verwendet werden. Benutze stattdessen Axis::SetLabelSide().',0),
-25060 => array('Unbekannte Ausrichtung angegeben für X-Achsentitel (%s).',1),
-25061 => array('Unbekannte Ausrichtung angegeben für Y-Achsentitel (%s).',1),
-25062 => array('Label unter einem Winkel werden für die Y-Achse nicht unterstützt.',0),
+25060 => array('Unbekannte Ausrichtung angegeben für X-Achsentitel (%s).',1),
+25061 => array('Unbekannte Ausrichtung angegeben für Y-Achsentitel (%s).',1),
+25062 => array('Label unter einem Winkel werden für die Y-Achse nicht unterstützt.',0),
25063 => array('Ticks::SetPrecision() sollte nicht mehr verwendet werden. Benutze stattdessen Ticks::SetLabelFormat() (oder Ticks::SetFormatCallback()).',0),
-25064 => array('Kleinere oder größere Schrittgröße ist 0. Überprüfe, ob Du fälschlicherweise SetTextTicks(0) in Deinem Skript hast. Wenn dies nicht der Fall ist, bist Du eventuell über einen Bug in JpGraph gestolpert. Bitte sende einen Report und füge den Code an, der den Fehler verursacht hat.',0),
-25065 => array('Tick-Positionen müssen als array() angegeben werden',0),
+25064 => array('Kleinere oder größere Schrittgröße ist 0. Überprüfe, ob Du fälschlicherweise SetTextTicks(0) in Deinem Skript hast. Wenn dies nicht der Fall ist, bist Du eventuell über einen Bug in JpGraph gestolpert. Bitte sende einen Report und füge den Code an, der den Fehler verursacht hat.',0),
+25065 => array('Tick-Positionen müssen als array() angegeben werden',0),
25066 => array('Wenn die Tick-Positionen und -Label von Hand eingegeben werden, muss die Anzahl der Ticks und der Label gleich sein.',0),
-25067 => array('Deine von Hand eingegebene Achse und Ticks sind nicht korrekt. Die Skala scheint zu klein zu sein für den Tickabstand.',0),
-25068 => array('Ein Plot hat eine ungültige Achse. Dies kann beispielsweise der Fall sein, wenn Du automatisches Text-Skalieren verwendest, um ein Liniendiagramm zu zeichnen mit nur einem Datenpunkt, oder wenn die Bildfläche zu klein ist. Es kann auch der Fall sein, dass kein Datenpunkt einen numerischen Wert hat (vielleicht nur \'-\' oder \'x\').',0),
-25069 => array('Grace muss größer sein als 0',0),
+25067 => array('Deine von Hand eingegebene Achse und Ticks sind nicht korrekt. Die Skala scheint zu klein zu sein für den Tickabstand.',0),
+25068 => array('Ein Plot hat eine ungültige Achse. Dies kann beispielsweise der Fall sein, wenn Du automatisches Text-Skalieren verwendest, um ein Liniendiagramm zu zeichnen mit nur einem Datenpunkt, oder wenn die Bildfläche zu klein ist. Es kann auch der Fall sein, dass kein Datenpunkt einen numerischen Wert hat (vielleicht nur \'-\' oder \'x\').',0),
+25069 => array('Grace muss größer sein als 0',0),
25070 => array('Deine Daten enthalten nicht-numerische Werte.',0),
-25071 => array('Du hast mit SetAutoMin() einen Mindestwert angegeben, der größer ist als der Maximalwert für die Achse. Dies ist nicht möglich.',0),
-25072 => array('Du hast mit SetAutoMax() einen Maximalwert angegeben, der kleiner ist als der Minimalwert der Achse. Dies ist nicht möglich.',0),
-25073 => array('Interner Fehler. Der Integer-Skalierungs-Algorithmus-Vergleich ist außerhalb der Grenzen (r=%f).',1),
-25074 => array('Interner Fehler. Der Skalierungsbereich ist negativ (%f) [für %s Achse]. Dieses Problem könnte verursacht werden durch den Versuch, \'ungültige\' Werte in die Daten-Vektoren einzugeben (z.B. nur String- oder NULL-Werte), was beim automatischen Skalieren einen Fehler erzeugt.',2),
-25075 => array('Die automatischen Ticks können nicht gesetzt werden, weil min==max.',0),
-25077 => array('Einstellfaktor für die Farbe muss größer sein als 0',0),
+25071 => array('Du hast mit SetAutoMin() einen Mindestwert angegeben, der größer ist als der Maximalwert für die Achse. Dies ist nicht möglich.',0),
+25072 => array('Du hast mit SetAutoMax() einen Maximalwert angegeben, der kleiner ist als der Minimalwert der Achse. Dies ist nicht möglich.',0),
+25073 => array('Interner Fehler. Der Integer-Skalierungs-Algorithmus-Vergleich ist außerhalb der Grenzen (r=%f).',1),
+25074 => array('Interner Fehler. Der Skalierungsbereich ist negativ (%f) [für %s Achse]. Dieses Problem könnte verursacht werden durch den Versuch, \'ungültige\' Werte in die Daten-Vektoren einzugeben (z.B. nur String- oder NULL-Werte), was beim automatischen Skalieren einen Fehler erzeugt.',2),
+25075 => array('Die automatischen Ticks können nicht gesetzt werden, weil min==max.',0),
+25077 => array('Einstellfaktor für die Farbe muss größer sein als 0',0),
25078 => array('Unbekannte Farbe: %s',1),
-25079 => array('Unbekannte Farbdefinition: %s, Größe=%d',2),
+25079 => array('Unbekannte Farbdefinition: %s, Größe=%d',2),
-25080 => array('Der Alpha-Parameter für Farben muss zwischen 0.0 und 1.0 liegen.',0),
-25081 => array('Das ausgewählte Grafikformat wird entweder nicht unterstützt oder ist unbekannt [%s]',1),
-25082 => array('Es wurden ungültige Größen für Breite und Höhe beim Erstellen des Bildes definiert (Breite=%d, Höhe=%d).',2),
-25083 => array('Es wurde eine ungültige Größe beim Kopieren des Bildes angegeben. Die Größe für das kopierte Bild wurde auf 1 Pixel oder weniger gesetzt.',0),
-25084 => array('Fehler beim Erstellen eines temporären GD-Canvas. Möglicherweise liegt ein Arbeitsspeicherproblem vor.',0),
-25085 => array('Ein Bild kann nicht aus dem angegebenen String erzeugt werden. Er ist entweder in einem nicht unterstützen Format oder er represäntiert ein kaputtes Bild.',0),
-25086 => array('Du scheinst nur GD 1.x installiert zu haben. Um Alphablending zu aktivieren, ist GD 2.x oder höher notwendig. Bitte installiere GD 2.x oder versichere Dich, dass die Konstante USE_GD2 richtig gesetzt ist. Standardmäßig wird die installierte GD-Version automatisch erkannt. Ganz selten wird GD2 erkannt, obwohl nur GD1 installiert ist. Die Konstante USE_GD2 muss dann zu "false" gesetzt werden.',0),
-25087 => array('Diese PHP-Version wurde ohne TTF-Unterstützung konfiguriert. PHP muss mit TTF-Unterstützung neu kompiliert und installiert werden.',0),
-25088 => array('Die GD-Schriftunterstützung wurde falsch konfiguriert. Der Aufruf von imagefontwidth() ist fehlerhaft.',0),
-25089 => array('Die GD-Schriftunterstützung wurde falsch konfiguriert. Der Aufruf von imagefontheight() ist fehlerhaft.',0),
+25080 => array('Der Alpha-Parameter für Farben muss zwischen 0.0 und 1.0 liegen.',0),
+25081 => array('Das ausgewählte Grafikformat wird entweder nicht unterstützt oder ist unbekannt [%s]',1),
+25082 => array('Es wurden ungültige Größen für Breite und Höhe beim Erstellen des Bildes definiert (Breite=%d, Höhe=%d).',2),
+25083 => array('Es wurde eine ungültige Größe beim Kopieren des Bildes angegeben. Die Größe für das kopierte Bild wurde auf 1 Pixel oder weniger gesetzt.',0),
+25084 => array('Fehler beim Erstellen eines temporären GD-Canvas. Möglicherweise liegt ein Arbeitsspeicherproblem vor.',0),
+25085 => array('Ein Bild kann nicht aus dem angegebenen String erzeugt werden. Er ist entweder in einem nicht unterstützen Format oder er represäntiert ein kaputtes Bild.',0),
+25086 => array('Du scheinst nur GD 1.x installiert zu haben. Um Alphablending zu aktivieren, ist GD 2.x oder höher notwendig. Bitte installiere GD 2.x oder versichere Dich, dass die Konstante USE_GD2 richtig gesetzt ist. Standardmäßig wird die installierte GD-Version automatisch erkannt. Ganz selten wird GD2 erkannt, obwohl nur GD1 installiert ist. Die Konstante USE_GD2 muss dann zu "false" gesetzt werden.',0),
+25087 => array('Diese PHP-Version wurde ohne TTF-Unterstützung konfiguriert. PHP muss mit TTF-Unterstützung neu kompiliert und installiert werden.',0),
+25088 => array('Die GD-Schriftunterstützung wurde falsch konfiguriert. Der Aufruf von imagefontwidth() ist fehlerhaft.',0),
+25089 => array('Die GD-Schriftunterstützung wurde falsch konfiguriert. Der Aufruf von imagefontheight() ist fehlerhaft.',0),
25090 => array('Unbekannte Richtung angegeben im Aufruf von StrokeBoxedText() [%s].',1),
-25091 => array('Die interne Schrift untestützt das Schreiben von Text in einem beliebigen Winkel nicht. Benutze stattdessen TTF-Schriften.',0),
-25092 => array('Es liegt entweder ein Konfigurationsproblem mit TrueType oder ein Problem beim Lesen der Schriftdatei "%s" vor. Versichere Dich, dass die Datei existiert und Leserechte und -pfad vergeben sind. (wenn \'basedir\' restriction in PHP aktiviert ist, muss die Schriftdatei im Dokumentwurzelverzeichnis abgelegt werden). Möglicherweise ist die FreeType-Bibliothek falsch installiert. Versuche, mindestens zur FreeType-Version 2.1.13 zu aktualisieren und kompiliere GD mit einem korrekten Setup neu, damit die FreeType-Bibliothek gefunden werden kann.',1),
+25091 => array('Die interne Schrift untestützt das Schreiben von Text in einem beliebigen Winkel nicht. Benutze stattdessen TTF-Schriften.',0),
+25092 => array('Es liegt entweder ein Konfigurationsproblem mit TrueType oder ein Problem beim Lesen der Schriftdatei "%s" vor. Versichere Dich, dass die Datei existiert und Leserechte und -pfad vergeben sind. (wenn \'basedir\' restriction in PHP aktiviert ist, muss die Schriftdatei im Dokumentwurzelverzeichnis abgelegt werden). Möglicherweise ist die FreeType-Bibliothek falsch installiert. Versuche, mindestens zur FreeType-Version 2.1.13 zu aktualisieren und kompiliere GD mit einem korrekten Setup neu, damit die FreeType-Bibliothek gefunden werden kann.',1),
25093 => array('Die Schriftdatei "%s" kann nicht gelesen werden beim Aufruf von Image::GetBBoxTTF. Bitte versichere Dich, dass die Schrift gesetzt wurde, bevor diese Methode aufgerufen wird, und dass die Schrift im TTF-Verzeichnis installiert ist.',1),
25094 => array('Die Textrichtung muss in einem Winkel zwischen 0 und 90 engegeben werden.',0),
25095 => array('Unbekannte Schriftfamilien-Definition. ',0),
-25096 => array('Der Farbpalette können keine weiteren Farben zugewiesen werden. Dem Bild wurde bereits die größtmögliche Anzahl von Farben (%d) zugewiesen und die Palette ist voll. Verwende stattdessen ein TrueColor-Bild',0),
+25096 => array('Der Farbpalette können keine weiteren Farben zugewiesen werden. Dem Bild wurde bereits die größtmögliche Anzahl von Farben (%d) zugewiesen und die Palette ist voll. Verwende stattdessen ein TrueColor-Bild',0),
25097 => array('Eine Farbe wurde als leerer String im Aufruf von PushColor() angegegeben.',0),
25098 => array('Negativer Farbindex. Unpassender Aufruf von PopColor().',0),
-25099 => array('Die Parameter für Helligkeit und Kontrast sind außerhalb des zulässigen Bereichs [-1,1]',0),
+25099 => array('Die Parameter für Helligkeit und Kontrast sind außerhalb des zulässigen Bereichs [-1,1]',0),
25100 => array('Es liegt ein Problem mit der Farbpalette und dem GD-Setup vor. Bitte deaktiviere anti-aliasing oder verwende GD2 mit TrueColor. Wenn die GD2-Bibliothek installiert ist, versichere Dich, dass die Konstante USE_GD2 auf "true" gesetzt und TrueColor aktiviert ist.',0),
-25101 => array('Ungültiges numerisches Argument für SetLineStyle(): (%d)',1),
-25102 => array('Ungültiges String-Argument für SetLineStyle(): %s',1),
-25103 => array('Ungültiges Argument für SetLineStyle %s',1),
+25101 => array('Ungültiges numerisches Argument für SetLineStyle(): (%d)',1),
+25102 => array('Ungültiges String-Argument für SetLineStyle(): %s',1),
+25103 => array('Ungültiges Argument für SetLineStyle %s',1),
25104 => array('Unbekannter Linientyp: %s',1),
-25105 => array('Es wurden NULL-Daten für ein gefülltes Polygon angegeben. Sorge dafür, dass keine NULL-Daten angegeben werden.',0),
-25106 => array('Image::FillToBorder : es können keine weiteren Farben zugewiesen werden.',0),
-25107 => array('In Datei "%s" kann nicht geschrieben werden. Überprüfe die aktuellen Schreibrechte.',1),
-25108 => array('Das Bild kann nicht gestreamt werden. Möglicherweise liegt ein Fehler im PHP/GD-Setup vor. Kompiliere PHP neu und verwende die eingebaute GD-Bibliothek, die mit PHP angeboten wird.',0),
-25109 => array('Deine PHP- (und GD-lib-) Installation scheint keine bekannten Grafikformate zu unterstützen. Sorge zunächst dafür, dass GD als PHP-Modul kompiliert ist. Wenn Du außerdem JPEG-Bilder verwenden willst, musst Du die JPEG-Bibliothek installieren. Weitere Details sind in der PHP-Dokumentation zu finden.',0),
+25105 => array('Es wurden NULL-Daten für ein gefülltes Polygon angegeben. Sorge dafür, dass keine NULL-Daten angegeben werden.',0),
+25106 => array('Image::FillToBorder : es können keine weiteren Farben zugewiesen werden.',0),
+25107 => array('In Datei "%s" kann nicht geschrieben werden. Überprüfe die aktuellen Schreibrechte.',1),
+25108 => array('Das Bild kann nicht gestreamt werden. Möglicherweise liegt ein Fehler im PHP/GD-Setup vor. Kompiliere PHP neu und verwende die eingebaute GD-Bibliothek, die mit PHP angeboten wird.',0),
+25109 => array('Deine PHP- (und GD-lib-) Installation scheint keine bekannten Grafikformate zu unterstützen. Sorge zunächst dafür, dass GD als PHP-Modul kompiliert ist. Wenn Du außerdem JPEG-Bilder verwenden willst, musst Du die JPEG-Bibliothek installieren. Weitere Details sind in der PHP-Dokumentation zu finden.',0),
-25110 => array('Dein PHP-Installation unterstützt das gewählte Grafikformat nicht: %s',1),
-25111 => array('Das gecachete Bild %s kann nicht gelöscht werden. Problem mit den Rechten?',1),
+25110 => array('Dein PHP-Installation unterstützt das gewählte Grafikformat nicht: %s',1),
+25111 => array('Das gecachete Bild %s kann nicht gelöscht werden. Problem mit den Rechten?',1),
25112 => array('Das Datum der gecacheten Datei (%s) liegt in der Zukunft.',1),
-25113 => array('Das gecachete Bild %s kann nicht gelöscht werden. Problem mit den Rechten?',1),
-25114 => array('PHP hat nicht die erforderlichen Rechte, um in die Cache-Datei %s zu schreiben. Bitte versichere Dich, dass der Benutzer, der PHP anwendet, die entsprechenden Schreibrechte für die Datei hat, wenn Du das Cache-System in JPGraph verwenden willst.',1),
-25115 => array('Berechtigung für gecachetes Bild %s kann nicht gesetzt werden. Problem mit den Rechten?',1),
-25116 => array('Datei kann nicht aus dem Cache %s geöffnet werden',1),
-25117 => array('Gecachetes Bild %s kann nicht zum Lesen geöffnet werden.',1),
+25113 => array('Das gecachete Bild %s kann nicht gelöscht werden. Problem mit den Rechten?',1),
+25114 => array('PHP hat nicht die erforderlichen Rechte, um in die Cache-Datei %s zu schreiben. Bitte versichere Dich, dass der Benutzer, der PHP anwendet, die entsprechenden Schreibrechte für die Datei hat, wenn Du das Cache-System in JPGraph verwenden willst.',1),
+25115 => array('Berechtigung für gecachetes Bild %s kann nicht gesetzt werden. Problem mit den Rechten?',1),
+25116 => array('Datei kann nicht aus dem Cache %s geöffnet werden',1),
+25117 => array('Gecachetes Bild %s kann nicht zum Lesen geöffnet werden.',1),
25118 => array('Verzeichnis %s kann nicht angelegt werden. Versichere Dich, dass PHP die Schreibrechte in diesem Verzeichnis hat.',1),
-25119 => array('Rechte für Datei %s können nicht gesetzt werden. Problem mit den Rechten?',1),
+25119 => array('Rechte für Datei %s können nicht gesetzt werden. Problem mit den Rechten?',1),
-25120 => array('Die Position für die Legende muss als Prozentwert im Bereich 0-1 angegeben werden.',0),
-25121 => array('Eine leerer Datenvektor wurde für den Plot eingegeben. Es muss wenigstens ein Datenpunkt vorliegen.',0),
+25120 => array('Die Position für die Legende muss als Prozentwert im Bereich 0-1 angegeben werden.',0),
+25121 => array('Eine leerer Datenvektor wurde für den Plot eingegeben. Es muss wenigstens ein Datenpunkt vorliegen.',0),
25122 => array('Stroke() muss als Subklasse der Klasse Plot definiert sein.',0),
25123 => array('Du kannst keine Text-X-Achse mit X-Koordinaten verwenden. Benutze stattdessen eine "int" oder "lin" Achse.',0),
-25124 => array('Der Eingabedatenvektor mus aufeinanderfolgende Werte von 0 aufwärts beinhalten. Der angegebene Y-Vektor beginnt mit leeren Werten (NULL).',0),
-25125 => array('Ungültige Richtung für statische Linie.',0),
-25126 => array('Es kann kein TrueColor-Bild erzeugt werden. Überprüfe, ob die GD2-Bibliothek und PHP korrekt aufgesetzt wurden.',0),
+25124 => array('Der Eingabedatenvektor mus aufeinanderfolgende Werte von 0 aufwärts beinhalten. Der angegebene Y-Vektor beginnt mit leeren Werten (NULL).',0),
+25125 => array('Ungültige Richtung für statische Linie.',0),
+25126 => array('Es kann kein TrueColor-Bild erzeugt werden. Überprüfe, ob die GD2-Bibliothek und PHP korrekt aufgesetzt wurden.',0),
25127 => array('The library has been configured for automatic encoding conversion of Japanese fonts. This requires that PHP has the mb_convert_encoding() function. Your PHP installation lacks this function (PHP needs the "--enable-mbstring" when compiled).',0),
+25128 => array('The function imageantialias() is not available in your PHP installation. Use the GD version that comes with PHP and not the standalone version.',0),
+25129 => array('Anti-alias can not be used with dashed lines. Please disable anti-alias or use solid lines.',0),
+25130 => array('Too small plot area. (%d x %d). With the given image size and margins there is to little space left for the plot. Increase the plot size or reduce the margins.',2),
+
+25131 => array('StrokeBoxedText2() only supports TTF fonts and not built-in bitmap fonts.',0),
+
+/*
+** jpgraph_led
+*/
+
+25500 => array('Multibyte strings must be enabled in the PHP installation in order to run the LED module so that the function mb_strlen() is available. See PHP documentation for more information.',0),
+
/*
**---------------------------------------------------------------------------------------------
@@ -408,19 +423,19 @@
** jpgraph_table
*/
-27001 => array('GTextTable: Ungültiges Argument für Set(). Das Array-Argument muss 2-- dimensional sein.',0),
-27002 => array('GTextTable: Ungültiges Argument für Set()',0),
-27003 => array('GTextTable: Falsche Anzahl von Argumenten für GTextTable::SetColor()',0),
-27004 => array('GTextTable: Angegebener Zellenbereich, der verschmolzen werden soll, ist ungültig.',0),
-27005 => array('GTextTable: Bereits verschmolzene Zellen im Bereich (%d,%d) bis (%d,%d) können nicht ein weiteres Mal verschmolzen werden.',4),
-27006 => array('GTextTable: Spalten-Argument = %d liegt außerhalb der festgelegten Tabellengröße.',1),
-27007 => array('GTextTable: Zeilen-Argument = %d liegt außerhalb der festgelegten Tabellengröße.',1),
-27008 => array('GTextTable: Spalten- und Zeilengröße müssen zu den Dimensionen der Tabelle passen.',0),
+27001 => array('GTextTable: Ungültiges Argument für Set(). Das Array-Argument muss 2-- dimensional sein.',0),
+27002 => array('GTextTable: Ungültiges Argument für Set()',0),
+27003 => array('GTextTable: Falsche Anzahl von Argumenten für GTextTable::SetColor()',0),
+27004 => array('GTextTable: Angegebener Zellenbereich, der verschmolzen werden soll, ist ungültig.',0),
+27005 => array('GTextTable: Bereits verschmolzene Zellen im Bereich (%d,%d) bis (%d,%d) können nicht ein weiteres Mal verschmolzen werden.',4),
+27006 => array('GTextTable: Spalten-Argument = %d liegt außerhalb der festgelegten Tabellengröße.',1),
+27007 => array('GTextTable: Zeilen-Argument = %d liegt außerhalb der festgelegten Tabellengröße.',1),
+27008 => array('GTextTable: Spalten- und Zeilengröße müssen zu den Dimensionen der Tabelle passen.',0),
27009 => array('GTextTable: Die Anzahl der Tabellenspalten oder -zeilen ist 0. Versichere Dich, dass die Methoden Init() oder Set() aufgerufen werden.',0),
27010 => array('GTextTable: Es wurde keine Ausrichtung beim Aufruf von SetAlign() angegeben.',0),
27011 => array('GTextTable: Es wurde eine unbekannte Ausrichtung beim Aufruf von SetAlign() abgegeben. Horizontal=%s, Vertikal=%s',2),
-27012 => array('GTextTable: Interner Fehler. Es wurde ein ungültiges Argument festgeleget %s',1),
-27013 => array('GTextTable: Das Argument für FormatNumber() muss ein String sein.',0),
+27012 => array('GTextTable: Interner Fehler. Es wurde ein ungültiges Argument festgeleget %s',1),
+27013 => array('GTextTable: Das Argument für FormatNumber() muss ein String sein.',0),
27014 => array('GTextTable: Die Tabelle wurde weder mit einem Aufruf von Set() noch von Init() initialisiert.',0),
27015 => array('GTextTable: Der Zellenbildbedingungstyp muss entweder TIMG_WIDTH oder TIMG_HEIGHT sein.',0),
@@ -428,32 +443,33 @@
** jpgraph_windrose
*/
-22001 => array('Die Gesamtsumme der prozentualen Anteile aller Windrosenarme darf 100%% nicht überschreiten!\n(Aktuell max: %d)',1),
-22002 => array('Das Bild ist zu klein für eine Skala. Bitte vergrößere das Bild.',0),
-22004 => array('Die Etikettendefinition für Windrosenrichtungen müssen 16 Werte haben (eine für jede Kompassrichtung).',0),
-22005 => array('Der Linientyp für radiale Linien muss einer von ("solid","dotted","dashed","longdashed") sein.',0),
-22006 => array('Es wurde ein ungültiger Windrosentyp angegeben.',0),
-22007 => array('Es wurden zu wenig Werte für die Bereichslegende angegeben.',0),
+22001 => array('Die Gesamtsumme der prozentualen Anteile aller Windrosenarme darf 100%% nicht überschreiten!\n(Aktuell max: %d)',1),
+22002 => array('Das Bild ist zu klein für eine Skala. Bitte vergrößere das Bild.',0),
+22004 => array('Die Etikettendefinition für Windrosenrichtungen müssen 16 Werte haben (eine für jede Kompassrichtung).',0),
+22005 => array('Der Linientyp für radiale Linien muss einer von ("solid","dotted","dashed","longdashed") sein.',0),
+22006 => array('Es wurde ein ungültiger Windrosentyp angegeben.',0),
+22007 => array('Es wurden zu wenig Werte für die Bereichslegende angegeben.',0),
22008 => array('Interner Fehler: Versuch, eine freie Windrose zu plotten, obwohl der Typ keine freie Windrose ist.',0),
22009 => array('Du hast die gleiche Richtung zweimal angegeben, einmal mit einem Winkel und einmal mit einer Kompassrichtung (%f Grad).',0),
22010 => array('Die Richtung muss entweder ein numerischer Wert sein oder eine der 16 Kompassrichtungen',0),
22011 => array('Der Windrosenindex muss ein numerischer oder Richtungswert sein. Du hast angegeben Index=%d',1),
-22012 => array('Die radiale Achsendefinition für die Windrose enthält eine nicht aktivierte Richtung.',0),
-22013 => array('Du hast dasselbe Look&Feel für die gleiche Kompassrichtung zweimal engegeben, einmal mit Text und einmal mit einem Index (Index=%d)',1),
-22014 => array('Der Index für eine Kompassrichtung muss zwischen 0 und 15 sein.',0),
+22012 => array('Die radiale Achsendefinition für die Windrose enthält eine nicht aktivierte Richtung.',0),
+22013 => array('Du hast dasselbe Look&Feel für die gleiche Kompassrichtung zweimal engegeben, einmal mit Text und einmal mit einem Index (Index=%d)',1),
+22014 => array('Der Index für eine Kompassrichtung muss zwischen 0 und 15 sein.',0),
22015 => array('Du hast einen unbekannten Windrosenplottyp angegeben.',0),
22016 => array('Der Windrosenarmindex muss ein numerischer oder ein Richtungswert sein.',0),
22017 => array('Die Windrosendaten enthalten eine Richtung, die nicht aktiviert ist. Bitte berichtige, welche Label angezeigt werden sollen.',0),
-22018 => array('Du hast für dieselbe Kompassrichtung zweimal Daten angegeben, einmal mit Text und einmal mit einem Index (Index=%d)',1),
-22019 => array('Der Index für eine Richtung muss zwischen 0 und 15 sein. Winkel dürfen nicht für einen regelmäßigen Windplot angegeben werden, sondern entweder ein Index oder eine Kompassrichtung.',0),
-22020 => array('Der Windrosenplot ist zu groß für die angegebene Bildgröße. Benutze entweder WindrosePlot::SetSize(), um den Plot kleiner zu machen oder vergrößere das Bild im ursprünglichen Aufruf von WindroseGraph().',0),
+22018 => array('Du hast für dieselbe Kompassrichtung zweimal Daten angegeben, einmal mit Text und einmal mit einem Index (Index=%d)',1),
+22019 => array('Der Index für eine Richtung muss zwischen 0 und 15 sein. Winkel dürfen nicht für einen regelmäßigen Windplot angegeben werden, sondern entweder ein Index oder eine Kompassrichtung.',0),
+22020 => array('Der Windrosenplot ist zu groß für die angegebene Bildgröße. Benutze entweder WindrosePlot::SetSize(), um den Plot kleiner zu machen oder vergrößere das Bild im ursprünglichen Aufruf von WindroseGraph().',0),
22021 => array('It is only possible to add Text, IconPlot or WindrosePlot to a Windrose Graph',0),
+
/*
** jpgraph_odometer
*/
13001 => array('Unbekannter Nadeltypstil (%d).',1),
-13002 => array('Ein Wert für das Odometer (%f) ist außerhalb des angegebenen Bereichs [%f,%f]',3),
+13002 => array('Ein Wert für das Odometer (%f) ist außerhalb des angegebenen Bereichs [%f,%f]',3),
/*
** jpgraph_barcode
@@ -461,38 +477,66 @@
1001 => array('Unbekannte Kodier-Specifikation: %s',1),
1002 => array('datenvalidierung schlug fehl. [%s] kann nicht mittels der Kodierung "%s" kodiert werden',2),
-1003 => array('Interner Kodierfehler. Kodieren von %s ist nicht möglich in Code 128',1),
+1003 => array('Interner Kodierfehler. Kodieren von %s ist nicht möglich in Code 128',1),
1004 => array('Interner barcode Fehler. Unbekannter UPC-E Kodiertyp: %s',1),
1005 => array('Interner Fehler. Das Textzeichen-Tupel (%s, %s) kann nicht im Code-128 Zeichensatz C kodiert werden.',2),
-1006 => array('Interner Kodierfehler für CODE 128. Es wurde versucht, CTRL in CHARSET != A zu kodieren.',0),
-1007 => array('Interner Kodierfehler für CODE 128. Es wurde versucht, DEL in CHARSET != B zu kodieren.',0),
-1008 => array('Interner Kodierfehler für CODE 128. Es wurde versucht, kleine Buchstaben in CHARSET != B zu kodieren.',0),
-1009 => array('Kodieren mittels CODE 93 wird noch nicht unterstützt.',0),
-1010 => array('Kodieren mittels POSTNET wird noch nicht unterstützt.',0),
-1011 => array('Nicht untrstütztes Barcode-Backend für den Typ %s',1),
+1006 => array('Interner Kodierfehler für CODE 128. Es wurde versucht, CTRL in CHARSET != A zu kodieren.',0),
+1007 => array('Interner Kodierfehler für CODE 128. Es wurde versucht, DEL in CHARSET != B zu kodieren.',0),
+1008 => array('Interner Kodierfehler für CODE 128. Es wurde versucht, kleine Buchstaben in CHARSET != B zu kodieren.',0),
+1009 => array('Kodieren mittels CODE 93 wird noch nicht unterstützt.',0),
+1010 => array('Kodieren mittels POSTNET wird noch nicht unterstützt.',0),
+1011 => array('Nicht untrstütztes Barcode-Backend für den Typ %s',1),
/*
** PDF417
*/
+26000 => array('PDF417: The PDF417 module requires that the PHP installation must support the function bcmod(). This is normally enabled at compile time. See documentation for more information.',0),
26001 => array('PDF417: Die Anzahl der Spalten muss zwischen 1 und 30 sein.',0),
26002 => array('PDF417: Der Fehler-Level muss zwischen 0 und 8 sein.',0),
-26003 => array('PDF417: Ungültiges Format für Eingabedaten, um sie mit PDF417 zu kodieren.',0),
-26004 => array('PDF417: die eigebenen Daten können nicht mit Fehler-Level %d und %d spalten kodiert werden, weil daraus zu viele Symbole oder mehr als 90 Zeilen resultieren.',2),
-26005 => array('PDF417: Die Datei "%s" kann nicht zum Schreiben geöffnet werden.',1),
-26006 => array('PDF417: Interner Fehler. Die Eingabedatendatei für PDF417-Cluster %d ist fehlerhaft.',1),
-26007 => array('PDF417: Interner Fehler. GetPattern: Ungültiger Code-Wert %d (Zeile %d)',2),
+26003 => array('PDF417: Ungültiges Format für Eingabedaten, um sie mit PDF417 zu kodieren.',0),
+26004 => array('PDF417: die eigebenen Daten können nicht mit Fehler-Level %d und %d spalten kodiert werden, weil daraus zu viele Symbole oder mehr als 90 Zeilen resultieren.',2),
+26005 => array('PDF417: Die Datei "%s" kann nicht zum Schreiben geöffnet werden.',1),
+26006 => array('PDF417: Interner Fehler. Die Eingabedatendatei für PDF417-Cluster %d ist fehlerhaft.',1),
+26007 => array('PDF417: Interner Fehler. GetPattern: Ungültiger Code-Wert %d (Zeile %d)',2),
26008 => array('PDF417: Interner Fehler. Modus wurde nicht in der Modusliste!! Modus %d',1),
-26009 => array('PDF417: Kodierfehler: Ungültiges Zeichen. Zeichen kann nicht mit ASCII-Code %d kodiert werden.',1),
+26009 => array('PDF417: Kodierfehler: Ungültiges Zeichen. Zeichen kann nicht mit ASCII-Code %d kodiert werden.',1),
26010 => array('PDF417: Interner Fehler: Keine Eingabedaten beim Dekodieren.',0),
-26011 => array('PDF417: Kodierfehler. Numerisches Kodieren bei nicht-numerischen Daten nicht möglich.',0),
-26012 => array('PDF417: Interner Fehler. Es wurden für den Binary-Kompressor keine Daten zum Dekodieren eingegeben.',0),
+26011 => array('PDF417: Kodierfehler. Numerisches Kodieren bei nicht-numerischen Daten nicht möglich.',0),
+26012 => array('PDF417: Interner Fehler. Es wurden für den Binary-Kompressor keine Daten zum Dekodieren eingegeben.',0),
26013 => array('PDF417: Interner Fehler. Checksum Fehler. Koeffiziententabellen sind fehlerhaft.',0),
-26014 => array('PDF417: Interner Fehler. Es wurden keine Daten zum Berechnen von Kodewörtern eingegeben.',0),
-26015 => array('PDF417: Interner Fehler. Ein Eintrag 0 in die Statusübertragungstabellen ist nicht NULL. Eintrag 1 = (%s)',1),
-26016 => array('PDF417: Interner Fehler: Nichtregistrierter Statusübertragungsmodus beim Dekodieren.',0),
+26014 => array('PDF417: Interner Fehler. Es wurden keine Daten zum Berechnen von Kodewörtern eingegeben.',0),
+26015 => array('PDF417: Interner Fehler. Ein Eintrag 0 in die Statusübertragungstabellen ist nicht NULL. Eintrag 1 = (%s)',1),
+26016 => array('PDF417: Interner Fehler: Nichtregistrierter Statusübertragungsmodus beim Dekodieren.',0),
+/*
+** jpgraph_contour
+*/
+
+28001 => array('Dritten parameter fur Contour muss ein vector der fargen sind.',0),
+28002 => array('Die anzahlen der farges jeder isobar linien muss gleich sein.',0),
+28003 => array('ContourPlot Interner Fehler: isobarHCrossing: Spalten index ist zu hoch (%d)',1),
+28004 => array('ContourPlot Interner Fehler: isobarHCrossing: Reihe index ist zu hoch (%d)',1),
+28005 => array('ContourPlot Interner Fehler: isobarVCrossing: Reihe index ist zu hoch (%d)',1),
+28006 => array('ContourPlot Interner Fehler: isobarVCrossing: Spalten index ist zu hoch (%d)',1),
+28007 => array('ContourPlot. Interpolation faktor ist zu hoch (>5)',0),
+
+
+/*
+ * jpgraph_matrix and colormap
+*/
+29201 => array('Min range value must be less or equal to max range value for colormaps',0),
+29202 => array('The distance between min and max value is too small for numerical precision',0),
+29203 => array('Number of color quantification level must be at least %d',1),
+29204 => array('Number of colors (%d) is invalid for this colormap. It must be a number that can be written as: %d + k*%d',3),
+29205 => array('Colormap specification out of range. Must be an integer in range [0,%d]',1),
+29206 => array('Invalid object added to MatrixGraph',0),
+29207 => array('Empty input data specified for MatrixPlot',0),
+29208 => array('Unknown side specifiction for matrix labels "%s"',1),
+29209 => array('CSIM Target matrix must be the same size as the data matrix (csim=%d x %d, data=%d x %d)',4),
+29210 => array('CSIM Target for matrix labels does not match the number of labels (csim=%d, labels=%d)',2),
+
);
?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/lang/en.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/lang/en.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/lang/en.inc.php 2008-03-24 07:51:47.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/lang/en.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,24 +1,21 @@
,Erklärung:
HTTP header wurden bereits zum Browser gesendet, wobei die Daten als Text gekennzeichnet wurden, bevor die Bibliothek die Chance hatte, seinen Bild-HTTP-Header zum Browser zu schicken. Dies verhindert, dass die Bibliothek Bilddaten zum Browser schicken kann (weil sie vom Browser als Text interpretiert würden und daher nur Mist dargestellt würde).JpGraph Error:
+10 => array('
',2),
/*
@@ -27,6 +24,8 @@
11 => array('No path specified for CACHE_DIR. Please specify CACHE_DIR manually in jpg-config.inc',0),
12 => array('No path specified for TTF_DIR and path can not be determined automatically. Please specify TTF_DIR manually (in jpg-config.inc).',0),
13 => array('The installed PHP version (%s) is not compatible with this release of the library. The library requires at least PHP version %s',2),
+
+
/*
** jpgraph_bar
*/
@@ -45,6 +44,7 @@
2012 => array('One of the objects submitted to AccBar is not a BarPlot. Make sure that you create the AccBar plot from an array of BarPlot objects. (Class=%s)',1),
2013 => array('You have specified an empty array for shadow colors in the bar plot.',0),
2014 => array('Number of datapoints for each data set in accbarplot must be the same',0),
+2015 => array('Individual bar plots in an AccBarPlot or GroupBarPlot can not have specified X-coordinates',0),
/*
@@ -75,8 +75,8 @@
6001 => array('Internal error. Height for ActivityTitles is < 0',0),
6002 => array('You can\'t specify negative sizes for Gantt graph dimensions. Use 0 to indicate that you want the library to automatically determine a dimension.',0),
-6003 => array('Invalid format for Constrain parameter at index=%d in CreateSimple(). Parameter must start with index 0 and contain arrays of (Row,Constrain-To,Constrain-Type)',1),
-6004 => array('Invalid format for Progress parameter at index=%d in CreateSimple(). Parameter must start with index 0 and contain arrays of (Row,Progress)',1),
+6003 => array('Invalid format for Constrain parameter at index=%d in CreateSimple(). Parameter must start with index 0 and contain arrays of (Row,Constrain-To,Constrain-Type)',1),
+6004 => array('Invalid format for Progress parameter at index=%d in CreateSimple(). Parameter must start with index 0 and contain arrays of (Row,Progress)',1),
6005 => array('SetScale() is not meaningful with Gantt charts.',0),
6006 => array('Cannot autoscale Gantt chart. No dated activities exist. [GetBarMinMax() start >= n]',0),
6007 => array('Sanity check for automatic Gantt chart size failed. Either the width (=%d) or height (=%d) is larger than MAX_GANTTIMG_SIZE. This could potentially be caused by a wrong date in one of the activities.',2),
@@ -102,6 +102,7 @@
6030 => array('Unknown arrow direction for link.',0),
6031 => array('Unknown arrow type for link.',0),
6032 => array('Internal error: Unknown path type (=%d) specified for link.',1),
+6033 => array('Array of fonts must contain arrays with 3 elements, i.e. (Family, Style, Size)',0),
/*
** jpgraph_gradient
@@ -131,6 +132,7 @@
10001 => array('LinePlot::SetFilled() is deprecated. Use SetFillColor()',0),
10002 => array('Plot too complicated for fast line Stroke. Use standard Stroke()',0),
10003 => array('Each plot in an accumulated lineplot must have the same number of data points.',0),
+
/*
** jpgraph_log
*/
@@ -145,8 +147,7 @@
** jpgraph_mgraph
*/
-/* 12001 => array("You are using GD 2.x and are trying to use a background images on a non truecolor image. To use background images with GD 2.x it is necessary to enable truecolor by setting the USE_TRUECOLOR constant to TRUE. Due to a bug in GD 2.0.1 using any truetype fonts with truecolor images will result in very poor quality fonts.",0),*/
-
+12001 => array("You are using GD 2.x and are trying to use a background images on a non truecolor image. To use background images with GD 2.x it is necessary to enable truecolor by setting the USE_TRUECOLOR constant to TRUE. Due to a bug in GD 2.0.1 using any truetype fonts with truecolor images will result in very poor quality fonts.",0),
12002 => array('Incorrect file name for MGraph::SetBackgroundImage() : %s Must have a valid image extension (jpg,gif,png) when using auto detection of image type',1),
12003 => array('Unknown file extension (%s) in MGraph::SetBackgroundImage() for filename: %s',2),
12004 => array('The image format of your background image (%s) is not supported in your system configuration. ',1),
@@ -157,6 +158,7 @@
12009 => array('Your PHP installation does not support the chosen graphic format: %s',1),
12010 => array('Can\'t create or stream image to file %s Check that PHP has enough permission to write a file to the current directory.',1),
12011 => array('Can\'t create truecolor image. Check that you really have GD2 library installed.',0),
+12012 => array('Can\'t create image. Check that you really have GD2 library installed.',0),
/*
** jpgraph_pie3d
@@ -255,11 +257,13 @@
24001 => array('FuncGenerator : No function specified. ',0),
24002 => array('FuncGenerator : Syntax error in function specification ',0),
24003 => array('DateScaleUtils: Unknown tick type specified in call to GetTicks()',0),
+24004 => array('ReadCSV2: Column count mismatch in %s line %d',2),
/*
** jpgraph
*/
-25002 => array('Your PHP installation does not seem to have the required GD 2.x library enabled. Please see the PHP documentation, "Image" section. Make sure that "php_gd2.dll" statement is uncomment in the [modules] section in the php.ini file.',0),
+25001 => array('This PHP installation is not configured with the GD library. Please recompile PHP with GD support to run JpGraph. (Neither function imagetypes() nor imagecreatefromstring() does exist)',0),
+25002 => array('Your PHP installation does not seem to have the required GD library. Please see the PHP documentation on how to install and enable the GD library.',0),
25003 => array('General PHP error : At %s:%d : %s',3),
25004 => array('General PHP error : %s ',1),
25005 => array('Can\'t access PHP_SELF, PHP global variable. You can\'t run PHP from command line if you want to use the \'auto\' naming of cache or image files.',0),
@@ -269,11 +273,11 @@
25009 => array('You must specify what scale to use with a call to Graph::SetScale()',0),
25010 => array('Graph::Add() You tried to add a null plot to the graph.',0),
-25011 => array('Graph::AddY2() You tried to add a null plot to the graph.',0),
-25012 => array('Graph::AddYN() You tried to add a null plot to the graph.',0),
+25011 => array('Graph::AddY2() You tried to add a null plot to the graph.',0),
+25012 => array('Graph::AddYN() You tried to add a null plot to the graph.',0),
25013 => array('You can only add standard plots to multiple Y-axis',0),
-25014 => array('Graph::AddText() You tried to add a null text to the graph.',0),
-25015 => array('Graph::AddLine() You tried to add a null line to the graph.',0),
+25014 => array('Graph::AddText() You tried to add a null text to the graph.',0),
+25015 => array('Graph::AddLine() You tried to add a null line to the graph.',0),
25016 => array('Graph::AddBand() You tried to add a null band to the graph.',0),
25017 => array('You are using GD 2.x and are trying to use a background images on a non truecolor image. To use background images with GD 2.x it is necessary to enable truecolor by setting the USE_TRUECOLOR constant to TRUE. Due to a bug in GD 2.0.1 using any truetype fonts with truecolor images will result in very poor quality fonts.',0),
25018 => array('Incorrect file name for Graph::SetBackgroundImage() : "%s" Must have a valid image extension (jpg,gif,png) when using auto detection of image type',1),
@@ -299,7 +303,7 @@
25036 => array('Unknown AxisStyle() : %s',1),
25037 => array('The image format of your background image (%s) is not supported in your system configuration. ',1),
25038 => array('Background image seems to be of different type (has different file extension) than specified imagetype. Specified: %s File: %s',2),
-25039 => array('Can\'t read background image: "%s"',1),
+25039 => array('Can\'t read background image: "%s"',1),
25040 => array('It is not possible to specify both a background image and a background country flag.',0),
25041 => array('In order to use Country flags as backgrounds you must include the "jpgraph_flags.php" file.',0),
@@ -319,7 +323,7 @@
25054 => array('Internal error: Unknown grid axis %s',1),
25055 => array('Axis::SetTickDirection() is deprecated. Use Axis::SetTickSide() instead',0),
25056 => array('SetTickLabelMargin() is deprecated. Use Axis::SetLabelMargin() instead.',0),
-25057 => array('SetTextTicks() is deprecated. Use SetTextTickInterval() instead.',0),
+25057 => array('SetTextTicks() is deprecated. Use SetTextTickInterval() instead.',0),
25058 => array('Text label interval must be specified >= 1.',0),
25059 => array('SetLabelPos() is deprecated. Use Axis::SetLabelSide() instead.',0),
@@ -360,10 +364,10 @@
25093 => array('Can not read font file "%s" in call to Image::GetBBoxTTF. Please make sure that you have set a font before calling this method and that the font is installed in the TTF directory.',1),
25094 => array('Direction for text most be given as an angle between 0 and 90.',0),
25095 => array('Unknown font font family specification. ',0),
-25096 => array('Can\'t allocate any more colors.',0),
+25096 => array('Can\'t allocate any more colors in palette image. Image has already allocated maximum of %d colors and the palette is now full. Change to a truecolor image instead',0),
25097 => array('Color specified as empty string in PushColor().',0),
25098 => array('Negative Color stack index. Unmatched call to PopColor()',0),
-25099 => array('Parameters for brightness and Contrast out of range [-1,1]',0),
+25099 => array('Parameters for brightness and Contrast out of range [-1,1]',0),
25100 => array('Problem with color palette and your GD setup. Please disable anti-aliasing or use GD2 with true-color. If you have GD2 library installed please make sure that you have set the USE_GD2 constant to true and truecolor is enabled.',0),
25101 => array('Illegal numeric argument to SetLineStyle(): (%d)',1),
@@ -382,7 +386,7 @@
25113 => array('Can\'t delete cached image "%s". Permission problem?',1),
25114 => array('PHP has not enough permissions to write to the cache file "%s". Please make sure that the user running PHP has write permission for this file if you wan to use the cache system with JpGraph.',1),
25115 => array('Can\'t set permission for cached image "%s". Permission problem?',1),
-25116 => array('Cant open file from cache "%s"',1),
+25116 => array('Cant open file from cache "%s"',1),
25117 => array('Can\'t open cached image "%s" for reading.',1),
25118 => array('Can\'t create directory "%s". Make sure PHP has write permission to this directory.',1),
25119 => array('Can\'t set permissions for "%s". Permission problems?',1),
@@ -395,6 +399,17 @@
25125 => array('Illegal direction for static line',0),
25126 => array('Can\'t create truecolor image. Check that the GD2 library is properly setup with PHP.',0),
25127 => array('The library has been configured for automatic encoding conversion of Japanese fonts. This requires that PHP has the mb_convert_encoding() function. Your PHP installation lacks this function (PHP needs the "--enable-mbstring" when compiled).',0),
+25128 => array('The function imageantialias() is not available in your PHP installation. Use the GD version that comes with PHP and not the standalone version.',0),
+25129 => array('Anti-alias can not be used with dashed lines. Please disable anti-alias or use solid lines.',0),
+25130 => array('Too small plot area. (%d x %d). With the given image size and margins there is to little space left for the plot. Increase the plot size or reduce the margins.',2),
+
+25131 => array('StrokeBoxedText2() only supports TTF fonts and not built-in bitmap fonts.',0),
+
+/*
+** jpgraph_led
+*/
+
+25500 => array('Multibyte strings must be enabled in the PHP installation in order to run the LED module so that the function mb_strlen() is available. See PHP documentation for more information.',0),
/*
**---------------------------------------------------------------------------------------------
@@ -403,7 +418,7 @@
*/
/*
-** jpgraph_table
+** jpgraph_table
*/
27001 => array('GTextTable: Invalid argument to Set(). Array argument must be 2 dimensional',0),
@@ -446,7 +461,6 @@
22019 => array('Index for direction must be between 0 and 15. You can\'t specify angles for a Regular Windplot, only index and compass directions.',0),
22020 => array('Windrose plot is too large to fit the specified Graph size. Please use WindrosePlot::SetSize() to make the plot smaller or increase the size of the Graph in the initial WindroseGraph() call.',0),
22021 => array('It is only possible to add Text, IconPlot or WindrosePlot to a Windrose Graph',0),
-
/*
** jpgraph_odometer
*/
@@ -473,7 +487,7 @@
/*
** PDF417
*/
-
+26000 => array('PDF417: The PDF417 module requires that the PHP installation must support the function bcmod(). This is normally enabled at compile time. See documentation for more information.',0),
26001 => array('PDF417: Number of Columns must be >= 1 and <= 30',0),
26002 => array('PDF417: Error level must be between 0 and 8',0),
26003 => array('PDF417: Invalid format for input data to encode with PDF417',0),
@@ -491,11 +505,32 @@
26015 => array('PDF417: Internal error. State transition table entry 0 is NULL. Entry 1 = (%s)',1),
26016 => array('PDF417: Internal error: Unrecognized state transition mode in decode.',0),
+/*
+** jpgraph_contour
+*/
+
+28001 => array('Third argument to Contour must be an array of colors.',0),
+28002 => array('Number of colors must equal the number of isobar lines specified',0),
+28003 => array('ContourPlot Internal Error: isobarHCrossing: Coloumn index too large (%d)',1),
+28004 => array('ContourPlot Internal Error: isobarHCrossing: Row index too large (%d)',1),
+28005 => array('ContourPlot Internal Error: isobarVCrossing: Row index too large (%d)',1),
+28006 => array('ContourPlot Internal Error: isobarVCrossing: Col index too large (%d)',1),
+28007 => array('ContourPlot interpolation factor is too large (>5)',0),
+
+/*
+ * jpgraph_matrix and colormap
+*/
+29201 => array('Min range value must be less or equal to max range value for colormaps',0),
+29202 => array('The distance between min and max value is too small for numerical precision',0),
+29203 => array('Number of color quantification level must be at least %d',1),
+29204 => array('Number of colors (%d) is invalid for this colormap. It must be a number that can be written as: %d + k*%d',3),
+29205 => array('Colormap specification out of range. Must be an integer in range [0,%d]',1),
+29206 => array('Invalid object added to MatrixGraph',0),
+29207 => array('Empty input data specified for MatrixPlot',0),
+29208 => array('Unknown side specifiction for matrix labels "%s"',1),
+29209 => array('CSIM Target matrix must be the same size as the data matrix (csim=%d x %d, data=%d x %d)',4),
+29210 => array('CSIM Target for matrix labels does not match the number of labels (csim=%d, labels=%d)',2),
);
-/*
- ** EOF
- */
-
?>
diff -urN smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/lang/prod.inc.php smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/lang/prod.inc.php
--- smeserver-unjunkmgr-2.0.old/root/usr/local/unjunkmgr/jpgraph/lang/prod.inc.php 2006-10-08 04:09:02.000000000 -0400
+++ smeserver-unjunkmgr-2.0/root/usr/local/unjunkmgr/jpgraph/lang/prod.inc.php 1970-01-01 04:13:08.000000000 -0500
@@ -1,10 +1,10 @@
array('JpGraph Error:
HTTP headers have already been sent.
Caused by output from file %s at line %d.Explanation:
HTTP headers have already been sent back to the browser indicating the data as text before the library got a chance to send it\'s image HTTP header to this browser. This makes it impossible for the library to send back image data to the browser (since that would be interpretated as text by the browser and show up as junk text).JpGraph Error:
+10 => array('
',2),
@@ -75,6 +75,7 @@
6030 => array(DEFAULT_ERROR_MESSAGE.'6030',0),
6031 => array(DEFAULT_ERROR_MESSAGE.'6031',0),
6032 => array(DEFAULT_ERROR_MESSAGE.'6032',0),
+6033 => array(DEFAULT_ERROR_MESSAGE.'6033',0),
7001 => array(DEFAULT_ERROR_MESSAGE.'7001',0),
8001 => array(DEFAULT_ERROR_MESSAGE.'8001',0),
8002 => array(DEFAULT_ERROR_MESSAGE.'8002',0),
@@ -83,6 +84,7 @@
9001 => array(DEFAULT_ERROR_MESSAGE.'9001',0),
10001 => array(DEFAULT_ERROR_MESSAGE.'10001',0),
10002 => array(DEFAULT_ERROR_MESSAGE.'10002',0),
+10003 => array(DEFAULT_ERROR_MESSAGE.'10003',0),
11001 => array(DEFAULT_ERROR_MESSAGE.'11001',0),
11002 => array(DEFAULT_ERROR_MESSAGE.'11002',0),
11003 => array(DEFAULT_ERROR_MESSAGE.'11003',0),
@@ -146,6 +148,7 @@
24001 => array(DEFAULT_ERROR_MESSAGE.'24001',0),
24002 => array(DEFAULT_ERROR_MESSAGE.'24002',0),
24003 => array(DEFAULT_ERROR_MESSAGE.'24003',0),
+24004 => array(DEFAULT_ERROR_MESSAGE.'24004',0),
25001 => array(DEFAULT_ERROR_MESSAGE.'25001',0),
25002 => array(DEFAULT_ERROR_MESSAGE.'25002',0),
25003 => array(DEFAULT_ERROR_MESSAGE.'25003',0),
@@ -271,7 +274,12 @@
25124 => array(DEFAULT_ERROR_MESSAGE.'25124',0),
25125 => array(DEFAULT_ERROR_MESSAGE.'25125',0),
25126 => array(DEFAULT_ERROR_MESSAGE.'25126',0),
-25127 => array(DEFAULT_ERROR_MESSAGE.'25126',0),
+25127 => array(DEFAULT_ERROR_MESSAGE.'25127',0),
+25128 => array(DEFAULT_ERROR_MESSAGE.'25128',0),
+25129 => array(DEFAULT_ERROR_MESSAGE.'25129',0),
+25130 => array(DEFAULT_ERROR_MESSAGE.'25130',0),
+25131 => array(DEFAULT_ERROR_MESSAGE.'25131',0),
+25500 => array(DEFAULT_ERROR_MESSAGE.'25500',0),
24003 => array(DEFAULT_ERROR_MESSAGE.'24003',0),
24004 => array(DEFAULT_ERROR_MESSAGE.'24004',0),
24005 => array(DEFAULT_ERROR_MESSAGE.'24005',0),
@@ -317,6 +325,7 @@
1009 => array(DEFAULT_ERROR_MESSAGE.'1009',0),
1010 => array(DEFAULT_ERROR_MESSAGE.'1010',0),
1011 => array(DEFAULT_ERROR_MESSAGE.'1011',0),
+26000 => array(DEFAULT_ERROR_MESSAGE.'26000',0),
26001 => array(DEFAULT_ERROR_MESSAGE.'26001',0),
26002 => array(DEFAULT_ERROR_MESSAGE.'26002',0),
26003 => array(DEFAULT_ERROR_MESSAGE.'26003',0),
@@ -349,6 +358,26 @@
27013 => array(DEFAULT_ERROR_MESSAGE.'27013',0),
27014 => array(DEFAULT_ERROR_MESSAGE.'27014',0),
27015 => array(DEFAULT_ERROR_MESSAGE.'27015',0),
+
+28001 => array(DEFAULT_ERROR_MESSAGE.'28001',0),
+28002 => array(DEFAULT_ERROR_MESSAGE.'28002',0),
+28003 => array(DEFAULT_ERROR_MESSAGE.'28003',0),
+28004 => array(DEFAULT_ERROR_MESSAGE.'28004',0),
+28005 => array(DEFAULT_ERROR_MESSAGE.'28005',0),
+28006 => array(DEFAULT_ERROR_MESSAGE.'28006',0),
+28007 => array(DEFAULT_ERROR_MESSAGE.'28007',0),
+
+29201 => array(DEFAULT_ERROR_MESSAGE.'28001',0),
+29202 => array(DEFAULT_ERROR_MESSAGE.'28002',0),
+29203 => array(DEFAULT_ERROR_MESSAGE.'28003',0),
+29204 => array(DEFAULT_ERROR_MESSAGE.'28004',0),
+29205 => array(DEFAULT_ERROR_MESSAGE.'28005',0),
+29206 => array(DEFAULT_ERROR_MESSAGE.'28006',0),
+29207 => array(DEFAULT_ERROR_MESSAGE.'28007',0),
+29208 => array(DEFAULT_ERROR_MESSAGE.'28008',0),
+29209 => array(DEFAULT_ERROR_MESSAGE.'28009',0),
+29210 => array(DEFAULT_ERROR_MESSAGE.'28010',0),
+
);
?>
JpGraph Error:
HTTP headers have already been sent.
Caused by output from file %s at line %d.Explanation:
HTTP headers have already been sent back to the browser indicating the data as text before the library got a chance to send it\'s image HTTP header to this browser. This makes it impossible for the library to send back image data to the browser (since that would be interpretated as text by the browser and show up as junk text).